blob: 40599b4bfd9b1684c3b4fceee808551b89909770 [file] [log] [blame]
// Copyright 2015 The Chromium Authors. All rights reserved.
// Use of this source code is governed by a BSD-style license that can be
// found in the LICENSE file.
#include "core/layout/ScrollAnchor.h"
#include "bindings/core/v8/V8BindingForCore.h"
#include "core/css/CSSMarkup.h"
#include "core/dom/ElementTraversal.h"
#include "core/dom/NthIndexCache.h"
#include "core/dom/StaticNodeList.h"
#include "core/frame/LocalFrameView.h"
#include "core/frame/UseCounter.h"
#include "core/layout/LayoutBlockFlow.h"
#include "core/layout/LayoutBox.h"
#include "core/layout/LayoutTable.h"
#include "core/layout/line/InlineTextBox.h"
#include "core/paint/PaintLayer.h"
#include "core/paint/PaintLayerScrollableArea.h"
#include "platform/Histogram.h"
namespace blink {
// With 100 unique strings, a 2^12 slot table has a false positive rate of ~2%.
using ClassnameFilter = BloomFilter<12>;
using Corner = ScrollAnchor::Corner;
using SerializedAnchor = ScrollAnchor::SerializedAnchor;
: anchor_object_(nullptr),
queued_(false) {}
ScrollAnchor::ScrollAnchor(ScrollableArea* scroller) : ScrollAnchor() {
ScrollAnchor::~ScrollAnchor() = default;
void ScrollAnchor::SetScroller(ScrollableArea* scroller) {
DCHECK_NE(scroller_, scroller);
DCHECK(scroller->IsRootFrameViewport() || scroller->IsLocalFrameView() ||
scroller_ = scroller;
static LayoutBox* ScrollerLayoutBox(const ScrollableArea* scroller) {
LayoutBox* box = scroller->GetLayoutBox();
return box;
// TODO(skobes): Storing a "corner" doesn't make much sense anymore since we
// adjust only on the block flow axis. This could probably be refactored to
// simply measure the movement of the block-start edge.
static Corner CornerToAnchor(const ScrollableArea* scroller) {
const ComputedStyle* style = ScrollerLayoutBox(scroller)->Style();
if (style->IsFlippedBlocksWritingMode())
return Corner::kTopRight;
return Corner::kTopLeft;
static LayoutPoint CornerPointOfRect(LayoutRect rect, Corner which_corner) {
switch (which_corner) {
case Corner::kTopLeft:
return rect.MinXMinYCorner();
case Corner::kTopRight:
return rect.MaxXMinYCorner();
return LayoutPoint();
// Bounds of the LayoutObject relative to the scroller's visible content rect.
static LayoutRect RelativeBounds(const LayoutObject* layout_object,
const ScrollableArea* scroller) {
LayoutRect local_bounds;
if (layout_object->IsBox()) {
local_bounds = ToLayoutBox(layout_object)->BorderBoxRect();
if (!layout_object->HasOverflowClip()) {
// borderBoxRect doesn't include overflow content and floats.
LayoutUnit max_y =
if (layout_object->IsLayoutBlockFlow() &&
ToLayoutBlockFlow(layout_object)->ContainsFloats()) {
// Note that lowestFloatLogicalBottom doesn't include floating
// grandchildren.
max_y = std::max(
} else if (layout_object->IsText()) {
// TODO(skobes): Use first and last InlineTextBox only?
for (InlineTextBox* box = ToLayoutText(layout_object)->FirstTextBox(); box;
box = box->NextTextBox())
} else {
// Only LayoutBox and LayoutText are supported.
LayoutRect relative_bounds = LayoutRect(
->LocalToVisibleContentQuad(FloatRect(local_bounds), layout_object)
return relative_bounds;
static LayoutPoint ComputeRelativeOffset(const LayoutObject* layout_object,
const ScrollableArea* scroller,
Corner corner) {
return CornerPointOfRect(RelativeBounds(layout_object, scroller), corner);
static bool CandidateMayMoveWithScroller(const LayoutObject* candidate,
const ScrollableArea* scroller) {
if (const ComputedStyle* style = candidate->Style()) {
if (style->HasViewportConstrainedPosition() ||
return false;
LayoutObject::AncestorSkipInfo skip_info(ScrollerLayoutBox(scroller));
return !skip_info.AncestorSkipped();
static bool IsOnlySiblingWithTagName(Element* element) {
return (1U == NthIndexCache::NthOfTypeIndex(*element)) &&
(1U == NthIndexCache::NthLastOfTypeIndex(*element));
static const AtomicString UniqueClassnameAmongSiblings(Element* element) {
auto classname_filter = WTF::WrapUnique(new ClassnameFilter());
Element* parent_element = ElementTraversal::FirstAncestor(*element->ToNode());
Element* sibling_element =
parent_element ? ElementTraversal::FirstChild(*parent_element->ToNode())
: element;
// Add every classname of every sibling to our bloom filter, starting from the
// leftmost sibling, but skipping |element|.
for (; sibling_element; sibling_element = ElementTraversal::NextSibling(
*sibling_element->ToNode())) {
if (sibling_element->HasClass() && sibling_element != element) {
const SpaceSplitString& class_names = sibling_element->ClassNames();
for (size_t i = 0; i < class_names.size(); ++i) {
const SpaceSplitString& class_names = element->ClassNames();
for (size_t i = 0; i < class_names.size(); ++i) {
// MayContain allows for false positives, but a false positive is relatively
// harmless; it just means we have to choose a different classname, or in
// the worst case a different selector.
if (!classname_filter->MayContain(class_names[i])) {
return class_names[i];
return AtomicString();
// Calculate a simple selector for |element| that uniquely identifies it among
// its siblings. If present, the element's id will be used; otherwise, less
// specific selectors are preferred to more specific ones. The ordering of
// selector preference is:
// 1. ID
// 2. Tag name
// 3. Class name
// 4. nth-child
static const String UniqueSimpleSelectorAmongSiblings(Element* element) {
if (element->HasID() &&
element->GetIdAttribute())) {
StringBuilder builder;
SerializeIdentifier(element->GetIdAttribute(), builder);
return builder.ToAtomicString();
if (IsOnlySiblingWithTagName(element)) {
StringBuilder builder;
SerializeIdentifier(element->TagQName().ToString(), builder);
return builder.ToAtomicString();
if (element->HasClass()) {
AtomicString unique_classname = UniqueClassnameAmongSiblings(element);
if (!unique_classname.IsEmpty()) {
return AtomicString(".") + unique_classname;
return ":nth-child(" +
String::Number(NthIndexCache::NthChildIndex(*element)) + ")";
// Computes a selector that uniquely identifies |anchor_node|. This is done
// by computing a selector that uniquely identifies each ancestor among its
// sibling elements, terminating at a definitively unique ancestor. The
// definitively unique ancestor is either the first ancestor with an id or
// the root of the document. The computed selectors are chained together with
// the child combinator(>) to produce a compound selector that is
// effectively a path through the DOM tree to |anchor_node|.
static const String ComputeUniqueSelector(Node* anchor_node) {
// The scroll anchor can be a pseudo element, but pseudo elements aren't part
// of the DOM and can't be used as part of a selector. We fail in this case;
// success isn't possible.
if (anchor_node->IsPseudoElement()) {
return String();
TRACE_EVENT0("blink", "ScrollAnchor::SerializeAnchor");
std::vector<String> selector_list;
for (Element* element = ElementTraversal::FirstAncestorOrSelf(*anchor_node);
element; element = ElementTraversal::FirstAncestor(*element->ToNode())) {
if (element->HasID() &&
element->GetIdAttribute())) {
StringBuilder builder;
size_t i = 0;
// We added the selectors tree-upward order from left to right, but css
// selectors are written tree-downward from left to right. We reverse the
// order of iteration to get a properly ordered compound selector.
for (auto reverse_iterator = selector_list.rbegin();
reverse_iterator != selector_list.rend(); ++reverse_iterator, ++i) {
if (i)
DEFINE_STATIC_LOCAL(CustomCountHistogram, selector_length_histogram,
("Layout.ScrollAnchor.SerializedAnchorSelectorLength", 1,
kMaxSerializedSelectorLength, 50));
if (builder.length() > kMaxSerializedSelectorLength) {
return String();
return builder.ToString();
ScrollAnchor::ExamineResult ScrollAnchor::Examine(
const LayoutObject* candidate) const {
if (candidate == ScrollerLayoutBox(scroller_))
return ExamineResult(kContinue);
if (candidate->IsLayoutInline())
return ExamineResult(kContinue);
// Anonymous blocks are not in the DOM tree and it may be hard for
// developers to reason about the anchor node.
if (candidate->IsAnonymous())
return ExamineResult(kContinue);
if (!candidate->IsText() && !candidate->IsBox())
return ExamineResult(kSkip);
if (!CandidateMayMoveWithScroller(candidate, scroller_))
return ExamineResult(kSkip);
if (candidate->Style()->OverflowAnchor() == EOverflowAnchor::kNone)
return ExamineResult(kSkip);
LayoutRect candidate_rect = RelativeBounds(candidate, scroller_);
LayoutRect visible_rect =
bool occupies_space =
candidate_rect.Width() > 0 && candidate_rect.Height() > 0;
if (occupies_space && visible_rect.Intersects(candidate_rect)) {
return ExamineResult(
visible_rect.Contains(candidate_rect) ? kReturn : kConstrain,
} else {
return ExamineResult(kSkip);
void ScrollAnchor::FindAnchor() {
TRACE_EVENT0("blink", "ScrollAnchor::findAnchor");
if (anchor_object_)
bool ScrollAnchor::FindAnchorRecursive(LayoutObject* candidate) {
ExamineResult result = Examine(candidate);
if (result.viable) {
anchor_object_ = candidate;
corner_ = result.corner;
if (result.status == kReturn)
return true;
if (result.status == kSkip)
return false;
for (LayoutObject* child = candidate->SlowFirstChild(); child;
child = child->NextSibling()) {
if (FindAnchorRecursive(child))
return true;
// Make a separate pass to catch positioned descendants with a static DOM
// parent that we skipped over (
if (candidate->IsLayoutBlock()) {
if (TrackedLayoutBoxListHashSet* positioned_descendants =
ToLayoutBlock(candidate)->PositionedObjects()) {
for (LayoutBox* descendant : *positioned_descendants) {
if (descendant->Parent() != candidate) {
if (FindAnchorRecursive(descendant))
return true;
if (result.status == kConstrain)
return true;
DCHECK_EQ(result.status, kContinue);
return false;
bool ScrollAnchor::ComputeScrollAnchorDisablingStyleChanged() {
LayoutObject* current = AnchorObject();
if (!current)
return false;
LayoutObject* scroller_box = ScrollerLayoutBox(scroller_);
while (true) {
if (current->ScrollAnchorDisablingStyleChanged())
return true;
if (current == scroller_box)
return false;
current = current->Parent();
void ScrollAnchor::NotifyBeforeLayout() {
if (queued_) {
scroll_anchor_disabling_style_changed_ |=
ScrollOffset scroll_offset = scroller_->GetScrollOffset();
float block_direction_scroll_offset =
? scroll_offset.Height()
: scroll_offset.Width();
if (block_direction_scroll_offset == 0) {
if (!anchor_object_) {
// FindAnchor() and ComputeRelativeOffset() query a box's borders as part of
// its geometry. But when collapsed, table borders can depend on internal
// parts, which get sorted during a layout pass. When a table with dirty
// internal structure is checked as an anchor candidate, a DCHECK was hit.
if (!anchor_object_)
saved_relative_offset_ =
ComputeRelativeOffset(anchor_object_, scroller_, corner_);
scroll_anchor_disabling_style_changed_ =
LocalFrameView* frame_view = ScrollerLayoutBox(scroller_)->GetFrameView();
ScrollableArea* owning_scroller =
? &ToRootFrameViewport(scroller_)->LayoutViewport()
: scroller_.Get();
queued_ = true;
IntSize ScrollAnchor::ComputeAdjustment() const {
// The anchor node can report fractional positions, but it is DIP-snapped when
// painting (, so we must round the offsets to determine the
// visual delta. If we scroll by the delta in LayoutUnits, the snapping of the
// anchor node may round differently from the snapping of the scroll position.
// (For example, anchor moving from 2.4px -> 2.6px is really 2px -> 3px, so we
// should scroll by 1px instead of 0.2px.) This is true regardless of whether
// the ScrollableArea actually uses fractional scroll positions.
IntSize delta = RoundedIntSize(ComputeRelativeOffset(anchor_object_,
scroller_, corner_)) -
// Only adjust on the block layout axis.
if (ScrollerLayoutBox(scroller_)->IsHorizontalWritingMode())
return delta;
void ScrollAnchor::Adjust() {
if (!queued_)
queued_ = false;
if (!anchor_object_)
IntSize adjustment = ComputeAdjustment();
if (adjustment.IsZero())
if (scroll_anchor_disabling_style_changed_) {
// Note that we only clear if the adjustment would have been non-zero.
// This minimizes redundant calls to findAnchor.
// TODO(skobes): add UMA metric for this.
DEFINE_STATIC_LOCAL(EnumerationHistogram, suppressed_by_sanaclap_histogram,
("Layout.ScrollAnchor.SuppressedBySanaclap", 2));
scroller_->GetScrollOffset() + FloatSize(adjustment), kAnchoringScroll);
// Update UMA metric.
DEFINE_STATIC_LOCAL(EnumerationHistogram, adjusted_offset_histogram,
("Layout.ScrollAnchor.AdjustedScrollOffset", 2));
bool ScrollAnchor::RestoreAnchor(const SerializedAnchor& serialized_anchor) {
if (!scroller_ || anchor_object_ || !serialized_anchor.IsValid()) {
return false;
DEFINE_STATIC_LOCAL(EnumerationHistogram, restoration_status_histogram,
("Layout.ScrollAnchor.RestorationStatus", kStatusCount));
Document* document = &(ScrollerLayoutBox(scroller_)->GetDocument());
v8::Isolate* isolate =
ExceptionState exception_state(isolate, ExceptionState::kQueryContext,
"ScrollAnchor", "RestoreAnchor");
StaticElementList* found_elements = document->QuerySelectorAll(
AtomicString(serialized_anchor.selector), exception_state);
if (exception_state.HadException()) {
return false;
if (found_elements->length() < 1) {
return false;
for (unsigned index = 0; index < found_elements->length(); index++) {
Element* anchor_element = found_elements->item(index);
LayoutObject* anchor_object = anchor_element->ToNode()->GetLayoutObject();
if (!anchor_object) {
// There are scenarios where the layout object we find is non-box and
// non-text; this can happen, e.g., if the original anchor object was a text
// element of a non-box element like <code>. The generated selector can't
// directly locate the text object, resulting in a loss of precision.
// Instead we scroll the object we do find into the same relative position
// and attempt to re-find the anchor. The user-visible effect should end up
// roughly the same.
ScrollOffset current_offset = scroller_->GetScrollOffset();
FloatPoint desired_point =
anchor_object->AbsoluteBoundingBoxFloatRect().Location() +
ScrollOffset desired_offset =
ScrollOffset(desired_point.X(), desired_point.Y());
ScrollOffset delta =
desired_offset -= delta;
scroller_->SetScrollOffset(desired_offset, kAnchoringScroll);
// If the above FindAnchor call failed, reset the scroll position and try
// again with the next found element.
if (!anchor_object_) {
scroller_->SetScrollOffset(current_offset, kAnchoringScroll);
corner_ = CornerToAnchor(scroller_);
saved_relative_offset_ =
ComputeRelativeOffset(anchor_object_, scroller_, corner_);
saved_selector_ = serialized_anchor.selector;
return true;
return false;
const SerializedAnchor ScrollAnchor::GetSerializedAnchor() {
// It's safe to return saved_selector_ before checking anchor_object_, since
// clearing anchor_object_ also clears saved_selector_.
if (!saved_selector_.IsEmpty()) {
return SerializedAnchor(
ComputeRelativeOffset(anchor_object_, scroller_, corner_));
if (!anchor_object_) {
if (!anchor_object_)
return SerializedAnchor();
SerializedAnchor new_anchor(
ComputeRelativeOffset(anchor_object_, scroller_, corner_));
if (new_anchor.IsValid()) {
saved_selector_ = new_anchor.selector;
return new_anchor;
void ScrollAnchor::ClearSelf() {
LayoutObject* anchor_object = anchor_object_;
anchor_object_ = nullptr;
saved_selector_ = String();
if (anchor_object)
void ScrollAnchor::Clear() {
LayoutObject* layout_object =
anchor_object_ ? anchor_object_ : ScrollerLayoutBox(scroller_);
PaintLayer* layer = nullptr;
if (LayoutObject* parent = layout_object->Parent())
layer = parent->EnclosingLayer();
// Walk up the layer tree to clear any scroll anchors.
while (layer) {
if (PaintLayerScrollableArea* scrollable_area =
layer->GetScrollableArea()) {
ScrollAnchor* anchor = scrollable_area->GetScrollAnchor();
layer = layer->Parent();
if (LocalFrameView* view = layout_object->GetFrameView()) {
ScrollAnchor* anchor = view->GetScrollAnchor();
bool ScrollAnchor::RefersTo(const LayoutObject* layout_object) const {
return anchor_object_ == layout_object;
void ScrollAnchor::NotifyRemoved(LayoutObject* layout_object) {
if (anchor_object_ == layout_object)
} // namespace blink