| /* SPDX-License-Identifier: LGPL-2.1-or-later */ |
| /* |
| * Copyright (C) 2020, Google Inc. |
| * |
| * ipu3.cpp - IPU3 Image Processing Algorithms |
| */ |
| |
| #include <algorithm> |
| #include <array> |
| #include <cmath> |
| #include <limits> |
| #include <map> |
| #include <memory> |
| #include <stdint.h> |
| #include <utility> |
| #include <vector> |
| |
| #include <linux/intel-ipu3.h> |
| #include <linux/v4l2-controls.h> |
| |
| #include <libcamera/base/log.h> |
| #include <libcamera/base/utils.h> |
| |
| #include <libcamera/control_ids.h> |
| #include <libcamera/framebuffer.h> |
| #include <libcamera/ipa/ipa_interface.h> |
| #include <libcamera/ipa/ipa_module_info.h> |
| #include <libcamera/ipa/ipu3_ipa_interface.h> |
| #include <libcamera/request.h> |
| |
| #include "libcamera/internal/mapped_framebuffer.h" |
| |
| #include "algorithms/af.h" |
| #include "algorithms/agc.h" |
| #include "algorithms/algorithm.h" |
| #include "algorithms/awb.h" |
| #include "algorithms/blc.h" |
| #include "algorithms/tone_mapping.h" |
| #include "libipa/camera_sensor_helper.h" |
| |
| /* Minimum grid width, expressed as a number of cells */ |
| static constexpr uint32_t kMinGridWidth = 16; |
| /* Maximum grid width, expressed as a number of cells */ |
| static constexpr uint32_t kMaxGridWidth = 80; |
| /* Minimum grid height, expressed as a number of cells */ |
| static constexpr uint32_t kMinGridHeight = 16; |
| /* Maximum grid height, expressed as a number of cells */ |
| static constexpr uint32_t kMaxGridHeight = 60; |
| /* log2 of the minimum grid cell width and height, in pixels */ |
| static constexpr uint32_t kMinCellSizeLog2 = 3; |
| /* log2 of the maximum grid cell width and height, in pixels */ |
| static constexpr uint32_t kMaxCellSizeLog2 = 6; |
| |
| namespace libcamera { |
| |
| LOG_DEFINE_CATEGORY(IPAIPU3) |
| |
| using namespace std::literals::chrono_literals; |
| |
| namespace ipa::ipu3 { |
| |
| /** |
| * \brief The IPU3 IPA implementation |
| * |
| * The IPU3 Pipeline defines an IPU3-specific interface for communication |
| * between the PipelineHandler and the IPA module. |
| * |
| * We extend the IPAIPU3Interface to implement our algorithms and handle events |
| * from the IPU3 PipelineHandler to satisfy requests from the application. |
| * |
| * At initialisation time, a CameraSensorHelper is instantiated to support |
| * camera-specific calculations, while the default controls are computed, and |
| * the algorithms are constructed and placed in an ordered list. |
| * |
| * The IPU3 ImgU operates with a grid layout to divide the overall frame into |
| * rectangular cells of pixels. When the IPA is configured, we determine the |
| * best grid for the statistics based on the pipeline handler Bayer Down Scaler |
| * output size. |
| * |
| * Two main events are then handled to operate the IPU3 ImgU by populating its |
| * parameter buffer, and adapting the settings of the sensor attached to the |
| * IPU3 CIO2 through sensor-specific V4L2 controls. |
| * |
| * When the event \a EventFillParams occurs we populate the ImgU parameter |
| * buffer with settings to configure the device in preparation for handling the |
| * frame queued in the Request. |
| * |
| * When the frame has completed processing, the ImgU will generate a statistics |
| * buffer which is given to the IPA as part of the \a EventStatReady event. At |
| * this event we run the algorithms to parse the statistics and cache any |
| * results for the next \a EventFillParams event. |
| * |
| * The individual algorithms are split into modular components that are called |
| * iteratively to allow them to process statistics from the ImgU in a defined |
| * order. |
| * |
| * The current implementation supports three core algorithms: |
| * - Automatic white balance (AWB) |
| * - Automatic gain and exposure control (AGC) |
| * - Black level correction (BLC) |
| * - Tone mapping (Gamma) |
| * |
| * AWB is implemented using a Greyworld algorithm, and calculates the red and |
| * blue gains to apply to generate a neutral grey frame overall. |
| * |
| * AGC is handled by calculating a histogram of the green channel to estimate an |
| * analogue gain and shutter time which will provide a well exposed frame. A |
| * low-pass IIR filter is used to smooth the changes to the sensor to reduce |
| * perceivable steps. |
| * |
| * The tone mapping algorithm provides a gamma correction table to improve the |
| * contrast of the scene. |
| * |
| * The black level compensation algorithm subtracts a hardcoded black level from |
| * all pixels. |
| * |
| * The IPU3 ImgU has further processing blocks to support image quality |
| * improvements through bayer and temporal noise reductions, however those are |
| * not supported in the current implementation, and will use default settings as |
| * provided by the kernel driver. |
| * |
| * Demosaicing is operating with the default parameters and could be further |
| * optimised to provide improved sharpening coefficients, checker artifact |
| * removal, and false color correction. |
| * |
| * Additional image enhancements can be made by providing lens and |
| * sensor-specific tuning to adapt for Black Level compensation (BLC), Lens |
| * shading correction (SHD) and Color correction (CCM). |
| */ |
| class IPAIPU3 : public IPAIPU3Interface |
| { |
| public: |
| int init(const IPASettings &settings, |
| const IPACameraSensorInfo &sensorInfo, |
| const ControlInfoMap &sensorControls, |
| ControlInfoMap *ipaControls) override; |
| |
| int start() override; |
| void stop() override; |
| |
| int configure(const IPAConfigInfo &configInfo, |
| ControlInfoMap *ipaControls) override; |
| |
| void mapBuffers(const std::vector<IPABuffer> &buffers) override; |
| void unmapBuffers(const std::vector<unsigned int> &ids) override; |
| void processEvent(const IPU3Event &event) override; |
| |
| private: |
| void updateControls(const IPACameraSensorInfo &sensorInfo, |
| const ControlInfoMap &sensorControls, |
| ControlInfoMap *ipaControls); |
| void updateSessionConfiguration(const ControlInfoMap &sensorControls); |
| void processControls(unsigned int frame, const ControlList &controls); |
| void fillParams(unsigned int frame, ipu3_uapi_params *params); |
| void parseStatistics(unsigned int frame, |
| int64_t frameTimestamp, |
| const ipu3_uapi_stats_3a *stats); |
| |
| void setControls(unsigned int frame); |
| void calculateBdsGrid(const Size &bdsOutputSize); |
| |
| std::map<unsigned int, MappedFrameBuffer> buffers_; |
| |
| ControlInfoMap ctrls_; |
| |
| IPACameraSensorInfo sensorInfo_; |
| |
| /* Camera sensor controls. */ |
| uint32_t defVBlank_; |
| uint32_t exposure_; |
| uint32_t minExposure_; |
| uint32_t maxExposure_; |
| uint32_t gain_; |
| uint32_t minGain_; |
| uint32_t maxGain_; |
| |
| /* Interface to the Camera Helper */ |
| std::unique_ptr<CameraSensorHelper> camHelper_; |
| |
| /* Maintain the algorithms used by the IPA */ |
| std::list<std::unique_ptr<ipa::ipu3::Algorithm>> algorithms_; |
| |
| /* Local parameter storage */ |
| struct IPAContext context_; |
| }; |
| |
| /** |
| * \brief Compute IPASessionConfiguration using the sensor information and the |
| * sensor V4L2 controls |
| */ |
| void IPAIPU3::updateSessionConfiguration(const ControlInfoMap &sensorControls) |
| { |
| const ControlInfo &v4l2Exposure = sensorControls.find(V4L2_CID_EXPOSURE)->second; |
| int32_t minExposure = v4l2Exposure.min().get<int32_t>(); |
| int32_t maxExposure = v4l2Exposure.max().get<int32_t>(); |
| |
| const ControlInfo &v4l2Gain = sensorControls.find(V4L2_CID_ANALOGUE_GAIN)->second; |
| int32_t minGain = v4l2Gain.min().get<int32_t>(); |
| int32_t maxGain = v4l2Gain.max().get<int32_t>(); |
| |
| /* |
| * When the AGC computes the new exposure values for a frame, it needs |
| * to know the limits for shutter speed and analogue gain. |
| * As it depends on the sensor, update it with the controls. |
| * |
| * \todo take VBLANK into account for maximum shutter speed |
| */ |
| context_.configuration.agc.minShutterSpeed = minExposure * context_.configuration.sensor.lineDuration; |
| context_.configuration.agc.maxShutterSpeed = maxExposure * context_.configuration.sensor.lineDuration; |
| context_.configuration.agc.minAnalogueGain = camHelper_->gain(minGain); |
| context_.configuration.agc.maxAnalogueGain = camHelper_->gain(maxGain); |
| } |
| |
| /** |
| * \brief Compute camera controls using the sensor information and the sensor |
| * V4L2 controls |
| * |
| * Some of the camera controls are computed by the pipeline handler, some others |
| * by the IPA module which is in charge of handling, for example, the exposure |
| * time and the frame duration. |
| * |
| * This function computes: |
| * - controls::ExposureTime |
| * - controls::FrameDurationLimits |
| */ |
| void IPAIPU3::updateControls(const IPACameraSensorInfo &sensorInfo, |
| const ControlInfoMap &sensorControls, |
| ControlInfoMap *ipaControls) |
| { |
| ControlInfoMap::Map controls{}; |
| double lineDuration = context_.configuration.sensor.lineDuration.get<std::micro>(); |
| |
| /* |
| * Compute exposure time limits by using line length and pixel rate |
| * converted to microseconds. Use the V4L2_CID_EXPOSURE control to get |
| * exposure min, max and default and convert it from lines to |
| * microseconds. |
| */ |
| const ControlInfo &v4l2Exposure = sensorControls.find(V4L2_CID_EXPOSURE)->second; |
| int32_t minExposure = v4l2Exposure.min().get<int32_t>() * lineDuration; |
| int32_t maxExposure = v4l2Exposure.max().get<int32_t>() * lineDuration; |
| int32_t defExposure = v4l2Exposure.def().get<int32_t>() * lineDuration; |
| controls[&controls::ExposureTime] = ControlInfo(minExposure, maxExposure, |
| defExposure); |
| |
| /* |
| * Compute the frame duration limits. |
| * |
| * The frame length is computed assuming a fixed line length combined |
| * with the vertical frame sizes. |
| */ |
| const ControlInfo &v4l2HBlank = sensorControls.find(V4L2_CID_HBLANK)->second; |
| uint32_t hblank = v4l2HBlank.def().get<int32_t>(); |
| uint32_t lineLength = sensorInfo.outputSize.width + hblank; |
| |
| const ControlInfo &v4l2VBlank = sensorControls.find(V4L2_CID_VBLANK)->second; |
| std::array<uint32_t, 3> frameHeights{ |
| v4l2VBlank.min().get<int32_t>() + sensorInfo.outputSize.height, |
| v4l2VBlank.max().get<int32_t>() + sensorInfo.outputSize.height, |
| v4l2VBlank.def().get<int32_t>() + sensorInfo.outputSize.height, |
| }; |
| |
| std::array<int64_t, 3> frameDurations; |
| for (unsigned int i = 0; i < frameHeights.size(); ++i) { |
| uint64_t frameSize = lineLength * frameHeights[i]; |
| frameDurations[i] = frameSize / (sensorInfo.pixelRate / 1000000U); |
| } |
| |
| controls[&controls::FrameDurationLimits] = ControlInfo(frameDurations[0], |
| frameDurations[1], |
| frameDurations[2]); |
| |
| *ipaControls = ControlInfoMap(std::move(controls), controls::controls); |
| } |
| |
| /** |
| * \brief Initialize the IPA module and its controls |
| * |
| * This function receives the camera sensor information from the pipeline |
| * handler, computes the limits of the controls it handles and returns |
| * them in the \a ipaControls output parameter. |
| */ |
| int IPAIPU3::init(const IPASettings &settings, |
| const IPACameraSensorInfo &sensorInfo, |
| const ControlInfoMap &sensorControls, |
| ControlInfoMap *ipaControls) |
| { |
| camHelper_ = CameraSensorHelperFactory::create(settings.sensorModel); |
| if (camHelper_ == nullptr) { |
| LOG(IPAIPU3, Error) |
| << "Failed to create camera sensor helper for " |
| << settings.sensorModel; |
| return -ENODEV; |
| } |
| |
| /* Clean context */ |
| context_ = {}; |
| context_.configuration.sensor.lineDuration = sensorInfo.lineLength * 1.0s / sensorInfo.pixelRate; |
| |
| /* Construct our Algorithms */ |
| algorithms_.push_back(std::make_unique<algorithms::Af>()); |
| algorithms_.push_back(std::make_unique<algorithms::Agc>()); |
| algorithms_.push_back(std::make_unique<algorithms::Awb>()); |
| algorithms_.push_back(std::make_unique<algorithms::BlackLevelCorrection>()); |
| algorithms_.push_back(std::make_unique<algorithms::ToneMapping>()); |
| |
| /* Initialize controls. */ |
| updateControls(sensorInfo, sensorControls, ipaControls); |
| |
| return 0; |
| } |
| |
| /** |
| * \brief Perform any processing required before the first frame |
| */ |
| int IPAIPU3::start() |
| { |
| /* |
| * Set the sensors V4L2 controls before the first frame to ensure that |
| * we have an expected and known configuration from the start. |
| */ |
| setControls(0); |
| |
| return 0; |
| } |
| |
| /** |
| * \brief Ensure that all processing has completed |
| */ |
| void IPAIPU3::stop() |
| { |
| } |
| |
| /** |
| * \brief Calculate a grid for the AWB statistics |
| * |
| * This function calculates a grid for the AWB algorithm in the IPU3 firmware. |
| * Its input is the BDS output size calculated in the ImgU. |
| * It is limited for now to the simplest method: find the lesser error |
| * with the width/height and respective log2 width/height of the cells. |
| * |
| * \todo The frame is divided into cells which can be 8x8 => 64x64. |
| * As a smaller cell improves the algorithm precision, adapting the |
| * x_start and y_start parameters of the grid would provoke a loss of |
| * some pixels but would also result in more accurate algorithms. |
| */ |
| void IPAIPU3::calculateBdsGrid(const Size &bdsOutputSize) |
| { |
| Size best; |
| Size bestLog2; |
| |
| /* Set the BDS output size in the IPAConfiguration structure */ |
| context_.configuration.grid.bdsOutputSize = bdsOutputSize; |
| |
| uint32_t minError = std::numeric_limits<uint32_t>::max(); |
| for (uint32_t shift = kMinCellSizeLog2; shift <= kMaxCellSizeLog2; ++shift) { |
| uint32_t width = std::clamp(bdsOutputSize.width >> shift, |
| kMinGridWidth, |
| kMaxGridWidth); |
| |
| width = width << shift; |
| uint32_t error = utils::abs_diff(width, bdsOutputSize.width); |
| if (error >= minError) |
| continue; |
| |
| minError = error; |
| best.width = width; |
| bestLog2.width = shift; |
| } |
| |
| minError = std::numeric_limits<uint32_t>::max(); |
| for (uint32_t shift = kMinCellSizeLog2; shift <= kMaxCellSizeLog2; ++shift) { |
| uint32_t height = std::clamp(bdsOutputSize.height >> shift, |
| kMinGridHeight, |
| kMaxGridHeight); |
| |
| height = height << shift; |
| uint32_t error = utils::abs_diff(height, bdsOutputSize.height); |
| if (error >= minError) |
| continue; |
| |
| minError = error; |
| best.height = height; |
| bestLog2.height = shift; |
| } |
| |
| struct ipu3_uapi_grid_config &bdsGrid = context_.configuration.grid.bdsGrid; |
| bdsGrid.x_start = 0; |
| bdsGrid.y_start = 0; |
| bdsGrid.width = best.width >> bestLog2.width; |
| bdsGrid.block_width_log2 = bestLog2.width; |
| bdsGrid.height = best.height >> bestLog2.height; |
| bdsGrid.block_height_log2 = bestLog2.height; |
| |
| /* The ImgU pads the lines to a multiple of 4 cells. */ |
| context_.configuration.grid.stride = utils::alignUp(bdsGrid.width, 4); |
| |
| LOG(IPAIPU3, Debug) << "Best grid found is: (" |
| << (int)bdsGrid.width << " << " << (int)bdsGrid.block_width_log2 << ") x (" |
| << (int)bdsGrid.height << " << " << (int)bdsGrid.block_height_log2 << ")"; |
| } |
| |
| /** |
| * \brief Configure the IPU3 IPA |
| * \param[in] configInfo The IPA configuration data, received from the pipeline |
| * handler |
| * \param[in] ipaControls The IPA controls to update |
| * |
| * Calculate the best grid for the statistics based on the pipeline handler BDS |
| * output, and parse the minimum and maximum exposure and analogue gain control |
| * values. |
| * |
| * \todo Document what the BDS is, ideally in a block diagram of the ImgU. |
| * |
| * All algorithm modules are called to allow them to prepare the |
| * \a IPASessionConfiguration structure for the \a IPAContext. |
| */ |
| int IPAIPU3::configure(const IPAConfigInfo &configInfo, |
| ControlInfoMap *ipaControls) |
| { |
| if (configInfo.sensorControls.empty()) { |
| LOG(IPAIPU3, Error) << "No sensor controls provided"; |
| return -ENODATA; |
| } |
| |
| sensorInfo_ = configInfo.sensorInfo; |
| |
| /* |
| * Compute the sensor V4L2 controls to be used by the algorithms and |
| * to be set on the sensor. |
| */ |
| ctrls_ = configInfo.sensorControls; |
| |
| const auto itExp = ctrls_.find(V4L2_CID_EXPOSURE); |
| if (itExp == ctrls_.end()) { |
| LOG(IPAIPU3, Error) << "Can't find exposure control"; |
| return -EINVAL; |
| } |
| |
| const auto itGain = ctrls_.find(V4L2_CID_ANALOGUE_GAIN); |
| if (itGain == ctrls_.end()) { |
| LOG(IPAIPU3, Error) << "Can't find gain control"; |
| return -EINVAL; |
| } |
| |
| const auto itVBlank = ctrls_.find(V4L2_CID_VBLANK); |
| if (itVBlank == ctrls_.end()) { |
| LOG(IPAIPU3, Error) << "Can't find VBLANK control"; |
| return -EINVAL; |
| } |
| |
| minExposure_ = itExp->second.min().get<int32_t>(); |
| maxExposure_ = itExp->second.max().get<int32_t>(); |
| exposure_ = minExposure_; |
| |
| minGain_ = itGain->second.min().get<int32_t>(); |
| maxGain_ = itGain->second.max().get<int32_t>(); |
| gain_ = minGain_; |
| |
| defVBlank_ = itVBlank->second.def().get<int32_t>(); |
| |
| calculateBdsGrid(configInfo.bdsOutputSize); |
| |
| /* Clean frameContext at each reconfiguration. */ |
| context_.frameContext = {}; |
| |
| /* Update the camera controls using the new sensor settings. */ |
| updateControls(sensorInfo_, ctrls_, ipaControls); |
| |
| /* Update the IPASessionConfiguration using the sensor settings. */ |
| updateSessionConfiguration(ctrls_); |
| |
| for (auto const &algo : algorithms_) { |
| int ret = algo->configure(context_, configInfo); |
| if (ret) |
| return ret; |
| } |
| |
| return 0; |
| } |
| |
| /** |
| * \brief Map the parameters and stats buffers allocated in the pipeline handler |
| * \param[in] buffers The buffers to map |
| */ |
| void IPAIPU3::mapBuffers(const std::vector<IPABuffer> &buffers) |
| { |
| for (const IPABuffer &buffer : buffers) { |
| const FrameBuffer fb(buffer.planes); |
| buffers_.emplace(buffer.id, |
| MappedFrameBuffer(&fb, MappedFrameBuffer::MapFlag::ReadWrite)); |
| } |
| } |
| |
| /** |
| * \brief Unmap the parameters and stats buffers |
| * \param[in] ids The IDs of the buffers to unmap |
| */ |
| void IPAIPU3::unmapBuffers(const std::vector<unsigned int> &ids) |
| { |
| for (unsigned int id : ids) { |
| auto it = buffers_.find(id); |
| if (it == buffers_.end()) |
| continue; |
| |
| buffers_.erase(it); |
| } |
| } |
| |
| /** |
| * \brief Process an event generated by the pipeline handler |
| * \param[in] event The event sent from pipeline handler |
| * |
| * The expected event handling over the lifetime of a Request has |
| * the following sequence: |
| * |
| * - EventProcessControls : Handle controls from a new Request |
| * - EventFillParams : Prepare the ISP to process the Request |
| * - EventStatReady : Process statistics after ISP completion |
| */ |
| void IPAIPU3::processEvent(const IPU3Event &event) |
| { |
| switch (event.op) { |
| case EventProcessControls: { |
| processControls(event.frame, event.controls); |
| break; |
| } |
| case EventFillParams: { |
| auto it = buffers_.find(event.bufferId); |
| if (it == buffers_.end()) { |
| LOG(IPAIPU3, Error) << "Could not find param buffer!"; |
| return; |
| } |
| |
| Span<uint8_t> mem = it->second.planes()[0]; |
| ipu3_uapi_params *params = |
| reinterpret_cast<ipu3_uapi_params *>(mem.data()); |
| |
| fillParams(event.frame, params); |
| break; |
| } |
| case EventStatReady: { |
| auto it = buffers_.find(event.bufferId); |
| if (it == buffers_.end()) { |
| LOG(IPAIPU3, Error) << "Could not find stats buffer!"; |
| return; |
| } |
| |
| Span<uint8_t> mem = it->second.planes()[0]; |
| const ipu3_uapi_stats_3a *stats = |
| reinterpret_cast<ipu3_uapi_stats_3a *>(mem.data()); |
| |
| int32_t exposure = event.sensorControls.get(V4L2_CID_EXPOSURE).get<int32_t>(); |
| int32_t gain = event.sensorControls.get(V4L2_CID_ANALOGUE_GAIN).get<int32_t>(); |
| |
| context_.frameContext.sensor.exposure = exposure; |
| context_.frameContext.sensor.gain = camHelper_->gain(gain); |
| |
| parseStatistics(event.frame, event.frameTimestamp, stats); |
| break; |
| } |
| default: |
| LOG(IPAIPU3, Error) << "Unknown event " << event.op; |
| break; |
| } |
| } |
| |
| /** |
| * \brief Process a control list for a request from the application |
| * \param[in] frame The number of the frame which will be processed next |
| * \param[in] controls The controls for the \a frame |
| * |
| * Parse the request to handle any IPA-managed controls that were set from the |
| * application such as manual sensor settings. |
| */ |
| void IPAIPU3::processControls([[maybe_unused]] unsigned int frame, |
| [[maybe_unused]] const ControlList &controls) |
| { |
| /* \todo Start processing for 'frame' based on 'controls'. */ |
| } |
| |
| /** |
| * \brief Fill the ImgU parameter buffer for the next frame |
| * \param[in] frame The number of the latest frame processed |
| * \param[out] params The parameter buffer to fill |
| * |
| * Algorithms are expected to fill the IPU3 parameter buffer for the next |
| * frame given their most recent processing of the ImgU statistics. |
| */ |
| void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params) |
| { |
| /* |
| * The incoming params buffer may contain uninitialised data, or the |
| * parameters of previously queued frames. Clearing the entire buffer |
| * may be an expensive operation, and the kernel will only read from |
| * structures which have their associated use-flag set. |
| * |
| * It is the responsibility of the algorithms to set the use flags |
| * accordingly for any data structure they update during prepare(). |
| */ |
| params->use = {}; |
| |
| for (auto const &algo : algorithms_) |
| algo->prepare(context_, params); |
| |
| IPU3Action op; |
| op.op = ActionParamFilled; |
| |
| queueFrameAction.emit(frame, op); |
| } |
| |
| /** |
| * \brief Process the statistics generated by the ImgU |
| * \param[in] frame The number of the latest frame processed |
| * \param[in] frameTimestamp The current frame timestamp |
| * \param[in] stats The IPU3 statistics and ISP results |
| * |
| * Parse the most recently processed image statistics from the ImgU. The |
| * statistics are passed to each algorithm module to run their calculations and |
| * update their state accordingly. |
| */ |
| void IPAIPU3::parseStatistics(unsigned int frame, |
| [[maybe_unused]] int64_t frameTimestamp, |
| const ipu3_uapi_stats_3a *stats) |
| { |
| double lineDuration = context_.configuration.sensor.lineDuration.get<std::micro>(); |
| ControlList ctrls(controls::controls); |
| |
| for (auto const &algo : algorithms_) |
| algo->process(context_, stats); |
| |
| setControls(frame); |
| |
| /* \todo Use VBlank value calculated from each frame exposure. */ |
| int64_t frameDuration = (defVBlank_ + sensorInfo_.outputSize.height) * lineDuration; |
| ctrls.set(controls::FrameDuration, frameDuration); |
| |
| ctrls.set(controls::AnalogueGain, context_.frameContext.sensor.gain); |
| |
| ctrls.set(controls::ColourTemperature, context_.frameContext.awb.temperatureK); |
| |
| ctrls.set(controls::ExposureTime, context_.frameContext.sensor.exposure * lineDuration); |
| |
| /* |
| * \todo The Metadata provides a path to getting extended data |
| * out to the application. Further data such as a simplifed Histogram |
| * might have value to be exposed, however such data may be |
| * difficult to report in a generically parsable way and we |
| * likely want to avoid putting platform specific metadata in. |
| */ |
| |
| IPU3Action op; |
| op.op = ActionMetadataReady; |
| op.controls = ctrls; |
| |
| queueFrameAction.emit(frame, op); |
| } |
| |
| /** |
| * \brief Handle sensor controls for a given \a frame number |
| * \param[in] frame The frame on which the sensor controls should be set |
| * |
| * Send the desired sensor control values to the pipeline handler to request |
| * that they are applied on the camera sensor. |
| */ |
| void IPAIPU3::setControls(unsigned int frame) |
| { |
| IPU3Action op; |
| op.op = ActionSetSensorControls; |
| |
| exposure_ = context_.frameContext.agc.exposure; |
| gain_ = camHelper_->gainCode(context_.frameContext.agc.gain); |
| |
| ControlList ctrls(ctrls_); |
| ctrls.set(V4L2_CID_EXPOSURE, static_cast<int32_t>(exposure_)); |
| ctrls.set(V4L2_CID_ANALOGUE_GAIN, static_cast<int32_t>(gain_)); |
| op.sensorControls = ctrls; |
| |
| queueFrameAction.emit(frame, op); |
| } |
| |
| } /* namespace ipa::ipu3 */ |
| |
| /** |
| * \brief External IPA module interface |
| * |
| * The IPAModuleInfo is required to match an IPA module construction against the |
| * intented pipeline handler with the module. The API and pipeline handler |
| * versions must match the corresponding IPA interface and pipeline handler. |
| * |
| * \sa struct IPAModuleInfo |
| */ |
| extern "C" { |
| const struct IPAModuleInfo ipaModuleInfo = { |
| IPA_MODULE_API_VERSION, |
| 1, |
| "PipelineHandlerIPU3", |
| "ipu3", |
| }; |
| |
| /** |
| * \brief Create an instance of the IPA interface |
| * |
| * This function is the entry point of the IPA module. It is called by the IPA |
| * manager to create an instance of the IPA interface for each camera. When |
| * matched against with a pipeline handler, the IPAManager will construct an IPA |
| * instance for each associated Camera. |
| */ |
| IPAInterface *ipaCreate() |
| { |
| return new ipa::ipu3::IPAIPU3(); |
| } |
| } |
| |
| } /* namespace libcamera */ |