Add Windows SDK sample code to deps/third_party/winsdk_samples_v71

TBR=kjellander
Review URL: https://webrtc-codereview.appspot.com/939023

git-svn-id: http://webrtc.googlecode.com/svn/deps/third_party/winsdk_samples_v71@3145 4adac7df-926f-26a2-2b94-8c16560cd09d
diff --git a/License/License.htm b/License/License.htm
new file mode 100644
index 0000000..5e5d9d6
--- /dev/null
+++ b/License/License.htm
@@ -0,0 +1,1866 @@
+<html xmlns:v="urn:schemas-microsoft-com:vml"

+xmlns:o="urn:schemas-microsoft-com:office:office"

+xmlns:w="urn:schemas-microsoft-com:office:word"

+xmlns:m="http://schemas.microsoft.com/office/2004/12/omml"

+xmlns="http://www.w3.org/TR/REC-html40">

+

+<head>

+<meta http-equiv=Content-Type content="text/html; charset=windows-1252">

+<meta name=ProgId content=Word.Document>

+<meta name=Generator content="Microsoft Word 14">

+<meta name=Originator content="Microsoft Word 14">

+<link rel=File-List href="License_files/filelist.xml">

+<!--[if gte mso 9]><xml>

+ <o:OfficeDocumentSettings>

+  <o:RemovePersonalInformation/>

+  <o:RemoveDateAndTime/>

+ </o:OfficeDocumentSettings>

+</xml><![endif]-->

+<link rel=themeData href="License_files/themedata.thmx">

+<link rel=colorSchemeMapping href="License_files/colorschememapping.xml">

+<!--[if gte mso 9]><xml>

+ <w:WordDocument>

+  <w:SpellingState>Clean</w:SpellingState>

+  <w:GrammarState>Clean</w:GrammarState>

+  <w:TrackMoves>false</w:TrackMoves>

+  <w:TrackFormatting/>

+  <w:PunctuationKerning/>

+  <w:ValidateAgainstSchemas/>

+  <w:SaveIfXMLInvalid>false</w:SaveIfXMLInvalid>

+  <w:IgnoreMixedContent>false</w:IgnoreMixedContent>

+  <w:AlwaysShowPlaceholderText>false</w:AlwaysShowPlaceholderText>

+  <w:DoNotPromoteQF/>

+  <w:LidThemeOther>EN-US</w:LidThemeOther>

+  <w:LidThemeAsian>X-NONE</w:LidThemeAsian>

+  <w:LidThemeComplexScript>AR-SA</w:LidThemeComplexScript>

+  <w:Compatibility>

+   <w:BreakWrappedTables/>

+   <w:SnapToGridInCell/>

+   <w:WrapTextWithPunct/>

+   <w:UseAsianBreakRules/>

+   <w:DontGrowAutofit/>

+   <w:SplitPgBreakAndParaMark/>

+   <w:EnableOpenTypeKerning/>

+   <w:DontFlipMirrorIndents/>

+   <w:OverrideTableStyleHps/>

+  </w:Compatibility>

+  <m:mathPr>

+   <m:mathFont m:val="Cambria Math"/>

+   <m:brkBin m:val="before"/>

+   <m:brkBinSub m:val="&#45;-"/>

+   <m:smallFrac m:val="off"/>

+   <m:dispDef/>

+   <m:lMargin m:val="0"/>

+   <m:rMargin m:val="0"/>

+   <m:defJc m:val="centerGroup"/>

+   <m:wrapIndent m:val="1440"/>

+   <m:intLim m:val="subSup"/>

+   <m:naryLim m:val="undOvr"/>

+  </m:mathPr></w:WordDocument>

+</xml><![endif]--><!--[if gte mso 9]><xml>

+ <w:LatentStyles DefLockedState="false" DefUnhideWhenUsed="true"

+  DefSemiHidden="true" DefQFormat="false" DefPriority="99"

+  LatentStyleCount="267">

+  <w:LsdException Locked="false" Priority="0" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Normal"/>

+  <w:LsdException Locked="false" Priority="9" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="heading 1"/>

+  <w:LsdException Locked="false" Priority="9" QFormat="true" Name="heading 2"/>

+  <w:LsdException Locked="false" Priority="9" QFormat="true" Name="heading 3"/>

+  <w:LsdException Locked="false" Priority="9" QFormat="true" Name="heading 4"/>

+  <w:LsdException Locked="false" Priority="9" QFormat="true" Name="heading 5"/>

+  <w:LsdException Locked="false" Priority="9" QFormat="true" Name="heading 6"/>

+  <w:LsdException Locked="false" Priority="9" QFormat="true" Name="heading 7"/>

+  <w:LsdException Locked="false" Priority="9" QFormat="true" Name="heading 8"/>

+  <w:LsdException Locked="false" Priority="9" QFormat="true" Name="heading 9"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 1"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 2"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 3"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 4"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 5"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 6"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 7"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 8"/>

+  <w:LsdException Locked="false" Priority="39" Name="toc 9"/>

+  <w:LsdException Locked="false" Priority="35" QFormat="true" Name="caption"/>

+  <w:LsdException Locked="false" Priority="10" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Title"/>

+  <w:LsdException Locked="false" Priority="1" Name="Default Paragraph Font"/>

+  <w:LsdException Locked="false" Priority="11" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Subtitle"/>

+  <w:LsdException Locked="false" Priority="22" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Strong"/>

+  <w:LsdException Locked="false" Priority="20" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Emphasis"/>

+  <w:LsdException Locked="false" Priority="59" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Table Grid"/>

+  <w:LsdException Locked="false" UnhideWhenUsed="false" Name="Placeholder Text"/>

+  <w:LsdException Locked="false" Priority="1" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="No Spacing"/>

+  <w:LsdException Locked="false" Priority="60" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Shading"/>

+  <w:LsdException Locked="false" Priority="61" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light List"/>

+  <w:LsdException Locked="false" Priority="62" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Grid"/>

+  <w:LsdException Locked="false" Priority="63" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 1"/>

+  <w:LsdException Locked="false" Priority="64" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 2"/>

+  <w:LsdException Locked="false" Priority="65" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 1"/>

+  <w:LsdException Locked="false" Priority="66" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 2"/>

+  <w:LsdException Locked="false" Priority="67" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 1"/>

+  <w:LsdException Locked="false" Priority="68" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 2"/>

+  <w:LsdException Locked="false" Priority="69" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 3"/>

+  <w:LsdException Locked="false" Priority="70" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Dark List"/>

+  <w:LsdException Locked="false" Priority="71" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Shading"/>

+  <w:LsdException Locked="false" Priority="72" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful List"/>

+  <w:LsdException Locked="false" Priority="73" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Grid"/>

+  <w:LsdException Locked="false" Priority="60" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Shading Accent 1"/>

+  <w:LsdException Locked="false" Priority="61" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light List Accent 1"/>

+  <w:LsdException Locked="false" Priority="62" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Grid Accent 1"/>

+  <w:LsdException Locked="false" Priority="63" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 1 Accent 1"/>

+  <w:LsdException Locked="false" Priority="64" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 2 Accent 1"/>

+  <w:LsdException Locked="false" Priority="65" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 1 Accent 1"/>

+  <w:LsdException Locked="false" UnhideWhenUsed="false" Name="Revision"/>

+  <w:LsdException Locked="false" Priority="34" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="List Paragraph"/>

+  <w:LsdException Locked="false" Priority="29" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Quote"/>

+  <w:LsdException Locked="false" Priority="30" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Intense Quote"/>

+  <w:LsdException Locked="false" Priority="66" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 2 Accent 1"/>

+  <w:LsdException Locked="false" Priority="67" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 1 Accent 1"/>

+  <w:LsdException Locked="false" Priority="68" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 2 Accent 1"/>

+  <w:LsdException Locked="false" Priority="69" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 3 Accent 1"/>

+  <w:LsdException Locked="false" Priority="70" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Dark List Accent 1"/>

+  <w:LsdException Locked="false" Priority="71" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Shading Accent 1"/>

+  <w:LsdException Locked="false" Priority="72" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful List Accent 1"/>

+  <w:LsdException Locked="false" Priority="73" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Grid Accent 1"/>

+  <w:LsdException Locked="false" Priority="60" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Shading Accent 2"/>

+  <w:LsdException Locked="false" Priority="61" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light List Accent 2"/>

+  <w:LsdException Locked="false" Priority="62" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Grid Accent 2"/>

+  <w:LsdException Locked="false" Priority="63" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 1 Accent 2"/>

+  <w:LsdException Locked="false" Priority="64" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 2 Accent 2"/>

+  <w:LsdException Locked="false" Priority="65" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 1 Accent 2"/>

+  <w:LsdException Locked="false" Priority="66" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 2 Accent 2"/>

+  <w:LsdException Locked="false" Priority="67" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 1 Accent 2"/>

+  <w:LsdException Locked="false" Priority="68" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 2 Accent 2"/>

+  <w:LsdException Locked="false" Priority="69" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 3 Accent 2"/>

+  <w:LsdException Locked="false" Priority="70" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Dark List Accent 2"/>

+  <w:LsdException Locked="false" Priority="71" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Shading Accent 2"/>

+  <w:LsdException Locked="false" Priority="72" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful List Accent 2"/>

+  <w:LsdException Locked="false" Priority="73" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Grid Accent 2"/>

+  <w:LsdException Locked="false" Priority="60" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Shading Accent 3"/>

+  <w:LsdException Locked="false" Priority="61" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light List Accent 3"/>

+  <w:LsdException Locked="false" Priority="62" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Grid Accent 3"/>

+  <w:LsdException Locked="false" Priority="63" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 1 Accent 3"/>

+  <w:LsdException Locked="false" Priority="64" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 2 Accent 3"/>

+  <w:LsdException Locked="false" Priority="65" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 1 Accent 3"/>

+  <w:LsdException Locked="false" Priority="66" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 2 Accent 3"/>

+  <w:LsdException Locked="false" Priority="67" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 1 Accent 3"/>

+  <w:LsdException Locked="false" Priority="68" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 2 Accent 3"/>

+  <w:LsdException Locked="false" Priority="69" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 3 Accent 3"/>

+  <w:LsdException Locked="false" Priority="70" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Dark List Accent 3"/>

+  <w:LsdException Locked="false" Priority="71" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Shading Accent 3"/>

+  <w:LsdException Locked="false" Priority="72" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful List Accent 3"/>

+  <w:LsdException Locked="false" Priority="73" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Grid Accent 3"/>

+  <w:LsdException Locked="false" Priority="60" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Shading Accent 4"/>

+  <w:LsdException Locked="false" Priority="61" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light List Accent 4"/>

+  <w:LsdException Locked="false" Priority="62" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Grid Accent 4"/>

+  <w:LsdException Locked="false" Priority="63" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 1 Accent 4"/>

+  <w:LsdException Locked="false" Priority="64" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 2 Accent 4"/>

+  <w:LsdException Locked="false" Priority="65" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 1 Accent 4"/>

+  <w:LsdException Locked="false" Priority="66" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 2 Accent 4"/>

+  <w:LsdException Locked="false" Priority="67" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 1 Accent 4"/>

+  <w:LsdException Locked="false" Priority="68" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 2 Accent 4"/>

+  <w:LsdException Locked="false" Priority="69" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 3 Accent 4"/>

+  <w:LsdException Locked="false" Priority="70" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Dark List Accent 4"/>

+  <w:LsdException Locked="false" Priority="71" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Shading Accent 4"/>

+  <w:LsdException Locked="false" Priority="72" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful List Accent 4"/>

+  <w:LsdException Locked="false" Priority="73" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Grid Accent 4"/>

+  <w:LsdException Locked="false" Priority="60" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Shading Accent 5"/>

+  <w:LsdException Locked="false" Priority="61" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light List Accent 5"/>

+  <w:LsdException Locked="false" Priority="62" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Grid Accent 5"/>

+  <w:LsdException Locked="false" Priority="63" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 1 Accent 5"/>

+  <w:LsdException Locked="false" Priority="64" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 2 Accent 5"/>

+  <w:LsdException Locked="false" Priority="65" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 1 Accent 5"/>

+  <w:LsdException Locked="false" Priority="66" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 2 Accent 5"/>

+  <w:LsdException Locked="false" Priority="67" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 1 Accent 5"/>

+  <w:LsdException Locked="false" Priority="68" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 2 Accent 5"/>

+  <w:LsdException Locked="false" Priority="69" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 3 Accent 5"/>

+  <w:LsdException Locked="false" Priority="70" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Dark List Accent 5"/>

+  <w:LsdException Locked="false" Priority="71" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Shading Accent 5"/>

+  <w:LsdException Locked="false" Priority="72" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful List Accent 5"/>

+  <w:LsdException Locked="false" Priority="73" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Grid Accent 5"/>

+  <w:LsdException Locked="false" Priority="60" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Shading Accent 6"/>

+  <w:LsdException Locked="false" Priority="61" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light List Accent 6"/>

+  <w:LsdException Locked="false" Priority="62" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Light Grid Accent 6"/>

+  <w:LsdException Locked="false" Priority="63" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 1 Accent 6"/>

+  <w:LsdException Locked="false" Priority="64" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Shading 2 Accent 6"/>

+  <w:LsdException Locked="false" Priority="65" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 1 Accent 6"/>

+  <w:LsdException Locked="false" Priority="66" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium List 2 Accent 6"/>

+  <w:LsdException Locked="false" Priority="67" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 1 Accent 6"/>

+  <w:LsdException Locked="false" Priority="68" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 2 Accent 6"/>

+  <w:LsdException Locked="false" Priority="69" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Medium Grid 3 Accent 6"/>

+  <w:LsdException Locked="false" Priority="70" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Dark List Accent 6"/>

+  <w:LsdException Locked="false" Priority="71" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Shading Accent 6"/>

+  <w:LsdException Locked="false" Priority="72" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful List Accent 6"/>

+  <w:LsdException Locked="false" Priority="73" SemiHidden="false"

+   UnhideWhenUsed="false" Name="Colorful Grid Accent 6"/>

+  <w:LsdException Locked="false" Priority="19" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Subtle Emphasis"/>

+  <w:LsdException Locked="false" Priority="21" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Intense Emphasis"/>

+  <w:LsdException Locked="false" Priority="31" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Subtle Reference"/>

+  <w:LsdException Locked="false" Priority="32" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Intense Reference"/>

+  <w:LsdException Locked="false" Priority="33" SemiHidden="false"

+   UnhideWhenUsed="false" QFormat="true" Name="Book Title"/>

+  <w:LsdException Locked="false" Priority="37" Name="Bibliography"/>

+  <w:LsdException Locked="false" Priority="39" QFormat="true" Name="TOC Heading"/>

+ </w:LatentStyles>

+</xml><![endif]-->

+<style>

+<!--

+ /* Font Definitions */

+ @font-face

+	{font-family:Wingdings;

+	panose-1:5 0 0 0 0 0 0 0 0 0;

+	mso-font-charset:2;

+	mso-generic-font-family:auto;

+	mso-font-pitch:variable;

+	mso-font-signature:0 268435456 0 0 -2147483648 0;}

+@font-face

+	{font-family:"MS Mincho";

+	panose-1:2 2 6 9 4 2 5 8 3 4;

+	mso-font-alt:"\FF2D\FF33 \660E\671D";

+	mso-font-charset:128;

+	mso-generic-font-family:modern;

+	mso-font-pitch:fixed;

+	mso-font-signature:-536870145 1791491579 18 0 131231 0;}

+@font-face

+	{font-family:SimSun;

+	panose-1:2 1 6 0 3 1 1 1 1 1;

+	mso-font-alt:\5B8B\4F53;

+	mso-font-charset:134;

+	mso-generic-font-family:auto;

+	mso-font-format:other;

+	mso-font-pitch:variable;

+	mso-font-signature:1 135135232 16 0 262144 0;}

+@font-face

+	{font-family:SimSun;

+	panose-1:2 1 6 0 3 1 1 1 1 1;

+	mso-font-alt:\5B8B\4F53;

+	mso-font-charset:134;

+	mso-generic-font-family:auto;

+	mso-font-format:other;

+	mso-font-pitch:variable;

+	mso-font-signature:1 135135232 16 0 262144 0;}

+@font-face

+	{font-family:Tahoma;

+	panose-1:2 11 6 4 3 5 4 4 2 4;

+	mso-font-charset:0;

+	mso-generic-font-family:swiss;

+	mso-font-pitch:variable;

+	mso-font-signature:-520081665 -1073717157 41 0 66047 0;}

+@font-face

+	{font-family:Verdana;

+	panose-1:2 11 6 4 3 5 4 4 2 4;

+	mso-font-charset:0;

+	mso-generic-font-family:swiss;

+	mso-font-pitch:variable;

+	mso-font-signature:-1593833729 1073750107 16 0 415 0;}

+@font-face

+	{font-family:"Trebuchet MS";

+	panose-1:2 11 6 3 2 2 2 2 2 4;

+	mso-font-charset:0;

+	mso-generic-font-family:swiss;

+	mso-font-pitch:variable;

+	mso-font-signature:647 0 0 0 159 0;}

+@font-face

+	{font-family:"\@SimSun";

+	panose-1:2 1 6 0 3 1 1 1 1 1;

+	mso-font-charset:134;

+	mso-generic-font-family:auto;

+	mso-font-pitch:variable;

+	mso-font-signature:3 680460288 22 0 262145 0;}

+@font-face

+	{font-family:"\@MS Mincho";

+	panose-1:2 2 6 9 4 2 5 8 3 4;

+	mso-font-charset:128;

+	mso-generic-font-family:modern;

+	mso-font-pitch:fixed;

+	mso-font-signature:-536870145 1791491579 18 0 131231 0;}

+ /* Style Definitions */

+ p.MsoNormal, li.MsoNormal, div.MsoNormal

+	{mso-style-unhide:no;

+	mso-style-qformat:yes;

+	mso-style-parent:"";

+	margin:0in;

+	margin-bottom:.0001pt;

+	mso-pagination:widow-orphan;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+h1

+	{mso-style-priority:9;

+	mso-style-unhide:no;

+	mso-style-qformat:yes;

+	mso-style-link:"Heading 1 Char";

+	mso-style-next:Normal;

+	margin-top:24.0pt;

+	margin-right:0in;

+	margin-bottom:0in;

+	margin-left:0in;

+	margin-bottom:.0001pt;

+	mso-pagination:widow-orphan lines-together;

+	page-break-after:avoid;

+	mso-outline-level:1;

+	font-size:14.0pt;

+	font-family:"Cambria","serif";

+	mso-ascii-font-family:Cambria;

+	mso-ascii-theme-font:major-latin;

+	mso-fareast-font-family:"Times New Roman";

+	mso-fareast-theme-font:major-fareast;

+	mso-hansi-font-family:Cambria;

+	mso-hansi-theme-font:major-latin;

+	mso-bidi-font-family:"Times New Roman";

+	mso-bidi-theme-font:major-bidi;

+	color:#365F91;

+	mso-themecolor:accent1;

+	mso-themeshade:191;

+	mso-font-kerning:0pt;

+	mso-bidi-font-weight:normal;}

+p.MsoCommentText, li.MsoCommentText, div.MsoCommentText

+	{mso-style-noshow:yes;

+	mso-style-priority:99;

+	mso-style-link:"Comment Text Char";

+	margin:0in;

+	margin-bottom:.0001pt;

+	mso-pagination:widow-orphan;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+p.MsoHeader, li.MsoHeader, div.MsoHeader

+	{mso-style-priority:99;

+	mso-style-link:"Header Char";

+	margin:0in;

+	margin-bottom:.0001pt;

+	mso-pagination:widow-orphan;

+	tab-stops:center 3.25in right 6.5in;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+p.MsoFooter, li.MsoFooter, div.MsoFooter

+	{mso-style-priority:99;

+	mso-style-link:"Footer Char";

+	margin:0in;

+	margin-bottom:.0001pt;

+	mso-pagination:widow-orphan;

+	tab-stops:center 3.25in right 6.5in;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+span.MsoCommentReference

+	{mso-style-noshow:yes;

+	mso-style-priority:99;

+	mso-ansi-font-size:8.0pt;

+	mso-bidi-font-size:8.0pt;}

+a:link, span.MsoHyperlink

+	{mso-style-priority:99;

+	mso-style-unhide:no;

+	font-family:"Times New Roman","serif";

+	mso-bidi-font-family:"Times New Roman";

+	color:blue;

+	text-decoration:underline;

+	text-underline:single;}

+a:visited, span.MsoHyperlinkFollowed

+	{mso-style-noshow:yes;

+	mso-style-priority:99;

+	color:purple;

+	mso-themecolor:followedhyperlink;

+	text-decoration:underline;

+	text-underline:single;}

+p.MsoCommentSubject, li.MsoCommentSubject, div.MsoCommentSubject

+	{mso-style-noshow:yes;

+	mso-style-priority:99;

+	mso-style-parent:"Comment Text";

+	mso-style-link:"Comment Subject Char";

+	mso-style-next:"Comment Text";

+	margin:0in;

+	margin-bottom:.0001pt;

+	mso-pagination:widow-orphan;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	font-weight:bold;}

+p.MsoAcetate, li.MsoAcetate, div.MsoAcetate

+	{mso-style-noshow:yes;

+	mso-style-priority:99;

+	mso-style-link:"Balloon Text Char";

+	margin:0in;

+	margin-bottom:.0001pt;

+	mso-pagination:widow-orphan;

+	font-size:8.0pt;

+	font-family:"Tahoma","sans-serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+p.MsoListParagraph, li.MsoListParagraph, div.MsoListParagraph

+	{mso-style-priority:34;

+	mso-style-unhide:no;

+	mso-style-qformat:yes;

+	margin-top:0in;

+	margin-right:0in;

+	margin-bottom:0in;

+	margin-left:.5in;

+	margin-bottom:.0001pt;

+	mso-add-space:auto;

+	mso-pagination:widow-orphan;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+p.MsoListParagraphCxSpFirst, li.MsoListParagraphCxSpFirst, div.MsoListParagraphCxSpFirst

+	{mso-style-priority:34;

+	mso-style-unhide:no;

+	mso-style-qformat:yes;

+	mso-style-type:export-only;

+	margin-top:0in;

+	margin-right:0in;

+	margin-bottom:0in;

+	margin-left:.5in;

+	margin-bottom:.0001pt;

+	mso-add-space:auto;

+	mso-pagination:widow-orphan;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+p.MsoListParagraphCxSpMiddle, li.MsoListParagraphCxSpMiddle, div.MsoListParagraphCxSpMiddle

+	{mso-style-priority:34;

+	mso-style-unhide:no;

+	mso-style-qformat:yes;

+	mso-style-type:export-only;

+	margin-top:0in;

+	margin-right:0in;

+	margin-bottom:0in;

+	margin-left:.5in;

+	margin-bottom:.0001pt;

+	mso-add-space:auto;

+	mso-pagination:widow-orphan;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+p.MsoListParagraphCxSpLast, li.MsoListParagraphCxSpLast, div.MsoListParagraphCxSpLast

+	{mso-style-priority:34;

+	mso-style-unhide:no;

+	mso-style-qformat:yes;

+	mso-style-type:export-only;

+	margin-top:0in;

+	margin-right:0in;

+	margin-bottom:0in;

+	margin-left:.5in;

+	margin-bottom:.0001pt;

+	mso-add-space:auto;

+	mso-pagination:widow-orphan;

+	font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-fareast-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+p.HeadingEULA, li.HeadingEULA, div.HeadingEULA

+	{mso-style-name:"Heading EULA";

+	mso-style-priority:99;

+	mso-style-unhide:no;

+	mso-style-next:Normal;

+	margin-top:6.0pt;

+	margin-right:0in;

+	margin-bottom:6.0pt;

+	margin-left:0in;

+	mso-pagination:widow-orphan;

+	font-size:14.0pt;

+	font-family:"Tahoma","sans-serif";

+	mso-fareast-font-family:"MS Mincho";

+	font-weight:bold;}

+span.CommentTextChar

+	{mso-style-name:"Comment Text Char";

+	mso-style-noshow:yes;

+	mso-style-priority:99;

+	mso-style-unhide:no;

+	mso-style-locked:yes;

+	mso-style-link:"Comment Text";

+	mso-ansi-font-size:10.0pt;

+	mso-bidi-font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-ascii-font-family:"Times New Roman";

+	mso-fareast-font-family:"Times New Roman";

+	mso-hansi-font-family:"Times New Roman";

+	mso-bidi-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+span.CommentSubjectChar

+	{mso-style-name:"Comment Subject Char";

+	mso-style-noshow:yes;

+	mso-style-priority:99;

+	mso-style-unhide:no;

+	mso-style-locked:yes;

+	mso-style-parent:"Comment Text Char";

+	mso-style-link:"Comment Subject";

+	mso-ansi-font-size:10.0pt;

+	mso-bidi-font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-ascii-font-family:"Times New Roman";

+	mso-fareast-font-family:"Times New Roman";

+	mso-hansi-font-family:"Times New Roman";

+	mso-bidi-font-family:"Times New Roman";

+	font-weight:bold;}

+span.BalloonTextChar

+	{mso-style-name:"Balloon Text Char";

+	mso-style-noshow:yes;

+	mso-style-priority:99;

+	mso-style-unhide:no;

+	mso-style-locked:yes;

+	mso-style-link:"Balloon Text";

+	mso-ansi-font-size:8.0pt;

+	mso-bidi-font-size:8.0pt;

+	font-family:"Tahoma","sans-serif";

+	mso-ascii-font-family:Tahoma;

+	mso-fareast-font-family:"Times New Roman";

+	mso-hansi-font-family:Tahoma;

+	mso-bidi-font-family:Tahoma;

+	mso-bidi-font-weight:bold;}

+span.Heading1Char

+	{mso-style-name:"Heading 1 Char";

+	mso-style-priority:9;

+	mso-style-unhide:no;

+	mso-style-locked:yes;

+	mso-style-link:"Heading 1";

+	mso-ansi-font-size:14.0pt;

+	mso-bidi-font-size:14.0pt;

+	font-family:"Cambria","serif";

+	mso-ascii-font-family:Cambria;

+	mso-ascii-theme-font:major-latin;

+	mso-fareast-font-family:"Times New Roman";

+	mso-fareast-theme-font:major-fareast;

+	mso-hansi-font-family:Cambria;

+	mso-hansi-theme-font:major-latin;

+	mso-bidi-font-family:"Times New Roman";

+	mso-bidi-theme-font:major-bidi;

+	color:#365F91;

+	mso-themecolor:accent1;

+	mso-themeshade:191;

+	font-weight:bold;

+	mso-bidi-font-weight:normal;}

+span.HeaderChar

+	{mso-style-name:"Header Char";

+	mso-style-priority:99;

+	mso-style-unhide:no;

+	mso-style-locked:yes;

+	mso-style-link:Header;

+	mso-ansi-font-size:10.0pt;

+	mso-bidi-font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-ascii-font-family:"Times New Roman";

+	mso-fareast-font-family:"Times New Roman";

+	mso-hansi-font-family:"Times New Roman";

+	mso-bidi-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+span.FooterChar

+	{mso-style-name:"Footer Char";

+	mso-style-priority:99;

+	mso-style-unhide:no;

+	mso-style-locked:yes;

+	mso-style-link:Footer;

+	mso-ansi-font-size:10.0pt;

+	mso-bidi-font-size:10.0pt;

+	font-family:"Times New Roman","serif";

+	mso-ascii-font-family:"Times New Roman";

+	mso-fareast-font-family:"Times New Roman";

+	mso-hansi-font-family:"Times New Roman";

+	mso-bidi-font-family:"Times New Roman";

+	mso-bidi-font-weight:bold;}

+span.SpellE

+	{mso-style-name:"";

+	mso-spl-e:yes;}

+span.GramE

+	{mso-style-name:"";

+	mso-gram-e:yes;}

+.MsoChpDefault

+	{mso-style-type:export-only;

+	mso-default-props:yes;

+	font-family:"Calibri","sans-serif";

+	mso-ascii-font-family:Calibri;

+	mso-ascii-theme-font:minor-latin;

+	mso-fareast-font-family:Calibri;

+	mso-fareast-theme-font:minor-latin;

+	mso-hansi-font-family:Calibri;

+	mso-hansi-theme-font:minor-latin;

+	mso-bidi-font-family:Arial;

+	mso-bidi-theme-font:minor-bidi;}

+.MsoPapDefault

+	{mso-style-type:export-only;

+	margin-left:.25in;

+	text-indent:-.25in;}

+ /* Page Definitions */

+ @page

+	{mso-footnote-separator:url("License_files/header.htm") fs;

+	mso-footnote-continuation-separator:url("License_files/header.htm") fcs;

+	mso-endnote-separator:url("License_files/header.htm") es;

+	mso-endnote-continuation-separator:url("License_files/header.htm") ecs;}

+@page WordSection1

+	{size:8.5in 11.0in;

+	margin:1.0in 1.25in 1.0in 1.25in;

+	mso-header-margin:.5in;

+	mso-footer-margin:.5in;

+	mso-even-header:url("License_files/header.htm") eh1;

+	mso-header:url("License_files/header.htm") h1;

+	mso-even-footer:url("License_files/header.htm") ef1;

+	mso-footer:url("License_files/header.htm") f1;

+	mso-first-header:url("License_files/header.htm") fh1;

+	mso-first-footer:url("License_files/header.htm") ff1;

+	mso-paper-source:0;}

+div.WordSection1

+	{page:WordSection1;}

+ /* List Definitions */

+ @list l0

+	{mso-list-id:72555307;

+	mso-list-type:hybrid;

+	mso-list-template-ids:-673314984 67698689 67698691 67698693 67698689 67698691 67698693 67698689 67698691 67698693;}

+@list l0:level1

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:89.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l0:level2

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:125.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l0:level3

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:161.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+@list l0:level4

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:197.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l0:level5

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:233.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l0:level6

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:269.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+@list l0:level7

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:305.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l0:level8

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:341.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l0:level9

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:377.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+@list l1

+	{mso-list-id:317072181;

+	mso-list-type:hybrid;

+	mso-list-template-ids:-799370550 -1411460628 67698713 67698715 67698703 67698713 67698715 67698703 67698713 67698715;}

+@list l1:level1

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:89.85pt;

+	text-indent:-.25in;}

+@list l1:level2

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:125.85pt;

+	text-indent:-.25in;}

+@list l1:level3

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	margin-left:161.85pt;

+	text-indent:-9.0pt;}

+@list l1:level4

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:197.85pt;

+	text-indent:-.25in;}

+@list l1:level5

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:233.85pt;

+	text-indent:-.25in;}

+@list l1:level6

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	margin-left:269.85pt;

+	text-indent:-9.0pt;}

+@list l1:level7

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:305.85pt;

+	text-indent:-.25in;}

+@list l1:level8

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:341.85pt;

+	text-indent:-.25in;}

+@list l1:level9

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	margin-left:377.85pt;

+	text-indent:-9.0pt;}

+@list l2

+	{mso-list-id:442189430;

+	mso-list-type:hybrid;

+	mso-list-template-ids:-489234706 67698689 67698691 67698693 67698689 67698691 67698693 67698689 67698691 67698693;}

+@list l2:level1

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:71.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l2:level2

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:107.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l2:level3

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:143.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+@list l2:level4

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:179.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l2:level5

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:215.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l2:level6

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:251.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+@list l2:level7

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:287.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l2:level8

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:323.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l2:level9

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:359.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+@list l3

+	{mso-list-id:952636574;

+	mso-list-type:hybrid;

+	mso-list-template-ids:-630920404 67698703 67698713 67698715 67698703 67698713 67698715 67698703 67698713 67698715;}

+@list l3:level1

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l3:level2

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l3:level3

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	text-indent:-9.0pt;}

+@list l3:level4

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l3:level5

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l3:level6

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	text-indent:-9.0pt;}

+@list l3:level7

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l3:level8

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l3:level9

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	text-indent:-9.0pt;}

+@list l4

+	{mso-list-id:2038118249;

+	mso-list-type:hybrid;

+	mso-list-template-ids:-1412671382 -1279482502 67698713 67698715 67698703 67698713 67698715 67698703 67698713 67698715;}

+@list l4:level1

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;

+	mso-ansi-font-size:8.0pt;

+	font-family:"Verdana","sans-serif";

+	mso-bidi-font-family:"Times New Roman";

+	color:black;

+	text-decoration:none;

+	text-underline:none;}

+@list l4:level2

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l4:level3

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	text-indent:-9.0pt;}

+@list l4:level4

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l4:level5

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l4:level6

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	text-indent:-9.0pt;}

+@list l4:level7

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l4:level8

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	text-indent:-.25in;}

+@list l4:level9

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	text-indent:-9.0pt;}

+@list l5

+	{mso-list-id:2083522293;

+	mso-list-type:hybrid;

+	mso-list-template-ids:-1919239184 972183006 67698713 67698715 67698703 67698713 67698715 67698703 67698713 67698715;}

+@list l5:level1

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:71.85pt;

+	text-indent:-.25in;}

+@list l5:level2

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:107.85pt;

+	text-indent:-.25in;}

+@list l5:level3

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	margin-left:143.85pt;

+	text-indent:-9.0pt;}

+@list l5:level4

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:179.85pt;

+	text-indent:-.25in;}

+@list l5:level5

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:215.85pt;

+	text-indent:-.25in;}

+@list l5:level6

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	margin-left:251.85pt;

+	text-indent:-9.0pt;}

+@list l5:level7

+	{mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:287.85pt;

+	text-indent:-.25in;}

+@list l5:level8

+	{mso-level-number-format:alpha-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:323.85pt;

+	text-indent:-.25in;}

+@list l5:level9

+	{mso-level-number-format:roman-lower;

+	mso-level-tab-stop:none;

+	mso-level-number-position:right;

+	margin-left:359.85pt;

+	text-indent:-9.0pt;}

+@list l6

+	{mso-list-id:2108503099;

+	mso-list-type:hybrid;

+	mso-list-template-ids:-225819026 67698689 67698691 67698693 67698689 67698691 67698693 67698689 67698691 67698693;}

+@list l6:level1

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:89.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l6:level2

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:125.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l6:level3

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:161.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+@list l6:level4

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:197.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l6:level5

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:233.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l6:level6

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:269.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+@list l6:level7

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0B7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:305.85pt;

+	text-indent:-.25in;

+	font-family:Symbol;}

+@list l6:level8

+	{mso-level-number-format:bullet;

+	mso-level-text:o;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:341.85pt;

+	text-indent:-.25in;

+	font-family:"Courier New";}

+@list l6:level9

+	{mso-level-number-format:bullet;

+	mso-level-text:\F0A7;

+	mso-level-tab-stop:none;

+	mso-level-number-position:left;

+	margin-left:377.85pt;

+	text-indent:-.25in;

+	font-family:Wingdings;}

+ol

+	{margin-bottom:0in;}

+ul

+	{margin-bottom:0in;}

+-->

+</style>

+<!--[if gte mso 10]>

+<style>

+ /* Style Definitions */

+ table.MsoNormalTable

+	{mso-style-name:"Table Normal";

+	mso-tstyle-rowband-size:0;

+	mso-tstyle-colband-size:0;

+	mso-style-noshow:yes;

+	mso-style-priority:99;

+	mso-style-parent:"";

+	mso-padding-alt:0in 5.4pt 0in 5.4pt;

+	mso-para-margin-top:0in;

+	mso-para-margin-right:0in;

+	mso-para-margin-bottom:0in;

+	mso-para-margin-left:.25in;

+	mso-para-margin-bottom:.0001pt;

+	text-indent:-.25in;

+	mso-pagination:widow-orphan;

+	font-size:11.0pt;

+	font-family:"Calibri","sans-serif";

+	mso-ascii-font-family:Calibri;

+	mso-ascii-theme-font:minor-latin;

+	mso-hansi-font-family:Calibri;

+	mso-hansi-theme-font:minor-latin;

+	mso-bidi-font-family:Arial;

+	mso-bidi-theme-font:minor-bidi;}

+</style>

+<![endif]--><!--[if gte mso 9]><xml>

+ <o:shapedefaults v:ext="edit" spidmax="2049"/>

+</xml><![endif]--><!--[if gte mso 9]><xml>

+ <o:shapelayout v:ext="edit">

+  <o:idmap v:ext="edit" data="1"/>

+ </o:shapelayout></xml><![endif]-->

+</head>

+

+<body lang=EN-US link=blue vlink=purple style='tab-interval:.5in'>

+

+<div class=WordSection1>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><b><span style='font-size:14.0pt;font-family:"Tahoma","sans-serif"'>MICROSOFT

+SOFTWARE LICENSE TERMS</span></b><b style='mso-bidi-font-weight:normal'><span

+style='font-size:14.0pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><b><span style='font-size:14.0pt;font-family:"Tahoma","sans-serif"'>MICROSOFT

+WINDOWS SOFTWARE DEVELOPMENT KIT FOR WINDOWS 7 and .NET FRAMEWORK 4</span></b><b

+style='mso-bidi-font-weight:normal'><span style='font-size:14.0pt;font-family:

+"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>These

+license terms are an agreement between Microsoft Corporation (or based on where

+you live, one of its affiliates) and you.&nbsp; Please read them.&nbsp; They

+apply to the software named above, which includes the media on which you

+received it, if any.&nbsp; The terms also apply to any Microsoft</span><b

+style='mso-bidi-font-weight:normal'><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>updates,<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>supplements,<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Internet-based

+services, and <o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>support

+services<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>for

+this software, unless other terms accompany those items.&nbsp; If so, those

+terms apply.</span><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>BY

+USING THE SOFTWARE, YOU ACCEPT THESE TERMS.&nbsp; IF YOU DO NOT ACCEPT THEM, DO

+NOT USE THE SOFTWARE.</span></b><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>If

+you comply with these license terms, you have the rights below.</span></b><b

+style='mso-bidi-font-weight:normal'><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+mso-font-kerning:18.0pt'>1.</span></b><b><span style='font-size:7.0pt;

+mso-font-kerning:18.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>INSTALLATION

+AND USE RIGHTS.&nbsp; </span></b><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt;mso-outline-level:2'><b style='mso-bidi-font-weight:

+normal'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>a.&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+Installation and Use.&nbsp; </span></b><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-bidi-font-weight:normal'>You may install and use any

+number of copies of the software on your devices to design, develop and test

+your programs that run on a Microsoft Windows operating system. <span

+style='mso-spacerun:yes'> </span>Further, you may install, use and/or deploy

+via a network management system or as part of a desktop image, any number of

+copies of the software on computer devices within your internal corporate

+network to design, develop and test your programs that run on a Microsoft

+Windows operating system.&nbsp; Each copy must be complete, including all

+copyright and trademark notices.&nbsp; You must require end users to agree to

+the terms that protect the software as much as these License terms.<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma'>b.</span></b><b><span

+style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Included Microsoft

+Programs.</span></b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>&nbsp;

+The software contains other Microsoft programs.&nbsp; These license terms apply

+to your use of those programs.<b> <o:p></o:p></b></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+mso-font-kerning:18.0pt'>2.</span></b><b><span style='font-size:7.0pt;

+mso-font-kerning:18.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>ADDITIONAL

+LICENSING REQUIREMENTS AND/OR USE RIGHTS.</span></b><b style='mso-bidi-font-weight:

+normal'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt;mso-outline-level:2'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma'>a.</span></b><b><span

+style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Distributable Code.</span></b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>&nbsp; The software

+contains code that you are permitted to distribute in programs you develop if

+you comply with the terms below.</span><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:53.85pt;text-indent:-17.85pt'><b><span style='font-family:"Tahoma","sans-serif"'>i.</span></b><b><span

+style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Right to Use and

+Distribute.</span></b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>&nbsp;

+The code and text files listed below are “Distributable Code.”</span><b

+style='mso-bidi-font-weight:normal'><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><u><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>REDIST.TXT Files</span></u><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>.&nbsp; You may copy

+and distribute the object code form of code listed in REDIST.TXT files, plus

+any files listed on the REDIST list located at </span><a

+href="http://go.microsoft.com/fwlink/?LinkID=185268&amp;clcid=0x409">http://go.microsoft.com/fwlink/?LinkID=185268&amp;clcid=0x409</a>.</p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:1.0in;text-indent:-.25in'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><u><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Sample

+Code</span></u><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>.&nbsp;

+You may modify, copy, and distribute the source and object code form of code

+marked as “sample.”<o:p></o:p></span></p>

+

+<p class=MsoListParagraph style='margin-top:6.0pt;margin-right:0in;margin-bottom:

+6.0pt;margin-left:1.0in;mso-add-space:auto;text-indent:-.25in;mso-list:l6 level1 lfo3'><![if !supportLists]><span

+style='font-size:9.5pt;font-family:Symbol;mso-fareast-font-family:Symbol;

+mso-bidi-font-family:Symbol'><span style='mso-list:Ignore'>·<span

+style='font:7.0pt "Times New Roman"'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span></span></span><![endif]><u><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif"'>Sample Code for Microsoft Bing Maps AJAX Control</span></u><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>.<span

+style='mso-spacerun:yes'>  </span>The software contains sample code that makes

+use of the Bing Maps AJAX Control.<span style='mso-spacerun:yes'>  </span>Your

+use and access of the Bing Maps AJAX Control is subject to the “Microsoft Bing

+Maps Platform API’s Terms of Use” which is located at:<span

+style='mso-spacerun:yes'>  </span></span><a

+href="http://go.microsoft.com/fwlink/?LinkID=185267&amp;clcid=0x409">http://go.microsoft.com/fwlink/?LinkID=185267&amp;clcid=0x409</a><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>.<span

+style='mso-spacerun:yes'>  </span><o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><u><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Microsoft Merge

+Modules</span></u><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>.&nbsp;

+You may copy and distribute the unmodified output of Microsoft Merge Modules.<u><o:p></o:p></u></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><u><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Third Party

+Distribution</span></u><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>.&nbsp;

+You may permit distributors of your programs to copy and distribute the

+Distributable Code as part of those programs.<u><o:p></o:p></u></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:53.85pt;text-indent:-17.85pt'><b><span style='font-family:"Tahoma","sans-serif"'>ii.</span></b><b><span

+style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Distribution

+Requirements</span></b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>.&nbsp;

+For any Distributable Code you distribute, you must</span><b style='mso-bidi-font-weight:

+normal'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>add significant

+primary functionality to it in your programs;<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>for any Distributable

+Code having a filename extension of .lib, distribute only the results of

+running such Distributable Code through a linker with your application;<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>distribute

+Distributable Code included in a setup program only as part of that setup

+program without modification;<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>require distributors

+and external end users to agree to terms that protect it at least as much as

+this agreement; <o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>display your valid

+copyright notice on your programs; <o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>for Distributable

+Code from the Windows Media Services SDK portions of the software, include in

+your program’s Help-About box (or in another obvious place if there is no box)

+the following copyright notice:&nbsp; “Portions utilize Microsoft Windows Media

+Technologies.&nbsp; Copyright (c) 2006 Microsoft Corporation.&nbsp; All Rights

+Reserved”; and<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>indemnify, defend,

+and hold harmless Microsoft from any claims, including attorneys’ fees, related

+to the distribution or use of your programs.<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:53.85pt;text-indent:-17.85pt'><b><span style='font-family:"Tahoma","sans-serif"'>iii.</span></b><b><span

+style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Distribution

+Restrictions.&nbsp; </span></b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>You

+may not</span><b style='mso-bidi-font-weight:normal'><span style='font-size:

+9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>alter any copyright,

+trademark or patent notice in the Distributable Code; <o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>use Microsoft’s

+trademarks in your programs’ names or in a way that suggests your programs come

+from or are endorsed by Microsoft; <o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>distribute

+Distributable Code to run on a platform other than the Windows platform;<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>include Distributable

+Code in malicious, deceptive or unlawful programs; or<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:71.75pt;text-indent:-17.9pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>modify or distribute

+the source code of any Distributable Code so that any part of it becomes

+subject to an Excluded License.&nbsp; An Excluded License is one that requires,

+as a condition of use, modification or distribution, that<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:89.6pt;text-indent:-17.85pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>the code be disclosed

+or distributed in source code form; or <o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:89.6pt;text-indent:-17.85pt'><span style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:

+7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>others have the right

+to modify it.<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt;mso-outline-level:2'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma'>b.</span></b><b><span

+style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Additional

+Functionality.&nbsp; </span></b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Microsoft

+may provide additional functionality for the software.&nbsp; Other license

+terms and fees may apply.</span><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+mso-font-kerning:18.0pt'>3.</span></b><b><span style='font-size:7.0pt;

+mso-font-kerning:18.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>INTERNET-BASED

+SERVICES.&nbsp; </span></b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-font-kerning:18.0pt'>Microsoft provides Internet-based services with the

+software.&nbsp; It may change or cancel them at any time. You may not use this

+service in any way that could harm it or impair anyone else’s use of it.&nbsp;

+You may not use the service to try to gain unauthorized access to any service,

+data, account or network by any means.</span><b style='mso-bidi-font-weight:

+normal'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+mso-font-kerning:18.0pt'>4.</span></b><b><span style='font-size:7.0pt;

+mso-font-kerning:18.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";text-transform:uppercase;

+mso-font-kerning:18.0pt'>Scope of License</span></b><b><span style='font-size:

+9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>.</span></b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>&nbsp;

+The software is licensed, not sold. This agreement only gives you some rights

+to use the software.&nbsp; Microsoft reserves all other rights.&nbsp; Unless

+applicable law gives you more rights despite this limitation, you may use the

+software only as expressly permitted in this agreement.&nbsp; In doing so, you

+must comply with any technical limitations in the software that only allow you

+to use it in certain ways.&nbsp; For more information, see </span><a

+href="http://www.microsoft.com/licensing/userights"><span style='font-size:

+9.5pt;mso-font-kerning:18.0pt'>www.microsoft.com/licensing/userights</span></a><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>.&nbsp;

+You may not</span><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>work

+around any technical limitations in the software;<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>reverse

+engineer, decompile or disassemble the software, except and only to the extent

+that applicable law expressly permits, despite this limitation;<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>make

+more copies of the software than specified in this agreement or allowed by

+applicable law, despite this limitation;<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>publish

+the software for others to copy;<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>rent,

+lease or lend the software; or<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>use the software

+for commercial software hosting services.<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-pagination:none;mso-outline-level:

+1;tab-stops:list .25in'><b><span style='font-family:"Tahoma","sans-serif";

+mso-fareast-font-family:SimSun'>5.<span style='mso-tab-count:1'>   </span>BACKUP

+COPY.</span></b><span style='font-family:"Tahoma","sans-serif";mso-fareast-font-family:

+SimSun;mso-bidi-font-weight:normal'> You may make one backup copy of the

+software. You may use it only to reinstall the software.</span><b><span

+style='font-family:"Tahoma","sans-serif";mso-fareast-font-family:SimSun'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+mso-font-kerning:18.0pt'>6.</span></b><b><span style='font-size:7.0pt;

+mso-font-kerning:18.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>DOCUMENTATION.</span></b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>&nbsp;

+Any person that has valid access to your computer or internal network may copy

+and use the documentation for your internal, reference purposes.</span><b

+style='mso-bidi-font-weight:normal'><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+mso-font-kerning:18.0pt'>7.</span></b><b><span style='font-size:7.0pt;

+mso-font-kerning:18.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>TRANSFER

+TO A THIRD PARTY.&nbsp; </span></b><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-font-kerning:18.0pt'>The first user of the software

+may transfer it, and this agreement, directly to a third party.&nbsp; Before

+the transfer, that party must agree that this agreement applies to the transfer

+and use of the software.&nbsp; The first user must uninstall the software

+before transferring it separately from the device.&nbsp; The first user may not

+retain any copies.</span><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";color:black;mso-themecolor:text1;

+mso-font-kerning:18.0pt'>8.</span></b><b><span style='font-size:7.0pt;

+mso-bidi-font-size:10.0pt;color:black;mso-themecolor:text1;mso-font-kerning:

+18.0pt'>&nbsp; </span></b><b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+text-transform:uppercase;mso-font-kerning:18.0pt'>Export Restrictions</span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>.</span></b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>&nbsp;

+The software is subject to United States export laws and regulations.&nbsp; You

+must comply with all domestic and international export laws and regulations

+that apply to the software.&nbsp; These laws include restrictions on

+destinations, end users and end use.&nbsp; For additional information, see </span><a

+href="http://www.microsoft.com/exporting"><span style='font-size:9.5pt;

+mso-font-kerning:18.0pt'>www.microsoft.com/exporting</span></a><u><span

+style='font-size:9.5pt;color:blue;mso-font-kerning:18.0pt'>.</span></u><b

+style='mso-bidi-font-weight:normal'><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+mso-font-kerning:18.0pt'>9.</span></b><b><span style='font-size:7.0pt;

+mso-font-kerning:18.0pt'>&nbsp; </span></b><b><span style='font-size:9.5pt;

+font-family:"Tahoma","sans-serif";text-transform:uppercase;mso-font-kerning:

+18.0pt'>SUPPORT SERVICES.</span></b><b><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-font-kerning:18.0pt'> </span></b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>Because

+this software is “as is,” we may not provide support services for it.</span><b

+style='mso-bidi-font-weight:normal'><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+mso-font-kerning:18.0pt'>10.</span></b><b><span style='font-size:7.0pt;

+mso-font-kerning:18.0pt'>&nbsp; </span></b><b><span style='font-size:9.5pt;

+font-family:"Tahoma","sans-serif";text-transform:uppercase;mso-font-kerning:

+18.0pt'>Entire Agreement.</span></b><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-font-kerning:18.0pt'>&nbsp; This agreement, and the

+terms for supplements, updates, Internet-based services and support services

+that you use, are the entire agreement for the software and support services.</span><b

+style='mso-bidi-font-weight:normal'><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.25in;text-indent:-.25in;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+color:black;mso-font-kerning:18.0pt'>11.</span></b><b><span style='font-size:

+7.0pt;color:black;mso-font-kerning:18.0pt'>&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";color:black;

+text-transform:uppercase;mso-font-kerning:18.0pt'>Applicable Law</span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";color:black;

+mso-font-kerning:18.0pt'>.</span></b><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt;mso-outline-level:2'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma'>a.</span></b><b><span

+style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>United States.</span></b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>&nbsp; If you

+acquired the software in the United States, Washington state law governs the

+interpretation of this agreement and applies to claims for breach of it,

+regardless of conflict of laws principles.&nbsp; The laws of the state where

+you live govern all other claims, including claims under state consumer protection

+laws, unfair competition laws, and in tort.</span><b style='mso-bidi-font-weight:

+normal'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt;mso-outline-level:2'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma'>b.</span></b><b><span

+style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; </span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Outside the United

+States.</span></b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>&nbsp;

+If you acquired the software in any other country, the laws of that country

+apply.</span><b style='mso-bidi-font-weight:normal'><span style='font-size:

+9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+text-transform:uppercase;mso-font-kerning:18.0pt'>12.</span></b><b><span

+style='font-size:7.0pt;text-transform:uppercase;mso-font-kerning:18.0pt'>&nbsp;

+</span></b><b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+text-transform:uppercase;mso-font-kerning:18.0pt'>Legal Effect.</span></b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>&nbsp;

+This agreement describes certain legal rights.&nbsp; You may have other rights

+under the laws of your country.&nbsp; You may also have rights with respect to

+the party from whom you acquired the software.&nbsp; This agreement does not

+change your rights under the laws of your country if the laws of your country

+do not permit it to do so.</span><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt;text-indent:-17.85pt;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+text-transform:uppercase;mso-font-kerning:18.0pt'>13.</span></b><b><span

+style='font-size:7.0pt;text-transform:uppercase;mso-font-kerning:18.0pt'>&nbsp;

+</span></b><b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+text-transform:uppercase;mso-font-kerning:18.0pt'>Disclaimer of Warranty.</span></b><b><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'>&nbsp;&nbsp;

+<span style='text-transform:uppercase'>The software is licensed “as-is.”&nbsp;

+You bear the risk of using it.&nbsp; Microsoft gives no express warranties,

+guarantees or conditions.&nbsp; You may have additional consumer rights under

+your local laws which this agreement cannot change.&nbsp; To the extent

+permitted under your local laws, Microsoft excludes the implied warranties of

+merchantability, fitness for a particular purpose and non-infringement.</span></span></b><b

+style='mso-bidi-font-weight:normal'><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.25in;text-indent:-.25in;mso-outline-level:1'><b><span

+style='font-family:"Trebuchet MS","sans-serif";mso-bidi-font-family:Tahoma;

+text-transform:uppercase;mso-font-kerning:18.0pt'>14.</span></b><b><span

+style='font-size:7.0pt;text-transform:uppercase;mso-font-kerning:18.0pt'>&nbsp;

+</span></b><b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+text-transform:uppercase;mso-font-kerning:18.0pt'>Limitation on and Exclusion

+of Remedies and Damages.&nbsp; You can recover from Microsoft and its suppliers

+only direct damages up to U.S. $5.00.&nbsp; You cannot recover any other

+damages, including consequential, lost profits, special, indirect or incidental

+damages.</span></b><b style='mso-bidi-font-weight:normal'><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-font-kerning:18.0pt'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:17.85pt'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>This

+limitation applies to<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>anything

+related to the software, services, content (including code) on third party

+Internet sites, or third party programs; and<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span style='font-size:9.5pt;font-family:

+Symbol;mso-bidi-font-family:Tahoma'>·</span><span style='font-size:7.0pt'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>claims

+for breach of contract, breach of warranty, guarantee or condition, strict

+liability, negligence, or other tort to the extent permitted by applicable law.<o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.25in'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>It

+also applies even if Microsoft knew or should have known about the possibility

+of the damages.&nbsp; The above limitation or exclusion may not apply to you

+because your country may not allow the exclusion or limitation of incidental,

+consequential or other damages.<o:p></o:p></span></p>

+

+<p class=MsoNormal><b><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'>Please

+note: As this software is distributed in Quebec, Canada, some of the clauses in

+this agreement are provided below in French.</span></b><b style='mso-bidi-font-weight:

+normal'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:12.0pt'><b><span lang=FR style='font-size:

+9.5pt;font-family:"Tahoma","sans-serif";mso-ansi-language:FR'>Remarque : Ce

+logiciel étant distribué au Québec, Canada, certaines des clauses dans ce

+contrat sont fournies ci-dessous en français.</span></b><b style='mso-bidi-font-weight:

+normal'><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></b></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><b><span lang=FR style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-ansi-language:FR'>EXONÉRATION DE GARANTIE.</span></b><span lang=FR

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-ansi-language:

+FR'> Le logiciel visé par une licence est offert « tel quel ». Toute

+utilisation de ce logiciel est à votre seule risque et péril. Microsoft

+n’accorde aucune autre garantie expresse. Vous pouvez bénéficier de droits

+additionnels en vertu du droit local sur la protection dues consommateurs, que

+ce contrat ne peut modifier. La ou elles sont permises par le droit locale, les

+garanties implicites de qualité marchande, d’adéquation à un usage particulier

+et d’absence de contrefaçon sont exclues.</span><span style='font-size:9.5pt;

+font-family:"Tahoma","sans-serif"'><o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><b><span lang=FR style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-ansi-language:FR'>LIMITATION DES DOMMAGES-INTÉRÊTS ET EXCLUSION DE

+RESPONSABILITÉ POUR LES DOMMAGES.</span></b><span lang=FR style='font-size:

+9.5pt;font-family:"Tahoma","sans-serif";mso-ansi-language:FR'>&nbsp; Vous

+pouvez obtenir de Microsoft et de ses fournisseurs une indemnisation en cas de

+dommages directs uniquement à hauteur de 5,00 $ US. Vous ne pouvez prétendre à

+aucune indemnisation pour les autres dommages, y compris les dommages spéciaux,

+indirects ou accessoires et pertes de bénéfices.</span><span style='font-size:

+9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><span class=SpellE><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif"'>Cette</span></span><span style='font-size:9.5pt;

+font-family:"Tahoma","sans-serif"'> limitation <span class=SpellE><span

+class=GramE>concerne</span></span><span class=GramE> :</span><o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-.25in'><span lang=FR style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma;mso-ansi-language:FR'>·</span><span

+lang=FR style='font-size:7.0pt;mso-ansi-language:FR'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span class=GramE><span lang=FR style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-ansi-language:FR'>tout</span></span><span lang=FR style='font-size:9.5pt;

+font-family:"Tahoma","sans-serif";mso-ansi-language:FR'>&nbsp; ce qui est relié

+au logiciel, aux services ou au contenu (y compris le code) figurant sur des

+sites Internet tiers ou dans des programmes tiers ; et</span><span

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:.5in;text-indent:-18.15pt'><span lang=FR style='font-size:9.5pt;

+font-family:Symbol;mso-bidi-font-family:Tahoma;mso-ansi-language:FR'>·</span><span

+lang=FR style='font-size:7.0pt;mso-ansi-language:FR'>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;

+</span><span class=GramE><span lang=FR style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-ansi-language:FR'>les</span></span><span lang=FR style='font-size:9.5pt;

+font-family:"Tahoma","sans-serif";mso-ansi-language:FR'> réclamations au titre

+de violation de contrat ou de garantie, ou au titre de responsabilité stricte,

+de négligence ou d’une autre faute dans la limite autorisée par la loi en

+vigueur.</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><span lang=FR style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-ansi-language:FR'>Elle s’applique également, même si Microsoft connaissait

+ou devrait connaître l’éventualité d’un tel dommage.&nbsp; Si votre pays

+n’autorise pas l’exclusion ou la limitation de responsabilité pour les dommages

+indirects, accessoires ou de quelque nature que ce soit, il se peut que la

+limitation ou l’exclusion ci-dessus ne <span class=GramE>s’appliquera</span>

+pas à votre égard.</span><span style='font-size:9.5pt;font-family:"Tahoma","sans-serif"'><o:p></o:p></span></p>

+

+<p class=MsoNormal style='margin-top:6.0pt;margin-right:0in;margin-bottom:6.0pt;

+margin-left:0in'><b><span lang=FR style='font-size:9.5pt;font-family:"Tahoma","sans-serif";

+mso-ansi-language:FR'>EFFET JURIDIQUE.</span></b><span lang=FR

+style='font-size:9.5pt;font-family:"Tahoma","sans-serif";mso-ansi-language:

+FR'>&nbsp; Le présent contrat décrit certains droits juridiques. Vous pourriez

+avoir d’autres droits prévus par les lois de votre pays.&nbsp; Le présent

+contrat ne modifie pas les droits que vous confèrent les lois de votre pays si

+celles ci ne le permettent pas.</span><span style='font-size:9.5pt;font-family:

+"Tahoma","sans-serif"'><o:p></o:p></span></p>

+

+<p class=MsoNormal><o:p>&nbsp;</o:p></p>

+

+<p class=HeadingEULA><span lang=FR style='mso-ansi-language:FR;font-weight:

+normal'><o:p>&nbsp;</o:p></span></p>

+

+<p class=HeadingEULA><span lang=FR style='mso-ansi-language:FR'><o:p>&nbsp;</o:p></span></p>

+

+<p class=MsoNormal><o:p>&nbsp;</o:p></p>

+

+</div>

+

+</body>

+

+</html>

diff --git a/License/Redist.txt b/License/Redist.txt
new file mode 100644
index 0000000..d9513bd
--- /dev/null
+++ b/License/Redist.txt
@@ -0,0 +1,99 @@
+Windows Software Development Kit Redistributable Code

+=====================================================

+The following list is a list of files available with the Microsoft Windows SDK for Windows 7 and .NET Framework 4 for redistribution under the Windows SDK license.  If the Microsoft software you have licensed is not the Windows SDK, only the files that are installed by the Microsoft software may be redistributed under such license.

+

+

+

+Static LIB files

+================

+Subject to the license terms for the software, the .lib files under the following directories may be distributed unmodified when built as part of your application:

+

+	\Program Files\Microsoft SDKs\Windows\v7.1\lib, 

+	\Program Files\Microsoft SDKs\Windows\v7.1\lib\x64 or 

+	\Program Files\Microsoft SDKs\Windows\v7.1\lib\ia64

+

+

+

+Windows SDK Binaries

+=====================================

+Subject to the license terms for the software, the following files may be distributed 

+unmodified:

+

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\Mage.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\MageUI.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\Resgen.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\IA64\Mage.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\IA64\MageUI.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\x64\Mage.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\x64\MageUI.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\NETFX 4.0 Tools\Mage.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\NETFX 4.0 Tools\MageUI.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\NETFX 4.0 Tools\Resgen.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\NETFX 4.0 Tools\IA64\Mage.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\NETFX 4.0 Tools\IA64\MageUI.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\NETFX 4.0 Tools\X64\Mage.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\bin\NETFX 4.0 Tools\X64\MageUI.exe

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\x86\sas.dll

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\amd64\sas.dll

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\ia64\sas.dll

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Application Verifier\ApplicationVerifier.x86.msi

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Application Verifier\ApplicationVerifier.amd64.msi

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Application Verifier\ApplicationVerifier.ia64.msi

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Debugging Tools for Windows\dbg_x86.msi

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Debugging Tools for Windows\dbg_amd64.msi

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Debugging Tools for Windows\dbg_ia64.msi

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Windows Performance Toolkit\wpt_ia64.msi

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Windows Performance Toolkit\wpt_x64.msi

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\Windows Performance Toolkit\wpt_x86.msi

+

+

+.NET Framework

+=====================================

+

+	.NET Framework 3.5

+	==================

+	Subject to the license terms for the software, the following .EXE files may be redistributed unmodified:

+	dotNetFx35setup.exe

+

+Please note that the file listed above is not included with the software. You can obtain copies of the file from Microsoft Downloads (http://www.microsoft.com/downloads). 

+

+

+	.NET Framework 4

+	==================

+	Subject to the license terms for the software, the following .EXE files may be redistributed unmodified:

+	dotNetFx40_Client_x86_x64.exe

+	dotNetFx40_Full_x86_x64.exe

+	dotNetFx40_Client_x86.exe

+	dotNetFx40_Full_x86.exe

+	dotNetFx40_Full_x86_ia64.exe

+	dotNetFx40_Client_setup.exe

+	dotNetFx40_Full_setup.exe

+

+Please note that the last 7 files listed above are not included with the software. You can obtain copies of those files from http://go.microsoft.com/fwlink/?LinkId=185911.

+

+Please note that the Language Packs listed below are not included with the software. However, you may  redistribute, unmodified, the individual language pack versions of the following files: You may obtain copies of those files from http://go.microsoft.com/fwlink/?LinkId=185911.

+

+	dotNetFx40LP_Full_x86_x64<Culture>.exe

+	dotNetFx40LP_Full_x86_ia64<Culture>.exe

+	dotNetFx40LP_Full_x86<Culture>.exe

+	dotNetFx40LP_Client_x86_x64<Culture>.exe

+	dotNetFx40LP_Client_x86<Culture>.exe

+

+Note: <Culture> represents the specific language identifier.  Language Packs are available for the following (listed here with their associated identifier code):

+

+Arabic (ar), Chinese-Taiwan (zh-cht), Czech (cs), Danish (da), German (de), Greek (el), Finnish (fi), French (fr), Hebrew (he), Hungarian (hu), Italian (it), Japanese (ja), Korean (ko), Dutch-Netherlands (nl), Norwegian (no), Polish (pl), Portuguese-Brazil (pt-BR), Russian (ru), Swedish (sv), Turkish (tr), Chinese (zh-chs), Portuguese-Portugal (pt-PT), Spanish (es)

+

+

+Visual C++ Compiler Redist files

+=====================================

+Subject to the license terms for the software, you may redistribute the files listed below unmodified as a part of your installation package:

+

+	\Program Files\Microsoft SDKs\Windows\v7.1\Redist\VC

+		vcredist_ia64.exe

+		vcredist_x64.exe

+		vcredist_x86.exe

+

+

+

+

+

diff --git a/Samples/multimedia/directshow/baseclasses/amextra.cpp b/Samples/multimedia/directshow/baseclasses/amextra.cpp
new file mode 100644
index 0000000..af0de96
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/amextra.cpp
@@ -0,0 +1,111 @@
+//------------------------------------------------------------------------------

+// File: AMExtra.cpp

+//

+// Desc: DirectShow base classes - implements CRenderedInputPin class.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+#include <streams.h>        // DirectShow base class definitions

+#include <mmsystem.h>       // Needed for definition of timeGetTime

+#include <limits.h>         // Standard data type limit definitions

+#include <measure.h>        // Used for time critical log functions

+

+#include "amextra.h"

+

+#pragma warning(disable:4355)

+

+//  Implements CRenderedInputPin class

+

+CRenderedInputPin::CRenderedInputPin(__in_opt LPCTSTR pObjectName,

+                                     __in CBaseFilter *pFilter,

+                                     __in CCritSec *pLock,

+                                     __inout HRESULT *phr,

+                                     __in_opt LPCWSTR pName) :

+    CBaseInputPin(pObjectName, pFilter, pLock, phr, pName),

+    m_bAtEndOfStream(FALSE),

+    m_bCompleteNotified(FALSE)

+{

+}

+#ifdef UNICODE

+CRenderedInputPin::CRenderedInputPin(__in_opt LPCSTR pObjectName,

+                                     __in CBaseFilter *pFilter,

+                                     __in CCritSec *pLock,

+                                     __inout HRESULT *phr,

+                                     __in_opt LPCWSTR pName) :

+    CBaseInputPin(pObjectName, pFilter, pLock, phr, pName),

+    m_bAtEndOfStream(FALSE),

+    m_bCompleteNotified(FALSE)

+{

+}

+#endif

+

+// Flush end of stream condition - caller should do any

+// necessary stream level locking before calling this

+

+STDMETHODIMP CRenderedInputPin::EndOfStream()

+{

+    HRESULT hr = CheckStreaming();

+

+    //  Do EC_COMPLETE handling for rendered pins

+    if (S_OK == hr  && !m_bAtEndOfStream) {

+        m_bAtEndOfStream = TRUE;

+        FILTER_STATE fs;

+        EXECUTE_ASSERT(SUCCEEDED(m_pFilter->GetState(0, &fs)));

+        if (fs == State_Running) {

+            DoCompleteHandling();

+        }

+    }

+    return hr;

+}

+

+

+// Called to complete the flush

+

+STDMETHODIMP CRenderedInputPin::EndFlush()

+{

+    CAutoLock lck(m_pLock);

+

+    // Clean up renderer state

+    m_bAtEndOfStream = FALSE;

+    m_bCompleteNotified = FALSE;

+

+    return CBaseInputPin::EndFlush();

+}

+

+

+// Notify of Run() from filter

+

+HRESULT CRenderedInputPin::Run(REFERENCE_TIME tStart)

+{

+    UNREFERENCED_PARAMETER(tStart);

+    m_bCompleteNotified = FALSE;

+    if (m_bAtEndOfStream) {

+        DoCompleteHandling();

+    }

+    return S_OK;

+}

+

+

+//  Clear status on going into paused state

+

+HRESULT CRenderedInputPin::Active()

+{

+    m_bAtEndOfStream = FALSE;

+    m_bCompleteNotified = FALSE;

+    return CBaseInputPin::Active();

+}

+

+

+//  Do stuff to deliver end of stream

+

+void CRenderedInputPin::DoCompleteHandling()

+{

+    ASSERT(m_bAtEndOfStream);

+    if (!m_bCompleteNotified) {

+        m_bCompleteNotified = TRUE;

+        m_pFilter->NotifyEvent(EC_COMPLETE, S_OK, (LONG_PTR)(IBaseFilter *)m_pFilter);

+    }

+}

+

diff --git a/Samples/multimedia/directshow/baseclasses/amextra.h b/Samples/multimedia/directshow/baseclasses/amextra.h
new file mode 100644
index 0000000..5a861bf
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/amextra.h
@@ -0,0 +1,56 @@
+//------------------------------------------------------------------------------

+// File: AMExtra.h

+//

+// Desc: DirectShow base classes.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+#ifndef __AMEXTRA__

+#define __AMEXTRA__

+

+// Simple rendered input pin

+//

+// NOTE if your filter queues stuff before rendering then it may not be

+// appropriate to use this class

+//

+// In that case queue the end of stream condition until the last sample

+// is actually rendered and flush the condition appropriately

+

+class CRenderedInputPin : public CBaseInputPin

+{

+public:

+

+    CRenderedInputPin(__in_opt LPCTSTR pObjectName,

+                      __in CBaseFilter *pFilter,

+                      __in CCritSec *pLock,

+                      __inout HRESULT *phr,

+                      __in_opt LPCWSTR pName);

+#ifdef UNICODE

+    CRenderedInputPin(__in_opt LPCSTR pObjectName,

+                      __in CBaseFilter *pFilter,

+                      __in CCritSec *pLock,

+                      __inout HRESULT *phr,

+                      __in_opt LPCWSTR pName);

+#endif

+    

+    // Override methods to track end of stream state

+    STDMETHODIMP EndOfStream();

+    STDMETHODIMP EndFlush();

+

+    HRESULT Active();

+    HRESULT Run(REFERENCE_TIME tStart);

+

+protected:

+

+    // Member variables to track state

+    BOOL m_bAtEndOfStream;      // Set by EndOfStream

+    BOOL m_bCompleteNotified;   // Set when we notify for EC_COMPLETE

+

+private:

+    void DoCompleteHandling();

+};

+

+#endif // __AMEXTRA__

+

diff --git a/Samples/multimedia/directshow/baseclasses/amfilter.cpp b/Samples/multimedia/directshow/baseclasses/amfilter.cpp
new file mode 100644
index 0000000..03c13d1
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/amfilter.cpp
@@ -0,0 +1,5358 @@
+//------------------------------------------------------------------------------

+// File: AMFilter.cpp

+//

+// Desc: DirectShow base classes - implements class hierarchy for streams

+//       architecture.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+//=====================================================================

+//=====================================================================

+// The following classes are declared in this header:

+//

+//

+// CBaseMediaFilter            Basic IMediaFilter support (abstract class)

+// CBaseFilter                 Support for IBaseFilter (incl. IMediaFilter)

+// CEnumPins                   Enumerate input and output pins

+// CEnumMediaTypes             Enumerate the preferred pin formats

+// CBasePin                    Abstract base class for IPin interface

+//    CBaseOutputPin           Adds data provider member functions

+//    CBaseInputPin            Implements IMemInputPin interface

+// CMediaSample                Basic transport unit for IMemInputPin

+// CBaseAllocator              General list guff for most allocators

+//    CMemAllocator            Implements memory buffer allocation

+//

+//=====================================================================

+//=====================================================================

+

+#include <streams.h>

+#include <strsafe.h>

+

+#ifdef DXMPERF

+#include "dxmperf.h"

+#endif // DXMPERF

+

+

+//=====================================================================

+// Helpers

+//=====================================================================

+STDAPI CreateMemoryAllocator(__deref_out IMemAllocator **ppAllocator)

+{

+    return CoCreateInstance(CLSID_MemoryAllocator,

+                            0,

+                            CLSCTX_INPROC_SERVER,

+                            IID_IMemAllocator,

+                            (void **)ppAllocator);

+}

+

+//  Put this one here rather than in ctlutil.cpp to avoid linking

+//  anything brought in by ctlutil.cpp

+STDAPI CreatePosPassThru(

+    __in_opt LPUNKNOWN pAgg,

+    BOOL bRenderer,

+    IPin *pPin,

+    __deref_out IUnknown **ppPassThru

+)

+{

+    *ppPassThru = NULL;

+    IUnknown *pUnkSeek;

+    HRESULT hr = CoCreateInstance(CLSID_SeekingPassThru,

+                                  pAgg,

+                                  CLSCTX_INPROC_SERVER,

+                                  IID_IUnknown,

+                                  (void **)&pUnkSeek

+                                 );

+    if (FAILED(hr)) {

+        return hr;

+    }

+

+    ISeekingPassThru *pPassThru;

+    hr = pUnkSeek->QueryInterface(IID_ISeekingPassThru, (void**)&pPassThru);

+    if (FAILED(hr)) {

+        pUnkSeek->Release();

+        return hr;

+    }

+    hr = pPassThru->Init(bRenderer, pPin);

+    pPassThru->Release();

+    if (FAILED(hr)) {

+        pUnkSeek->Release();

+        return hr;

+    }

+    *ppPassThru = pUnkSeek;

+    return S_OK;

+}

+

+

+

+#define CONNECT_TRACE_LEVEL 3

+

+//=====================================================================

+//=====================================================================

+// Implements CBaseMediaFilter

+//=====================================================================

+//=====================================================================

+

+

+/* Constructor */

+

+CBaseMediaFilter::CBaseMediaFilter(__in_opt LPCTSTR pName,

+                   __inout_opt LPUNKNOWN    pUnk,

+                   __in CCritSec *pLock,

+                   REFCLSID clsid) :

+    CUnknown(pName, pUnk),

+    m_pLock(pLock),

+    m_clsid(clsid),

+    m_State(State_Stopped),

+    m_pClock(NULL)

+{

+}

+

+

+/* Destructor */

+

+CBaseMediaFilter::~CBaseMediaFilter()

+{

+    // must be stopped, but can't call Stop here since

+    // our critsec has been destroyed.

+

+    /* Release any clock we were using */

+

+    if (m_pClock) {

+        m_pClock->Release();

+        m_pClock = NULL;

+    }

+}

+

+

+/* Override this to say what interfaces we support and where */

+

+STDMETHODIMP

+CBaseMediaFilter::NonDelegatingQueryInterface(

+    REFIID riid,

+    __deref_out void ** ppv)

+{

+    if (riid == IID_IMediaFilter) {

+        return GetInterface((IMediaFilter *) this, ppv);

+    } else if (riid == IID_IPersist) {

+        return GetInterface((IPersist *) this, ppv);

+    } else {

+        return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+/* Return the filter's clsid */

+STDMETHODIMP

+CBaseMediaFilter::GetClassID(__out CLSID *pClsID)

+{

+    CheckPointer(pClsID,E_POINTER);

+    ValidateReadWritePtr(pClsID,sizeof(CLSID));

+    *pClsID = m_clsid;

+    return NOERROR;

+}

+

+/* Override this if your state changes are not done synchronously */

+

+STDMETHODIMP

+CBaseMediaFilter::GetState(DWORD dwMSecs, __out FILTER_STATE *State)

+{

+    UNREFERENCED_PARAMETER(dwMSecs);

+    CheckPointer(State,E_POINTER);

+    ValidateReadWritePtr(State,sizeof(FILTER_STATE));

+

+    *State = m_State;

+    return S_OK;

+}

+

+

+/* Set the clock we will use for synchronisation */

+

+STDMETHODIMP

+CBaseMediaFilter::SetSyncSource(__inout_opt IReferenceClock *pClock)

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    // Ensure the new one does not go away - even if the same as the old

+    if (pClock) {

+        pClock->AddRef();

+    }

+

+    // if we have a clock, release it

+    if (m_pClock) {

+        m_pClock->Release();

+    }

+

+    // Set the new reference clock (might be NULL)

+    // Should we query it to ensure it is a clock?  Consider for a debug build.

+    m_pClock = pClock;

+

+    return NOERROR;

+}

+

+/* Return the clock we are using for synchronisation */

+STDMETHODIMP

+CBaseMediaFilter::GetSyncSource(__deref_out_opt IReferenceClock **pClock)

+{

+    CheckPointer(pClock,E_POINTER);

+    ValidateReadWritePtr(pClock,sizeof(IReferenceClock *));

+    CAutoLock cObjectLock(m_pLock);

+

+    if (m_pClock) {

+        // returning an interface... addref it...

+        m_pClock->AddRef();

+    }

+    *pClock = (IReferenceClock*)m_pClock;

+    return NOERROR;

+}

+

+

+/* Put the filter into a stopped state */

+

+STDMETHODIMP

+CBaseMediaFilter::Stop()

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    m_State = State_Stopped;

+    return S_OK;

+}

+

+

+/* Put the filter into a paused state */

+

+STDMETHODIMP

+CBaseMediaFilter::Pause()

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    m_State = State_Paused;

+    return S_OK;

+}

+

+

+// Put the filter into a running state.

+

+// The time parameter is the offset to be added to the samples'

+// stream time to get the reference time at which they should be presented.

+//

+// you can either add these two and compare it against the reference clock,

+// or you can call CBaseMediaFilter::StreamTime and compare that against

+// the sample timestamp.

+

+STDMETHODIMP

+CBaseMediaFilter::Run(REFERENCE_TIME tStart)

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    // remember the stream time offset

+    m_tStart = tStart;

+

+    if (m_State == State_Stopped){

+        HRESULT hr = Pause();

+

+        if (FAILED(hr)) {

+            return hr;

+        }

+    }

+    m_State = State_Running;

+    return S_OK;

+}

+

+

+//

+// return the current stream time - samples with start timestamps of this

+// time or before should be rendered by now

+HRESULT

+CBaseMediaFilter::StreamTime(CRefTime& rtStream)

+{

+    // Caller must lock for synchronization

+    // We can't grab the filter lock because we want to be able to call

+    // this from worker threads without deadlocking

+

+    if (m_pClock == NULL) {

+        return VFW_E_NO_CLOCK;

+    }

+

+    // get the current reference time

+    HRESULT hr = m_pClock->GetTime((REFERENCE_TIME*)&rtStream);

+    if (FAILED(hr)) {

+        return hr;

+    }

+

+    // subtract the stream offset to get stream time

+    rtStream -= m_tStart;

+

+    return S_OK;

+}

+

+

+//=====================================================================

+//=====================================================================

+// Implements CBaseFilter

+//=====================================================================

+//=====================================================================

+

+

+/* Override this to say what interfaces we support and where */

+

+STDMETHODIMP CBaseFilter::NonDelegatingQueryInterface(REFIID riid,

+                                                      __deref_out void **ppv)

+{

+    /* Do we have this interface */

+

+    if (riid == IID_IBaseFilter) {

+        return GetInterface((IBaseFilter *) this, ppv);

+    } else if (riid == IID_IMediaFilter) {

+        return GetInterface((IMediaFilter *) this, ppv);

+    } else if (riid == IID_IPersist) {

+        return GetInterface((IPersist *) this, ppv);

+    } else if (riid == IID_IAMovieSetup) {

+        return GetInterface((IAMovieSetup *) this, ppv);

+    } else {

+        return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+#ifdef DEBUG

+STDMETHODIMP_(ULONG) CBaseFilter::NonDelegatingRelease()

+{

+    if (m_cRef == 1) {

+        KASSERT(m_pGraph == NULL);

+    }

+    return CUnknown::NonDelegatingRelease();

+}

+#endif

+

+

+/* Constructor */

+

+CBaseFilter::CBaseFilter(__in_opt LPCTSTR pName,

+             __inout_opt LPUNKNOWN  pUnk,

+             __in CCritSec   *pLock,

+             REFCLSID   clsid) :

+    CUnknown( pName, pUnk ),

+    m_pLock(pLock),

+    m_clsid(clsid),

+    m_State(State_Stopped),

+    m_pClock(NULL),

+    m_pGraph(NULL),

+    m_pSink(NULL),

+    m_pName(NULL),

+    m_PinVersion(1)

+{

+#ifdef DXMPERF

+    PERFLOG_CTOR( pName ? pName : L"CBaseFilter", (IBaseFilter *) this );

+#endif // DXMPERF

+

+    ASSERT(pLock != NULL);

+}

+

+/* Passes in a redundant HRESULT argument */

+

+CBaseFilter::CBaseFilter(__in_opt LPCTSTR pName,

+                         __in_opt LPUNKNOWN  pUnk,

+                         __in CCritSec  *pLock,

+                         REFCLSID   clsid,

+                         __inout HRESULT   *phr) :

+    CUnknown( pName, pUnk ),

+    m_pLock(pLock),

+    m_clsid(clsid),

+    m_State(State_Stopped),

+    m_pClock(NULL),

+    m_pGraph(NULL),

+    m_pSink(NULL),

+    m_pName(NULL),

+    m_PinVersion(1)

+{

+#ifdef DXMPERF

+    PERFLOG_CTOR( pName ? pName : L"CBaseFilter", (IBaseFilter *) this );

+#endif // DXMPERF

+

+    ASSERT(pLock != NULL);

+    UNREFERENCED_PARAMETER(phr);

+}

+

+#ifdef UNICODE

+CBaseFilter::CBaseFilter(__in_opt LPCSTR pName,

+             __in_opt LPUNKNOWN  pUnk,

+             __in CCritSec   *pLock,

+             REFCLSID   clsid) :

+    CUnknown( pName, pUnk ),

+    m_pLock(pLock),

+    m_clsid(clsid),

+    m_State(State_Stopped),

+    m_pClock(NULL),

+    m_pGraph(NULL),

+    m_pSink(NULL),

+    m_pName(NULL),

+    m_PinVersion(1)

+{

+#ifdef DXMPERF

+    PERFLOG_CTOR( L"CBaseFilter", (IBaseFilter *) this );

+#endif // DXMPERF

+

+    ASSERT(pLock != NULL);

+}

+CBaseFilter::CBaseFilter(__in_opt LPCSTR pName,

+                         __in_opt LPUNKNOWN  pUnk,

+                         __in CCritSec  *pLock,

+                         REFCLSID   clsid,

+                         __inout HRESULT   *phr) :

+    CUnknown( pName, pUnk ),

+    m_pLock(pLock),

+    m_clsid(clsid),

+    m_State(State_Stopped),

+    m_pClock(NULL),

+    m_pGraph(NULL),

+    m_pSink(NULL),

+    m_pName(NULL),

+    m_PinVersion(1)

+{

+#ifdef DXMPERF

+    PERFLOG_CTOR( L"CBaseFilter", (IBaseFilter *) this );

+#endif // DXMPERF

+

+    ASSERT(pLock != NULL);

+    UNREFERENCED_PARAMETER(phr);

+}

+#endif

+

+/* Destructor */

+

+CBaseFilter::~CBaseFilter()

+{

+#ifdef DXMPERF

+    PERFLOG_DTOR( L"CBaseFilter", (IBaseFilter *) this );

+#endif // DXMPERF

+

+    // NOTE we do NOT hold references on the filtergraph for m_pGraph or m_pSink

+    // When we did we had the circular reference problem.  Nothing would go away.

+

+    delete[] m_pName;

+

+    // must be stopped, but can't call Stop here since

+    // our critsec has been destroyed.

+

+    /* Release any clock we were using */

+    if (m_pClock) {

+        m_pClock->Release();

+        m_pClock = NULL;

+    }

+}

+

+/* Return the filter's clsid */

+STDMETHODIMP

+CBaseFilter::GetClassID(__out CLSID *pClsID)

+{

+    CheckPointer(pClsID,E_POINTER);

+    ValidateReadWritePtr(pClsID,sizeof(CLSID));

+    *pClsID = m_clsid;

+    return NOERROR;

+}

+

+/* Override this if your state changes are not done synchronously */

+STDMETHODIMP

+CBaseFilter::GetState(DWORD dwMSecs, __out FILTER_STATE *State)

+{

+    UNREFERENCED_PARAMETER(dwMSecs);

+    CheckPointer(State,E_POINTER);

+    ValidateReadWritePtr(State,sizeof(FILTER_STATE));

+

+    *State = m_State;

+    return S_OK;

+}

+

+

+/* Set the clock we will use for synchronisation */

+

+STDMETHODIMP

+CBaseFilter::SetSyncSource(__in_opt IReferenceClock *pClock)

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    // Ensure the new one does not go away - even if the same as the old

+    if (pClock) {

+        pClock->AddRef();

+    }

+

+    // if we have a clock, release it

+    if (m_pClock) {

+        m_pClock->Release();

+    }

+

+    // Set the new reference clock (might be NULL)

+    // Should we query it to ensure it is a clock?  Consider for a debug build.

+    m_pClock = pClock;

+

+    return NOERROR;

+}

+

+/* Return the clock we are using for synchronisation */

+STDMETHODIMP

+CBaseFilter::GetSyncSource(__deref_out_opt IReferenceClock **pClock)

+{

+    CheckPointer(pClock,E_POINTER);

+    ValidateReadWritePtr(pClock,sizeof(IReferenceClock *));

+    CAutoLock cObjectLock(m_pLock);

+

+    if (m_pClock) {

+        // returning an interface... addref it...

+        m_pClock->AddRef();

+    }

+    *pClock = (IReferenceClock*)m_pClock;

+    return NOERROR;

+}

+

+

+

+// override CBaseMediaFilter Stop method, to deactivate any pins this

+// filter has.

+STDMETHODIMP

+CBaseFilter::Stop()

+{

+    CAutoLock cObjectLock(m_pLock);

+    HRESULT hr = NOERROR;

+

+    // notify all pins of the state change

+    if (m_State != State_Stopped) {

+        int cPins = GetPinCount();

+        for (int c = 0; c < cPins; c++) {

+

+            CBasePin *pPin = GetPin(c);

+            if (NULL == pPin) {

+                break;

+            }

+

+            // Disconnected pins are not activated - this saves pins worrying

+            // about this state themselves. We ignore the return code to make

+            // sure everyone is inactivated regardless. The base input pin

+            // class can return an error if it has no allocator but Stop can

+            // be used to resync the graph state after something has gone bad

+

+            if (pPin->IsConnected()) {

+                HRESULT hrTmp = pPin->Inactive();

+                if (FAILED(hrTmp) && SUCCEEDED(hr)) {

+                    hr = hrTmp;

+                }

+            }

+        }

+    }

+

+#ifdef DXMPERF

+    PERFLOG_STOP( m_pName ? m_pName : L"CBaseFilter", (IBaseFilter *) this, m_State );

+#endif // DXMPERF

+

+    m_State = State_Stopped;

+    return hr;

+}

+

+

+// override CBaseMediaFilter Pause method to activate any pins

+// this filter has (also called from Run)

+

+STDMETHODIMP

+CBaseFilter::Pause()

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    // notify all pins of the change to active state

+    if (m_State == State_Stopped) {

+        int cPins = GetPinCount();

+        for (int c = 0; c < cPins; c++) {

+

+            CBasePin *pPin = GetPin(c);

+            if (NULL == pPin) {

+                break;

+            }

+

+            // Disconnected pins are not activated - this saves pins

+            // worrying about this state themselves

+

+            if (pPin->IsConnected()) {

+                HRESULT hr = pPin->Active();

+                if (FAILED(hr)) {

+                    return hr;

+                }

+            }

+        }

+    }

+

+

+#ifdef DXMPERF

+    PERFLOG_PAUSE( m_pName ? m_pName : L"CBaseFilter", (IBaseFilter *) this, m_State );

+#endif // DXMPERF

+

+    m_State = State_Paused;

+    return S_OK;

+}

+

+// Put the filter into a running state.

+

+// The time parameter is the offset to be added to the samples'

+// stream time to get the reference time at which they should be presented.

+//

+// you can either add these two and compare it against the reference clock,

+// or you can call CBaseFilter::StreamTime and compare that against

+// the sample timestamp.

+

+STDMETHODIMP

+CBaseFilter::Run(REFERENCE_TIME tStart)

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    // remember the stream time offset

+    m_tStart = tStart;

+

+    if (m_State == State_Stopped){

+    HRESULT hr = Pause();

+

+    if (FAILED(hr)) {

+        return hr;

+    }

+    }

+    // notify all pins of the change to active state

+    if (m_State != State_Running) {

+        int cPins = GetPinCount();

+        for (int c = 0; c < cPins; c++) {

+

+            CBasePin *pPin = GetPin(c);

+            if (NULL == pPin) {

+                break;

+            }

+

+            // Disconnected pins are not activated - this saves pins

+            // worrying about this state themselves

+

+            if (pPin->IsConnected()) {

+                HRESULT hr = pPin->Run(tStart);

+                if (FAILED(hr)) {

+                    return hr;

+                }

+            }

+        }

+    }

+

+#ifdef DXMPERF

+    PERFLOG_RUN( m_pName ? m_pName : L"CBaseFilter", (IBaseFilter *) this, tStart, m_State );

+#endif // DXMPERF

+

+    m_State = State_Running;

+    return S_OK;

+}

+

+//

+// return the current stream time - samples with start timestamps of this

+// time or before should be rendered by now

+HRESULT

+CBaseFilter::StreamTime(CRefTime& rtStream)

+{

+    // Caller must lock for synchronization

+    // We can't grab the filter lock because we want to be able to call

+    // this from worker threads without deadlocking

+

+    if (m_pClock == NULL) {

+        return VFW_E_NO_CLOCK;

+    }

+

+    // get the current reference time

+    HRESULT hr = m_pClock->GetTime((REFERENCE_TIME*)&rtStream);

+    if (FAILED(hr)) {

+        return hr;

+    }

+

+    // subtract the stream offset to get stream time

+    rtStream -= m_tStart;

+

+    return S_OK;

+}

+

+

+/* Create an enumerator for the pins attached to this filter */

+

+STDMETHODIMP

+CBaseFilter::EnumPins(__deref_out IEnumPins **ppEnum)

+{

+    CheckPointer(ppEnum,E_POINTER);

+    ValidateReadWritePtr(ppEnum,sizeof(IEnumPins *));

+

+    /* Create a new ref counted enumerator */

+

+    *ppEnum = new CEnumPins(this,

+                        NULL);

+

+    return *ppEnum == NULL ? E_OUTOFMEMORY : NOERROR;

+}

+

+

+// default behaviour of FindPin is to assume pins are named

+// by their pin names

+STDMETHODIMP

+CBaseFilter::FindPin(

+    LPCWSTR Id,

+    __deref_out IPin ** ppPin

+)

+{

+    CheckPointer(ppPin,E_POINTER);

+    ValidateReadWritePtr(ppPin,sizeof(IPin *));

+

+    //  We're going to search the pin list so maintain integrity

+    CAutoLock lck(m_pLock);

+    int iCount = GetPinCount();

+    for (int i = 0; i < iCount; i++) {

+        CBasePin *pPin = GetPin(i);

+        if (NULL == pPin) {

+            break;

+        }

+

+        if (0 == lstrcmpW(pPin->Name(), Id)) {

+            //  Found one that matches

+            //

+            //  AddRef() and return it

+            *ppPin = pPin;

+            pPin->AddRef();

+            return S_OK;

+        }

+    }

+    *ppPin = NULL;

+    return VFW_E_NOT_FOUND;

+}

+

+/* Return information about this filter */

+

+STDMETHODIMP

+CBaseFilter::QueryFilterInfo(__out FILTER_INFO * pInfo)

+{

+    CheckPointer(pInfo,E_POINTER);

+    ValidateReadWritePtr(pInfo,sizeof(FILTER_INFO));

+

+    if (m_pName) {

+        (void)StringCchCopyW(pInfo->achName, NUMELMS(pInfo->achName), m_pName);

+    } else {

+        pInfo->achName[0] = L'\0';

+    }

+    pInfo->pGraph = m_pGraph;

+    if (m_pGraph)

+        m_pGraph->AddRef();

+    return NOERROR;

+}

+

+

+/* Provide the filter with a filter graph */

+

+STDMETHODIMP

+CBaseFilter::JoinFilterGraph(

+    __inout_opt IFilterGraph * pGraph,

+    __in_opt LPCWSTR pName)

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    // NOTE: we no longer hold references on the graph (m_pGraph, m_pSink)

+

+    m_pGraph = pGraph;

+    if (m_pGraph) {

+        HRESULT hr = m_pGraph->QueryInterface(IID_IMediaEventSink,

+                        (void**) &m_pSink);

+        if (FAILED(hr)) {

+            ASSERT(m_pSink == NULL);

+        }

+        else m_pSink->Release();        // we do NOT keep a reference on it.

+    } else {

+        // if graph pointer is null, then we should

+        // also release the IMediaEventSink on the same object - we don't

+        // refcount it, so just set it to null

+        m_pSink = NULL;

+    }

+

+

+    if (m_pName) {

+        delete[] m_pName;

+        m_pName = NULL;

+    }

+

+    if (pName) {

+        size_t namelen;

+        HRESULT hr = StringCchLengthW(pName, STRSAFE_MAX_CCH, &namelen);

+        if (FAILED(hr)) {

+            return hr;

+        }

+        m_pName = new WCHAR[namelen + 1];

+        if (m_pName) {

+            (void)StringCchCopyW(m_pName, namelen + 1, pName);

+        } else {

+            return E_OUTOFMEMORY;

+        }

+    }

+

+#ifdef DXMPERF

+    PERFLOG_JOINGRAPH( m_pName ? m_pName : L"CBaseFilter",(IBaseFilter *) this, pGraph );

+#endif // DXMPERF

+

+    return NOERROR;

+}

+

+

+// return a Vendor information string. Optional - may return E_NOTIMPL.

+// memory returned should be freed using CoTaskMemFree

+// default implementation returns E_NOTIMPL

+STDMETHODIMP

+CBaseFilter::QueryVendorInfo(

+    __deref_out LPWSTR* pVendorInfo)

+{

+    UNREFERENCED_PARAMETER(pVendorInfo);

+    return E_NOTIMPL;

+}

+

+

+// send an event notification to the filter graph if we know about it.

+// returns S_OK if delivered, S_FALSE if the filter graph does not sink

+// events, or an error otherwise.

+HRESULT

+CBaseFilter::NotifyEvent(

+    long EventCode,

+    LONG_PTR EventParam1,

+    LONG_PTR EventParam2)

+{

+    // Snapshot so we don't have to lock up

+    IMediaEventSink *pSink = m_pSink;

+    if (pSink) {

+        if (EC_COMPLETE == EventCode) {

+            EventParam2 = (LONG_PTR)(IBaseFilter*)this;

+        }

+

+        return pSink->Notify(EventCode, EventParam1, EventParam2);

+    } else {

+        return E_NOTIMPL;

+    }

+}

+

+// Request reconnect

+// pPin is the pin to reconnect

+// pmt is the type to reconnect with - can be NULL

+// Calls ReconnectEx on the filter graph

+HRESULT

+CBaseFilter::ReconnectPin(

+    IPin *pPin,

+    __in_opt AM_MEDIA_TYPE const *pmt

+)

+{

+    IFilterGraph2 *pGraph2;

+    if (m_pGraph != NULL) {

+        HRESULT hr = m_pGraph->QueryInterface(IID_IFilterGraph2, (void **)&pGraph2);

+        if (SUCCEEDED(hr)) {

+            hr = pGraph2->ReconnectEx(pPin, pmt);

+            pGraph2->Release();

+            return hr;

+        } else {

+            return m_pGraph->Reconnect(pPin);

+        }

+    } else {

+        return E_NOINTERFACE;

+    }

+}

+

+

+

+/* This is the same idea as the media type version does for type enumeration

+   on pins but for the list of pins available. So if the list of pins you

+   provide changes dynamically then either override this virtual function

+   to provide the version number, or more simply call IncrementPinVersion */

+

+LONG CBaseFilter::GetPinVersion()

+{

+    return m_PinVersion;

+}

+

+

+/* Increment the current pin version cookie */

+

+void CBaseFilter::IncrementPinVersion()

+{

+    InterlockedIncrement(&m_PinVersion);

+}

+

+/* register filter */

+

+STDMETHODIMP CBaseFilter::Register()

+{

+    // get setup data, if it exists

+    //

+    LPAMOVIESETUP_FILTER psetupdata = GetSetupData();

+

+    // check we've got data

+    //

+    if( NULL == psetupdata ) return S_FALSE;

+

+    // init is ref counted so call just in case

+    // we're being called cold.

+    //

+    HRESULT hr = CoInitialize( (LPVOID)NULL );

+    ASSERT( SUCCEEDED(hr) );

+

+    // get hold of IFilterMapper

+    //

+    IFilterMapper *pIFM;

+    hr = CoCreateInstance( CLSID_FilterMapper

+                             , NULL

+                             , CLSCTX_INPROC_SERVER

+                             , IID_IFilterMapper

+                             , (void **)&pIFM       );

+    if( SUCCEEDED(hr) )

+    {

+        hr = AMovieSetupRegisterFilter( psetupdata, pIFM, TRUE );

+        pIFM->Release();

+    }

+

+    // and clear up

+    //

+    CoFreeUnusedLibraries();

+    CoUninitialize();

+

+    return NOERROR;

+}

+

+

+/* unregister filter */

+

+STDMETHODIMP CBaseFilter::Unregister()

+{

+    // get setup data, if it exists

+    //

+    LPAMOVIESETUP_FILTER psetupdata = GetSetupData();

+

+    // check we've got data

+    //

+    if( NULL == psetupdata ) return S_FALSE;

+

+    // OLE init is ref counted so call

+    // just in case we're being called cold.

+    //

+    HRESULT hr = CoInitialize( (LPVOID)NULL );

+    ASSERT( SUCCEEDED(hr) );

+

+    // get hold of IFilterMapper

+    //

+    IFilterMapper *pIFM;

+    hr = CoCreateInstance( CLSID_FilterMapper

+                             , NULL

+                             , CLSCTX_INPROC_SERVER

+                             , IID_IFilterMapper

+                             , (void **)&pIFM       );

+    if( SUCCEEDED(hr) )

+    {

+        hr = AMovieSetupRegisterFilter( psetupdata, pIFM, FALSE );

+

+        // release interface

+        //

+        pIFM->Release();

+    }

+

+    // clear up

+    //

+    CoFreeUnusedLibraries();

+    CoUninitialize();

+

+    // handle one acceptable "error" - that

+    // of filter not being registered!

+    // (couldn't find a suitable #define'd

+    // name for the error!)

+    //

+    if( 0x80070002 == hr)

+      return NOERROR;

+    else

+      return hr;

+}

+

+

+//=====================================================================

+//=====================================================================

+// Implements CEnumPins

+//=====================================================================

+//=====================================================================

+

+

+CEnumPins::CEnumPins(__in CBaseFilter *pFilter,

+                     __in_opt CEnumPins *pEnumPins) :

+    m_Position(0),

+    m_PinCount(0),

+    m_pFilter(pFilter),

+    m_cRef(1),               // Already ref counted

+    m_PinCache(NAME("Pin Cache"))

+{

+

+#ifdef DEBUG

+    m_dwCookie = DbgRegisterObjectCreation("CEnumPins", 0);

+#endif

+

+    /* We must be owned by a filter derived from CBaseFilter */

+

+    ASSERT(pFilter != NULL);

+

+    /* Hold a reference count on our filter */

+    m_pFilter->AddRef();

+

+    /* Are we creating a new enumerator */

+

+    if (pEnumPins == NULL) {

+        m_Version = m_pFilter->GetPinVersion();

+        m_PinCount = m_pFilter->GetPinCount();

+    } else {

+        ASSERT(m_Position <= m_PinCount);

+        m_Position = pEnumPins->m_Position;

+        m_PinCount = pEnumPins->m_PinCount;

+        m_Version = pEnumPins->m_Version;

+        m_PinCache.AddTail(&(pEnumPins->m_PinCache));

+    }

+}

+

+

+/* Destructor releases the reference count on our filter NOTE since we hold

+   a reference count on the filter who created us we know it is safe to

+   release it, no access can be made to it afterwards though as we have just

+   caused the last reference count to go and the object to be deleted */

+

+CEnumPins::~CEnumPins()

+{

+    m_pFilter->Release();

+

+#ifdef DEBUG

+    DbgRegisterObjectDestruction(m_dwCookie);

+#endif

+}

+

+

+/* Override this to say what interfaces we support where */

+

+STDMETHODIMP

+CEnumPins::QueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    CheckPointer(ppv, E_POINTER);

+

+    /* Do we have this interface */

+

+    if (riid == IID_IEnumPins || riid == IID_IUnknown) {

+        return GetInterface((IEnumPins *) this, ppv);

+    } else {

+        *ppv = NULL;

+        return E_NOINTERFACE;

+    }

+}

+

+STDMETHODIMP_(ULONG)

+CEnumPins::AddRef()

+{

+    return InterlockedIncrement(&m_cRef);

+}

+

+STDMETHODIMP_(ULONG)

+CEnumPins::Release()

+{

+    ULONG cRef = InterlockedDecrement(&m_cRef);

+    if (cRef == 0) {

+        delete this;

+    }

+    return cRef;

+}

+

+/* One of an enumerator's basic member functions allows us to create a cloned

+   interface that initially has the same state. Since we are taking a snapshot

+   of an object (current position and all) we must lock access at the start */

+

+STDMETHODIMP 

+CEnumPins::Clone(__deref_out IEnumPins **ppEnum)

+{

+    CheckPointer(ppEnum,E_POINTER);

+    ValidateReadWritePtr(ppEnum,sizeof(IEnumPins *));

+    HRESULT hr = NOERROR;

+

+    /* Check we are still in sync with the filter */

+    if (AreWeOutOfSync() == TRUE) {

+        *ppEnum = NULL;

+        hr =  VFW_E_ENUM_OUT_OF_SYNC;

+    } else {

+        *ppEnum = new CEnumPins(m_pFilter, 

+                                this);

+        if (*ppEnum == NULL) {

+            hr = E_OUTOFMEMORY;

+        }

+    }

+    return hr;

+}

+

+

+/* Return the next pin after the current position */

+

+STDMETHODIMP

+CEnumPins::Next(ULONG cPins,        // place this many pins...

+        __out_ecount(cPins) IPin **ppPins,      // ...in this array

+        __out_opt ULONG *pcFetched)   // actual count passed returned here

+{

+    CheckPointer(ppPins,E_POINTER);

+    ValidateReadWritePtr(ppPins,cPins * sizeof(IPin *));

+

+    ASSERT(ppPins);

+

+    if (pcFetched!=NULL) {

+        ValidateWritePtr(pcFetched, sizeof(ULONG));

+        *pcFetched = 0;           // default unless we succeed

+    }

+    // now check that the parameter is valid

+    else if (cPins>1) {   // pcFetched == NULL

+        return E_INVALIDARG;

+    }

+    ULONG cFetched = 0;           // increment as we get each one.

+

+    /* Check we are still in sync with the filter */

+    if (AreWeOutOfSync() == TRUE) {

+        // If we are out of sync, we should refresh the enumerator.

+        // This will reset the position and update the other members, but

+        // will not clear cache of pins we have already returned.

+        Refresh();

+    }

+

+    /* Return each pin interface NOTE GetPin returns CBasePin * not addrefed

+       so we must QI for the IPin (which increments its reference count)

+       If while we are retrieving a pin from the filter an error occurs we

+       assume that our internal state is stale with respect to the filter

+       (for example someone has deleted a pin) so we

+       return VFW_E_ENUM_OUT_OF_SYNC                            */

+

+    while (cFetched < cPins && m_PinCount > m_Position) {

+

+        /* Get the next pin object from the filter */

+

+        CBasePin *pPin = m_pFilter->GetPin(m_Position++);

+        if (pPin == NULL) {

+            // If this happend, and it's not the first time through, then we've got a problem,

+            // since we should really go back and release the iPins, which we have previously

+            // AddRef'ed.

+            ASSERT( cFetched==0 );

+            return VFW_E_ENUM_OUT_OF_SYNC;

+        }

+

+        /* We only want to return this pin, if it is not in our cache */

+        if (0 == m_PinCache.Find(pPin))

+        {

+            /* From the object get an IPin interface */

+

+            *ppPins = pPin;

+            pPin->AddRef();

+

+            cFetched++;

+            ppPins++;

+

+            m_PinCache.AddTail(pPin);

+        }

+    }

+

+    if (pcFetched!=NULL) {

+        *pcFetched = cFetched;

+    }

+

+    return (cPins==cFetched ? NOERROR : S_FALSE);

+}

+

+

+/* Skip over one or more entries in the enumerator */

+

+STDMETHODIMP

+CEnumPins::Skip(ULONG cPins)

+{

+    /* Check we are still in sync with the filter */

+    if (AreWeOutOfSync() == TRUE) {

+        return VFW_E_ENUM_OUT_OF_SYNC;

+    }

+

+    /* Work out how many pins are left to skip over */

+    /* We could position at the end if we are asked to skip too many... */

+    /* ..which would match the base implementation for CEnumMediaTypes::Skip */

+

+    ULONG PinsLeft = m_PinCount - m_Position;

+    if (cPins > PinsLeft) {

+        return S_FALSE;

+    }

+    m_Position += cPins;

+    return NOERROR;

+}

+

+

+/* Set the current position back to the start */

+/* Reset has 4 simple steps:

+ *

+ * Set position to head of list

+ * Sync enumerator with object being enumerated

+ * Clear the cache of pins already returned

+ * return S_OK

+ */

+

+STDMETHODIMP

+CEnumPins::Reset()

+{

+    m_Version = m_pFilter->GetPinVersion();

+    m_PinCount = m_pFilter->GetPinCount();

+

+    m_Position = 0;

+

+    // Clear the cache

+    m_PinCache.RemoveAll();

+

+    return S_OK;

+}

+

+

+/* Set the current position back to the start */

+/* Refresh has 3 simple steps:

+ *

+ * Set position to head of list

+ * Sync enumerator with object being enumerated

+ * return S_OK

+ */

+

+STDMETHODIMP

+CEnumPins::Refresh()

+{

+    m_Version = m_pFilter->GetPinVersion();

+    m_PinCount = m_pFilter->GetPinCount();

+

+    m_Position = 0;

+    return S_OK;

+}

+

+

+//=====================================================================

+//=====================================================================

+// Implements CEnumMediaTypes

+//=====================================================================

+//=====================================================================

+

+

+CEnumMediaTypes::CEnumMediaTypes(__in CBasePin *pPin,

+                                 __in_opt CEnumMediaTypes *pEnumMediaTypes) :

+    m_Position(0),

+    m_pPin(pPin),

+    m_cRef(1)

+{

+

+#ifdef DEBUG

+    m_dwCookie = DbgRegisterObjectCreation("CEnumMediaTypes", 0);

+#endif

+

+    /* We must be owned by a pin derived from CBasePin */

+

+    ASSERT(pPin != NULL);

+

+    /* Hold a reference count on our pin */

+    m_pPin->AddRef();

+

+    /* Are we creating a new enumerator */

+

+    if (pEnumMediaTypes == NULL) {

+        m_Version = m_pPin->GetMediaTypeVersion();

+        return;

+    }

+

+    m_Position = pEnumMediaTypes->m_Position;

+    m_Version = pEnumMediaTypes->m_Version;

+}

+

+

+/* Destructor releases the reference count on our base pin. NOTE since we hold

+   a reference count on the pin who created us we know it is safe to release

+   it, no access can be made to it afterwards though as we might have just

+   caused the last reference count to go and the object to be deleted */

+

+CEnumMediaTypes::~CEnumMediaTypes()

+{

+#ifdef DEBUG

+    DbgRegisterObjectDestruction(m_dwCookie);

+#endif

+    m_pPin->Release();

+}

+

+

+/* Override this to say what interfaces we support where */

+

+STDMETHODIMP

+CEnumMediaTypes::QueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    CheckPointer(ppv, E_POINTER);

+

+    /* Do we have this interface */

+

+    if (riid == IID_IEnumMediaTypes || riid == IID_IUnknown) {

+        return GetInterface((IEnumMediaTypes *) this, ppv);

+    } else {

+        *ppv = NULL;

+        return E_NOINTERFACE;

+    }

+}

+

+STDMETHODIMP_(ULONG)

+CEnumMediaTypes::AddRef()

+{

+    return InterlockedIncrement(&m_cRef);

+}

+

+STDMETHODIMP_(ULONG)

+CEnumMediaTypes::Release()

+{

+    ULONG cRef = InterlockedDecrement(&m_cRef);

+    if (cRef == 0) {

+        delete this;

+    }

+    return cRef;

+}

+

+/* One of an enumerator's basic member functions allows us to create a cloned

+   interface that initially has the same state. Since we are taking a snapshot

+   of an object (current position and all) we must lock access at the start */

+

+STDMETHODIMP

+CEnumMediaTypes::Clone(__deref_out IEnumMediaTypes **ppEnum)

+{

+    CheckPointer(ppEnum,E_POINTER);

+    ValidateReadWritePtr(ppEnum,sizeof(IEnumMediaTypes *));

+    HRESULT hr = NOERROR;

+

+    /* Check we are still in sync with the pin */

+    if (AreWeOutOfSync() == TRUE) {

+        *ppEnum = NULL;

+        hr = VFW_E_ENUM_OUT_OF_SYNC;

+    } else {

+

+        *ppEnum = new CEnumMediaTypes(m_pPin,

+                                      this);

+

+        if (*ppEnum == NULL) {

+            hr =  E_OUTOFMEMORY;

+        }

+    }

+    return hr;

+}

+

+

+/* Enumerate the next pin(s) after the current position. The client using this

+   interface passes in a pointer to an array of pointers each of which will

+   be filled in with a pointer to a fully initialised media type format

+   Return NOERROR if it all works,

+          S_FALSE if fewer than cMediaTypes were enumerated.

+          VFW_E_ENUM_OUT_OF_SYNC if the enumerator has been broken by

+                                 state changes in the filter

+   The actual count always correctly reflects the number of types in the array.

+*/

+

+STDMETHODIMP

+CEnumMediaTypes::Next(ULONG cMediaTypes,          // place this many types...

+                      __out_ecount(cMediaTypes) AM_MEDIA_TYPE **ppMediaTypes,   // ...in this array

+                      __out ULONG *pcFetched)           // actual count passed

+{

+    CheckPointer(ppMediaTypes,E_POINTER);

+    ValidateReadWritePtr(ppMediaTypes,cMediaTypes * sizeof(AM_MEDIA_TYPE *));

+    /* Check we are still in sync with the pin */

+    if (AreWeOutOfSync() == TRUE) {

+        return VFW_E_ENUM_OUT_OF_SYNC;

+    }

+

+    if (pcFetched!=NULL) {

+        ValidateWritePtr(pcFetched, sizeof(ULONG));

+        *pcFetched = 0;           // default unless we succeed

+    }

+    // now check that the parameter is valid

+    else if (cMediaTypes>1) {     // pcFetched == NULL

+        return E_INVALIDARG;

+    }

+    ULONG cFetched = 0;           // increment as we get each one.

+

+    /* Return each media type by asking the filter for them in turn - If we

+       have an error code retured to us while we are retrieving a media type

+       we assume that our internal state is stale with respect to the filter

+       (for example the window size changing) so we return

+       VFW_E_ENUM_OUT_OF_SYNC */

+

+    while (cMediaTypes) {

+

+        CMediaType cmt;

+

+        HRESULT hr = m_pPin->GetMediaType(m_Position++, &cmt);

+        if (S_OK != hr) {

+            break;

+        }

+

+        /* We now have a CMediaType object that contains the next media type

+           but when we assign it to the array position we CANNOT just assign

+           the AM_MEDIA_TYPE structure because as soon as the object goes out of

+           scope it will delete the memory we have just copied. The function

+           we use is CreateMediaType which allocates a task memory block */

+

+        /*  Transfer across the format block manually to save an allocate

+            and free on the format block and generally go faster */

+

+        *ppMediaTypes = (AM_MEDIA_TYPE *)CoTaskMemAlloc(sizeof(AM_MEDIA_TYPE));

+        if (*ppMediaTypes == NULL) {

+            break;

+        }

+

+        /*  Do a regular copy */

+        **ppMediaTypes = cmt;

+

+        /*  Make sure the destructor doesn't free these */

+        cmt.pbFormat = NULL;

+        cmt.cbFormat = NULL;

+        cmt.pUnk     = NULL;

+

+

+        ppMediaTypes++;

+        cFetched++;

+        cMediaTypes--;

+    }

+

+    if (pcFetched!=NULL) {

+        *pcFetched = cFetched;

+    }

+

+    return ( cMediaTypes==0 ? NOERROR : S_FALSE );

+}

+

+

+/* Skip over one or more entries in the enumerator */

+

+STDMETHODIMP

+CEnumMediaTypes::Skip(ULONG cMediaTypes)

+{

+    //  If we're skipping 0 elements we're guaranteed to skip the

+    //  correct number of elements

+    if (cMediaTypes == 0) {

+        return S_OK;

+    }

+

+    /* Check we are still in sync with the pin */

+    if (AreWeOutOfSync() == TRUE) {

+        return VFW_E_ENUM_OUT_OF_SYNC;

+    }

+

+    m_Position += cMediaTypes;

+

+    /*  See if we're over the end */

+    CMediaType cmt;

+    return S_OK == m_pPin->GetMediaType(m_Position - 1, &cmt) ? S_OK : S_FALSE;

+}

+

+

+/* Set the current position back to the start */

+/* Reset has 3 simple steps:

+ *

+ * set position to head of list

+ * sync enumerator with object being enumerated

+ * return S_OK

+ */

+

+STDMETHODIMP

+CEnumMediaTypes::Reset()

+

+{

+    m_Position = 0;

+

+    // Bring the enumerator back into step with the current state.  This

+    // may be a noop but ensures that the enumerator will be valid on the

+    // next call.

+    m_Version = m_pPin->GetMediaTypeVersion();

+    return NOERROR;

+}

+

+

+//=====================================================================

+//=====================================================================

+// Implements CBasePin

+//=====================================================================

+//=====================================================================

+

+

+/* NOTE The implementation of this class calls the CUnknown constructor with

+   a NULL outer unknown pointer. This has the effect of making us a self

+   contained class, ie any QueryInterface, AddRef or Release calls will be

+   routed to the class's NonDelegatingUnknown methods. You will typically

+   find that the classes that do this then override one or more of these

+   virtual functions to provide more specialised behaviour. A good example

+   of this is where a class wants to keep the QueryInterface internal but

+   still wants its lifetime controlled by the external object */

+

+/* Constructor */

+

+CBasePin::CBasePin(__in_opt LPCTSTR pObjectName,

+           __in CBaseFilter *pFilter,

+           __in CCritSec *pLock,

+           __inout HRESULT *phr,

+           __in_opt LPCWSTR pName,

+           PIN_DIRECTION dir) :

+    CUnknown( pObjectName, NULL ),

+    m_pFilter(pFilter),

+    m_pLock(pLock),

+    m_pName(NULL),

+    m_Connected(NULL),

+    m_dir(dir),

+    m_bRunTimeError(FALSE),

+    m_pQSink(NULL),

+    m_TypeVersion(1),

+    m_tStart(),

+    m_tStop(MAX_TIME),

+    m_bCanReconnectWhenActive(false),

+    m_bTryMyTypesFirst(false),

+    m_dRate(1.0)

+{

+    /*  WARNING - pFilter is often not a properly constituted object at

+        this state (in particular QueryInterface may not work) - this

+        is because its owner is often its containing object and we

+        have been called from the containing object's constructor so

+        the filter's owner has not yet had its CUnknown constructor

+        called

+    */

+#ifdef DXMPERF

+    PERFLOG_CTOR( pName ? pName : L"CBasePin", (IPin *) this );

+#endif // DXMPERF

+

+    ASSERT(pFilter != NULL);

+    ASSERT(pLock != NULL);

+

+    if (pName) {

+        size_t cchName;

+        HRESULT hr = StringCchLengthW(pName, STRSAFE_MAX_CCH, &cchName);

+        if (SUCCEEDED(hr)) {

+            m_pName = new WCHAR[cchName + 1];

+            if (m_pName) {

+                (void)StringCchCopyW(m_pName, cchName + 1, pName);

+            }

+        }

+    }

+

+#ifdef DEBUG

+    m_cRef = 0;

+#endif

+}

+

+#ifdef UNICODE

+CBasePin::CBasePin(__in_opt LPCSTR pObjectName,

+           __in CBaseFilter *pFilter,

+           __in CCritSec *pLock,

+           __inout HRESULT *phr,

+           __in_opt LPCWSTR pName,

+           PIN_DIRECTION dir) :

+    CUnknown( pObjectName, NULL ),

+    m_pFilter(pFilter),

+    m_pLock(pLock),

+    m_pName(NULL),

+    m_Connected(NULL),

+    m_dir(dir),

+    m_bRunTimeError(FALSE),

+    m_pQSink(NULL),

+    m_TypeVersion(1),

+    m_tStart(),

+    m_tStop(MAX_TIME),

+    m_bCanReconnectWhenActive(false),

+    m_bTryMyTypesFirst(false),

+    m_dRate(1.0)

+{

+    /*  WARNING - pFilter is often not a properly constituted object at

+        this state (in particular QueryInterface may not work) - this

+        is because its owner is often its containing object and we

+        have been called from the containing object's constructor so

+        the filter's owner has not yet had its CUnknown constructor

+        called

+    */

+#ifdef DXMPERF

+    PERFLOG_CTOR( pName ? pName : L"CBasePin", (IPin *) this );

+#endif // DXMPERF

+

+    ASSERT(pFilter != NULL);

+    ASSERT(pLock != NULL);

+

+    if (pName) {

+        size_t cchName;

+        HRESULT hr = StringCchLengthW(pName, STRSAFE_MAX_CCH, &cchName);

+        if (SUCCEEDED(hr)) {

+            m_pName = new WCHAR[cchName + 1];

+            if (m_pName) {

+                (void)StringCchCopyW(m_pName, cchName + 1, pName);

+            }

+        }

+    }

+

+

+#ifdef DEBUG

+    m_cRef = 0;

+#endif

+}

+#endif

+

+/* Destructor since a connected pin holds a reference count on us there is

+   no way that we can be deleted unless we are not currently connected */

+

+CBasePin::~CBasePin()

+{

+#ifdef DXMPERF

+    PERFLOG_DTOR( m_pName ? m_pName : L"CBasePin", (IPin *) this );

+#endif // DXMPERF

+

+    //  We don't call disconnect because if the filter is going away

+    //  all the pins must have a reference count of zero so they must

+    //  have been disconnected anyway - (but check the assumption)

+    ASSERT(m_Connected == FALSE);

+

+    delete[] m_pName;

+

+    // check the internal reference count is consistent

+    ASSERT(m_cRef == 0);

+}

+

+

+/* Override this to say what interfaces we support and where */

+

+STDMETHODIMP

+CBasePin::NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv)

+{

+    /* Do we have this interface */

+

+    if (riid == IID_IPin) {

+        return GetInterface((IPin *) this, ppv);

+    } else if (riid == IID_IQualityControl) {

+        return GetInterface((IQualityControl *) this, ppv);

+    } else {

+        return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+/* Override to increment the owning filter's reference count */

+

+STDMETHODIMP_(ULONG)

+CBasePin::NonDelegatingAddRef()

+{

+    ASSERT(InterlockedIncrement(&m_cRef) > 0);

+    return m_pFilter->AddRef();

+}

+

+

+/* Override to decrement the owning filter's reference count */

+

+STDMETHODIMP_(ULONG)

+CBasePin::NonDelegatingRelease()

+{

+    ASSERT(InterlockedDecrement(&m_cRef) >= 0);

+    return m_pFilter->Release();

+}

+

+

+/* Displays pin connection information */

+

+#ifdef DEBUG

+void

+CBasePin::DisplayPinInfo(IPin *pReceivePin)

+{

+

+    if (DbgCheckModuleLevel(LOG_TRACE, CONNECT_TRACE_LEVEL)) {

+        PIN_INFO ConnectPinInfo;

+        PIN_INFO ReceivePinInfo;

+

+        if (FAILED(QueryPinInfo(&ConnectPinInfo))) {

+            StringCchCopyW(ConnectPinInfo.achName, sizeof(ConnectPinInfo.achName)/sizeof(WCHAR), L"Bad Pin");

+        } else {

+            QueryPinInfoReleaseFilter(ConnectPinInfo);

+        }

+

+        if (FAILED(pReceivePin->QueryPinInfo(&ReceivePinInfo))) {

+            StringCchCopyW(ReceivePinInfo.achName, sizeof(ReceivePinInfo.achName)/sizeof(WCHAR), L"Bad Pin");

+        } else {

+            QueryPinInfoReleaseFilter(ReceivePinInfo);

+        }

+

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Trying to connect Pins :")));

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("    <%ls>"), ConnectPinInfo.achName));

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("    <%ls>"), ReceivePinInfo.achName));

+    }

+}

+#endif

+

+

+/* Displays general information on the pin media type */

+

+#ifdef DEBUG

+void CBasePin::DisplayTypeInfo(IPin *pPin, const CMediaType *pmt)

+{

+    UNREFERENCED_PARAMETER(pPin);

+    if (DbgCheckModuleLevel(LOG_TRACE, CONNECT_TRACE_LEVEL)) {

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Trying media type:")));

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("    major type:  %hs"),

+               GuidNames[*pmt->Type()]));

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("    sub type  :  %hs"),

+               GuidNames[*pmt->Subtype()]));

+    }

+}

+#endif

+

+/* Asked to connect to a pin. A pin is always attached to an owning filter

+   object so we always delegate our locking to that object. We first of all

+   retrieve a media type enumerator for the input pin and see if we accept

+   any of the formats that it would ideally like, failing that we retrieve

+   our enumerator and see if it will accept any of our preferred types */

+

+STDMETHODIMP

+CBasePin::Connect(

+    IPin * pReceivePin,

+    __in_opt const AM_MEDIA_TYPE *pmt   // optional media type

+)

+{

+    CheckPointer(pReceivePin,E_POINTER);

+    ValidateReadPtr(pReceivePin,sizeof(IPin));

+    CAutoLock cObjectLock(m_pLock);

+    DisplayPinInfo(pReceivePin);

+

+    /* See if we are already connected */

+

+    if (m_Connected) {

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Already connected")));

+        return VFW_E_ALREADY_CONNECTED;

+    }

+

+    /* See if the filter is active */

+    if (!IsStopped() && !m_bCanReconnectWhenActive) {

+        return VFW_E_NOT_STOPPED;

+    }

+

+

+    // Find a mutually agreeable media type -

+    // Pass in the template media type. If this is partially specified,

+    // each of the enumerated media types will need to be checked against

+    // it. If it is non-null and fully specified, we will just try to connect

+    // with this.

+

+    const CMediaType * ptype = (CMediaType*)pmt;

+    HRESULT hr = AgreeMediaType(pReceivePin, ptype);

+    if (FAILED(hr)) {

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Failed to agree type")));

+

+        // Since the procedure is already returning an error code, there

+        // is nothing else this function can do to report the error.

+        EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) );

+

+#ifdef DXMPERF

+        PERFLOG_CONNECT( (IPin *) this, pReceivePin, hr, pmt );

+#endif // DXMPERF

+

+        return hr;

+    }

+

+    DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Connection succeeded")));

+

+#ifdef DXMPERF

+    PERFLOG_CONNECT( (IPin *) this, pReceivePin, NOERROR, pmt );

+#endif // DXMPERF

+

+    return NOERROR;

+}

+

+// given a specific media type, attempt a connection (includes

+// checking that the type is acceptable to this pin)

+HRESULT

+CBasePin::AttemptConnection(

+    IPin* pReceivePin,      // connect to this pin

+    const CMediaType* pmt   // using this type

+)

+{

+    // The caller should hold the filter lock becasue this function

+    // uses m_Connected.  The caller should also hold the filter lock

+    // because this function calls SetMediaType(), IsStopped() and

+    // CompleteConnect().

+    ASSERT(CritCheckIn(m_pLock));

+

+    // Check that the connection is valid  -- need to do this for every

+    // connect attempt since BreakConnect will undo it.

+    HRESULT hr = CheckConnect(pReceivePin);

+    if (FAILED(hr)) {

+        DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("CheckConnect failed")));

+

+        // Since the procedure is already returning an error code, there

+        // is nothing else this function can do to report the error.

+        EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) );

+

+        return hr;

+    }

+

+    DisplayTypeInfo(pReceivePin, pmt);

+

+    /* Check we will accept this media type */

+

+    hr = CheckMediaType(pmt);

+    if (hr == NOERROR) {

+

+        /*  Make ourselves look connected otherwise ReceiveConnection

+            may not be able to complete the connection

+        */

+        m_Connected = pReceivePin;

+        m_Connected->AddRef();

+        hr = SetMediaType(pmt);

+        if (SUCCEEDED(hr)) {

+            /* See if the other pin will accept this type */

+

+            hr = pReceivePin->ReceiveConnection((IPin *)this, pmt);

+            if (SUCCEEDED(hr)) {

+                /* Complete the connection */

+

+                hr = CompleteConnect(pReceivePin);

+                if (SUCCEEDED(hr)) {

+                    return hr;

+                } else {

+                    DbgLog((LOG_TRACE,

+                            CONNECT_TRACE_LEVEL,

+                            TEXT("Failed to complete connection")));

+                    pReceivePin->Disconnect();

+                }

+            }

+        }

+    } else {

+        // we cannot use this media type

+

+        // return a specific media type error if there is one

+        // or map a general failure code to something more helpful

+        // (in particular S_FALSE gets changed to an error code)

+        if (SUCCEEDED(hr) ||

+            (hr == E_FAIL) ||

+            (hr == E_INVALIDARG)) {

+            hr = VFW_E_TYPE_NOT_ACCEPTED;

+        }

+    }

+

+    // BreakConnect and release any connection here in case CheckMediaType

+    // failed, or if we set anything up during a call back during

+    // ReceiveConnection.

+

+    // Since the procedure is already returning an error code, there

+    // is nothing else this function can do to report the error.

+    EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) );

+

+    /*  If failed then undo our state */

+    if (m_Connected) {

+        m_Connected->Release();

+        m_Connected = NULL;

+    }

+

+    return hr;

+}

+

+/* Given an enumerator we cycle through all the media types it proposes and

+   firstly suggest them to our derived pin class and if that succeeds try

+   them with the pin in a ReceiveConnection call. This means that if our pin

+   proposes a media type we still check in here that we can support it. This

+   is deliberate so that in simple cases the enumerator can hold all of the

+   media types even if some of them are not really currently available */

+

+HRESULT CBasePin::TryMediaTypes(

+    IPin *pReceivePin,

+    __in_opt const CMediaType *pmt,

+    IEnumMediaTypes *pEnum)

+{

+    /* Reset the current enumerator position */

+

+    HRESULT hr = pEnum->Reset();

+    if (FAILED(hr)) {

+        return hr;

+    }

+

+    CMediaType *pMediaType = NULL;

+    ULONG ulMediaCount = 0;

+

+    // attempt to remember a specific error code if there is one

+    HRESULT hrFailure = S_OK;

+

+    for (;;) {

+

+        /* Retrieve the next media type NOTE each time round the loop the

+           enumerator interface will allocate another AM_MEDIA_TYPE structure

+           If we are successful then we copy it into our output object, if

+           not then we must delete the memory allocated before returning */

+

+        hr = pEnum->Next(1, (AM_MEDIA_TYPE**)&pMediaType,&ulMediaCount);

+        if (hr != S_OK) {

+            if (S_OK == hrFailure) {

+                hrFailure = VFW_E_NO_ACCEPTABLE_TYPES;

+            }

+            return hrFailure;

+        }

+

+

+        ASSERT(ulMediaCount == 1);

+        ASSERT(pMediaType);

+

+        // check that this matches the partial type (if any)

+

+        if (pMediaType &&

+            ((pmt == NULL) ||

+            pMediaType->MatchesPartial(pmt))) {

+

+            hr = AttemptConnection(pReceivePin, pMediaType);

+

+            // attempt to remember a specific error code

+            if (FAILED(hr) &&

+            SUCCEEDED(hrFailure) &&

+            (hr != E_FAIL) &&

+            (hr != E_INVALIDARG) &&

+            (hr != VFW_E_TYPE_NOT_ACCEPTED)) {

+                hrFailure = hr;

+            }

+        } else {

+            hr = VFW_E_NO_ACCEPTABLE_TYPES;

+        }

+

+        if(pMediaType) {

+            DeleteMediaType(pMediaType);

+            pMediaType = NULL;

+        }

+

+        if (S_OK == hr) {

+            return hr;

+        }

+    }

+}

+

+

+/* This is called to make the connection, including the taask of finding

+   a media type for the pin connection. pmt is the proposed media type

+   from the Connect call: if this is fully specified, we will try that.

+   Otherwise we enumerate and try all the input pin's types first and

+   if that fails we then enumerate and try all our preferred media types.

+   For each media type we check it against pmt (if non-null and partially

+   specified) as well as checking that both pins will accept it.

+ */

+

+HRESULT CBasePin::AgreeMediaType(

+    IPin *pReceivePin,

+    const CMediaType *pmt)

+{

+    ASSERT(pReceivePin);

+    IEnumMediaTypes *pEnumMediaTypes = NULL;

+

+    // if the media type is fully specified then use that

+    if ( (pmt != NULL) && (!pmt->IsPartiallySpecified())) {

+

+        // if this media type fails, then we must fail the connection

+        // since if pmt is nonnull we are only allowed to connect

+        // using a type that matches it.

+

+        return AttemptConnection(pReceivePin, pmt);

+    }

+

+

+    /* Try the other pin's enumerator */

+

+    HRESULT hrFailure = VFW_E_NO_ACCEPTABLE_TYPES;

+

+    for (int i = 0; i < 2; i++) {

+        HRESULT hr;

+        if (i == (int)m_bTryMyTypesFirst) {

+            hr = pReceivePin->EnumMediaTypes(&pEnumMediaTypes);

+        } else {

+            hr = EnumMediaTypes(&pEnumMediaTypes);

+        }

+        if (SUCCEEDED(hr)) {

+            ASSERT(pEnumMediaTypes);

+            hr = TryMediaTypes(pReceivePin,pmt,pEnumMediaTypes);

+            pEnumMediaTypes->Release();

+            if (SUCCEEDED(hr)) {

+                return NOERROR;

+            } else {

+                // try to remember specific error codes if there are any

+                if ((hr != E_FAIL) &&

+                    (hr != E_INVALIDARG) &&

+                    (hr != VFW_E_TYPE_NOT_ACCEPTED)) {

+                    hrFailure = hr;

+                }

+            }

+        }

+    }

+

+    return hrFailure;

+}

+

+

+/* Called when we want to complete a connection to another filter. Failing

+   this will also fail the connection and disconnect the other pin as well */

+

+HRESULT

+CBasePin::CompleteConnect(IPin *pReceivePin)

+{

+    UNREFERENCED_PARAMETER(pReceivePin);

+    return NOERROR;

+}

+

+

+/* This is called to set the format for a pin connection - CheckMediaType

+   will have been called to check the connection format and if it didn't

+   return an error code then this (virtual) function will be invoked */

+

+HRESULT

+CBasePin::SetMediaType(const CMediaType *pmt)

+{

+    HRESULT hr = m_mt.Set(*pmt);

+    if (FAILED(hr)) {

+        return hr;

+    }

+

+    return NOERROR;

+}

+

+

+/* This is called during Connect() to provide a virtual method that can do

+   any specific check needed for connection such as QueryInterface. This

+   base class method just checks that the pin directions don't match */

+

+HRESULT

+CBasePin::CheckConnect(IPin * pPin)

+{

+    /* Check that pin directions DONT match */

+

+    PIN_DIRECTION pd;

+    pPin->QueryDirection(&pd);

+

+    ASSERT((pd == PINDIR_OUTPUT) || (pd == PINDIR_INPUT));

+    ASSERT((m_dir == PINDIR_OUTPUT) || (m_dir == PINDIR_INPUT));

+

+    // we should allow for non-input and non-output connections?

+    if (pd == m_dir) {

+        return VFW_E_INVALID_DIRECTION;

+    }

+    return NOERROR;

+}

+

+

+/* This is called when we realise we can't make a connection to the pin and

+   must undo anything we did in CheckConnect - override to release QIs done */

+

+HRESULT

+CBasePin::BreakConnect()

+{

+    return NOERROR;

+}

+

+

+/* Called normally by an output pin on an input pin to try and establish a

+   connection.

+*/

+

+STDMETHODIMP

+CBasePin::ReceiveConnection(

+    IPin * pConnector,   // this is the pin who we will connect to

+    const AM_MEDIA_TYPE *pmt  // this is the media type we will exchange

+)

+{

+    CheckPointer(pConnector,E_POINTER);

+    CheckPointer(pmt,E_POINTER);

+    ValidateReadPtr(pConnector,sizeof(IPin));

+    ValidateReadPtr(pmt,sizeof(AM_MEDIA_TYPE));

+    CAutoLock cObjectLock(m_pLock);

+

+    /* Are we already connected */

+    if (m_Connected) {

+        return VFW_E_ALREADY_CONNECTED;

+    }

+

+    /* See if the filter is active */

+    if (!IsStopped() && !m_bCanReconnectWhenActive) {

+        return VFW_E_NOT_STOPPED;

+    }

+

+    HRESULT hr = CheckConnect(pConnector);

+    if (FAILED(hr)) {

+        // Since the procedure is already returning an error code, there

+        // is nothing else this function can do to report the error.

+        EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) );

+

+#ifdef DXMPERF

+        PERFLOG_RXCONNECT( pConnector, (IPin *) this, hr, pmt );

+#endif // DXMPERF

+

+        return hr;

+    }

+

+    /* Ask derived class if this media type is ok */

+

+    CMediaType * pcmt = (CMediaType*) pmt;

+    hr = CheckMediaType(pcmt);

+    if (hr != NOERROR) {

+        // no -we don't support this media type

+

+        // Since the procedure is already returning an error code, there

+        // is nothing else this function can do to report the error.

+        EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) );

+

+        // return a specific media type error if there is one

+        // or map a general failure code to something more helpful

+        // (in particular S_FALSE gets changed to an error code)

+        if (SUCCEEDED(hr) ||

+            (hr == E_FAIL) ||

+            (hr == E_INVALIDARG)) {

+            hr = VFW_E_TYPE_NOT_ACCEPTED;

+        }

+

+#ifdef DXMPERF

+        PERFLOG_RXCONNECT( pConnector, (IPin *) this, hr, pmt );

+#endif // DXMPERF

+

+        return hr;

+    }

+

+    /* Complete the connection */

+

+    m_Connected = pConnector;

+    m_Connected->AddRef();

+    hr = SetMediaType(pcmt);

+    if (SUCCEEDED(hr)) {

+        hr = CompleteConnect(pConnector);

+        if (SUCCEEDED(hr)) {

+

+#ifdef DXMPERF

+            PERFLOG_RXCONNECT( pConnector, (IPin *) this, NOERROR, pmt );

+#endif // DXMPERF

+

+            return NOERROR;

+        }

+    }

+

+    DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Failed to set the media type or failed to complete the connection.")));

+    m_Connected->Release();

+    m_Connected = NULL;

+

+    // Since the procedure is already returning an error code, there

+    // is nothing else this function can do to report the error.

+    EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) );

+

+#ifdef DXMPERF

+    PERFLOG_RXCONNECT( pConnector, (IPin *) this, hr, pmt );

+#endif // DXMPERF

+

+    return hr;

+}

+

+

+/* Called when we want to terminate a pin connection */

+

+STDMETHODIMP

+CBasePin::Disconnect()

+{

+    CAutoLock cObjectLock(m_pLock);

+

+    /* See if the filter is active */

+    if (!IsStopped()) {

+        return VFW_E_NOT_STOPPED;

+    }

+

+    return DisconnectInternal();

+}

+

+STDMETHODIMP

+CBasePin::DisconnectInternal()

+{

+    ASSERT(CritCheckIn(m_pLock));

+

+    if (m_Connected) {

+        HRESULT hr = BreakConnect();

+        if( FAILED( hr ) ) {

+

+#ifdef DXMPERF

+            PERFLOG_DISCONNECT( (IPin *) this, m_Connected, hr );

+#endif // DXMPERF

+

+            // There is usually a bug in the program if BreakConnect() fails.

+            DbgBreak( "WARNING: BreakConnect() failed in CBasePin::Disconnect()." );

+            return hr;

+        }

+

+        m_Connected->Release();

+        m_Connected = NULL;

+

+#ifdef DXMPERF

+        PERFLOG_DISCONNECT( (IPin *) this, m_Connected, S_OK );

+#endif // DXMPERF

+

+        return S_OK;

+    } else {

+        // no connection - not an error

+

+#ifdef DXMPERF

+        PERFLOG_DISCONNECT( (IPin *) this, m_Connected, S_FALSE );

+#endif // DXMPERF

+

+        return S_FALSE;

+    }

+}

+

+

+/* Return an AddRef()'d pointer to the connected pin if there is one */

+STDMETHODIMP

+CBasePin::ConnectedTo(

+    __deref_out IPin **ppPin

+)

+{

+    CheckPointer(ppPin,E_POINTER);

+    ValidateReadWritePtr(ppPin,sizeof(IPin *));

+    //

+    //  It's pointless to lock here.

+    //  The caller should ensure integrity.

+    //

+

+    IPin *pPin = m_Connected;

+    *ppPin = pPin;

+    if (pPin != NULL) {

+        pPin->AddRef();

+        return S_OK;

+    } else {

+        ASSERT(*ppPin == NULL);

+        return VFW_E_NOT_CONNECTED;

+    }

+}

+

+/* Return the media type of the connection */

+STDMETHODIMP

+CBasePin::ConnectionMediaType(

+    __out AM_MEDIA_TYPE *pmt

+)

+{

+    CheckPointer(pmt,E_POINTER);

+    ValidateReadWritePtr(pmt,sizeof(AM_MEDIA_TYPE));

+    CAutoLock cObjectLock(m_pLock);

+

+    /*  Copy constructor of m_mt allocates the memory */

+    if (IsConnected()) {

+        CopyMediaType( pmt, &m_mt );

+        return S_OK;

+    } else {

+        ((CMediaType *)pmt)->InitMediaType();

+        return VFW_E_NOT_CONNECTED;

+    }

+}

+

+/* Return information about the filter we are connect to */

+

+STDMETHODIMP

+CBasePin::QueryPinInfo(

+    __out PIN_INFO * pInfo

+)

+{

+    CheckPointer(pInfo,E_POINTER);

+    ValidateReadWritePtr(pInfo,sizeof(PIN_INFO));

+

+    pInfo->pFilter = m_pFilter;

+    if (m_pFilter) {

+        m_pFilter->AddRef();

+    }

+

+    if (m_pName) {

+        (void)StringCchCopyW(pInfo->achName, NUMELMS(pInfo->achName), m_pName);

+    } else {

+        pInfo->achName[0] = L'\0';

+    }

+

+    pInfo->dir = m_dir;

+

+    return NOERROR;

+}

+

+STDMETHODIMP

+CBasePin::QueryDirection(

+    __out PIN_DIRECTION * pPinDir

+)

+{

+    CheckPointer(pPinDir,E_POINTER);

+    ValidateReadWritePtr(pPinDir,sizeof(PIN_DIRECTION));

+

+    *pPinDir = m_dir;

+    return NOERROR;

+}

+

+// Default QueryId to return the pin's name

+STDMETHODIMP

+CBasePin::QueryId(

+    __deref_out LPWSTR * Id

+)

+{

+    //  We're not going away because someone's got a pointer to us

+    //  so there's no need to lock

+

+    return AMGetWideString(Name(), Id);

+}

+

+/* Does this pin support this media type WARNING this interface function does

+   not lock the main object as it is meant to be asynchronous by nature - if

+   the media types you support depend on some internal state that is updated

+   dynamically then you will need to implement locking in a derived class */

+

+STDMETHODIMP

+CBasePin::QueryAccept(

+    const AM_MEDIA_TYPE *pmt

+)

+{

+    CheckPointer(pmt,E_POINTER);

+    ValidateReadPtr(pmt,sizeof(AM_MEDIA_TYPE));

+

+    /* The CheckMediaType method is valid to return error codes if the media

+       type is horrible, an example might be E_INVALIDARG. What we do here

+       is map all the error codes into either S_OK or S_FALSE regardless */

+

+    HRESULT hr = CheckMediaType((CMediaType*)pmt);

+    if (FAILED(hr)) {

+        return S_FALSE;

+    }

+    // note that the only defined success codes should be S_OK and S_FALSE...

+    return hr;

+}

+

+

+/* This can be called to return an enumerator for the pin's list of preferred

+   media types. An input pin is not obliged to have any preferred formats

+   although it can do. For example, the window renderer has a preferred type

+   which describes a video image that matches the current window size. All

+   output pins should expose at least one preferred format otherwise it is

+   possible that neither pin has any types and so no connection is possible */

+

+STDMETHODIMP

+CBasePin::EnumMediaTypes(

+    __deref_out IEnumMediaTypes **ppEnum

+)

+{

+    CheckPointer(ppEnum,E_POINTER);

+    ValidateReadWritePtr(ppEnum,sizeof(IEnumMediaTypes *));

+

+    /* Create a new ref counted enumerator */

+

+    *ppEnum = new CEnumMediaTypes(this,

+                              NULL);

+

+    if (*ppEnum == NULL) {

+        return E_OUTOFMEMORY;

+    }

+

+    return NOERROR;

+}

+

+

+

+/* This is a virtual function that returns a media type corresponding with

+   place iPosition in the list. This base class simply returns an error as

+   we support no media types by default but derived classes should override */

+

+HRESULT CBasePin::GetMediaType(int iPosition, __inout CMediaType *pMediaType)

+{

+    UNREFERENCED_PARAMETER(iPosition);

+    UNREFERENCED_PARAMETER(pMediaType);

+    return E_UNEXPECTED;

+}

+

+

+/* This is a virtual function that returns the current media type version.

+   The base class initialises the media type enumerators with the value 1

+   By default we always returns that same value. A Derived class may change

+   the list of media types available and after doing so it should increment

+   the version either in a method derived from this, or more simply by just

+   incrementing the m_TypeVersion base pin variable. The type enumerators

+   call this when they want to see if their enumerations are out of date */

+

+LONG CBasePin::GetMediaTypeVersion()

+{

+    return m_TypeVersion;

+}

+

+

+/* Increment the cookie representing the current media type version */

+

+void CBasePin::IncrementTypeVersion()

+{

+    InterlockedIncrement(&m_TypeVersion);

+}

+

+

+/* Called by IMediaFilter implementation when the state changes from Stopped

+   to either paused or running and in derived classes could do things like

+   commit memory and grab hardware resource (the default is to do nothing) */

+

+HRESULT

+CBasePin::Active(void)

+{

+    return NOERROR;

+}

+

+/* Called by IMediaFilter implementation when the state changes from

+   to either paused to running and in derived classes could do things like

+   commit memory and grab hardware resource (the default is to do nothing) */

+

+HRESULT

+CBasePin::Run(REFERENCE_TIME tStart)

+{

+    UNREFERENCED_PARAMETER(tStart);

+    return NOERROR;

+}

+

+

+/* Also called by the IMediaFilter implementation when the state changes to

+   Stopped at which point you should decommit allocators and free hardware

+   resources you grabbed in the Active call (default is also to do nothing) */

+

+HRESULT

+CBasePin::Inactive(void)

+{

+    m_bRunTimeError = FALSE;

+    return NOERROR;

+}

+

+

+// Called when no more data will arrive

+STDMETHODIMP

+CBasePin::EndOfStream(void)

+{

+    return S_OK;

+}

+

+

+STDMETHODIMP

+CBasePin::SetSink(IQualityControl * piqc)

+{

+    CAutoLock cObjectLock(m_pLock);

+    if (piqc) ValidateReadPtr(piqc,sizeof(IQualityControl));

+    m_pQSink = piqc;

+    return NOERROR;

+} // SetSink

+

+

+STDMETHODIMP

+CBasePin::Notify(IBaseFilter * pSender, Quality q)

+{

+    UNREFERENCED_PARAMETER(q);

+    UNREFERENCED_PARAMETER(pSender);

+    DbgBreak("IQualityControl::Notify not over-ridden from CBasePin.  (IGNORE is OK)");

+    return E_NOTIMPL;

+} //Notify

+

+

+// NewSegment notifies of the start/stop/rate applying to the data

+// about to be received. Default implementation records data and

+// returns S_OK.

+// Override this to pass downstream.

+STDMETHODIMP

+CBasePin::NewSegment(

+                REFERENCE_TIME tStart,

+                REFERENCE_TIME tStop,

+                double dRate)

+{

+    m_tStart = tStart;

+    m_tStop = tStop;

+    m_dRate = dRate;

+

+    return S_OK;

+}

+

+

+//=====================================================================

+//=====================================================================

+// Implements CBaseOutputPin

+//=====================================================================

+//=====================================================================

+

+

+CBaseOutputPin::CBaseOutputPin(__in_opt LPCTSTR pObjectName,

+                   __in CBaseFilter *pFilter,

+                   __in CCritSec *pLock,

+                   __inout HRESULT *phr,

+                   __in_opt LPCWSTR pName) :

+    CBasePin(pObjectName, pFilter, pLock, phr, pName, PINDIR_OUTPUT),

+    m_pAllocator(NULL),

+    m_pInputPin(NULL)

+{

+    ASSERT(pFilter);

+}

+

+#ifdef UNICODE

+CBaseOutputPin::CBaseOutputPin(__in_opt LPCSTR pObjectName,

+                   __in CBaseFilter *pFilter,

+                   __in CCritSec *pLock,

+                   __inout HRESULT *phr,

+                   __in_opt LPCWSTR pName) :

+    CBasePin(pObjectName, pFilter, pLock, phr, pName, PINDIR_OUTPUT),

+    m_pAllocator(NULL),

+    m_pInputPin(NULL)

+{

+    ASSERT(pFilter);

+}

+#endif

+

+/*   This is called after a media type has been proposed

+

+     Try to complete the connection by agreeing the allocator

+*/

+HRESULT

+CBaseOutputPin::CompleteConnect(IPin *pReceivePin)

+{

+    UNREFERENCED_PARAMETER(pReceivePin);

+    return DecideAllocator(m_pInputPin, &m_pAllocator);

+}

+

+

+/* This method is called when the output pin is about to try and connect to

+   an input pin. It is at this point that you should try and grab any extra

+   interfaces that you need, in this case IMemInputPin. Because this is

+   only called if we are not currently connected we do NOT need to call

+   BreakConnect. This also makes it easier to derive classes from us as

+   BreakConnect is only called when we actually have to break a connection

+   (or a partly made connection) and not when we are checking a connection */

+

+/* Overriden from CBasePin */

+

+HRESULT

+CBaseOutputPin::CheckConnect(IPin * pPin)

+{

+    HRESULT hr = CBasePin::CheckConnect(pPin);

+    if (FAILED(hr)) {

+    return hr;

+    }

+

+    // get an input pin and an allocator interface

+    hr = pPin->QueryInterface(IID_IMemInputPin, (void **) &m_pInputPin);

+    if (FAILED(hr)) {

+        return hr;

+    }

+    return NOERROR;

+}

+

+

+/* Overriden from CBasePin */

+

+HRESULT

+CBaseOutputPin::BreakConnect()

+{

+    /* Release any allocator we hold */

+

+    if (m_pAllocator) {

+        // Always decommit the allocator because a downstream filter may or

+        // may not decommit the connection's allocator.  A memory leak could

+        // occur if the allocator is not decommited when a connection is broken.

+        HRESULT hr = m_pAllocator->Decommit();

+        if( FAILED( hr ) ) {

+            return hr;

+        }

+

+        m_pAllocator->Release();

+        m_pAllocator = NULL;

+    }

+

+    /* Release any input pin interface we hold */

+

+    if (m_pInputPin) {

+        m_pInputPin->Release();

+        m_pInputPin = NULL;

+    }

+    return NOERROR;

+}

+

+

+/* This is called when the input pin didn't give us a valid allocator */

+

+HRESULT

+CBaseOutputPin::InitAllocator(__deref_out IMemAllocator **ppAlloc)

+{

+    return CreateMemoryAllocator(ppAlloc);

+}

+

+

+/* Decide on an allocator, override this if you want to use your own allocator

+   Override DecideBufferSize to call SetProperties. If the input pin fails

+   the GetAllocator call then this will construct a CMemAllocator and call

+   DecideBufferSize on that, and if that fails then we are completely hosed.

+   If the you succeed the DecideBufferSize call, we will notify the input

+   pin of the selected allocator. NOTE this is called during Connect() which

+   therefore looks after grabbing and locking the object's critical section */

+

+// We query the input pin for its requested properties and pass this to

+// DecideBufferSize to allow it to fulfill requests that it is happy

+// with (eg most people don't care about alignment and are thus happy to

+// use the downstream pin's alignment request).

+

+HRESULT

+CBaseOutputPin::DecideAllocator(IMemInputPin *pPin, __deref_out IMemAllocator **ppAlloc)

+{

+    HRESULT hr = NOERROR;

+    *ppAlloc = NULL;

+

+    // get downstream prop request

+    // the derived class may modify this in DecideBufferSize, but

+    // we assume that he will consistently modify it the same way,

+    // so we only get it once

+    ALLOCATOR_PROPERTIES prop;

+    ZeroMemory(&prop, sizeof(prop));

+

+    // whatever he returns, we assume prop is either all zeros

+    // or he has filled it out.

+    pPin->GetAllocatorRequirements(&prop);

+

+    // if he doesn't care about alignment, then set it to 1

+    if (prop.cbAlign == 0) {

+        prop.cbAlign = 1;

+    }

+

+    /* Try the allocator provided by the input pin */

+

+    hr = pPin->GetAllocator(ppAlloc);

+    if (SUCCEEDED(hr)) {

+

+        hr = DecideBufferSize(*ppAlloc, &prop);

+        if (SUCCEEDED(hr)) {

+            hr = pPin->NotifyAllocator(*ppAlloc, FALSE);

+            if (SUCCEEDED(hr)) {

+                return NOERROR;

+            }

+        }

+    }

+

+    /* If the GetAllocator failed we may not have an interface */

+

+    if (*ppAlloc) {

+        (*ppAlloc)->Release();

+        *ppAlloc = NULL;

+    }

+

+    /* Try the output pin's allocator by the same method */

+

+    hr = InitAllocator(ppAlloc);

+    if (SUCCEEDED(hr)) {

+

+        // note - the properties passed here are in the same

+        // structure as above and may have been modified by

+        // the previous call to DecideBufferSize

+        hr = DecideBufferSize(*ppAlloc, &prop);

+        if (SUCCEEDED(hr)) {

+            hr = pPin->NotifyAllocator(*ppAlloc, FALSE);

+            if (SUCCEEDED(hr)) {

+                return NOERROR;

+            }

+        }

+    }

+

+    /* Likewise we may not have an interface to release */

+

+    if (*ppAlloc) {

+        (*ppAlloc)->Release();

+        *ppAlloc = NULL;

+    }

+    return hr;

+}

+

+

+/* This returns an empty sample buffer from the allocator WARNING the same

+   dangers and restrictions apply here as described below for Deliver() */

+

+HRESULT

+CBaseOutputPin::GetDeliveryBuffer(__deref_out IMediaSample ** ppSample,

+                                  __in_opt REFERENCE_TIME * pStartTime,

+                                  __in_opt REFERENCE_TIME * pEndTime,

+                                  DWORD dwFlags)

+{

+    if (m_pAllocator != NULL) {

+        return m_pAllocator->GetBuffer(ppSample,pStartTime,pEndTime,dwFlags);

+    } else {

+        return E_NOINTERFACE;

+    }

+}

+

+

+/* Deliver a filled-in sample to the connected input pin. NOTE the object must

+   have locked itself before calling us otherwise we may get halfway through

+   executing this method only to find the filter graph has got in and

+   disconnected us from the input pin. If the filter has no worker threads

+   then the lock is best applied on Receive(), otherwise it should be done

+   when the worker thread is ready to deliver. There is a wee snag to worker

+   threads that this shows up. The worker thread must lock the object when

+   it is ready to deliver a sample, but it may have to wait until a state

+   change has completed, but that may never complete because the state change

+   is waiting for the worker thread to complete. The way to handle this is for

+   the state change code to grab the critical section, then set an abort event

+   for the worker thread, then release the critical section and wait for the

+   worker thread to see the event we set and then signal that it has finished

+   (with another event). At which point the state change code can complete */

+

+// note (if you've still got any breath left after reading that) that you

+// need to release the sample yourself after this call. if the connected

+// input pin needs to hold onto the sample beyond the call, it will addref

+// the sample itself.

+

+// of course you must release this one and call GetDeliveryBuffer for the

+// next. You cannot reuse it directly.

+

+HRESULT

+CBaseOutputPin::Deliver(IMediaSample * pSample)

+{

+    if (m_pInputPin == NULL) {

+        return VFW_E_NOT_CONNECTED;

+    }

+

+#ifdef DXMPERF

+    PERFLOG_DELIVER( m_pName ? m_pName : L"CBaseOutputPin", (IPin *) this, (IPin  *) m_pInputPin, pSample, &m_mt );

+#endif // DXMPERF

+

+    return m_pInputPin->Receive(pSample);

+}

+

+

+// called from elsewhere in our filter to pass EOS downstream to

+// our connected input pin

+HRESULT

+CBaseOutputPin::DeliverEndOfStream(void)

+{

+    // remember this is on IPin not IMemInputPin

+    if (m_Connected == NULL) {

+        return VFW_E_NOT_CONNECTED;

+    }

+    return m_Connected->EndOfStream();

+}

+

+

+/* Commit the allocator's memory, this is called through IMediaFilter

+   which is responsible for locking the object before calling us */

+

+HRESULT

+CBaseOutputPin::Active(void)

+{

+    if (m_pAllocator == NULL) {

+        return VFW_E_NO_ALLOCATOR;

+    }

+    return m_pAllocator->Commit();

+}

+

+

+/* Free up or unprepare allocator's memory, this is called through

+   IMediaFilter which is responsible for locking the object first */

+

+HRESULT

+CBaseOutputPin::Inactive(void)

+{

+    m_bRunTimeError = FALSE;

+    if (m_pAllocator == NULL) {

+        return VFW_E_NO_ALLOCATOR;

+    }

+    return m_pAllocator->Decommit();

+}

+

+// we have a default handling of EndOfStream which is to return

+// an error, since this should be called on input pins only

+STDMETHODIMP

+CBaseOutputPin::EndOfStream(void)

+{

+    return E_UNEXPECTED;

+}

+

+

+// BeginFlush should be called on input pins only

+STDMETHODIMP

+CBaseOutputPin::BeginFlush(void)

+{

+    return E_UNEXPECTED;

+}

+

+// EndFlush should be called on input pins only

+STDMETHODIMP

+CBaseOutputPin::EndFlush(void)

+{

+    return E_UNEXPECTED;

+}

+

+// call BeginFlush on the connected input pin

+HRESULT

+CBaseOutputPin::DeliverBeginFlush(void)

+{

+    // remember this is on IPin not IMemInputPin

+    if (m_Connected == NULL) {

+        return VFW_E_NOT_CONNECTED;

+    }

+    return m_Connected->BeginFlush();

+}

+

+// call EndFlush on the connected input pin

+HRESULT

+CBaseOutputPin::DeliverEndFlush(void)

+{

+    // remember this is on IPin not IMemInputPin

+    if (m_Connected == NULL) {

+        return VFW_E_NOT_CONNECTED;

+    }

+    return m_Connected->EndFlush();

+}

+// deliver NewSegment to connected pin

+HRESULT

+CBaseOutputPin::DeliverNewSegment(

+    REFERENCE_TIME tStart,

+    REFERENCE_TIME tStop,

+    double dRate)

+{

+    if (m_Connected == NULL) {

+        return VFW_E_NOT_CONNECTED;

+    }

+    return m_Connected->NewSegment(tStart, tStop, dRate);

+}

+

+

+//=====================================================================

+//=====================================================================

+// Implements CBaseInputPin

+//=====================================================================

+//=====================================================================

+

+

+/* Constructor creates a default allocator object */

+

+CBaseInputPin::CBaseInputPin(__in_opt LPCTSTR pObjectName,

+                 __in CBaseFilter *pFilter,

+                 __in CCritSec *pLock,

+                 __inout HRESULT *phr,

+                 __in_opt LPCWSTR pPinName) :

+    CBasePin(pObjectName, pFilter, pLock, phr, pPinName, PINDIR_INPUT),

+    m_pAllocator(NULL),

+    m_bReadOnly(FALSE),

+    m_bFlushing(FALSE)

+{

+    ZeroMemory(&m_SampleProps, sizeof(m_SampleProps));

+}

+

+#ifdef UNICODE

+CBaseInputPin::CBaseInputPin(__in LPCSTR pObjectName,

+                 __in CBaseFilter *pFilter,

+                 __in CCritSec *pLock,

+                 __inout HRESULT *phr,

+                 __in_opt LPCWSTR pPinName) :

+    CBasePin(pObjectName, pFilter, pLock, phr, pPinName, PINDIR_INPUT),

+    m_pAllocator(NULL),

+    m_bReadOnly(FALSE),

+    m_bFlushing(FALSE)

+{

+    ZeroMemory(&m_SampleProps, sizeof(m_SampleProps));

+}

+#endif

+

+/* Destructor releases it's reference count on the default allocator */

+

+CBaseInputPin::~CBaseInputPin()

+{

+    if (m_pAllocator != NULL) {

+    m_pAllocator->Release();

+    m_pAllocator = NULL;

+    }

+}

+

+

+// override this to publicise our interfaces

+STDMETHODIMP

+CBaseInputPin::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    /* Do we know about this interface */

+

+    if (riid == IID_IMemInputPin) {

+        return GetInterface((IMemInputPin *) this, ppv);

+    } else {

+        return CBasePin::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+/* Return the allocator interface that this input pin would like the output

+   pin to use. NOTE subsequent calls to GetAllocator should all return an

+   interface onto the SAME object so we create one object at the start

+

+   Note:

+       The allocator is Release()'d on disconnect and replaced on

+       NotifyAllocator().

+

+   Override this to provide your own allocator.

+*/

+

+STDMETHODIMP

+CBaseInputPin::GetAllocator(

+    __deref_out IMemAllocator **ppAllocator)

+{

+    CheckPointer(ppAllocator,E_POINTER);

+    ValidateReadWritePtr(ppAllocator,sizeof(IMemAllocator *));

+    CAutoLock cObjectLock(m_pLock);

+

+    if (m_pAllocator == NULL) {

+        HRESULT hr = CreateMemoryAllocator(&m_pAllocator);

+        if (FAILED(hr)) {

+            return hr;

+        }

+    }

+    ASSERT(m_pAllocator != NULL);

+    *ppAllocator = m_pAllocator;

+    m_pAllocator->AddRef();

+    return NOERROR;

+}

+

+

+/* Tell the input pin which allocator the output pin is actually going to use

+   Override this if you care - NOTE the locking we do both here and also in

+   GetAllocator is unnecessary but derived classes that do something useful

+   will undoubtedly have to lock the object so this might help remind people */

+

+STDMETHODIMP

+CBaseInputPin::NotifyAllocator(

+    IMemAllocator * pAllocator,

+    BOOL bReadOnly)

+{

+    CheckPointer(pAllocator,E_POINTER);

+    ValidateReadPtr(pAllocator,sizeof(IMemAllocator));

+    CAutoLock cObjectLock(m_pLock);

+

+    IMemAllocator *pOldAllocator = m_pAllocator;

+    pAllocator->AddRef();

+    m_pAllocator = pAllocator;

+

+    if (pOldAllocator != NULL) {

+        pOldAllocator->Release();

+    }

+

+    // the readonly flag indicates whether samples from this allocator should

+    // be regarded as readonly - if true, then inplace transforms will not be

+    // allowed.

+    m_bReadOnly = (BYTE)bReadOnly;

+    return NOERROR;

+}

+

+

+HRESULT

+CBaseInputPin::BreakConnect()

+{

+    /* We don't need our allocator any more */

+    if (m_pAllocator) {

+        // Always decommit the allocator because a downstream filter may or

+        // may not decommit the connection's allocator.  A memory leak could

+        // occur if the allocator is not decommited when a pin is disconnected.

+        HRESULT hr = m_pAllocator->Decommit();

+        if( FAILED( hr ) ) {

+            return hr;

+        }

+

+        m_pAllocator->Release();

+        m_pAllocator = NULL;

+    }

+

+    return S_OK;

+}

+

+

+/* Do something with this media sample - this base class checks to see if the

+   format has changed with this media sample and if so checks that the filter

+   will accept it, generating a run time error if not. Once we have raised a

+   run time error we set a flag so that no more samples will be accepted

+

+   It is important that any filter should override this method and implement

+   synchronization so that samples are not processed when the pin is

+   disconnected etc

+*/

+

+STDMETHODIMP

+CBaseInputPin::Receive(IMediaSample *pSample)

+{

+    CheckPointer(pSample,E_POINTER);

+    ValidateReadPtr(pSample,sizeof(IMediaSample));

+    ASSERT(pSample);

+

+    HRESULT hr = CheckStreaming();

+    if (S_OK != hr) {

+        return hr;

+    }

+

+#ifdef DXMPERF

+    PERFLOG_RECEIVE( m_pName ? m_pName : L"CBaseInputPin", (IPin *) m_Connected, (IPin *) this, pSample, &m_mt );

+#endif // DXMPERF

+

+

+    /* Check for IMediaSample2 */

+    IMediaSample2 *pSample2;

+    if (SUCCEEDED(pSample->QueryInterface(IID_IMediaSample2, (void **)&pSample2))) {

+        hr = pSample2->GetProperties(sizeof(m_SampleProps), (PBYTE)&m_SampleProps);

+        pSample2->Release();

+        if (FAILED(hr)) {

+            return hr;

+        }

+    } else {

+        /*  Get the properties the hard way */

+        m_SampleProps.cbData = sizeof(m_SampleProps);

+        m_SampleProps.dwTypeSpecificFlags = 0;

+        m_SampleProps.dwStreamId = AM_STREAM_MEDIA;

+        m_SampleProps.dwSampleFlags = 0;

+        if (S_OK == pSample->IsDiscontinuity()) {

+            m_SampleProps.dwSampleFlags |= AM_SAMPLE_DATADISCONTINUITY;

+        }

+        if (S_OK == pSample->IsPreroll()) {

+            m_SampleProps.dwSampleFlags |= AM_SAMPLE_PREROLL;

+        }

+        if (S_OK == pSample->IsSyncPoint()) {

+            m_SampleProps.dwSampleFlags |= AM_SAMPLE_SPLICEPOINT;

+        }

+        if (SUCCEEDED(pSample->GetTime(&m_SampleProps.tStart,

+                                       &m_SampleProps.tStop))) {

+            m_SampleProps.dwSampleFlags |= AM_SAMPLE_TIMEVALID |

+                                           AM_SAMPLE_STOPVALID;

+        }

+        if (S_OK == pSample->GetMediaType(&m_SampleProps.pMediaType)) {

+            m_SampleProps.dwSampleFlags |= AM_SAMPLE_TYPECHANGED;

+        }

+        pSample->GetPointer(&m_SampleProps.pbBuffer);

+        m_SampleProps.lActual = pSample->GetActualDataLength();

+        m_SampleProps.cbBuffer = pSample->GetSize();

+    }

+

+    /* Has the format changed in this sample */

+

+    if (!(m_SampleProps.dwSampleFlags & AM_SAMPLE_TYPECHANGED)) {

+        return NOERROR;

+    }

+

+    /* Check the derived class accepts this format */

+    /* This shouldn't fail as the source must call QueryAccept first */

+

+    hr = CheckMediaType((CMediaType *)m_SampleProps.pMediaType);

+

+    if (hr == NOERROR) {

+        return NOERROR;

+    }

+

+    /* Raise a runtime error if we fail the media type */

+

+    m_bRunTimeError = TRUE;

+    EndOfStream();

+    m_pFilter->NotifyEvent(EC_ERRORABORT,VFW_E_TYPE_NOT_ACCEPTED,0);

+    return VFW_E_INVALIDMEDIATYPE;

+}

+

+

+/*  Receive multiple samples */

+STDMETHODIMP

+CBaseInputPin::ReceiveMultiple (

+    __in_ecount(nSamples) IMediaSample **pSamples,

+    long nSamples,

+    __out long *nSamplesProcessed)

+{

+    CheckPointer(pSamples,E_POINTER);

+    ValidateReadPtr(pSamples,nSamples * sizeof(IMediaSample *));

+

+    HRESULT hr = S_OK;

+    *nSamplesProcessed = 0;

+    while (nSamples-- > 0) {

+         hr = Receive(pSamples[*nSamplesProcessed]);

+

+         /*  S_FALSE means don't send any more */

+         if (hr != S_OK) {

+             break;

+         }

+         (*nSamplesProcessed)++;

+    }

+    return hr;

+}

+

+/*  See if Receive() might block */

+STDMETHODIMP

+CBaseInputPin::ReceiveCanBlock()

+{

+    /*  Ask all the output pins if they block

+        If there are no output pin assume we do block

+    */

+    int cPins = m_pFilter->GetPinCount();

+    int cOutputPins = 0;

+    for (int c = 0; c < cPins; c++) {

+        CBasePin *pPin = m_pFilter->GetPin(c);

+        if (NULL == pPin) {

+            break;

+        }

+        PIN_DIRECTION pd;

+        HRESULT hr = pPin->QueryDirection(&pd);

+        if (FAILED(hr)) {

+            return hr;

+        }

+

+        if (pd == PINDIR_OUTPUT) {

+

+            IPin *pConnected;

+            hr = pPin->ConnectedTo(&pConnected);

+            if (SUCCEEDED(hr)) {

+                ASSERT(pConnected != NULL);

+                cOutputPins++;

+                IMemInputPin *pInputPin;

+                hr = pConnected->QueryInterface(

+                                              IID_IMemInputPin,

+                                              (void **)&pInputPin);

+                pConnected->Release();

+                if (SUCCEEDED(hr)) {

+                    hr = pInputPin->ReceiveCanBlock();

+                    pInputPin->Release();

+                    if (hr != S_FALSE) {

+                        return S_OK;

+                    }

+                } else {

+                    /*  There's a transport we don't understand here */

+                    return S_OK;

+                }

+            }

+        }

+    }

+    return cOutputPins == 0 ? S_OK : S_FALSE;

+}

+

+// Default handling for BeginFlush - call at the beginning

+// of your implementation (makes sure that all Receive calls

+// fail). After calling this, you need to free any queued data

+// and then call downstream.

+STDMETHODIMP

+CBaseInputPin::BeginFlush(void)

+{

+    //  BeginFlush is NOT synchronized with streaming but is part of

+    //  a control action - hence we synchronize with the filter

+    CAutoLock lck(m_pLock);

+

+    // if we are already in mid-flush, this is probably a mistake

+    // though not harmful - try to pick it up for now so I can think about it

+    ASSERT(!m_bFlushing);

+

+    // first thing to do is ensure that no further Receive calls succeed

+    m_bFlushing = TRUE;

+

+    // now discard any data and call downstream - must do that

+    // in derived classes

+    return S_OK;

+}

+

+// default handling for EndFlush - call at end of your implementation

+// - before calling this, ensure that there is no queued data and no thread

+// pushing any more without a further receive, then call downstream,

+// then call this method to clear the m_bFlushing flag and re-enable

+// receives

+STDMETHODIMP

+CBaseInputPin::EndFlush(void)

+{

+    //  Endlush is NOT synchronized with streaming but is part of

+    //  a control action - hence we synchronize with the filter

+    CAutoLock lck(m_pLock);

+

+    // almost certainly a mistake if we are not in mid-flush

+    ASSERT(m_bFlushing);

+

+    // before calling, sync with pushing thread and ensure

+    // no more data is going downstream, then call EndFlush on

+    // downstream pins.

+

+    // now re-enable Receives

+    m_bFlushing = FALSE;

+

+    // No more errors

+    m_bRunTimeError = FALSE;

+

+    return S_OK;

+}

+

+

+STDMETHODIMP

+CBaseInputPin::Notify(IBaseFilter * pSender, Quality q)

+{

+    UNREFERENCED_PARAMETER(q);

+    CheckPointer(pSender,E_POINTER);

+    ValidateReadPtr(pSender,sizeof(IBaseFilter));

+    DbgBreak("IQuality::Notify called on an input pin");

+    return NOERROR;

+} // Notify

+

+/* Free up or unprepare allocator's memory, this is called through

+   IMediaFilter which is responsible for locking the object first */

+

+HRESULT

+CBaseInputPin::Inactive(void)

+{

+    m_bRunTimeError = FALSE;

+    if (m_pAllocator == NULL) {

+        return VFW_E_NO_ALLOCATOR;

+    }

+

+    m_bFlushing = FALSE;

+

+    return m_pAllocator->Decommit();

+}

+

+// what requirements do we have of the allocator - override if you want

+// to support other people's allocators but need a specific alignment

+// or prefix.

+STDMETHODIMP

+CBaseInputPin::GetAllocatorRequirements(__out ALLOCATOR_PROPERTIES*pProps)

+{

+    UNREFERENCED_PARAMETER(pProps);

+    return E_NOTIMPL;

+}

+

+//  Check if it's OK to process data

+//

+HRESULT

+CBaseInputPin::CheckStreaming()

+{

+    //  Shouldn't be able to get any data if we're not connected!

+    ASSERT(IsConnected());

+

+    //  Don't process stuff in Stopped state

+    if (IsStopped()) {

+        return VFW_E_WRONG_STATE;

+    }

+    if (m_bFlushing) {

+        return S_FALSE;

+    }

+    if (m_bRunTimeError) {

+        return VFW_E_RUNTIME_ERROR;

+    }

+    return S_OK;

+}

+

+// Pass on the Quality notification q to

+// a. Our QualityControl sink (if we have one) or else

+// b. to our upstream filter

+// and if that doesn't work, throw it away with a bad return code

+HRESULT

+CBaseInputPin::PassNotify(Quality& q)

+{

+    // We pass the message on, which means that we find the quality sink

+    // for our input pin and send it there

+

+    DbgLog((LOG_TRACE,3,TEXT("Passing Quality notification through transform")));

+    if (m_pQSink!=NULL) {

+        return m_pQSink->Notify(m_pFilter, q);

+    } else {

+        // no sink set, so pass it upstream

+        HRESULT hr;

+        IQualityControl * pIQC;

+

+        hr = VFW_E_NOT_FOUND;                   // default

+        if (m_Connected) {

+            m_Connected->QueryInterface(IID_IQualityControl, (void**)&pIQC);

+

+            if (pIQC!=NULL) {

+                hr = pIQC->Notify(m_pFilter, q);

+                pIQC->Release();

+            }

+        }

+        return hr;

+    }

+

+} // PassNotify

+

+//=====================================================================

+//=====================================================================

+// Memory allocation class, implements CMediaSample

+//=====================================================================

+//=====================================================================

+

+

+/* NOTE The implementation of this class calls the CUnknown constructor with

+   a NULL outer unknown pointer. This has the effect of making us a self

+   contained class, ie any QueryInterface, AddRef or Release calls will be

+   routed to the class's NonDelegatingUnknown methods. You will typically

+   find that the classes that do this then override one or more of these

+   virtual functions to provide more specialised behaviour. A good example

+   of this is where a class wants to keep the QueryInterface internal but

+   still wants it's lifetime controlled by the external object */

+

+/* The last two parameters have default values of NULL and zero */

+

+CMediaSample::CMediaSample(__in_opt LPCTSTR pName,

+               __in_opt CBaseAllocator *pAllocator,

+               __inout_opt HRESULT *phr,

+               __in_bcount_opt(length) LPBYTE pBuffer,

+               LONG length) :

+    m_pBuffer(pBuffer),             // Initialise the buffer

+    m_cbBuffer(length),             // And it's length

+    m_lActual(length),              // By default, actual = length

+    m_pMediaType(NULL),             // No media type change

+    m_dwFlags(0),                   // Nothing set

+    m_cRef(0),                      // 0 ref count

+    m_dwTypeSpecificFlags(0),       // Type specific flags

+    m_dwStreamId(AM_STREAM_MEDIA),  // Stream id

+    m_pAllocator(pAllocator)        // Allocator

+{

+#ifdef DXMPERF

+    PERFLOG_CTOR( pName ? pName : L"CMediaSample", (IMediaSample *) this );

+#endif // DXMPERF

+

+    /* We must have an owner and it must also be derived from class

+       CBaseAllocator BUT we do not hold a reference count on it */

+

+    ASSERT(pAllocator);

+

+    if (length < 0) {

+        *phr = VFW_E_BUFFER_OVERFLOW;

+        m_cbBuffer = 0;

+    }

+}

+

+#ifdef UNICODE

+CMediaSample::CMediaSample(__in_opt LPCSTR pName,

+               __in_opt CBaseAllocator *pAllocator,

+               __inout_opt HRESULT *phr,

+               __in_bcount_opt(length) LPBYTE pBuffer,

+               LONG length) :

+    m_pBuffer(pBuffer),             // Initialise the buffer

+    m_cbBuffer(length),             // And it's length

+    m_lActual(length),              // By default, actual = length

+    m_pMediaType(NULL),             // No media type change

+    m_dwFlags(0),                   // Nothing set

+    m_cRef(0),                      // 0 ref count

+    m_dwTypeSpecificFlags(0),       // Type specific flags

+    m_dwStreamId(AM_STREAM_MEDIA),  // Stream id

+    m_pAllocator(pAllocator)        // Allocator

+{

+#ifdef DXMPERF

+    PERFLOG_CTOR( L"CMediaSample", (IMediaSample *) this );

+#endif // DXMPERF

+

+    /* We must have an owner and it must also be derived from class

+       CBaseAllocator BUT we do not hold a reference count on it */

+

+    ASSERT(pAllocator);

+}

+#endif

+

+/* Destructor deletes the media type memory */

+

+CMediaSample::~CMediaSample()

+{

+#ifdef DXMPERF

+    PERFLOG_DTOR( L"CMediaSample", (IMediaSample *) this );

+#endif // DXMPERF

+

+    if (m_pMediaType) {

+    DeleteMediaType(m_pMediaType);

+    }

+}

+

+/* Override this to publicise our interfaces */

+

+STDMETHODIMP

+CMediaSample::QueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    if (riid == IID_IMediaSample ||

+        riid == IID_IMediaSample2 ||

+        riid == IID_IUnknown) {

+        return GetInterface((IMediaSample *) this, ppv);

+    } else {

+        *ppv = NULL;

+        return E_NOINTERFACE;

+    }

+}

+

+STDMETHODIMP_(ULONG)

+CMediaSample::AddRef()

+{

+    return InterlockedIncrement(&m_cRef);

+}

+

+

+// --  CMediaSample lifetimes --

+//

+// On final release of this sample buffer it is not deleted but

+// returned to the freelist of the owning memory allocator

+//

+// The allocator may be waiting for the last buffer to be placed on the free

+// list in order to decommit all the memory, so the ReleaseBuffer() call may

+// result in this sample being deleted. We also need to hold a refcount on

+// the allocator to stop that going away until we have finished with this.

+// However, we cannot release the allocator before the ReleaseBuffer, as the

+// release may cause us to be deleted. Similarly we can't do it afterwards.

+//

+// Thus we must leave it to the allocator to hold an addref on our behalf.

+// When he issues us in GetBuffer, he addref's himself. When ReleaseBuffer

+// is called, he releases himself, possibly causing us and him to be deleted.

+

+

+STDMETHODIMP_(ULONG)

+CMediaSample::Release()

+{

+    /* Decrement our own private reference count */

+    LONG lRef;

+    if (m_cRef == 1) {

+        lRef = 0;

+        m_cRef = 0;

+    } else {

+        lRef = InterlockedDecrement(&m_cRef);

+    }

+    ASSERT(lRef >= 0);

+

+    DbgLog((LOG_MEMORY,3,TEXT("    Unknown %X ref-- = %d"),

+        this, m_cRef));

+

+    /* Did we release our final reference count */

+    if (lRef == 0) {

+        /* Free all resources */

+        if (m_dwFlags & Sample_TypeChanged) {

+            SetMediaType(NULL);

+        }

+        ASSERT(m_pMediaType == NULL);

+        m_dwFlags = 0;

+        m_dwTypeSpecificFlags = 0;

+        m_dwStreamId = AM_STREAM_MEDIA;

+

+        /* This may cause us to be deleted */

+        // Our refcount is reliably 0 thus no-one will mess with us

+        m_pAllocator->ReleaseBuffer(this);

+    }

+    return (ULONG)lRef;

+}

+

+

+// set the buffer pointer and length. Used by allocators that

+// want variable sized pointers or pointers into already-read data.

+// This is only available through a CMediaSample* not an IMediaSample*

+// and so cannot be changed by clients.

+HRESULT

+CMediaSample::SetPointer(__in_bcount(cBytes) BYTE * ptr, LONG cBytes)

+{

+    if (cBytes < 0) {

+        return VFW_E_BUFFER_OVERFLOW;

+    }

+    m_pBuffer = ptr;            // new buffer area (could be null)

+    m_cbBuffer = cBytes;        // length of buffer

+    m_lActual = cBytes;         // length of data in buffer (assume full)

+

+    return S_OK;

+}

+

+

+// get me a read/write pointer to this buffer's memory. I will actually

+// want to use sizeUsed bytes.

+STDMETHODIMP

+CMediaSample::GetPointer(__deref_out BYTE ** ppBuffer)

+{

+    ValidateReadWritePtr(ppBuffer,sizeof(BYTE *));

+

+    // creator must have set pointer either during

+    // constructor or by SetPointer

+    ASSERT(m_pBuffer);

+

+    *ppBuffer = m_pBuffer;

+    return NOERROR;

+}

+

+

+// return the size in bytes of this buffer

+STDMETHODIMP_(LONG)

+CMediaSample::GetSize(void)

+{

+    return m_cbBuffer;

+}

+

+

+// get the stream time at which this sample should start and finish.

+STDMETHODIMP

+CMediaSample::GetTime(

+    __out REFERENCE_TIME * pTimeStart,     // put time here

+    __out REFERENCE_TIME * pTimeEnd

+)

+{

+    ValidateReadWritePtr(pTimeStart,sizeof(REFERENCE_TIME));

+    ValidateReadWritePtr(pTimeEnd,sizeof(REFERENCE_TIME));

+

+    if (!(m_dwFlags & Sample_StopValid)) {

+        if (!(m_dwFlags & Sample_TimeValid)) {

+            return VFW_E_SAMPLE_TIME_NOT_SET;

+        } else {

+            *pTimeStart = m_Start;

+

+            //  Make sure old stuff works

+            *pTimeEnd = m_Start + 1;

+            return VFW_S_NO_STOP_TIME;

+        }

+    }

+

+    *pTimeStart = m_Start;

+    *pTimeEnd = m_End;

+    return NOERROR;

+}

+

+

+// Set the stream time at which this sample should start and finish.

+// NULL pointers means the time is reset

+STDMETHODIMP

+CMediaSample::SetTime(

+    __in_opt REFERENCE_TIME * pTimeStart,

+    __in_opt REFERENCE_TIME * pTimeEnd

+)

+{

+    if (pTimeStart == NULL) {

+        ASSERT(pTimeEnd == NULL);

+        m_dwFlags &= ~(Sample_TimeValid | Sample_StopValid);

+    } else {

+        if (pTimeEnd == NULL) {

+            m_Start = *pTimeStart;

+            m_dwFlags |= Sample_TimeValid;

+            m_dwFlags &= ~Sample_StopValid;

+        } else {

+            ValidateReadPtr(pTimeStart,sizeof(REFERENCE_TIME));

+            ValidateReadPtr(pTimeEnd,sizeof(REFERENCE_TIME));

+            ASSERT(*pTimeEnd >= *pTimeStart);

+

+            m_Start = *pTimeStart;

+            m_End = *pTimeEnd;

+            m_dwFlags |= Sample_TimeValid | Sample_StopValid;

+        }

+    }

+    return NOERROR;

+}

+

+

+// get the media times (eg bytes) for this sample

+STDMETHODIMP

+CMediaSample::GetMediaTime(

+    __out LONGLONG * pTimeStart,

+    __out LONGLONG * pTimeEnd

+)

+{

+    ValidateReadWritePtr(pTimeStart,sizeof(LONGLONG));

+    ValidateReadWritePtr(pTimeEnd,sizeof(LONGLONG));

+

+    if (!(m_dwFlags & Sample_MediaTimeValid)) {

+        return VFW_E_MEDIA_TIME_NOT_SET;

+    }

+

+    *pTimeStart = m_MediaStart;

+    *pTimeEnd = (m_MediaStart + m_MediaEnd);

+    return NOERROR;

+}

+

+

+// Set the media times for this sample

+STDMETHODIMP

+CMediaSample::SetMediaTime(

+    __in_opt LONGLONG * pTimeStart,

+    __in_opt LONGLONG * pTimeEnd

+)

+{

+    if (pTimeStart == NULL) {

+        ASSERT(pTimeEnd == NULL);

+        m_dwFlags &= ~Sample_MediaTimeValid;

+    } else {

+        if (NULL == pTimeEnd) {

+            return E_POINTER;

+        }

+        ValidateReadPtr(pTimeStart,sizeof(LONGLONG));

+        ValidateReadPtr(pTimeEnd,sizeof(LONGLONG));

+        ASSERT(*pTimeEnd >= *pTimeStart);

+

+        m_MediaStart = *pTimeStart;

+        m_MediaEnd = (LONG)(*pTimeEnd - *pTimeStart);

+        m_dwFlags |= Sample_MediaTimeValid;

+    }

+    return NOERROR;

+}

+

+

+STDMETHODIMP

+CMediaSample::IsSyncPoint(void)

+{

+    if (m_dwFlags & Sample_SyncPoint) {

+        return S_OK;

+    } else {

+        return S_FALSE;

+    }

+}

+

+

+STDMETHODIMP

+CMediaSample::SetSyncPoint(BOOL bIsSyncPoint)

+{

+    if (bIsSyncPoint) {

+        m_dwFlags |= Sample_SyncPoint;

+    } else {

+        m_dwFlags &= ~Sample_SyncPoint;

+    }

+    return NOERROR;

+}

+

+// returns S_OK if there is a discontinuity in the data (this same is

+// not a continuation of the previous stream of data

+// - there has been a seek).

+STDMETHODIMP

+CMediaSample::IsDiscontinuity(void)

+{

+    if (m_dwFlags & Sample_Discontinuity) {

+        return S_OK;

+    } else {

+        return S_FALSE;

+    }

+}

+

+// set the discontinuity property - TRUE if this sample is not a

+// continuation, but a new sample after a seek.

+STDMETHODIMP

+CMediaSample::SetDiscontinuity(BOOL bDiscont)

+{

+    // should be TRUE or FALSE

+    if (bDiscont) {

+        m_dwFlags |= Sample_Discontinuity;

+    } else {

+        m_dwFlags &= ~Sample_Discontinuity;

+    }

+    return S_OK;

+}

+

+STDMETHODIMP

+CMediaSample::IsPreroll(void)

+{

+    if (m_dwFlags & Sample_Preroll) {

+        return S_OK;

+    } else {

+        return S_FALSE;

+    }

+}

+

+

+STDMETHODIMP

+CMediaSample::SetPreroll(BOOL bIsPreroll)

+{

+    if (bIsPreroll) {

+        m_dwFlags |= Sample_Preroll;

+    } else {

+        m_dwFlags &= ~Sample_Preroll;

+    }

+    return NOERROR;

+}

+

+STDMETHODIMP_(LONG)

+CMediaSample::GetActualDataLength(void)

+{

+    return m_lActual;

+}

+

+

+STDMETHODIMP

+CMediaSample::SetActualDataLength(LONG lActual)

+{

+    if (lActual > m_cbBuffer || lActual < 0) {

+        ASSERT(lActual <= GetSize());

+        return VFW_E_BUFFER_OVERFLOW;

+    }

+    m_lActual = lActual;

+    return NOERROR;

+}

+

+

+/* These allow for limited format changes in band */

+

+STDMETHODIMP

+CMediaSample::GetMediaType(__deref_out AM_MEDIA_TYPE **ppMediaType)

+{

+    ValidateReadWritePtr(ppMediaType,sizeof(AM_MEDIA_TYPE *));

+    ASSERT(ppMediaType);

+

+    /* Do we have a new media type for them */

+

+    if (!(m_dwFlags & Sample_TypeChanged)) {

+        ASSERT(m_pMediaType == NULL);

+        *ppMediaType = NULL;

+        return S_FALSE;

+    }

+

+    ASSERT(m_pMediaType);

+

+    /* Create a copy of our media type */

+

+    *ppMediaType = CreateMediaType(m_pMediaType);

+    if (*ppMediaType == NULL) {

+        return E_OUTOFMEMORY;

+    }

+    return NOERROR;

+}

+

+

+/* Mark this sample as having a different format type */

+

+STDMETHODIMP

+CMediaSample::SetMediaType(__in_opt AM_MEDIA_TYPE *pMediaType)

+{

+    /* Delete the current media type */

+

+    if (m_pMediaType) {

+        DeleteMediaType(m_pMediaType);

+        m_pMediaType = NULL;

+    }

+

+    /* Mechanism for resetting the format type */

+

+    if (pMediaType == NULL) {

+        m_dwFlags &= ~Sample_TypeChanged;

+        return NOERROR;

+    }

+

+    ASSERT(pMediaType);

+    ValidateReadPtr(pMediaType,sizeof(AM_MEDIA_TYPE));

+

+    /* Take a copy of the media type */

+

+    m_pMediaType = CreateMediaType(pMediaType);

+    if (m_pMediaType == NULL) {

+        m_dwFlags &= ~Sample_TypeChanged;

+        return E_OUTOFMEMORY;

+    }

+

+    m_dwFlags |= Sample_TypeChanged;

+    return NOERROR;

+}

+

+// Set and get properties (IMediaSample2)

+STDMETHODIMP CMediaSample::GetProperties(

+    DWORD cbProperties,

+    __out_bcount(cbProperties) BYTE * pbProperties

+)

+{

+    if (0 != cbProperties) {

+        CheckPointer(pbProperties, E_POINTER);

+        //  Return generic stuff up to the length

+        AM_SAMPLE2_PROPERTIES Props;

+        Props.cbData     = min(cbProperties, sizeof(Props));

+        Props.dwSampleFlags = m_dwFlags & ~Sample_MediaTimeValid;

+        Props.dwTypeSpecificFlags = m_dwTypeSpecificFlags;

+        Props.pbBuffer   = m_pBuffer;

+        Props.cbBuffer   = m_cbBuffer;

+        Props.lActual    = m_lActual;

+        Props.tStart     = m_Start;

+        Props.tStop      = m_End;

+        Props.dwStreamId = m_dwStreamId;

+        if (m_dwFlags & AM_SAMPLE_TYPECHANGED) {

+            Props.pMediaType = m_pMediaType;

+        } else {

+            Props.pMediaType = NULL;

+        }

+        CopyMemory(pbProperties, &Props, Props.cbData);

+    }

+    return S_OK;

+}

+

+#define CONTAINS_FIELD(type, field, offset) \

+    ((FIELD_OFFSET(type, field) + sizeof(((type *)0)->field)) <= offset)

+

+HRESULT CMediaSample::SetProperties(

+    DWORD cbProperties,

+    __in_bcount(cbProperties) const BYTE * pbProperties

+)

+{

+

+    /*  Generic properties */

+    AM_MEDIA_TYPE *pMediaType = NULL;

+

+    if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, cbData, cbProperties)) {

+        CheckPointer(pbProperties, E_POINTER);

+        AM_SAMPLE2_PROPERTIES *pProps =

+            (AM_SAMPLE2_PROPERTIES *)pbProperties;

+

+        /*  Don't use more data than is actually there */

+        if (pProps->cbData < cbProperties) {

+            cbProperties = pProps->cbData;

+        }

+        /*  We only handle IMediaSample2 */

+        if (cbProperties > sizeof(*pProps) ||

+            pProps->cbData > sizeof(*pProps)) {

+            return E_INVALIDARG;

+        }

+        /*  Do checks first, the assignments (for backout) */

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, dwSampleFlags, cbProperties)) {

+            /*  Check the flags */

+            if (pProps->dwSampleFlags &

+                    (~Sample_ValidFlags | Sample_MediaTimeValid)) {

+                return E_INVALIDARG;

+            }

+            /*  Check a flag isn't being set for a property

+                not being provided

+            */

+            if ((pProps->dwSampleFlags & AM_SAMPLE_TIMEVALID) &&

+                 !(m_dwFlags & AM_SAMPLE_TIMEVALID) &&

+                 !CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, tStop, cbProperties)) {

+                 return E_INVALIDARG;

+            }

+        }

+        /*  NB - can't SET the pointer or size */

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, pbBuffer, cbProperties)) {

+

+            /*  Check pbBuffer */

+            if (pProps->pbBuffer != 0 && pProps->pbBuffer != m_pBuffer) {

+                return E_INVALIDARG;

+            }

+        }

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, cbBuffer, cbProperties)) {

+

+            /*  Check cbBuffer */

+            if (pProps->cbBuffer != 0 && pProps->cbBuffer != m_cbBuffer) {

+                return E_INVALIDARG;

+            }

+        }

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, cbBuffer, cbProperties) &&

+            CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, lActual, cbProperties)) {

+

+            /*  Check lActual */

+            if (pProps->cbBuffer < pProps->lActual) {

+                return E_INVALIDARG;

+            }

+        }

+

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, pMediaType, cbProperties)) {

+

+            /*  Check pMediaType */

+            if (pProps->dwSampleFlags & AM_SAMPLE_TYPECHANGED) {

+                CheckPointer(pProps->pMediaType, E_POINTER);

+                pMediaType = CreateMediaType(pProps->pMediaType);

+                if (pMediaType == NULL) {

+                    return E_OUTOFMEMORY;

+                }

+            }

+        }

+

+        /*  Now do the assignments */

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, dwStreamId, cbProperties)) {

+            m_dwStreamId = pProps->dwStreamId;

+        }

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, dwSampleFlags, cbProperties)) {

+            /*  Set the flags */

+            m_dwFlags = pProps->dwSampleFlags |

+                                (m_dwFlags & Sample_MediaTimeValid);

+            m_dwTypeSpecificFlags = pProps->dwTypeSpecificFlags;

+        } else {

+            if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, dwTypeSpecificFlags, cbProperties)) {

+                m_dwTypeSpecificFlags = pProps->dwTypeSpecificFlags;

+            }

+        }

+

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, lActual, cbProperties)) {

+            /*  Set lActual */

+            m_lActual = pProps->lActual;

+        }

+

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, tStop, cbProperties)) {

+

+            /*  Set the times */

+            m_End   = pProps->tStop;

+        }

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, tStart, cbProperties)) {

+

+            /*  Set the times */

+            m_Start = pProps->tStart;

+        }

+

+        if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, pMediaType, cbProperties)) {

+            /*  Set pMediaType */

+            if (pProps->dwSampleFlags & AM_SAMPLE_TYPECHANGED) {

+                if (m_pMediaType != NULL) {

+                    DeleteMediaType(m_pMediaType);

+                }

+                m_pMediaType = pMediaType;

+            }

+        }

+

+        /*  Fix up the type changed flag to correctly reflect the current state

+            If, for instance the input contained no type change but the

+            output does then if we don't do this we'd lose the

+            output media type.

+        */

+        if (m_pMediaType) {

+            m_dwFlags |= Sample_TypeChanged;

+        } else {

+            m_dwFlags &= ~Sample_TypeChanged;

+        }

+    }

+

+    return S_OK;

+}

+

+

+//

+// The streaming thread calls IPin::NewSegment(), IPin::EndOfStream(),

+// IMemInputPin::Receive() and IMemInputPin::ReceiveMultiple() on the

+// connected input pin.  The application thread calls Block().  The

+// following class members can only be called by the streaming thread.

+//

+//    Deliver()

+//    DeliverNewSegment()

+//    StartUsingOutputPin()

+//    StopUsingOutputPin()

+//    ChangeOutputFormat()

+//    ChangeMediaType()

+//    DynamicReconnect()

+//

+// The following class members can only be called by the application thread.

+//

+//    Block()

+//    SynchronousBlockOutputPin()

+//    AsynchronousBlockOutputPin()

+//

+

+CDynamicOutputPin::CDynamicOutputPin(

+    __in_opt LPCTSTR pObjectName,

+    __in CBaseFilter *pFilter,

+    __in CCritSec *pLock,

+    __inout HRESULT *phr,

+    __in_opt LPCWSTR pName) :

+        CBaseOutputPin(pObjectName, pFilter, pLock, phr, pName),

+        m_hStopEvent(NULL),

+        m_pGraphConfig(NULL),

+        m_bPinUsesReadOnlyAllocator(FALSE),

+        m_BlockState(NOT_BLOCKED),

+        m_hUnblockOutputPinEvent(NULL),

+        m_hNotifyCallerPinBlockedEvent(NULL),

+        m_dwBlockCallerThreadID(0),

+        m_dwNumOutstandingOutputPinUsers(0)

+{

+    HRESULT hr = Initialize();

+    if( FAILED( hr ) ) {

+        *phr = hr;

+        return;

+    }

+}

+

+#ifdef UNICODE

+CDynamicOutputPin::CDynamicOutputPin(

+    __in_opt LPCSTR pObjectName,

+    __in CBaseFilter *pFilter,

+    __in CCritSec *pLock,

+    __inout HRESULT *phr,

+    __in_opt LPCWSTR pName) :

+        CBaseOutputPin(pObjectName, pFilter, pLock, phr, pName),

+        m_hStopEvent(NULL),

+        m_pGraphConfig(NULL),

+        m_bPinUsesReadOnlyAllocator(FALSE),

+        m_BlockState(NOT_BLOCKED),

+        m_hUnblockOutputPinEvent(NULL),

+        m_hNotifyCallerPinBlockedEvent(NULL),

+        m_dwBlockCallerThreadID(0),

+        m_dwNumOutstandingOutputPinUsers(0)

+{

+    HRESULT hr = Initialize();

+    if( FAILED( hr ) ) {

+        *phr = hr;

+        return;

+    }

+}

+#endif

+

+CDynamicOutputPin::~CDynamicOutputPin()

+{

+    if(NULL != m_hUnblockOutputPinEvent) {

+        // This call should not fail because we have access to m_hUnblockOutputPinEvent

+        // and m_hUnblockOutputPinEvent is a valid event.

+        EXECUTE_ASSERT(::CloseHandle(m_hUnblockOutputPinEvent));

+    }

+

+    if(NULL != m_hNotifyCallerPinBlockedEvent) {

+        // This call should not fail because we have access to m_hNotifyCallerPinBlockedEvent

+        // and m_hNotifyCallerPinBlockedEvent is a valid event.

+        EXECUTE_ASSERT(::CloseHandle(m_hNotifyCallerPinBlockedEvent));

+    }

+}

+

+HRESULT CDynamicOutputPin::Initialize(void)

+{

+    m_hUnblockOutputPinEvent = ::CreateEvent( NULL,   // The event will have the default security descriptor.

+                                              TRUE,   // This is a manual reset event.

+                                              TRUE,   // The event is initially signaled.

+                                              NULL ); // The event is not named.

+

+    // CreateEvent() returns NULL if an error occurs.

+    if(NULL == m_hUnblockOutputPinEvent) {

+        return AmGetLastErrorToHResult();

+    }

+

+    //  Set flag to say we can reconnect while streaming.

+    SetReconnectWhenActive(true);

+

+    return S_OK;

+}

+

+STDMETHODIMP CDynamicOutputPin::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    if(riid == IID_IPinFlowControl) {

+        return GetInterface(static_cast<IPinFlowControl*>(this), ppv);

+    } else {

+        return CBaseOutputPin::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+STDMETHODIMP CDynamicOutputPin::Disconnect(void)

+{

+    CAutoLock cObjectLock(m_pLock);

+    return DisconnectInternal();

+}

+

+STDMETHODIMP CDynamicOutputPin::Block(DWORD dwBlockFlags, HANDLE hEvent)

+{

+    const DWORD VALID_FLAGS = AM_PIN_FLOW_CONTROL_BLOCK;

+

+    // Check for illegal flags.

+    if(dwBlockFlags & ~VALID_FLAGS) {

+        return E_INVALIDARG;

+    }

+

+    // Make sure the event is unsignaled.

+    if((dwBlockFlags & AM_PIN_FLOW_CONTROL_BLOCK) && (NULL != hEvent)) {

+        if( !::ResetEvent( hEvent ) ) {

+            return AmGetLastErrorToHResult();

+        }

+    }

+

+    // No flags are set if we are unblocking the output pin.

+    if(0 == dwBlockFlags) {

+

+        // This parameter should be NULL because unblock operations are always synchronous.

+        // There is no need to notify the caller when the event is done.

+        if(NULL != hEvent) {

+            return E_INVALIDARG;

+        }

+    }

+

+    #ifdef DEBUG

+    AssertValid();

+    #endif // DEBUG

+

+    HRESULT hr;

+

+    if(dwBlockFlags & AM_PIN_FLOW_CONTROL_BLOCK) {

+        // IPinFlowControl::Block()'s hEvent parameter is NULL if the block is synchronous.

+        // If hEvent is not NULL, the block is asynchronous.

+        if(NULL == hEvent) {

+            hr = SynchronousBlockOutputPin();

+        } else {

+            hr = AsynchronousBlockOutputPin(hEvent);

+        }

+    } else {

+        hr = UnblockOutputPin();

+    }

+

+    #ifdef DEBUG

+    AssertValid();

+    #endif // DEBUG

+

+    if(FAILED(hr)) {

+        return hr;

+    }

+

+    return S_OK;

+}

+

+HRESULT CDynamicOutputPin::SynchronousBlockOutputPin(void)

+{

+    HANDLE hNotifyCallerPinBlockedEvent = :: CreateEvent( NULL,   // The event will have the default security attributes.

+                                                          FALSE,  // This is an automatic reset event.

+                                                          FALSE,  // The event is initially unsignaled.

+                                                          NULL ); // The event is not named.

+

+    // CreateEvent() returns NULL if an error occurs.

+    if(NULL == hNotifyCallerPinBlockedEvent) {

+        return AmGetLastErrorToHResult();

+    }

+

+    HRESULT hr = AsynchronousBlockOutputPin(hNotifyCallerPinBlockedEvent);

+    if(FAILED(hr)) {

+        // This call should not fail because we have access to hNotifyCallerPinBlockedEvent

+        // and hNotifyCallerPinBlockedEvent is a valid event.

+        EXECUTE_ASSERT(::CloseHandle(hNotifyCallerPinBlockedEvent));

+

+        return hr;

+    }

+

+    hr = WaitEvent(hNotifyCallerPinBlockedEvent);

+

+    // This call should not fail because we have access to hNotifyCallerPinBlockedEvent

+    // and hNotifyCallerPinBlockedEvent is a valid event.

+    EXECUTE_ASSERT(::CloseHandle(hNotifyCallerPinBlockedEvent));

+

+    if(FAILED(hr)) {

+        return hr;

+    }

+

+    return S_OK;

+}

+

+HRESULT CDynamicOutputPin::AsynchronousBlockOutputPin(HANDLE hNotifyCallerPinBlockedEvent)

+{

+    // This function holds the m_BlockStateLock because it uses

+    // m_dwBlockCallerThreadID, m_BlockState and

+    // m_hNotifyCallerPinBlockedEvent.

+    CAutoLock alBlockStateLock(&m_BlockStateLock);

+

+    if(NOT_BLOCKED != m_BlockState) {

+        if(m_dwBlockCallerThreadID == ::GetCurrentThreadId()) {

+            return VFW_E_PIN_ALREADY_BLOCKED_ON_THIS_THREAD;

+        } else {

+            return VFW_E_PIN_ALREADY_BLOCKED;

+        }

+    }

+

+    BOOL fSuccess = ::DuplicateHandle( ::GetCurrentProcess(),

+                                       hNotifyCallerPinBlockedEvent,

+                                       ::GetCurrentProcess(),

+                                       &m_hNotifyCallerPinBlockedEvent,

+                                       EVENT_MODIFY_STATE,

+                                       FALSE,

+                                       0 );

+    if( !fSuccess ) {

+        return AmGetLastErrorToHResult();

+    }

+

+    m_BlockState = PENDING;

+    m_dwBlockCallerThreadID = ::GetCurrentThreadId();

+

+    // The output pin cannot be blocked if the streaming thread is

+    // calling IPin::NewSegment(), IPin::EndOfStream(), IMemInputPin::Receive()

+    // or IMemInputPin::ReceiveMultiple() on the connected input pin.  Also, it

+    // cannot be blocked if the streaming thread is calling DynamicReconnect(),

+    // ChangeMediaType() or ChangeOutputFormat().

+    if(!StreamingThreadUsingOutputPin()) {

+

+        // The output pin can be immediately blocked.

+        BlockOutputPin();

+    }

+

+    return S_OK;

+}

+

+void CDynamicOutputPin::BlockOutputPin(void)

+{

+    // The caller should always hold the m_BlockStateLock because this function

+    // uses m_BlockState and m_hNotifyCallerPinBlockedEvent.

+    ASSERT(CritCheckIn(&m_BlockStateLock));

+

+    // This function should not be called if the streaming thread is modifying

+    // the connection state or it's passing data downstream.

+    ASSERT(!StreamingThreadUsingOutputPin());

+

+    // This should not fail because we successfully created the event

+    // and we have the security permissions to change it's state.

+    EXECUTE_ASSERT(::ResetEvent(m_hUnblockOutputPinEvent));

+

+    // This event should not fail because AsynchronousBlockOutputPin() successfully

+    // duplicated this handle and we have the appropriate security permissions.

+    EXECUTE_ASSERT(::SetEvent(m_hNotifyCallerPinBlockedEvent));

+    EXECUTE_ASSERT(::CloseHandle(m_hNotifyCallerPinBlockedEvent));

+

+    m_BlockState = BLOCKED;

+    m_hNotifyCallerPinBlockedEvent = NULL;

+}

+

+HRESULT CDynamicOutputPin::UnblockOutputPin(void)

+{

+    // UnblockOutputPin() holds the m_BlockStateLock because it

+    // uses m_BlockState, m_dwBlockCallerThreadID and

+    // m_hNotifyCallerPinBlockedEvent.

+    CAutoLock alBlockStateLock(&m_BlockStateLock);

+

+    if(NOT_BLOCKED == m_BlockState) {

+        return S_FALSE;

+    }

+

+    // This should not fail because we successfully created the event

+    // and we have the security permissions to change it's state.

+    EXECUTE_ASSERT(::SetEvent(m_hUnblockOutputPinEvent));

+

+    // Cancel the block operation if it's still pending.

+    if(NULL != m_hNotifyCallerPinBlockedEvent) {

+        // This event should not fail because AsynchronousBlockOutputPin() successfully

+        // duplicated this handle and we have the appropriate security permissions.

+        EXECUTE_ASSERT(::SetEvent(m_hNotifyCallerPinBlockedEvent));

+        EXECUTE_ASSERT(::CloseHandle(m_hNotifyCallerPinBlockedEvent));

+    }

+

+    m_BlockState = NOT_BLOCKED;

+    m_dwBlockCallerThreadID = 0;

+    m_hNotifyCallerPinBlockedEvent = NULL;

+

+    return S_OK;

+}

+

+HRESULT CDynamicOutputPin::StartUsingOutputPin(void)

+{

+    // The caller should not hold m_BlockStateLock.  If the caller does,

+    // a deadlock could occur.

+    ASSERT(CritCheckOut(&m_BlockStateLock));

+

+    CAutoLock alBlockStateLock(&m_BlockStateLock);

+

+    #ifdef DEBUG

+    AssertValid();

+    #endif // DEBUG

+

+    // Are we in the middle of a block operation?

+    while(BLOCKED == m_BlockState) {

+        m_BlockStateLock.Unlock();

+

+        // If this ASSERT fires, a deadlock could occur.  The caller should make sure

+        // that this thread never acquires the Block State lock more than once.

+        ASSERT(CritCheckOut( &m_BlockStateLock ));

+

+        // WaitForMultipleObjects() returns WAIT_OBJECT_0 if the unblock event

+        // is fired.  It returns WAIT_OBJECT_0 + 1 if the stop event if fired.

+        // See the Windows SDK documentation for more information on

+        // WaitForMultipleObjects().

+        const DWORD UNBLOCK = WAIT_OBJECT_0;

+        const DWORD STOP = WAIT_OBJECT_0 + 1;

+

+        HANDLE ahWaitEvents[] = { m_hUnblockOutputPinEvent, m_hStopEvent };

+        DWORD dwNumWaitEvents = sizeof(ahWaitEvents)/sizeof(HANDLE);

+

+        DWORD dwReturnValue = ::WaitForMultipleObjects( dwNumWaitEvents, ahWaitEvents, FALSE, INFINITE );

+

+        m_BlockStateLock.Lock();

+

+        #ifdef DEBUG

+        AssertValid();

+        #endif // DEBUG

+

+        switch( dwReturnValue ) {

+        case UNBLOCK:

+            break;

+

+        case STOP:

+            return VFW_E_STATE_CHANGED;

+

+        case WAIT_FAILED:

+            return AmGetLastErrorToHResult();

+

+        default:

+            DbgBreak( "An Unexpected case occured in CDynamicOutputPin::StartUsingOutputPin()." );

+            return E_UNEXPECTED;

+        }

+    }

+

+    m_dwNumOutstandingOutputPinUsers++;

+

+    #ifdef DEBUG

+    AssertValid();

+    #endif // DEBUG

+

+    return S_OK;

+}

+

+void CDynamicOutputPin::StopUsingOutputPin(void)

+{

+    CAutoLock alBlockStateLock(&m_BlockStateLock);

+

+    #ifdef DEBUG

+    AssertValid();

+    #endif // DEBUG

+

+    m_dwNumOutstandingOutputPinUsers--;

+

+    if((m_dwNumOutstandingOutputPinUsers == 0) && (NOT_BLOCKED != m_BlockState)) {

+        BlockOutputPin();

+    }

+

+    #ifdef DEBUG

+    AssertValid();

+    #endif // DEBUG

+}

+

+bool CDynamicOutputPin::StreamingThreadUsingOutputPin(void)

+{

+    CAutoLock alBlockStateLock(&m_BlockStateLock);

+

+    return (m_dwNumOutstandingOutputPinUsers > 0);

+}

+

+void CDynamicOutputPin::SetConfigInfo(IGraphConfig *pGraphConfig, HANDLE hStopEvent)

+{

+    // This pointer is not addrefed because filters are not allowed to

+    // hold references to the filter graph manager.  See the documentation for

+    // IBaseFilter::JoinFilterGraph() in the Direct Show SDK for more information.

+    m_pGraphConfig = pGraphConfig;

+

+    m_hStopEvent = hStopEvent;

+}

+

+HRESULT CDynamicOutputPin::Active(void)

+{

+    // Make sure the user initialized the object by calling SetConfigInfo().

+    if((NULL == m_hStopEvent) || (NULL == m_pGraphConfig)) {

+        DbgBreak( ERROR: CDynamicOutputPin::Active() failed because m_pGraphConfig and m_hStopEvent were not initialized.  Call SetConfigInfo() to initialize them. );

+        return E_FAIL;

+    }

+

+    // If this ASSERT fires, the user may have passed an invalid event handle to SetConfigInfo().

+    // The ASSERT can also fire if the event if destroyed and then Active() is called.  An event

+    // handle is invalid if 1) the event does not exist or the user does not have the security

+    // permissions to use the event.

+    EXECUTE_ASSERT(ResetEvent(m_hStopEvent));

+

+    return CBaseOutputPin::Active();

+}

+

+HRESULT CDynamicOutputPin::Inactive(void)

+{

+    // If this ASSERT fires, the user may have passed an invalid event handle to SetConfigInfo().

+    // The ASSERT can also fire if the event if destroyed and then Active() is called.  An event

+    // handle is invalid if 1) the event does not exist or the user does not have the security

+    // permissions to use the event.

+    EXECUTE_ASSERT(SetEvent(m_hStopEvent));

+

+    return CBaseOutputPin::Inactive();

+}

+

+HRESULT CDynamicOutputPin::DeliverBeginFlush(void)

+{

+    // If this ASSERT fires, the user may have passed an invalid event handle to SetConfigInfo().

+    // The ASSERT can also fire if the event if destroyed and then DeliverBeginFlush() is called.

+    // An event handle is invalid if 1) the event does not exist or the user does not have the security

+    // permissions to use the event.

+    EXECUTE_ASSERT(SetEvent(m_hStopEvent));

+

+    return CBaseOutputPin::DeliverBeginFlush();

+}

+

+HRESULT CDynamicOutputPin::DeliverEndFlush(void)

+{

+    // If this ASSERT fires, the user may have passed an invalid event handle to SetConfigInfo().

+    // The ASSERT can also fire if the event if destroyed and then DeliverBeginFlush() is called.

+    // An event handle is invalid if 1) the event does not exist or the user does not have the security

+    // permissions to use the event.

+    EXECUTE_ASSERT(ResetEvent(m_hStopEvent));

+

+    return CBaseOutputPin::DeliverEndFlush();

+}

+

+

+// ChangeOutputFormat() either dynamicly changes the connection's format type or it dynamicly

+// reconnects the output pin.

+HRESULT CDynamicOutputPin::ChangeOutputFormat

+    (

+    const AM_MEDIA_TYPE *pmt,

+    REFERENCE_TIME tSegmentStart,

+    REFERENCE_TIME tSegmentStop,

+    double dSegmentRate

+    )

+{

+    // The caller should call StartUsingOutputPin() before calling this

+    // method.

+    ASSERT(StreamingThreadUsingOutputPin());

+

+    // Callers should always pass a valid media type to ChangeOutputFormat() .

+    ASSERT(NULL != pmt);

+

+    CMediaType cmt(*pmt);

+    HRESULT hr = ChangeMediaType(&cmt);

+    if (FAILED(hr)) {

+        return hr;

+    }

+

+    hr = DeliverNewSegment(tSegmentStart, tSegmentStop, dSegmentRate);

+    if( FAILED( hr ) ) {

+        return hr;

+    }

+

+    return S_OK;

+}

+

+HRESULT CDynamicOutputPin::ChangeMediaType(const CMediaType *pmt)

+{

+    // The caller should call StartUsingOutputPin() before calling this

+    // method.

+    ASSERT(StreamingThreadUsingOutputPin());

+

+    // This function assumes the filter graph is running.

+    ASSERT(!IsStopped());

+

+    if(!IsConnected()) {

+        return VFW_E_NOT_CONNECTED;

+    }

+

+    /*  First check if the downstream pin will accept a dynamic

+        format change

+    */

+    QzCComPtr<IPinConnection> pConnection;

+

+    m_Connected->QueryInterface(IID_IPinConnection, (void **)&pConnection);

+    if(pConnection != NULL) {

+

+        if(S_OK == pConnection->DynamicQueryAccept(pmt)) {

+

+            HRESULT hr = ChangeMediaTypeHelper(pmt);

+            if(FAILED(hr)) {

+                return hr;

+            }

+

+            return S_OK;

+        }

+    }

+

+    /*  Can't do the dynamic connection */

+    return DynamicReconnect(pmt);

+}

+

+HRESULT CDynamicOutputPin::ChangeMediaTypeHelper(const CMediaType *pmt)

+{

+    // The caller should call StartUsingOutputPin() before calling this

+    // method.

+    ASSERT(StreamingThreadUsingOutputPin());

+

+    HRESULT hr = m_Connected->ReceiveConnection(this, pmt);

+    if(FAILED(hr)) {

+        return hr;

+    }

+

+    hr = SetMediaType(pmt);

+    if(FAILED(hr)) {

+        return hr;

+    }

+

+    // Does this pin use the local memory transport?

+    if(NULL != m_pInputPin) {

+        // This function assumes that m_pInputPin and m_Connected are

+        // two different interfaces to the same object.

+        ASSERT(::IsEqualObject(m_Connected, m_pInputPin));

+

+        ALLOCATOR_PROPERTIES apInputPinRequirements;

+        apInputPinRequirements.cbAlign = 0;

+        apInputPinRequirements.cbBuffer = 0;

+        apInputPinRequirements.cbPrefix = 0;

+        apInputPinRequirements.cBuffers = 0;

+

+        m_pInputPin->GetAllocatorRequirements(&apInputPinRequirements);

+

+        // A zero allignment does not make any sense.

+        if(0 == apInputPinRequirements.cbAlign) {

+            apInputPinRequirements.cbAlign = 1;

+        }

+

+        hr = m_pAllocator->Decommit();

+        if(FAILED(hr)) {

+            return hr;

+        }

+

+        hr = DecideBufferSize(m_pAllocator,  &apInputPinRequirements);

+        if(FAILED(hr)) {

+            return hr;

+        }

+

+        hr = m_pAllocator->Commit();

+        if(FAILED(hr)) {

+            return hr;

+        }

+

+        hr = m_pInputPin->NotifyAllocator(m_pAllocator, m_bPinUsesReadOnlyAllocator);

+        if(FAILED(hr)) {

+            return hr;

+        }

+    }

+

+    return S_OK;

+}

+

+// this method has to be called from the thread that is pushing data,

+// and it's the caller's responsibility to make sure that the thread

+// has no outstand samples because they cannot be delivered after a

+// reconnect

+//

+HRESULT CDynamicOutputPin::DynamicReconnect( const CMediaType* pmt )

+{

+    // The caller should call StartUsingOutputPin() before calling this

+    // method.

+    ASSERT(StreamingThreadUsingOutputPin());

+

+    if((m_pGraphConfig == NULL) || (NULL == m_hStopEvent)) {

+        return E_FAIL;

+    }

+

+    HRESULT hr = m_pGraphConfig->Reconnect(

+        this,

+        NULL,

+        pmt,

+        NULL,

+        m_hStopEvent,

+        AM_GRAPH_CONFIG_RECONNECT_CACHE_REMOVED_FILTERS );

+

+    return hr;

+}

+

+HRESULT CDynamicOutputPin::CompleteConnect(IPin *pReceivePin)

+{

+    HRESULT hr = CBaseOutputPin::CompleteConnect(pReceivePin);

+    if(SUCCEEDED(hr)) {

+        if(!IsStopped() && m_pAllocator) {

+            hr = m_pAllocator->Commit();

+            ASSERT(hr != VFW_E_ALREADY_COMMITTED);

+        }

+    }

+

+    return hr;

+}

+

+#ifdef DEBUG

+void CDynamicOutputPin::AssertValid(void)

+{

+    // Make sure the object was correctly initialized.

+

+    // This ASSERT only fires if the object failed to initialize

+    // and the user ignored the constructor's return code (phr).

+    ASSERT(NULL != m_hUnblockOutputPinEvent);

+

+    // If either of these ASSERTs fire, the user did not correctly call

+    // SetConfigInfo().

+    ASSERT(NULL != m_hStopEvent);

+    ASSERT(NULL != m_pGraphConfig);

+

+    // Make sure the block state is consistent.

+

+    CAutoLock alBlockStateLock(&m_BlockStateLock);

+

+    // BLOCK_STATE variables only have three legal values: PENDING, BLOCKED and NOT_BLOCKED.

+    ASSERT((NOT_BLOCKED == m_BlockState) || (PENDING == m_BlockState) || (BLOCKED == m_BlockState));

+

+    // m_hNotifyCallerPinBlockedEvent is only needed when a block operation cannot complete

+    // immediately.

+    ASSERT(((NULL == m_hNotifyCallerPinBlockedEvent) && (PENDING != m_BlockState)) ||

+           ((NULL != m_hNotifyCallerPinBlockedEvent) && (PENDING == m_BlockState)) );

+

+    // m_dwBlockCallerThreadID should always be 0 if the pin is not blocked and

+    // the user is not trying to block the pin.

+    ASSERT((0 == m_dwBlockCallerThreadID) || (NOT_BLOCKED != m_BlockState));

+

+    // If this ASSERT fires, the streaming thread is using the output pin and the

+    // output pin is blocked.

+    ASSERT(((0 != m_dwNumOutstandingOutputPinUsers) && (BLOCKED != m_BlockState)) ||

+           ((0 == m_dwNumOutstandingOutputPinUsers) && (NOT_BLOCKED != m_BlockState)) ||

+           ((0 == m_dwNumOutstandingOutputPinUsers) && (NOT_BLOCKED == m_BlockState)) );

+}

+#endif // DEBUG

+

+HRESULT CDynamicOutputPin::WaitEvent(HANDLE hEvent)

+{

+    const DWORD EVENT_SIGNALED = WAIT_OBJECT_0;

+

+    DWORD dwReturnValue = ::WaitForSingleObject(hEvent, INFINITE);

+

+    switch( dwReturnValue ) {

+    case EVENT_SIGNALED:

+        return S_OK;

+

+    case WAIT_FAILED:

+        return AmGetLastErrorToHResult();

+

+    default:

+        DbgBreak( "An Unexpected case occured in CDynamicOutputPin::WaitEvent()." );

+        return E_UNEXPECTED;

+    }

+}

+

+//=====================================================================

+//=====================================================================

+// Implements CBaseAllocator

+//=====================================================================

+//=====================================================================

+

+

+/* Constructor overrides the default settings for the free list to request

+   that it be alertable (ie the list can be cast to a handle which can be

+   passed to WaitForSingleObject). Both of the allocator lists also ask for

+   object locking, the all list matches the object default settings but I

+   have included them here just so it is obvious what kind of list it is */

+

+CBaseAllocator::CBaseAllocator(__in_opt LPCTSTR pName,

+                               __inout_opt LPUNKNOWN pUnk,

+                               __inout HRESULT *phr,

+                               BOOL bEvent,

+                               BOOL fEnableReleaseCallback

+                               ) :

+    CUnknown(pName, pUnk),

+    m_lAllocated(0),

+    m_bChanged(FALSE),

+    m_bCommitted(FALSE),

+    m_bDecommitInProgress(FALSE),

+    m_lSize(0),

+    m_lCount(0),

+    m_lAlignment(0),

+    m_lPrefix(0),

+    m_hSem(NULL),

+    m_lWaiting(0),

+    m_fEnableReleaseCallback(fEnableReleaseCallback),

+    m_pNotify(NULL)

+{

+#ifdef DXMPERF

+    PERFLOG_CTOR( pName ? pName : L"CBaseAllocator", (IMemAllocator *) this );

+#endif // DXMPERF

+

+    if (bEvent) {

+        m_hSem = CreateSemaphore(NULL, 0, 0x7FFFFFFF, NULL);

+        if (m_hSem == NULL) {

+            *phr = E_OUTOFMEMORY;

+            return;

+        }

+    }

+}

+

+#ifdef UNICODE

+CBaseAllocator::CBaseAllocator(__in_opt LPCSTR pName,

+                               __inout_opt LPUNKNOWN pUnk,

+                               __inout HRESULT *phr,

+                               BOOL bEvent,

+                               BOOL fEnableReleaseCallback) :

+    CUnknown(pName, pUnk),

+    m_lAllocated(0),

+    m_bChanged(FALSE),

+    m_bCommitted(FALSE),

+    m_bDecommitInProgress(FALSE),

+    m_lSize(0),

+    m_lCount(0),

+    m_lAlignment(0),

+    m_lPrefix(0),

+    m_hSem(NULL),

+    m_lWaiting(0),

+    m_fEnableReleaseCallback(fEnableReleaseCallback),

+    m_pNotify(NULL)

+{

+#ifdef DXMPERF

+    PERFLOG_CTOR( L"CBaseAllocator", (IMemAllocator *) this );

+#endif // DXMPERF

+

+    if (bEvent) {

+        m_hSem = CreateSemaphore(NULL, 0, 0x7FFFFFFF, NULL);

+        if (m_hSem == NULL) {

+            *phr = E_OUTOFMEMORY;

+            return;

+        }

+    }

+}

+#endif

+

+/* Destructor */

+

+CBaseAllocator::~CBaseAllocator()

+{

+    // we can't call Decommit here since that would mean a call to a

+    // pure virtual in destructor.

+    // We must assume that the derived class has gone into decommit state in

+    // its destructor.

+#ifdef DXMPERF

+    PERFLOG_DTOR( L"CBaseAllocator", (IMemAllocator *) this );

+#endif // DXMPERF

+

+    ASSERT(!m_bCommitted);

+    if (m_hSem != NULL) {

+        EXECUTE_ASSERT(CloseHandle(m_hSem));

+    }

+    if (m_pNotify) {

+        m_pNotify->Release();

+    }

+}

+

+

+/* Override this to publicise our interfaces */

+

+STDMETHODIMP

+CBaseAllocator::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    /* Do we know about this interface */

+

+    if (riid == IID_IMemAllocator ||

+        riid == IID_IMemAllocatorCallbackTemp && m_fEnableReleaseCallback) {

+        return GetInterface((IMemAllocatorCallbackTemp *) this, ppv);

+    } else {

+        return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+/* This sets the size and count of the required samples. The memory isn't

+   actually allocated until Commit() is called, if memory has already been

+   allocated then assuming no samples are outstanding the user may call us

+   to change the buffering, the memory will be released in Commit() */

+

+STDMETHODIMP

+CBaseAllocator::SetProperties(

+                __in ALLOCATOR_PROPERTIES* pRequest,

+                __out ALLOCATOR_PROPERTIES* pActual)

+{

+    CheckPointer(pRequest, E_POINTER);

+    CheckPointer(pActual, E_POINTER);

+    ValidateReadWritePtr(pActual, sizeof(ALLOCATOR_PROPERTIES));

+    CAutoLock cObjectLock(this);

+

+    ZeroMemory(pActual, sizeof(ALLOCATOR_PROPERTIES));

+

+    ASSERT(pRequest->cbBuffer > 0);

+

+    /*  Check the alignment requested */

+    if (pRequest->cbAlign != 1) {

+        DbgLog((LOG_ERROR, 2, TEXT("Alignment requested was 0x%x, not 1"),

+               pRequest->cbAlign));

+        return VFW_E_BADALIGN;

+    }

+

+    /* Can't do this if already committed, there is an argument that says we

+       should not reject the SetProperties call if there are buffers still

+       active. However this is called by the source filter, which is the same

+       person who is holding the samples. Therefore it is not unreasonable

+       for them to free all their samples before changing the requirements */

+

+    if (m_bCommitted) {

+        return VFW_E_ALREADY_COMMITTED;

+    }

+

+    /* Must be no outstanding buffers */

+

+    if (m_lAllocated != m_lFree.GetCount()) {

+        return VFW_E_BUFFERS_OUTSTANDING;

+    }

+

+    /* There isn't any real need to check the parameters as they

+       will just be rejected when the user finally calls Commit */

+

+    pActual->cbBuffer = m_lSize = pRequest->cbBuffer;

+    pActual->cBuffers = m_lCount = pRequest->cBuffers;

+    pActual->cbAlign = m_lAlignment = pRequest->cbAlign;

+    pActual->cbPrefix = m_lPrefix = pRequest->cbPrefix;

+

+    m_bChanged = TRUE;

+    return NOERROR;

+}

+

+STDMETHODIMP

+CBaseAllocator::GetProperties(

+    __out ALLOCATOR_PROPERTIES * pActual)

+{

+    CheckPointer(pActual,E_POINTER);

+    ValidateReadWritePtr(pActual,sizeof(ALLOCATOR_PROPERTIES));

+

+    CAutoLock cObjectLock(this);

+    pActual->cbBuffer = m_lSize;

+    pActual->cBuffers = m_lCount;

+    pActual->cbAlign = m_lAlignment;

+    pActual->cbPrefix = m_lPrefix;

+    return NOERROR;

+}

+

+// get container for a sample. Blocking, synchronous call to get the

+// next free buffer (as represented by an IMediaSample interface).

+// on return, the time etc properties will be invalid, but the buffer

+// pointer and size will be correct.

+

+HRESULT CBaseAllocator::GetBuffer(__deref_out IMediaSample **ppBuffer,

+                                  __in_opt REFERENCE_TIME *pStartTime,

+                                  __in_opt REFERENCE_TIME *pEndTime,

+                                  DWORD dwFlags

+                                  )

+{

+    UNREFERENCED_PARAMETER(pStartTime);

+    UNREFERENCED_PARAMETER(pEndTime);

+    UNREFERENCED_PARAMETER(dwFlags);

+    CMediaSample *pSample;

+

+    *ppBuffer = NULL;

+    for (;;)

+    {

+        {  // scope for lock

+            CAutoLock cObjectLock(this);

+

+            /* Check we are committed */

+            if (!m_bCommitted) {

+                return VFW_E_NOT_COMMITTED;

+            }

+            pSample = (CMediaSample *) m_lFree.RemoveHead();

+            if (pSample == NULL) {

+                SetWaiting();

+            }

+        }

+

+        /* If we didn't get a sample then wait for the list to signal */

+

+        if (pSample) {

+            break;

+        }

+        if (dwFlags & AM_GBF_NOWAIT) {

+            return VFW_E_TIMEOUT;

+        }

+        ASSERT(m_hSem != NULL);

+        WaitForSingleObject(m_hSem, INFINITE);

+    }

+

+    /* Addref the buffer up to one. On release

+       back to zero instead of being deleted, it will requeue itself by

+       calling the ReleaseBuffer member function. NOTE the owner of a

+       media sample must always be derived from CBaseAllocator */

+

+

+    ASSERT(pSample->m_cRef == 0);

+    pSample->m_cRef = 1;

+    *ppBuffer = pSample;

+

+#ifdef DXMPERF

+    PERFLOG_GETBUFFER( (IMemAllocator *) this, pSample );

+#endif // DXMPERF

+

+    return NOERROR;

+}

+

+

+/* Final release of a CMediaSample will call this */

+

+STDMETHODIMP

+CBaseAllocator::ReleaseBuffer(IMediaSample * pSample)

+{

+    CheckPointer(pSample,E_POINTER);

+    ValidateReadPtr(pSample,sizeof(IMediaSample));

+

+#ifdef DXMPERF

+    PERFLOG_RELBUFFER( (IMemAllocator *) this, pSample );

+#endif // DXMPERF

+

+

+    BOOL bRelease = FALSE;

+    {

+        CAutoLock cal(this);

+

+        /* Put back on the free list */

+

+        m_lFree.Add((CMediaSample *)pSample);

+        if (m_lWaiting != 0) {

+            NotifySample();

+        }

+

+        // if there is a pending Decommit, then we need to complete it by

+        // calling Free() when the last buffer is placed on the free list

+

+        LONG l1 = m_lFree.GetCount();

+        if (m_bDecommitInProgress && (l1 == m_lAllocated)) {

+            Free();

+            m_bDecommitInProgress = FALSE;

+            bRelease = TRUE;

+        }

+    }

+

+    if (m_pNotify) {

+

+        ASSERT(m_fEnableReleaseCallback);

+

+        //

+        // Note that this is not synchronized with setting up a notification

+        // method.

+        //

+        m_pNotify->NotifyRelease();

+    }

+

+    /* For each buffer there is one AddRef, made in GetBuffer and released

+       here. This may cause the allocator and all samples to be deleted */

+

+    if (bRelease) {

+        Release();

+    }

+    return NOERROR;

+}

+

+STDMETHODIMP

+CBaseAllocator::SetNotify(

+    IMemAllocatorNotifyCallbackTemp* pNotify

+    )

+{

+    ASSERT(m_fEnableReleaseCallback);

+    CAutoLock lck(this);

+    if (pNotify) {

+        pNotify->AddRef();

+    }

+    if (m_pNotify) {

+        m_pNotify->Release();

+    }

+    m_pNotify = pNotify;

+    return S_OK;

+}

+

+STDMETHODIMP

+CBaseAllocator::GetFreeCount(

+    __out LONG* plBuffersFree

+    )

+{

+    ASSERT(m_fEnableReleaseCallback);

+    CAutoLock cObjectLock(this);

+    *plBuffersFree = m_lCount - m_lAllocated + m_lFree.GetCount();

+    return NOERROR;

+}

+

+void

+CBaseAllocator::NotifySample()

+{

+    if (m_lWaiting != 0) {

+        ASSERT(m_hSem != NULL);

+        ReleaseSemaphore(m_hSem, m_lWaiting, 0);

+        m_lWaiting = 0;

+    }

+}

+

+STDMETHODIMP

+CBaseAllocator::Commit()

+{

+    /* Check we are not decommitted */

+    CAutoLock cObjectLock(this);

+

+    // cannot need to alloc or re-alloc if we are committed

+    if (m_bCommitted) {

+        return NOERROR;

+    }

+

+    /* Allow GetBuffer calls */

+

+    m_bCommitted = TRUE;

+

+    // is there a pending decommit ? if so, just cancel it

+    if (m_bDecommitInProgress) {

+        m_bDecommitInProgress = FALSE;

+

+        // don't call Alloc at this point. He cannot allow SetProperties

+        // between Decommit and the last free, so the buffer size cannot have

+        // changed. And because some of the buffers are not free yet, he

+        // cannot re-alloc anyway.

+        return NOERROR;

+    }

+

+    DbgLog((LOG_MEMORY, 1, TEXT("Allocating: %ldx%ld"), m_lCount, m_lSize));

+

+    // actually need to allocate the samples

+    HRESULT hr = Alloc();

+    if (FAILED(hr)) {

+        m_bCommitted = FALSE;

+        return hr;

+    }

+    AddRef();

+    return NOERROR;

+}

+

+

+STDMETHODIMP

+CBaseAllocator::Decommit()

+{

+    BOOL bRelease = FALSE;

+    {

+        /* Check we are not already decommitted */

+        CAutoLock cObjectLock(this);

+        if (m_bCommitted == FALSE) {

+            if (m_bDecommitInProgress == FALSE) {

+                return NOERROR;

+            }

+        }

+

+        /* No more GetBuffer calls will succeed */

+        m_bCommitted = FALSE;

+

+        // are any buffers outstanding?

+        if (m_lFree.GetCount() < m_lAllocated) {

+            // please complete the decommit when last buffer is freed

+            m_bDecommitInProgress = TRUE;

+        } else {

+            m_bDecommitInProgress = FALSE;

+

+            // need to complete the decommit here as there are no

+            // outstanding buffers

+

+            Free();

+            bRelease = TRUE;

+        }

+

+        // Tell anyone waiting that they can go now so we can

+        // reject their call

+#pragma warning(push)

+#ifndef _PREFAST_

+#pragma warning(disable:4068)

+#endif

+#pragma prefast(suppress:__WARNING_DEREF_NULL_PTR, "Suppress warning related to Free() invalidating 'this' which is no applicable to CBaseAllocator::Free()")

+        NotifySample();

+

+#pragma warning(pop)

+    }

+

+    if (bRelease) {

+        Release();

+    }

+    return NOERROR;

+}

+

+

+/* Base definition of allocation which checks we are ok to go ahead and do

+   the full allocation. We return S_FALSE if the requirements are the same */

+

+HRESULT

+CBaseAllocator::Alloc(void)

+{

+    /* Error if he hasn't set the size yet */

+    if (m_lCount <= 0 || m_lSize <= 0 || m_lAlignment <= 0) {

+        return VFW_E_SIZENOTSET;

+    }

+

+    /* should never get here while buffers outstanding */

+    ASSERT(m_lFree.GetCount() == m_lAllocated);

+

+    /* If the requirements haven't changed then don't reallocate */

+    if (m_bChanged == FALSE) {

+        return S_FALSE;

+    }

+

+    return NOERROR;

+}

+

+/*  Implement CBaseAllocator::CSampleList::Remove(pSample)

+    Removes pSample from the list

+*/

+void

+CBaseAllocator::CSampleList::Remove(__inout CMediaSample * pSample)

+{

+    CMediaSample **pSearch;

+    for (pSearch = &m_List;

+         *pSearch != NULL;

+         pSearch = &(CBaseAllocator::NextSample(*pSearch))) {

+       if (*pSearch == pSample) {

+           *pSearch = CBaseAllocator::NextSample(pSample);

+           CBaseAllocator::NextSample(pSample) = NULL;

+           m_nOnList--;

+           return;

+       }

+    }

+    DbgBreak("Couldn't find sample in list");

+}

+

+//=====================================================================

+//=====================================================================

+// Implements CMemAllocator

+//=====================================================================

+//=====================================================================

+

+

+/* This goes in the factory template table to create new instances */

+CUnknown *CMemAllocator::CreateInstance(__inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr)

+{

+    CUnknown *pUnkRet = new CMemAllocator(NAME("CMemAllocator"), pUnk, phr);

+    return pUnkRet;

+}

+

+CMemAllocator::CMemAllocator(

+    __in_opt LPCTSTR pName,

+    __inout_opt LPUNKNOWN pUnk,

+    __inout HRESULT *phr)

+    : CBaseAllocator(pName, pUnk, phr, TRUE, TRUE),

+    m_pBuffer(NULL)

+{

+}

+

+#ifdef UNICODE

+CMemAllocator::CMemAllocator(

+    __in_opt LPCSTR pName,

+    __inout_opt LPUNKNOWN pUnk,

+    __inout HRESULT *phr)

+    : CBaseAllocator(pName, pUnk, phr, TRUE, TRUE),

+    m_pBuffer(NULL)

+{

+}

+#endif

+

+/* This sets the size and count of the required samples. The memory isn't

+   actually allocated until Commit() is called, if memory has already been

+   allocated then assuming no samples are outstanding the user may call us

+   to change the buffering, the memory will be released in Commit() */

+STDMETHODIMP

+CMemAllocator::SetProperties(

+                __in ALLOCATOR_PROPERTIES* pRequest,

+                __out ALLOCATOR_PROPERTIES* pActual)

+{

+    CheckPointer(pActual,E_POINTER);

+    ValidateReadWritePtr(pActual,sizeof(ALLOCATOR_PROPERTIES));

+    CAutoLock cObjectLock(this);

+

+    ZeroMemory(pActual, sizeof(ALLOCATOR_PROPERTIES));

+

+    ASSERT(pRequest->cbBuffer > 0);

+

+    SYSTEM_INFO SysInfo;

+    GetSystemInfo(&SysInfo);

+

+    /*  Check the alignment request is a power of 2 */

+    if ((-pRequest->cbAlign & pRequest->cbAlign) != pRequest->cbAlign) {

+        DbgLog((LOG_ERROR, 1, TEXT("Alignment requested 0x%x not a power of 2!"),

+               pRequest->cbAlign));

+    }

+    /*  Check the alignment requested */

+    if (pRequest->cbAlign == 0 ||

+    (SysInfo.dwAllocationGranularity & (pRequest->cbAlign - 1)) != 0) {

+        DbgLog((LOG_ERROR, 1, TEXT("Invalid alignment 0x%x requested - granularity = 0x%x"),

+               pRequest->cbAlign, SysInfo.dwAllocationGranularity));

+        return VFW_E_BADALIGN;

+    }

+

+    /* Can't do this if already committed, there is an argument that says we

+       should not reject the SetProperties call if there are buffers still

+       active. However this is called by the source filter, which is the same

+       person who is holding the samples. Therefore it is not unreasonable

+       for them to free all their samples before changing the requirements */

+

+    if (m_bCommitted == TRUE) {

+        return VFW_E_ALREADY_COMMITTED;

+    }

+

+    /* Must be no outstanding buffers */

+

+    if (m_lFree.GetCount() < m_lAllocated) {

+        return VFW_E_BUFFERS_OUTSTANDING;

+    }

+

+    /* There isn't any real need to check the parameters as they

+       will just be rejected when the user finally calls Commit */

+

+    // round length up to alignment - remember that prefix is included in

+    // the alignment

+    LONG lSize = pRequest->cbBuffer + pRequest->cbPrefix;

+    LONG lRemainder = lSize % pRequest->cbAlign;

+    if (lRemainder != 0) {

+        lSize = lSize - lRemainder + pRequest->cbAlign;

+    }

+    pActual->cbBuffer = m_lSize = (lSize - pRequest->cbPrefix);

+

+    pActual->cBuffers = m_lCount = pRequest->cBuffers;

+    pActual->cbAlign = m_lAlignment = pRequest->cbAlign;

+    pActual->cbPrefix = m_lPrefix = pRequest->cbPrefix;

+

+    m_bChanged = TRUE;

+    return NOERROR;

+}

+

+// override this to allocate our resources when Commit is called.

+//

+// note that our resources may be already allocated when this is called,

+// since we don't free them on Decommit. We will only be called when in

+// decommit state with all buffers free.

+//

+// object locked by caller

+HRESULT

+CMemAllocator::Alloc(void)

+{

+    CAutoLock lck(this);

+

+    /* Check he has called SetProperties */

+    HRESULT hr = CBaseAllocator::Alloc();

+    if (FAILED(hr)) {

+        return hr;

+    }

+

+    /* If the requirements haven't changed then don't reallocate */

+    if (hr == S_FALSE) {

+        ASSERT(m_pBuffer);

+        return NOERROR;

+    }

+    ASSERT(hr == S_OK); // we use this fact in the loop below

+

+    /* Free the old resources */

+    if (m_pBuffer) {

+        ReallyFree();

+    }

+

+    /* Make sure we've got reasonable values */

+    if ( m_lSize < 0 || m_lPrefix < 0 || m_lCount < 0 ) {

+        return E_OUTOFMEMORY;

+    }

+

+    /* Compute the aligned size */

+    LONG lAlignedSize = m_lSize + m_lPrefix;

+

+    /*  Check overflow */

+    if (lAlignedSize < m_lSize) {

+        return E_OUTOFMEMORY;

+    }

+

+    if (m_lAlignment > 1) {

+        LONG lRemainder = lAlignedSize % m_lAlignment;

+        if (lRemainder != 0) {

+            LONG lNewSize = lAlignedSize + m_lAlignment - lRemainder;

+            if (lNewSize < lAlignedSize) {

+                return E_OUTOFMEMORY;

+            }

+            lAlignedSize = lNewSize;

+        }

+    }

+

+    /* Create the contiguous memory block for the samples

+       making sure it's properly aligned (64K should be enough!)

+    */

+    ASSERT(lAlignedSize % m_lAlignment == 0);

+

+    LONGLONG lToAllocate = m_lCount * (LONGLONG)lAlignedSize;

+

+    /*  Check overflow */

+    if (lToAllocate > MAXLONG) {

+        return E_OUTOFMEMORY;

+    }

+

+    m_pBuffer = (PBYTE)VirtualAlloc(NULL,

+                    (LONG)lToAllocate,

+                    MEM_COMMIT,

+                    PAGE_READWRITE);

+

+    if (m_pBuffer == NULL) {

+        return E_OUTOFMEMORY;

+    }

+

+    LPBYTE pNext = m_pBuffer;

+    CMediaSample *pSample;

+

+    ASSERT(m_lAllocated == 0);

+

+    // Create the new samples - we have allocated m_lSize bytes for each sample

+    // plus m_lPrefix bytes per sample as a prefix. We set the pointer to

+    // the memory after the prefix - so that GetPointer() will return a pointer

+    // to m_lSize bytes.

+    for (; m_lAllocated < m_lCount; m_lAllocated++, pNext += lAlignedSize) {

+

+

+        pSample = new CMediaSample(

+                            NAME("Default memory media sample"),

+                this,

+                            &hr,

+                            pNext + m_lPrefix,      // GetPointer() value

+                            m_lSize);               // not including prefix

+

+            ASSERT(SUCCEEDED(hr));

+        if (pSample == NULL) {

+            return E_OUTOFMEMORY;

+        }

+

+        // This CANNOT fail

+        m_lFree.Add(pSample);

+    }

+

+    m_bChanged = FALSE;

+    return NOERROR;

+}

+

+

+// override this to free up any resources we have allocated.

+// called from the base class on Decommit when all buffers have been

+// returned to the free list.

+//

+// caller has already locked the object.

+

+// in our case, we keep the memory until we are deleted, so

+// we do nothing here. The memory is deleted in the destructor by

+// calling ReallyFree()

+void

+CMemAllocator::Free(void)

+{

+    return;

+}

+

+

+// called from the destructor (and from Alloc if changing size/count) to

+// actually free up the memory

+void

+CMemAllocator::ReallyFree(void)

+{

+    /* Should never be deleting this unless all buffers are freed */

+

+    ASSERT(m_lAllocated == m_lFree.GetCount());

+

+    /* Free up all the CMediaSamples */

+

+    CMediaSample *pSample;

+    for (;;) {

+        pSample = m_lFree.RemoveHead();

+        if (pSample != NULL) {

+            delete pSample;

+        } else {

+            break;

+        }

+    }

+

+    m_lAllocated = 0;

+

+    // free the block of buffer memory

+    if (m_pBuffer) {

+        EXECUTE_ASSERT(VirtualFree(m_pBuffer, 0, MEM_RELEASE));

+        m_pBuffer = NULL;

+    }

+}

+

+

+/* Destructor frees our memory resources */

+

+CMemAllocator::~CMemAllocator()

+{

+    Decommit();

+    ReallyFree();

+}

+

+// ------------------------------------------------------------------------

+// filter registration through IFilterMapper. used if IFilterMapper is

+// not found (Quartz 1.0 install)

+

+STDAPI

+AMovieSetupRegisterFilter( const AMOVIESETUP_FILTER * const psetupdata

+                         , IFilterMapper *                  pIFM

+                         , BOOL                             bRegister  )

+{

+  DbgLog((LOG_TRACE, 3, TEXT("= AMovieSetupRegisterFilter")));

+

+  // check we've got data

+  //

+  if( NULL == psetupdata ) return S_FALSE;

+

+

+  // unregister filter

+  // (as pins are subkeys of filter's CLSID key

+  // they do not need to be removed separately).

+  //

+  DbgLog((LOG_TRACE, 3, TEXT("= = unregister filter")));

+  HRESULT hr = pIFM->UnregisterFilter( *(psetupdata->clsID) );

+

+

+  if( bRegister )

+  {

+    // register filter

+    //

+    DbgLog((LOG_TRACE, 3, TEXT("= = register filter")));

+    hr = pIFM->RegisterFilter( *(psetupdata->clsID)

+                             , psetupdata->strName

+                             , psetupdata->dwMerit    );

+    if( SUCCEEDED(hr) )

+    {

+      // all its pins

+      //

+      DbgLog((LOG_TRACE, 3, TEXT("= = register filter pins")));

+      for( UINT m1=0; m1 < psetupdata->nPins; m1++ )

+      {

+        hr = pIFM->RegisterPin( *(psetupdata->clsID)

+                              , psetupdata->lpPin[m1].strName

+                              , psetupdata->lpPin[m1].bRendered

+                              , psetupdata->lpPin[m1].bOutput

+                              , psetupdata->lpPin[m1].bZero

+                              , psetupdata->lpPin[m1].bMany

+                              , *(psetupdata->lpPin[m1].clsConnectsToFilter)

+                              , psetupdata->lpPin[m1].strConnectsToPin );

+

+        if( SUCCEEDED(hr) )

+        {

+          // and each pin's media types

+          //

+          DbgLog((LOG_TRACE, 3, TEXT("= = register filter pin types")));

+          for( UINT m2=0; m2 < psetupdata->lpPin[m1].nMediaTypes; m2++ )

+          {

+            hr = pIFM->RegisterPinType( *(psetupdata->clsID)

+                                      , psetupdata->lpPin[m1].strName

+                                      , *(psetupdata->lpPin[m1].lpMediaType[m2].clsMajorType)

+                                      , *(psetupdata->lpPin[m1].lpMediaType[m2].clsMinorType) );

+            if( FAILED(hr) ) break;

+          }

+          if( FAILED(hr) ) break;

+        }

+        if( FAILED(hr) ) break;

+      }

+    }

+  }

+

+  // handle one acceptable "error" - that

+  // of filter not being registered!

+  // (couldn't find a suitable #define'd

+  // name for the error!)

+  //

+  if( 0x80070002 == hr)

+    return NOERROR;

+  else

+    return hr;

+}

+

+//  Remove warnings about unreferenced inline functions

+#pragma warning(disable:4514)

+

diff --git a/Samples/multimedia/directshow/baseclasses/amfilter.h b/Samples/multimedia/directshow/baseclasses/amfilter.h
new file mode 100644
index 0000000..14f17cd
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/amfilter.h
@@ -0,0 +1,1587 @@
+//------------------------------------------------------------------------------

+// File: AMFilter.h

+//

+// Desc: DirectShow base classes - efines class hierarchy for streams

+//       architecture.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+#ifndef __FILTER__

+#define __FILTER__

+

+/* The following classes are declared in this header: */

+

+class CBaseMediaFilter;     // IMediaFilter support

+class CBaseFilter;          // IBaseFilter,IMediaFilter support

+class CBasePin;             // Abstract base class for IPin interface

+class CEnumPins;            // Enumerate input and output pins

+class CEnumMediaTypes;      // Enumerate the pin's preferred formats

+class CBaseOutputPin;       // Adds data provider member functions

+class CBaseInputPin;        // Implements IMemInputPin interface

+class CMediaSample;         // Basic transport unit for IMemInputPin

+class CBaseAllocator;       // General list guff for most allocators

+class CMemAllocator;        // Implements memory buffer allocation

+

+

+//=====================================================================

+//=====================================================================

+//

+// QueryFilterInfo and QueryPinInfo AddRef the interface pointers

+// they return.  You can use the macro below to release the interface.

+//

+//=====================================================================

+//=====================================================================

+

+#define QueryFilterInfoReleaseGraph(fi) if ((fi).pGraph) (fi).pGraph->Release();

+

+#define QueryPinInfoReleaseFilter(pi) if ((pi).pFilter) (pi).pFilter->Release();

+

+//=====================================================================

+//=====================================================================

+// Defines CBaseMediaFilter

+//

+// Abstract base class implementing IMediaFilter.

+//

+// Typically you will derive your filter from CBaseFilter rather than

+// this,  unless you are implementing an object such as a plug-in

+// distributor that needs to support IMediaFilter but not IBaseFilter.

+//

+// Note that IMediaFilter is derived from IPersist to allow query of

+// class id.

+//=====================================================================

+//=====================================================================

+

+class AM_NOVTABLE CBaseMediaFilter : public CUnknown,

+                                     public IMediaFilter

+{

+

+protected:

+

+    FILTER_STATE    m_State;            // current state: running, paused

+    IReferenceClock *m_pClock;          // this filter's reference clock

+    // note: all filters in a filter graph use the same clock

+

+    // offset from stream time to reference time

+    CRefTime        m_tStart;

+

+    CLSID	    m_clsid;            // This filters clsid

+                                        // used for serialization

+    CCritSec        *m_pLock;           // Object we use for locking

+

+public:

+

+    CBaseMediaFilter(

+        __in_opt LPCTSTR pName,

+        __inout_opt LPUNKNOWN pUnk,

+        __in CCritSec  *pLock,

+	REFCLSID   clsid);

+

+    virtual ~CBaseMediaFilter();

+

+    DECLARE_IUNKNOWN

+

+    // override this to say what interfaces we support where

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv);

+

+    //

+    // --- IPersist method ---

+    //

+

+    STDMETHODIMP GetClassID(__out CLSID *pClsID);

+

+    // --- IMediaFilter methods ---

+

+    STDMETHODIMP GetState(DWORD dwMSecs, __out FILTER_STATE *State);

+

+    STDMETHODIMP SetSyncSource(__inout_opt IReferenceClock *pClock);

+

+    STDMETHODIMP GetSyncSource(__deref_out_opt IReferenceClock **pClock);

+

+    // default implementation of Stop and Pause just record the

+    // state. Override to activate or de-activate your filter.

+    // Note that Run when called from Stopped state will call Pause

+    // to ensure activation, so if you are a source or transform

+    // you will probably not need to override Run.

+    STDMETHODIMP Stop();

+    STDMETHODIMP Pause();

+

+

+    // the start parameter is the difference to be added to the

+    // sample's stream time to get the reference time for

+    // its presentation

+    STDMETHODIMP Run(REFERENCE_TIME tStart);

+

+    // --- helper methods ---

+

+    // return the current stream time - ie find out what

+    // stream time should be appearing now

+    virtual HRESULT StreamTime(CRefTime& rtStream);

+

+    // Is the filter currently active? (running or paused)

+    BOOL IsActive() {

+        CAutoLock cObjectLock(m_pLock);

+        return ((m_State == State_Paused) || (m_State == State_Running));

+    };

+};

+

+//=====================================================================

+//=====================================================================

+// Defines CBaseFilter

+//

+// An abstract class providing basic IBaseFilter support for pin

+// enumeration and filter information reading.

+//

+// We cannot derive from CBaseMediaFilter since methods in IMediaFilter

+// are also in IBaseFilter and would be ambiguous. Since much of the code

+// assumes that they derive from a class that has m_State and other state

+// directly available, we duplicate code from CBaseMediaFilter rather than

+// having a member variable.

+//

+// Derive your filter from this, or from a derived object such as

+// CTransformFilter.

+//=====================================================================

+//=====================================================================

+

+

+class AM_NOVTABLE CBaseFilter : public CUnknown,        // Handles an IUnknown

+                    public IBaseFilter,     // The Filter Interface

+                    public IAMovieSetup     // For un/registration

+{

+

+friend class CBasePin;

+

+protected:

+    FILTER_STATE    m_State;            // current state: running, paused

+    IReferenceClock *m_pClock;          // this graph's ref clock

+    CRefTime        m_tStart;           // offset from stream time to reference time

+    CLSID	    m_clsid;            // This filters clsid

+                                        // used for serialization

+    CCritSec        *m_pLock;           // Object we use for locking

+

+    WCHAR           *m_pName;           // Full filter name

+    IFilterGraph    *m_pGraph;          // Graph we belong to

+    IMediaEventSink *m_pSink;           // Called with notify events

+    LONG            m_PinVersion;       // Current pin version

+

+public:

+

+    CBaseFilter(

+        __in_opt LPCTSTR pName,   // Object description

+        __inout_opt LPUNKNOWN pUnk,  // IUnknown of delegating object

+        __in CCritSec  *pLock,    // Object who maintains lock

+	REFCLSID   clsid);        // The clsid to be used to serialize this filter

+

+    CBaseFilter(

+        __in_opt LPCTSTR pName,    // Object description

+        __in_opt LPUNKNOWN pUnk,  // IUnknown of delegating object

+        __in CCritSec  *pLock,    // Object who maintains lock

+	REFCLSID   clsid,         // The clsid to be used to serialize this filter

+        __inout HRESULT   *phr);  // General OLE return code

+#ifdef UNICODE

+    CBaseFilter(

+        __in_opt LPCSTR pName,    // Object description

+        __in_opt LPUNKNOWN pUnk,  // IUnknown of delegating object

+        __in CCritSec  *pLock,    // Object who maintains lock

+	REFCLSID   clsid);        // The clsid to be used to serialize this filter

+

+    CBaseFilter(

+        __in_opt LPCSTR pName,     // Object description

+        __in_opt LPUNKNOWN pUnk,  // IUnknown of delegating object

+        __in CCritSec  *pLock,    // Object who maintains lock

+	REFCLSID   clsid,         // The clsid to be used to serialize this filter

+        __inout HRESULT   *phr);  // General OLE return code

+#endif

+    ~CBaseFilter();

+

+    DECLARE_IUNKNOWN

+

+    // override this to say what interfaces we support where

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv);

+#ifdef DEBUG

+    STDMETHODIMP_(ULONG) NonDelegatingRelease();

+#endif

+

+    //

+    // --- IPersist method ---

+    //

+

+    STDMETHODIMP GetClassID(__out CLSID *pClsID);

+

+    // --- IMediaFilter methods ---

+

+    STDMETHODIMP GetState(DWORD dwMSecs, __out FILTER_STATE *State);

+

+    STDMETHODIMP SetSyncSource(__in_opt IReferenceClock *pClock);

+

+    STDMETHODIMP GetSyncSource(__deref_out_opt IReferenceClock **pClock);

+

+

+    // override Stop and Pause so we can activate the pins.

+    // Note that Run will call Pause first if activation needed.

+    // Override these if you want to activate your filter rather than

+    // your pins.

+    STDMETHODIMP Stop();

+    STDMETHODIMP Pause();

+

+    // the start parameter is the difference to be added to the

+    // sample's stream time to get the reference time for

+    // its presentation

+    STDMETHODIMP Run(REFERENCE_TIME tStart);

+

+    // --- helper methods ---

+

+    // return the current stream time - ie find out what

+    // stream time should be appearing now

+    virtual HRESULT StreamTime(CRefTime& rtStream);

+

+    // Is the filter currently active?

+    BOOL IsActive() {

+        CAutoLock cObjectLock(m_pLock);

+        return ((m_State == State_Paused) || (m_State == State_Running));

+    };

+

+    // Is this filter stopped (without locking)

+    BOOL IsStopped() {

+        return (m_State == State_Stopped);

+    };

+

+    //

+    // --- IBaseFilter methods ---

+    //

+

+    // pin enumerator

+    STDMETHODIMP EnumPins(

+                    __deref_out IEnumPins ** ppEnum);

+

+

+    // default behaviour of FindPin assumes pin ids are their names

+    STDMETHODIMP FindPin(

+        LPCWSTR Id,

+        __deref_out IPin ** ppPin

+    );

+

+    STDMETHODIMP QueryFilterInfo(

+                    __out FILTER_INFO * pInfo);

+

+    STDMETHODIMP JoinFilterGraph(

+                    __inout_opt IFilterGraph * pGraph,

+                    __in_opt LPCWSTR pName);

+

+    // return a Vendor information string. Optional - may return E_NOTIMPL.

+    // memory returned should be freed using CoTaskMemFree

+    // default implementation returns E_NOTIMPL

+    STDMETHODIMP QueryVendorInfo(

+                    __deref_out LPWSTR* pVendorInfo

+            );

+

+    // --- helper methods ---

+

+    // send an event notification to the filter graph if we know about it.

+    // returns S_OK if delivered, S_FALSE if the filter graph does not sink

+    // events, or an error otherwise.

+    HRESULT NotifyEvent(

+        long EventCode,

+        LONG_PTR EventParam1,

+        LONG_PTR EventParam2);

+

+    // return the filter graph we belong to

+    __out_opt IFilterGraph *GetFilterGraph() {

+        return m_pGraph;

+    }

+

+    // Request reconnect

+    // pPin is the pin to reconnect

+    // pmt is the type to reconnect with - can be NULL

+    // Calls ReconnectEx on the filter graph

+    HRESULT ReconnectPin(IPin *pPin, __in_opt AM_MEDIA_TYPE const *pmt);

+

+    // find out the current pin version (used by enumerators)

+    virtual LONG GetPinVersion();

+    void IncrementPinVersion();

+

+    // you need to supply these to access the pins from the enumerator

+    // and for default Stop and Pause/Run activation.

+    virtual int GetPinCount() PURE;

+    virtual CBasePin *GetPin(int n) PURE;

+

+    // --- IAMovieSetup methods ---

+

+    STDMETHODIMP Register();    // ask filter to register itself

+    STDMETHODIMP Unregister();  // and unregister itself

+

+    // --- setup helper methods ---

+    // (override to return filters setup data)

+

+    virtual __out_opt LPAMOVIESETUP_FILTER GetSetupData(){ return NULL; }

+

+};

+

+

+//=====================================================================

+//=====================================================================

+// Defines CBasePin

+//

+// Abstract class that supports the basics of IPin

+//=====================================================================

+//=====================================================================

+

+class  AM_NOVTABLE CBasePin : public CUnknown, public IPin, public IQualityControl

+{

+

+protected:

+

+    WCHAR *         m_pName;		        // This pin's name

+    IPin            *m_Connected;               // Pin we have connected to

+    PIN_DIRECTION   m_dir;                      // Direction of this pin

+    CCritSec        *m_pLock;                   // Object we use for locking

+    bool            m_bRunTimeError;            // Run time error generated

+    bool            m_bCanReconnectWhenActive;  // OK to reconnect when active

+    bool            m_bTryMyTypesFirst;         // When connecting enumerate

+                                                // this pin's types first

+    CBaseFilter    *m_pFilter;                  // Filter we were created by

+    IQualityControl *m_pQSink;                  // Target for Quality messages

+    LONG            m_TypeVersion;              // Holds current type version

+    CMediaType      m_mt;                       // Media type of connection

+

+    CRefTime        m_tStart;                   // time from NewSegment call

+    CRefTime        m_tStop;                    // time from NewSegment

+    double          m_dRate;                    // rate from NewSegment

+

+#ifdef DEBUG

+    LONG            m_cRef;                     // Ref count tracing

+#endif

+

+    // displays pin connection information

+

+#ifdef DEBUG

+    void DisplayPinInfo(IPin *pReceivePin);

+    void DisplayTypeInfo(IPin *pPin, const CMediaType *pmt);

+#else

+    void DisplayPinInfo(IPin *pReceivePin) {};

+    void DisplayTypeInfo(IPin *pPin, const CMediaType *pmt) {};

+#endif

+

+    // used to agree a media type for a pin connection

+

+    // given a specific media type, attempt a connection (includes

+    // checking that the type is acceptable to this pin)

+    HRESULT

+    AttemptConnection(

+        IPin* pReceivePin,      // connect to this pin

+        const CMediaType* pmt   // using this type

+    );

+

+    // try all the media types in this enumerator - for each that

+    // we accept, try to connect using ReceiveConnection.

+    HRESULT TryMediaTypes(

+                        IPin *pReceivePin,          // connect to this pin

+                        __in_opt const CMediaType *pmt,  // proposed type from Connect

+                        IEnumMediaTypes *pEnum);    // try this enumerator

+

+    // establish a connection with a suitable mediatype. Needs to

+    // propose a media type if the pmt pointer is null or partially

+    // specified - use TryMediaTypes on both our and then the other pin's

+    // enumerator until we find one that works.

+    HRESULT AgreeMediaType(

+                        IPin *pReceivePin,      // connect to this pin

+                        const CMediaType *pmt);      // proposed type from Connect

+

+public:

+

+    CBasePin(

+        __in_opt LPCTSTR pObjectName,         // Object description

+        __in CBaseFilter *pFilter,       // Owning filter who knows about pins

+        __in CCritSec *pLock,            // Object who implements the lock

+        __inout HRESULT *phr,               // General OLE return code

+        __in_opt LPCWSTR pName,              // Pin name for us

+        PIN_DIRECTION dir);         // Either PINDIR_INPUT or PINDIR_OUTPUT

+#ifdef UNICODE

+    CBasePin(

+        __in_opt LPCSTR pObjectName,         // Object description

+        __in CBaseFilter *pFilter,       // Owning filter who knows about pins

+        __in CCritSec *pLock,            // Object who implements the lock

+        __inout HRESULT *phr,               // General OLE return code

+        __in_opt LPCWSTR pName,              // Pin name for us

+        PIN_DIRECTION dir);         // Either PINDIR_INPUT or PINDIR_OUTPUT

+#endif

+    virtual ~CBasePin();

+

+    DECLARE_IUNKNOWN

+

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv);

+    STDMETHODIMP_(ULONG) NonDelegatingRelease();

+    STDMETHODIMP_(ULONG) NonDelegatingAddRef();

+

+    // --- IPin methods ---

+

+    // take lead role in establishing a connection. Media type pointer

+    // may be null, or may point to partially-specified mediatype

+    // (subtype or format type may be GUID_NULL).

+    STDMETHODIMP Connect(

+        IPin * pReceivePin,

+        __in_opt const AM_MEDIA_TYPE *pmt   // optional media type

+    );

+

+    // (passive) accept a connection from another pin

+    STDMETHODIMP ReceiveConnection(

+        IPin * pConnector,      // this is the initiating connecting pin

+        const AM_MEDIA_TYPE *pmt   // this is the media type we will exchange

+    );

+

+    STDMETHODIMP Disconnect();

+

+    STDMETHODIMP ConnectedTo(__deref_out IPin **pPin);

+

+    STDMETHODIMP ConnectionMediaType(__out AM_MEDIA_TYPE *pmt);

+

+    STDMETHODIMP QueryPinInfo(

+        __out PIN_INFO * pInfo

+    );

+

+    STDMETHODIMP QueryDirection(

+    	__out PIN_DIRECTION * pPinDir

+    );

+

+    STDMETHODIMP QueryId(

+        __deref_out LPWSTR * Id

+    );

+

+    // does the pin support this media type

+    STDMETHODIMP QueryAccept(

+        const AM_MEDIA_TYPE *pmt

+    );

+

+    // return an enumerator for this pins preferred media types

+    STDMETHODIMP EnumMediaTypes(

+        __deref_out IEnumMediaTypes **ppEnum

+    );

+

+    // return an array of IPin* - the pins that this pin internally connects to

+    // All pins put in the array must be AddReffed (but no others)

+    // Errors: "Can't say" - FAIL, not enough slots - return S_FALSE

+    // Default: return E_NOTIMPL

+    // The filter graph will interpret NOT_IMPL as any input pin connects to

+    // all visible output pins and vice versa.

+    // apPin can be NULL if nPin==0 (not otherwise).

+    STDMETHODIMP QueryInternalConnections(

+        __out_ecount_part(*nPin,*nPin) IPin* *apPin,     // array of IPin*

+        __inout ULONG *nPin                  // on input, the number of slots

+                                             // on output  the number of pins

+    ) { return E_NOTIMPL; }

+

+    // Called when no more data will be sent

+    STDMETHODIMP EndOfStream(void);

+

+    // Begin/EndFlush still PURE

+

+    // NewSegment notifies of the start/stop/rate applying to the data

+    // about to be received. Default implementation records data and

+    // returns S_OK.

+    // Override this to pass downstream.

+    STDMETHODIMP NewSegment(

+                    REFERENCE_TIME tStart,

+                    REFERENCE_TIME tStop,

+                    double dRate);

+

+    //================================================================================

+    // IQualityControl methods

+    //================================================================================

+

+    STDMETHODIMP Notify(IBaseFilter * pSender, Quality q);

+

+    STDMETHODIMP SetSink(IQualityControl * piqc);

+

+    // --- helper methods ---

+

+    // Returns true if the pin is connected. false otherwise.

+    BOOL IsConnected(void) {return (m_Connected != NULL); };

+    // Return the pin this is connected to (if any)

+    IPin * GetConnected() { return m_Connected; };

+

+    // Check if our filter is currently stopped

+    BOOL IsStopped() {

+        return (m_pFilter->m_State == State_Stopped);

+    };

+

+    // find out the current type version (used by enumerators)

+    virtual LONG GetMediaTypeVersion();

+    void IncrementTypeVersion();

+

+    // switch the pin to active (paused or running) mode

+    // not an error to call this if already active

+    virtual HRESULT Active(void);

+

+    // switch the pin to inactive state - may already be inactive

+    virtual HRESULT Inactive(void);

+

+    // Notify of Run() from filter

+    virtual HRESULT Run(REFERENCE_TIME tStart);

+

+    // check if the pin can support this specific proposed type and format

+    virtual HRESULT CheckMediaType(const CMediaType *) PURE;

+

+    // set the connection to use this format (previously agreed)

+    virtual HRESULT SetMediaType(const CMediaType *);

+

+    // check that the connection is ok before verifying it

+    // can be overridden eg to check what interfaces will be supported.

+    virtual HRESULT CheckConnect(IPin *);

+

+    // Set and release resources required for a connection

+    virtual HRESULT BreakConnect();

+    virtual HRESULT CompleteConnect(IPin *pReceivePin);

+

+    // returns the preferred formats for a pin

+    virtual HRESULT GetMediaType(int iPosition, __inout CMediaType *pMediaType);

+

+    // access to NewSegment values

+    REFERENCE_TIME CurrentStopTime() {

+        return m_tStop;

+    }

+    REFERENCE_TIME CurrentStartTime() {

+        return m_tStart;

+    }

+    double CurrentRate() {

+        return m_dRate;

+    }

+

+    //  Access name

+    LPWSTR Name() { return m_pName; };

+

+    //  Can reconnectwhen active?

+    void SetReconnectWhenActive(bool bCanReconnect)

+    {

+        m_bCanReconnectWhenActive = bCanReconnect;

+    }

+

+    bool CanReconnectWhenActive()

+    {

+        return m_bCanReconnectWhenActive;

+    }

+

+protected:

+    STDMETHODIMP DisconnectInternal();

+};

+

+

+//=====================================================================

+//=====================================================================

+// Defines CEnumPins

+//

+// Pin enumerator class that works by calling CBaseFilter. This interface

+// is provided by CBaseFilter::EnumPins and calls GetPinCount() and

+// GetPin() to enumerate existing pins. Needs to be a separate object so

+// that it can be cloned (creating an existing object at the same

+// position in the enumeration)

+//

+//=====================================================================

+//=====================================================================

+

+class CEnumPins : public IEnumPins      // The interface we support

+{

+    int m_Position;                 // Current ordinal position

+    int m_PinCount;                 // Number of pins available

+    CBaseFilter *m_pFilter;         // The filter who owns us

+    LONG m_Version;                 // Pin version information

+    LONG m_cRef;

+

+    typedef CGenericList<CBasePin> CPinList;

+

+    CPinList m_PinCache;	    // These pointers have not been AddRef'ed and

+				    // so they should not be dereferenced.  They are

+				    // merely kept to ID which pins have been enumerated.

+

+#ifdef DEBUG

+    DWORD m_dwCookie;

+#endif

+

+    /* If while we are retrieving a pin for example from the filter an error

+       occurs we assume that our internal state is stale with respect to the

+       filter (someone may have deleted all the pins). We can check before

+       starting whether or not the operation is likely to fail by asking the

+       filter what it's current version number is. If the filter has not

+       overriden the GetPinVersion method then this will always match */

+

+    BOOL AreWeOutOfSync() {

+        return (m_pFilter->GetPinVersion() == m_Version ? FALSE : TRUE);

+    };

+

+    /* This method performs the same operations as Reset, except is does not clear

+       the cache of pins already enumerated. */

+

+    STDMETHODIMP Refresh();

+

+public:

+

+    CEnumPins(

+        __in CBaseFilter *pFilter,

+        __in_opt CEnumPins *pEnumPins);

+

+    virtual ~CEnumPins();

+

+    // IUnknown

+    STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv);

+    STDMETHODIMP_(ULONG) AddRef();

+    STDMETHODIMP_(ULONG) Release();

+

+    // IEnumPins

+    STDMETHODIMP Next(

+        ULONG cPins,         // place this many pins...

+        __out_ecount(cPins) IPin ** ppPins,    // ...in this array of IPin*

+        __out_opt ULONG * pcFetched    // actual count passed returned here

+    );

+

+    STDMETHODIMP Skip(ULONG cPins);

+    STDMETHODIMP Reset();

+    STDMETHODIMP Clone(__deref_out IEnumPins **ppEnum);

+

+

+};

+

+

+//=====================================================================

+//=====================================================================

+// Defines CEnumMediaTypes

+//

+// Enumerates the preferred formats for input and output pins

+//=====================================================================

+//=====================================================================

+

+class CEnumMediaTypes : public IEnumMediaTypes    // The interface we support

+{

+    int m_Position;           // Current ordinal position

+    CBasePin *m_pPin;         // The pin who owns us

+    LONG m_Version;           // Media type version value

+    LONG m_cRef;

+#ifdef DEBUG

+    DWORD m_dwCookie;

+#endif

+

+    /* The media types a filter supports can be quite dynamic so we add to

+       the general IEnumXXXX interface the ability to be signaled when they

+       change via an event handle the connected filter supplies. Until the

+       Reset method is called after the state changes all further calls to

+       the enumerator (except Reset) will return E_UNEXPECTED error code */

+

+    BOOL AreWeOutOfSync() {

+        return (m_pPin->GetMediaTypeVersion() == m_Version ? FALSE : TRUE);

+    };

+

+public:

+

+    CEnumMediaTypes(

+        __in CBasePin *pPin,

+        __in_opt CEnumMediaTypes *pEnumMediaTypes);

+

+    virtual ~CEnumMediaTypes();

+

+    // IUnknown

+    STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv);

+    STDMETHODIMP_(ULONG) AddRef();

+    STDMETHODIMP_(ULONG) Release();

+

+    // IEnumMediaTypes

+    STDMETHODIMP Next(

+        ULONG cMediaTypes,          // place this many pins...

+        __out_ecount(cMediaTypes) AM_MEDIA_TYPE ** ppMediaTypes,  // ...in this array

+        __out_opt ULONG * pcFetched           // actual count passed

+    );

+

+    STDMETHODIMP Skip(ULONG cMediaTypes);

+    STDMETHODIMP Reset();

+    STDMETHODIMP Clone(__deref_out IEnumMediaTypes **ppEnum);

+};

+

+

+

+

+//=====================================================================

+//=====================================================================

+// Defines CBaseOutputPin

+//

+// class derived from CBasePin that can pass buffers to a connected pin

+// that supports IMemInputPin. Supports IPin.

+//

+// Derive your output pin from this.

+//

+//=====================================================================

+//=====================================================================

+

+class  AM_NOVTABLE CBaseOutputPin : public CBasePin

+{

+

+protected:

+

+    IMemAllocator *m_pAllocator;

+    IMemInputPin *m_pInputPin;        // interface on the downstreaminput pin

+                                      // set up in CheckConnect when we connect.

+

+public:

+

+    CBaseOutputPin(

+        __in_opt LPCTSTR pObjectName,

+        __in CBaseFilter *pFilter,

+        __in CCritSec *pLock,

+        __inout HRESULT *phr,

+        __in_opt LPCWSTR pName);

+#ifdef UNICODE

+    CBaseOutputPin(

+        __in_opt LPCSTR pObjectName,

+        __in CBaseFilter *pFilter,

+        __in CCritSec *pLock,

+        __inout HRESULT *phr,

+        __in_opt LPCWSTR pName);

+#endif

+    // override CompleteConnect() so we can negotiate an allocator

+    virtual HRESULT CompleteConnect(IPin *pReceivePin);

+

+    // negotiate the allocator and its buffer size/count and other properties

+    // Calls DecideBufferSize to set properties

+    virtual HRESULT DecideAllocator(IMemInputPin * pPin, __deref_out IMemAllocator ** pAlloc);

+

+    // override this to set the buffer size and count. Return an error

+    // if the size/count is not to your liking.

+    // The allocator properties passed in are those requested by the

+    // input pin - use eg the alignment and prefix members if you have

+    // no preference on these.

+    virtual HRESULT DecideBufferSize(

+        IMemAllocator * pAlloc,

+        __inout ALLOCATOR_PROPERTIES * ppropInputRequest

+    ) PURE;

+

+    // returns an empty sample buffer from the allocator

+    virtual HRESULT GetDeliveryBuffer(__deref_out IMediaSample ** ppSample,

+                                      __in_opt REFERENCE_TIME * pStartTime,

+                                      __in_opt REFERENCE_TIME * pEndTime,

+                                      DWORD dwFlags);

+

+    // deliver a filled-in sample to the connected input pin

+    // note - you need to release it after calling this. The receiving

+    // pin will addref the sample if it needs to hold it beyond the

+    // call.

+    virtual HRESULT Deliver(IMediaSample *);

+

+    // override this to control the connection

+    virtual HRESULT InitAllocator(__deref_out IMemAllocator **ppAlloc);

+    HRESULT CheckConnect(IPin *pPin);

+    HRESULT BreakConnect();

+

+    // override to call Commit and Decommit

+    HRESULT Active(void);

+    HRESULT Inactive(void);

+

+    // we have a default handling of EndOfStream which is to return

+    // an error, since this should be called on input pins only

+    STDMETHODIMP EndOfStream(void);

+

+    // called from elsewhere in our filter to pass EOS downstream to

+    // our connected input pin

+    virtual HRESULT DeliverEndOfStream(void);

+

+    // same for Begin/EndFlush - we handle Begin/EndFlush since it

+    // is an error on an output pin, and we have Deliver methods to

+    // call the methods on the connected pin

+    STDMETHODIMP BeginFlush(void);

+    STDMETHODIMP EndFlush(void);

+    virtual HRESULT DeliverBeginFlush(void);

+    virtual HRESULT DeliverEndFlush(void);

+

+    // deliver NewSegment to connected pin - you will need to

+    // override this if you queue any data in your output pin.

+    virtual HRESULT DeliverNewSegment(

+                        REFERENCE_TIME tStart,

+                        REFERENCE_TIME tStop,

+                        double dRate);

+

+    //================================================================================

+    // IQualityControl methods

+    //================================================================================

+

+    // All inherited from CBasePin and not overridden here.

+    // STDMETHODIMP Notify(IBaseFilter * pSender, Quality q);

+    // STDMETHODIMP SetSink(IQualityControl * piqc);

+};

+

+

+//=====================================================================

+//=====================================================================

+// Defines CBaseInputPin

+//

+// derive your standard input pin from this.

+// you need to supply GetMediaType and CheckConnect etc (see CBasePin),

+// and you need to supply Receive to do something more useful.

+//

+//=====================================================================

+//=====================================================================

+

+class AM_NOVTABLE CBaseInputPin : public CBasePin,

+                                  public IMemInputPin

+{

+

+protected:

+

+    IMemAllocator *m_pAllocator;    // Default memory allocator

+

+    // allocator is read-only, so received samples

+    // cannot be modified (probably only relevant to in-place

+    // transforms

+    BYTE m_bReadOnly;

+

+    // in flushing state (between BeginFlush and EndFlush)

+    // if TRUE, all Receives are returned with S_FALSE

+    BYTE m_bFlushing;

+

+    // Sample properties - initalized in Receive

+    AM_SAMPLE2_PROPERTIES m_SampleProps;

+

+public:

+

+    CBaseInputPin(

+        __in_opt LPCTSTR pObjectName,

+        __in CBaseFilter *pFilter,

+        __in CCritSec *pLock,

+        __inout HRESULT *phr,

+        __in_opt LPCWSTR pName);

+#ifdef UNICODE

+    CBaseInputPin(

+        __in_opt LPCSTR pObjectName,

+        __in CBaseFilter *pFilter,

+        __in CCritSec *pLock,

+        __inout HRESULT *phr,

+        __in_opt LPCWSTR pName);

+#endif

+    virtual ~CBaseInputPin();

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    // return the allocator interface that this input pin

+    // would like the output pin to use

+    STDMETHODIMP GetAllocator(__deref_out IMemAllocator ** ppAllocator);

+

+    // tell the input pin which allocator the output pin is actually

+    // going to use.

+    STDMETHODIMP NotifyAllocator(

+                    IMemAllocator * pAllocator,

+                    BOOL bReadOnly);

+

+    // do something with this media sample

+    STDMETHODIMP Receive(IMediaSample *pSample);

+

+    // do something with these media samples

+    STDMETHODIMP ReceiveMultiple (

+        __in_ecount(nSamples) IMediaSample **pSamples,

+        long nSamples,

+        __out long *nSamplesProcessed);

+

+    // See if Receive() blocks

+    STDMETHODIMP ReceiveCanBlock();

+

+    // Default handling for BeginFlush - call at the beginning

+    // of your implementation (makes sure that all Receive calls

+    // fail). After calling this, you need to free any queued data

+    // and then call downstream.

+    STDMETHODIMP BeginFlush(void);

+

+    // default handling for EndFlush - call at end of your implementation

+    // - before calling this, ensure that there is no queued data and no thread

+    // pushing any more without a further receive, then call downstream,

+    // then call this method to clear the m_bFlushing flag and re-enable

+    // receives

+    STDMETHODIMP EndFlush(void);

+

+    // this method is optional (can return E_NOTIMPL).

+    // default implementation returns E_NOTIMPL. Override if you have

+    // specific alignment or prefix needs, but could use an upstream

+    // allocator

+    STDMETHODIMP GetAllocatorRequirements(__out ALLOCATOR_PROPERTIES*pProps);

+

+    // Release the pin's allocator.

+    HRESULT BreakConnect();

+

+    // helper method to check the read-only flag

+    BOOL IsReadOnly() {

+        return m_bReadOnly;

+    };

+

+    // helper method to see if we are flushing

+    BOOL IsFlushing() {

+        return m_bFlushing;

+    };

+

+    //  Override this for checking whether it's OK to process samples

+    //  Also call this from EndOfStream.

+    virtual HRESULT CheckStreaming();

+

+    // Pass a Quality notification on to the appropriate sink

+    HRESULT PassNotify(Quality& q);

+

+

+    //================================================================================

+    // IQualityControl methods (from CBasePin)

+    //================================================================================

+

+    STDMETHODIMP Notify(IBaseFilter * pSender, Quality q);

+

+    // no need to override:

+    // STDMETHODIMP SetSink(IQualityControl * piqc);

+

+

+    // switch the pin to inactive state - may already be inactive

+    virtual HRESULT Inactive(void);

+

+    // Return sample properties pointer

+    AM_SAMPLE2_PROPERTIES * SampleProps() {

+        ASSERT(m_SampleProps.cbData != 0);

+        return &m_SampleProps;

+    }

+

+};

+

+///////////////////////////////////////////////////////////////////////////

+// CDynamicOutputPin

+//

+

+class CDynamicOutputPin : public CBaseOutputPin,

+                          public IPinFlowControl

+{

+public:

+#ifdef UNICODE

+    CDynamicOutputPin(

+        __in_opt LPCSTR pObjectName,

+        __in CBaseFilter *pFilter,

+        __in CCritSec *pLock,

+        __inout HRESULT *phr,

+        __in_opt LPCWSTR pName);

+#endif

+

+    CDynamicOutputPin(

+        __in_opt LPCTSTR pObjectName,

+        __in CBaseFilter *pFilter,

+        __in CCritSec *pLock,

+        __inout HRESULT *phr,

+        __in_opt LPCWSTR pName);

+

+    ~CDynamicOutputPin();

+

+    // IUnknown Methods

+    DECLARE_IUNKNOWN

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    // IPin Methods

+    STDMETHODIMP Disconnect(void);

+

+    // IPinFlowControl Methods

+    STDMETHODIMP Block(DWORD dwBlockFlags, HANDLE hEvent);

+

+    //  Set graph config info

+    void SetConfigInfo(IGraphConfig *pGraphConfig, HANDLE hStopEvent);

+

+    #ifdef DEBUG

+    virtual HRESULT Deliver(IMediaSample *pSample);

+    virtual HRESULT DeliverEndOfStream(void);

+    virtual HRESULT DeliverNewSegment(REFERENCE_TIME tStart, REFERENCE_TIME tStop, double dRate);

+    #endif // DEBUG

+

+    HRESULT DeliverBeginFlush(void);

+    HRESULT DeliverEndFlush(void);

+

+    HRESULT Inactive(void);

+    HRESULT Active(void);

+    virtual HRESULT CompleteConnect(IPin *pReceivePin);

+

+    virtual HRESULT StartUsingOutputPin(void);

+    virtual void StopUsingOutputPin(void);

+    virtual bool StreamingThreadUsingOutputPin(void);

+

+    HRESULT ChangeOutputFormat

+        (

+        const AM_MEDIA_TYPE *pmt,

+        REFERENCE_TIME tSegmentStart,

+        REFERENCE_TIME tSegmentStop,

+        double dSegmentRate

+        );

+    HRESULT ChangeMediaType(const CMediaType *pmt);

+    HRESULT DynamicReconnect(const CMediaType *pmt);

+

+protected:

+    HRESULT SynchronousBlockOutputPin(void);

+    HRESULT AsynchronousBlockOutputPin(HANDLE hNotifyCallerPinBlockedEvent);

+    HRESULT UnblockOutputPin(void);

+

+    void BlockOutputPin(void);

+    void ResetBlockState(void);

+

+    static HRESULT WaitEvent(HANDLE hEvent);

+

+    enum BLOCK_STATE

+    {

+        NOT_BLOCKED,

+        PENDING,

+        BLOCKED

+    };

+

+    // This lock should be held when the following class members are

+    // being used: m_hNotifyCallerPinBlockedEvent, m_BlockState,

+    // m_dwBlockCallerThreadID and m_dwNumOutstandingOutputPinUsers.

+    CCritSec m_BlockStateLock;

+

+    // This event should be signaled when the output pin is

+    // not blocked.  This is a manual reset event.  For more

+    // information on events, see the documentation for

+    // CreateEvent() in the Windows SDK.

+    HANDLE m_hUnblockOutputPinEvent;

+

+    // This event will be signaled when block operation succeedes or

+    // when the user cancels the block operation.  The block operation

+    // can be canceled by calling IPinFlowControl2::Block( 0, NULL )

+    // while the block operation is pending.

+    HANDLE m_hNotifyCallerPinBlockedEvent;

+

+    // The state of the current block operation.

+    BLOCK_STATE m_BlockState;

+

+    // The ID of the thread which last called IPinFlowControl::Block().

+    // For more information on thread IDs, see the documentation for

+    // GetCurrentThreadID() in the Windows SDK.

+    DWORD m_dwBlockCallerThreadID;

+

+    // The number of times StartUsingOutputPin() has been sucessfully

+    // called and a corresponding call to StopUsingOutputPin() has not

+    // been made.  When this variable is greater than 0, the streaming

+    // thread is calling IPin::NewSegment(), IPin::EndOfStream(),

+    // IMemInputPin::Receive() or IMemInputPin::ReceiveMultiple().  The

+    // streaming thread could also be calling: DynamicReconnect(),

+    // ChangeMediaType() or ChangeOutputFormat().  The output pin cannot

+    // be blocked while the output pin is being used.

+    DWORD m_dwNumOutstandingOutputPinUsers;

+

+    // This event should be set when the IMediaFilter::Stop() is called.

+    // This is a manual reset event.  It is also set when the output pin

+    // delivers a flush to the connected input pin.

+    HANDLE m_hStopEvent;

+    IGraphConfig* m_pGraphConfig;

+

+    // TRUE if the output pin's allocator's samples are read only.

+    // Otherwise FALSE.  For more information, see the documentation

+    // for IMemInputPin::NotifyAllocator().

+    BOOL m_bPinUsesReadOnlyAllocator;

+

+private:

+    HRESULT Initialize(void);

+    HRESULT ChangeMediaTypeHelper(const CMediaType *pmt);

+

+    #ifdef DEBUG

+    void AssertValid(void);

+    #endif // DEBUG

+};

+

+class CAutoUsingOutputPin

+{

+public:

+    CAutoUsingOutputPin( __in CDynamicOutputPin* pOutputPin, __inout HRESULT* phr );

+    ~CAutoUsingOutputPin();

+

+private:

+    CDynamicOutputPin* m_pOutputPin;

+};

+

+inline CAutoUsingOutputPin::CAutoUsingOutputPin( __in CDynamicOutputPin* pOutputPin, __inout HRESULT* phr ) :

+    m_pOutputPin(NULL)

+{

+    // The caller should always pass in valid pointers.

+    ASSERT( NULL != pOutputPin );

+    ASSERT( NULL != phr );

+

+    // Make sure the user initialized phr.

+    ASSERT( S_OK == *phr );

+

+    HRESULT hr = pOutputPin->StartUsingOutputPin();

+    if( FAILED( hr ) )

+    {

+        *phr = hr;

+        return;

+    }

+

+    m_pOutputPin = pOutputPin;

+}

+

+inline CAutoUsingOutputPin::~CAutoUsingOutputPin()

+{

+    if( NULL != m_pOutputPin )

+    {

+        m_pOutputPin->StopUsingOutputPin();

+    }

+}

+

+#ifdef DEBUG

+

+inline HRESULT CDynamicOutputPin::Deliver(IMediaSample *pSample)

+{

+    // The caller should call StartUsingOutputPin() before calling this

+    // method.

+    ASSERT(StreamingThreadUsingOutputPin());

+

+    return CBaseOutputPin::Deliver(pSample);

+}

+

+inline HRESULT CDynamicOutputPin::DeliverEndOfStream(void)

+{

+    // The caller should call StartUsingOutputPin() before calling this

+    // method.

+    ASSERT( StreamingThreadUsingOutputPin() );

+

+    return CBaseOutputPin::DeliverEndOfStream();

+}

+

+inline HRESULT CDynamicOutputPin::DeliverNewSegment(REFERENCE_TIME tStart, REFERENCE_TIME tStop, double dRate)

+{

+    // The caller should call StartUsingOutputPin() before calling this

+    // method.

+    ASSERT(StreamingThreadUsingOutputPin());

+

+    return CBaseOutputPin::DeliverNewSegment(tStart, tStop, dRate);

+}

+

+#endif // DEBUG

+

+//=====================================================================

+//=====================================================================

+// Memory allocators

+//

+// the shared memory transport between pins requires the input pin

+// to provide a memory allocator that can provide sample objects. A

+// sample object supports the IMediaSample interface.

+//

+// CBaseAllocator handles the management of free and busy samples. It

+// allocates CMediaSample objects. CBaseAllocator is an abstract class:

+// in particular it has no method of initializing the list of free

+// samples. CMemAllocator is derived from CBaseAllocator and initializes

+// the list of samples using memory from the standard IMalloc interface.

+//

+// If you want your buffers to live in some special area of memory,

+// derive your allocator object from CBaseAllocator. If you derive your

+// IMemInputPin interface object from CBaseMemInputPin, you will get

+// CMemAllocator-based allocation etc for free and will just need to

+// supply the Receive handling, and media type / format negotiation.

+//=====================================================================

+//=====================================================================

+

+

+//=====================================================================

+//=====================================================================

+// Defines CMediaSample

+//

+// an object of this class supports IMediaSample and represents a buffer

+// for media data with some associated properties. Releasing it returns

+// it to a freelist managed by a CBaseAllocator derived object.

+//=====================================================================

+//=====================================================================

+

+class CMediaSample : public IMediaSample2    // The interface we support

+{

+

+protected:

+

+    friend class CBaseAllocator;

+

+    /*  Values for dwFlags - these are used for backward compatiblity

+        only now - use AM_SAMPLE_xxx

+    */

+    enum { Sample_SyncPoint       = 0x01,   /* Is this a sync point */

+           Sample_Preroll         = 0x02,   /* Is this a preroll sample */

+           Sample_Discontinuity   = 0x04,   /* Set if start of new segment */

+           Sample_TypeChanged     = 0x08,   /* Has the type changed */

+           Sample_TimeValid       = 0x10,   /* Set if time is valid */

+           Sample_MediaTimeValid  = 0x20,   /* Is the media time valid */

+           Sample_TimeDiscontinuity = 0x40, /* Time discontinuity */

+           Sample_StopValid       = 0x100,  /* Stop time valid */

+           Sample_ValidFlags      = 0x1FF

+         };

+

+    /* Properties, the media sample class can be a container for a format

+       change in which case we take a copy of a type through the SetMediaType

+       interface function and then return it when GetMediaType is called. As

+       we do no internal processing on it we leave it as a pointer */

+

+    DWORD            m_dwFlags;         /* Flags for this sample */

+                                        /* Type specific flags are packed

+                                           into the top word

+                                        */

+    DWORD            m_dwTypeSpecificFlags; /* Media type specific flags */

+    __field_ecount_opt(m_cbBuffer) LPBYTE           m_pBuffer;         /* Pointer to the complete buffer */

+    LONG             m_lActual;         /* Length of data in this sample */

+    LONG             m_cbBuffer;        /* Size of the buffer */

+    CBaseAllocator  *m_pAllocator;      /* The allocator who owns us */

+    CMediaSample     *m_pNext;          /* Chaining in free list */

+    REFERENCE_TIME   m_Start;           /* Start sample time */

+    REFERENCE_TIME   m_End;             /* End sample time */

+    LONGLONG         m_MediaStart;      /* Real media start position */

+    LONG             m_MediaEnd;        /* A difference to get the end */

+    AM_MEDIA_TYPE    *m_pMediaType;     /* Media type change data */

+    DWORD            m_dwStreamId;      /* Stream id */

+public:

+    LONG             m_cRef;            /* Reference count */

+

+

+public:

+

+    CMediaSample(

+        __in_opt LPCTSTR pName,

+        __in_opt CBaseAllocator *pAllocator,

+        __inout_opt HRESULT *phr,

+        __in_bcount_opt(length) LPBYTE pBuffer = NULL,

+        LONG length = 0);

+#ifdef UNICODE

+    CMediaSample(

+        __in_opt LPCSTR pName,

+        __in_opt CBaseAllocator *pAllocator,

+        __inout_opt HRESULT *phr,

+        __in_bcount_opt(length) LPBYTE pBuffer = NULL,

+        LONG length = 0);

+#endif

+

+    virtual ~CMediaSample();

+

+    /* Note the media sample does not delegate to its owner */

+

+    STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv);

+    STDMETHODIMP_(ULONG) AddRef();

+    STDMETHODIMP_(ULONG) Release();

+

+    // set the buffer pointer and length. Used by allocators that

+    // want variable sized pointers or pointers into already-read data.

+    // This is only available through a CMediaSample* not an IMediaSample*

+    // and so cannot be changed by clients.

+    HRESULT SetPointer(__in_bcount(cBytes) BYTE * ptr, LONG cBytes);

+

+    // Get me a read/write pointer to this buffer's memory.

+    STDMETHODIMP GetPointer(__deref_out BYTE ** ppBuffer);

+

+    STDMETHODIMP_(LONG) GetSize(void);

+

+    // get the stream time at which this sample should start and finish.

+    STDMETHODIMP GetTime(

+        __out REFERENCE_TIME * pTimeStart,     // put time here

+        __out REFERENCE_TIME * pTimeEnd

+    );

+

+    // Set the stream time at which this sample should start and finish.

+    STDMETHODIMP SetTime(

+        __in_opt REFERENCE_TIME * pTimeStart,     // put time here

+        __in_opt REFERENCE_TIME * pTimeEnd

+    );

+    STDMETHODIMP IsSyncPoint(void);

+    STDMETHODIMP SetSyncPoint(BOOL bIsSyncPoint);

+    STDMETHODIMP IsPreroll(void);

+    STDMETHODIMP SetPreroll(BOOL bIsPreroll);

+

+    STDMETHODIMP_(LONG) GetActualDataLength(void);

+    STDMETHODIMP SetActualDataLength(LONG lActual);

+

+    // these allow for limited format changes in band

+

+    STDMETHODIMP GetMediaType(__deref_out AM_MEDIA_TYPE **ppMediaType);

+    STDMETHODIMP SetMediaType(__in_opt AM_MEDIA_TYPE *pMediaType);

+

+    // returns S_OK if there is a discontinuity in the data (this same is

+    // not a continuation of the previous stream of data

+    // - there has been a seek).

+    STDMETHODIMP IsDiscontinuity(void);

+    // set the discontinuity property - TRUE if this sample is not a

+    // continuation, but a new sample after a seek.

+    STDMETHODIMP SetDiscontinuity(BOOL bDiscontinuity);

+

+    // get the media times for this sample

+    STDMETHODIMP GetMediaTime(

+    	__out LONGLONG * pTimeStart,

+	    __out LONGLONG * pTimeEnd

+    );

+

+    // Set the media times for this sample

+    STDMETHODIMP SetMediaTime(

+    	__in_opt LONGLONG * pTimeStart,

+	    __in_opt LONGLONG * pTimeEnd

+    );

+

+    // Set and get properties (IMediaSample2)

+    STDMETHODIMP GetProperties(

+        DWORD cbProperties,

+        __out_bcount(cbProperties) BYTE * pbProperties

+    );

+

+    STDMETHODIMP SetProperties(

+        DWORD cbProperties,

+        __in_bcount(cbProperties) const BYTE * pbProperties

+    );

+};

+

+

+//=====================================================================

+//=====================================================================

+// Defines CBaseAllocator

+//

+// Abstract base class that manages a list of media samples

+//

+// This class provides support for getting buffers from the free list,

+// including handling of commit and (asynchronous) decommit.

+//

+// Derive from this class and override the Alloc and Free functions to

+// allocate your CMediaSample (or derived) objects and add them to the

+// free list, preparing them as necessary.

+//=====================================================================

+//=====================================================================

+

+class AM_NOVTABLE CBaseAllocator : public CUnknown,// A non delegating IUnknown

+                       public IMemAllocatorCallbackTemp, // The interface we support

+                       public CCritSec             // Provides object locking

+{

+    class CSampleList;

+    friend class CSampleList;

+

+    /*  Trick to get at protected member in CMediaSample */

+    static CMediaSample * &NextSample(__in CMediaSample *pSample)

+    {

+        return pSample->m_pNext;

+    };

+

+    /*  Mini list class for the free list */

+    class CSampleList

+    {

+    public:

+        CSampleList() : m_List(NULL), m_nOnList(0) {};

+#ifdef DEBUG

+        ~CSampleList()

+        {

+            ASSERT(m_nOnList == 0);

+        };

+#endif

+        CMediaSample *Head() const { return m_List; };

+        CMediaSample *Next(__in CMediaSample *pSample) const { return CBaseAllocator::NextSample(pSample); };

+        int GetCount() const { return m_nOnList; };

+        void Add(__inout CMediaSample *pSample)

+        {

+            ASSERT(pSample != NULL);

+            CBaseAllocator::NextSample(pSample) = m_List;

+            m_List = pSample;

+            m_nOnList++;

+        };

+        CMediaSample *RemoveHead()

+        {

+            CMediaSample *pSample = m_List;

+            if (pSample != NULL) {

+                m_List = CBaseAllocator::NextSample(m_List);

+                m_nOnList--;

+            }

+            return pSample;

+        };

+        void Remove(__inout CMediaSample *pSample);

+

+    public:

+        CMediaSample *m_List;

+        int           m_nOnList;

+    };

+protected:

+

+    CSampleList m_lFree;        // Free list

+

+    /*  Note to overriders of CBaseAllocator.

+

+        We use a lazy signalling mechanism for waiting for samples.

+        This means we don't call the OS if no waits occur.

+

+        In order to implement this:

+

+        1. When a new sample is added to m_lFree call NotifySample() which

+           calls ReleaseSemaphore on m_hSem with a count of m_lWaiting and

+           sets m_lWaiting to 0.

+           This must all be done holding the allocator's critical section.

+

+        2. When waiting for a sample call SetWaiting() which increments

+           m_lWaiting BEFORE leaving the allocator's critical section.

+

+        3. Actually wait by calling WaitForSingleObject(m_hSem, INFINITE)

+           having left the allocator's critical section.  The effect of

+           this is to remove 1 from the semaphore's count.  You MUST call

+           this once having incremented m_lWaiting.

+

+        The following are then true when the critical section is not held :

+            (let nWaiting = number about to wait or waiting)

+

+            (1) if (m_lFree.GetCount() != 0) then (m_lWaiting == 0)

+            (2) m_lWaiting + Semaphore count == nWaiting

+

+        We would deadlock if

+           nWaiting != 0 &&

+           m_lFree.GetCount() != 0 &&

+           Semaphore count == 0

+

+           But from (1) if m_lFree.GetCount() != 0 then m_lWaiting == 0 so

+           from (2) Semaphore count == nWaiting (which is non-0) so the

+           deadlock can't happen.

+    */

+

+    HANDLE m_hSem;              // For signalling

+    long m_lWaiting;            // Waiting for a free element

+    long m_lCount;              // how many buffers we have agreed to provide

+    long m_lAllocated;          // how many buffers are currently allocated

+    long m_lSize;               // agreed size of each buffer

+    long m_lAlignment;          // agreed alignment

+    long m_lPrefix;             // agreed prefix (preceeds GetPointer() value)

+    BOOL m_bChanged;            // Have the buffer requirements changed

+

+    // if true, we are decommitted and can't allocate memory

+    BOOL m_bCommitted;

+    // if true, the decommit has happened, but we haven't called Free yet

+    // as there are still outstanding buffers

+    BOOL m_bDecommitInProgress;

+

+    //  Notification interface

+    IMemAllocatorNotifyCallbackTemp *m_pNotify;

+

+    BOOL m_fEnableReleaseCallback;

+

+    // called to decommit the memory when the last buffer is freed

+    // pure virtual - need to override this

+    virtual void Free(void) PURE;

+

+    // override to allocate the memory when commit called

+    virtual HRESULT Alloc(void);

+

+public:

+

+    CBaseAllocator(

+        __in_opt LPCTSTR , __inout_opt LPUNKNOWN, __inout HRESULT *,

+        BOOL bEvent = TRUE, BOOL fEnableReleaseCallback = FALSE);

+#ifdef UNICODE

+    CBaseAllocator(

+        __in_opt LPCSTR , __inout_opt LPUNKNOWN, __inout HRESULT *,

+        BOOL bEvent = TRUE, BOOL fEnableReleaseCallback = FALSE);

+#endif

+    virtual ~CBaseAllocator();

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    STDMETHODIMP SetProperties(

+		    __in ALLOCATOR_PROPERTIES* pRequest,

+		    __out ALLOCATOR_PROPERTIES* pActual);

+

+    // return the properties actually being used on this allocator

+    STDMETHODIMP GetProperties(

+		    __out ALLOCATOR_PROPERTIES* pProps);

+

+    // override Commit to allocate memory. We handle the GetBuffer

+    //state changes

+    STDMETHODIMP Commit();

+

+    // override this to handle the memory freeing. We handle any outstanding

+    // GetBuffer calls

+    STDMETHODIMP Decommit();

+

+    // get container for a sample. Blocking, synchronous call to get the

+    // next free buffer (as represented by an IMediaSample interface).

+    // on return, the time etc properties will be invalid, but the buffer

+    // pointer and size will be correct. The two time parameters are

+    // optional and either may be NULL, they may alternatively be set to

+    // the start and end times the sample will have attached to it

+    // bPrevFramesSkipped is not used (used only by the video renderer's

+    // allocator where it affects quality management in direct draw).

+

+    STDMETHODIMP GetBuffer(__deref_out IMediaSample **ppBuffer,

+                           __in_opt REFERENCE_TIME * pStartTime,

+                           __in_opt REFERENCE_TIME * pEndTime,

+                           DWORD dwFlags);

+

+    // final release of a CMediaSample will call this

+    STDMETHODIMP ReleaseBuffer(IMediaSample *pBuffer);

+    // obsolete:: virtual void PutOnFreeList(CMediaSample * pSample);

+

+    STDMETHODIMP SetNotify(IMemAllocatorNotifyCallbackTemp *pNotify);

+

+    STDMETHODIMP GetFreeCount(__out LONG *plBuffersFree);

+

+    // Notify that a sample is available

+    void NotifySample();

+

+    // Notify that we're waiting for a sample

+    void SetWaiting() { m_lWaiting++; };

+};

+

+

+//=====================================================================

+//=====================================================================

+// Defines CMemAllocator

+//

+// this is an allocator based on CBaseAllocator that allocates sample

+// buffers in main memory (from 'new'). You must call SetProperties

+// before calling Commit.

+//

+// we don't free the memory when going into Decommit state. The simplest

+// way to implement this without complicating CBaseAllocator is to

+// have a Free() function, called to go into decommit state, that does

+// nothing and a ReallyFree function called from our destructor that

+// actually frees the memory.

+//=====================================================================

+//=====================================================================

+

+//  Make me one from quartz.dll

+STDAPI CreateMemoryAllocator(__deref_out IMemAllocator **ppAllocator);

+

+class CMemAllocator : public CBaseAllocator

+{

+

+protected:

+

+    LPBYTE m_pBuffer;   // combined memory for all buffers

+

+    // override to free the memory when decommit completes

+    // - we actually do nothing, and save the memory until deletion.

+    void Free(void);

+

+    // called from the destructor (and from Alloc if changing size/count) to

+    // actually free up the memory

+    void ReallyFree(void);

+

+    // overriden to allocate the memory when commit called

+    HRESULT Alloc(void);

+

+public:

+    /* This goes in the factory template table to create new instances */

+    static CUnknown *CreateInstance(__inout_opt LPUNKNOWN, __inout HRESULT *);

+

+    STDMETHODIMP SetProperties(

+		    __in ALLOCATOR_PROPERTIES* pRequest,

+		    __out ALLOCATOR_PROPERTIES* pActual);

+

+    CMemAllocator(__in_opt LPCTSTR , __inout_opt LPUNKNOWN, __inout HRESULT *);

+#ifdef UNICODE

+    CMemAllocator(__in_opt LPCSTR , __inout_opt LPUNKNOWN, __inout HRESULT *);

+#endif

+    ~CMemAllocator();

+};

+

+// helper used by IAMovieSetup implementation

+STDAPI

+AMovieSetupRegisterFilter( const AMOVIESETUP_FILTER * const psetupdata

+                         , IFilterMapper *                  pIFM

+                         , BOOL                             bRegister  );

+

+

+///////////////////////////////////////////////////////////////////////////

+// ------------------------------------------------------------------------

+// ------------------------------------------------------------------------

+// ------------------------------------------------------------------------

+// ------------------------------------------------------------------------

+///////////////////////////////////////////////////////////////////////////

+

+#endif /* __FILTER__ */

+

+

+

diff --git a/Samples/multimedia/directshow/baseclasses/amvideo.cpp b/Samples/multimedia/directshow/baseclasses/amvideo.cpp
new file mode 100644
index 0000000..42fe446
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/amvideo.cpp
@@ -0,0 +1,275 @@
+//------------------------------------------------------------------------------

+// File: AMVideo.cpp

+//

+// Desc: DirectShow base classes - implements helper functions for

+//       bitmap formats.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+#include <streams.h>

+#include <limits.h>

+

+// These are bit field masks for true colour devices

+

+const DWORD bits555[] = {0x007C00,0x0003E0,0x00001F};

+const DWORD bits565[] = {0x00F800,0x0007E0,0x00001F};

+const DWORD bits888[] = {0xFF0000,0x00FF00,0x0000FF};

+

+// This maps bitmap subtypes into a bits per pixel value and also a

+// name. unicode and ansi versions are stored because we have to

+// return a pointer to a static string.

+const struct {

+    const GUID *pSubtype;

+    WORD BitCount;

+    CHAR *pName;

+    WCHAR *wszName;

+} BitCountMap[] =  { &MEDIASUBTYPE_RGB1,        1,   "RGB Monochrome",     L"RGB Monochrome",   

+                     &MEDIASUBTYPE_RGB4,        4,   "RGB VGA",            L"RGB VGA",          

+                     &MEDIASUBTYPE_RGB8,        8,   "RGB 8",              L"RGB 8",            

+                     &MEDIASUBTYPE_RGB565,      16,  "RGB 565 (16 bit)",   L"RGB 565 (16 bit)", 

+                     &MEDIASUBTYPE_RGB555,      16,  "RGB 555 (16 bit)",   L"RGB 555 (16 bit)", 

+                     &MEDIASUBTYPE_RGB24,       24,  "RGB 24",             L"RGB 24",           

+                     &MEDIASUBTYPE_RGB32,       32,  "RGB 32",             L"RGB 32",

+                     &MEDIASUBTYPE_ARGB32,    32,  "ARGB 32",             L"ARGB 32",

+                     &MEDIASUBTYPE_Overlay,     0,   "Overlay",            L"Overlay",          

+                     &GUID_NULL,                0,   "UNKNOWN",            L"UNKNOWN"           

+};

+

+// Return the size of the bitmap as defined by this header

+

+STDAPI_(DWORD) GetBitmapSize(const BITMAPINFOHEADER *pHeader)

+{

+    return DIBSIZE(*pHeader);

+}

+

+

+// This is called if the header has a 16 bit colour depth and needs to work

+// out the detailed type from the bit fields (either RGB 565 or RGB 555)

+

+STDAPI_(const GUID) GetTrueColorType(const BITMAPINFOHEADER *pbmiHeader)

+{

+    BITMAPINFO *pbmInfo = (BITMAPINFO *) pbmiHeader;

+    ASSERT(pbmiHeader->biBitCount == 16);

+

+    // If its BI_RGB then it's RGB 555 by default

+

+    if (pbmiHeader->biCompression == BI_RGB) {

+        return MEDIASUBTYPE_RGB555;

+    }

+

+    // Compare the bit fields with RGB 555

+

+    DWORD *pMask = (DWORD *) pbmInfo->bmiColors;

+    if (pMask[0] == bits555[0]) {

+        if (pMask[1] == bits555[1]) {

+            if (pMask[2] == bits555[2]) {

+                return MEDIASUBTYPE_RGB555;

+            }

+        }

+    }

+

+    // Compare the bit fields with RGB 565

+

+    pMask = (DWORD *) pbmInfo->bmiColors;

+    if (pMask[0] == bits565[0]) {

+        if (pMask[1] == bits565[1]) {

+            if (pMask[2] == bits565[2]) {

+                return MEDIASUBTYPE_RGB565;

+            }

+        }

+    }

+    return GUID_NULL;

+}

+

+

+// Given a BITMAPINFOHEADER structure this returns the GUID sub type that is

+// used to describe it in format negotiations. For example a video codec fills

+// in the format block with a VIDEOINFO structure, it also fills in the major

+// type with MEDIATYPE_VIDEO and the subtype with a GUID that matches the bit

+// count, for example if it is an eight bit image then MEDIASUBTYPE_RGB8

+

+STDAPI_(const GUID) GetBitmapSubtype(const BITMAPINFOHEADER *pbmiHeader)

+{

+    ASSERT(pbmiHeader);

+

+    // If it's not RGB then create a GUID from the compression type

+

+    if (pbmiHeader->biCompression != BI_RGB) {

+        if (pbmiHeader->biCompression != BI_BITFIELDS) {

+            FOURCCMap FourCCMap(pbmiHeader->biCompression);

+            return (const GUID) FourCCMap;

+        }

+    }

+

+    // Map the RGB DIB bit depth to a image GUID

+

+    switch(pbmiHeader->biBitCount) {

+        case 1    :   return MEDIASUBTYPE_RGB1;

+        case 4    :   return MEDIASUBTYPE_RGB4;

+        case 8    :   return MEDIASUBTYPE_RGB8;

+        case 16   :   return GetTrueColorType(pbmiHeader);

+        case 24   :   return MEDIASUBTYPE_RGB24;

+        case 32   :   return MEDIASUBTYPE_RGB32;

+    }

+    return GUID_NULL;

+}

+

+

+// Given a video bitmap subtype we return the number of bits per pixel it uses

+// We return a WORD bit count as thats what the BITMAPINFOHEADER uses. If the

+// GUID subtype is not found in the table we return an invalid USHRT_MAX

+

+STDAPI_(WORD) GetBitCount(const GUID *pSubtype)

+{

+    ASSERT(pSubtype);

+    const GUID *pMediaSubtype;

+    INT iPosition = 0;

+

+    // Scan the mapping list seeing if the source GUID matches any known

+    // bitmap subtypes, the list is terminated by a GUID_NULL entry

+

+    while (TRUE) {

+        pMediaSubtype = BitCountMap[iPosition].pSubtype;

+        if (IsEqualGUID(*pMediaSubtype,GUID_NULL)) {

+            return USHRT_MAX;

+        }

+        if (IsEqualGUID(*pMediaSubtype,*pSubtype)) {

+            return BitCountMap[iPosition].BitCount;

+        }

+        iPosition++;

+    }

+}

+

+

+// Given a bitmap subtype we return a description name that can be used for

+// debug purposes. In a retail build this function still returns the names

+// If the subtype isn't found in the lookup table we return string UNKNOWN

+

+int LocateSubtype(const GUID *pSubtype)

+{

+    ASSERT(pSubtype);

+    const GUID *pMediaSubtype;

+    INT iPosition = 0;

+

+    // Scan the mapping list seeing if the source GUID matches any known

+    // bitmap subtypes, the list is terminated by a GUID_NULL entry

+

+    while (TRUE) {

+        pMediaSubtype = BitCountMap[iPosition].pSubtype;

+        if (IsEqualGUID(*pMediaSubtype,*pSubtype) ||

+            IsEqualGUID(*pMediaSubtype,GUID_NULL)

+            )

+        {

+            break;

+        }

+        

+        iPosition++;

+    }

+

+    return iPosition;

+}

+

+

+

+STDAPI_(WCHAR *) GetSubtypeNameW(const GUID *pSubtype)

+{

+    return BitCountMap[LocateSubtype(pSubtype)].wszName;

+}

+

+STDAPI_(CHAR *) GetSubtypeNameA(const GUID *pSubtype)

+{

+    return BitCountMap[LocateSubtype(pSubtype)].pName;

+}

+

+#ifndef GetSubtypeName

+#error wxutil.h should have defined GetSubtypeName

+#endif

+#undef GetSubtypeName

+

+// this is here for people that linked to it directly; most people

+// would use the header file that picks the A or W version.

+STDAPI_(CHAR *) GetSubtypeName(const GUID *pSubtype)

+{

+    return GetSubtypeNameA(pSubtype);

+}

+

+

+// The mechanism for describing a bitmap format is with the BITMAPINFOHEADER

+// This is really messy to deal with because it invariably has fields that

+// follow it holding bit fields, palettes and the rest. This function gives

+// the number of bytes required to hold a VIDEOINFO that represents it. This

+// count includes the prefix information (like the rcSource rectangle) the

+// BITMAPINFOHEADER field, and any other colour information on the end.

+//

+// WARNING If you want to copy a BITMAPINFOHEADER into a VIDEOINFO always make

+// sure that you use the HEADER macro because the BITMAPINFOHEADER field isn't

+// right at the start of the VIDEOINFO (there are a number of other fields),

+//

+//     CopyMemory(HEADER(pVideoInfo),pbmi,sizeof(BITMAPINFOHEADER));

+//

+

+STDAPI_(LONG) GetBitmapFormatSize(const BITMAPINFOHEADER *pHeader)

+{

+    // Everyone has this to start with this  

+    LONG Size = SIZE_PREHEADER + pHeader->biSize;

+

+    ASSERT(pHeader->biSize >= sizeof(BITMAPINFOHEADER));

+    

+    // Does this format use a palette, if the number of colours actually used

+    // is zero then it is set to the maximum that are allowed for that colour

+    // depth (an example is 256 for eight bits). Truecolour formats may also

+    // pass a palette with them in which case the used count is non zero

+

+    // This would scare me.

+    ASSERT(pHeader->biBitCount <= iPALETTE || pHeader->biClrUsed == 0);

+

+    if (pHeader->biBitCount <= iPALETTE || pHeader->biClrUsed) {

+        LONG Entries = (DWORD) 1 << pHeader->biBitCount;

+        if (pHeader->biClrUsed) {

+            Entries = pHeader->biClrUsed;

+        }

+        Size += Entries * sizeof(RGBQUAD);

+    }

+

+    // Truecolour formats may have a BI_BITFIELDS specifier for compression

+    // type which means that room for three DWORDs should be allocated that

+    // specify where in each pixel the RGB colour components may be found

+

+    if (pHeader->biCompression == BI_BITFIELDS) {

+        Size += SIZE_MASKS;

+    }

+

+    // A BITMAPINFO for a palettised image may also contain a palette map that

+    // provides the information to map from a source palette to a destination

+    // palette during a BitBlt for example, because this information is only

+    // ever processed during drawing you don't normally store the palette map

+    // nor have any way of knowing if it is present in the data structure

+

+    return Size;

+}

+

+

+// Returns TRUE if the VIDEOINFO contains a palette

+

+STDAPI_(BOOL) ContainsPalette(const VIDEOINFOHEADER *pVideoInfo)

+{

+    if (PALETTISED(pVideoInfo) == FALSE) {

+        if (pVideoInfo->bmiHeader.biClrUsed == 0) {

+            return FALSE;

+        }

+    }

+    return TRUE;

+}

+

+

+// Return a pointer to the first entry in a palette

+

+STDAPI_(const RGBQUAD *) GetBitmapPalette(const VIDEOINFOHEADER *pVideoInfo)

+{

+    if (pVideoInfo->bmiHeader.biCompression == BI_BITFIELDS) {

+        return TRUECOLOR(pVideoInfo)->bmiColors;

+    }

+    return COLORS(pVideoInfo);

+}

diff --git a/Samples/multimedia/directshow/baseclasses/arithutil.cpp b/Samples/multimedia/directshow/baseclasses/arithutil.cpp
new file mode 100644
index 0000000..cd0d127
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/arithutil.cpp
@@ -0,0 +1,360 @@
+//------------------------------------------------------------------------------

+// File: ArithUtil.cpp

+//

+// Desc: DirectShow base classes - implements helper classes for building

+//       multimedia filters.

+//

+// Copyright (c) 1992-2004 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+#include <streams.h>

+

+//

+//  Declare function from largeint.h we need so that PPC can build

+//

+

+//

+// Enlarged integer divide - 64-bits / 32-bits > 32-bits

+//

+

+#ifndef _X86_

+

+#define LLtoU64(x) (*(unsigned __int64*)(void*)(&(x)))

+

+__inline

+ULONG

+WINAPI

+EnlargedUnsignedDivide (

+    IN ULARGE_INTEGER Dividend,

+    IN ULONG Divisor,

+    IN PULONG Remainder

+    )

+{

+        // return remainder if necessary

+        if (Remainder != NULL)

+                *Remainder = (ULONG)(LLtoU64(Dividend) % Divisor);

+        return (ULONG)(LLtoU64(Dividend) / Divisor);

+}

+

+#else

+__inline

+ULONG

+WINAPI

+EnlargedUnsignedDivide (

+    IN ULARGE_INTEGER Dividend,

+    IN ULONG Divisor,

+    IN PULONG Remainder

+    )

+{

+    ULONG ulResult;

+    _asm {

+        mov eax,Dividend.LowPart

+        mov edx,Dividend.HighPart

+        mov ecx,Remainder

+        div Divisor

+        or  ecx,ecx

+        jz  short label

+        mov [ecx],edx

+label:

+        mov ulResult,eax

+    }

+    return ulResult;

+}

+#endif

+

+

+/*  Arithmetic functions to help with time format conversions

+*/

+

+#ifdef _M_ALPHA

+// work around bug in version 12.00.8385 of the alpha compiler where

+// UInt32x32To64 sign-extends its arguments (?)

+#undef UInt32x32To64

+#define UInt32x32To64(a, b) (((ULONGLONG)((ULONG)(a)) & 0xffffffff) * ((ULONGLONG)((ULONG)(b)) & 0xffffffff))

+#endif

+

+/*   Compute (a * b + d) / c */

+LONGLONG WINAPI llMulDiv(LONGLONG a, LONGLONG b, LONGLONG c, LONGLONG d)

+{

+    /*  Compute the absolute values to avoid signed arithmetic problems */

+    ULARGE_INTEGER ua, ub;

+    DWORDLONG uc;

+

+    ua.QuadPart = (DWORDLONG)(a >= 0 ? a : -a);

+    ub.QuadPart = (DWORDLONG)(b >= 0 ? b : -b);

+    uc          = (DWORDLONG)(c >= 0 ? c : -c);

+    BOOL bSign = (a < 0) ^ (b < 0);

+

+    /*  Do long multiplication */

+    ULARGE_INTEGER p[2];

+    p[0].QuadPart  = UInt32x32To64(ua.LowPart, ub.LowPart);

+

+    /*  This next computation cannot overflow into p[1].HighPart because

+        the max number we can compute here is:

+

+                 (2 ** 32 - 1) * (2 ** 32 - 1) +  // ua.LowPart * ub.LowPart

+    (2 ** 32) *  (2 ** 31) * (2 ** 32 - 1) * 2    // x.LowPart * y.HighPart * 2

+

+    == 2 ** 96 - 2 ** 64 + (2 ** 64 - 2 ** 33 + 1)

+    == 2 ** 96 - 2 ** 33 + 1

+    < 2 ** 96

+    */

+

+    ULARGE_INTEGER x;

+    x.QuadPart     = UInt32x32To64(ua.LowPart, ub.HighPart) +

+                     UInt32x32To64(ua.HighPart, ub.LowPart) +

+                     p[0].HighPart;

+    p[0].HighPart  = x.LowPart;

+    p[1].QuadPart  = UInt32x32To64(ua.HighPart, ub.HighPart) + x.HighPart;

+

+    if (d != 0) {

+        ULARGE_INTEGER ud[2];

+        if (bSign) {

+            ud[0].QuadPart = (DWORDLONG)(-d);

+            if (d > 0) {

+                /*  -d < 0 */

+                ud[1].QuadPart = (DWORDLONG)(LONGLONG)-1;

+            } else {

+                ud[1].QuadPart = (DWORDLONG)0;

+            }

+        } else {

+            ud[0].QuadPart = (DWORDLONG)d;

+            if (d < 0) {

+                ud[1].QuadPart = (DWORDLONG)(LONGLONG)-1;

+            } else {

+                ud[1].QuadPart = (DWORDLONG)0;

+            }

+        }

+        /*  Now do extended addition */

+        ULARGE_INTEGER uliTotal;

+

+        /*  Add ls DWORDs */

+        uliTotal.QuadPart  = (DWORDLONG)ud[0].LowPart + p[0].LowPart;

+        p[0].LowPart       = uliTotal.LowPart;

+

+        /*  Propagate carry */

+        uliTotal.LowPart   = uliTotal.HighPart;

+        uliTotal.HighPart  = 0;

+

+        /*  Add 2nd most ls DWORDs */

+        uliTotal.QuadPart += (DWORDLONG)ud[0].HighPart + p[0].HighPart;

+        p[0].HighPart      = uliTotal.LowPart;

+

+        /*  Propagate carry */

+        uliTotal.LowPart   = uliTotal.HighPart;

+        uliTotal.HighPart  = 0;

+

+        /*  Add MS DWORDLONGs - no carry expected */

+        p[1].QuadPart     += ud[1].QuadPart + uliTotal.QuadPart;

+

+        /*  Now see if we got a sign change from the addition */

+        if ((LONG)p[1].HighPart < 0) {

+            bSign = !bSign;

+

+            /*  Negate the current value (ugh!) */

+            p[0].QuadPart  = ~p[0].QuadPart;

+            p[1].QuadPart  = ~p[1].QuadPart;

+            p[0].QuadPart += 1;

+            p[1].QuadPart += (p[0].QuadPart == 0);

+        }

+    }

+

+    /*  Now for the division */

+    if (c < 0) {

+        bSign = !bSign;

+    }

+

+

+    /*  This will catch c == 0 and overflow */

+    if (uc <= p[1].QuadPart) {

+        return bSign ? (LONGLONG)0x8000000000000000 :

+                       (LONGLONG)0x7FFFFFFFFFFFFFFF;

+    }

+

+    DWORDLONG ullResult;

+

+    /*  Do the division */

+    /*  If the dividend is a DWORD_LONG use the compiler */

+    if (p[1].QuadPart == 0) {

+        ullResult = p[0].QuadPart / uc;

+        return bSign ? -(LONGLONG)ullResult : (LONGLONG)ullResult;

+    }

+

+    /*  If the divisor is a DWORD then its simpler */

+    ULARGE_INTEGER ulic;

+    ulic.QuadPart = uc;

+    if (ulic.HighPart == 0) {

+        ULARGE_INTEGER uliDividend;

+        ULARGE_INTEGER uliResult;

+        DWORD dwDivisor = (DWORD)uc;

+        // ASSERT(p[1].HighPart == 0 && p[1].LowPart < dwDivisor);

+        uliDividend.HighPart = p[1].LowPart;

+        uliDividend.LowPart = p[0].HighPart;

+#ifndef USE_LARGEINT

+        uliResult.HighPart = (DWORD)(uliDividend.QuadPart / dwDivisor);

+        p[0].HighPart = (DWORD)(uliDividend.QuadPart % dwDivisor);

+        uliResult.LowPart = 0;

+        uliResult.QuadPart = p[0].QuadPart / dwDivisor + uliResult.QuadPart;

+#else

+        /*  NOTE - this routine will take exceptions if

+            the result does not fit in a DWORD

+        */

+        if (uliDividend.QuadPart >= (DWORDLONG)dwDivisor) {

+            uliResult.HighPart = EnlargedUnsignedDivide(

+                                     uliDividend,

+                                     dwDivisor,

+                                     &p[0].HighPart);

+        } else {

+            uliResult.HighPart = 0;

+        }

+        uliResult.LowPart = EnlargedUnsignedDivide(

+                                 p[0],

+                                 dwDivisor,

+                                 NULL);

+#endif

+        return bSign ? -(LONGLONG)uliResult.QuadPart :

+                        (LONGLONG)uliResult.QuadPart;

+    }

+

+

+    ullResult = 0;

+

+    /*  OK - do long division */

+    for (int i = 0; i < 64; i++) {

+        ullResult <<= 1;

+

+        /*  Shift 128 bit p left 1 */

+        p[1].QuadPart <<= 1;

+        if ((p[0].HighPart & 0x80000000) != 0) {

+            p[1].LowPart++;

+        }

+        p[0].QuadPart <<= 1;

+

+        /*  Compare */

+        if (uc <= p[1].QuadPart) {

+            p[1].QuadPart -= uc;

+            ullResult += 1;

+        }

+    }

+

+    return bSign ? - (LONGLONG)ullResult : (LONGLONG)ullResult;

+}

+

+LONGLONG WINAPI Int64x32Div32(LONGLONG a, LONG b, LONG c, LONG d)

+{

+    ULARGE_INTEGER ua;

+    DWORD ub;

+    DWORD uc;

+

+    /*  Compute the absolute values to avoid signed arithmetic problems */

+    ua.QuadPart = (DWORDLONG)(a >= 0 ? a : -a);

+    ub = (DWORD)(b >= 0 ? b : -b);

+    uc = (DWORD)(c >= 0 ? c : -c);

+    BOOL bSign = (a < 0) ^ (b < 0);

+

+    /*  Do long multiplication */

+    ULARGE_INTEGER p0;

+    DWORD p1;

+    p0.QuadPart  = UInt32x32To64(ua.LowPart, ub);

+

+    if (ua.HighPart != 0) {

+        ULARGE_INTEGER x;

+        x.QuadPart     = UInt32x32To64(ua.HighPart, ub) + p0.HighPart;

+        p0.HighPart  = x.LowPart;

+        p1   = x.HighPart;

+    } else {

+        p1 = 0;

+    }

+

+    if (d != 0) {

+        ULARGE_INTEGER ud0;

+        DWORD ud1;

+

+        if (bSign) {

+            //

+            //  Cast d to LONGLONG first otherwise -0x80000000 sign extends

+            //  incorrectly

+            //

+            ud0.QuadPart = (DWORDLONG)(-(LONGLONG)d);

+            if (d > 0) {

+                /*  -d < 0 */

+                ud1 = (DWORD)-1;

+            } else {

+                ud1 = (DWORD)0;

+            }

+        } else {

+            ud0.QuadPart = (DWORDLONG)d;

+            if (d < 0) {

+                ud1 = (DWORD)-1;

+            } else {

+                ud1 = (DWORD)0;

+            }

+        }

+        /*  Now do extended addition */

+        ULARGE_INTEGER uliTotal;

+

+        /*  Add ls DWORDs */

+        uliTotal.QuadPart  = (DWORDLONG)ud0.LowPart + p0.LowPart;

+        p0.LowPart       = uliTotal.LowPart;

+

+        /*  Propagate carry */

+        uliTotal.LowPart   = uliTotal.HighPart;

+        uliTotal.HighPart  = 0;

+

+        /*  Add 2nd most ls DWORDs */

+        uliTotal.QuadPart += (DWORDLONG)ud0.HighPart + p0.HighPart;

+        p0.HighPart      = uliTotal.LowPart;

+

+        /*  Add MS DWORDLONGs - no carry expected */

+        p1 += ud1 + uliTotal.HighPart;

+

+        /*  Now see if we got a sign change from the addition */

+        if ((LONG)p1 < 0) {

+            bSign = !bSign;

+

+            /*  Negate the current value (ugh!) */

+            p0.QuadPart  = ~p0.QuadPart;

+            p1 = ~p1;

+            p0.QuadPart += 1;

+            p1 += (p0.QuadPart == 0);

+        }

+    }

+

+    /*  Now for the division */

+    if (c < 0) {

+        bSign = !bSign;

+    }

+

+

+    /*  This will catch c == 0 and overflow */

+    if (uc <= p1) {

+        return bSign ? (LONGLONG)0x8000000000000000 :

+                       (LONGLONG)0x7FFFFFFFFFFFFFFF;

+    }

+

+    /*  Do the division */

+

+    /*  If the divisor is a DWORD then its simpler */

+    ULARGE_INTEGER uliDividend;

+    ULARGE_INTEGER uliResult;

+    DWORD dwDivisor = uc;

+    uliDividend.HighPart = p1;

+    uliDividend.LowPart = p0.HighPart;

+    /*  NOTE - this routine will take exceptions if

+        the result does not fit in a DWORD

+    */

+    if (uliDividend.QuadPart >= (DWORDLONG)dwDivisor) {

+        uliResult.HighPart = EnlargedUnsignedDivide(

+                                 uliDividend,

+                                 dwDivisor,

+                                 &p0.HighPart);

+    } else {

+        uliResult.HighPart = 0;

+    }

+    uliResult.LowPart = EnlargedUnsignedDivide(

+                             p0,

+                             dwDivisor,

+                             NULL);

+    return bSign ? -(LONGLONG)uliResult.QuadPart :

+                    (LONGLONG)uliResult.QuadPart;

+}

diff --git a/Samples/multimedia/directshow/baseclasses/baseclasses.sln b/Samples/multimedia/directshow/baseclasses/baseclasses.sln
new file mode 100644
index 0000000..a93b581
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/baseclasses.sln
@@ -0,0 +1,38 @@
+

+Microsoft Visual Studio Solution File, Format Version 9.00

+# Visual Studio 2005

+Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "BaseClasses", "BaseClasses.vcproj", "{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}"

+EndProject

+Global

+	GlobalSection(SolutionConfigurationPlatforms) = preSolution

+		Debug_MBCS|Win32 = Debug_MBCS|Win32

+		Debug_MBCS|x64 = Debug_MBCS|x64

+		Debug|Win32 = Debug|Win32

+		Debug|x64 = Debug|x64

+		Release_MBCS|Win32 = Release_MBCS|Win32

+		Release_MBCS|x64 = Release_MBCS|x64

+		Release|Win32 = Release|Win32

+		Release|x64 = Release|x64

+	EndGlobalSection

+	GlobalSection(ProjectConfigurationPlatforms) = postSolution

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug_MBCS|Win32.ActiveCfg = Debug_MBCS|Win32

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug_MBCS|Win32.Build.0 = Debug_MBCS|Win32

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug_MBCS|x64.ActiveCfg = Debug_MBCS|x64

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug_MBCS|x64.Build.0 = Debug_MBCS|x64

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug|Win32.ActiveCfg = Debug|Win32

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug|Win32.Build.0 = Debug|Win32

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug|x64.ActiveCfg = Debug|x64

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug|x64.Build.0 = Debug|x64

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release_MBCS|Win32.ActiveCfg = Release_MBCS|Win32

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release_MBCS|Win32.Build.0 = Release_MBCS|Win32

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release_MBCS|x64.ActiveCfg = Release_MBCS|x64

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release_MBCS|x64.Build.0 = Release_MBCS|x64

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release|Win32.ActiveCfg = Release|Win32

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release|Win32.Build.0 = Release|Win32

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release|x64.ActiveCfg = Release|x64

+		{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release|x64.Build.0 = Release|x64

+	EndGlobalSection

+	GlobalSection(SolutionProperties) = preSolution

+		HideSolutionNode = FALSE

+	EndGlobalSection

+EndGlobal

diff --git a/Samples/multimedia/directshow/baseclasses/baseclasses.vcproj b/Samples/multimedia/directshow/baseclasses/baseclasses.vcproj
new file mode 100644
index 0000000..22c63b1
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/baseclasses.vcproj
@@ -0,0 +1,826 @@
+<?xml version="1.0" encoding="Windows-1252"?>

+<VisualStudioProject

+	ProjectType="Visual C++"

+	Version="8.00"

+	Name="BaseClasses"

+	ProjectGUID="{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}"

+	RootNamespace="BaseClasses"

+	Keyword="Win32Proj"

+	>

+	<Platforms>

+		<Platform

+			Name="Win32"

+		/>

+		<Platform

+			Name="x64"

+		/>

+	</Platforms>

+	<ToolFiles>

+	</ToolFiles>

+	<Configurations>

+		<Configuration

+			Name="Debug|Win32"

+			OutputDirectory="Debug"

+			IntermediateDirectory="Debug"

+			ConfigurationType="4"

+			CharacterSet="1"

+			>

+			<Tool

+				Name="VCPreBuildEventTool"

+			/>

+			<Tool

+				Name="VCCustomBuildTool"

+			/>

+			<Tool

+				Name="VCXMLDataGeneratorTool"

+			/>

+			<Tool

+				Name="VCWebServiceProxyGeneratorTool"

+			/>

+			<Tool

+				Name="VCMIDLTool"

+			/>

+			<Tool

+				Name="VCCLCompilerTool"

+				Optimization="0"

+				AdditionalIncludeDirectories="."

+				PreprocessorDefinitions="WIN32;_DEBUG;_LIB"

+				MinimalRebuild="true"

+				BasicRuntimeChecks="3"

+				RuntimeLibrary="3"

+				UsePrecompiledHeader="0"

+				WarningLevel="3"

+				DebugInformationFormat="4"

+			/>

+			<Tool

+				Name="VCManagedResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCPreLinkEventTool"

+			/>

+			<Tool

+				Name="VCLibrarianTool"

+				AdditionalDependencies="strmiids.lib"

+				OutputFile="$(OutDir)\strmbasd.lib"

+				AdditionalLibraryDirectories=""

+			/>

+			<Tool

+				Name="VCALinkTool"

+			/>

+			<Tool

+				Name="VCXDCMakeTool"

+			/>

+			<Tool

+				Name="VCBscMakeTool"

+			/>

+			<Tool

+				Name="VCFxCopTool"

+			/>

+			<Tool

+				Name="VCPostBuildEventTool"

+			/>

+		</Configuration>

+		<Configuration

+			Name="Release|Win32"

+			OutputDirectory="Release"

+			IntermediateDirectory="Release"

+			ConfigurationType="4"

+			CharacterSet="1"

+			>

+			<Tool

+				Name="VCPreBuildEventTool"

+			/>

+			<Tool

+				Name="VCCustomBuildTool"

+			/>

+			<Tool

+				Name="VCXMLDataGeneratorTool"

+			/>

+			<Tool

+				Name="VCWebServiceProxyGeneratorTool"

+			/>

+			<Tool

+				Name="VCMIDLTool"

+			/>

+			<Tool

+				Name="VCCLCompilerTool"

+				Optimization="2"

+				AdditionalIncludeDirectories="."

+				PreprocessorDefinitions="WIN32;NDEBUG;_LIB;"

+				RuntimeLibrary="2"

+				UsePrecompiledHeader="0"

+				WarningLevel="3"

+				DebugInformationFormat="3"

+			/>

+			<Tool

+				Name="VCManagedResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCPreLinkEventTool"

+			/>

+			<Tool

+				Name="VCLibrarianTool"

+				AdditionalDependencies="strmiids.lib"

+				OutputFile="$(OutDir)\strmbase.lib"

+			/>

+			<Tool

+				Name="VCALinkTool"

+			/>

+			<Tool

+				Name="VCXDCMakeTool"

+			/>

+			<Tool

+				Name="VCBscMakeTool"

+			/>

+			<Tool

+				Name="VCFxCopTool"

+			/>

+			<Tool

+				Name="VCPostBuildEventTool"

+			/>

+		</Configuration>

+		<Configuration

+			Name="Debug_MBCS|Win32"

+			OutputDirectory="$(ConfigurationName)"

+			IntermediateDirectory="$(ConfigurationName)"

+			ConfigurationType="4"

+			CharacterSet="2"

+			>

+			<Tool

+				Name="VCPreBuildEventTool"

+			/>

+			<Tool

+				Name="VCCustomBuildTool"

+			/>

+			<Tool

+				Name="VCXMLDataGeneratorTool"

+			/>

+			<Tool

+				Name="VCWebServiceProxyGeneratorTool"

+			/>

+			<Tool

+				Name="VCMIDLTool"

+			/>

+			<Tool

+				Name="VCCLCompilerTool"

+				Optimization="0"

+				AdditionalIncludeDirectories="."

+				PreprocessorDefinitions="WIN32;_DEBUG;_LIB"

+				MinimalRebuild="true"

+				BasicRuntimeChecks="3"

+				RuntimeLibrary="3"

+				UsePrecompiledHeader="0"

+				WarningLevel="3"

+				DebugInformationFormat="4"

+			/>

+			<Tool

+				Name="VCManagedResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCPreLinkEventTool"

+			/>

+			<Tool

+				Name="VCLibrarianTool"

+				AdditionalDependencies="strmiids.lib"

+				OutputFile="$(OutDir)\strmbasd.lib"

+				AdditionalLibraryDirectories=""

+			/>

+			<Tool

+				Name="VCALinkTool"

+			/>

+			<Tool

+				Name="VCXDCMakeTool"

+			/>

+			<Tool

+				Name="VCBscMakeTool"

+			/>

+			<Tool

+				Name="VCFxCopTool"

+			/>

+			<Tool

+				Name="VCPostBuildEventTool"

+			/>

+		</Configuration>

+		<Configuration

+			Name="Release_MBCS|Win32"

+			OutputDirectory="$(ConfigurationName)"

+			IntermediateDirectory="$(ConfigurationName)"

+			ConfigurationType="4"

+			CharacterSet="2"

+			>

+			<Tool

+				Name="VCPreBuildEventTool"

+			/>

+			<Tool

+				Name="VCCustomBuildTool"

+			/>

+			<Tool

+				Name="VCXMLDataGeneratorTool"

+			/>

+			<Tool

+				Name="VCWebServiceProxyGeneratorTool"

+			/>

+			<Tool

+				Name="VCMIDLTool"

+			/>

+			<Tool

+				Name="VCCLCompilerTool"

+				Optimization="2"

+				AdditionalIncludeDirectories="."

+				PreprocessorDefinitions="WIN32;NDEBUG;_LIB;"

+				RuntimeLibrary="2"

+				UsePrecompiledHeader="0"

+				WarningLevel="3"

+				DebugInformationFormat="3"

+			/>

+			<Tool

+				Name="VCManagedResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCPreLinkEventTool"

+			/>

+			<Tool

+				Name="VCLibrarianTool"

+				AdditionalDependencies="strmiids.lib"

+				OutputFile="$(OutDir)\strmbase.lib"

+			/>

+			<Tool

+				Name="VCALinkTool"

+			/>

+			<Tool

+				Name="VCXDCMakeTool"

+			/>

+			<Tool

+				Name="VCBscMakeTool"

+			/>

+			<Tool

+				Name="VCFxCopTool"

+			/>

+			<Tool

+				Name="VCPostBuildEventTool"

+			/>

+		</Configuration>

+		<Configuration

+			Name="Debug|x64"

+			OutputDirectory="$(PlatformName)\$(ConfigurationName)"

+			IntermediateDirectory="$(PlatformName)\$(ConfigurationName)"

+			ConfigurationType="4"

+			CharacterSet="1"

+			>

+			<Tool

+				Name="VCPreBuildEventTool"

+			/>

+			<Tool

+				Name="VCCustomBuildTool"

+			/>

+			<Tool

+				Name="VCXMLDataGeneratorTool"

+			/>

+			<Tool

+				Name="VCWebServiceProxyGeneratorTool"

+			/>

+			<Tool

+				Name="VCMIDLTool"

+				TargetEnvironment="3"

+			/>

+			<Tool

+				Name="VCCLCompilerTool"

+				Optimization="0"

+				AdditionalIncludeDirectories="."

+				PreprocessorDefinitions="WIN32;_DEBUG;_LIB"

+				MinimalRebuild="true"

+				BasicRuntimeChecks="3"

+				RuntimeLibrary="3"

+				UsePrecompiledHeader="0"

+				WarningLevel="3"

+				DebugInformationFormat="3"

+			/>

+			<Tool

+				Name="VCManagedResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCPreLinkEventTool"

+			/>

+			<Tool

+				Name="VCLibrarianTool"

+				AdditionalDependencies="strmiids.lib"

+				OutputFile="$(OutDir)\strmbasd.lib"

+				AdditionalLibraryDirectories=""

+			/>

+			<Tool

+				Name="VCALinkTool"

+			/>

+			<Tool

+				Name="VCXDCMakeTool"

+			/>

+			<Tool

+				Name="VCBscMakeTool"

+			/>

+			<Tool

+				Name="VCFxCopTool"

+			/>

+			<Tool

+				Name="VCPostBuildEventTool"

+			/>

+		</Configuration>

+		<Configuration

+			Name="Release|x64"

+			OutputDirectory="$(PlatformName)\$(ConfigurationName)"

+			IntermediateDirectory="$(PlatformName)\$(ConfigurationName)"

+			ConfigurationType="4"

+			CharacterSet="1"

+			>

+			<Tool

+				Name="VCPreBuildEventTool"

+			/>

+			<Tool

+				Name="VCCustomBuildTool"

+			/>

+			<Tool

+				Name="VCXMLDataGeneratorTool"

+			/>

+			<Tool

+				Name="VCWebServiceProxyGeneratorTool"

+			/>

+			<Tool

+				Name="VCMIDLTool"

+				TargetEnvironment="3"

+			/>

+			<Tool

+				Name="VCCLCompilerTool"

+				Optimization="2"

+				AdditionalIncludeDirectories="."

+				PreprocessorDefinitions="WIN32;NDEBUG;_LIB;"

+				RuntimeLibrary="2"

+				UsePrecompiledHeader="0"

+				WarningLevel="3"

+				DebugInformationFormat="3"

+			/>

+			<Tool

+				Name="VCManagedResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCPreLinkEventTool"

+			/>

+			<Tool

+				Name="VCLibrarianTool"

+				AdditionalDependencies="strmiids.lib"

+				OutputFile="$(OutDir)\strmbase.lib"

+			/>

+			<Tool

+				Name="VCALinkTool"

+			/>

+			<Tool

+				Name="VCXDCMakeTool"

+			/>

+			<Tool

+				Name="VCBscMakeTool"

+			/>

+			<Tool

+				Name="VCFxCopTool"

+			/>

+			<Tool

+				Name="VCPostBuildEventTool"

+			/>

+		</Configuration>

+		<Configuration

+			Name="Debug_MBCS|x64"

+			OutputDirectory="$(PlatformName)\$(ConfigurationName)"

+			IntermediateDirectory="$(PlatformName)\$(ConfigurationName)"

+			ConfigurationType="4"

+			CharacterSet="2"

+			>

+			<Tool

+				Name="VCPreBuildEventTool"

+			/>

+			<Tool

+				Name="VCCustomBuildTool"

+			/>

+			<Tool

+				Name="VCXMLDataGeneratorTool"

+			/>

+			<Tool

+				Name="VCWebServiceProxyGeneratorTool"

+			/>

+			<Tool

+				Name="VCMIDLTool"

+				TargetEnvironment="3"

+			/>

+			<Tool

+				Name="VCCLCompilerTool"

+				Optimization="0"

+				AdditionalIncludeDirectories="."

+				PreprocessorDefinitions="WIN32;_DEBUG;_LIB"

+				MinimalRebuild="true"

+				BasicRuntimeChecks="3"

+				RuntimeLibrary="3"

+				UsePrecompiledHeader="0"

+				WarningLevel="3"

+				DebugInformationFormat="3"

+			/>

+			<Tool

+				Name="VCManagedResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCPreLinkEventTool"

+			/>

+			<Tool

+				Name="VCLibrarianTool"

+				AdditionalDependencies="strmiids.lib"

+				OutputFile="$(OutDir)\strmbasd.lib"

+				AdditionalLibraryDirectories=""

+			/>

+			<Tool

+				Name="VCALinkTool"

+			/>

+			<Tool

+				Name="VCXDCMakeTool"

+			/>

+			<Tool

+				Name="VCBscMakeTool"

+			/>

+			<Tool

+				Name="VCFxCopTool"

+			/>

+			<Tool

+				Name="VCPostBuildEventTool"

+			/>

+		</Configuration>

+		<Configuration

+			Name="Release_MBCS|x64"

+			OutputDirectory="$(PlatformName)\$(ConfigurationName)"

+			IntermediateDirectory="$(PlatformName)\$(ConfigurationName)"

+			ConfigurationType="4"

+			CharacterSet="2"

+			>

+			<Tool

+				Name="VCPreBuildEventTool"

+			/>

+			<Tool

+				Name="VCCustomBuildTool"

+			/>

+			<Tool

+				Name="VCXMLDataGeneratorTool"

+			/>

+			<Tool

+				Name="VCWebServiceProxyGeneratorTool"

+			/>

+			<Tool

+				Name="VCMIDLTool"

+				TargetEnvironment="3"

+			/>

+			<Tool

+				Name="VCCLCompilerTool"

+				Optimization="2"

+				AdditionalIncludeDirectories="."

+				PreprocessorDefinitions="WIN32;NDEBUG;_LIB;"

+				RuntimeLibrary="2"

+				UsePrecompiledHeader="0"

+				WarningLevel="3"

+				DebugInformationFormat="3"

+			/>

+			<Tool

+				Name="VCManagedResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCResourceCompilerTool"

+			/>

+			<Tool

+				Name="VCPreLinkEventTool"

+			/>

+			<Tool

+				Name="VCLibrarianTool"

+				AdditionalDependencies="strmiids.lib"

+				OutputFile="$(OutDir)\strmbase.lib"

+			/>

+			<Tool

+				Name="VCALinkTool"

+			/>

+			<Tool

+				Name="VCXDCMakeTool"

+			/>

+			<Tool

+				Name="VCBscMakeTool"

+			/>

+			<Tool

+				Name="VCFxCopTool"

+			/>

+			<Tool

+				Name="VCPostBuildEventTool"

+			/>

+		</Configuration>

+	</Configurations>

+	<References>

+	</References>

+	<Files>

+		<Filter

+			Name="Source Files"

+			Filter="cpp;c;cc;cxx;def;odl;idl;hpj;bat;asm;asmx"

+			UniqueIdentifier="{4FC737F1-C7A5-4376-A066-2A32D752A2FF}"

+			>

+			<File

+				RelativePath=".\amextra.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\amfilter.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\amvideo.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\arithutil.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\combase.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\cprop.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\ctlutil.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\ddmm.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\dllentry.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\dllsetup.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\mtype.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\outputq.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\perflog.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\pstream.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\pullpin.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\refclock.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\renbase.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\schedule.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\seekpt.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\source.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\strmctl.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\sysclock.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\transfrm.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\transip.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\videoctl.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\vtrans.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\winctrl.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\winutil.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\wxdebug.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\wxlist.cpp"

+				>

+			</File>

+			<File

+				RelativePath=".\wxutil.cpp"

+				>

+			</File>

+		</Filter>

+		<Filter

+			Name="Header Files"

+			Filter="h;hpp;hxx;hm;inl;inc;xsd"

+			UniqueIdentifier="{93995380-89BD-4b04-88EB-625FBE52EBFB}"

+			>

+			<File

+				RelativePath=".\amextra.h"

+				>

+			</File>

+			<File

+				RelativePath=".\amfilter.h"

+				>

+			</File>

+			<File

+				RelativePath=".\cache.h"

+				>

+			</File>

+			<File

+				RelativePath=".\combase.h"

+				>

+			</File>

+			<File

+				RelativePath=".\cprop.h"

+				>

+			</File>

+			<File

+				RelativePath=".\ctlutil.h"

+				>

+			</File>

+			<File

+				RelativePath=".\ddmm.h"

+				>

+			</File>

+			<File

+				RelativePath=".\dllsetup.h"

+				>

+			</File>

+			<File

+				RelativePath=".\dxmperf.h"

+				>

+			</File>

+			<File

+				RelativePath=".\fourcc.h"

+				>

+			</File>

+			<File

+				RelativePath=".\measure.h"

+				>

+			</File>

+			<File

+				RelativePath=".\msgthrd.h"

+				>

+			</File>

+			<File

+				RelativePath=".\mtype.h"

+				>

+			</File>

+			<File

+				RelativePath=".\outputq.h"

+				>

+			</File>

+			<File

+				RelativePath=".\perflog.h"

+				>

+			</File>

+			<File

+				RelativePath=".\perfstruct.h"

+				>

+			</File>

+			<File

+				RelativePath=".\pstream.h"

+				>

+			</File>

+			<File

+				RelativePath=".\pullpin.h"

+				>

+			</File>

+			<File

+				RelativePath=".\refclock.h"

+				>

+			</File>

+			<File

+				RelativePath=".\reftime.h"

+				>

+			</File>

+			<File

+				RelativePath=".\renbase.h"

+				>

+			</File>

+			<File

+				RelativePath=".\schedule.h"

+				>

+			</File>

+			<File

+				RelativePath=".\seekpt.h"

+				>

+			</File>

+			<File

+				RelativePath=".\source.h"

+				>

+			</File>

+			<File

+				RelativePath=".\streams.h"

+				>

+			</File>

+			<File

+				RelativePath=".\strmctl.h"

+				>

+			</File>

+			<File

+				RelativePath=".\sysclock.h"

+				>

+			</File>

+			<File

+				RelativePath=".\transfrm.h"

+				>

+			</File>

+			<File

+				RelativePath=".\transip.h"

+				>

+			</File>

+			<File

+				RelativePath=".\videoctl.h"

+				>

+			</File>

+			<File

+				RelativePath=".\vtrans.h"

+				>

+			</File>

+			<File

+				RelativePath=".\winctrl.h"

+				>

+			</File>

+			<File

+				RelativePath=".\winutil.h"

+				>

+			</File>

+			<File

+				RelativePath=".\wxdebug.h"

+				>

+			</File>

+			<File

+				RelativePath=".\wxlist.h"

+				>

+			</File>

+			<File

+				RelativePath=".\wxutil.h"

+				>

+			</File>

+		</Filter>

+		<Filter

+			Name="Resource Files"

+			Filter="rc;ico;cur;bmp;dlg;rc2;rct;bin;rgs;gif;jpg;jpeg;jpe;resx;tiff;tif;png;wav"

+			UniqueIdentifier="{67DA6AB6-F800-4c08-8B7A-83BB121AAD01}"

+			>

+		</Filter>

+	</Files>

+	<Globals>

+	</Globals>

+</VisualStudioProject>

diff --git a/Samples/multimedia/directshow/baseclasses/cache.h b/Samples/multimedia/directshow/baseclasses/cache.h
new file mode 100644
index 0000000..0a807c2
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/cache.h
@@ -0,0 +1,74 @@
+//------------------------------------------------------------------------------

+// File: Cache.h

+//

+// Desc: DirectShow base classes - efines a non-MFC generic cache class.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+/* This class implements a simple cache. A cache object is instantiated

+   with the number of items it is to hold. An item is a pointer to an

+   object derived from CBaseObject (helps reduce memory leaks). The cache

+   can then have objects added to it and removed from it. The cache size

+   is fixed at construction time and may therefore run out or be flooded.

+   If it runs out it returns a NULL pointer, if it fills up it also returns

+   a NULL pointer instead of a pointer to the object just inserted */

+

+/* Making these classes inherit from CBaseObject does nothing for their

+   functionality but it allows us to check there are no memory leaks */

+

+/* WARNING Be very careful when using this class, what it lets you do is

+   store and retrieve objects so that you can minimise object creation

+   which in turns improves efficiency. However the object you store is

+   exactly the same as the object you get back which means that it short

+   circuits the constructor initialisation phase. This means any class

+   variables the object has (eg pointers) are highly likely to be invalid.

+   Therefore ensure you reinitialise the object before using it again */

+

+

+#ifndef __CACHE__

+#define __CACHE__

+

+

+class CCache : CBaseObject {

+

+    /* Make copy constructor and assignment operator inaccessible */

+

+    CCache(const CCache &refCache);

+    CCache &operator=(const CCache &refCache);

+

+private:

+

+    /* These are initialised in the constructor. The first variable points to

+       an array of pointers, each of which points to a CBaseObject derived

+       object. The m_iCacheSize is the static fixed size for the cache and the

+       m_iUsed defines the number of places filled with objects at any time.

+       We fill the array of pointers from the start (ie m_ppObjects[0] first)

+       and then only add and remove objects from the end position, so in this

+       respect the array of object pointers should be treated as a stack */

+

+    CBaseObject **m_ppObjects;

+    const INT m_iCacheSize;

+    INT m_iUsed;

+

+public:

+

+    CCache(__in_opt LPCTSTR pName,INT iItems);

+    virtual ~CCache();

+

+    /* Add an item to the cache */

+    CBaseObject *AddToCache(__in CBaseObject *pObject);

+

+    /* Remove an item from the cache */

+    CBaseObject *RemoveFromCache();

+

+    /* Delete all the objects held in the cache */

+    void RemoveAll(void);

+

+    /* Return the cache size which is set during construction */

+    INT GetCacheSize(void) const {return m_iCacheSize;};

+};

+

+#endif /* __CACHE__ */

+

diff --git a/Samples/multimedia/directshow/baseclasses/checkbmi.h b/Samples/multimedia/directshow/baseclasses/checkbmi.h
new file mode 100644
index 0000000..7287967
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/checkbmi.h
@@ -0,0 +1,120 @@
+//  Copyright (c) 1992 - 1997  Microsoft Corporation.  All Rights Reserved.

+

+#ifndef _CHECKBMI_H_

+#define _CHECKBMI_H_

+

+#ifdef __cplusplus

+extern "C" {

+#endif

+

+//  Helper

+__inline BOOL MultiplyCheckOverflow(DWORD a, DWORD b, __deref_out_range(==, a * b) DWORD *pab) {

+    *pab = a * b;

+    if ((a == 0) || (((*pab) / a) == b)) {

+        return TRUE;

+    }

+    return FALSE;

+}

+

+

+//  Checks if the fields in a BITMAPINFOHEADER won't generate

+//  overlows and buffer overruns

+//  This is not a complete check and does not guarantee code using this structure will be secure

+//  from attack

+//  Bugs this is guarding against:

+//        1.  Total structure size calculation overflowing

+//        2.  biClrUsed > 256 for 8-bit palettized content

+//        3.  Total bitmap size in bytes overflowing

+//        4.  biSize < size of the base structure leading to accessessing random memory

+//        5.  Total structure size exceeding know size of data

+//

+

+__success(return != 0) __inline BOOL ValidateBitmapInfoHeader(

+    const BITMAPINFOHEADER *pbmi,   // pointer to structure to check

+    __out_range(>=, sizeof(BITMAPINFOHEADER)) DWORD cbSize     // size of memory block containing structure

+)

+{

+    DWORD dwWidthInBytes;

+    DWORD dwBpp;

+    DWORD dwWidthInBits;

+    DWORD dwHeight;

+    DWORD dwSizeImage;

+    DWORD dwClrUsed;

+

+    // Reject bad parameters - do the size check first to avoid reading bad memory

+    if (cbSize < sizeof(BITMAPINFOHEADER) ||

+        pbmi->biSize < sizeof(BITMAPINFOHEADER) ||

+        pbmi->biSize > 4096) {

+        return FALSE;

+    }

+

+    //  Reject 0 size

+    if (pbmi->biWidth == 0 || pbmi->biHeight == 0) {

+        return FALSE;

+    }

+

+    // Use bpp of 200 for validating against further overflows if not set for compressed format

+    dwBpp = 200;

+

+    if (pbmi->biBitCount > dwBpp) {

+        return FALSE;

+    }

+

+    // Strictly speaking abs can overflow so cast explicitly to DWORD

+    dwHeight = (DWORD)abs(pbmi->biHeight);

+

+    if (!MultiplyCheckOverflow(dwBpp, (DWORD)pbmi->biWidth, &dwWidthInBits)) {

+        return FALSE;

+    }

+

+    //  Compute correct width in bytes - rounding up to 4 bytes

+    dwWidthInBytes = (dwWidthInBits / 8 + 3) & ~3;

+

+    if (!MultiplyCheckOverflow(dwWidthInBytes, dwHeight, &dwSizeImage)) {

+        return FALSE;

+    }

+

+    // Fail if total size is 0 - this catches indivual quantities being 0

+    // Also don't allow huge values > 1GB which might cause arithmetic

+    // errors for users

+    if (dwSizeImage > 0x40000000 ||

+        pbmi->biSizeImage > 0x40000000) {

+        return FALSE;

+    }

+

+    //  Fail if biClrUsed looks bad

+    if (pbmi->biClrUsed > 256) {

+        return FALSE;

+    }

+

+    if (pbmi->biClrUsed == 0 && pbmi->biBitCount <= 8 && pbmi->biBitCount > 0) {

+        dwClrUsed = (1 << pbmi->biBitCount);

+    } else {

+        dwClrUsed = pbmi->biClrUsed;

+    }

+

+    //  Check total size

+    if (cbSize < pbmi->biSize + dwClrUsed * sizeof(RGBQUAD) +

+                 (pbmi->biCompression == BI_BITFIELDS ? 3 * sizeof(DWORD) : 0)) {

+        return FALSE;

+    }

+

+    //  If it is RGB validate biSizeImage - lots of code assumes the size is correct

+    if (pbmi->biCompression == BI_RGB || pbmi->biCompression == BI_BITFIELDS) {

+        if (pbmi->biSizeImage != 0) {

+            DWORD dwBits = (DWORD)pbmi->biWidth * (DWORD)pbmi->biBitCount;

+            DWORD dwWidthInBytes = ((DWORD)((dwBits+31) & (~31)) / 8);

+            DWORD dwTotalSize = (DWORD)abs(pbmi->biHeight) * dwWidthInBytes;

+            if (dwTotalSize > pbmi->biSizeImage) {

+                return FALSE;

+            }

+        }

+    }

+    return TRUE;

+}

+

+#ifdef __cplusplus

+}

+#endif

+

+#endif // _CHECKBMI_H_

diff --git a/Samples/multimedia/directshow/baseclasses/combase.cpp b/Samples/multimedia/directshow/baseclasses/combase.cpp
new file mode 100644
index 0000000..ec62a88
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/combase.cpp
@@ -0,0 +1,265 @@
+//------------------------------------------------------------------------------

+// File: ComBase.cpp

+//

+// Desc: DirectShow base classes - implements class hierarchy for creating

+//       COM objects.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+#include <streams.h>

+#pragma warning( disable : 4514 )   // Disable warnings re unused inline functions

+

+

+/* Define the static member variable */

+

+LONG CBaseObject::m_cObjects = 0;

+

+

+/* Constructor */

+

+CBaseObject::CBaseObject(__in_opt LPCTSTR pName)

+{

+    /* Increment the number of active objects */

+    InterlockedIncrement(&m_cObjects);

+

+#ifdef DEBUG

+

+#ifdef UNICODE

+    m_dwCookie = DbgRegisterObjectCreation(0, pName);

+#else

+    m_dwCookie = DbgRegisterObjectCreation(pName, 0);

+#endif

+

+#endif

+}

+

+#ifdef UNICODE

+CBaseObject::CBaseObject(const char *pName)

+{

+    /* Increment the number of active objects */

+    InterlockedIncrement(&m_cObjects);

+

+#ifdef DEBUG

+    m_dwCookie = DbgRegisterObjectCreation(pName, 0);

+#endif

+}

+#endif

+

+HINSTANCE	hlibOLEAut32;

+

+/* Destructor */

+

+CBaseObject::~CBaseObject()

+{

+    /* Decrement the number of objects active */

+    if (InterlockedDecrement(&m_cObjects) == 0) {

+	if (hlibOLEAut32) {

+	    FreeLibrary(hlibOLEAut32);

+

+	    hlibOLEAut32 = 0;

+	}

+    };

+

+

+#ifdef DEBUG

+    DbgRegisterObjectDestruction(m_dwCookie);

+#endif

+}

+

+static const TCHAR szOle32Aut[]   = TEXT("OleAut32.dll");

+

+HINSTANCE LoadOLEAut32()

+{

+    if (hlibOLEAut32 == 0) {

+

+	hlibOLEAut32 = LoadLibrary(szOle32Aut);

+    }

+

+    return hlibOLEAut32;

+}

+

+

+/* Constructor */

+

+// We know we use "this" in the initialization list, we also know we don't modify *phr.

+#pragma warning( disable : 4355 4100 )

+CUnknown::CUnknown(__in_opt LPCTSTR pName, __in_opt LPUNKNOWN pUnk)

+: CBaseObject(pName)

+/* Start the object with a reference count of zero - when the      */

+/* object is queried for it's first interface this may be          */

+/* incremented depending on whether or not this object is          */

+/* currently being aggregated upon                                 */

+, m_cRef(0)

+/* Set our pointer to our IUnknown interface.                      */

+/* If we have an outer, use its, otherwise use ours.               */

+/* This pointer effectivly points to the owner of                  */

+/* this object and can be accessed by the GetOwner() method.       */

+, m_pUnknown( pUnk != 0 ? pUnk : reinterpret_cast<LPUNKNOWN>( static_cast<PNDUNKNOWN>(this) ) )

+ /* Why the double cast?  Well, the inner cast is a type-safe cast */

+ /* to pointer to a type from which we inherit.  The second is     */

+ /* type-unsafe but works because INonDelegatingUnknown "behaves   */

+ /* like" IUnknown. (Only the names on the methods change.)        */

+{

+    // Everything we need to do has been done in the initializer list

+}

+

+// This does the same as above except it has a useless HRESULT argument

+// use the previous constructor, this is just left for compatibility...

+CUnknown::CUnknown(__in_opt LPCTSTR pName, __in_opt LPUNKNOWN pUnk, __inout_opt HRESULT *phr) :

+    CBaseObject(pName),

+    m_cRef(0),

+    m_pUnknown( pUnk != 0 ? pUnk : reinterpret_cast<LPUNKNOWN>( static_cast<PNDUNKNOWN>(this) ) )

+{

+}

+

+#ifdef UNICODE

+CUnknown::CUnknown(__in_opt LPCSTR pName, __in_opt LPUNKNOWN pUnk)

+: CBaseObject(pName), m_cRef(0),

+    m_pUnknown( pUnk != 0 ? pUnk : reinterpret_cast<LPUNKNOWN>( static_cast<PNDUNKNOWN>(this) ) )

+{ }

+

+CUnknown::CUnknown(__in_opt LPCSTR pName, __in_opt LPUNKNOWN pUnk, __inout_opt HRESULT *phr) :

+    CBaseObject(pName), m_cRef(0),

+    m_pUnknown( pUnk != 0 ? pUnk : reinterpret_cast<LPUNKNOWN>( static_cast<PNDUNKNOWN>(this) ) )

+{ }

+

+#endif

+

+#pragma warning( default : 4355 4100 )

+

+

+/* QueryInterface */

+

+STDMETHODIMP CUnknown::NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv)

+{

+    CheckPointer(ppv,E_POINTER);

+    ValidateReadWritePtr(ppv,sizeof(PVOID));

+

+    /* We know only about IUnknown */

+

+    if (riid == IID_IUnknown) {

+        GetInterface((LPUNKNOWN) (PNDUNKNOWN) this, ppv);

+        return NOERROR;

+    } else {

+        *ppv = NULL;

+        return E_NOINTERFACE;

+    }

+}

+

+/* We have to ensure that we DON'T use a max macro, since these will typically   */

+/* lead to one of the parameters being evaluated twice.  Since we are worried    */

+/* about concurrency, we can't afford to access the m_cRef twice since we can't  */

+/* afford to run the risk that its value having changed between accesses.        */

+

+template<class T> inline static T ourmax( const T & a, const T & b )

+{

+    return a > b ? a : b;

+}

+

+/* AddRef */

+

+STDMETHODIMP_(ULONG) CUnknown::NonDelegatingAddRef()

+{

+    LONG lRef = InterlockedIncrement( &m_cRef );

+    ASSERT(lRef > 0);

+    DbgLog((LOG_MEMORY,3,TEXT("    Obj %d ref++ = %d"),

+           m_dwCookie, m_cRef));

+    return ourmax(ULONG(m_cRef), 1ul);

+}

+

+

+/* Release */

+

+STDMETHODIMP_(ULONG) CUnknown::NonDelegatingRelease()

+{

+    /* If the reference count drops to zero delete ourselves */

+

+    LONG lRef = InterlockedDecrement( &m_cRef );

+    ASSERT(lRef >= 0);

+

+    DbgLog((LOG_MEMORY,3,TEXT("    Object %d ref-- = %d"),

+	    m_dwCookie, m_cRef));

+    if (lRef == 0) {

+

+        // COM rules say we must protect against re-entrancy.

+        // If we are an aggregator and we hold our own interfaces

+        // on the aggregatee, the QI for these interfaces will

+        // addref ourselves. So after doing the QI we must release

+        // a ref count on ourselves. Then, before releasing the

+        // private interface, we must addref ourselves. When we do

+        // this from the destructor here it will result in the ref

+        // count going to 1 and then back to 0 causing us to

+        // re-enter the destructor. Hence we add an extra refcount here

+        // once we know we will delete the object.

+        // for an example aggregator see filgraph\distrib.cpp.

+

+        m_cRef++;

+

+        delete this;

+        return ULONG(0);

+    } else {

+        //  Don't touch m_cRef again even in this leg as the object

+        //  may have just been released on another thread too

+        return ourmax(ULONG(lRef), 1ul);

+    }

+}

+

+

+/* Return an interface pointer to a requesting client

+   performing a thread safe AddRef as necessary */

+

+STDAPI GetInterface(LPUNKNOWN pUnk, __out void **ppv)

+{

+    CheckPointer(ppv, E_POINTER);

+    *ppv = pUnk;

+    pUnk->AddRef();

+    return NOERROR;

+}

+

+

+/* Compares two interfaces and returns TRUE if they are on the same object */

+

+BOOL WINAPI IsEqualObject(IUnknown *pFirst, IUnknown *pSecond)

+{

+    /*  Different objects can't have the same interface pointer for

+        any interface

+    */

+    if (pFirst == pSecond) {

+        return TRUE;

+    }

+    /*  OK - do it the hard way - check if they have the same

+        IUnknown pointers - a single object can only have one of these

+    */

+    LPUNKNOWN pUnknown1;     // Retrieve the IUnknown interface

+    LPUNKNOWN pUnknown2;     // Retrieve the other IUnknown interface

+    HRESULT hr;              // General OLE return code

+

+    ASSERT(pFirst);

+    ASSERT(pSecond);

+

+    /* See if the IUnknown pointers match */

+

+    hr = pFirst->QueryInterface(IID_IUnknown,(void **) &pUnknown1);

+    if (FAILED(hr)) {

+        return FALSE;

+    }

+    ASSERT(pUnknown1);

+

+    /* Release the extra interface we hold */

+

+    pUnknown1->Release();

+

+    hr = pSecond->QueryInterface(IID_IUnknown,(void **) &pUnknown2);

+    if (FAILED(hr)) {

+        return FALSE;

+    }

+    ASSERT(pUnknown2);

+

+    /* Release the extra interface we hold */

+

+    pUnknown2->Release();

+    return (pUnknown1 == pUnknown2);

+}

+

diff --git a/Samples/multimedia/directshow/baseclasses/combase.h b/Samples/multimedia/directshow/baseclasses/combase.h
new file mode 100644
index 0000000..f735ba9
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/combase.h
@@ -0,0 +1,305 @@
+//------------------------------------------------------------------------------

+// File: ComBase.h

+//

+// Desc: DirectShow base classes - defines a class hierarchy for creating

+//       COM objects.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+/*

+

+a. Derive your COM object from CUnknown

+

+b. Make a static CreateInstance function that takes an LPUNKNOWN, an HRESULT *

+   and a TCHAR *. The LPUNKNOWN defines the object to delegate IUnknown calls

+   to. The HRESULT * allows error codes to be passed around constructors and

+   the TCHAR * is a descriptive name that can be printed on the debugger.

+

+   It is important that constructors only change the HRESULT * if they have

+   to set an ERROR code, if it was successful then leave it alone or you may

+   overwrite an error code from an object previously created.

+

+   When you call a constructor the descriptive name should be in static store

+   as we do not copy the string. To stop large amounts of memory being used

+   in retail builds by all these static strings use the NAME macro,

+

+   CMyFilter = new CImplFilter(NAME("My filter"),pUnknown,phr);

+   if (FAILED(hr)) {

+       return hr;

+   }

+

+   In retail builds NAME(_x_) compiles to NULL, the base CBaseObject class

+   knows not to do anything with objects that don't have a name.

+

+c. Have a constructor for your object that passes the LPUNKNOWN, HRESULT * and

+   TCHAR * to the CUnknown constructor. You can set the HRESULT if you have an

+   error, or just simply pass it through to the constructor.

+

+   The object creation will fail in the class factory if the HRESULT indicates

+   an error (ie FAILED(HRESULT) == TRUE)

+

+d. Create a FactoryTemplate with your object's class id and CreateInstance

+   function.

+

+Then (for each interface) either

+

+Multiple inheritance

+

+1. Also derive it from ISomeInterface

+2. Include DECLARE_IUNKNOWN in your class definition to declare

+   implementations of QueryInterface, AddRef and Release that

+   call the outer unknown

+3. Override NonDelegatingQueryInterface to expose ISomeInterface by

+   code something like

+

+     if (riid == IID_ISomeInterface) {

+         return GetInterface((ISomeInterface *) this, ppv);

+     } else {

+         return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+     }

+

+4. Declare and implement the member functions of ISomeInterface.

+

+or: Nested interfaces

+

+1. Declare a class derived from CUnknown

+2. Include DECLARE_IUNKNOWN in your class definition

+3. Override NonDelegatingQueryInterface to expose ISomeInterface by

+   code something like

+

+     if (riid == IID_ISomeInterface) {

+         return GetInterface((ISomeInterface *) this, ppv);

+     } else {

+         return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+     }

+

+4. Implement the member functions of ISomeInterface. Use GetOwner() to

+   access the COM object class.

+

+And in your COM object class:

+

+5. Make the nested class a friend of the COM object class, and declare

+   an instance of the nested class as a member of the COM object class.

+

+   NOTE that because you must always pass the outer unknown and an hResult

+   to the CUnknown constructor you cannot use a default constructor, in

+   other words you will have to make the member variable a pointer to the

+   class and make a NEW call in your constructor to actually create it.

+

+6. override the NonDelegatingQueryInterface with code like this:

+

+     if (riid == IID_ISomeInterface) {

+         return m_pImplFilter->

+            NonDelegatingQueryInterface(IID_ISomeInterface, ppv);

+     } else {

+         return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+     }

+

+You can have mixed classes which support some interfaces via multiple

+inheritance and some via nested classes

+

+*/

+

+#ifndef __COMBASE__

+#define __COMBASE__

+

+// Filter Setup data structures no defined in axextend.idl

+

+typedef REGPINTYPES

+AMOVIESETUP_MEDIATYPE, * PAMOVIESETUP_MEDIATYPE, * FAR LPAMOVIESETUP_MEDIATYPE;

+

+typedef REGFILTERPINS

+AMOVIESETUP_PIN, * PAMOVIESETUP_PIN, * FAR LPAMOVIESETUP_PIN;

+

+typedef struct _AMOVIESETUP_FILTER

+{

+  const CLSID * clsID;

+  const WCHAR * strName;

+  DWORD      dwMerit;

+  UINT       nPins;

+  const AMOVIESETUP_PIN * lpPin;

+}

+AMOVIESETUP_FILTER, * PAMOVIESETUP_FILTER, * FAR LPAMOVIESETUP_FILTER;

+

+/* The DLLENTRY module initialises the module handle on loading */

+

+extern HINSTANCE g_hInst;

+

+/* On DLL load remember which platform we are running on */

+

+extern DWORD g_amPlatform;

+extern OSVERSIONINFO g_osInfo;     // Filled in by GetVersionEx

+

+/* Version of IUnknown that is renamed to allow a class to support both

+   non delegating and delegating IUnknowns in the same COM object */

+

+#ifndef INONDELEGATINGUNKNOWN_DEFINED

+DECLARE_INTERFACE(INonDelegatingUnknown)

+{

+    STDMETHOD(NonDelegatingQueryInterface) (THIS_ REFIID, LPVOID *) PURE;

+    STDMETHOD_(ULONG, NonDelegatingAddRef)(THIS) PURE;

+    STDMETHOD_(ULONG, NonDelegatingRelease)(THIS) PURE;

+};

+#define INONDELEGATINGUNKNOWN_DEFINED

+#endif

+

+typedef INonDelegatingUnknown *PNDUNKNOWN;

+

+

+/* This is the base object class that supports active object counting. As

+   part of the debug facilities we trace every time a C++ object is created

+   or destroyed. The name of the object has to be passed up through the class

+   derivation list during construction as you cannot call virtual functions

+   in the constructor. The downside of all this is that every single object

+   constructor has to take an object name parameter that describes it */

+

+class CBaseObject

+{

+

+private:

+

+    // Disable the copy constructor and assignment by default so you will get

+    //   compiler errors instead of unexpected behaviour if you pass objects

+    //   by value or assign objects.

+    CBaseObject(const CBaseObject& objectSrc);          // no implementation

+    void operator=(const CBaseObject& objectSrc);       // no implementation

+

+private:

+    static LONG m_cObjects;     /* Total number of objects active */

+

+protected:

+#ifdef DEBUG

+    DWORD m_dwCookie;           /* Cookie identifying this object */

+#endif

+

+

+public:

+

+    /* These increment and decrement the number of active objects */

+

+    CBaseObject(__in_opt LPCTSTR pName);

+#ifdef UNICODE

+    CBaseObject(__in_opt LPCSTR pName);

+#endif

+    ~CBaseObject();

+

+    /* Call this to find if there are any CUnknown derived objects active */

+

+    static LONG ObjectsActive() {

+        return m_cObjects;

+    };

+};

+

+

+/* An object that supports one or more COM interfaces will be based on

+   this class. It supports counting of total objects for DLLCanUnloadNow

+   support, and an implementation of the core non delegating IUnknown */

+

+class AM_NOVTABLE CUnknown : public INonDelegatingUnknown,

+                 public CBaseObject

+{

+private:

+    const LPUNKNOWN m_pUnknown; /* Owner of this object */

+

+protected:                      /* So we can override NonDelegatingRelease() */

+    volatile LONG m_cRef;       /* Number of reference counts */

+

+public:

+

+    CUnknown(__in_opt LPCTSTR pName, __in_opt LPUNKNOWN pUnk);

+    virtual ~CUnknown() {};

+

+    // This is redundant, just use the other constructor

+    //   as we never touch the HRESULT in this anyway

+    CUnknown(__in_opt LPCTSTR Name, __in_opt LPUNKNOWN pUnk, __inout_opt HRESULT *phr);

+#ifdef UNICODE

+    CUnknown(__in_opt LPCSTR pName, __in_opt LPUNKNOWN pUnk);

+    CUnknown(__in_opt LPCSTR pName, __in_opt LPUNKNOWN pUnk,__inout_opt HRESULT *phr);

+#endif

+

+    /* Return the owner of this object */

+

+    LPUNKNOWN GetOwner() const {

+        return m_pUnknown;

+    };

+

+    /* Called from the class factory to create a new instance, it is

+       pure virtual so it must be overriden in your derived class */

+

+    /* static CUnknown *CreateInstance(LPUNKNOWN, HRESULT *) */

+

+    /* Non delegating unknown implementation */

+

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID, __deref_out void **);

+    STDMETHODIMP_(ULONG) NonDelegatingAddRef();

+    STDMETHODIMP_(ULONG) NonDelegatingRelease();

+};

+

+/* Return an interface pointer to a requesting client

+   performing a thread safe AddRef as necessary */

+

+STDAPI GetInterface(LPUNKNOWN pUnk, __out void **ppv);

+

+/* A function that can create a new COM object */

+

+typedef CUnknown *(CALLBACK *LPFNNewCOMObject)(__in_opt LPUNKNOWN pUnkOuter, __inout_opt HRESULT *phr);

+

+/*  A function (can be NULL) which is called from the DLL entrypoint

+    routine for each factory template:

+

+    bLoading - TRUE on DLL load, FALSE on DLL unload

+    rclsid   - the m_ClsID of the entry

+*/

+typedef void (CALLBACK *LPFNInitRoutine)(BOOL bLoading, const CLSID *rclsid);

+

+/* Create one of these per object class in an array so that

+   the default class factory code can create new instances */

+

+class CFactoryTemplate {

+

+public:

+

+    const WCHAR *              m_Name;

+    const CLSID *              m_ClsID;

+    LPFNNewCOMObject           m_lpfnNew;

+    LPFNInitRoutine            m_lpfnInit;

+    const AMOVIESETUP_FILTER * m_pAMovieSetup_Filter;

+

+    BOOL IsClassID(REFCLSID rclsid) const {

+        return (IsEqualCLSID(*m_ClsID,rclsid));

+    };

+

+    CUnknown *CreateInstance(__inout_opt LPUNKNOWN pUnk, __inout_opt HRESULT *phr) const {

+        CheckPointer(phr,NULL);

+        return m_lpfnNew(pUnk, phr);

+    };

+};

+

+

+/* You must override the (pure virtual) NonDelegatingQueryInterface to return

+   interface pointers (using GetInterface) to the interfaces your derived

+   class supports (the default implementation only supports IUnknown) */

+

+#define DECLARE_IUNKNOWN                                        \

+    STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv) {      \

+        return GetOwner()->QueryInterface(riid,ppv);            \

+    };                                                          \

+    STDMETHODIMP_(ULONG) AddRef() {                             \

+        return GetOwner()->AddRef();                            \

+    };                                                          \

+    STDMETHODIMP_(ULONG) Release() {                            \

+        return GetOwner()->Release();                           \

+    };

+

+

+

+HINSTANCE	LoadOLEAut32();

+

+

+#endif /* __COMBASE__ */

+

+

+

+

diff --git a/Samples/multimedia/directshow/baseclasses/cprop.cpp b/Samples/multimedia/directshow/baseclasses/cprop.cpp
new file mode 100644
index 0000000..7bd76b4
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/cprop.cpp
@@ -0,0 +1,383 @@
+//------------------------------------------------------------------------------

+// File: CProp.cpp

+//

+// Desc: DirectShow base classes - implements CBasePropertyPage class.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+#include <streams.h>

+

+// Constructor for the base property page class. As described in the header

+// file we must be initialised with dialog and title resource identifiers.

+// The class supports IPropertyPage and overrides AddRef and Release calls

+// to keep track of the reference counts. When the last count is released

+// we call SetPageSite(NULL) and SetObjects(0,NULL) to release interfaces

+// previously obtained by the property page when it had SetObjects called

+

+CBasePropertyPage::CBasePropertyPage(__in_opt LPCTSTR pName,   // Debug only name

+                                     __inout_opt LPUNKNOWN pUnk, // COM Delegator

+                                     int DialogId,      // Resource ID

+                                     int TitleId) :     // To get tital

+    CUnknown(pName,pUnk),

+    m_DialogId(DialogId),

+    m_TitleId(TitleId),

+    m_hwnd(NULL),

+    m_Dlg(NULL),

+    m_pPageSite(NULL),

+    m_bObjectSet(FALSE),

+    m_bDirty(FALSE)

+{

+}

+

+#ifdef UNICODE

+CBasePropertyPage::CBasePropertyPage(__in_opt LPCSTR pName,     // Debug only name

+                                     __inout_opt LPUNKNOWN pUnk,  // COM Delegator

+                                     int DialogId,      // Resource ID

+                                     int TitleId) :     // To get tital

+    CUnknown(pName,pUnk),

+    m_DialogId(DialogId),

+    m_TitleId(TitleId),

+    m_hwnd(NULL),

+    m_Dlg(NULL),

+    m_pPageSite(NULL),

+    m_bObjectSet(FALSE),

+    m_bDirty(FALSE)

+{

+}

+#endif

+

+// Increment our reference count

+

+STDMETHODIMP_(ULONG) CBasePropertyPage::NonDelegatingAddRef()

+{

+    LONG lRef = InterlockedIncrement(&m_cRef);

+    ASSERT(lRef > 0);

+    return max(ULONG(m_cRef),1ul);

+}

+

+

+// Release a reference count and protect against reentrancy

+

+STDMETHODIMP_(ULONG) CBasePropertyPage::NonDelegatingRelease()

+{

+    // If the reference count drops to zero delete ourselves

+

+    LONG lRef = InterlockedDecrement(&m_cRef);

+    if (lRef == 0) {

+        m_cRef++;

+        SetPageSite(NULL);

+        SetObjects(0,NULL);

+        delete this;

+        return ULONG(0);

+    } else {

+        //  Don't touch m_cRef again here!

+        return max(ULONG(lRef),1ul);

+    }

+}

+

+

+// Expose our IPropertyPage interface

+

+STDMETHODIMP

+CBasePropertyPage::NonDelegatingQueryInterface(REFIID riid,__deref_out void **ppv)

+{

+    if (riid == IID_IPropertyPage) {

+        return GetInterface((IPropertyPage *)this,ppv);

+    } else {

+        return CUnknown::NonDelegatingQueryInterface(riid,ppv);

+    }

+}

+

+

+// Get the page info so that the page site can size itself

+

+STDMETHODIMP CBasePropertyPage::GetPageInfo(__out LPPROPPAGEINFO pPageInfo)

+{

+    CheckPointer(pPageInfo,E_POINTER);

+    WCHAR wszTitle[STR_MAX_LENGTH];

+    WideStringFromResource(wszTitle,m_TitleId);

+

+    // Allocate dynamic memory for the property page title

+

+    LPOLESTR pszTitle;

+    HRESULT hr = AMGetWideString(wszTitle, &pszTitle);

+    if (FAILED(hr)) {

+        NOTE("No caption memory");

+        return hr;

+    }

+

+    pPageInfo->cb               = sizeof(PROPPAGEINFO);

+    pPageInfo->pszTitle         = pszTitle;

+    pPageInfo->pszDocString     = NULL;

+    pPageInfo->pszHelpFile      = NULL;

+    pPageInfo->dwHelpContext    = 0;

+

+    // Set defaults in case GetDialogSize fails

+    pPageInfo->size.cx          = 340;

+    pPageInfo->size.cy          = 150;

+

+    GetDialogSize(m_DialogId, DialogProc,0L,&pPageInfo->size);

+    return NOERROR;

+}

+

+

+// Handles the messages for our property window

+

+INT_PTR CALLBACK CBasePropertyPage::DialogProc(HWND hwnd,

+                                            UINT uMsg,

+                                            WPARAM wParam,

+                                            LPARAM lParam)

+{

+    CBasePropertyPage *pPropertyPage;

+

+    switch (uMsg) {

+

+        case WM_INITDIALOG:

+

+            _SetWindowLongPtr(hwnd, DWLP_USER, lParam);

+

+            // This pointer may be NULL when calculating size

+

+            pPropertyPage = (CBasePropertyPage *) lParam;

+            if (pPropertyPage == NULL) {

+                return (LRESULT) 1;

+            }

+            pPropertyPage->m_Dlg = hwnd;

+    }

+

+    // This pointer may be NULL when calculating size

+

+    pPropertyPage = _GetWindowLongPtr<CBasePropertyPage*>(hwnd, DWLP_USER);

+    if (pPropertyPage == NULL) {

+        return (LRESULT) 1;

+    }

+    return pPropertyPage->OnReceiveMessage(hwnd,uMsg,wParam,lParam);

+}

+

+

+// Tells us the object that should be informed of the property changes

+

+STDMETHODIMP CBasePropertyPage::SetObjects(ULONG cObjects,__in_ecount_opt(cObjects) LPUNKNOWN *ppUnk)

+{

+    if (cObjects == 1) {

+

+        if ((ppUnk == NULL) || (*ppUnk == NULL)) {

+            return E_POINTER;

+        }

+

+        // Set a flag to say that we have set the Object

+        m_bObjectSet = TRUE ;

+        return OnConnect(*ppUnk);

+

+    } else if (cObjects == 0) {

+

+        // Set a flag to say that we have not set the Object for the page

+        m_bObjectSet = FALSE ;

+        return OnDisconnect();

+    }

+

+    DbgBreak("No support for more than one object");

+    return E_UNEXPECTED;

+}

+

+

+// Create the window we will use to edit properties

+

+STDMETHODIMP CBasePropertyPage::Activate(HWND hwndParent,

+                                         LPCRECT pRect,

+                                         BOOL fModal)

+{

+    CheckPointer(pRect,E_POINTER);

+

+    // Return failure if SetObject has not been called.

+    if (m_bObjectSet == FALSE) {

+        return E_UNEXPECTED;

+    }

+

+    if (m_hwnd) {

+        return E_UNEXPECTED;

+    }

+

+    m_hwnd = CreateDialogParam(g_hInst,

+                               MAKEINTRESOURCE(m_DialogId),

+                               hwndParent,

+                               DialogProc,

+                               (LPARAM) this);

+    if (m_hwnd == NULL) {

+        return E_OUTOFMEMORY;

+    }

+

+    OnActivate();

+    Move(pRect);

+    return Show(SW_SHOWNORMAL);

+}

+

+

+// Set the position of the property page

+

+STDMETHODIMP CBasePropertyPage::Move(LPCRECT pRect)

+{

+    CheckPointer(pRect,E_POINTER);

+

+    if (m_hwnd == NULL) {

+        return E_UNEXPECTED;

+    }

+

+    MoveWindow(m_hwnd,              // Property page handle

+               pRect->left,         // x coordinate

+               pRect->top,          // y coordinate

+               WIDTH(pRect),        // Overall window width

+               HEIGHT(pRect),       // And likewise height

+               TRUE);               // Should we repaint it

+

+    return NOERROR;

+}

+

+

+// Display the property dialog

+

+STDMETHODIMP CBasePropertyPage::Show(UINT nCmdShow)

+{

+   // Have we been activated yet

+

+    if (m_hwnd == NULL) {

+        return E_UNEXPECTED;

+    }

+

+    // Ignore wrong show flags

+

+    if ((nCmdShow != SW_SHOW) && (nCmdShow != SW_SHOWNORMAL) && (nCmdShow != SW_HIDE)) {

+        return E_INVALIDARG;

+    }

+

+    ShowWindow(m_hwnd,nCmdShow);

+    InvalidateRect(m_hwnd,NULL,TRUE);

+    return NOERROR;

+}

+

+

+// Destroy the property page dialog

+

+STDMETHODIMP CBasePropertyPage::Deactivate(void)

+{

+    if (m_hwnd == NULL) {

+        return E_UNEXPECTED;

+    }

+

+    // Remove WS_EX_CONTROLPARENT before DestroyWindow call

+

+    DWORD dwStyle = GetWindowLong(m_hwnd, GWL_EXSTYLE);

+    dwStyle = dwStyle & (~WS_EX_CONTROLPARENT);

+

+    //  Set m_hwnd to be NULL temporarily so the message handler

+    //  for WM_STYLECHANGING doesn't add the WS_EX_CONTROLPARENT

+    //  style back in

+    HWND hwnd = m_hwnd;

+    m_hwnd = NULL;

+    SetWindowLong(hwnd, GWL_EXSTYLE, dwStyle);

+    m_hwnd = hwnd;

+

+    OnDeactivate();

+

+    // Destroy the dialog window

+

+    DestroyWindow(m_hwnd);

+    m_hwnd = NULL;

+    return NOERROR;

+}

+

+

+// Tells the application property page site

+

+STDMETHODIMP CBasePropertyPage::SetPageSite(__in_opt LPPROPERTYPAGESITE pPageSite)

+{

+    if (pPageSite) {

+

+        if (m_pPageSite) {

+            return E_UNEXPECTED;

+        }

+

+        m_pPageSite = pPageSite;

+        m_pPageSite->AddRef();

+

+    } else {

+

+        if (m_pPageSite == NULL) {

+            return E_UNEXPECTED;

+        }

+

+        m_pPageSite->Release();

+        m_pPageSite = NULL;

+    }

+    return NOERROR;

+}

+

+

+// Apply any changes so far made

+

+STDMETHODIMP CBasePropertyPage::Apply()

+{

+    // In ActiveMovie 1.0 we used to check whether we had been activated or

+    // not. This is too constrictive. Apply should be allowed as long as

+    // SetObject was called to set an object. So we will no longer check to

+    // see if we have been activated (ie., m_hWnd != NULL), but instead

+    // make sure that m_bObjectSet is TRUE (ie., SetObject has been called).

+

+    if (m_bObjectSet == FALSE) {

+        return E_UNEXPECTED;

+    }

+

+    // Must have had a site set

+

+    if (m_pPageSite == NULL) {

+        return E_UNEXPECTED;

+    }

+

+    // Has anything changed

+

+    if (m_bDirty == FALSE) {

+        return NOERROR;

+    }

+

+    // Commit derived class changes

+

+    HRESULT hr = OnApplyChanges();

+    if (SUCCEEDED(hr)) {

+        m_bDirty = FALSE;

+    }

+    return hr;

+}

+

+

+// Base class definition for message handling

+

+INT_PTR CBasePropertyPage::OnReceiveMessage(HWND hwnd,UINT uMsg,WPARAM wParam,LPARAM lParam)

+{

+    // we would like the TAB key to move around the tab stops in our property

+    // page, but for some reason OleCreatePropertyFrame clears the CONTROLPARENT

+    // style behind our back, so we need to switch it back on now behind its

+    // back.  Otherwise the tab key will be useless in every page.

+    //

+

+    CBasePropertyPage *pPropertyPage;

+    {

+        pPropertyPage = _GetWindowLongPtr<CBasePropertyPage*>(hwnd, DWLP_USER);

+

+        if (pPropertyPage->m_hwnd == NULL) {

+            return 0;

+        }

+        switch (uMsg) {

+          case WM_STYLECHANGING:

+              if (wParam == GWL_EXSTYLE) {

+                  LPSTYLESTRUCT lpss = (LPSTYLESTRUCT)lParam;

+                  lpss->styleNew |= WS_EX_CONTROLPARENT;

+                  return 0;

+              }

+        }

+    }

+		

+    return DefWindowProc(hwnd,uMsg,wParam,lParam);

+}

+

diff --git a/Samples/multimedia/directshow/baseclasses/cprop.h b/Samples/multimedia/directshow/baseclasses/cprop.h
new file mode 100644
index 0000000..db44940
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/cprop.h
@@ -0,0 +1,95 @@
+//------------------------------------------------------------------------------

+// File: CProp.h

+//

+// Desc: DirectShow base classes.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+#ifndef __CPROP__

+#define __CPROP__

+

+// Base property page class. Filters typically expose custom properties by

+// implementing special control interfaces, examples are IDirectDrawVideo

+// and IQualProp on renderers. This allows property pages to be built that

+// use the given interface. Applications such as the ActiveMovie OCX query

+// filters for the property pages they support and expose them to the user

+//

+// This class provides all the framework for a property page. A property

+// page is a COM object that supports IPropertyPage. We should be created

+// with a resource ID for the dialog which we will load when required. We

+// should also be given in the constructor a resource ID for a title string

+// we will load from the DLLs STRINGTABLE. The property page titles must be

+// stored in resource files so that they can be easily internationalised

+//

+// We have a number of virtual methods (not PURE) that may be overriden in

+// derived classes to query for interfaces and so on. These functions have

+// simple implementations here that just return NOERROR. Derived classes

+// will almost definately have to override the message handler method called

+// OnReceiveMessage. We have a static dialog procedure that calls the method

+// so that derived classes don't have to fiddle around with the this pointer

+

+class AM_NOVTABLE CBasePropertyPage : public IPropertyPage, public CUnknown

+{

+protected:

+

+    LPPROPERTYPAGESITE m_pPageSite;       // Details for our property site

+    HWND m_hwnd;                          // Window handle for the page

+    HWND m_Dlg;                           // Actual dialog window handle

+    BOOL m_bDirty;                        // Has anything been changed

+    int m_TitleId;                        // Resource identifier for title

+    int m_DialogId;                       // Dialog resource identifier

+

+    static INT_PTR CALLBACK DialogProc(HWND hwnd,

+                                       UINT uMsg,

+                                       WPARAM wParam,

+                                       LPARAM lParam);

+

+private:

+    BOOL m_bObjectSet ;                  // SetObject has been called or not.

+public:

+

+    CBasePropertyPage(__in_opt LPCTSTR pName,      // Debug only name

+                      __inout_opt LPUNKNOWN pUnk, // COM Delegator

+                      int DialogId,               // Resource ID

+                      int TitleId);               // To get tital

+

+#ifdef UNICODE

+    CBasePropertyPage(__in_opt LPCSTR pName,

+                      __inout_opt LPUNKNOWN pUnk,

+                      int DialogId,  

+                      int TitleId);

+#endif

+    virtual ~CBasePropertyPage() { };

+    DECLARE_IUNKNOWN

+

+    // Override these virtual methods

+

+    virtual HRESULT OnConnect(IUnknown *pUnknown) { return NOERROR; };

+    virtual HRESULT OnDisconnect() { return NOERROR; };

+    virtual HRESULT OnActivate() { return NOERROR; };

+    virtual HRESULT OnDeactivate() { return NOERROR; };

+    virtual HRESULT OnApplyChanges() { return NOERROR; };

+    virtual INT_PTR OnReceiveMessage(HWND hwnd,UINT uMsg,WPARAM wParam,LPARAM lParam);

+

+    // These implement an IPropertyPage interface

+

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+    STDMETHODIMP_(ULONG) NonDelegatingRelease();

+    STDMETHODIMP_(ULONG) NonDelegatingAddRef();

+    STDMETHODIMP SetPageSite(__in_opt LPPROPERTYPAGESITE pPageSite);

+    STDMETHODIMP Activate(HWND hwndParent, LPCRECT prect,BOOL fModal);

+    STDMETHODIMP Deactivate(void);

+    STDMETHODIMP GetPageInfo(__out LPPROPPAGEINFO pPageInfo);

+    STDMETHODIMP SetObjects(ULONG cObjects, __in_ecount_opt(cObjects) LPUNKNOWN *ppUnk);

+    STDMETHODIMP Show(UINT nCmdShow);

+    STDMETHODIMP Move(LPCRECT prect);

+    STDMETHODIMP IsPageDirty(void) { return m_bDirty ? S_OK : S_FALSE; }

+    STDMETHODIMP Apply(void);

+    STDMETHODIMP Help(LPCWSTR lpszHelpDir) { return E_NOTIMPL; }

+    STDMETHODIMP TranslateAccelerator(__inout LPMSG lpMsg) { return E_NOTIMPL; }

+};

+

+#endif // __CPROP__

+

diff --git a/Samples/multimedia/directshow/baseclasses/ctlutil.cpp b/Samples/multimedia/directshow/baseclasses/ctlutil.cpp
new file mode 100644
index 0000000..8ccb9dc
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/ctlutil.cpp
@@ -0,0 +1,2541 @@
+//------------------------------------------------------------------------------

+// File: CtlUtil.cpp

+//

+// Desc: DirectShow base classes.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+// Base classes implementing IDispatch parsing for the basic control dual

+// interfaces. Derive from these and implement just the custom method and

+// property methods. We also implement CPosPassThru that can be used by

+// renderers and transforms to pass by IMediaPosition and IMediaSeeking

+

+

+#include <streams.h>

+#include <limits.h>

+#include "seekpt.h"

+

+// 'bool' non standard reserved word

+#pragma warning(disable:4237)

+

+

+// --- CBaseDispatch implementation ----------

+CBaseDispatch::~CBaseDispatch()

+{

+    if (m_pti) {

+	m_pti->Release();

+    }

+}

+

+

+// return 1 if we support GetTypeInfo

+

+STDMETHODIMP

+CBaseDispatch::GetTypeInfoCount(__out UINT * pctinfo)

+{

+    CheckPointer(pctinfo,E_POINTER);

+    ValidateReadWritePtr(pctinfo,sizeof(UINT *));

+    *pctinfo = 1;

+    return S_OK;

+}

+

+

+typedef HRESULT (STDAPICALLTYPE *LPLOADTYPELIB)(

+			    const OLECHAR FAR *szFile,

+			    __deref_out ITypeLib FAR* FAR* pptlib);

+

+typedef HRESULT (STDAPICALLTYPE *LPLOADREGTYPELIB)(REFGUID rguid,

+			    WORD wVerMajor,

+			    WORD wVerMinor,

+			    LCID lcid,

+			    __deref_out ITypeLib FAR* FAR* pptlib);

+

+// attempt to find our type library

+

+STDMETHODIMP

+CBaseDispatch::GetTypeInfo(

+  REFIID riid,

+  UINT itinfo,

+  LCID lcid,

+  __deref_out ITypeInfo ** pptinfo)

+{

+    CheckPointer(pptinfo,E_POINTER);

+    ValidateReadWritePtr(pptinfo,sizeof(ITypeInfo *));

+    HRESULT hr;

+

+    *pptinfo = NULL;

+

+    // we only support one type element

+    if (0 != itinfo) {

+	return TYPE_E_ELEMENTNOTFOUND;

+    }

+

+    if (NULL == pptinfo) {

+	return E_POINTER;

+    }

+

+    // always look for neutral

+    if (NULL == m_pti) {

+

+	LPLOADTYPELIB	    lpfnLoadTypeLib;

+	LPLOADREGTYPELIB    lpfnLoadRegTypeLib;

+	ITypeLib	    *ptlib;

+	HINSTANCE	    hInst;

+

+	static const char  szTypeLib[]	  = "LoadTypeLib";

+	static const char  szRegTypeLib[] = "LoadRegTypeLib";

+	static const WCHAR szControl[]	  = L"control.tlb";

+

+	//

+	// Try to get the Ole32Aut.dll module handle.

+	//

+

+	hInst = LoadOLEAut32();

+	if (hInst == NULL) {

+	    DWORD dwError = GetLastError();

+	    return AmHresultFromWin32(dwError);

+	}

+	lpfnLoadRegTypeLib = (LPLOADREGTYPELIB)GetProcAddress(hInst,

+							      szRegTypeLib);

+	if (lpfnLoadRegTypeLib == NULL) {

+	    DWORD dwError = GetLastError();

+	    return AmHresultFromWin32(dwError);

+	}

+

+	hr = (*lpfnLoadRegTypeLib)(LIBID_QuartzTypeLib, 1, 0, // version 1.0

+				   lcid, &ptlib);

+

+	if (FAILED(hr)) {

+

+	    // attempt to load directly - this will fill the

+	    // registry in if it finds it

+

+	    lpfnLoadTypeLib = (LPLOADTYPELIB)GetProcAddress(hInst, szTypeLib);

+	    if (lpfnLoadTypeLib == NULL) {

+		DWORD dwError = GetLastError();

+		return AmHresultFromWin32(dwError);

+	    }

+

+	    hr = (*lpfnLoadTypeLib)(szControl, &ptlib);

+	    if (FAILED(hr)) {

+		return hr;

+	    }

+	}

+

+	hr = ptlib->GetTypeInfoOfGuid(

+		    riid,

+		    &m_pti);

+

+	ptlib->Release();

+

+	if (FAILED(hr)) {

+	    return hr;

+	}

+    }

+

+    *pptinfo = m_pti;

+    m_pti->AddRef();

+    return S_OK;

+}

+

+

+STDMETHODIMP

+CBaseDispatch::GetIDsOfNames(

+  REFIID riid,

+  __in_ecount(cNames) LPOLESTR * rgszNames,

+  UINT cNames,

+  LCID lcid,

+  __out_ecount(cNames) DISPID * rgdispid)

+{

+    // although the IDispatch riid is dead, we use this to pass from

+    // the interface implementation class to us the iid we are talking about.

+

+    ITypeInfo * pti;

+    HRESULT hr = GetTypeInfo(riid, 0, lcid, &pti);

+

+    if (SUCCEEDED(hr)) {

+	hr = pti->GetIDsOfNames(rgszNames, cNames, rgdispid);

+

+	pti->Release();

+    }

+    return hr;

+}

+

+

+// --- CMediaControl implementation ---------

+

+CMediaControl::CMediaControl(const TCHAR * name,LPUNKNOWN pUnk) :

+    CUnknown(name, pUnk)

+{

+}

+

+// expose our interfaces IMediaControl and IUnknown

+

+STDMETHODIMP

+CMediaControl::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    ValidateReadWritePtr(ppv,sizeof(PVOID));

+    if (riid == IID_IMediaControl) {

+	return GetInterface( (IMediaControl *) this, ppv);

+    } else {

+	return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+// return 1 if we support GetTypeInfo

+

+STDMETHODIMP

+CMediaControl::GetTypeInfoCount(__out UINT * pctinfo)

+{

+    return m_basedisp.GetTypeInfoCount(pctinfo);

+}

+

+

+// attempt to find our type library

+

+STDMETHODIMP

+CMediaControl::GetTypeInfo(

+  UINT itinfo,

+  LCID lcid,

+  __deref_out ITypeInfo ** pptinfo)

+{

+    return m_basedisp.GetTypeInfo(

+		IID_IMediaControl,

+		itinfo,

+		lcid,

+		pptinfo);

+}

+

+

+STDMETHODIMP

+CMediaControl::GetIDsOfNames(

+  REFIID riid,

+  __in_ecount(cNames) LPOLESTR * rgszNames,

+  UINT cNames,

+  LCID lcid,

+  __out_ecount(cNames) DISPID * rgdispid)

+{

+    return m_basedisp.GetIDsOfNames(

+			IID_IMediaControl,

+			rgszNames,

+			cNames,

+			lcid,

+			rgdispid);

+}

+

+

+STDMETHODIMP

+CMediaControl::Invoke(

+  DISPID dispidMember,

+  REFIID riid,

+  LCID lcid,

+  WORD wFlags,

+  __in DISPPARAMS * pdispparams,

+  __out_opt VARIANT * pvarResult,

+  __out_opt EXCEPINFO * pexcepinfo,

+  __out_opt UINT * puArgErr)

+{

+    // this parameter is a dead leftover from an earlier interface

+    if (IID_NULL != riid) {

+	return DISP_E_UNKNOWNINTERFACE;

+    }

+

+    ITypeInfo * pti;

+    HRESULT hr = GetTypeInfo(0, lcid, &pti);

+

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pti->Invoke(

+	    (IMediaControl *)this,

+	    dispidMember,

+	    wFlags,

+	    pdispparams,

+	    pvarResult,

+	    pexcepinfo,

+	    puArgErr);

+

+    pti->Release();

+    return hr;

+}

+

+

+// --- CMediaEvent implementation ----------

+

+

+CMediaEvent::CMediaEvent(__in_opt LPCTSTR name,__in_opt LPUNKNOWN pUnk) :

+    CUnknown(name, pUnk)

+{

+}

+

+

+// expose our interfaces IMediaEvent and IUnknown

+

+STDMETHODIMP

+CMediaEvent::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    ValidateReadWritePtr(ppv,sizeof(PVOID));

+    if (riid == IID_IMediaEvent || riid == IID_IMediaEventEx) {

+	return GetInterface( (IMediaEventEx *) this, ppv);

+    } else {

+	return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+// return 1 if we support GetTypeInfo

+

+STDMETHODIMP

+CMediaEvent::GetTypeInfoCount(__out UINT * pctinfo)

+{

+    return m_basedisp.GetTypeInfoCount(pctinfo);

+}

+

+

+// attempt to find our type library

+

+STDMETHODIMP

+CMediaEvent::GetTypeInfo(

+  UINT itinfo,

+  LCID lcid,

+  __deref_out ITypeInfo ** pptinfo)

+{

+    return m_basedisp.GetTypeInfo(

+		IID_IMediaEvent,

+		itinfo,

+		lcid,

+		pptinfo);

+}

+

+

+STDMETHODIMP

+CMediaEvent::GetIDsOfNames(

+  REFIID riid,

+  __in_ecount(cNames) LPOLESTR * rgszNames,

+  UINT cNames,

+  LCID lcid,

+  __out_ecount(cNames) DISPID * rgdispid)

+{

+    return m_basedisp.GetIDsOfNames(

+			IID_IMediaEvent,

+			rgszNames,

+			cNames,

+			lcid,

+			rgdispid);

+}

+

+

+STDMETHODIMP

+CMediaEvent::Invoke(

+  DISPID dispidMember,

+  REFIID riid,

+  LCID lcid,

+  WORD wFlags,

+  __in DISPPARAMS * pdispparams,

+  __out_opt VARIANT * pvarResult,

+  __out_opt EXCEPINFO * pexcepinfo,

+  __out_opt UINT * puArgErr)

+{

+    // this parameter is a dead leftover from an earlier interface

+    if (IID_NULL != riid) {

+	return DISP_E_UNKNOWNINTERFACE;

+    }

+

+    ITypeInfo * pti;

+    HRESULT hr = GetTypeInfo(0, lcid, &pti);

+

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pti->Invoke(

+	    (IMediaEvent *)this,

+	    dispidMember,

+	    wFlags,

+	    pdispparams,

+	    pvarResult,

+	    pexcepinfo,

+	    puArgErr);

+

+    pti->Release();

+    return hr;

+}

+

+

+// --- CMediaPosition implementation ----------

+

+

+CMediaPosition::CMediaPosition(__in_opt LPCTSTR name,__in_opt LPUNKNOWN pUnk) :

+    CUnknown(name, pUnk)

+{

+}

+

+CMediaPosition::CMediaPosition(__in_opt LPCTSTR name,

+                               __in_opt LPUNKNOWN pUnk,

+                               __inout HRESULT * phr) :

+    CUnknown(name, pUnk)

+{

+    UNREFERENCED_PARAMETER(phr);

+}

+

+

+// expose our interfaces IMediaPosition and IUnknown

+

+STDMETHODIMP

+CMediaPosition::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    ValidateReadWritePtr(ppv,sizeof(PVOID));

+    if (riid == IID_IMediaPosition) {

+	return GetInterface( (IMediaPosition *) this, ppv);

+    } else {

+	return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+// return 1 if we support GetTypeInfo

+

+STDMETHODIMP

+CMediaPosition::GetTypeInfoCount(__out UINT * pctinfo)

+{

+    return m_basedisp.GetTypeInfoCount(pctinfo);

+}

+

+

+// attempt to find our type library

+

+STDMETHODIMP

+CMediaPosition::GetTypeInfo(

+  UINT itinfo,

+  LCID lcid,

+  __deref_out ITypeInfo ** pptinfo)

+{

+    return m_basedisp.GetTypeInfo(

+		IID_IMediaPosition,

+		itinfo,

+		lcid,

+		pptinfo);

+}

+

+

+STDMETHODIMP

+CMediaPosition::GetIDsOfNames(

+  REFIID riid,

+  __in_ecount(cNames) LPOLESTR * rgszNames,

+  UINT cNames,

+  LCID lcid,

+  __out_ecount(cNames) DISPID * rgdispid)

+{

+    return m_basedisp.GetIDsOfNames(

+			IID_IMediaPosition,

+			rgszNames,

+			cNames,

+			lcid,

+			rgdispid);

+}

+

+

+STDMETHODIMP

+CMediaPosition::Invoke(

+  DISPID dispidMember,

+  REFIID riid,

+  LCID lcid,

+  WORD wFlags,

+  __in DISPPARAMS * pdispparams,

+  __out_opt VARIANT * pvarResult,

+  __out_opt EXCEPINFO * pexcepinfo,

+  __out_opt UINT * puArgErr)

+{

+    // this parameter is a dead leftover from an earlier interface

+    if (IID_NULL != riid) {

+	return DISP_E_UNKNOWNINTERFACE;

+    }

+

+    ITypeInfo * pti;

+    HRESULT hr = GetTypeInfo(0, lcid, &pti);

+

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pti->Invoke(

+	    (IMediaPosition *)this,

+	    dispidMember,

+	    wFlags,

+	    pdispparams,

+	    pvarResult,

+	    pexcepinfo,

+	    puArgErr);

+

+    pti->Release();

+    return hr;

+}

+

+

+// --- IMediaPosition and IMediaSeeking pass through class ----------

+

+

+CPosPassThru::CPosPassThru(__in_opt LPCTSTR pName,

+			   __in_opt LPUNKNOWN pUnk,

+			   __inout HRESULT *phr,

+			   IPin *pPin) :

+    CMediaPosition(pName,pUnk),

+    m_pPin(pPin)

+{

+    if (pPin == NULL) {

+	*phr = E_POINTER;

+	return;

+    }

+}

+

+

+// Expose our IMediaSeeking and IMediaPosition interfaces

+

+STDMETHODIMP

+CPosPassThru::NonDelegatingQueryInterface(REFIID riid,__deref_out void **ppv)

+{

+    CheckPointer(ppv,E_POINTER);

+    *ppv = NULL;

+

+    if (riid == IID_IMediaSeeking) {

+	return GetInterface( static_cast<IMediaSeeking *>(this), ppv);

+    }

+    return CMediaPosition::NonDelegatingQueryInterface(riid,ppv);

+}

+

+

+// Return the IMediaPosition interface from our peer

+

+HRESULT

+CPosPassThru::GetPeer(IMediaPosition ** ppMP)

+{

+    *ppMP = NULL;

+

+    IPin *pConnected;

+    HRESULT hr = m_pPin->ConnectedTo(&pConnected);

+    if (FAILED(hr)) {

+	return E_NOTIMPL;

+    }

+    IMediaPosition * pMP;

+    hr = pConnected->QueryInterface(IID_IMediaPosition, (void **) &pMP);

+    pConnected->Release();

+    if (FAILED(hr)) {

+	return E_NOTIMPL;

+    }

+

+    *ppMP = pMP;

+    return S_OK;

+}

+

+

+// Return the IMediaSeeking interface from our peer

+

+HRESULT

+CPosPassThru::GetPeerSeeking(__deref_out IMediaSeeking ** ppMS)

+{

+    *ppMS = NULL;

+

+    IPin *pConnected;

+    HRESULT hr = m_pPin->ConnectedTo(&pConnected);

+    if (FAILED(hr)) {

+	return E_NOTIMPL;

+    }

+    IMediaSeeking * pMS;

+    hr = pConnected->QueryInterface(IID_IMediaSeeking, (void **) &pMS);

+    pConnected->Release();

+    if (FAILED(hr)) {

+	return E_NOTIMPL;

+    }

+

+    *ppMS = pMS;

+    return S_OK;

+}

+

+

+// --- IMediaSeeking methods ----------

+

+

+STDMETHODIMP

+CPosPassThru::GetCapabilities(__out DWORD * pCaps)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->GetCapabilities(pCaps);

+    pMS->Release();

+    return hr;

+}

+

+STDMETHODIMP

+CPosPassThru::CheckCapabilities(__inout DWORD * pCaps)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->CheckCapabilities(pCaps);

+    pMS->Release();

+    return hr;

+}

+

+STDMETHODIMP

+CPosPassThru::IsFormatSupported(const GUID * pFormat)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->IsFormatSupported(pFormat);

+    pMS->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::QueryPreferredFormat(__out GUID *pFormat)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->QueryPreferredFormat(pFormat);

+    pMS->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::SetTimeFormat(const GUID * pFormat)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->SetTimeFormat(pFormat);

+    pMS->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::GetTimeFormat(__out GUID *pFormat)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->GetTimeFormat(pFormat);

+    pMS->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::IsUsingTimeFormat(const GUID * pFormat)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->IsUsingTimeFormat(pFormat);

+    pMS->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::ConvertTimeFormat(__out LONGLONG * pTarget, 

+                                __in_opt const GUID * pTargetFormat,

+				LONGLONG Source, 

+                                __in_opt const GUID * pSourceFormat )

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->ConvertTimeFormat(pTarget, pTargetFormat, Source, pSourceFormat );

+    pMS->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::SetPositions( __inout_opt LONGLONG * pCurrent, 

+                            DWORD CurrentFlags, 

+                            __inout_opt LONGLONG * pStop, 

+                            DWORD StopFlags )

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->SetPositions(pCurrent, CurrentFlags, pStop, StopFlags );

+    pMS->Release();

+    return hr;

+}

+

+STDMETHODIMP

+CPosPassThru::GetPositions(__out_opt LONGLONG *pCurrent, __out_opt LONGLONG * pStop)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->GetPositions(pCurrent,pStop);

+    pMS->Release();

+    return hr;

+}

+

+HRESULT

+CPosPassThru::GetSeekingLongLong

+( HRESULT (__stdcall IMediaSeeking::*pMethod)( __out LONGLONG * )

+, LONGLONG * pll

+)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (SUCCEEDED(hr))

+    {

+	hr = (pMS->*pMethod)(pll);

+	pMS->Release();

+    }

+    return hr;

+}

+

+// If we don't have a current position then ask upstream

+

+STDMETHODIMP

+CPosPassThru::GetCurrentPosition(__out LONGLONG *pCurrent)

+{

+    // Can we report the current position

+    HRESULT hr = GetMediaTime(pCurrent,NULL);

+    if (SUCCEEDED(hr)) hr = NOERROR;

+    else hr = GetSeekingLongLong( &IMediaSeeking::GetCurrentPosition, pCurrent );

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::GetStopPosition(__out LONGLONG *pStop)

+{

+    return GetSeekingLongLong( &IMediaSeeking::GetStopPosition, pStop );;

+}

+

+STDMETHODIMP

+CPosPassThru::GetDuration(__out LONGLONG *pDuration)

+{

+    return GetSeekingLongLong( &IMediaSeeking::GetDuration, pDuration );;

+}

+

+

+STDMETHODIMP

+CPosPassThru::GetPreroll(__out LONGLONG *pllPreroll)

+{

+    return GetSeekingLongLong( &IMediaSeeking::GetPreroll, pllPreroll );;

+}

+

+

+STDMETHODIMP

+CPosPassThru::GetAvailable( __out_opt LONGLONG *pEarliest, __out_opt LONGLONG *pLatest )

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMS->GetAvailable( pEarliest, pLatest );

+    pMS->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::GetRate(__out double * pdRate)

+{

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMS->GetRate(pdRate);

+    pMS->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::SetRate(double dRate)

+{

+    if (0.0 == dRate) {

+		return E_INVALIDARG;

+    }

+

+    IMediaSeeking* pMS;

+    HRESULT hr = GetPeerSeeking(&pMS);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMS->SetRate(dRate);

+    pMS->Release();

+    return hr;

+}

+

+

+

+

+// --- IMediaPosition methods ----------

+

+

+STDMETHODIMP

+CPosPassThru::get_Duration(__out REFTIME * plength)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pMP->get_Duration(plength);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::get_CurrentPosition(__out REFTIME * pllTime)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->get_CurrentPosition(pllTime);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::put_CurrentPosition(REFTIME llTime)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->put_CurrentPosition(llTime);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::get_StopTime(__out REFTIME * pllTime)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->get_StopTime(pllTime);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::put_StopTime(REFTIME llTime)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->put_StopTime(llTime);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::get_PrerollTime(__out REFTIME * pllTime)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->get_PrerollTime(pllTime);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::put_PrerollTime(REFTIME llTime)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->put_PrerollTime(llTime);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::get_Rate(__out double * pdRate)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->get_Rate(pdRate);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::put_Rate(double dRate)

+{

+    if (0.0 == dRate) {

+		return E_INVALIDARG;

+    }

+

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->put_Rate(dRate);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::CanSeekForward(__out LONG *pCanSeekForward)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->CanSeekForward(pCanSeekForward);

+    pMP->Release();

+    return hr;

+}

+

+

+STDMETHODIMP

+CPosPassThru::CanSeekBackward(__out LONG *pCanSeekBackward)

+{

+    IMediaPosition* pMP;

+    HRESULT hr = GetPeer(&pMP);

+    if (FAILED(hr)) {

+	return hr;

+    }

+    hr = pMP->CanSeekBackward(pCanSeekBackward);

+    pMP->Release();

+    return hr;

+}

+

+

+// --- Implements the CRendererPosPassThru class ----------

+

+

+// Media times (eg current frame, field, sample etc) are passed through the

+// filtergraph in media samples. When a renderer gets a sample with media

+// times in it, it will call one of the RegisterMediaTime methods we expose

+// (one takes an IMediaSample, the other takes the media times direct). We

+// store the media times internally and return them in GetCurrentPosition.

+

+CRendererPosPassThru::CRendererPosPassThru(__in_opt LPCTSTR pName,

+					   __in_opt LPUNKNOWN pUnk,

+					   __inout HRESULT *phr,

+					   IPin *pPin) :

+    CPosPassThru(pName,pUnk,phr,pPin),

+    m_StartMedia(0),

+    m_EndMedia(0),

+    m_bReset(TRUE)

+{

+}

+

+

+// Sets the media times the object should report

+

+HRESULT

+CRendererPosPassThru::RegisterMediaTime(IMediaSample *pMediaSample)

+{

+    ASSERT(pMediaSample);

+    LONGLONG StartMedia;

+    LONGLONG EndMedia;

+

+    CAutoLock cAutoLock(&m_PositionLock);

+

+    // Get the media times from the sample

+

+    HRESULT hr = pMediaSample->GetTime(&StartMedia,&EndMedia);

+    if (FAILED(hr))

+    {

+	ASSERT(hr == VFW_E_SAMPLE_TIME_NOT_SET);

+	return hr;

+    }

+

+    m_StartMedia = StartMedia;

+    m_EndMedia = EndMedia;

+    m_bReset = FALSE;

+    return NOERROR;

+}

+

+

+// Sets the media times the object should report

+

+HRESULT

+CRendererPosPassThru::RegisterMediaTime(LONGLONG StartTime,LONGLONG EndTime)

+{

+    CAutoLock cAutoLock(&m_PositionLock);

+    m_StartMedia = StartTime;

+    m_EndMedia = EndTime;

+    m_bReset = FALSE;

+    return NOERROR;

+}

+

+

+// Return the current media times registered in the object

+

+HRESULT

+CRendererPosPassThru::GetMediaTime(__out LONGLONG *pStartTime, __out_opt LONGLONG *pEndTime)

+{

+    ASSERT(pStartTime);

+

+    CAutoLock cAutoLock(&m_PositionLock);

+    if (m_bReset == TRUE) {

+	return E_FAIL;

+    }

+

+    // We don't have to return the end time

+

+    HRESULT hr = ConvertTimeFormat( pStartTime, 0, m_StartMedia, &TIME_FORMAT_MEDIA_TIME );

+    if (pEndTime && SUCCEEDED(hr)) {

+	hr = ConvertTimeFormat( pEndTime, 0, m_EndMedia, &TIME_FORMAT_MEDIA_TIME );

+    }

+    return hr;

+}

+

+

+// Resets the media times we hold

+

+HRESULT

+CRendererPosPassThru::ResetMediaTime()

+{

+    CAutoLock cAutoLock(&m_PositionLock);

+    m_StartMedia = 0;

+    m_EndMedia = 0;

+    m_bReset = TRUE;

+    return NOERROR;

+}

+

+// Intended to be called by the owing filter during EOS processing so

+// that the media times can be adjusted to the stop time.  This ensures

+// that the GetCurrentPosition will actully get to the stop position.

+HRESULT

+CRendererPosPassThru::EOS()

+{

+    HRESULT hr;

+

+    if ( m_bReset == TRUE ) hr = E_FAIL;

+    else

+    {

+	LONGLONG llStop;

+	if SUCCEEDED(hr=GetStopPosition(&llStop))

+	{

+	    CAutoLock cAutoLock(&m_PositionLock);

+	    m_StartMedia =

+	    m_EndMedia	 = llStop;

+	}

+    }

+    return hr;

+}

+

+// -- CSourceSeeking implementation ------------

+

+CSourceSeeking::CSourceSeeking(

+    __in_opt LPCTSTR pName,

+    __in_opt LPUNKNOWN pUnk,

+    __inout HRESULT* phr,

+    __in CCritSec * pLock) :

+        CUnknown(pName, pUnk),

+        m_pLock(pLock),

+        m_rtStart((long)0)

+{

+    m_rtStop = _I64_MAX / 2;

+    m_rtDuration = m_rtStop;

+    m_dRateSeeking = 1.0;

+

+    m_dwSeekingCaps = AM_SEEKING_CanSeekForwards

+        | AM_SEEKING_CanSeekBackwards

+        | AM_SEEKING_CanSeekAbsolute

+        | AM_SEEKING_CanGetStopPos

+        | AM_SEEKING_CanGetDuration;

+}

+

+HRESULT CSourceSeeking::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    if(riid == IID_IMediaSeeking) {

+        CheckPointer(ppv, E_POINTER);

+        return GetInterface(static_cast<IMediaSeeking *>(this), ppv);

+    }

+    else {

+        return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+HRESULT CSourceSeeking::IsFormatSupported(const GUID * pFormat)

+{

+    CheckPointer(pFormat, E_POINTER);

+    // only seeking in time (REFERENCE_TIME units) is supported

+    return *pFormat == TIME_FORMAT_MEDIA_TIME ? S_OK : S_FALSE;

+}

+

+HRESULT CSourceSeeking::QueryPreferredFormat(__out GUID *pFormat)

+{

+    CheckPointer(pFormat, E_POINTER);

+    *pFormat = TIME_FORMAT_MEDIA_TIME;

+    return S_OK;

+}

+

+HRESULT CSourceSeeking::SetTimeFormat(const GUID * pFormat)

+{

+    CheckPointer(pFormat, E_POINTER);

+

+    // nothing to set; just check that it's TIME_FORMAT_TIME

+    return *pFormat == TIME_FORMAT_MEDIA_TIME ? S_OK : E_INVALIDARG;

+}

+

+HRESULT CSourceSeeking::IsUsingTimeFormat(const GUID * pFormat)

+{

+    CheckPointer(pFormat, E_POINTER);

+    return *pFormat == TIME_FORMAT_MEDIA_TIME ? S_OK : S_FALSE;

+}

+

+HRESULT CSourceSeeking::GetTimeFormat(__out GUID *pFormat)

+{

+    CheckPointer(pFormat, E_POINTER);

+    *pFormat = TIME_FORMAT_MEDIA_TIME;

+    return S_OK;

+}

+

+HRESULT CSourceSeeking::GetDuration(__out LONGLONG *pDuration)

+{

+    CheckPointer(pDuration, E_POINTER);

+    CAutoLock lock(m_pLock);

+    *pDuration = m_rtDuration;

+    return S_OK;

+}

+

+HRESULT CSourceSeeking::GetStopPosition(__out LONGLONG *pStop)

+{

+    CheckPointer(pStop, E_POINTER);

+    CAutoLock lock(m_pLock);

+    *pStop = m_rtStop;

+    return S_OK;

+}

+

+HRESULT CSourceSeeking::GetCurrentPosition(__out LONGLONG *pCurrent)

+{

+    // GetCurrentPosition is typically supported only in renderers and

+    // not in source filters.

+    return E_NOTIMPL;

+}

+

+HRESULT CSourceSeeking::GetCapabilities( __out DWORD * pCapabilities )

+{

+    CheckPointer(pCapabilities, E_POINTER);

+    *pCapabilities = m_dwSeekingCaps;

+    return S_OK;

+}

+

+HRESULT CSourceSeeking::CheckCapabilities( __inout DWORD * pCapabilities )

+{

+    CheckPointer(pCapabilities, E_POINTER);

+

+    // make sure all requested capabilities are in our mask

+    return (~m_dwSeekingCaps & *pCapabilities) ? S_FALSE : S_OK;

+}

+

+HRESULT CSourceSeeking::ConvertTimeFormat( __out LONGLONG * pTarget, 

+                                           __in_opt const GUID * pTargetFormat,

+                                           LONGLONG Source, 

+                                           __in_opt const GUID * pSourceFormat )

+{

+    CheckPointer(pTarget, E_POINTER);

+    // format guids can be null to indicate current format

+

+    // since we only support TIME_FORMAT_MEDIA_TIME, we don't really

+    // offer any conversions.

+    if(pTargetFormat == 0 || *pTargetFormat == TIME_FORMAT_MEDIA_TIME)

+    {

+        if(pSourceFormat == 0 || *pSourceFormat == TIME_FORMAT_MEDIA_TIME)

+        {

+            *pTarget = Source;

+            return S_OK;

+        }

+    }

+

+    return E_INVALIDARG;

+}

+

+

+HRESULT CSourceSeeking::SetPositions( __inout_opt LONGLONG * pCurrent,  

+                                      DWORD CurrentFlags, 

+                                      __inout_opt LONGLONG * pStop,  

+                                      DWORD StopFlags )

+{

+    DWORD StopPosBits = StopFlags & AM_SEEKING_PositioningBitsMask;

+    DWORD StartPosBits = CurrentFlags & AM_SEEKING_PositioningBitsMask;

+

+    if(StopFlags) {

+        CheckPointer(pStop, E_POINTER);

+

+        // accept only relative, incremental, or absolute positioning

+        if(StopPosBits != StopFlags) {

+            return E_INVALIDARG;

+        }

+    }

+

+    if(CurrentFlags) {

+        CheckPointer(pCurrent, E_POINTER);

+        if(StartPosBits != AM_SEEKING_AbsolutePositioning &&

+           StartPosBits != AM_SEEKING_RelativePositioning) {

+            return E_INVALIDARG;

+        }

+    }

+

+

+    // scope for autolock

+    {

+        CAutoLock lock(m_pLock);

+

+        // set start position

+        if(StartPosBits == AM_SEEKING_AbsolutePositioning)

+        {

+            m_rtStart = *pCurrent;

+        }

+        else if(StartPosBits == AM_SEEKING_RelativePositioning)

+        {

+            m_rtStart += *pCurrent;

+        }

+

+        // set stop position

+        if(StopPosBits == AM_SEEKING_AbsolutePositioning)

+        {

+            m_rtStop = *pStop;

+        }

+        else if(StopPosBits == AM_SEEKING_IncrementalPositioning)

+        {

+            m_rtStop = m_rtStart + *pStop;

+        }

+        else if(StopPosBits == AM_SEEKING_RelativePositioning)

+        {

+            m_rtStop = m_rtStop + *pStop;

+        }

+    }

+

+

+    HRESULT hr = S_OK;

+    if(SUCCEEDED(hr) && StopPosBits) {

+        hr = ChangeStop();

+    }

+    if(StartPosBits) {

+        hr = ChangeStart();

+    }

+

+    return hr;

+}

+

+

+HRESULT CSourceSeeking::GetPositions( __out_opt LONGLONG * pCurrent, __out_opt LONGLONG * pStop )

+{

+    if(pCurrent) {

+        *pCurrent = m_rtStart;

+    }

+    if(pStop) {

+        *pStop = m_rtStop;

+    }

+

+    return S_OK;;

+}

+

+

+HRESULT CSourceSeeking::GetAvailable( __out_opt LONGLONG * pEarliest, __out_opt LONGLONG * pLatest )

+{

+    if(pEarliest) {

+        *pEarliest = 0;

+    }

+    if(pLatest) {

+        CAutoLock lock(m_pLock);

+        *pLatest = m_rtDuration;

+    }

+    return S_OK;

+}

+

+HRESULT CSourceSeeking::SetRate( double dRate)

+{

+    {

+        CAutoLock lock(m_pLock);

+        m_dRateSeeking = dRate;

+    }

+    return ChangeRate();

+}

+

+HRESULT CSourceSeeking::GetRate( __out double * pdRate)

+{

+    CheckPointer(pdRate, E_POINTER);

+    CAutoLock lock(m_pLock);

+    *pdRate = m_dRateSeeking;

+    return S_OK;

+}

+

+HRESULT CSourceSeeking::GetPreroll(__out LONGLONG *pPreroll)

+{

+    CheckPointer(pPreroll, E_POINTER);

+    *pPreroll = 0;

+    return S_OK;

+}

+

+

+

+

+

+// --- CSourcePosition implementation ----------

+

+

+CSourcePosition::CSourcePosition(__in_opt LPCTSTR pName,

+				 __in_opt LPUNKNOWN pUnk,

+				 __inout HRESULT* phr,

+				 __in CCritSec * pLock) :

+    CMediaPosition(pName, pUnk),

+    m_pLock(pLock),

+    m_Start(CRefTime((LONGLONG)0))

+{

+    m_Stop = _I64_MAX;

+    m_Rate = 1.0;

+}

+

+

+STDMETHODIMP

+CSourcePosition::get_Duration(__out REFTIME * plength)

+{

+    CheckPointer(plength,E_POINTER);

+    ValidateReadWritePtr(plength,sizeof(REFTIME));

+    CAutoLock lock(m_pLock);

+

+    *plength = m_Duration;

+    return S_OK;

+}

+

+

+STDMETHODIMP

+CSourcePosition::put_CurrentPosition(REFTIME llTime)

+{

+    m_pLock->Lock();

+    m_Start = llTime;

+    m_pLock->Unlock();

+

+    return ChangeStart();

+}

+

+

+STDMETHODIMP

+CSourcePosition::get_StopTime(__out REFTIME * pllTime)

+{

+    CheckPointer(pllTime,E_POINTER);

+    ValidateReadWritePtr(pllTime,sizeof(REFTIME));

+    CAutoLock lock(m_pLock);

+

+    *pllTime = m_Stop;

+    return S_OK;

+}

+

+

+STDMETHODIMP

+CSourcePosition::put_StopTime(REFTIME llTime)

+{

+    m_pLock->Lock();

+    m_Stop = llTime;

+    m_pLock->Unlock();

+

+    return ChangeStop();

+}

+

+

+STDMETHODIMP

+CSourcePosition::get_PrerollTime(__out REFTIME * pllTime)

+{

+    CheckPointer(pllTime,E_POINTER);

+    ValidateReadWritePtr(pllTime,sizeof(REFTIME));

+    return E_NOTIMPL;

+}

+

+

+STDMETHODIMP

+CSourcePosition::put_PrerollTime(REFTIME llTime)

+{

+    return E_NOTIMPL;

+}

+

+

+STDMETHODIMP

+CSourcePosition::get_Rate(__out double * pdRate)

+{

+    CheckPointer(pdRate,E_POINTER);

+    ValidateReadWritePtr(pdRate,sizeof(double));

+    CAutoLock lock(m_pLock);

+

+    *pdRate = m_Rate;

+    return S_OK;

+}

+

+

+STDMETHODIMP

+CSourcePosition::put_Rate(double dRate)

+{

+    m_pLock->Lock();

+    m_Rate = dRate;

+    m_pLock->Unlock();

+

+    return ChangeRate();

+}

+

+

+// By default we can seek forwards

+

+STDMETHODIMP

+CSourcePosition::CanSeekForward(__out LONG *pCanSeekForward)

+{

+    CheckPointer(pCanSeekForward,E_POINTER);

+    *pCanSeekForward = OATRUE;

+    return S_OK;

+}

+

+

+// By default we can seek backwards

+

+STDMETHODIMP

+CSourcePosition::CanSeekBackward(__out LONG *pCanSeekBackward)

+{

+    CheckPointer(pCanSeekBackward,E_POINTER);

+    *pCanSeekBackward = OATRUE;

+    return S_OK;

+}

+

+

+// --- Implementation of CBasicAudio class ----------

+

+

+CBasicAudio::CBasicAudio(__in_opt LPCTSTR pName,__in_opt LPUNKNOWN punk) :

+    CUnknown(pName, punk)

+{

+}

+

+// overriden to publicise our interfaces

+

+STDMETHODIMP

+CBasicAudio::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    ValidateReadWritePtr(ppv,sizeof(PVOID));

+    if (riid == IID_IBasicAudio) {

+	return GetInterface( (IBasicAudio *) this, ppv);

+    } else {

+	return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+STDMETHODIMP

+CBasicAudio::GetTypeInfoCount(__out UINT * pctinfo)

+{

+    return m_basedisp.GetTypeInfoCount(pctinfo);

+}

+

+

+STDMETHODIMP

+CBasicAudio::GetTypeInfo(

+  UINT itinfo,

+  LCID lcid,

+  __deref_out ITypeInfo ** pptinfo)

+{

+    return m_basedisp.GetTypeInfo(

+		IID_IBasicAudio,

+		itinfo,

+		lcid,

+		pptinfo);

+}

+

+

+STDMETHODIMP

+CBasicAudio::GetIDsOfNames(

+  REFIID riid,

+  __in_ecount(cNames) LPOLESTR * rgszNames,

+  UINT cNames,

+  LCID lcid,

+  __out_ecount(cNames) DISPID * rgdispid)

+{

+    return m_basedisp.GetIDsOfNames(

+			IID_IBasicAudio,

+			rgszNames,

+			cNames,

+			lcid,

+			rgdispid);

+}

+

+

+STDMETHODIMP

+CBasicAudio::Invoke(

+  DISPID dispidMember,

+  REFIID riid,

+  LCID lcid,

+  WORD wFlags,

+  __in DISPPARAMS * pdispparams,

+  __out_opt VARIANT * pvarResult,

+  __out_opt EXCEPINFO * pexcepinfo,

+  __out_opt UINT * puArgErr)

+{

+    // this parameter is a dead leftover from an earlier interface

+    if (IID_NULL != riid) {

+	return DISP_E_UNKNOWNINTERFACE;

+    }

+

+    ITypeInfo * pti;

+    HRESULT hr = GetTypeInfo(0, lcid, &pti);

+

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pti->Invoke(

+	    (IBasicAudio *)this,

+	    dispidMember,

+	    wFlags,

+	    pdispparams,

+	    pvarResult,

+	    pexcepinfo,

+	    puArgErr);

+

+    pti->Release();

+    return hr;

+}

+

+

+// --- IVideoWindow implementation ----------

+

+CBaseVideoWindow::CBaseVideoWindow(__in_opt LPCTSTR pName,__in_opt LPUNKNOWN punk) :

+    CUnknown(pName, punk)

+{

+}

+

+

+// overriden to publicise our interfaces

+

+STDMETHODIMP

+CBaseVideoWindow::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    ValidateReadWritePtr(ppv,sizeof(PVOID));

+    if (riid == IID_IVideoWindow) {

+	return GetInterface( (IVideoWindow *) this, ppv);

+    } else {

+	return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+STDMETHODIMP

+CBaseVideoWindow::GetTypeInfoCount(__out UINT * pctinfo)

+{

+    return m_basedisp.GetTypeInfoCount(pctinfo);

+}

+

+

+STDMETHODIMP

+CBaseVideoWindow::GetTypeInfo(

+  UINT itinfo,

+  LCID lcid,

+  __deref_out ITypeInfo ** pptinfo)

+{

+    return m_basedisp.GetTypeInfo(

+		IID_IVideoWindow,

+		itinfo,

+		lcid,

+		pptinfo);

+}

+

+

+STDMETHODIMP

+CBaseVideoWindow::GetIDsOfNames(

+  REFIID riid,

+  __in_ecount(cNames) LPOLESTR * rgszNames,

+  UINT cNames,

+  LCID lcid,

+  __out_ecount(cNames) DISPID * rgdispid)

+{

+    return m_basedisp.GetIDsOfNames(

+			IID_IVideoWindow,

+			rgszNames,

+			cNames,

+			lcid,

+			rgdispid);

+}

+

+

+STDMETHODIMP

+CBaseVideoWindow::Invoke(

+  DISPID dispidMember,

+  REFIID riid,

+  LCID lcid,

+  WORD wFlags,

+  __in DISPPARAMS * pdispparams,

+  __out_opt VARIANT * pvarResult,

+  __out_opt EXCEPINFO * pexcepinfo,

+  __out_opt UINT * puArgErr)

+{

+    // this parameter is a dead leftover from an earlier interface

+    if (IID_NULL != riid) {

+	return DISP_E_UNKNOWNINTERFACE;

+    }

+

+    ITypeInfo * pti;

+    HRESULT hr = GetTypeInfo(0, lcid, &pti);

+

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pti->Invoke(

+	    (IVideoWindow *)this,

+	    dispidMember,

+	    wFlags,

+	    pdispparams,

+	    pvarResult,

+	    pexcepinfo,

+	    puArgErr);

+

+    pti->Release();

+    return hr;

+}

+

+

+// --- IBasicVideo implementation ----------

+

+

+CBaseBasicVideo::CBaseBasicVideo(__in_opt LPCTSTR pName,__in_opt LPUNKNOWN punk) :

+    CUnknown(pName, punk)

+{

+}

+

+

+// overriden to publicise our interfaces

+

+STDMETHODIMP

+CBaseBasicVideo::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv)

+{

+    ValidateReadWritePtr(ppv,sizeof(PVOID));

+    if (riid == IID_IBasicVideo || riid == IID_IBasicVideo2) {

+	return GetInterface( static_cast<IBasicVideo2 *>(this), ppv);

+    } else {

+	return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+STDMETHODIMP

+CBaseBasicVideo::GetTypeInfoCount(__out UINT * pctinfo)

+{

+    return m_basedisp.GetTypeInfoCount(pctinfo);

+}

+

+

+STDMETHODIMP

+CBaseBasicVideo::GetTypeInfo(

+  UINT itinfo,

+  LCID lcid,

+  __deref_out ITypeInfo ** pptinfo)

+{

+    return m_basedisp.GetTypeInfo(

+		IID_IBasicVideo,

+		itinfo,

+		lcid,

+		pptinfo);

+}

+

+

+STDMETHODIMP

+CBaseBasicVideo::GetIDsOfNames(

+  REFIID riid,

+  __in_ecount(cNames) LPOLESTR * rgszNames,

+  UINT cNames,

+  LCID lcid,

+  __out_ecount(cNames) DISPID * rgdispid)

+{

+    return m_basedisp.GetIDsOfNames(

+			IID_IBasicVideo,

+			rgszNames,

+			cNames,

+			lcid,

+			rgdispid);

+}

+

+

+STDMETHODIMP

+CBaseBasicVideo::Invoke(

+  DISPID dispidMember,

+  REFIID riid,

+  LCID lcid,

+  WORD wFlags,

+  __in DISPPARAMS * pdispparams,

+  __out_opt VARIANT * pvarResult,

+  __out_opt EXCEPINFO * pexcepinfo,

+  __out_opt UINT * puArgErr)

+{

+    // this parameter is a dead leftover from an earlier interface

+    if (IID_NULL != riid) {

+	return DISP_E_UNKNOWNINTERFACE;

+    }

+

+    ITypeInfo * pti;

+    HRESULT hr = GetTypeInfo(0, lcid, &pti);

+

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    hr = pti->Invoke(

+	    (IBasicVideo *)this,

+	    dispidMember,

+	    wFlags,

+	    pdispparams,

+	    pvarResult,

+	    pexcepinfo,

+	    puArgErr);

+

+    pti->Release();

+    return hr;

+}

+

+

+// --- Implementation of Deferred Commands ----------

+

+

+CDispParams::CDispParams(UINT nArgs, __in_ecount(nArgs) VARIANT* pArgs, __inout_opt HRESULT *phr)

+{

+   cNamedArgs = 0;

+   rgdispidNamedArgs = NULL;

+   cArgs = nArgs;

+

+    if (cArgs) {

+	rgvarg = new VARIANT[cArgs];

+        if (NULL == rgvarg) {

+            cArgs = 0;

+            if (phr) {

+                *phr = E_OUTOFMEMORY;

+            }

+            return;

+        }

+

+	for (UINT i = 0; i < cArgs; i++) {

+

+            //  Why aren't we using VariantCopy?

+

+	    VARIANT * pDest = &rgvarg[i];

+	    VARIANT * pSrc = &pArgs[i];

+

+	    pDest->vt = pSrc->vt;

+	    switch(pDest->vt) {

+

+	    case VT_I4:

+		pDest->lVal = pSrc->lVal;

+		break;

+

+	    case VT_UI1:

+		pDest->bVal = pSrc->bVal;

+		break;

+

+	    case VT_I2:

+		pDest->iVal = pSrc->iVal;

+		break;

+

+	    case VT_R4:

+		pDest->fltVal = pSrc->fltVal;

+		break;

+

+	    case VT_R8:

+		pDest->dblVal = pSrc->dblVal;

+		break;

+

+	    case VT_BOOL:

+		pDest->boolVal = pSrc->boolVal;

+		break;

+

+	    case VT_ERROR:

+		pDest->scode = pSrc->scode;

+		break;

+

+	    case VT_CY:

+		pDest->cyVal = pSrc->cyVal;

+		break;

+

+	    case VT_DATE:

+		pDest->date = pSrc->date;

+		break;

+

+	    case VT_BSTR:

+		if ((PVOID)pSrc->bstrVal == NULL) {

+		    pDest->bstrVal = NULL;

+		} else {

+

+		    // a BSTR is a WORD followed by a UNICODE string.

+		    // the pointer points just after the WORD

+

+		    WORD len = * (WORD*) (pSrc->bstrVal - (sizeof(WORD) / sizeof(OLECHAR)));

+		    OLECHAR* pch = new OLECHAR[len + (sizeof(WORD)/sizeof(OLECHAR))];

+                    if (pch) {

+        		WORD *pui = (WORD*)pch;

+        		*pui = len;

+         	        pDest->bstrVal = pch + (sizeof(WORD)/sizeof(OLECHAR));

+         		CopyMemory(pDest->bstrVal, pSrc->bstrVal, len*sizeof(OLECHAR));

+                    } else {

+                        cArgs = i;

+                        if (phr) {

+                            *phr = E_OUTOFMEMORY;

+                        }

+                    }

+		}

+		break;

+

+	    case VT_UNKNOWN:

+		pDest->punkVal = pSrc->punkVal;

+		pDest->punkVal->AddRef();

+		break;

+

+	    case VT_DISPATCH:

+		pDest->pdispVal = pSrc->pdispVal;

+		pDest->pdispVal->AddRef();

+		break;

+

+	    default:

+		// a type we haven't got round to adding yet!

+		ASSERT(0);

+		break;

+	    }

+	}

+

+    } else {

+	rgvarg = NULL;

+    }

+

+}

+

+

+CDispParams::~CDispParams()

+{

+    for (UINT i = 0; i < cArgs; i++) {

+	switch(rgvarg[i].vt) {

+        case VT_BSTR:

+            //  Explicitly cast BSTR to PVOID to tell code scanning tools we really mean to test the pointer

+	    if ((PVOID)rgvarg[i].bstrVal != NULL) {

+		OLECHAR * pch = rgvarg[i].bstrVal - (sizeof(WORD)/sizeof(OLECHAR));

+		delete pch;

+	    }

+	    break;

+

+	case VT_UNKNOWN:

+	    rgvarg[i].punkVal->Release();

+	    break;

+

+	case VT_DISPATCH:

+	    rgvarg[i].pdispVal->Release();

+	    break;

+	}

+    }

+    delete[] rgvarg;

+}

+

+

+// lifetime is controlled by refcounts (see defer.h)

+

+CDeferredCommand::CDeferredCommand(

+    __inout CCmdQueue * pQ,

+    __in_opt LPUNKNOWN	pUnk,

+    __inout HRESULT *	phr,

+    __in LPUNKNOWN	pUnkExecutor,

+    REFTIME	time,

+    __in GUID*	iid,

+    long	dispidMethod,

+    short	wFlags,

+    long	nArgs,

+    __in_ecount(nArgs) VARIANT*	pDispParams,

+    __out VARIANT*	pvarResult,

+    __out short*	puArgErr,

+    BOOL	bStream

+    ) :

+	CUnknown(NAME("DeferredCommand"), pUnk),

+	m_pQueue(pQ),

+	m_pUnk(pUnkExecutor),

+	m_iid(iid),

+	m_dispidMethod(dispidMethod),

+	m_wFlags(wFlags),

+	m_DispParams(nArgs, pDispParams, phr),

+	m_pvarResult(pvarResult),

+	m_bStream(bStream),

+	m_hrResult(E_ABORT)

+

+{

+    // convert REFTIME to REFERENCE_TIME

+    COARefTime convertor(time);

+    m_time = convertor;

+

+    // no check of time validity - it's ok to queue a command that's

+    // already late

+

+    // check iid is supportable on pUnk by QueryInterface for it

+    IUnknown * pInterface;

+    HRESULT hr = m_pUnk->QueryInterface(GetIID(), (void**) &pInterface);

+    if (FAILED(hr)) {

+	*phr = hr;

+	return;

+    }

+    pInterface->Release();

+

+

+    // !!! check dispidMethod and param/return types using typelib

+    ITypeInfo *pti;

+    hr = m_Dispatch.GetTypeInfo(*iid, 0, 0, &pti);

+    if (FAILED(hr)) {

+	*phr = hr;

+	return;

+    }

+    // !!! some sort of ITypeInfo validity check here

+    pti->Release();

+

+

+    // Fix up the dispid for put and get

+    if (wFlags == DISPATCH_PROPERTYPUT) {

+        m_DispParams.cNamedArgs = 1;

+        m_DispId = DISPID_PROPERTYPUT;

+        m_DispParams.rgdispidNamedArgs = &m_DispId;

+    }

+

+    // all checks ok - add to queue

+    hr = pQ->Insert(this);

+    if (FAILED(hr)) {

+	*phr = hr;

+    }

+}

+

+

+// refcounts are held by caller of InvokeAt... and by list. So if

+// we get here, we can't be on the list

+

+#if 0

+CDeferredCommand::~CDeferredCommand()

+{

+    // this assert is invalid since if the queue is deleted while we are

+    // still on the queue, we will have been removed by the queue and this

+    // m_pQueue will not have been modified.

+    // ASSERT(m_pQueue == NULL);

+

+    // we don't hold a ref count on pUnk, which is the object that should

+    // execute the command.

+    // This is because there would otherwise be a circular refcount problem

+    // since pUnk probably owns the CmdQueue object that has a refcount

+    // on us.

+    // The lifetime of pUnk is guaranteed by it being part of, or lifetime

+    // controlled by, our parent object. As long as we are on the list, pUnk

+    // must be valid. Once we are off the list, we do not use pUnk.

+

+}

+#endif

+

+

+// overriden to publicise our interfaces

+

+STDMETHODIMP

+CDeferredCommand::NonDelegatingQueryInterface(REFIID riid, __out void **ppv)

+{

+    ValidateReadWritePtr(ppv,sizeof(PVOID));

+    if (riid == IID_IDeferredCommand) {

+	return GetInterface( (IDeferredCommand *) this, ppv);

+    } else {

+	return CUnknown::NonDelegatingQueryInterface(riid, ppv);

+    }

+}

+

+

+// remove from q. this will reduce the refcount by one (since the q

+// holds a count) but can't make us go away since he must have a

+// refcount in order to call this method.

+

+STDMETHODIMP

+CDeferredCommand::Cancel()

+{

+    if (m_pQueue == NULL) {

+	return VFW_E_ALREADY_CANCELLED;

+    }

+

+    HRESULT hr = m_pQueue->Remove(this);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    m_pQueue = NULL;

+    return S_OK;

+}

+

+

+STDMETHODIMP

+CDeferredCommand::Confidence(__out LONG* pConfidence)

+{

+    return E_NOTIMPL;

+}

+

+

+STDMETHODIMP

+CDeferredCommand::GetHResult(__out HRESULT * phrResult)

+{

+    CheckPointer(phrResult,E_POINTER);

+    ValidateReadWritePtr(phrResult,sizeof(HRESULT));

+

+    if (m_pQueue != NULL) {

+	return E_ABORT;

+    }

+    *phrResult = m_hrResult;

+    return S_OK;

+}

+

+

+// set the time to be a new time (checking that it is valid) and

+// then requeue

+

+STDMETHODIMP

+CDeferredCommand::Postpone(REFTIME newtime)

+{

+

+    // check that this time is not past

+    // convert REFTIME to REFERENCE_TIME

+    COARefTime convertor(newtime);

+

+    // check that the time has not passed

+    if (m_pQueue->CheckTime(convertor, IsStreamTime())) {

+	return VFW_E_TIME_ALREADY_PASSED;

+    }

+

+    // extract from list

+    HRESULT hr = m_pQueue->Remove(this);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    // change time

+    m_time = convertor;

+

+    // requeue

+    hr = m_pQueue->Insert(this);

+

+    return hr;

+}

+

+

+HRESULT

+CDeferredCommand::Invoke()

+{

+    // check that we are still outstanding

+    if (m_pQueue == NULL) {

+	return VFW_E_ALREADY_CANCELLED;

+    }

+

+    // get the type info

+    ITypeInfo* pti;

+    HRESULT hr = m_Dispatch.GetTypeInfo(GetIID(), 0, 0, &pti);

+    if (FAILED(hr)) {

+	return hr;

+    }

+

+    // qi for the expected interface and then invoke it. Note that we have to

+    // treat the returned interface as IUnknown since we don't know its type.

+    IUnknown* pInterface;

+

+    hr = m_pUnk->QueryInterface(GetIID(), (void**) &pInterface);

+    if (FAILED(hr)) {

+	pti->Release();

+	return hr;

+    }

+

+    EXCEPINFO expinfo;

+    UINT uArgErr;

+    m_hrResult = pti->Invoke(

+	pInterface,

+	GetMethod(),

+	GetFlags(),

+	GetParams(),

+	GetResult(),

+	&expinfo,

+	&uArgErr);

+

+    // release the interface we QI'd for

+    pInterface->Release();

+    pti->Release();

+

+

+    // remove from list whether or not successful

+    // or we loop indefinitely

+    hr = m_pQueue->Remove(this);

+    m_pQueue = NULL;

+    return hr;

+}

+

+

+

+// --- CCmdQueue methods ----------

+

+

+CCmdQueue::CCmdQueue(__inout_opt HRESULT *phr) :

+    m_listPresentation(NAME("Presentation time command list")),

+    m_listStream(NAME("Stream time command list")),

+    m_evDue(TRUE, phr),    // manual reset

+    m_dwAdvise(0),

+    m_pClock(NULL),

+    m_bRunning(FALSE)

+{

+}

+

+

+CCmdQueue::~CCmdQueue()

+{

+    // empty all our lists

+

+    // we hold a refcount on each, so traverse and Release each

+    // entry then RemoveAll to empty the list

+    POSITION pos = m_listPresentation.GetHeadPosition();

+

+    while(pos) {

+	CDeferredCommand* pCmd = m_listPresentation.GetNext(pos);

+	pCmd->Release();

+    }

+    m_listPresentation.RemoveAll();

+

+    pos = m_listStream.GetHeadPosition();

+

+    while(pos) {

+	CDeferredCommand* pCmd = m_listStream.GetNext(pos);

+	pCmd->Release();

+    }

+    m_listStream.RemoveAll();

+

+    if (m_pClock) {

+	if (m_dwAdvise) {

+	    m_pClock->Unadvise(m_dwAdvise);

+	    m_dwAdvise = 0;

+	}

+	m_pClock->Release();

+    }

+}

+

+

+// returns a new CDeferredCommand object that will be initialised with

+// the parameters and will be added to the queue during construction.

+// returns S_OK if successfully created otherwise an error and

+// no object has been queued.

+

+HRESULT

+CCmdQueue::New(

+    __out CDeferredCommand **ppCmd,

+    __in     LPUNKNOWN	pUnk,		// this object will execute command

+    REFTIME	time,

+    __in GUID*	iid,

+    long	dispidMethod,

+    short	wFlags,

+    long	cArgs,

+    __in_ecount(cArgs) VARIANT*	pDispParams,

+    __out VARIANT*	pvarResult,

+    __out short*	puArgErr,

+    BOOL	bStream

+)

+{

+    CAutoLock lock(&m_Lock);

+

+    HRESULT hr = S_OK;

+    *ppCmd = NULL;

+

+    CDeferredCommand* pCmd;

+    pCmd = new CDeferredCommand(

+		    this,

+		    NULL,	    // not aggregated

+		    &hr,

+		    pUnk,	    // this guy will execute

+		    time,

+		    iid,

+		    dispidMethod,

+		    wFlags,

+		    cArgs,

+		    pDispParams,

+		    pvarResult,

+		    puArgErr,

+		    bStream);

+

+    if (pCmd == NULL) {

+	hr = E_OUTOFMEMORY;

+    } else {

+	*ppCmd = pCmd;

+    }

+    return hr;

+}

+

+

+HRESULT

+CCmdQueue::Insert(__in CDeferredCommand* pCmd)

+{

+    CAutoLock lock(&m_Lock);

+

+    // addref the item

+    pCmd->AddRef();

+

+    CGenericList<CDeferredCommand> * pList;

+    if (pCmd->IsStreamTime()) {

+	pList = &m_listStream;

+    } else {

+	pList = &m_listPresentation;

+    }

+    POSITION pos = pList->GetHeadPosition();

+

+    // seek past all items that are before us

+    while (pos &&

+	(pList->GetValid(pos)->GetTime() <= pCmd->GetTime())) {

+

+	pList->GetNext(pos);

+    }

+

+    // now at end of list or in front of items that come later

+    if (!pos) {

+	pList->AddTail(pCmd);

+    } else {

+	pList->AddBefore(pos, pCmd);

+    }

+

+    SetTimeAdvise();

+    return S_OK;

+}

+

+

+HRESULT

+CCmdQueue::Remove(__in CDeferredCommand* pCmd)

+{

+    CAutoLock lock(&m_Lock);

+    HRESULT hr = S_OK;

+

+    CGenericList<CDeferredCommand> * pList;

+    if (pCmd->IsStreamTime()) {

+	pList = &m_listStream;

+    } else {

+	pList = &m_listPresentation;

+    }

+    POSITION pos = pList->GetHeadPosition();

+

+    // traverse the list

+    while (pos && (pList->GetValid(pos) != pCmd)) {

+	pList->GetNext(pos);

+    }

+

+    // did we drop off the end?

+    if (!pos) {

+	hr = VFW_E_NOT_FOUND;

+    } else {

+

+	// found it - now take off list

+	pList->Remove(pos);

+

+	// Insert did an AddRef, so release it

+	pCmd->Release();

+

+	// check that timer request is still for earliest time

+	SetTimeAdvise();

+    }

+    return hr;

+}

+

+

+// set the clock used for timing

+

+HRESULT

+CCmdQueue::SetSyncSource(__in_opt IReferenceClock* pClock)

+{

+    CAutoLock lock(&m_Lock);

+

+    // addref the new clock first in case they are the same

+    if (pClock) {

+	pClock->AddRef();

+    }

+

+    // kill any advise on the old clock

+    if (m_pClock) {

+	if (m_dwAdvise) {

+	    m_pClock->Unadvise(m_dwAdvise);

+	    m_dwAdvise = 0;

+	}

+	m_pClock->Release();

+    }

+    m_pClock = pClock;

+

+    // set up a new advise

+    SetTimeAdvise();

+    return S_OK;

+}

+

+

+// set up a timer event with the reference clock

+

+void

+CCmdQueue::SetTimeAdvise(void)

+{

+    // make sure we have a clock to use

+    if (!m_pClock) {

+	return;

+    }

+

+    // reset the event whenever we are requesting a new signal

+    m_evDue.Reset();

+

+    // time 0 is earliest

+    CRefTime current;

+

+    // find the earliest presentation time

+    POSITION pos = m_listPresentation.GetHeadPosition();

+    if (pos != NULL) {

+	current = m_listPresentation.GetValid(pos)->GetTime();

+    }

+

+    // if we're running, check the stream times too

+    if (m_bRunning) {

+

+	CRefTime t;

+        pos = m_listStream.GetHeadPosition();

+	if (NULL != pos) {

+	    t = m_listStream.GetValid(pos)->GetTime();

+

+	    // add on stream time offset to get presentation time

+	    t += m_StreamTimeOffset;

+

+	    // is this earlier?

+	    if ((current == TimeZero) || (t < current)) {

+		current = t;

+	    }

+	}

+    }

+

+    // need to change?

+    if ((current > TimeZero) && (current != m_tCurrentAdvise)) {

+	if (m_dwAdvise) {

+	    m_pClock->Unadvise(m_dwAdvise);

+	    // reset the event whenever we are requesting a new signal

+	    m_evDue.Reset();

+	}

+

+	// ask for time advice - the first two params are either

+	// stream time offset and stream time or

+	// presentation time and 0. we always use the latter

+	HRESULT hr = m_pClock->AdviseTime(

+		    (REFERENCE_TIME)current,

+		    TimeZero,

+		    (HEVENT) HANDLE(m_evDue),

+		    &m_dwAdvise);

+

+	ASSERT(SUCCEEDED(hr));

+	m_tCurrentAdvise = current;

+    }

+}

+

+

+// switch to run mode. Streamtime to Presentation time mapping known.

+

+HRESULT

+CCmdQueue::Run(REFERENCE_TIME tStreamTimeOffset)

+{

+    CAutoLock lock(&m_Lock);

+

+    m_StreamTimeOffset = tStreamTimeOffset;

+    m_bRunning = TRUE;

+

+    // ensure advise is accurate

+    SetTimeAdvise();

+    return S_OK;

+}

+

+

+// switch to Stopped or Paused mode. Time mapping not known.

+

+HRESULT

+CCmdQueue::EndRun()

+{

+    CAutoLock lock(&m_Lock);

+

+    m_bRunning = FALSE;

+

+    // check timer setting - stream times

+    SetTimeAdvise();

+    return S_OK;

+}

+

+

+// return a pointer to the next due command. Blocks for msTimeout

+// milliseconds until there is a due command.

+// Stream-time commands will only become due between Run and Endrun calls.

+// The command remains queued until invoked or cancelled.

+// Returns E_ABORT if timeout occurs, otherwise S_OK (or other error).

+//

+// returns an AddRef'd object

+

+HRESULT

+CCmdQueue::GetDueCommand(__out CDeferredCommand ** ppCmd, long msTimeout)

+{

+    // loop until we timeout or find a due command

+    for (;;) {

+

+	{

+	    CAutoLock lock(&m_Lock);

+

+

+	    // find the earliest command

+	    CDeferredCommand * pCmd = NULL;

+

+	    // check the presentation time and the

+	    // stream time list to find the earliest

+

+            POSITION pos = m_listPresentation.GetHeadPosition();

+

+	    if (NULL != pos) {

+		pCmd = m_listPresentation.GetValid(pos);

+	    }

+

+	    if (m_bRunning) {

+		pos = m_listStream.GetHeadPosition();

+                if (NULL != pos) {

+                    CDeferredCommand* pStrm = m_listStream.GetValid(pos);

+

+                    CRefTime t = pStrm->GetTime() + m_StreamTimeOffset;

+                    if (!pCmd || (t < pCmd->GetTime())) {

+                        pCmd = pStrm;

+                    }

+                }

+            }

+

+	    //	if we have found one, is it due?

+	    if (pCmd) {

+		if (CheckTime(pCmd->GetTime(), pCmd->IsStreamTime())) {

+

+		    // yes it's due - addref it

+		    pCmd->AddRef();

+		    *ppCmd = pCmd;

+		    return S_OK;

+		}

+	    }

+	}

+

+	// block until the advise is signalled

+	if (WaitForSingleObject(m_evDue, msTimeout) != WAIT_OBJECT_0) {

+	    return E_ABORT;

+	}

+    }

+}

+

+

+// return a pointer to a command that will be due for a given time.

+// Pass in a stream time here. The stream time offset will be passed

+// in via the Run method.

+// Commands remain queued until invoked or cancelled.

+// This method will not block. It will report E_ABORT if there are no

+// commands due yet.

+//

+// returns an AddRef'd object

+

+HRESULT

+CCmdQueue::GetCommandDueFor(REFERENCE_TIME rtStream, __out CDeferredCommand**ppCmd)

+{

+    CAutoLock lock(&m_Lock);

+

+    CRefTime tStream(rtStream);

+

+    // find the earliest stream and presentation time commands

+    CDeferredCommand* pStream = NULL;

+    POSITION pos = m_listStream.GetHeadPosition();

+    if (NULL != pos) {

+	pStream = m_listStream.GetValid(pos);

+    }

+    CDeferredCommand* pPresent = NULL;

+    pos = m_listPresentation.GetHeadPosition();

+    if (NULL != pos) {

+	pPresent = m_listPresentation.GetValid(pos);

+    }

+

+    // is there a presentation time that has passed already

+    if (pPresent && CheckTime(pPresent->GetTime(), FALSE)) {

+	pPresent->AddRef();

+	*ppCmd = pPresent;

+	return S_OK;

+    }

+

+    // is there a stream time command due before this stream time

+    if (pStream && (pStream->GetTime() <= tStream)) {

+	pStream->AddRef();

+	*ppCmd = pStream;

+	return S_OK;

+    }

+

+    // if we are running, we can map presentation times to

+    // stream time. In this case, is there a presentation time command

+    // that will be due before this stream time is presented?

+    if (m_bRunning && pPresent) {

+

+	// this stream time will appear at...

+	tStream += m_StreamTimeOffset;

+

+	// due before that?

+	if (pPresent->GetTime() <= tStream) {

+	    *ppCmd = pPresent;

+	    return S_OK;

+	}

+    }

+

+    // no commands due yet

+    return VFW_E_NOT_FOUND;

+}

+

diff --git a/Samples/multimedia/directshow/baseclasses/ctlutil.h b/Samples/multimedia/directshow/baseclasses/ctlutil.h
new file mode 100644
index 0000000..7e4719c
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/ctlutil.h
@@ -0,0 +1,923 @@
+//------------------------------------------------------------------------------

+// File: CtlUtil.h

+//

+// Desc: DirectShow base classes.

+//

+// Copyright (c) 1992-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+// Base classes implementing IDispatch parsing for the basic control dual

+// interfaces. Derive from these and implement just the custom method and

+// property methods. We also implement CPosPassThru that can be used by

+// renderers and transforms to pass by IMediaPosition and IMediaSeeking

+

+#ifndef __CTLUTIL__

+#define __CTLUTIL__

+

+// OLE Automation has different ideas of TRUE and FALSE

+

+#define OATRUE (-1)

+#define OAFALSE (0)

+

+

+// It's possible that we could replace this class with CreateStdDispatch

+

+class CBaseDispatch

+{

+    ITypeInfo * m_pti;

+

+public:

+

+    CBaseDispatch() : m_pti(NULL) {}

+    ~CBaseDispatch();

+

+    /* IDispatch methods */

+    STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo);

+

+    STDMETHODIMP GetTypeInfo(

+      REFIID riid,

+      UINT itinfo,

+      LCID lcid,

+      __deref_out ITypeInfo ** pptinfo);

+

+    STDMETHODIMP GetIDsOfNames(

+      REFIID riid,

+      __in_ecount(cNames) LPOLESTR * rgszNames,

+      UINT cNames,

+      LCID lcid,

+      __out_ecount(cNames) DISPID * rgdispid);

+};

+

+

+class AM_NOVTABLE CMediaControl :

+    public IMediaControl,

+    public CUnknown

+{

+    CBaseDispatch m_basedisp;

+

+public:

+

+    CMediaControl(const TCHAR *, LPUNKNOWN);

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    /* IDispatch methods */

+    STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo);

+

+    STDMETHODIMP GetTypeInfo(

+      UINT itinfo,

+      LCID lcid,

+      __deref_out ITypeInfo ** pptinfo);

+

+    STDMETHODIMP GetIDsOfNames(

+      REFIID riid,

+      __in_ecount(cNames) LPOLESTR * rgszNames,

+      UINT cNames,

+      LCID lcid,

+      __out_ecount(cNames) DISPID * rgdispid);

+

+    STDMETHODIMP Invoke(

+      DISPID dispidMember,

+      REFIID riid,

+      LCID lcid,

+      WORD wFlags,

+      __in DISPPARAMS * pdispparams,

+      __out_opt VARIANT * pvarResult,

+      __out_opt EXCEPINFO * pexcepinfo,

+      __out_opt UINT * puArgErr);

+};

+

+

+class AM_NOVTABLE CMediaEvent :

+    public IMediaEventEx,

+    public CUnknown

+{

+    CBaseDispatch m_basedisp;

+

+public:

+

+    CMediaEvent(__in_opt LPCTSTR, __in_opt LPUNKNOWN);

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    /* IDispatch methods */

+    STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo);

+

+    STDMETHODIMP GetTypeInfo(

+      UINT itinfo,

+      LCID lcid,

+      __deref_out ITypeInfo ** pptinfo);

+

+    STDMETHODIMP GetIDsOfNames(

+      REFIID riid,

+      __in_ecount(cNames) LPOLESTR * rgszNames,

+      UINT cNames,

+      LCID lcid,

+      __out_ecount(cNames) DISPID * rgdispid);

+

+    STDMETHODIMP Invoke(

+      DISPID dispidMember,

+      REFIID riid,

+      LCID lcid,

+      WORD wFlags,

+      __in DISPPARAMS * pdispparams,

+      __out_opt VARIANT * pvarResult,

+      __out_opt EXCEPINFO * pexcepinfo,

+      __out_opt UINT * puArgErr);

+};

+

+

+class AM_NOVTABLE CMediaPosition :

+    public IMediaPosition,

+    public CUnknown

+{

+    CBaseDispatch m_basedisp;

+

+

+public:

+

+    CMediaPosition(__in_opt LPCTSTR, __in_opt LPUNKNOWN);

+    CMediaPosition(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT *phr);

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    /* IDispatch methods */

+    STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo);

+

+    STDMETHODIMP GetTypeInfo(

+      UINT itinfo,

+      LCID lcid,

+      __deref_out ITypeInfo ** pptinfo);

+

+    STDMETHODIMP GetIDsOfNames(

+      REFIID riid,

+      __in_ecount(cNames) LPOLESTR * rgszNames,

+      UINT cNames,

+      LCID lcid,

+      __out_ecount(cNames) DISPID * rgdispid);

+

+    STDMETHODIMP Invoke(

+      DISPID dispidMember,

+      REFIID riid,

+      LCID lcid,

+      WORD wFlags,

+      __in DISPPARAMS * pdispparams,

+      __out_opt VARIANT * pvarResult,

+      __out_opt EXCEPINFO * pexcepinfo,

+      __out_opt UINT * puArgErr);

+

+};

+

+

+// OA-compatibility means that we must use double as the RefTime value,

+// and REFERENCE_TIME (essentially a LONGLONG) within filters.

+// this class converts between the two

+

+class COARefTime : public CRefTime {

+public:

+

+    COARefTime() {

+    };

+

+    COARefTime(CRefTime t)

+        : CRefTime(t)

+    {

+    };

+

+    COARefTime(REFERENCE_TIME t)

+        : CRefTime(t)

+    {

+    };

+

+    COARefTime(double d) {

+        m_time = (LONGLONG) (d * 10000000);

+    };

+

+    operator double() {

+        return double(m_time) / 10000000;

+    };

+

+    operator REFERENCE_TIME() {

+        return m_time;

+    };

+

+    COARefTime& operator=(const double& rd)  {

+        m_time = (LONGLONG) (rd * 10000000);

+        return *this;

+    }

+

+    COARefTime& operator=(const REFERENCE_TIME& rt)  {

+        m_time = rt;

+        return *this;

+    }

+

+    inline BOOL operator==(const COARefTime& rt)

+    {

+        return m_time == rt.m_time;

+    };

+

+    inline BOOL operator!=(const COARefTime& rt)

+    {

+        return m_time != rt.m_time;

+    };

+

+    inline BOOL operator < (const COARefTime& rt)

+    {

+        return m_time < rt.m_time;

+    };

+

+    inline BOOL operator > (const COARefTime& rt)

+    {

+        return m_time > rt.m_time;

+    };

+

+    inline BOOL operator >= (const COARefTime& rt)

+    {

+        return m_time >= rt.m_time;

+    };

+

+    inline BOOL operator <= (const COARefTime& rt)

+    {

+        return m_time <= rt.m_time;

+    };

+

+    inline COARefTime operator+(const COARefTime& rt)

+    {

+        return COARefTime(m_time + rt.m_time);

+    };

+

+    inline COARefTime operator-(const COARefTime& rt)

+    {

+        return COARefTime(m_time - rt.m_time);

+    };

+

+    inline COARefTime operator*(LONG l)

+    {

+        return COARefTime(m_time * l);

+    };

+

+    inline COARefTime operator/(LONG l)

+    {

+        return COARefTime(m_time / l);

+    };

+

+private:

+    //  Prevent bugs from constructing from LONG (which gets

+    //  converted to double and then multiplied by 10000000

+    COARefTime(LONG);

+    LONG operator=(LONG);

+};

+

+

+// A utility class that handles IMediaPosition and IMediaSeeking on behalf

+// of single-input pin renderers, or transform filters.

+//

+// Renderers will expose this from the filter; transform filters will

+// expose it from the output pin and not the renderer.

+//

+// Create one of these, giving it your IPin* for your input pin, and delegate

+// all IMediaPosition methods to it. It will query the input pin for

+// IMediaPosition and respond appropriately.

+//

+// Call ForceRefresh if the pin connection changes.

+//

+// This class no longer caches the upstream IMediaPosition or IMediaSeeking

+// it acquires it on each method call. This means ForceRefresh is not needed.

+// The method is kept for source compatibility and to minimise the changes

+// if we need to put it back later for performance reasons.

+

+class CPosPassThru : public IMediaSeeking, public CMediaPosition

+{

+    IPin *m_pPin;

+

+    HRESULT GetPeer(__deref_out IMediaPosition **ppMP);

+    HRESULT GetPeerSeeking(__deref_out IMediaSeeking **ppMS);

+

+public:

+

+    CPosPassThru(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT*, IPin *);

+    DECLARE_IUNKNOWN

+

+    HRESULT ForceRefresh() {

+        return S_OK;

+    };

+

+    // override to return an accurate current position

+    virtual HRESULT GetMediaTime(__out LONGLONG *pStartTime, __out_opt LONGLONG *pEndTime) {

+        return E_FAIL;

+    }

+

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid,__deref_out void **ppv);

+

+    // IMediaSeeking methods

+    STDMETHODIMP GetCapabilities( __out DWORD * pCapabilities );

+    STDMETHODIMP CheckCapabilities( __inout DWORD * pCapabilities );

+    STDMETHODIMP SetTimeFormat(const GUID * pFormat);

+    STDMETHODIMP GetTimeFormat(__out GUID *pFormat);

+    STDMETHODIMP IsUsingTimeFormat(const GUID * pFormat);

+    STDMETHODIMP IsFormatSupported( const GUID * pFormat);

+    STDMETHODIMP QueryPreferredFormat( __out GUID *pFormat);

+    STDMETHODIMP ConvertTimeFormat(__out LONGLONG * pTarget, 

+                                   __in_opt const GUID * pTargetFormat,

+                                   LONGLONG Source, 

+                                   __in_opt const GUID * pSourceFormat );

+    STDMETHODIMP SetPositions( __inout_opt LONGLONG * pCurrent, DWORD CurrentFlags

+                             , __inout_opt LONGLONG * pStop, DWORD StopFlags );

+

+    STDMETHODIMP GetPositions( __out_opt LONGLONG * pCurrent, __out_opt LONGLONG * pStop );

+    STDMETHODIMP GetCurrentPosition( __out LONGLONG * pCurrent );

+    STDMETHODIMP GetStopPosition( __out LONGLONG * pStop );

+    STDMETHODIMP SetRate( double dRate);

+    STDMETHODIMP GetRate( __out double * pdRate);

+    STDMETHODIMP GetDuration( __out LONGLONG *pDuration);

+    STDMETHODIMP GetAvailable( __out_opt LONGLONG *pEarliest, __out_opt LONGLONG *pLatest );

+    STDMETHODIMP GetPreroll( __out LONGLONG *pllPreroll );

+

+    // IMediaPosition properties

+    STDMETHODIMP get_Duration(__out REFTIME * plength);

+    STDMETHODIMP put_CurrentPosition(REFTIME llTime);

+    STDMETHODIMP get_StopTime(__out REFTIME * pllTime);

+    STDMETHODIMP put_StopTime(REFTIME llTime);

+    STDMETHODIMP get_PrerollTime(__out REFTIME * pllTime);

+    STDMETHODIMP put_PrerollTime(REFTIME llTime);

+    STDMETHODIMP get_Rate(__out double * pdRate);

+    STDMETHODIMP put_Rate(double dRate);

+    STDMETHODIMP get_CurrentPosition(__out REFTIME * pllTime);

+    STDMETHODIMP CanSeekForward(__out LONG *pCanSeekForward);

+    STDMETHODIMP CanSeekBackward(__out LONG *pCanSeekBackward);

+

+private:

+    HRESULT GetSeekingLongLong( HRESULT (__stdcall IMediaSeeking::*pMethod)( LONGLONG * ),

+                                __out LONGLONG * pll );

+};

+

+

+// Adds the ability to return a current position

+

+class CRendererPosPassThru : public CPosPassThru

+{

+    CCritSec m_PositionLock;    // Locks access to our position

+    LONGLONG m_StartMedia;      // Start media time last seen

+    LONGLONG m_EndMedia;        // And likewise the end media

+    BOOL m_bReset;              // Have media times been set

+

+public:

+

+    // Used to help with passing media times through graph

+

+    CRendererPosPassThru(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT*, IPin *);

+    HRESULT RegisterMediaTime(IMediaSample *pMediaSample);

+    HRESULT RegisterMediaTime(LONGLONG StartTime,LONGLONG EndTime);

+    HRESULT GetMediaTime(__out LONGLONG *pStartTime,__out_opt LONGLONG *pEndTime);

+    HRESULT ResetMediaTime();

+    HRESULT EOS();

+};

+

+STDAPI CreatePosPassThru(

+    __in_opt LPUNKNOWN pAgg,

+    BOOL bRenderer,

+    IPin *pPin,

+    __deref_out IUnknown **ppPassThru

+);

+

+// A class that handles the IDispatch part of IBasicAudio and leaves the

+// properties and methods themselves pure virtual.

+

+class AM_NOVTABLE CBasicAudio : public IBasicAudio, public CUnknown

+{

+    CBaseDispatch m_basedisp;

+

+public:

+

+    CBasicAudio(__in_opt LPCTSTR, __in_opt LPUNKNOWN);

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    /* IDispatch methods */

+    STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo);

+

+    STDMETHODIMP GetTypeInfo(

+      UINT itinfo,

+      LCID lcid,

+      __deref_out ITypeInfo ** pptinfo);

+

+    STDMETHODIMP GetIDsOfNames(

+      REFIID riid,

+      __in_ecount(cNames) LPOLESTR * rgszNames,

+      UINT cNames,

+      LCID lcid,

+      __out_ecount(cNames) DISPID * rgdispid);

+

+    STDMETHODIMP Invoke(

+      DISPID dispidMember,

+      REFIID riid,

+      LCID lcid,

+      WORD wFlags,

+      __in DISPPARAMS * pdispparams,

+      __out_opt VARIANT * pvarResult,

+      __out_opt EXCEPINFO * pexcepinfo,

+      __out_opt UINT * puArgErr);

+};

+

+

+// A class that handles the IDispatch part of IBasicVideo and leaves the

+// properties and methods themselves pure virtual.

+

+class AM_NOVTABLE CBaseBasicVideo : public IBasicVideo2, public CUnknown

+{

+    CBaseDispatch m_basedisp;

+

+public:

+

+    CBaseBasicVideo(__in_opt LPCTSTR, __in_opt LPUNKNOWN);

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    /* IDispatch methods */

+    STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo);

+

+    STDMETHODIMP GetTypeInfo(

+      UINT itinfo,

+      LCID lcid,

+      __deref_out ITypeInfo ** pptinfo);

+

+    STDMETHODIMP GetIDsOfNames(

+      REFIID riid,

+      __in_ecount(cNames) LPOLESTR * rgszNames,

+      UINT cNames,

+      LCID lcid,

+      __out_ecount(cNames) DISPID * rgdispid);

+

+    STDMETHODIMP Invoke(

+      DISPID dispidMember,

+      REFIID riid,

+      LCID lcid,

+      WORD wFlags,

+      __in DISPPARAMS * pdispparams,

+      __out_opt VARIANT * pvarResult,

+      __out_opt EXCEPINFO * pexcepinfo,

+      __out_opt UINT * puArgErr);

+

+    STDMETHODIMP GetPreferredAspectRatio(

+      __out long *plAspectX,

+      __out long *plAspectY)

+    {

+        return E_NOTIMPL;

+    }

+};

+

+

+// A class that handles the IDispatch part of IVideoWindow and leaves the

+// properties and methods themselves pure virtual.

+

+class AM_NOVTABLE CBaseVideoWindow : public IVideoWindow, public CUnknown

+{

+    CBaseDispatch m_basedisp;

+

+public:

+

+    CBaseVideoWindow(__in_opt LPCTSTR, __in_opt LPUNKNOWN);

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    /* IDispatch methods */

+    STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo);

+

+    STDMETHODIMP GetTypeInfo(

+      UINT itinfo,

+      LCID lcid,

+      __deref_out ITypeInfo ** pptinfo);

+

+    STDMETHODIMP GetIDsOfNames(

+      REFIID riid,

+      __in_ecount(cNames) LPOLESTR * rgszNames,

+      UINT cNames,

+      LCID lcid,

+      __out_ecount(cNames) DISPID * rgdispid);

+

+    STDMETHODIMP Invoke(

+      DISPID dispidMember,

+      REFIID riid,

+      LCID lcid,

+      WORD wFlags,

+      __in DISPPARAMS * pdispparams,

+      __out_opt VARIANT * pvarResult,

+      __out_opt EXCEPINFO * pexcepinfo,

+      __out_opt UINT * puArgErr);

+};

+

+

+// abstract class to help source filters with their implementation

+// of IMediaPosition. Derive from this and set the duration (and stop

+// position). Also override NotifyChange to do something when the properties

+// change.

+

+class AM_NOVTABLE CSourcePosition : public CMediaPosition

+{

+

+public:

+    CSourcePosition(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT*, __in CCritSec *);

+

+    // IMediaPosition methods

+    STDMETHODIMP get_Duration(__out REFTIME * plength);

+    STDMETHODIMP put_CurrentPosition(REFTIME llTime);

+    STDMETHODIMP get_StopTime(__out REFTIME * pllTime);

+    STDMETHODIMP put_StopTime(REFTIME llTime);

+    STDMETHODIMP get_PrerollTime(__out REFTIME * pllTime);

+    STDMETHODIMP put_PrerollTime(REFTIME llTime);

+    STDMETHODIMP get_Rate(__out double * pdRate);

+    STDMETHODIMP put_Rate(double dRate);

+    STDMETHODIMP CanSeekForward(__out LONG *pCanSeekForward);

+    STDMETHODIMP CanSeekBackward(__out LONG *pCanSeekBackward);

+

+    // override if you can return the data you are actually working on

+    STDMETHODIMP get_CurrentPosition(__out REFTIME * pllTime) {

+        return E_NOTIMPL;

+    };

+

+protected:

+

+    // we call this to notify changes. Override to handle them

+    virtual HRESULT ChangeStart() PURE;

+    virtual HRESULT ChangeStop() PURE;

+    virtual HRESULT ChangeRate() PURE;

+

+    COARefTime m_Duration;

+    COARefTime m_Start;

+    COARefTime m_Stop;

+    double m_Rate;

+

+    CCritSec * m_pLock;

+};

+

+class AM_NOVTABLE CSourceSeeking :

+    public IMediaSeeking,

+    public CUnknown

+{

+

+public:

+

+    DECLARE_IUNKNOWN;

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);

+

+    // IMediaSeeking methods

+

+    STDMETHODIMP IsFormatSupported(const GUID * pFormat);

+    STDMETHODIMP QueryPreferredFormat(__out GUID *pFormat);

+    STDMETHODIMP SetTimeFormat(const GUID * pFormat);

+    STDMETHODIMP IsUsingTimeFormat(const GUID * pFormat);

+    STDMETHODIMP GetTimeFormat(__out GUID *pFormat);

+    STDMETHODIMP GetDuration(__out LONGLONG *pDuration);

+    STDMETHODIMP GetStopPosition(__out LONGLONG *pStop);

+    STDMETHODIMP GetCurrentPosition(__out LONGLONG *pCurrent);

+    STDMETHODIMP GetCapabilities( __out DWORD * pCapabilities );

+    STDMETHODIMP CheckCapabilities( __inout DWORD * pCapabilities );

+    STDMETHODIMP ConvertTimeFormat( __out LONGLONG * pTarget, 

+                                    __in_opt const GUID * pTargetFormat,

+                                    LONGLONG Source, 

+                                    __in_opt const GUID * pSourceFormat );

+

+    STDMETHODIMP SetPositions( __inout_opt LONGLONG * pCurrent,  DWORD CurrentFlags

+			     , __inout_opt LONGLONG * pStop,  DWORD StopFlags );

+

+    STDMETHODIMP GetPositions( __out_opt LONGLONG * pCurrent, __out_opt LONGLONG * pStop );

+

+    STDMETHODIMP GetAvailable( __out_opt LONGLONG * pEarliest, __out_opt LONGLONG * pLatest );

+    STDMETHODIMP SetRate( double dRate);

+    STDMETHODIMP GetRate( __out double * pdRate);

+    STDMETHODIMP GetPreroll(__out LONGLONG *pPreroll);

+

+

+protected:

+

+    // ctor

+    CSourceSeeking(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT*, __in CCritSec *);

+

+    // we call this to notify changes. Override to handle them

+    virtual HRESULT ChangeStart() PURE;

+    virtual HRESULT ChangeStop() PURE;

+    virtual HRESULT ChangeRate() PURE;

+

+    CRefTime m_rtDuration;      // length of stream

+    CRefTime m_rtStart;         // source will start here

+    CRefTime m_rtStop;          // source will stop here

+    double m_dRateSeeking;

+

+    // seeking capabilities

+    DWORD m_dwSeekingCaps;

+

+    CCritSec * m_pLock;

+};

+

+

+// Base classes supporting Deferred commands.

+

+// Deferred commands are queued by calls to methods on the IQueueCommand

+// interface, exposed by the filtergraph and by some filters. A successful

+// call to one of these methods will return an IDeferredCommand interface

+// representing the queued command.

+//

+// A CDeferredCommand object represents a single deferred command, and exposes

+// the IDeferredCommand interface as well as other methods permitting time

+// checks and actual execution. It contains a reference to the CCommandQueue

+// object on which it is queued.

+//

+// CCommandQueue is a base class providing a queue of CDeferredCommand

+// objects, and methods to add, remove, check status and invoke the queued

+// commands. A CCommandQueue object would be part of an object that

+// implemented IQueueCommand.

+

+class CCmdQueue;

+

+// take a copy of the params and store them. Release any allocated

+// memory in destructor

+

+class CDispParams : public DISPPARAMS

+{

+public:

+    CDispParams(UINT nArgs, __in_ecount(nArgs) VARIANT* pArgs, __inout_opt HRESULT *phr = NULL);

+    ~CDispParams();

+};

+

+

+// CDeferredCommand lifetime is controlled by refcounts. Caller of

+// InvokeAt.. gets a refcounted interface pointer, and the CCmdQueue

+// object also holds a refcount on us. Calling Cancel or Invoke takes

+// us off the CCmdQueue and thus reduces the refcount by 1. Once taken

+// off the queue we cannot be put back on the queue.

+

+class CDeferredCommand

+    : public CUnknown,

+      public IDeferredCommand

+{

+public:

+

+    CDeferredCommand(

+        __inout CCmdQueue * pQ,

+        __in_opt LPUNKNOWN   pUnk,               // aggregation outer unk

+        __inout HRESULT *   phr,

+        __in LPUNKNOWN   pUnkExecutor,       // object that will execute this cmd

+        REFTIME     time,

+        __in GUID*       iid,

+        long        dispidMethod,

+        short       wFlags,

+        long        cArgs,

+        __in_ecount(cArgs) VARIANT*    pDispParams,

+        __out VARIANT*    pvarResult,

+        __out short*      puArgErr,

+        BOOL        bStream

+        );

+

+    DECLARE_IUNKNOWN

+

+    // override this to publicise our interfaces

+    STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __out void **ppv);

+

+    // IDeferredCommand methods

+    STDMETHODIMP Cancel();

+    STDMETHODIMP Confidence(

+                    __out LONG* pConfidence);

+    STDMETHODIMP Postpone(

+                    REFTIME newtime);

+    STDMETHODIMP GetHResult(

+                    __out HRESULT* phrResult);

+

+    // other public methods

+

+    HRESULT Invoke();

+

+    // access methods

+

+    // returns TRUE if streamtime, FALSE if presentation time

+    BOOL IsStreamTime() {

+       return m_bStream;

+    };

+

+    CRefTime GetTime() {

+        return m_time;

+    };

+

+    REFIID GetIID() {

+        return *m_iid;

+    };

+

+    long GetMethod() {

+        return m_dispidMethod;

+    };

+

+    short GetFlags() {

+        return m_wFlags;

+    };

+

+    DISPPARAMS* GetParams() {

+        return &m_DispParams;

+    };

+

+    VARIANT* GetResult() {

+        return m_pvarResult;

+    };

+

+protected:

+

+    CCmdQueue* m_pQueue;

+

+    // pUnk for the interface that we will execute the command on

+    LPUNKNOWN   m_pUnk;

+

+    // stored command data

+    REFERENCE_TIME     m_time;

+    GUID*       m_iid;

+    long        m_dispidMethod;

+    short       m_wFlags;

+    VARIANT*    m_pvarResult;

+    BOOL        m_bStream;

+    CDispParams m_DispParams;

+    DISPID      m_DispId;         //  For get and put

+

+    // we use this for ITypeInfo access

+    CBaseDispatch   m_Dispatch;

+

+    // save retval here

+    HRESULT     m_hrResult;

+};

+

+

+// a list of CDeferredCommand objects. this is a base class providing

+// the basics of access to the list. If you want to use CDeferredCommand

+// objects then your queue needs to be derived from this class.

+

+class AM_NOVTABLE CCmdQueue

+{

+public:

+    CCmdQueue(__inout_opt HRESULT *phr = NULL);

+    virtual ~CCmdQueue();

+

+    // returns a new CDeferredCommand object that will be initialised with

+    // the parameters and will be added to the queue during construction.

+    // returns S_OK if successfully created otherwise an error and

+    // no object has been queued.

+    virtual HRESULT  New(

+        __out CDeferredCommand **ppCmd,

+        __in LPUNKNOWN   pUnk,

+        REFTIME     time,

+        __in GUID*       iid,

+        long        dispidMethod,

+        short       wFlags,

+        long        cArgs,

+        __in_ecount(cArgs) VARIANT*    pDispParams,

+        __out VARIANT*    pvarResult,

+        __out short*      puArgErr,

+        BOOL        bStream

+    );

+

+    // called by the CDeferredCommand object to add and remove itself

+    // from the queue

+    virtual HRESULT Insert(__in CDeferredCommand* pCmd);

+    virtual HRESULT Remove(__in CDeferredCommand* pCmd);

+

+    // Command-Due Checking

+    //

+    // There are two schemes of synchronisation: coarse and accurate. In

+    // coarse mode, you wait till the time arrives and then execute the cmd.

+    // In accurate mode, you wait until you are processing the sample that

+    // will appear at the time, and then execute the command. It's up to the

+    // filter which one it will implement. The filtergraph will always

+    // implement coarse mode for commands queued at the filtergraph.

+    //

+    // If you want coarse sync, you probably want to wait until there is a

+    // command due, and then execute it. You can do this by calling

+    // GetDueCommand. If you have several things to wait for, get the

+    // event handle from GetDueHandle() and when this is signalled then call

+    // GetDueCommand. Stream time will only advance between calls to Run and

+    // EndRun. Note that to avoid an extra thread there is no guarantee that

+    // if the handle is set there will be a command ready. Each time the

+    // event is signalled, call GetDueCommand (probably with a 0 timeout);

+    // This may return E_ABORT.

+    //

+    // If you want accurate sync, you must call GetCommandDueFor, passing

+    // as a parameter the stream time of the samples you are about to process.

+    // This will return:

+    //   -- a stream-time command due at or before that stream time

+    //   -- a presentation-time command due at or before the

+    //      time that stream time will be presented (only between Run

+    //      and EndRun calls, since outside of this, the mapping from

+    //      stream time to presentation time is not known.

+    //   -- any presentation-time command due now.

+    // This means that if you want accurate synchronisation on samples that

+    // might be processed during Paused mode, you need to use

+    // stream-time commands.

+    //

+    // In all cases, commands remain queued until Invoked or Cancelled. The

+    // setting and resetting of the event handle is managed entirely by this

+    // queue object.

+

+    // set the clock used for timing

+    virtual HRESULT SetSyncSource(__in_opt IReferenceClock*);

+

+    // switch to run mode. Streamtime to Presentation time mapping known.

+    virtual HRESULT Run(REFERENCE_TIME tStreamTimeOffset);

+

+    // switch to Stopped or Paused mode. Time mapping not known.

+    virtual HRESULT EndRun();

+

+    // return a pointer to the next due command. Blocks for msTimeout

+    // milliseconds until there is a due command.

+    // Stream-time commands will only become due between Run and Endrun calls.

+    // The command remains queued until invoked or cancelled.

+    // Returns E_ABORT if timeout occurs, otherwise S_OK (or other error).

+    // Returns an AddRef-ed object

+    virtual HRESULT GetDueCommand(__out CDeferredCommand ** ppCmd, long msTimeout);

+

+    // return the event handle that will be signalled whenever

+    // there are deferred commands due for execution (when GetDueCommand

+    // will not block).

+    HANDLE GetDueHandle() {

+        return HANDLE(m_evDue);

+    };

+

+    // return a pointer to a command that will be due for a given time.

+    // Pass in a stream time here. The stream time offset will be passed

+    // in via the Run method.

+    // Commands remain queued until invoked or cancelled.

+    // This method will not block. It will report VFW_E_NOT_FOUND if there

+    // are no commands due yet.

+    // Returns an AddRef-ed object

+    virtual HRESULT GetCommandDueFor(REFERENCE_TIME tStream, __out CDeferredCommand**ppCmd);

+

+    // check if a given time is due (TRUE if it is due yet)

+    BOOL CheckTime(CRefTime time, BOOL bStream) {

+

+        // if no clock, nothing is due!

+        if (!m_pClock) {

+            return FALSE;

+        }

+

+        // stream time

+        if (bStream) {

+

+            // not valid if not running

+            if (!m_bRunning) {

+                return FALSE;

+            }

+            // add on known stream time offset to get presentation time

+            time += m_StreamTimeOffset;

+        }

+

+        CRefTime Now;

+        m_pClock->GetTime((REFERENCE_TIME*)&Now);

+        return (time <= Now);

+    };

+

+protected:

+

+    // protect access to lists etc

+    CCritSec m_Lock;

+

+    // commands queued in presentation time are stored here

+    CGenericList<CDeferredCommand> m_listPresentation;

+

+    // commands queued in stream time are stored here

+    CGenericList<CDeferredCommand> m_listStream;

+

+    // set when any commands are due

+    CAMEvent m_evDue;

+

+    // creates an advise for the earliest time required, if any

+    void SetTimeAdvise(void);

+

+    // advise id from reference clock (0 if no outstanding advise)

+    DWORD_PTR m_dwAdvise;

+

+    // advise time is for this presentation time

+    CRefTime m_tCurrentAdvise;

+

+    // the reference clock we are using (addrefed)

+    IReferenceClock* m_pClock;

+

+    // true when running

+    BOOL m_bRunning;

+

+    // contains stream time offset when m_bRunning is true

+    CRefTime m_StreamTimeOffset;

+};

+

+#endif // __CTLUTIL__

diff --git a/Samples/multimedia/directshow/baseclasses/ddmm.cpp b/Samples/multimedia/directshow/baseclasses/ddmm.cpp
new file mode 100644
index 0000000..bfa700c
--- /dev/null
+++ b/Samples/multimedia/directshow/baseclasses/ddmm.cpp
@@ -0,0 +1,129 @@
+//------------------------------------------------------------------------------

+// File: DDMM.cpp

+//

+// Desc: DirectShow base classes - implements routines for using DirectDraw

+//       on a multimonitor system.

+//

+// Copyright (c) 1995-2001 Microsoft Corporation.  All rights reserved.

+//------------------------------------------------------------------------------

+

+

+#include <streams.h>

+#include <ddraw.h>

+#include "ddmm.h"

+

+/*

+ * FindDeviceCallback

+ */

+typedef struct {

+	LPSTR   szDevice;

+	GUID*   lpGUID;

+	GUID    GUID;

+	BOOL    fFound;

+}   FindDeviceData;

+

+BOOL CALLBACK FindDeviceCallback(__in_opt GUID* lpGUID, __in LPSTR szName, __in LPSTR szDevice, __in LPVOID lParam)

+{

+	FindDeviceData *p = (FindDeviceData*)lParam;

+

+	if (lstrcmpiA(p->szDevice, szDevice) == 0) {

+	    if (lpGUID) {

+		p->GUID = *lpGUID;

+		p->lpGUID = &p->GUID;

+	    } else {

+		p->lpGUID = NULL;

+	    }

+	    p->fFound = TRUE;

+	    return FALSE;

+	}

+	return TRUE;

+}

+

+

+BOOL CALLBACK FindDeviceCallbackEx(__in_opt GUID* lpGUID, __in LPSTR szName, __in LPSTR szDevice, __in LPVOID lParam, HMONITOR hMonitor)

+{

+	FindDeviceData *p = (FindDeviceData*)lParam;

+

+	if (lstrcmpiA(p->szDevice, szDevice) == 0) {

+	    if (lpGUID) {

+		p->GUID = *lpGUID;

+		p->lpGUID = &p->GUID;

+	    } else {

+		p->lpGUID = NULL;

+