| // Copyright 2012 the V8 project authors. All rights reserved. |
| // Use of this source code is governed by a BSD-style license that can be |
| // found in the LICENSE file. |
| |
| /** \mainpage V8 API Reference Guide |
| * |
| * V8 is Google's open source JavaScript engine. |
| * |
| * This set of documents provides reference material generated from the |
| * V8 header file, include/v8.h. |
| * |
| * For other documentation see http://code.google.com/apis/v8/ |
| */ |
| |
| #ifndef INCLUDE_V8_H_ |
| #define INCLUDE_V8_H_ |
| |
| #include <stddef.h> |
| #include <stdint.h> |
| #include <stdio.h> |
| #include <memory> |
| #include <utility> |
| #include <vector> |
| |
| #include "v8-version.h" // NOLINT(build/include) |
| #include "v8config.h" // NOLINT(build/include) |
| |
| // We reserve the V8_* prefix for macros defined in V8 public API and |
| // assume there are no name conflicts with the embedder's code. |
| |
| #ifdef V8_OS_WIN |
| |
| // Setup for Windows DLL export/import. When building the V8 DLL the |
| // BUILDING_V8_SHARED needs to be defined. When building a program which uses |
| // the V8 DLL USING_V8_SHARED needs to be defined. When either building the V8 |
| // static library or building a program which uses the V8 static library neither |
| // BUILDING_V8_SHARED nor USING_V8_SHARED should be defined. |
| #ifdef BUILDING_V8_SHARED |
| # define V8_EXPORT __declspec(dllexport) |
| #elif USING_V8_SHARED |
| # define V8_EXPORT __declspec(dllimport) |
| #else |
| # define V8_EXPORT |
| #endif // BUILDING_V8_SHARED |
| |
| #else // V8_OS_WIN |
| |
| // Setup for Linux shared library export. |
| #if V8_HAS_ATTRIBUTE_VISIBILITY |
| # ifdef BUILDING_V8_SHARED |
| # define V8_EXPORT __attribute__ ((visibility("default"))) |
| # else |
| # define V8_EXPORT |
| # endif |
| #else |
| # define V8_EXPORT |
| #endif |
| |
| #endif // V8_OS_WIN |
| |
| /** |
| * The v8 JavaScript engine. |
| */ |
| namespace v8 { |
| |
| class AccessorSignature; |
| class Array; |
| class ArrayBuffer; |
| class BigInt; |
| class BigIntObject; |
| class Boolean; |
| class BooleanObject; |
| class Context; |
| class Data; |
| class Date; |
| class External; |
| class Function; |
| class FunctionTemplate; |
| class HeapProfiler; |
| class ImplementationUtilities; |
| class Int32; |
| class Integer; |
| class Isolate; |
| template <class T> |
| class Maybe; |
| class Name; |
| class Number; |
| class NumberObject; |
| class Object; |
| class ObjectOperationDescriptor; |
| class ObjectTemplate; |
| class Platform; |
| class Primitive; |
| class Promise; |
| class PropertyDescriptor; |
| class Proxy; |
| class RawOperationDescriptor; |
| class Script; |
| class SharedArrayBuffer; |
| class Signature; |
| class StartupData; |
| class StackFrame; |
| class StackTrace; |
| class String; |
| class StringObject; |
| class Symbol; |
| class SymbolObject; |
| class PrimitiveArray; |
| class Private; |
| class Uint32; |
| class Utils; |
| class Value; |
| class WasmCompiledModule; |
| template <class T> class Local; |
| template <class T> |
| class MaybeLocal; |
| template <class T> class Eternal; |
| template<class T> class NonCopyablePersistentTraits; |
| template<class T> class PersistentBase; |
| template <class T, class M = NonCopyablePersistentTraits<T> > |
| class Persistent; |
| template <class T> |
| class Global; |
| template<class K, class V, class T> class PersistentValueMap; |
| template <class K, class V, class T> |
| class PersistentValueMapBase; |
| template <class K, class V, class T> |
| class GlobalValueMap; |
| template<class V, class T> class PersistentValueVector; |
| template<class T, class P> class WeakCallbackObject; |
| class FunctionTemplate; |
| class ObjectTemplate; |
| template<typename T> class FunctionCallbackInfo; |
| template<typename T> class PropertyCallbackInfo; |
| class StackTrace; |
| class StackFrame; |
| class Isolate; |
| class CallHandlerHelper; |
| class EscapableHandleScope; |
| template<typename T> class ReturnValue; |
| |
| namespace internal { |
| class Arguments; |
| class DeferredHandles; |
| class Heap; |
| class HeapObject; |
| class Isolate; |
| class LocalEmbedderHeapTracer; |
| class NeverReadOnlySpaceObject; |
| class Object; |
| struct ScriptStreamingData; |
| template<typename T> class CustomArguments; |
| class PropertyCallbackArguments; |
| class FunctionCallbackArguments; |
| class GlobalHandles; |
| |
| namespace wasm { |
| class NativeModule; |
| class StreamingDecoder; |
| } // namespace wasm |
| |
| /** |
| * Configuration of tagging scheme. |
| */ |
| const int kApiPointerSize = sizeof(void*); // NOLINT |
| const int kApiDoubleSize = sizeof(double); // NOLINT |
| const int kApiIntSize = sizeof(int); // NOLINT |
| const int kApiInt64Size = sizeof(int64_t); // NOLINT |
| |
| // Tag information for HeapObject. |
| const int kHeapObjectTag = 1; |
| const int kWeakHeapObjectTag = 3; |
| const int kHeapObjectTagSize = 2; |
| const intptr_t kHeapObjectTagMask = (1 << kHeapObjectTagSize) - 1; |
| |
| // Tag information for Smi. |
| const int kSmiTag = 0; |
| const int kSmiTagSize = 1; |
| const intptr_t kSmiTagMask = (1 << kSmiTagSize) - 1; |
| |
| template <size_t tagged_ptr_size> |
| struct SmiTagging; |
| |
| template <int kSmiShiftSize> |
| V8_INLINE internal::Object* IntToSmi(int value) { |
| int smi_shift_bits = kSmiTagSize + kSmiShiftSize; |
| intptr_t tagged_value = |
| (static_cast<intptr_t>(value) << smi_shift_bits) | kSmiTag; |
| return reinterpret_cast<internal::Object*>(tagged_value); |
| } |
| |
| // Smi constants for systems where tagged pointer is a 32-bit value. |
| template <> |
| struct SmiTagging<4> { |
| enum { kSmiShiftSize = 0, kSmiValueSize = 31 }; |
| static int SmiShiftSize() { return kSmiShiftSize; } |
| static int SmiValueSize() { return kSmiValueSize; } |
| V8_INLINE static int SmiToInt(const internal::Object* value) { |
| int shift_bits = kSmiTagSize + kSmiShiftSize; |
| // Throw away top 32 bits and shift down (requires >> to be sign extending). |
| return static_cast<int>(reinterpret_cast<intptr_t>(value)) >> shift_bits; |
| } |
| V8_INLINE static internal::Object* IntToSmi(int value) { |
| return internal::IntToSmi<kSmiShiftSize>(value); |
| } |
| V8_INLINE static constexpr bool IsValidSmi(intptr_t value) { |
| // To be representable as an tagged small integer, the two |
| // most-significant bits of 'value' must be either 00 or 11 due to |
| // sign-extension. To check this we add 01 to the two |
| // most-significant bits, and check if the most-significant bit is 0 |
| // |
| // CAUTION: The original code below: |
| // bool result = ((value + 0x40000000) & 0x80000000) == 0; |
| // may lead to incorrect results according to the C language spec, and |
| // in fact doesn't work correctly with gcc4.1.1 in some cases: The |
| // compiler may produce undefined results in case of signed integer |
| // overflow. The computation must be done w/ unsigned ints. |
| return static_cast<uintptr_t>(value) + 0x40000000U < 0x80000000U; |
| } |
| }; |
| |
| // Smi constants for systems where tagged pointer is a 64-bit value. |
| template <> |
| struct SmiTagging<8> { |
| enum { kSmiShiftSize = 31, kSmiValueSize = 32 }; |
| static int SmiShiftSize() { return kSmiShiftSize; } |
| static int SmiValueSize() { return kSmiValueSize; } |
| V8_INLINE static int SmiToInt(const internal::Object* value) { |
| int shift_bits = kSmiTagSize + kSmiShiftSize; |
| // Shift down and throw away top 32 bits. |
| return static_cast<int>(reinterpret_cast<intptr_t>(value) >> shift_bits); |
| } |
| V8_INLINE static internal::Object* IntToSmi(int value) { |
| return internal::IntToSmi<kSmiShiftSize>(value); |
| } |
| V8_INLINE static constexpr bool IsValidSmi(intptr_t value) { |
| // To be representable as a long smi, the value must be a 32-bit integer. |
| return (value == static_cast<int32_t>(value)); |
| } |
| }; |
| |
| #if V8_COMPRESS_POINTERS |
| static_assert( |
| kApiPointerSize == kApiInt64Size, |
| "Pointer compression can be enabled only for 64-bit architectures"); |
| typedef SmiTagging<4> PlatformSmiTagging; |
| #else |
| typedef SmiTagging<kApiPointerSize> PlatformSmiTagging; |
| #endif |
| |
| const int kSmiShiftSize = PlatformSmiTagging::kSmiShiftSize; |
| const int kSmiValueSize = PlatformSmiTagging::kSmiValueSize; |
| const int kSmiMinValue = (static_cast<unsigned int>(-1)) << (kSmiValueSize - 1); |
| const int kSmiMaxValue = -(kSmiMinValue + 1); |
| constexpr bool SmiValuesAre31Bits() { return kSmiValueSize == 31; } |
| constexpr bool SmiValuesAre32Bits() { return kSmiValueSize == 32; } |
| |
| } // namespace internal |
| |
| namespace debug { |
| class ConsoleCallArguments; |
| } // namespace debug |
| |
| // --- Handles --- |
| |
| #define TYPE_CHECK(T, S) \ |
| while (false) { \ |
| *(static_cast<T* volatile*>(0)) = static_cast<S*>(0); \ |
| } |
| |
| /** |
| * An object reference managed by the v8 garbage collector. |
| * |
| * All objects returned from v8 have to be tracked by the garbage |
| * collector so that it knows that the objects are still alive. Also, |
| * because the garbage collector may move objects, it is unsafe to |
| * point directly to an object. Instead, all objects are stored in |
| * handles which are known by the garbage collector and updated |
| * whenever an object moves. Handles should always be passed by value |
| * (except in cases like out-parameters) and they should never be |
| * allocated on the heap. |
| * |
| * There are two types of handles: local and persistent handles. |
| * |
| * Local handles are light-weight and transient and typically used in |
| * local operations. They are managed by HandleScopes. That means that a |
| * HandleScope must exist on the stack when they are created and that they are |
| * only valid inside of the HandleScope active during their creation. |
| * For passing a local handle to an outer HandleScope, an EscapableHandleScope |
| * and its Escape() method must be used. |
| * |
| * Persistent handles can be used when storing objects across several |
| * independent operations and have to be explicitly deallocated when they're no |
| * longer used. |
| * |
| * It is safe to extract the object stored in the handle by |
| * dereferencing the handle (for instance, to extract the Object* from |
| * a Local<Object>); the value will still be governed by a handle |
| * behind the scenes and the same rules apply to these values as to |
| * their handles. |
| */ |
| template <class T> |
| class Local { |
| public: |
| V8_INLINE Local() : val_(0) {} |
| template <class S> |
| V8_INLINE Local(Local<S> that) |
| : val_(reinterpret_cast<T*>(*that)) { |
| /** |
| * This check fails when trying to convert between incompatible |
| * handles. For example, converting from a Local<String> to a |
| * Local<Number>. |
| */ |
| TYPE_CHECK(T, S); |
| } |
| |
| /** |
| * Returns true if the handle is empty. |
| */ |
| V8_INLINE bool IsEmpty() const { return val_ == 0; } |
| |
| /** |
| * Sets the handle to be empty. IsEmpty() will then return true. |
| */ |
| V8_INLINE void Clear() { val_ = 0; } |
| |
| V8_INLINE T* operator->() const { return val_; } |
| |
| V8_INLINE T* operator*() const { return val_; } |
| |
| /** |
| * Checks whether two handles are the same. |
| * Returns true if both are empty, or if the objects |
| * to which they refer are identical. |
| * The handles' references are not checked. |
| */ |
| template <class S> |
| V8_INLINE bool operator==(const Local<S>& that) const { |
| internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); |
| internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); |
| if (a == 0) return b == 0; |
| if (b == 0) return false; |
| return *a == *b; |
| } |
| |
| template <class S> V8_INLINE bool operator==( |
| const PersistentBase<S>& that) const { |
| internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); |
| internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); |
| if (a == 0) return b == 0; |
| if (b == 0) return false; |
| return *a == *b; |
| } |
| |
| /** |
| * Checks whether two handles are different. |
| * Returns true if only one of the handles is empty, or if |
| * the objects to which they refer are different. |
| * The handles' references are not checked. |
| */ |
| template <class S> |
| V8_INLINE bool operator!=(const Local<S>& that) const { |
| return !operator==(that); |
| } |
| |
| template <class S> V8_INLINE bool operator!=( |
| const Persistent<S>& that) const { |
| return !operator==(that); |
| } |
| |
| /** |
| * Cast a handle to a subclass, e.g. Local<Value> to Local<Object>. |
| * This is only valid if the handle actually refers to a value of the |
| * target type. |
| */ |
| template <class S> V8_INLINE static Local<T> Cast(Local<S> that) { |
| #ifdef V8_ENABLE_CHECKS |
| // If we're going to perform the type check then we have to check |
| // that the handle isn't empty before doing the checked cast. |
| if (that.IsEmpty()) return Local<T>(); |
| #endif |
| return Local<T>(T::Cast(*that)); |
| } |
| |
| /** |
| * Calling this is equivalent to Local<S>::Cast(). |
| * In particular, this is only valid if the handle actually refers to a value |
| * of the target type. |
| */ |
| template <class S> |
| V8_INLINE Local<S> As() const { |
| return Local<S>::Cast(*this); |
| } |
| |
| /** |
| * Create a local handle for the content of another handle. |
| * The referee is kept alive by the local handle even when |
| * the original handle is destroyed/disposed. |
| */ |
| V8_INLINE static Local<T> New(Isolate* isolate, Local<T> that); |
| V8_INLINE static Local<T> New(Isolate* isolate, |
| const PersistentBase<T>& that); |
| |
| private: |
| friend class Utils; |
| template<class F> friend class Eternal; |
| template<class F> friend class PersistentBase; |
| template<class F, class M> friend class Persistent; |
| template<class F> friend class Local; |
| template <class F> |
| friend class MaybeLocal; |
| template<class F> friend class FunctionCallbackInfo; |
| template<class F> friend class PropertyCallbackInfo; |
| friend class String; |
| friend class Object; |
| friend class Context; |
| friend class Isolate; |
| friend class Private; |
| template<class F> friend class internal::CustomArguments; |
| friend Local<Primitive> Undefined(Isolate* isolate); |
| friend Local<Primitive> Null(Isolate* isolate); |
| friend Local<Boolean> True(Isolate* isolate); |
| friend Local<Boolean> False(Isolate* isolate); |
| friend class HandleScope; |
| friend class EscapableHandleScope; |
| template <class F1, class F2, class F3> |
| friend class PersistentValueMapBase; |
| template<class F1, class F2> friend class PersistentValueVector; |
| template <class F> |
| friend class ReturnValue; |
| |
| explicit V8_INLINE Local(T* that) : val_(that) {} |
| V8_INLINE static Local<T> New(Isolate* isolate, T* that); |
| T* val_; |
| }; |
| |
| |
| #if !defined(V8_IMMINENT_DEPRECATION_WARNINGS) |
| // Handle is an alias for Local for historical reasons. |
| template <class T> |
| using Handle = Local<T>; |
| #endif |
| |
| |
| /** |
| * A MaybeLocal<> is a wrapper around Local<> that enforces a check whether |
| * the Local<> is empty before it can be used. |
| * |
| * If an API method returns a MaybeLocal<>, the API method can potentially fail |
| * either because an exception is thrown, or because an exception is pending, |
| * e.g. because a previous API call threw an exception that hasn't been caught |
| * yet, or because a TerminateExecution exception was thrown. In that case, an |
| * empty MaybeLocal is returned. |
| */ |
| template <class T> |
| class MaybeLocal { |
| public: |
| V8_INLINE MaybeLocal() : val_(nullptr) {} |
| template <class S> |
| V8_INLINE MaybeLocal(Local<S> that) |
| : val_(reinterpret_cast<T*>(*that)) { |
| TYPE_CHECK(T, S); |
| } |
| |
| V8_INLINE bool IsEmpty() const { return val_ == nullptr; } |
| |
| /** |
| * Converts this MaybeLocal<> to a Local<>. If this MaybeLocal<> is empty, |
| * |false| is returned and |out| is left untouched. |
| */ |
| template <class S> |
| V8_WARN_UNUSED_RESULT V8_INLINE bool ToLocal(Local<S>* out) const { |
| out->val_ = IsEmpty() ? nullptr : this->val_; |
| return !IsEmpty(); |
| } |
| |
| /** |
| * Converts this MaybeLocal<> to a Local<>. If this MaybeLocal<> is empty, |
| * V8 will crash the process. |
| */ |
| V8_INLINE Local<T> ToLocalChecked(); |
| |
| /** |
| * Converts this MaybeLocal<> to a Local<>, using a default value if this |
| * MaybeLocal<> is empty. |
| */ |
| template <class S> |
| V8_INLINE Local<S> FromMaybe(Local<S> default_value) const { |
| return IsEmpty() ? default_value : Local<S>(val_); |
| } |
| |
| private: |
| T* val_; |
| }; |
| |
| /** |
| * Eternal handles are set-once handles that live for the lifetime of the |
| * isolate. |
| */ |
| template <class T> class Eternal { |
| public: |
| V8_INLINE Eternal() : val_(nullptr) {} |
| template <class S> |
| V8_INLINE Eternal(Isolate* isolate, Local<S> handle) : val_(nullptr) { |
| Set(isolate, handle); |
| } |
| // Can only be safely called if already set. |
| V8_INLINE Local<T> Get(Isolate* isolate) const; |
| V8_INLINE bool IsEmpty() const { return val_ == nullptr; } |
| template<class S> V8_INLINE void Set(Isolate* isolate, Local<S> handle); |
| |
| private: |
| T* val_; |
| }; |
| |
| |
| static const int kInternalFieldsInWeakCallback = 2; |
| static const int kEmbedderFieldsInWeakCallback = 2; |
| |
| template <typename T> |
| class WeakCallbackInfo { |
| public: |
| typedef void (*Callback)(const WeakCallbackInfo<T>& data); |
| |
| WeakCallbackInfo(Isolate* isolate, T* parameter, |
| void* embedder_fields[kEmbedderFieldsInWeakCallback], |
| Callback* callback) |
| : isolate_(isolate), parameter_(parameter), callback_(callback) { |
| for (int i = 0; i < kEmbedderFieldsInWeakCallback; ++i) { |
| embedder_fields_[i] = embedder_fields[i]; |
| } |
| } |
| |
| V8_INLINE Isolate* GetIsolate() const { return isolate_; } |
| V8_INLINE T* GetParameter() const { return parameter_; } |
| V8_INLINE void* GetInternalField(int index) const; |
| |
| // When first called, the embedder MUST Reset() the Global which triggered the |
| // callback. The Global itself is unusable for anything else. No v8 other api |
| // calls may be called in the first callback. Should additional work be |
| // required, the embedder must set a second pass callback, which will be |
| // called after all the initial callbacks are processed. |
| // Calling SetSecondPassCallback on the second pass will immediately crash. |
| void SetSecondPassCallback(Callback callback) const { *callback_ = callback; } |
| |
| private: |
| Isolate* isolate_; |
| T* parameter_; |
| Callback* callback_; |
| void* embedder_fields_[kEmbedderFieldsInWeakCallback]; |
| }; |
| |
| |
| // kParameter will pass a void* parameter back to the callback, kInternalFields |
| // will pass the first two internal fields back to the callback, kFinalizer |
| // will pass a void* parameter back, but is invoked before the object is |
| // actually collected, so it can be resurrected. In the last case, it is not |
| // possible to request a second pass callback. |
| enum class WeakCallbackType { kParameter, kInternalFields, kFinalizer }; |
| |
| /** |
| * An object reference that is independent of any handle scope. Where |
| * a Local handle only lives as long as the HandleScope in which it was |
| * allocated, a PersistentBase handle remains valid until it is explicitly |
| * disposed using Reset(). |
| * |
| * A persistent handle contains a reference to a storage cell within |
| * the V8 engine which holds an object value and which is updated by |
| * the garbage collector whenever the object is moved. A new storage |
| * cell can be created using the constructor or PersistentBase::Reset and |
| * existing handles can be disposed using PersistentBase::Reset. |
| * |
| */ |
| template <class T> class PersistentBase { |
| public: |
| /** |
| * If non-empty, destroy the underlying storage cell |
| * IsEmpty() will return true after this call. |
| */ |
| V8_INLINE void Reset(); |
| /** |
| * If non-empty, destroy the underlying storage cell |
| * and create a new one with the contents of other if other is non empty |
| */ |
| template <class S> |
| V8_INLINE void Reset(Isolate* isolate, const Local<S>& other); |
| |
| /** |
| * If non-empty, destroy the underlying storage cell |
| * and create a new one with the contents of other if other is non empty |
| */ |
| template <class S> |
| V8_INLINE void Reset(Isolate* isolate, const PersistentBase<S>& other); |
| |
| V8_INLINE bool IsEmpty() const { return val_ == NULL; } |
| V8_INLINE void Empty() { val_ = 0; } |
| |
| V8_INLINE Local<T> Get(Isolate* isolate) const { |
| return Local<T>::New(isolate, *this); |
| } |
| |
| template <class S> |
| V8_INLINE bool operator==(const PersistentBase<S>& that) const { |
| internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); |
| internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); |
| if (a == NULL) return b == NULL; |
| if (b == NULL) return false; |
| return *a == *b; |
| } |
| |
| template <class S> |
| V8_INLINE bool operator==(const Local<S>& that) const { |
| internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); |
| internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); |
| if (a == NULL) return b == NULL; |
| if (b == NULL) return false; |
| return *a == *b; |
| } |
| |
| template <class S> |
| V8_INLINE bool operator!=(const PersistentBase<S>& that) const { |
| return !operator==(that); |
| } |
| |
| template <class S> |
| V8_INLINE bool operator!=(const Local<S>& that) const { |
| return !operator==(that); |
| } |
| |
| /** |
| * Install a finalization callback on this object. |
| * NOTE: There is no guarantee as to *when* or even *if* the callback is |
| * invoked. The invocation is performed solely on a best effort basis. |
| * As always, GC-based finalization should *not* be relied upon for any |
| * critical form of resource management! |
| */ |
| template <typename P> |
| V8_INLINE void SetWeak(P* parameter, |
| typename WeakCallbackInfo<P>::Callback callback, |
| WeakCallbackType type); |
| |
| /** |
| * Turns this handle into a weak phantom handle without finalization callback. |
| * The handle will be reset automatically when the garbage collector detects |
| * that the object is no longer reachable. |
| * A related function Isolate::NumberOfPhantomHandleResetsSinceLastCall |
| * returns how many phantom handles were reset by the garbage collector. |
| */ |
| V8_INLINE void SetWeak(); |
| |
| template<typename P> |
| V8_INLINE P* ClearWeak(); |
| |
| // TODO(dcarney): remove this. |
| V8_INLINE void ClearWeak() { ClearWeak<void>(); } |
| |
| /** |
| * Annotates the strong handle with the given label, which is then used by the |
| * heap snapshot generator as a name of the edge from the root to the handle. |
| * The function does not take ownership of the label and assumes that the |
| * label is valid as long as the handle is valid. |
| */ |
| V8_INLINE void AnnotateStrongRetainer(const char* label); |
| |
| /** |
| * Allows the embedder to tell the v8 garbage collector that a certain object |
| * is alive. Only allowed when the embedder is asked to trace its heap by |
| * EmbedderHeapTracer. |
| */ |
| V8_INLINE void RegisterExternalReference(Isolate* isolate) const; |
| |
| /** |
| * Marks the reference to this object independent. Garbage collector is free |
| * to ignore any object groups containing this object. Weak callback for an |
| * independent handle should not assume that it will be preceded by a global |
| * GC prologue callback or followed by a global GC epilogue callback. |
| */ |
| V8_DEPRECATE_SOON( |
| "Objects are always considered independent. " |
| "Use MarkActive to avoid collecting otherwise dead weak handles.", |
| V8_INLINE void MarkIndependent()); |
| |
| /** |
| * Marks the reference to this object as active. The scavenge garbage |
| * collection should not reclaim the objects marked as active, even if the |
| * object held by the handle is otherwise unreachable. |
| * |
| * This bit is cleared after the each garbage collection pass. |
| */ |
| V8_INLINE void MarkActive(); |
| |
| V8_DEPRECATE_SOON("See MarkIndependent.", |
| V8_INLINE bool IsIndependent() const); |
| |
| /** Checks if the handle holds the only reference to an object. */ |
| V8_INLINE bool IsNearDeath() const; |
| |
| /** Returns true if the handle's reference is weak. */ |
| V8_INLINE bool IsWeak() const; |
| |
| /** |
| * Assigns a wrapper class ID to the handle. See RetainedObjectInfo interface |
| * description in v8-profiler.h for details. |
| */ |
| V8_INLINE void SetWrapperClassId(uint16_t class_id); |
| |
| /** |
| * Returns the class ID previously assigned to this handle or 0 if no class ID |
| * was previously assigned. |
| */ |
| V8_INLINE uint16_t WrapperClassId() const; |
| |
| PersistentBase(const PersistentBase& other) = delete; // NOLINT |
| void operator=(const PersistentBase&) = delete; |
| |
| private: |
| friend class Isolate; |
| friend class Utils; |
| template<class F> friend class Local; |
| template<class F1, class F2> friend class Persistent; |
| template <class F> |
| friend class Global; |
| template<class F> friend class PersistentBase; |
| template<class F> friend class ReturnValue; |
| template <class F1, class F2, class F3> |
| friend class PersistentValueMapBase; |
| template<class F1, class F2> friend class PersistentValueVector; |
| friend class Object; |
| |
| explicit V8_INLINE PersistentBase(T* val) : val_(val) {} |
| V8_INLINE static T* New(Isolate* isolate, T* that); |
| |
| T* val_; |
| }; |
| |
| |
| /** |
| * Default traits for Persistent. This class does not allow |
| * use of the copy constructor or assignment operator. |
| * At present kResetInDestructor is not set, but that will change in a future |
| * version. |
| */ |
| template<class T> |
| class NonCopyablePersistentTraits { |
| public: |
| typedef Persistent<T, NonCopyablePersistentTraits<T> > NonCopyablePersistent; |
| static const bool kResetInDestructor = false; |
| template<class S, class M> |
| V8_INLINE static void Copy(const Persistent<S, M>& source, |
| NonCopyablePersistent* dest) { |
| Uncompilable<Object>(); |
| } |
| // TODO(dcarney): come up with a good compile error here. |
| template<class O> V8_INLINE static void Uncompilable() { |
| TYPE_CHECK(O, Primitive); |
| } |
| }; |
| |
| |
| /** |
| * Helper class traits to allow copying and assignment of Persistent. |
| * This will clone the contents of storage cell, but not any of the flags, etc. |
| */ |
| template<class T> |
| struct CopyablePersistentTraits { |
| typedef Persistent<T, CopyablePersistentTraits<T> > CopyablePersistent; |
| static const bool kResetInDestructor = true; |
| template<class S, class M> |
| static V8_INLINE void Copy(const Persistent<S, M>& source, |
| CopyablePersistent* dest) { |
| // do nothing, just allow copy |
| } |
| }; |
| |
| |
| /** |
| * A PersistentBase which allows copy and assignment. |
| * |
| * Copy, assignment and destructor behavior is controlled by the traits |
| * class M. |
| * |
| * Note: Persistent class hierarchy is subject to future changes. |
| */ |
| template <class T, class M> class Persistent : public PersistentBase<T> { |
| public: |
| /** |
| * A Persistent with no storage cell. |
| */ |
| V8_INLINE Persistent() : PersistentBase<T>(0) { } |
| /** |
| * Construct a Persistent from a Local. |
| * When the Local is non-empty, a new storage cell is created |
| * pointing to the same object, and no flags are set. |
| */ |
| template <class S> |
| V8_INLINE Persistent(Isolate* isolate, Local<S> that) |
| : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { |
| TYPE_CHECK(T, S); |
| } |
| /** |
| * Construct a Persistent from a Persistent. |
| * When the Persistent is non-empty, a new storage cell is created |
| * pointing to the same object, and no flags are set. |
| */ |
| template <class S, class M2> |
| V8_INLINE Persistent(Isolate* isolate, const Persistent<S, M2>& that) |
| : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { |
| TYPE_CHECK(T, S); |
| } |
| /** |
| * The copy constructors and assignment operator create a Persistent |
| * exactly as the Persistent constructor, but the Copy function from the |
| * traits class is called, allowing the setting of flags based on the |
| * copied Persistent. |
| */ |
| V8_INLINE Persistent(const Persistent& that) : PersistentBase<T>(0) { |
| Copy(that); |
| } |
| template <class S, class M2> |
| V8_INLINE Persistent(const Persistent<S, M2>& that) : PersistentBase<T>(0) { |
| Copy(that); |
| } |
| V8_INLINE Persistent& operator=(const Persistent& that) { // NOLINT |
| Copy(that); |
| return *this; |
| } |
| template <class S, class M2> |
| V8_INLINE Persistent& operator=(const Persistent<S, M2>& that) { // NOLINT |
| Copy(that); |
| return *this; |
| } |
| /** |
| * The destructor will dispose the Persistent based on the |
| * kResetInDestructor flags in the traits class. Since not calling dispose |
| * can result in a memory leak, it is recommended to always set this flag. |
| */ |
| V8_INLINE ~Persistent() { |
| if (M::kResetInDestructor) this->Reset(); |
| } |
| |
| // TODO(dcarney): this is pretty useless, fix or remove |
| template <class S> |
| V8_INLINE static Persistent<T>& Cast(const Persistent<S>& that) { // NOLINT |
| #ifdef V8_ENABLE_CHECKS |
| // If we're going to perform the type check then we have to check |
| // that the handle isn't empty before doing the checked cast. |
| if (!that.IsEmpty()) T::Cast(*that); |
| #endif |
| return reinterpret_cast<Persistent<T>&>(const_cast<Persistent<S>&>(that)); |
| } |
| |
| // TODO(dcarney): this is pretty useless, fix or remove |
| template <class S> |
| V8_INLINE Persistent<S>& As() const { // NOLINT |
| return Persistent<S>::Cast(*this); |
| } |
| |
| private: |
| friend class Isolate; |
| friend class Utils; |
| template<class F> friend class Local; |
| template<class F1, class F2> friend class Persistent; |
| template<class F> friend class ReturnValue; |
| |
| explicit V8_INLINE Persistent(T* that) : PersistentBase<T>(that) {} |
| V8_INLINE T* operator*() const { return this->val_; } |
| template<class S, class M2> |
| V8_INLINE void Copy(const Persistent<S, M2>& that); |
| }; |
| |
| |
| /** |
| * A PersistentBase which has move semantics. |
| * |
| * Note: Persistent class hierarchy is subject to future changes. |
| */ |
| template <class T> |
| class Global : public PersistentBase<T> { |
| public: |
| /** |
| * A Global with no storage cell. |
| */ |
| V8_INLINE Global() : PersistentBase<T>(nullptr) {} |
| /** |
| * Construct a Global from a Local. |
| * When the Local is non-empty, a new storage cell is created |
| * pointing to the same object, and no flags are set. |
| */ |
| template <class S> |
| V8_INLINE Global(Isolate* isolate, Local<S> that) |
| : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { |
| TYPE_CHECK(T, S); |
| } |
| /** |
| * Construct a Global from a PersistentBase. |
| * When the Persistent is non-empty, a new storage cell is created |
| * pointing to the same object, and no flags are set. |
| */ |
| template <class S> |
| V8_INLINE Global(Isolate* isolate, const PersistentBase<S>& that) |
| : PersistentBase<T>(PersistentBase<T>::New(isolate, that.val_)) { |
| TYPE_CHECK(T, S); |
| } |
| /** |
| * Move constructor. |
| */ |
| V8_INLINE Global(Global&& other) : PersistentBase<T>(other.val_) { // NOLINT |
| other.val_ = nullptr; |
| } |
| V8_INLINE ~Global() { this->Reset(); } |
| /** |
| * Move via assignment. |
| */ |
| template <class S> |
| V8_INLINE Global& operator=(Global<S>&& rhs) { // NOLINT |
| TYPE_CHECK(T, S); |
| if (this != &rhs) { |
| this->Reset(); |
| this->val_ = rhs.val_; |
| rhs.val_ = nullptr; |
| } |
| return *this; |
| } |
| /** |
| * Pass allows returning uniques from functions, etc. |
| */ |
| Global Pass() { return static_cast<Global&&>(*this); } // NOLINT |
| |
| /* |
| * For compatibility with Chromium's base::Bind (base::Passed). |
| */ |
| typedef void MoveOnlyTypeForCPP03; |
| |
| Global(const Global&) = delete; |
| void operator=(const Global&) = delete; |
| |
| private: |
| template <class F> |
| friend class ReturnValue; |
| V8_INLINE T* operator*() const { return this->val_; } |
| }; |
| |
| |
| // UniquePersistent is an alias for Global for historical reason. |
| template <class T> |
| using UniquePersistent = Global<T>; |
| |
| |
| /** |
| * A stack-allocated class that governs a number of local handles. |
| * After a handle scope has been created, all local handles will be |
| * allocated within that handle scope until either the handle scope is |
| * deleted or another handle scope is created. If there is already a |
| * handle scope and a new one is created, all allocations will take |
| * place in the new handle scope until it is deleted. After that, |
| * new handles will again be allocated in the original handle scope. |
| * |
| * After the handle scope of a local handle has been deleted the |
| * garbage collector will no longer track the object stored in the |
| * handle and may deallocate it. The behavior of accessing a handle |
| * for which the handle scope has been deleted is undefined. |
| */ |
| class V8_EXPORT HandleScope { |
| public: |
| explicit HandleScope(Isolate* isolate); |
| |
| ~HandleScope(); |
| |
| /** |
| * Counts the number of allocated handles. |
| */ |
| static int NumberOfHandles(Isolate* isolate); |
| |
| V8_INLINE Isolate* GetIsolate() const { |
| return reinterpret_cast<Isolate*>(isolate_); |
| } |
| |
| HandleScope(const HandleScope&) = delete; |
| void operator=(const HandleScope&) = delete; |
| |
| protected: |
| V8_INLINE HandleScope() {} |
| |
| void Initialize(Isolate* isolate); |
| |
| static internal::Object** CreateHandle(internal::Isolate* isolate, |
| internal::Object* value); |
| |
| private: |
| // Declaring operator new and delete as deleted is not spec compliant. |
| // Therefore declare them private instead to disable dynamic alloc |
| void* operator new(size_t size); |
| void* operator new[](size_t size); |
| void operator delete(void*, size_t); |
| void operator delete[](void*, size_t); |
| |
| // Uses heap_object to obtain the current Isolate. |
| static internal::Object** CreateHandle( |
| internal::NeverReadOnlySpaceObject* heap_object, internal::Object* value); |
| |
| internal::Isolate* isolate_; |
| internal::Object** prev_next_; |
| internal::Object** prev_limit_; |
| |
| // Local::New uses CreateHandle with an Isolate* parameter. |
| template<class F> friend class Local; |
| |
| // Object::GetInternalField and Context::GetEmbedderData use CreateHandle with |
| // a HeapObject* in their shortcuts. |
| friend class Object; |
| friend class Context; |
| }; |
| |
| |
| /** |
| * A HandleScope which first allocates a handle in the current scope |
| * which will be later filled with the escape value. |
| */ |
| class V8_EXPORT EscapableHandleScope : public HandleScope { |
| public: |
| explicit EscapableHandleScope(Isolate* isolate); |
| V8_INLINE ~EscapableHandleScope() {} |
| |
| /** |
| * Pushes the value into the previous scope and returns a handle to it. |
| * Cannot be called twice. |
| */ |
| template <class T> |
| V8_INLINE Local<T> Escape(Local<T> value) { |
| internal::Object** slot = |
| Escape(reinterpret_cast<internal::Object**>(*value)); |
| return Local<T>(reinterpret_cast<T*>(slot)); |
| } |
| |
| template <class T> |
| V8_INLINE MaybeLocal<T> EscapeMaybe(MaybeLocal<T> value) { |
| return Escape(value.FromMaybe(Local<T>())); |
| } |
| |
| EscapableHandleScope(const EscapableHandleScope&) = delete; |
| void operator=(const EscapableHandleScope&) = delete; |
| |
| private: |
| // Declaring operator new and delete as deleted is not spec compliant. |
| // Therefore declare them private instead to disable dynamic alloc |
| void* operator new(size_t size); |
| void* operator new[](size_t size); |
| void operator delete(void*, size_t); |
| void operator delete[](void*, size_t); |
| |
| internal::Object** Escape(internal::Object** escape_value); |
| internal::Object** escape_slot_; |
| }; |
| |
| /** |
| * A SealHandleScope acts like a handle scope in which no handle allocations |
| * are allowed. It can be useful for debugging handle leaks. |
| * Handles can be allocated within inner normal HandleScopes. |
| */ |
| class V8_EXPORT SealHandleScope { |
| public: |
| explicit SealHandleScope(Isolate* isolate); |
| ~SealHandleScope(); |
| |
| SealHandleScope(const SealHandleScope&) = delete; |
| void operator=(const SealHandleScope&) = delete; |
| |
| private: |
| // Declaring operator new and delete as deleted is not spec compliant. |
| // Therefore declare them private instead to disable dynamic alloc |
| void* operator new(size_t size); |
| void* operator new[](size_t size); |
| void operator delete(void*, size_t); |
| void operator delete[](void*, size_t); |
| |
| internal::Isolate* const isolate_; |
| internal::Object** prev_limit_; |
| int prev_sealed_level_; |
| }; |
| |
| |
| // --- Special objects --- |
| |
| |
| /** |
| * The superclass of values and API object templates. |
| */ |
| class V8_EXPORT Data { |
| private: |
| Data(); |
| }; |
| |
| /** |
| * A container type that holds relevant metadata for module loading. |
| * |
| * This is passed back to the embedder as part of |
| * HostImportModuleDynamicallyCallback for module loading. |
| */ |
| class V8_EXPORT ScriptOrModule { |
| public: |
| /** |
| * The name that was passed by the embedder as ResourceName to the |
| * ScriptOrigin. This can be either a v8::String or v8::Undefined. |
| */ |
| Local<Value> GetResourceName(); |
| |
| /** |
| * The options that were passed by the embedder as HostDefinedOptions to |
| * the ScriptOrigin. |
| */ |
| Local<PrimitiveArray> GetHostDefinedOptions(); |
| }; |
| |
| /** |
| * An array to hold Primitive values. This is used by the embedder to |
| * pass host defined options to the ScriptOptions during compilation. |
| * |
| * This is passed back to the embedder as part of |
| * HostImportModuleDynamicallyCallback for module loading. |
| * |
| */ |
| class V8_EXPORT PrimitiveArray { |
| public: |
| static Local<PrimitiveArray> New(Isolate* isolate, int length); |
| int Length() const; |
| void Set(Isolate* isolate, int index, Local<Primitive> item); |
| Local<Primitive> Get(Isolate* isolate, int index); |
| }; |
| |
| /** |
| * The optional attributes of ScriptOrigin. |
| */ |
| class ScriptOriginOptions { |
| public: |
| V8_INLINE ScriptOriginOptions(bool is_shared_cross_origin = false, |
| bool is_opaque = false, bool is_wasm = false, |
| bool is_module = false) |
| : flags_((is_shared_cross_origin ? kIsSharedCrossOrigin : 0) | |
| (is_wasm ? kIsWasm : 0) | (is_opaque ? kIsOpaque : 0) | |
| (is_module ? kIsModule : 0)) {} |
| V8_INLINE ScriptOriginOptions(int flags) |
| : flags_(flags & |
| (kIsSharedCrossOrigin | kIsOpaque | kIsWasm | kIsModule)) {} |
| |
| bool IsSharedCrossOrigin() const { |
| return (flags_ & kIsSharedCrossOrigin) != 0; |
| } |
| bool IsOpaque() const { return (flags_ & kIsOpaque) != 0; } |
| bool IsWasm() const { return (flags_ & kIsWasm) != 0; } |
| bool IsModule() const { return (flags_ & kIsModule) != 0; } |
| |
| int Flags() const { return flags_; } |
| |
| private: |
| enum { |
| kIsSharedCrossOrigin = 1, |
| kIsOpaque = 1 << 1, |
| kIsWasm = 1 << 2, |
| kIsModule = 1 << 3 |
| }; |
| const int flags_; |
| }; |
| |
| /** |
| * The origin, within a file, of a script. |
| */ |
| class ScriptOrigin { |
| public: |
| V8_INLINE ScriptOrigin( |
| Local<Value> resource_name, |
| Local<Integer> resource_line_offset = Local<Integer>(), |
| Local<Integer> resource_column_offset = Local<Integer>(), |
| Local<Boolean> resource_is_shared_cross_origin = Local<Boolean>(), |
| Local<Integer> script_id = Local<Integer>(), |
| Local<Value> source_map_url = Local<Value>(), |
| Local<Boolean> resource_is_opaque = Local<Boolean>(), |
| Local<Boolean> is_wasm = Local<Boolean>(), |
| Local<Boolean> is_module = Local<Boolean>(), |
| Local<PrimitiveArray> host_defined_options = Local<PrimitiveArray>()); |
| |
| V8_INLINE Local<Value> ResourceName() const; |
| V8_INLINE Local<Integer> ResourceLineOffset() const; |
| V8_INLINE Local<Integer> ResourceColumnOffset() const; |
| V8_INLINE Local<Integer> ScriptID() const; |
| V8_INLINE Local<Value> SourceMapUrl() const; |
| V8_INLINE Local<PrimitiveArray> HostDefinedOptions() const; |
| V8_INLINE ScriptOriginOptions Options() const { return options_; } |
| |
| private: |
| Local<Value> resource_name_; |
| Local<Integer> resource_line_offset_; |
| Local<Integer> resource_column_offset_; |
| ScriptOriginOptions options_; |
| Local<Integer> script_id_; |
| Local<Value> source_map_url_; |
| Local<PrimitiveArray> host_defined_options_; |
| }; |
| |
| /** |
| * A compiled JavaScript script, not yet tied to a Context. |
| */ |
| class V8_EXPORT UnboundScript { |
| public: |
| /** |
| * Binds the script to the currently entered context. |
| */ |
| Local<Script> BindToCurrentContext(); |
| |
| int GetId(); |
| Local<Value> GetScriptName(); |
| |
| /** |
| * Data read from magic sourceURL comments. |
| */ |
| Local<Value> GetSourceURL(); |
| /** |
| * Data read from magic sourceMappingURL comments. |
| */ |
| Local<Value> GetSourceMappingURL(); |
| |
| /** |
| * Returns zero based line number of the code_pos location in the script. |
| * -1 will be returned if no information available. |
| */ |
| int GetLineNumber(int code_pos); |
| |
| static const int kNoScriptId = 0; |
| }; |
| |
| /** |
| * A compiled JavaScript module, not yet tied to a Context. |
| */ |
| class V8_EXPORT UnboundModuleScript { |
| // Only used as a container for code caching. |
| }; |
| |
| /** |
| * A location in JavaScript source. |
| */ |
| class V8_EXPORT Location { |
| public: |
| int GetLineNumber() { return line_number_; } |
| int GetColumnNumber() { return column_number_; } |
| |
| Location(int line_number, int column_number) |
| : line_number_(line_number), column_number_(column_number) {} |
| |
| private: |
| int line_number_; |
| int column_number_; |
| }; |
| |
| /** |
| * A compiled JavaScript module. |
| */ |
| class V8_EXPORT Module { |
| public: |
| /** |
| * The different states a module can be in. |
| * |
| * This corresponds to the states used in ECMAScript except that "evaluated" |
| * is split into kEvaluated and kErrored, indicating success and failure, |
| * respectively. |
| */ |
| enum Status { |
| kUninstantiated, |
| kInstantiating, |
| kInstantiated, |
| kEvaluating, |
| kEvaluated, |
| kErrored |
| }; |
| |
| /** |
| * Returns the module's current status. |
| */ |
| Status GetStatus() const; |
| |
| /** |
| * For a module in kErrored status, this returns the corresponding exception. |
| */ |
| Local<Value> GetException() const; |
| |
| /** |
| * Returns the number of modules requested by this module. |
| */ |
| int GetModuleRequestsLength() const; |
| |
| /** |
| * Returns the ith module specifier in this module. |
| * i must be < GetModuleRequestsLength() and >= 0. |
| */ |
| Local<String> GetModuleRequest(int i) const; |
| |
| /** |
| * Returns the source location (line number and column number) of the ith |
| * module specifier's first occurrence in this module. |
| */ |
| Location GetModuleRequestLocation(int i) const; |
| |
| /** |
| * Returns the identity hash for this object. |
| */ |
| int GetIdentityHash() const; |
| |
| typedef MaybeLocal<Module> (*ResolveCallback)(Local<Context> context, |
| Local<String> specifier, |
| Local<Module> referrer); |
| |
| /** |
| * Instantiates the module and its dependencies. |
| * |
| * Returns an empty Maybe<bool> if an exception occurred during |
| * instantiation. (In the case where the callback throws an exception, that |
| * exception is propagated.) |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> InstantiateModule(Local<Context> context, |
| ResolveCallback callback); |
| |
| /** |
| * Evaluates the module and its dependencies. |
| * |
| * If status is kInstantiated, run the module's code. On success, set status |
| * to kEvaluated and return the completion value; on failure, set status to |
| * kErrored and propagate the thrown exception (which is then also available |
| * via |GetException|). |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Evaluate(Local<Context> context); |
| |
| /** |
| * Returns the namespace object of this module. |
| * |
| * The module's status must be at least kInstantiated. |
| */ |
| Local<Value> GetModuleNamespace(); |
| |
| /** |
| * Returns the corresponding context-unbound module script. |
| * |
| * The module must be unevaluated, i.e. its status must not be kEvaluating, |
| * kEvaluated or kErrored. |
| */ |
| Local<UnboundModuleScript> GetUnboundModuleScript(); |
| }; |
| |
| /** |
| * A compiled JavaScript script, tied to a Context which was active when the |
| * script was compiled. |
| */ |
| class V8_EXPORT Script { |
| public: |
| /** |
| * A shorthand for ScriptCompiler::Compile(). |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( |
| Local<Context> context, Local<String> source, |
| ScriptOrigin* origin = nullptr); |
| |
| /** |
| * Runs the script returning the resulting value. It will be run in the |
| * context in which it was created (ScriptCompiler::CompileBound or |
| * UnboundScript::BindToCurrentContext()). |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context); |
| |
| /** |
| * Returns the corresponding context-unbound script. |
| */ |
| Local<UnboundScript> GetUnboundScript(); |
| }; |
| |
| |
| /** |
| * For compiling scripts. |
| */ |
| class V8_EXPORT ScriptCompiler { |
| public: |
| /** |
| * Compilation data that the embedder can cache and pass back to speed up |
| * future compilations. The data is produced if the CompilerOptions passed to |
| * the compilation functions in ScriptCompiler contains produce_data_to_cache |
| * = true. The data to cache can then can be retrieved from |
| * UnboundScript. |
| */ |
| struct V8_EXPORT CachedData { |
| enum BufferPolicy { |
| BufferNotOwned, |
| BufferOwned |
| }; |
| |
| CachedData() |
| : data(NULL), |
| length(0), |
| rejected(false), |
| buffer_policy(BufferNotOwned) {} |
| |
| // If buffer_policy is BufferNotOwned, the caller keeps the ownership of |
| // data and guarantees that it stays alive until the CachedData object is |
| // destroyed. If the policy is BufferOwned, the given data will be deleted |
| // (with delete[]) when the CachedData object is destroyed. |
| CachedData(const uint8_t* data, int length, |
| BufferPolicy buffer_policy = BufferNotOwned); |
| ~CachedData(); |
| // TODO(marja): Async compilation; add constructors which take a callback |
| // which will be called when V8 no longer needs the data. |
| const uint8_t* data; |
| int length; |
| bool rejected; |
| BufferPolicy buffer_policy; |
| |
| // Prevent copying. |
| CachedData(const CachedData&) = delete; |
| CachedData& operator=(const CachedData&) = delete; |
| }; |
| |
| /** |
| * Source code which can be then compiled to a UnboundScript or Script. |
| */ |
| class Source { |
| public: |
| // Source takes ownership of CachedData. |
| V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin, |
| CachedData* cached_data = NULL); |
| V8_INLINE Source(Local<String> source_string, |
| CachedData* cached_data = NULL); |
| V8_INLINE ~Source(); |
| |
| // Ownership of the CachedData or its buffers is *not* transferred to the |
| // caller. The CachedData object is alive as long as the Source object is |
| // alive. |
| V8_INLINE const CachedData* GetCachedData() const; |
| |
| V8_INLINE const ScriptOriginOptions& GetResourceOptions() const; |
| |
| // Prevent copying. |
| Source(const Source&) = delete; |
| Source& operator=(const Source&) = delete; |
| |
| private: |
| friend class ScriptCompiler; |
| |
| Local<String> source_string; |
| |
| // Origin information |
| Local<Value> resource_name; |
| Local<Integer> resource_line_offset; |
| Local<Integer> resource_column_offset; |
| ScriptOriginOptions resource_options; |
| Local<Value> source_map_url; |
| Local<PrimitiveArray> host_defined_options; |
| |
| // Cached data from previous compilation (if a kConsume*Cache flag is |
| // set), or hold newly generated cache data (kProduce*Cache flags) are |
| // set when calling a compile method. |
| CachedData* cached_data; |
| }; |
| |
| /** |
| * For streaming incomplete script data to V8. The embedder should implement a |
| * subclass of this class. |
| */ |
| class V8_EXPORT ExternalSourceStream { |
| public: |
| virtual ~ExternalSourceStream() {} |
| |
| /** |
| * V8 calls this to request the next chunk of data from the embedder. This |
| * function will be called on a background thread, so it's OK to block and |
| * wait for the data, if the embedder doesn't have data yet. Returns the |
| * length of the data returned. When the data ends, GetMoreData should |
| * return 0. Caller takes ownership of the data. |
| * |
| * When streaming UTF-8 data, V8 handles multi-byte characters split between |
| * two data chunks, but doesn't handle multi-byte characters split between |
| * more than two data chunks. The embedder can avoid this problem by always |
| * returning at least 2 bytes of data. |
| * |
| * When streaming UTF-16 data, V8 does not handle characters split between |
| * two data chunks. The embedder has to make sure that chunks have an even |
| * length. |
| * |
| * If the embedder wants to cancel the streaming, they should make the next |
| * GetMoreData call return 0. V8 will interpret it as end of data (and most |
| * probably, parsing will fail). The streaming task will return as soon as |
| * V8 has parsed the data it received so far. |
| */ |
| virtual size_t GetMoreData(const uint8_t** src) = 0; |
| |
| /** |
| * V8 calls this method to set a 'bookmark' at the current position in |
| * the source stream, for the purpose of (maybe) later calling |
| * ResetToBookmark. If ResetToBookmark is called later, then subsequent |
| * calls to GetMoreData should return the same data as they did when |
| * SetBookmark was called earlier. |
| * |
| * The embedder may return 'false' to indicate it cannot provide this |
| * functionality. |
| */ |
| virtual bool SetBookmark(); |
| |
| /** |
| * V8 calls this to return to a previously set bookmark. |
| */ |
| virtual void ResetToBookmark(); |
| }; |
| |
| |
| /** |
| * Source code which can be streamed into V8 in pieces. It will be parsed |
| * while streaming. It can be compiled after the streaming is complete. |
| * StreamedSource must be kept alive while the streaming task is ran (see |
| * ScriptStreamingTask below). |
| */ |
| class V8_EXPORT StreamedSource { |
| public: |
| enum Encoding { ONE_BYTE, TWO_BYTE, UTF8 }; |
| |
| StreamedSource(ExternalSourceStream* source_stream, Encoding encoding); |
| ~StreamedSource(); |
| |
| // Ownership of the CachedData or its buffers is *not* transferred to the |
| // caller. The CachedData object is alive as long as the StreamedSource |
| // object is alive. |
| const CachedData* GetCachedData() const; |
| |
| internal::ScriptStreamingData* impl() const { return impl_; } |
| |
| // Prevent copying. |
| StreamedSource(const StreamedSource&) = delete; |
| StreamedSource& operator=(const StreamedSource&) = delete; |
| |
| private: |
| internal::ScriptStreamingData* impl_; |
| }; |
| |
| /** |
| * A streaming task which the embedder must run on a background thread to |
| * stream scripts into V8. Returned by ScriptCompiler::StartStreamingScript. |
| */ |
| class ScriptStreamingTask { |
| public: |
| virtual ~ScriptStreamingTask() {} |
| virtual void Run() = 0; |
| }; |
| |
| enum CompileOptions { |
| kNoCompileOptions = 0, |
| kProduceParserCache, |
| kConsumeParserCache, |
| kProduceCodeCache, |
| kProduceFullCodeCache, |
| kConsumeCodeCache, |
| kEagerCompile |
| }; |
| |
| /** |
| * The reason for which we are not requesting or providing a code cache. |
| */ |
| enum NoCacheReason { |
| kNoCacheNoReason = 0, |
| kNoCacheBecauseCachingDisabled, |
| kNoCacheBecauseNoResource, |
| kNoCacheBecauseInlineScript, |
| kNoCacheBecauseModule, |
| kNoCacheBecauseStreamingSource, |
| kNoCacheBecauseInspector, |
| kNoCacheBecauseScriptTooSmall, |
| kNoCacheBecauseCacheTooCold, |
| kNoCacheBecauseV8Extension, |
| kNoCacheBecauseExtensionModule, |
| kNoCacheBecausePacScript, |
| kNoCacheBecauseInDocumentWrite, |
| kNoCacheBecauseResourceWithNoCacheHandler, |
| kNoCacheBecauseDeferredProduceCodeCache |
| }; |
| |
| /** |
| * Compiles the specified script (context-independent). |
| * Cached data as part of the source object can be optionally produced to be |
| * consumed later to speed up compilation of identical source scripts. |
| * |
| * Note that when producing cached data, the source must point to NULL for |
| * cached data. When consuming cached data, the cached data must have been |
| * produced by the same version of V8. |
| * |
| * \param source Script source code. |
| * \return Compiled script object (context independent; for running it must be |
| * bound to a context). |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundScript( |
| Isolate* isolate, Source* source, |
| CompileOptions options = kNoCompileOptions, |
| NoCacheReason no_cache_reason = kNoCacheNoReason); |
| |
| /** |
| * Compiles the specified script (bound to current context). |
| * |
| * \param source Script source code. |
| * \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile() |
| * using pre_data speeds compilation if it's done multiple times. |
| * Owned by caller, no references are kept when this function returns. |
| * \return Compiled script object, bound to the context that was active |
| * when this function was called. When run it will always use this |
| * context. |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( |
| Local<Context> context, Source* source, |
| CompileOptions options = kNoCompileOptions, |
| NoCacheReason no_cache_reason = kNoCacheNoReason); |
| |
| /** |
| * Returns a task which streams script data into V8, or NULL if the script |
| * cannot be streamed. The user is responsible for running the task on a |
| * background thread and deleting it. When ran, the task starts parsing the |
| * script, and it will request data from the StreamedSource as needed. When |
| * ScriptStreamingTask::Run exits, all data has been streamed and the script |
| * can be compiled (see Compile below). |
| * |
| * This API allows to start the streaming with as little data as possible, and |
| * the remaining data (for example, the ScriptOrigin) is passed to Compile. |
| */ |
| static ScriptStreamingTask* StartStreamingScript( |
| Isolate* isolate, StreamedSource* source, |
| CompileOptions options = kNoCompileOptions); |
| |
| /** |
| * Compiles a streamed script (bound to current context). |
| * |
| * This can only be called after the streaming has finished |
| * (ScriptStreamingTask has been run). V8 doesn't construct the source string |
| * during streaming, so the embedder needs to pass the full source here. |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( |
| Local<Context> context, StreamedSource* source, |
| Local<String> full_source_string, const ScriptOrigin& origin); |
| |
| /** |
| * Return a version tag for CachedData for the current V8 version & flags. |
| * |
| * This value is meant only for determining whether a previously generated |
| * CachedData instance is still valid; the tag has no other meaing. |
| * |
| * Background: The data carried by CachedData may depend on the exact |
| * V8 version number or current compiler flags. This means that when |
| * persisting CachedData, the embedder must take care to not pass in |
| * data from another V8 version, or the same version with different |
| * features enabled. |
| * |
| * The easiest way to do so is to clear the embedder's cache on any |
| * such change. |
| * |
| * Alternatively, this tag can be stored alongside the cached data and |
| * compared when it is being used. |
| */ |
| static uint32_t CachedDataVersionTag(); |
| |
| /** |
| * Compile an ES module, returning a Module that encapsulates |
| * the compiled code. |
| * |
| * Corresponds to the ParseModule abstract operation in the |
| * ECMAScript specification. |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Module> CompileModule( |
| Isolate* isolate, Source* source, |
| CompileOptions options = kNoCompileOptions, |
| NoCacheReason no_cache_reason = kNoCacheNoReason); |
| |
| /** |
| * Compile a function for a given context. This is equivalent to running |
| * |
| * with (obj) { |
| * return function(args) { ... } |
| * } |
| * |
| * It is possible to specify multiple context extensions (obj in the above |
| * example). |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInContext( |
| Local<Context> context, Source* source, size_t arguments_count, |
| Local<String> arguments[], size_t context_extension_count, |
| Local<Object> context_extensions[], |
| CompileOptions options = kNoCompileOptions, |
| NoCacheReason no_cache_reason = kNoCacheNoReason); |
| |
| /** |
| * Creates and returns code cache for the specified unbound_script. |
| * This will return nullptr if the script cannot be serialized. The |
| * CachedData returned by this function should be owned by the caller. |
| */ |
| static CachedData* CreateCodeCache(Local<UnboundScript> unbound_script); |
| |
| /** |
| * Creates and returns code cache for the specified unbound_module_script. |
| * This will return nullptr if the script cannot be serialized. The |
| * CachedData returned by this function should be owned by the caller. |
| */ |
| static CachedData* CreateCodeCache( |
| Local<UnboundModuleScript> unbound_module_script); |
| |
| /** |
| * Creates and returns code cache for the specified function that was |
| * previously produced by CompileFunctionInContext. |
| * This will return nullptr if the script cannot be serialized. The |
| * CachedData returned by this function should be owned by the caller. |
| */ |
| static CachedData* CreateCodeCacheForFunction(Local<Function> function); |
| |
| private: |
| static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal( |
| Isolate* isolate, Source* source, CompileOptions options, |
| NoCacheReason no_cache_reason); |
| }; |
| |
| |
| /** |
| * An error message. |
| */ |
| class V8_EXPORT Message { |
| public: |
| Local<String> Get() const; |
| |
| /** |
| * Return the isolate to which the Message belongs. |
| */ |
| Isolate* GetIsolate() const; |
| |
| V8_WARN_UNUSED_RESULT MaybeLocal<String> GetSourceLine( |
| Local<Context> context) const; |
| |
| /** |
| * Returns the origin for the script from where the function causing the |
| * error originates. |
| */ |
| ScriptOrigin GetScriptOrigin() const; |
| |
| /** |
| * Returns the resource name for the script from where the function causing |
| * the error originates. |
| */ |
| Local<Value> GetScriptResourceName() const; |
| |
| /** |
| * Exception stack trace. By default stack traces are not captured for |
| * uncaught exceptions. SetCaptureStackTraceForUncaughtExceptions allows |
| * to change this option. |
| */ |
| Local<StackTrace> GetStackTrace() const; |
| |
| /** |
| * Returns the number, 1-based, of the line where the error occurred. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<int> GetLineNumber(Local<Context> context) const; |
| |
| /** |
| * Returns the index within the script of the first character where |
| * the error occurred. |
| */ |
| int GetStartPosition() const; |
| |
| /** |
| * Returns the index within the script of the last character where |
| * the error occurred. |
| */ |
| int GetEndPosition() const; |
| |
| /** |
| * Returns the error level of the message. |
| */ |
| int ErrorLevel() const; |
| |
| /** |
| * Returns the index within the line of the first character where |
| * the error occurred. |
| */ |
| int GetStartColumn() const; |
| V8_WARN_UNUSED_RESULT Maybe<int> GetStartColumn(Local<Context> context) const; |
| |
| /** |
| * Returns the index within the line of the last character where |
| * the error occurred. |
| */ |
| int GetEndColumn() const; |
| V8_WARN_UNUSED_RESULT Maybe<int> GetEndColumn(Local<Context> context) const; |
| |
| /** |
| * Passes on the value set by the embedder when it fed the script from which |
| * this Message was generated to V8. |
| */ |
| bool IsSharedCrossOrigin() const; |
| bool IsOpaque() const; |
| |
| // TODO(1245381): Print to a string instead of on a FILE. |
| static void PrintCurrentStackTrace(Isolate* isolate, FILE* out); |
| |
| static const int kNoLineNumberInfo = 0; |
| static const int kNoColumnInfo = 0; |
| static const int kNoScriptIdInfo = 0; |
| }; |
| |
| |
| /** |
| * Representation of a JavaScript stack trace. The information collected is a |
| * snapshot of the execution stack and the information remains valid after |
| * execution continues. |
| */ |
| class V8_EXPORT StackTrace { |
| public: |
| /** |
| * Flags that determine what information is placed captured for each |
| * StackFrame when grabbing the current stack trace. |
| * Note: these options are deprecated and we always collect all available |
| * information (kDetailed). |
| */ |
| enum StackTraceOptions { |
| kLineNumber = 1, |
| kColumnOffset = 1 << 1 | kLineNumber, |
| kScriptName = 1 << 2, |
| kFunctionName = 1 << 3, |
| kIsEval = 1 << 4, |
| kIsConstructor = 1 << 5, |
| kScriptNameOrSourceURL = 1 << 6, |
| kScriptId = 1 << 7, |
| kExposeFramesAcrossSecurityOrigins = 1 << 8, |
| kOverview = kLineNumber | kColumnOffset | kScriptName | kFunctionName, |
| kDetailed = kOverview | kIsEval | kIsConstructor | kScriptNameOrSourceURL |
| }; |
| |
| /** |
| * Returns a StackFrame at a particular index. |
| */ |
| Local<StackFrame> GetFrame(Isolate* isolate, uint32_t index) const; |
| |
| /** |
| * Returns the number of StackFrames. |
| */ |
| int GetFrameCount() const; |
| |
| /** |
| * Grab a snapshot of the current JavaScript execution stack. |
| * |
| * \param frame_limit The maximum number of stack frames we want to capture. |
| * \param options Enumerates the set of things we will capture for each |
| * StackFrame. |
| */ |
| static Local<StackTrace> CurrentStackTrace( |
| Isolate* isolate, int frame_limit, StackTraceOptions options = kDetailed); |
| }; |
| |
| |
| /** |
| * A single JavaScript stack frame. |
| */ |
| class V8_EXPORT StackFrame { |
| public: |
| /** |
| * Returns the number, 1-based, of the line for the associate function call. |
| * This method will return Message::kNoLineNumberInfo if it is unable to |
| * retrieve the line number, or if kLineNumber was not passed as an option |
| * when capturing the StackTrace. |
| */ |
| int GetLineNumber() const; |
| |
| /** |
| * Returns the 1-based column offset on the line for the associated function |
| * call. |
| * This method will return Message::kNoColumnInfo if it is unable to retrieve |
| * the column number, or if kColumnOffset was not passed as an option when |
| * capturing the StackTrace. |
| */ |
| int GetColumn() const; |
| |
| /** |
| * Returns the id of the script for the function for this StackFrame. |
| * This method will return Message::kNoScriptIdInfo if it is unable to |
| * retrieve the script id, or if kScriptId was not passed as an option when |
| * capturing the StackTrace. |
| */ |
| int GetScriptId() const; |
| |
| /** |
| * Returns the name of the resource that contains the script for the |
| * function for this StackFrame. |
| */ |
| Local<String> GetScriptName() const; |
| |
| /** |
| * Returns the name of the resource that contains the script for the |
| * function for this StackFrame or sourceURL value if the script name |
| * is undefined and its source ends with //# sourceURL=... string or |
| * deprecated //@ sourceURL=... string. |
| */ |
| Local<String> GetScriptNameOrSourceURL() const; |
| |
| /** |
| * Returns the name of the function associated with this stack frame. |
| */ |
| Local<String> GetFunctionName() const; |
| |
| /** |
| * Returns whether or not the associated function is compiled via a call to |
| * eval(). |
| */ |
| bool IsEval() const; |
| |
| /** |
| * Returns whether or not the associated function is called as a |
| * constructor via "new". |
| */ |
| bool IsConstructor() const; |
| |
| /** |
| * Returns whether or not the associated functions is defined in wasm. |
| */ |
| bool IsWasm() const; |
| }; |
| |
| |
| // A StateTag represents a possible state of the VM. |
| enum StateTag { |
| JS, |
| GC, |
| PARSER, |
| BYTECODE_COMPILER, |
| COMPILER, |
| OTHER, |
| EXTERNAL, |
| IDLE |
| }; |
| |
| // A RegisterState represents the current state of registers used |
| // by the sampling profiler API. |
| struct RegisterState { |
| RegisterState() : pc(nullptr), sp(nullptr), fp(nullptr) {} |
| void* pc; // Instruction pointer. |
| void* sp; // Stack pointer. |
| void* fp; // Frame pointer. |
| }; |
| |
| // The output structure filled up by GetStackSample API function. |
| struct SampleInfo { |
| size_t frames_count; // Number of frames collected. |
| StateTag vm_state; // Current VM state. |
| void* external_callback_entry; // External callback address if VM is |
| // executing an external callback. |
| }; |
| |
| /** |
| * A JSON Parser and Stringifier. |
| */ |
| class V8_EXPORT JSON { |
| public: |
| /** |
| * Tries to parse the string |json_string| and returns it as value if |
| * successful. |
| * |
| * \param json_string The string to parse. |
| * \return The corresponding value if successfully parsed. |
| */ |
| static V8_DEPRECATE_SOON("Use the maybe version taking context", |
| MaybeLocal<Value> Parse(Isolate* isolate, |
| Local<String> json_string)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Value> Parse( |
| Local<Context> context, Local<String> json_string); |
| |
| /** |
| * Tries to stringify the JSON-serializable object |json_object| and returns |
| * it as string if successful. |
| * |
| * \param json_object The JSON-serializable object to stringify. |
| * \return The corresponding string if successfully stringified. |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> Stringify( |
| Local<Context> context, Local<Value> json_object, |
| Local<String> gap = Local<String>()); |
| }; |
| |
| /** |
| * Value serialization compatible with the HTML structured clone algorithm. |
| * The format is backward-compatible (i.e. safe to store to disk). |
| * |
| * WARNING: This API is under development, and changes (including incompatible |
| * changes to the API or wire format) may occur without notice until this |
| * warning is removed. |
| */ |
| class V8_EXPORT ValueSerializer { |
| public: |
| class V8_EXPORT Delegate { |
| public: |
| virtual ~Delegate() {} |
| |
| /** |
| * Handles the case where a DataCloneError would be thrown in the structured |
| * clone spec. Other V8 embedders may throw some other appropriate exception |
| * type. |
| */ |
| virtual void ThrowDataCloneError(Local<String> message) = 0; |
| |
| /** |
| * The embedder overrides this method to write some kind of host object, if |
| * possible. If not, a suitable exception should be thrown and |
| * Nothing<bool>() returned. |
| */ |
| virtual Maybe<bool> WriteHostObject(Isolate* isolate, Local<Object> object); |
| |
| /** |
| * Called when the ValueSerializer is going to serialize a |
| * SharedArrayBuffer object. The embedder must return an ID for the |
| * object, using the same ID if this SharedArrayBuffer has already been |
| * serialized in this buffer. When deserializing, this ID will be passed to |
| * ValueDeserializer::GetSharedArrayBufferFromId as |clone_id|. |
| * |
| * If the object cannot be serialized, an |
| * exception should be thrown and Nothing<uint32_t>() returned. |
| */ |
| virtual Maybe<uint32_t> GetSharedArrayBufferId( |
| Isolate* isolate, Local<SharedArrayBuffer> shared_array_buffer); |
| |
| virtual Maybe<uint32_t> GetWasmModuleTransferId( |
| Isolate* isolate, Local<WasmCompiledModule> module); |
| /** |
| * Allocates memory for the buffer of at least the size provided. The actual |
| * size (which may be greater or equal) is written to |actual_size|. If no |
| * buffer has been allocated yet, nullptr will be provided. |
| * |
| * If the memory cannot be allocated, nullptr should be returned. |
| * |actual_size| will be ignored. It is assumed that |old_buffer| is still |
| * valid in this case and has not been modified. |
| * |
| * The default implementation uses the stdlib's `realloc()` function. |
| */ |
| virtual void* ReallocateBufferMemory(void* old_buffer, size_t size, |
| size_t* actual_size); |
| |
| /** |
| * Frees a buffer allocated with |ReallocateBufferMemory|. |
| * |
| * The default implementation uses the stdlib's `free()` function. |
| */ |
| virtual void FreeBufferMemory(void* buffer); |
| }; |
| |
| explicit ValueSerializer(Isolate* isolate); |
| ValueSerializer(Isolate* isolate, Delegate* delegate); |
| ~ValueSerializer(); |
| |
| /** |
| * Writes out a header, which includes the format version. |
| */ |
| void WriteHeader(); |
| |
| /** |
| * Serializes a JavaScript value into the buffer. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> WriteValue(Local<Context> context, |
| Local<Value> value); |
| |
| /** |
| * Returns the stored data. This serializer should not be used once the buffer |
| * is released. The contents are undefined if a previous write has failed. |
| */ |
| V8_DEPRECATE_SOON("Use Release()", std::vector<uint8_t> ReleaseBuffer()); |
| |
| /** |
| * Returns the stored data (allocated using the delegate's |
| * ReallocateBufferMemory) and its size. This serializer should not be used |
| * once the buffer is released. The contents are undefined if a previous write |
| * has failed. Ownership of the buffer is transferred to the caller. |
| */ |
| V8_WARN_UNUSED_RESULT std::pair<uint8_t*, size_t> Release(); |
| |
| /** |
| * Marks an ArrayBuffer as havings its contents transferred out of band. |
| * Pass the corresponding ArrayBuffer in the deserializing context to |
| * ValueDeserializer::TransferArrayBuffer. |
| */ |
| void TransferArrayBuffer(uint32_t transfer_id, |
| Local<ArrayBuffer> array_buffer); |
| |
| /** |
| * Similar to TransferArrayBuffer, but for SharedArrayBuffer. |
| */ |
| V8_DEPRECATE_SOON("Use Delegate::GetSharedArrayBufferId", |
| void TransferSharedArrayBuffer( |
| uint32_t transfer_id, |
| Local<SharedArrayBuffer> shared_array_buffer)); |
| |
| /** |
| * Indicate whether to treat ArrayBufferView objects as host objects, |
| * i.e. pass them to Delegate::WriteHostObject. This should not be |
| * called when no Delegate was passed. |
| * |
| * The default is not to treat ArrayBufferViews as host objects. |
| */ |
| void SetTreatArrayBufferViewsAsHostObjects(bool mode); |
| |
| /** |
| * Write raw data in various common formats to the buffer. |
| * Note that integer types are written in base-128 varint format, not with a |
| * binary copy. For use during an override of Delegate::WriteHostObject. |
| */ |
| void WriteUint32(uint32_t value); |
| void WriteUint64(uint64_t value); |
| void WriteDouble(double value); |
| void WriteRawBytes(const void* source, size_t length); |
| |
| private: |
| ValueSerializer(const ValueSerializer&) = delete; |
| void operator=(const ValueSerializer&) = delete; |
| |
| struct PrivateData; |
| PrivateData* private_; |
| }; |
| |
| /** |
| * Deserializes values from data written with ValueSerializer, or a compatible |
| * implementation. |
| * |
| * WARNING: This API is under development, and changes (including incompatible |
| * changes to the API or wire format) may occur without notice until this |
| * warning is removed. |
| */ |
| class V8_EXPORT ValueDeserializer { |
| public: |
| class V8_EXPORT Delegate { |
| public: |
| virtual ~Delegate() {} |
| |
| /** |
| * The embedder overrides this method to read some kind of host object, if |
| * possible. If not, a suitable exception should be thrown and |
| * MaybeLocal<Object>() returned. |
| */ |
| virtual MaybeLocal<Object> ReadHostObject(Isolate* isolate); |
| |
| /** |
| * Get a WasmCompiledModule given a transfer_id previously provided |
| * by ValueSerializer::GetWasmModuleTransferId |
| */ |
| virtual MaybeLocal<WasmCompiledModule> GetWasmModuleFromId( |
| Isolate* isolate, uint32_t transfer_id); |
| |
| /** |
| * Get a SharedArrayBuffer given a clone_id previously provided |
| * by ValueSerializer::GetSharedArrayBufferId |
| */ |
| virtual MaybeLocal<SharedArrayBuffer> GetSharedArrayBufferFromId( |
| Isolate* isolate, uint32_t clone_id); |
| }; |
| |
| ValueDeserializer(Isolate* isolate, const uint8_t* data, size_t size); |
| ValueDeserializer(Isolate* isolate, const uint8_t* data, size_t size, |
| Delegate* delegate); |
| ~ValueDeserializer(); |
| |
| /** |
| * Reads and validates a header (including the format version). |
| * May, for example, reject an invalid or unsupported wire format. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> ReadHeader(Local<Context> context); |
| |
| /** |
| * Deserializes a JavaScript value from the buffer. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> ReadValue(Local<Context> context); |
| |
| /** |
| * Accepts the array buffer corresponding to the one passed previously to |
| * ValueSerializer::TransferArrayBuffer. |
| */ |
| void TransferArrayBuffer(uint32_t transfer_id, |
| Local<ArrayBuffer> array_buffer); |
| |
| /** |
| * Similar to TransferArrayBuffer, but for SharedArrayBuffer. |
| * The id is not necessarily in the same namespace as unshared ArrayBuffer |
| * objects. |
| */ |
| void TransferSharedArrayBuffer(uint32_t id, |
| Local<SharedArrayBuffer> shared_array_buffer); |
| |
| /** |
| * Must be called before ReadHeader to enable support for reading the legacy |
| * wire format (i.e., which predates this being shipped). |
| * |
| * Don't use this unless you need to read data written by previous versions of |
| * blink::ScriptValueSerializer. |
| */ |
| void SetSupportsLegacyWireFormat(bool supports_legacy_wire_format); |
| |
| /** |
| * Expect inline wasm in the data stream (rather than in-memory transfer) |
| */ |
| void SetExpectInlineWasm(bool allow_inline_wasm); |
| |
| /** |
| * Reads the underlying wire format version. Likely mostly to be useful to |
| * legacy code reading old wire format versions. Must be called after |
| * ReadHeader. |
| */ |
| uint32_t GetWireFormatVersion() const; |
| |
| /** |
| * Reads raw data in various common formats to the buffer. |
| * Note that integer types are read in base-128 varint format, not with a |
| * binary copy. For use during an override of Delegate::ReadHostObject. |
| */ |
| V8_WARN_UNUSED_RESULT bool ReadUint32(uint32_t* value); |
| V8_WARN_UNUSED_RESULT bool ReadUint64(uint64_t* value); |
| V8_WARN_UNUSED_RESULT bool ReadDouble(double* value); |
| V8_WARN_UNUSED_RESULT bool ReadRawBytes(size_t length, const void** data); |
| |
| private: |
| ValueDeserializer(const ValueDeserializer&) = delete; |
| void operator=(const ValueDeserializer&) = delete; |
| |
| struct PrivateData; |
| PrivateData* private_; |
| }; |
| |
| |
| // --- Value --- |
| |
| |
| /** |
| * The superclass of all JavaScript values and objects. |
| */ |
| class V8_EXPORT Value : public Data { |
| public: |
| /** |
| * Returns true if this value is the undefined value. See ECMA-262 |
| * 4.3.10. |
| */ |
| V8_INLINE bool IsUndefined() const; |
| |
| /** |
| * Returns true if this value is the null value. See ECMA-262 |
| * 4.3.11. |
| */ |
| V8_INLINE bool IsNull() const; |
| |
| /** |
| * Returns true if this value is either the null or the undefined value. |
| * See ECMA-262 |
| * 4.3.11. and 4.3.12 |
| */ |
| V8_INLINE bool IsNullOrUndefined() const; |
| |
| /** |
| * Returns true if this value is true. |
| */ |
| bool IsTrue() const; |
| |
| /** |
| * Returns true if this value is false. |
| */ |
| bool IsFalse() const; |
| |
| /** |
| * Returns true if this value is a symbol or a string. |
| */ |
| bool IsName() const; |
| |
| /** |
| * Returns true if this value is an instance of the String type. |
| * See ECMA-262 8.4. |
| */ |
| V8_INLINE bool IsString() const; |
| |
| /** |
| * Returns true if this value is a symbol. |
| */ |
| bool IsSymbol() const; |
| |
| /** |
| * Returns true if this value is a function. |
| */ |
| bool IsFunction() const; |
| |
| /** |
| * Returns true if this value is an array. Note that it will return false for |
| * an Proxy for an array. |
| */ |
| bool IsArray() const; |
| |
| /** |
| * Returns true if this value is an object. |
| */ |
| bool IsObject() const; |
| |
| /** |
| * Returns true if this value is a bigint. |
| */ |
| bool IsBigInt() const; |
| |
| /** |
| * Returns true if this value is boolean. |
| */ |
| bool IsBoolean() const; |
| |
| /** |
| * Returns true if this value is a number. |
| */ |
| bool IsNumber() const; |
| |
| /** |
| * Returns true if this value is external. |
| */ |
| bool IsExternal() const; |
| |
| /** |
| * Returns true if this value is a 32-bit signed integer. |
| */ |
| bool IsInt32() const; |
| |
| /** |
| * Returns true if this value is a 32-bit unsigned integer. |
| */ |
| bool IsUint32() const; |
| |
| /** |
| * Returns true if this value is a Date. |
| */ |
| bool IsDate() const; |
| |
| /** |
| * Returns true if this value is an Arguments object. |
| */ |
| bool IsArgumentsObject() const; |
| |
| /** |
| * Returns true if this value is a BigInt object. |
| */ |
| bool IsBigIntObject() const; |
| |
| /** |
| * Returns true if this value is a Boolean object. |
| */ |
| bool IsBooleanObject() const; |
| |
| /** |
| * Returns true if this value is a Number object. |
| */ |
| bool IsNumberObject() const; |
| |
| /** |
| * Returns true if this value is a String object. |
| */ |
| bool IsStringObject() const; |
| |
| /** |
| * Returns true if this value is a Symbol object. |
| */ |
| bool IsSymbolObject() const; |
| |
| /** |
| * Returns true if this value is a NativeError. |
| */ |
| bool IsNativeError() const; |
| |
| /** |
| * Returns true if this value is a RegExp. |
| */ |
| bool IsRegExp() const; |
| |
| /** |
| * Returns true if this value is an async function. |
| */ |
| bool IsAsyncFunction() const; |
| |
| /** |
| * Returns true if this value is a Generator function. |
| */ |
| bool IsGeneratorFunction() const; |
| |
| /** |
| * Returns true if this value is a Generator object (iterator). |
| */ |
| bool IsGeneratorObject() const; |
| |
| /** |
| * Returns true if this value is a Promise. |
| */ |
| bool IsPromise() const; |
| |
| /** |
| * Returns true if this value is a Map. |
| */ |
| bool IsMap() const; |
| |
| /** |
| * Returns true if this value is a Set. |
| */ |
| bool IsSet() const; |
| |
| /** |
| * Returns true if this value is a Map Iterator. |
| */ |
| bool IsMapIterator() const; |
| |
| /** |
| * Returns true if this value is a Set Iterator. |
| */ |
| bool IsSetIterator() const; |
| |
| /** |
| * Returns true if this value is a WeakMap. |
| */ |
| bool IsWeakMap() const; |
| |
| /** |
| * Returns true if this value is a WeakSet. |
| */ |
| bool IsWeakSet() const; |
| |
| /** |
| * Returns true if this value is an ArrayBuffer. |
| */ |
| bool IsArrayBuffer() const; |
| |
| /** |
| * Returns true if this value is an ArrayBufferView. |
| */ |
| bool IsArrayBufferView() const; |
| |
| /** |
| * Returns true if this value is one of TypedArrays. |
| */ |
| bool IsTypedArray() const; |
| |
| /** |
| * Returns true if this value is an Uint8Array. |
| */ |
| bool IsUint8Array() const; |
| |
| /** |
| * Returns true if this value is an Uint8ClampedArray. |
| */ |
| bool IsUint8ClampedArray() const; |
| |
| /** |
| * Returns true if this value is an Int8Array. |
| */ |
| bool IsInt8Array() const; |
| |
| /** |
| * Returns true if this value is an Uint16Array. |
| */ |
| bool IsUint16Array() const; |
| |
| /** |
| * Returns true if this value is an Int16Array. |
| */ |
| bool IsInt16Array() const; |
| |
| /** |
| * Returns true if this value is an Uint32Array. |
| */ |
| bool IsUint32Array() const; |
| |
| /** |
| * Returns true if this value is an Int32Array. |
| */ |
| bool IsInt32Array() const; |
| |
| /** |
| * Returns true if this value is a Float32Array. |
| */ |
| bool IsFloat32Array() const; |
| |
| /** |
| * Returns true if this value is a Float64Array. |
| */ |
| bool IsFloat64Array() const; |
| |
| /** |
| * Returns true if this value is a BigInt64Array. |
| */ |
| bool IsBigInt64Array() const; |
| |
| /** |
| * Returns true if this value is a BigUint64Array. |
| */ |
| bool IsBigUint64Array() const; |
| |
| /** |
| * Returns true if this value is a DataView. |
| */ |
| bool IsDataView() const; |
| |
| /** |
| * Returns true if this value is a SharedArrayBuffer. |
| * This is an experimental feature. |
| */ |
| bool IsSharedArrayBuffer() const; |
| |
| /** |
| * Returns true if this value is a JavaScript Proxy. |
| */ |
| bool IsProxy() const; |
| |
| bool IsWebAssemblyCompiledModule() const; |
| |
| /** |
| * Returns true if the value is a Module Namespace Object. |
| */ |
| bool IsModuleNamespaceObject() const; |
| |
| V8_WARN_UNUSED_RESULT MaybeLocal<BigInt> ToBigInt( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Boolean> ToBoolean( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Number> ToNumber( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<String> ToString( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<String> ToDetailString( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> ToObject( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Integer> ToInteger( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToUint32( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Int32> ToInt32(Local<Context> context) const; |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Boolean> ToBoolean(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Number> ToNumber(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<String> ToString(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Object> ToObject(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Integer> ToInteger(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Int32> ToInt32(Isolate* isolate) const); |
| |
| /** |
| * Attempts to convert a string to an array index. |
| * Returns an empty handle if the conversion fails. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToArrayIndex( |
| Local<Context> context) const; |
| |
| V8_WARN_UNUSED_RESULT Maybe<bool> BooleanValue(Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT Maybe<double> NumberValue(Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT Maybe<int64_t> IntegerValue( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT Maybe<uint32_t> Uint32Value( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT Maybe<int32_t> Int32Value(Local<Context> context) const; |
| |
| /** JS == */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> Equals(Local<Context> context, |
| Local<Value> that) const; |
| bool StrictEquals(Local<Value> that) const; |
| bool SameValue(Local<Value> that) const; |
| |
| template <class T> V8_INLINE static Value* Cast(T* value); |
| |
| Local<String> TypeOf(Isolate*); |
| |
| Maybe<bool> InstanceOf(Local<Context> context, Local<Object> object); |
| |
| private: |
| V8_INLINE bool QuickIsUndefined() const; |
| V8_INLINE bool QuickIsNull() const; |
| V8_INLINE bool QuickIsNullOrUndefined() const; |
| V8_INLINE bool QuickIsString() const; |
| bool FullIsUndefined() const; |
| bool FullIsNull() const; |
| bool FullIsString() const; |
| }; |
| |
| |
| /** |
| * The superclass of primitive values. See ECMA-262 4.3.2. |
| */ |
| class V8_EXPORT Primitive : public Value { }; |
| |
| |
| /** |
| * A primitive boolean value (ECMA-262, 4.3.14). Either the true |
| * or false value. |
| */ |
| class V8_EXPORT Boolean : public Primitive { |
| public: |
| bool Value() const; |
| V8_INLINE static Boolean* Cast(v8::Value* obj); |
| V8_INLINE static Local<Boolean> New(Isolate* isolate, bool value); |
| |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A superclass for symbols and strings. |
| */ |
| class V8_EXPORT Name : public Primitive { |
| public: |
| /** |
| * Returns the identity hash for this object. The current implementation |
| * uses an inline property on the object to store the identity hash. |
| * |
| * The return value will never be 0. Also, it is not guaranteed to be |
| * unique. |
| */ |
| int GetIdentityHash(); |
| |
| V8_INLINE static Name* Cast(Value* obj); |
| |
| private: |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * A flag describing different modes of string creation. |
| * |
| * Aside from performance implications there are no differences between the two |
| * creation modes. |
| */ |
| enum class NewStringType { |
| /** |
| * Create a new string, always allocating new storage memory. |
| */ |
| kNormal, |
| |
| /** |
| * Acts as a hint that the string should be created in the |
| * old generation heap space and be deduplicated if an identical string |
| * already exists. |
| */ |
| kInternalized |
| }; |
| |
| /** |
| * A JavaScript string value (ECMA-262, 4.3.17). |
| */ |
| class V8_EXPORT String : public Name { |
| public: |
| static constexpr int kMaxLength = internal::kApiPointerSize == 4 |
| ? (1 << 28) - 16 |
| : internal::kSmiMaxValue / 2 - 24; |
| |
| enum Encoding { |
| UNKNOWN_ENCODING = 0x1, |
| TWO_BYTE_ENCODING = 0x0, |
| ONE_BYTE_ENCODING = 0x8 |
| }; |
| /** |
| * Returns the number of characters (UTF-16 code units) in this string. |
| */ |
| int Length() const; |
| |
| /** |
| * Returns the number of bytes in the UTF-8 encoded |
| * representation of this string. |
| */ |
| int Utf8Length(Isolate* isolate) const; |
| |
| /** |
| * Returns whether this string is known to contain only one byte data, |
| * i.e. ISO-8859-1 code points. |
| * Does not read the string. |
| * False negatives are possible. |
| */ |
| bool IsOneByte() const; |
| |
| /** |
| * Returns whether this string contain only one byte data, |
| * i.e. ISO-8859-1 code points. |
| * Will read the entire string in some cases. |
| */ |
| bool ContainsOnlyOneByte() const; |
| |
| /** |
| * Write the contents of the string to an external buffer. |
| * If no arguments are given, expects the buffer to be large |
| * enough to hold the entire string and NULL terminator. Copies |
| * the contents of the string and the NULL terminator into the |
| * buffer. |
| * |
| * WriteUtf8 will not write partial UTF-8 sequences, preferring to stop |
| * before the end of the buffer. |
| * |
| * Copies up to length characters into the output buffer. |
| * Only null-terminates if there is enough space in the buffer. |
| * |
| * \param buffer The buffer into which the string will be copied. |
| * \param start The starting position within the string at which |
| * copying begins. |
| * \param length The number of characters to copy from the string. For |
| * WriteUtf8 the number of bytes in the buffer. |
| * \param nchars_ref The number of characters written, can be NULL. |
| * \param options Various options that might affect performance of this or |
| * subsequent operations. |
| * \return The number of characters copied to the buffer excluding the null |
| * terminator. For WriteUtf8: The number of bytes copied to the buffer |
| * including the null terminator (if written). |
| */ |
| enum WriteOptions { |
| NO_OPTIONS = 0, |
| HINT_MANY_WRITES_EXPECTED = 1, |
| NO_NULL_TERMINATION = 2, |
| PRESERVE_ONE_BYTE_NULL = 4, |
| // Used by WriteUtf8 to replace orphan surrogate code units with the |
| // unicode replacement character. Needs to be set to guarantee valid UTF-8 |
| // output. |
| REPLACE_INVALID_UTF8 = 8 |
| }; |
| |
| // 16-bit character codes. |
| int Write(Isolate* isolate, uint16_t* buffer, int start = 0, int length = -1, |
| int options = NO_OPTIONS) const; |
| // One byte characters. |
| int WriteOneByte(Isolate* isolate, uint8_t* buffer, int start = 0, |
| int length = -1, int options = NO_OPTIONS) const; |
| // UTF-8 encoded characters. |
| int WriteUtf8(Isolate* isolate, char* buffer, int length = -1, |
| int* nchars_ref = NULL, int options = NO_OPTIONS) const; |
| |
| /** |
| * A zero length string. |
| */ |
| V8_INLINE static Local<String> Empty(Isolate* isolate); |
| |
| /** |
| * Returns true if the string is external |
| */ |
| bool IsExternal() const; |
| |
| /** |
| * Returns true if the string is both external and one-byte. |
| */ |
| bool IsExternalOneByte() const; |
| |
| class V8_EXPORT ExternalStringResourceBase { // NOLINT |
| public: |
| virtual ~ExternalStringResourceBase() {} |
| |
| virtual bool IsCompressible() const { return false; } |
| |
| protected: |
| ExternalStringResourceBase() {} |
| |
| /** |
| * Internally V8 will call this Dispose method when the external string |
| * resource is no longer needed. The default implementation will use the |
| * delete operator. This method can be overridden in subclasses to |
| * control how allocated external string resources are disposed. |
| */ |
| virtual void Dispose() { delete this; } |
| |
| // Disallow copying and assigning. |
| ExternalStringResourceBase(const ExternalStringResourceBase&) = delete; |
| void operator=(const ExternalStringResourceBase&) = delete; |
| |
| private: |
| friend class internal::Heap; |
| friend class v8::String; |
| }; |
| |
| /** |
| * An ExternalStringResource is a wrapper around a two-byte string |
| * buffer that resides outside V8's heap. Implement an |
| * ExternalStringResource to manage the life cycle of the underlying |
| * buffer. Note that the string data must be immutable. |
| */ |
| class V8_EXPORT ExternalStringResource |
| : public ExternalStringResourceBase { |
| public: |
| /** |
| * Override the destructor to manage the life cycle of the underlying |
| * buffer. |
| */ |
| virtual ~ExternalStringResource() {} |
| |
| /** |
| * The string data from the underlying buffer. |
| */ |
| virtual const uint16_t* data() const = 0; |
| |
| /** |
| * The length of the string. That is, the number of two-byte characters. |
| */ |
| virtual size_t length() const = 0; |
| |
| protected: |
| ExternalStringResource() {} |
| }; |
| |
| /** |
| * An ExternalOneByteStringResource is a wrapper around an one-byte |
| * string buffer that resides outside V8's heap. Implement an |
| * ExternalOneByteStringResource to manage the life cycle of the |
| * underlying buffer. Note that the string data must be immutable |
| * and that the data must be Latin-1 and not UTF-8, which would require |
| * special treatment internally in the engine and do not allow efficient |
| * indexing. Use String::New or convert to 16 bit data for non-Latin1. |
| */ |
| |
| class V8_EXPORT ExternalOneByteStringResource |
| : public ExternalStringResourceBase { |
| public: |
| /** |
| * Override the destructor to manage the life cycle of the underlying |
| * buffer. |
| */ |
| virtual ~ExternalOneByteStringResource() {} |
| /** The string data from the underlying buffer.*/ |
| virtual const char* data() const = 0; |
| /** The number of Latin-1 characters in the string.*/ |
| virtual size_t length() const = 0; |
| protected: |
| ExternalOneByteStringResource() {} |
| }; |
| |
| /** |
| * If the string is an external string, return the ExternalStringResourceBase |
| * regardless of the encoding, otherwise return NULL. The encoding of the |
| * string is returned in encoding_out. |
| */ |
| V8_INLINE ExternalStringResourceBase* GetExternalStringResourceBase( |
| Encoding* encoding_out) const; |
| |
| /** |
| * Get the ExternalStringResource for an external string. Returns |
| * NULL if IsExternal() doesn't return true. |
| */ |
| V8_INLINE ExternalStringResource* GetExternalStringResource() const; |
| |
| /** |
| * Get the ExternalOneByteStringResource for an external one-byte string. |
| * Returns NULL if IsExternalOneByte() doesn't return true. |
| */ |
| const ExternalOneByteStringResource* GetExternalOneByteStringResource() const; |
| |
| V8_INLINE static String* Cast(v8::Value* obj); |
| |
| // TODO(dcarney): remove with deprecation of New functions. |
| enum NewStringType { |
| kNormalString = static_cast<int>(v8::NewStringType::kNormal), |
| kInternalizedString = static_cast<int>(v8::NewStringType::kInternalized) |
| }; |
| |
| /** Allocates a new string from UTF-8 data.*/ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<String> NewFromUtf8(Isolate* isolate, const char* data, |
| NewStringType type = kNormalString, |
| int length = -1)); |
| |
| /** Allocates a new string from UTF-8 data. Only returns an empty value when |
| * length > kMaxLength. **/ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromUtf8( |
| Isolate* isolate, const char* data, v8::NewStringType type, |
| int length = -1); |
| |
| /** Allocates a new string from Latin-1 data. Only returns an empty value |
| * when length > kMaxLength. **/ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromOneByte( |
| Isolate* isolate, const uint8_t* data, v8::NewStringType type, |
| int length = -1); |
| |
| /** Allocates a new string from UTF-16 data.*/ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<String> NewFromTwoByte(Isolate* isolate, const uint16_t* data, |
| NewStringType type = kNormalString, |
| int length = -1)); |
| |
| /** Allocates a new string from UTF-16 data. Only returns an empty value when |
| * length > kMaxLength. **/ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromTwoByte( |
| Isolate* isolate, const uint16_t* data, v8::NewStringType type, |
| int length = -1); |
| |
| /** |
| * Creates a new string by concatenating the left and the right strings |
| * passed in as parameters. |
| */ |
| static Local<String> Concat(Isolate* isolate, Local<String> left, |
| Local<String> right); |
| |
| /** |
| * Creates a new external string using the data defined in the given |
| * resource. When the external string is no longer live on V8's heap the |
| * resource will be disposed by calling its Dispose method. The caller of |
| * this function should not otherwise delete or modify the resource. Neither |
| * should the underlying buffer be deallocated or modified except through the |
| * destructor of the external string resource. |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalTwoByte( |
| Isolate* isolate, ExternalStringResource* resource); |
| |
| /** |
| * Associate an external string resource with this string by transforming it |
| * in place so that existing references to this string in the JavaScript heap |
| * will use the external string resource. The external string resource's |
| * character contents need to be equivalent to this string. |
| * Returns true if the string has been changed to be an external string. |
| * The string is not modified if the operation fails. See NewExternal for |
| * information on the lifetime of the resource. |
| */ |
| bool MakeExternal(ExternalStringResource* resource); |
| |
| /** |
| * Creates a new external string using the one-byte data defined in the given |
| * resource. When the external string is no longer live on V8's heap the |
| * resource will be disposed by calling its Dispose method. The caller of |
| * this function should not otherwise delete or modify the resource. Neither |
| * should the underlying buffer be deallocated or modified except through the |
| * destructor of the external string resource. |
| */ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<String> NewExternal(Isolate* isolate, |
| ExternalOneByteStringResource* resource)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalOneByte( |
| Isolate* isolate, ExternalOneByteStringResource* resource); |
| |
| /** |
| * Associate an external string resource with this string by transforming it |
| * in place so that existing references to this string in the JavaScript heap |
| * will use the external string resource. The external string resource's |
| * character contents need to be equivalent to this string. |
| * Returns true if the string has been changed to be an external string. |
| * The string is not modified if the operation fails. See NewExternal for |
| * information on the lifetime of the resource. |
| */ |
| bool MakeExternal(ExternalOneByteStringResource* resource); |
| |
| /** |
| * Returns true if this string can be made external. |
| */ |
| bool CanMakeExternal(); |
| |
| /** |
| * Returns true if the strings values are equal. Same as JS ==/===. |
| */ |
| bool StringEquals(Local<String> str); |
| |
| /** |
| * Converts an object to a UTF-8-encoded character array. Useful if |
| * you want to print the object. If conversion to a string fails |
| * (e.g. due to an exception in the toString() method of the object) |
| * then the length() method returns 0 and the * operator returns |
| * NULL. |
| */ |
| class V8_EXPORT Utf8Value { |
| public: |
| Utf8Value(Isolate* isolate, Local<v8::Value> obj); |
| ~Utf8Value(); |
| char* operator*() { return str_; } |
| const char* operator*() const { return str_; } |
| int length() const { return length_; } |
| |
| // Disallow copying and assigning. |
| Utf8Value(const Utf8Value&) = delete; |
| void operator=(const Utf8Value&) = delete; |
| |
| private: |
| char* str_; |
| int length_; |
| }; |
| |
| /** |
| * Converts an object to a two-byte (UTF-16-encoded) string. |
| * If conversion to a string fails (eg. due to an exception in the toString() |
| * method of the object) then the length() method returns 0 and the * operator |
| * returns NULL. |
| */ |
| class V8_EXPORT Value { |
| public: |
| Value(Isolate* isolate, Local<v8::Value> obj); |
| ~Value(); |
| uint16_t* operator*() { return str_; } |
| const uint16_t* operator*() const { return str_; } |
| int length() const { return length_; } |
| |
| // Disallow copying and assigning. |
| Value(const Value&) = delete; |
| void operator=(const Value&) = delete; |
| |
| private: |
| uint16_t* str_; |
| int length_; |
| }; |
| |
| private: |
| void VerifyExternalStringResourceBase(ExternalStringResourceBase* v, |
| Encoding encoding) const; |
| void VerifyExternalStringResource(ExternalStringResource* val) const; |
| ExternalStringResource* GetExternalStringResourceSlow() const; |
| ExternalStringResourceBase* GetExternalStringResourceBaseSlow( |
| String::Encoding* encoding_out) const; |
| const ExternalOneByteStringResource* GetExternalOneByteStringResourceSlow() |
| const; |
| |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript symbol (ECMA-262 edition 6) |
| */ |
| class V8_EXPORT Symbol : public Name { |
| public: |
| /** |
| * Returns the print name string of the symbol, or undefined if none. |
| */ |
| Local<Value> Name() const; |
| |
| /** |
| * Create a symbol. If name is not empty, it will be used as the description. |
| */ |
| static Local<Symbol> New(Isolate* isolate, |
| Local<String> name = Local<String>()); |
| |
| /** |
| * Access global symbol registry. |
| * Note that symbols created this way are never collected, so |
| * they should only be used for statically fixed properties. |
| * Also, there is only one global name space for the names used as keys. |
| * To minimize the potential for clashes, use qualified names as keys. |
| */ |
| static Local<Symbol> For(Isolate *isolate, Local<String> name); |
| |
| /** |
| * Retrieve a global symbol. Similar to |For|, but using a separate |
| * registry that is not accessible by (and cannot clash with) JavaScript code. |
| */ |
| static Local<Symbol> ForApi(Isolate *isolate, Local<String> name); |
| |
| // Well-known symbols |
| static Local<Symbol> GetHasInstance(Isolate* isolate); |
| static Local<Symbol> GetIsConcatSpreadable(Isolate* isolate); |
| static Local<Symbol> GetIterator(Isolate* isolate); |
| static Local<Symbol> GetMatch(Isolate* isolate); |
| static Local<Symbol> GetReplace(Isolate* isolate); |
| static Local<Symbol> GetSearch(Isolate* isolate); |
| static Local<Symbol> GetSplit(Isolate* isolate); |
| static Local<Symbol> GetToPrimitive(Isolate* isolate); |
| static Local<Symbol> GetToStringTag(Isolate* isolate); |
| static Local<Symbol> GetUnscopables(Isolate* isolate); |
| |
| V8_INLINE static Symbol* Cast(Value* obj); |
| |
| private: |
| Symbol(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * A private symbol |
| * |
| * This is an experimental feature. Use at your own risk. |
| */ |
| class V8_EXPORT Private : public Data { |
| public: |
| /** |
| * Returns the print name string of the private symbol, or undefined if none. |
| */ |
| Local<Value> Name() const; |
| |
| /** |
| * Create a private symbol. If name is not empty, it will be the description. |
| */ |
| static Local<Private> New(Isolate* isolate, |
| Local<String> name = Local<String>()); |
| |
| /** |
| * Retrieve a global private symbol. If a symbol with this name has not |
| * been retrieved in the same isolate before, it is created. |
| * Note that private symbols created this way are never collected, so |
| * they should only be used for statically fixed properties. |
| * Also, there is only one global name space for the names used as keys. |
| * To minimize the potential for clashes, use qualified names as keys, |
| * e.g., "Class#property". |
| */ |
| static Local<Private> ForApi(Isolate* isolate, Local<String> name); |
| |
| V8_INLINE static Private* Cast(Data* data); |
| |
| private: |
| Private(); |
| |
| static void CheckCast(Data* that); |
| }; |
| |
| |
| /** |
| * A JavaScript number value (ECMA-262, 4.3.20) |
| */ |
| class V8_EXPORT Number : public Primitive { |
| public: |
| double Value() const; |
| static Local<Number> New(Isolate* isolate, double value); |
| V8_INLINE static Number* Cast(v8::Value* obj); |
| private: |
| Number(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript value representing a signed integer. |
| */ |
| class V8_EXPORT Integer : public Number { |
| public: |
| static Local<Integer> New(Isolate* isolate, int32_t value); |
| static Local<Integer> NewFromUnsigned(Isolate* isolate, uint32_t value); |
| int64_t Value() const; |
| V8_INLINE static Integer* Cast(v8::Value* obj); |
| private: |
| Integer(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript value representing a 32-bit signed integer. |
| */ |
| class V8_EXPORT Int32 : public Integer { |
| public: |
| int32_t Value() const; |
| V8_INLINE static Int32* Cast(v8::Value* obj); |
| |
| private: |
| Int32(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript value representing a 32-bit unsigned integer. |
| */ |
| class V8_EXPORT Uint32 : public Integer { |
| public: |
| uint32_t Value() const; |
| V8_INLINE static Uint32* Cast(v8::Value* obj); |
| |
| private: |
| Uint32(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| /** |
| * A JavaScript BigInt value (https://tc39.github.io/proposal-bigint) |
| */ |
| class V8_EXPORT BigInt : public Primitive { |
| public: |
| static Local<BigInt> New(Isolate* isolate, int64_t value); |
| static Local<BigInt> NewFromUnsigned(Isolate* isolate, uint64_t value); |
| /** |
| * Creates a new BigInt object using a specified sign bit and a |
| * specified list of digits/words. |
| * The resulting number is calculated as: |
| * |
| * (-1)^sign_bit * (words[0] * (2^64)^0 + words[1] * (2^64)^1 + ...) |
| */ |
| static MaybeLocal<BigInt> NewFromWords(Local<Context> context, int sign_bit, |
| int word_count, const uint64_t* words); |
| |
| /** |
| * Returns the value of this BigInt as an unsigned 64-bit integer. |
| * If `lossless` is provided, it will reflect whether the return value was |
| * truncated or wrapped around. In particular, it is set to `false` if this |
| * BigInt is negative. |
| */ |
| uint64_t Uint64Value(bool* lossless = nullptr) const; |
| |
| /** |
| * Returns the value of this BigInt as a signed 64-bit integer. |
| * If `lossless` is provided, it will reflect whether this BigInt was |
| * truncated or not. |
| */ |
| int64_t Int64Value(bool* lossless = nullptr) const; |
| |
| /** |
| * Returns the number of 64-bit words needed to store the result of |
| * ToWordsArray(). |
| */ |
| int WordCount() const; |
| |
| /** |
| * Writes the contents of this BigInt to a specified memory location. |
| * `sign_bit` must be provided and will be set to 1 if this BigInt is |
| * negative. |
| * `*word_count` has to be initialized to the length of the `words` array. |
| * Upon return, it will be set to the actual number of words that would |
| * be needed to store this BigInt (i.e. the return value of `WordCount()`). |
| */ |
| void ToWordsArray(int* sign_bit, int* word_count, uint64_t* words) const; |
| |
| V8_INLINE static BigInt* Cast(v8::Value* obj); |
| |
| private: |
| BigInt(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| /** |
| * PropertyAttribute. |
| */ |
| enum PropertyAttribute { |
| /** None. **/ |
| None = 0, |
| /** ReadOnly, i.e., not writable. **/ |
| ReadOnly = 1 << 0, |
| /** DontEnum, i.e., not enumerable. **/ |
| DontEnum = 1 << 1, |
| /** DontDelete, i.e., not configurable. **/ |
| DontDelete = 1 << 2 |
| }; |
| |
| /** |
| * Accessor[Getter|Setter] are used as callback functions when |
| * setting|getting a particular property. See Object and ObjectTemplate's |
| * method SetAccessor. |
| */ |
| typedef void (*AccessorGetterCallback)( |
| Local<String> property, |
| const PropertyCallbackInfo<Value>& info); |
| typedef void (*AccessorNameGetterCallback)( |
| Local<Name> property, |
| const PropertyCallbackInfo<Value>& info); |
| |
| |
| typedef void (*AccessorSetterCallback)( |
| Local<String> property, |
| Local<Value> value, |
| const PropertyCallbackInfo<void>& info); |
| typedef void (*AccessorNameSetterCallback)( |
| Local<Name> property, |
| Local<Value> value, |
| const PropertyCallbackInfo<void>& info); |
| |
| |
| /** |
| * Access control specifications. |
| * |
| * Some accessors should be accessible across contexts. These |
| * accessors have an explicit access control parameter which specifies |
| * the kind of cross-context access that should be allowed. |
| * |
| * TODO(dcarney): Remove PROHIBITS_OVERWRITING as it is now unused. |
| */ |
| enum AccessControl { |
| DEFAULT = 0, |
| ALL_CAN_READ = 1, |
| ALL_CAN_WRITE = 1 << 1, |
| PROHIBITS_OVERWRITING = 1 << 2 |
| }; |
| |
| /** |
| * Property filter bits. They can be or'ed to build a composite filter. |
| */ |
| enum PropertyFilter { |
| ALL_PROPERTIES = 0, |
| ONLY_WRITABLE = 1, |
| ONLY_ENUMERABLE = 2, |
| ONLY_CONFIGURABLE = 4, |
| SKIP_STRINGS = 8, |
| SKIP_SYMBOLS = 16 |
| }; |
| |
| /** |
| * Options for marking whether callbacks may trigger JS-observable side effects. |
| * Side-effect-free callbacks are whitelisted during debug evaluation with |
| * throwOnSideEffect. It applies when calling a Function, FunctionTemplate, |
| * or an Accessor's getter callback. For Interceptors, please see |
| * PropertyHandlerFlags's kHasNoSideEffect. |
| */ |
| enum class SideEffectType { kHasSideEffect, kHasNoSideEffect }; |
| |
| /** |
| * Keys/Properties filter enums: |
| * |
| * KeyCollectionMode limits the range of collected properties. kOwnOnly limits |
| * the collected properties to the given Object only. kIncludesPrototypes will |
| * include all keys of the objects's prototype chain as well. |
| */ |
| enum class KeyCollectionMode { kOwnOnly, kIncludePrototypes }; |
| |
| /** |
| * kIncludesIndices allows for integer indices to be collected, while |
| * kSkipIndices will exclude integer indices from being collected. |
| */ |
| enum class IndexFilter { kIncludeIndices, kSkipIndices }; |
| |
| /** |
| * kConvertToString will convert integer indices to strings. |
| * kKeepNumbers will return numbers for integer indices. |
| */ |
| enum class KeyConversionMode { kConvertToString, kKeepNumbers }; |
| |
| /** |
| * Integrity level for objects. |
| */ |
| enum class IntegrityLevel { kFrozen, kSealed }; |
| |
| /** |
| * A JavaScript object (ECMA-262, 4.3.3) |
| */ |
| class V8_EXPORT Object : public Value { |
| public: |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool Set(Local<Value> key, Local<Value> value)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, |
| Local<Value> key, Local<Value> value); |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool Set(uint32_t index, Local<Value> value)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, uint32_t index, |
| Local<Value> value); |
| |
| // Implements CreateDataProperty (ECMA-262, 7.3.4). |
| // |
| // Defines a configurable, writable, enumerable property with the given value |
| // on the object unless the property already exists and is not configurable |
| // or the object is not extensible. |
| // |
| // Returns true on success. |
| V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context, |
| Local<Name> key, |
| Local<Value> value); |
| V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context, |
| uint32_t index, |
| Local<Value> value); |
| |
| // Implements DefineOwnProperty. |
| // |
| // In general, CreateDataProperty will be faster, however, does not allow |
| // for specifying attributes. |
| // |
| // Returns true on success. |
| V8_WARN_UNUSED_RESULT Maybe<bool> DefineOwnProperty( |
| Local<Context> context, Local<Name> key, Local<Value> value, |
| PropertyAttribute attributes = None); |
| |
| // Implements Object.DefineProperty(O, P, Attributes), see Ecma-262 19.1.2.4. |
| // |
| // The defineProperty function is used to add an own property or |
| // update the attributes of an existing own property of an object. |
| // |
| // Both data and accessor descriptors can be used. |
| // |
| // In general, CreateDataProperty is faster, however, does not allow |
| // for specifying attributes or an accessor descriptor. |
| // |
| // The PropertyDescriptor can change when redefining a property. |
| // |
| // Returns true on success. |
| V8_WARN_UNUSED_RESULT Maybe<bool> DefineProperty( |
| Local<Context> context, Local<Name> key, PropertyDescriptor& descriptor); |
| |
| V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(Local<Value> key)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, |
| Local<Value> key); |
| |
| V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(uint32_t index)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, |
| uint32_t index); |
| |
| /** |
| * Gets the property attributes of a property which can be None or |
| * any combination of ReadOnly, DontEnum and DontDelete. Returns |
| * None when the property doesn't exist. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetPropertyAttributes( |
| Local<Context> context, Local<Value> key); |
| |
| /** |
| * Returns Object.getOwnPropertyDescriptor as per ES2016 section 19.1.2.6. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetOwnPropertyDescriptor( |
| Local<Context> context, Local<Name> key); |
| |
| V8_DEPRECATE_SOON("Use maybe version", bool Has(Local<Value> key)); |
| /** |
| * Object::Has() calls the abstract operation HasProperty(O, P) described |
| * in ECMA-262, 7.3.10. Has() returns |
| * true, if the object has the property, either own or on the prototype chain. |
| * Interceptors, i.e., PropertyQueryCallbacks, are called if present. |
| * |
| * Has() has the same side effects as JavaScript's `variable in object`. |
| * For example, calling Has() on a revoked proxy will throw an exception. |
| * |
| * \note Has() converts the key to a name, which possibly calls back into |
| * JavaScript. |
| * |
| * See also v8::Object::HasOwnProperty() and |
| * v8::Object::HasRealNamedProperty(). |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, |
| Local<Value> key); |
| |
| V8_DEPRECATE_SOON("Use maybe version", bool Delete(Local<Value> key)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context, |
| Local<Value> key); |
| |
| V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, uint32_t index); |
| |
| V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context, |
| uint32_t index); |
| |
| /** |
| * Note: SideEffectType affects the getter only, not the setter. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> SetAccessor( |
| Local<Context> context, Local<Name> name, |
| AccessorNameGetterCallback getter, AccessorNameSetterCallback setter = 0, |
| MaybeLocal<Value> data = MaybeLocal<Value>(), |
| AccessControl settings = DEFAULT, PropertyAttribute attribute = None, |
| SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect); |
| |
| void SetAccessorProperty(Local<Name> name, Local<Function> getter, |
| Local<Function> setter = Local<Function>(), |
| PropertyAttribute attribute = None, |
| AccessControl settings = DEFAULT); |
| |
| /** |
| * Sets a native data property like Template::SetNativeDataProperty, but |
| * this method sets on this object directly. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> SetNativeDataProperty( |
| Local<Context> context, Local<Name> name, |
| AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter = nullptr, |
| Local<Value> data = Local<Value>(), PropertyAttribute attributes = None, |
| SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect); |
| |
| /** |
| * Attempts to create a property with the given name which behaves like a data |
| * property, except that the provided getter is invoked (and provided with the |
| * data value) to supply its value the first time it is read. After the |
| * property is accessed once, it is replaced with an ordinary data property. |
| * |
| * Analogous to Template::SetLazyDataProperty. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> SetLazyDataProperty( |
| Local<Context> context, Local<Name> name, |
| AccessorNameGetterCallback getter, Local<Value> data = Local<Value>(), |
| PropertyAttribute attributes = None, |
| SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect); |
| |
| /** |
| * Functionality for private properties. |
| * This is an experimental feature, use at your own risk. |
| * Note: Private properties are not inherited. Do not rely on this, since it |
| * may change. |
| */ |
| Maybe<bool> HasPrivate(Local<Context> context, Local<Private> key); |
| Maybe<bool> SetPrivate(Local<Context> context, Local<Private> key, |
| Local<Value> value); |
| Maybe<bool> DeletePrivate(Local<Context> context, Local<Private> key); |
| MaybeLocal<Value> GetPrivate(Local<Context> context, Local<Private> key); |
| |
| /** |
| * Returns an array containing the names of the enumerable properties |
| * of this object, including properties from prototype objects. The |
| * array returned by this method contains the same values as would |
| * be enumerated by a for-in statement over this object. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetPropertyNames()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetPropertyNames( |
| Local<Context> context); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetPropertyNames( |
| Local<Context> context, KeyCollectionMode mode, |
| PropertyFilter property_filter, IndexFilter index_filter, |
| KeyConversionMode key_conversion = KeyConversionMode::kKeepNumbers); |
| |
| /** |
| * This function has the same functionality as GetPropertyNames but |
| * the returned array doesn't contain the names of properties from |
| * prototype objects. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetOwnPropertyNames()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetOwnPropertyNames( |
| Local<Context> context); |
| |
| /** |
| * Returns an array containing the names of the filtered properties |
| * of this object, including properties from prototype objects. The |
| * array returned by this method contains the same values as would |
| * be enumerated by a for-in statement over this object. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetOwnPropertyNames( |
| Local<Context> context, PropertyFilter filter, |
| KeyConversionMode key_conversion = KeyConversionMode::kKeepNumbers); |
| |
| /** |
| * Get the prototype object. This does not skip objects marked to |
| * be skipped by __proto__ and it does not consult the security |
| * handler. |
| */ |
| Local<Value> GetPrototype(); |
| |
| /** |
| * Set the prototype object. This does not skip objects marked to |
| * be skipped by __proto__ and it does not consult the security |
| * handler. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> SetPrototype(Local<Context> context, |
| Local<Value> prototype); |
| |
| /** |
| * Finds an instance of the given function template in the prototype |
| * chain. |
| */ |
| Local<Object> FindInstanceInPrototypeChain(Local<FunctionTemplate> tmpl); |
| |
| /** |
| * Call builtin Object.prototype.toString on this object. |
| * This is different from Value::ToString() that may call |
| * user-defined toString function. This one does not. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<String> ObjectProtoToString( |
| Local<Context> context); |
| |
| /** |
| * Returns the name of the function invoked as a constructor for this object. |
| */ |
| Local<String> GetConstructorName(); |
| |
| /** |
| * Sets the integrity level of the object. |
| */ |
| Maybe<bool> SetIntegrityLevel(Local<Context> context, IntegrityLevel level); |
| |
| /** Gets the number of internal fields for this Object. */ |
| int InternalFieldCount(); |
| |
| /** Same as above, but works for Persistents */ |
| V8_INLINE static int InternalFieldCount( |
| const PersistentBase<Object>& object) { |
| return object.val_->InternalFieldCount(); |
| } |
| |
| /** Gets the value from an internal field. */ |
| V8_INLINE Local<Value> GetInternalField(int index); |
| |
| /** Sets the value in an internal field. */ |
| void SetInternalField(int index, Local<Value> value); |
| |
| /** |
| * Gets a 2-byte-aligned native pointer from an internal field. This field |
| * must have been set by SetAlignedPointerInInternalField, everything else |
| * leads to undefined behavior. |
| */ |
| V8_INLINE void* GetAlignedPointerFromInternalField(int index); |
| |
| /** Same as above, but works for Persistents */ |
| V8_INLINE static void* GetAlignedPointerFromInternalField( |
| const PersistentBase<Object>& object, int index) { |
| return object.val_->GetAlignedPointerFromInternalField(index); |
| } |
| |
| /** |
| * Sets a 2-byte-aligned native pointer in an internal field. To retrieve such |
| * a field, GetAlignedPointerFromInternalField must be used, everything else |
| * leads to undefined behavior. |
| */ |
| void SetAlignedPointerInInternalField(int index, void* value); |
| void SetAlignedPointerInInternalFields(int argc, int indices[], |
| void* values[]); |
| |
| /** |
| * HasOwnProperty() is like JavaScript's Object.prototype.hasOwnProperty(). |
| * |
| * See also v8::Object::Has() and v8::Object::HasRealNamedProperty(). |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context, |
| Local<Name> key); |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context, |
| uint32_t index); |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool HasRealNamedProperty(Local<String> key)); |
| /** |
| * Use HasRealNamedProperty() if you want to check if an object has an own |
| * property without causing side effects, i.e., without calling interceptors. |
| * |
| * This function is similar to v8::Object::HasOwnProperty(), but it does not |
| * call interceptors. |
| * |
| * \note Consider using non-masking interceptors, i.e., the interceptors are |
| * not called if the receiver has the real named property. See |
| * `v8::PropertyHandlerFlags::kNonMasking`. |
| * |
| * See also v8::Object::Has(). |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedProperty(Local<Context> context, |
| Local<Name> key); |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool HasRealIndexedProperty(uint32_t index)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasRealIndexedProperty( |
| Local<Context> context, uint32_t index); |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool HasRealNamedCallbackProperty(Local<String> key)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedCallbackProperty( |
| Local<Context> context, Local<Name> key); |
| |
| /** |
| * If result.IsEmpty() no real property was located in the prototype chain. |
| * This means interceptors in the prototype chain are not called. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedPropertyInPrototypeChain( |
| Local<Context> context, Local<Name> key); |
| |
| /** |
| * Gets the property attributes of a real property in the prototype chain, |
| * which can be None or any combination of ReadOnly, DontEnum and DontDelete. |
| * Interceptors in the prototype chain are not called. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> |
| GetRealNamedPropertyAttributesInPrototypeChain(Local<Context> context, |
| Local<Name> key); |
| |
| /** |
| * If result.IsEmpty() no real property was located on the object or |
| * in the prototype chain. |
| * This means interceptors in the prototype chain are not called. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedProperty( |
| Local<Context> context, Local<Name> key); |
| |
| /** |
| * Gets the property attributes of a real property which can be |
| * None or any combination of ReadOnly, DontEnum and DontDelete. |
| * Interceptors in the prototype chain are not called. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetRealNamedPropertyAttributes( |
| Local<Context> context, Local<Name> key); |
| |
| /** Tests for a named lookup interceptor.*/ |
| bool HasNamedLookupInterceptor(); |
| |
| /** Tests for an index lookup interceptor.*/ |
| bool HasIndexedLookupInterceptor(); |
| |
| /** |
| * Returns the identity hash for this object. The current implementation |
| * uses a hidden property on the object to store the identity hash. |
| * |
| * The return value will never be 0. Also, it is not guaranteed to be |
| * unique. |
| */ |
| int GetIdentityHash(); |
| |
| /** |
| * Clone this object with a fast but shallow copy. Values will point |
| * to the same values as the original object. |
| */ |
| // TODO(dcarney): take an isolate and optionally bail out? |
| Local<Object> Clone(); |
| |
| /** |
| * Returns the context in which the object was created. |
| */ |
| Local<Context> CreationContext(); |
| |
| /** Same as above, but works for Persistents */ |
| V8_INLINE static Local<Context> CreationContext( |
| const PersistentBase<Object>& object) { |
| return object.val_->CreationContext(); |
| } |
| |
| /** |
| * Checks whether a callback is set by the |
| * ObjectTemplate::SetCallAsFunctionHandler method. |
| * When an Object is callable this method returns true. |
| */ |
| bool IsCallable(); |
| |
| /** |
| * True if this object is a constructor. |
| */ |
| bool IsConstructor(); |
| |
| /** |
| * Call an Object as a function if a callback is set by the |
| * ObjectTemplate::SetCallAsFunctionHandler method. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsFunction(Local<Context> context, |
| Local<Value> recv, |
| int argc, |
| Local<Value> argv[]); |
| |
| /** |
| * Call an Object as a constructor if a callback is set by the |
| * ObjectTemplate::SetCallAsFunctionHandler method. |
| * Note: This method behaves like the Function::NewInstance method. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsConstructor( |
| Local<Context> context, int argc, Local<Value> argv[]); |
| |
| /** |
| * Return the isolate to which the Object belongs to. |
| */ |
| Isolate* GetIsolate(); |
| |
| /** |
| * If this object is a Set, Map, WeakSet or WeakMap, this returns a |
| * representation of the elements of this object as an array. |
| * If this object is a SetIterator or MapIterator, this returns all |
| * elements of the underlying collection, starting at the iterator's current |
| * position. |
| * For other types, this will return an empty MaybeLocal<Array> (without |
| * scheduling an exception). |
| */ |
| MaybeLocal<Array> PreviewEntries(bool* is_key_value); |
| |
| static Local<Object> New(Isolate* isolate); |
| |
| V8_INLINE static Object* Cast(Value* obj); |
| |
| private: |
| Object(); |
| static void CheckCast(Value* obj); |
| Local<Value> SlowGetInternalField(int index); |
| void* SlowGetAlignedPointerFromInternalField(int index); |
| }; |
| |
| |
| /** |
| * An instance of the built-in array constructor (ECMA-262, 15.4.2). |
| */ |
| class V8_EXPORT Array : public Object { |
| public: |
| uint32_t Length() const; |
| |
| /** |
| * Creates a JavaScript array with the given length. If the length |
| * is negative the returned array will have length 0. |
| */ |
| static Local<Array> New(Isolate* isolate, int length = 0); |
| |
| V8_INLINE static Array* Cast(Value* obj); |
| private: |
| Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in Map constructor (ECMA-262, 6th Edition, 23.1.1). |
| */ |
| class V8_EXPORT Map : public Object { |
| public: |
| size_t Size() const; |
| void Clear(); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, |
| Local<Value> key); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Map> Set(Local<Context> context, |
| Local<Value> key, |
| Local<Value> value); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, |
| Local<Value> key); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context, |
| Local<Value> key); |
| |
| /** |
| * Returns an array of length Size() * 2, where index N is the Nth key and |
| * index N + 1 is the Nth value. |
| */ |
| Local<Array> AsArray() const; |
| |
| /** |
| * Creates a new empty Map. |
| */ |
| static Local<Map> New(Isolate* isolate); |
| |
| V8_INLINE static Map* Cast(Value* obj); |
| |
| private: |
| Map(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in Set constructor (ECMA-262, 6th Edition, 23.2.1). |
| */ |
| class V8_EXPORT Set : public Object { |
| public: |
| size_t Size() const; |
| void Clear(); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Set> Add(Local<Context> context, |
| Local<Value> key); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, |
| Local<Value> key); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context, |
| Local<Value> key); |
| |
| /** |
| * Returns an array of the keys in this Set. |
| */ |
| Local<Array> AsArray() const; |
| |
| /** |
| * Creates a new empty Set. |
| */ |
| static Local<Set> New(Isolate* isolate); |
| |
| V8_INLINE static Set* Cast(Value* obj); |
| |
| private: |
| Set(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| template<typename T> |
| class ReturnValue { |
| public: |
| template <class S> V8_INLINE ReturnValue(const ReturnValue<S>& that) |
| : value_(that.value_) { |
| TYPE_CHECK(T, S); |
| } |
| // Local setters |
| template <typename S> |
| V8_INLINE V8_DEPRECATE_SOON("Use Global<> instead", |
| void Set(const Persistent<S>& handle)); |
| template <typename S> |
| V8_INLINE void Set(const Global<S>& handle); |
| template <typename S> |
| V8_INLINE void Set(const Local<S> handle); |
| // Fast primitive setters |
| V8_INLINE void Set(bool value); |
| V8_INLINE void Set(double i); |
| V8_INLINE void Set(int32_t i); |
| V8_INLINE void Set(uint32_t i); |
| // Fast JS primitive setters |
| V8_INLINE void SetNull(); |
| V8_INLINE void SetUndefined(); |
| V8_INLINE void SetEmptyString(); |
| // Convenience getter for Isolate |
| V8_INLINE Isolate* GetIsolate() const; |
| |
| // Pointer setter: Uncompilable to prevent inadvertent misuse. |
| template <typename S> |
| V8_INLINE void Set(S* whatever); |
| |
| // Getter. Creates a new Local<> so it comes with a certain performance |
| // hit. If the ReturnValue was not yet set, this will return the undefined |
| // value. |
| V8_INLINE Local<Value> Get() const; |
| |
| private: |
| template<class F> friend class ReturnValue; |
| template<class F> friend class FunctionCallbackInfo; |
| template<class F> friend class PropertyCallbackInfo; |
| template <class F, class G, class H> |
| friend class PersistentValueMapBase; |
| V8_INLINE void SetInternal(internal::Object* value) { *value_ = value; } |
| V8_INLINE internal::Object* GetDefaultValue(); |
| V8_INLINE explicit ReturnValue(internal::Object** slot); |
| internal::Object** value_; |
| }; |
| |
| |
| /** |
| * The argument information given to function call callbacks. This |
| * class provides access to information about the context of the call, |
| * including the receiver, the number and values of arguments, and |
| * the holder of the function. |
| */ |
| template<typename T> |
| class FunctionCallbackInfo { |
| public: |
| /** The number of available arguments. */ |
| V8_INLINE int Length() const; |
| /** Accessor for the available arguments. */ |
| V8_INLINE Local<Value> operator[](int i) const; |
| /** Returns the receiver. This corresponds to the "this" value. */ |
| V8_INLINE Local<Object> This() const; |
| /** |
| * If the callback was created without a Signature, this is the same |
| * value as This(). If there is a signature, and the signature didn't match |
| * This() but one of its hidden prototypes, this will be the respective |
| * hidden prototype. |
| * |
| * Note that this is not the prototype of This() on which the accessor |
| * referencing this callback was found (which in V8 internally is often |
| * referred to as holder [sic]). |
| */ |
| V8_INLINE Local<Object> Holder() const; |
| /** For construct calls, this returns the "new.target" value. */ |
| V8_INLINE Local<Value> NewTarget() const; |
| /** Indicates whether this is a regular call or a construct call. */ |
| V8_INLINE bool IsConstructCall() const; |
| /** The data argument specified when creating the callback. */ |
| V8_INLINE Local<Value> Data() const; |
| /** The current Isolate. */ |
| V8_INLINE Isolate* GetIsolate() const; |
| /** The ReturnValue for the call. */ |
| V8_INLINE ReturnValue<T> GetReturnValue() const; |
| // This shouldn't be public, but the arm compiler needs it. |
| static const int kArgsLength = 6; |
| |
| protected: |
| friend class internal::FunctionCallbackArguments; |
| friend class internal::CustomArguments<FunctionCallbackInfo>; |
| friend class debug::ConsoleCallArguments; |
| static const int kHolderIndex = 0; |
| static const int kIsolateIndex = 1; |
| static const int kReturnValueDefaultValueIndex = 2; |
| static const int kReturnValueIndex = 3; |
| static const int kDataIndex = 4; |
| static const int kNewTargetIndex = 5; |
| |
| V8_INLINE FunctionCallbackInfo(internal::Object** implicit_args, |
| internal::Object** values, int length); |
| internal::Object** implicit_args_; |
| internal::Object** values_; |
| int length_; |
| }; |
| |
| |
| /** |
| * The information passed to a property callback about the context |
| * of the property access. |
| */ |
| template<typename T> |
| class PropertyCallbackInfo { |
| public: |
| /** |
| * \return The isolate of the property access. |
| */ |
| V8_INLINE Isolate* GetIsolate() const; |
| |
| /** |
| * \return The data set in the configuration, i.e., in |
| * `NamedPropertyHandlerConfiguration` or |
| * `IndexedPropertyHandlerConfiguration.` |
| */ |
| V8_INLINE Local<Value> Data() const; |
| |
| /** |
| * \return The receiver. In many cases, this is the object on which the |
| * property access was intercepted. When using |
| * `Reflect.get`, `Function.prototype.call`, or similar functions, it is the |
| * object passed in as receiver or thisArg. |
| * |
| * \code |
| * void GetterCallback(Local<Name> name, |
| * const v8::PropertyCallbackInfo<v8::Value>& info) { |
| * auto context = info.GetIsolate()->GetCurrentContext(); |
| * |
| * v8::Local<v8::Value> a_this = |
| * info.This() |
| * ->GetRealNamedProperty(context, v8_str("a")) |
| * .ToLocalChecked(); |
| * v8::Local<v8::Value> a_holder = |
| * info.Holder() |
| * ->GetRealNamedProperty(context, v8_str("a")) |
| * .ToLocalChecked(); |
| * |
| * CHECK(v8_str("r")->Equals(context, a_this).FromJust()); |
| * CHECK(v8_str("obj")->Equals(context, a_holder).FromJust()); |
| * |
| * info.GetReturnValue().Set(name); |
| * } |
| * |
| * v8::Local<v8::FunctionTemplate> templ = |
| * v8::FunctionTemplate::New(isolate); |
| * templ->InstanceTemplate()->SetHandler( |
| * v8::NamedPropertyHandlerConfiguration(GetterCallback)); |
| * LocalContext env; |
| * env->Global() |
| * ->Set(env.local(), v8_str("obj"), templ->GetFunction(env.local()) |
| * .ToLocalChecked() |
| * ->NewInstance(env.local()) |
| * .ToLocalChecked()) |
| * .FromJust(); |
| * |
| * CompileRun("obj.a = 'obj'; var r = {a: 'r'}; Reflect.get(obj, 'x', r)"); |
| * \endcode |
| */ |
| V8_INLINE Local<Object> This() const; |
| |
| /** |
| * \return The object in the prototype chain of the receiver that has the |
| * interceptor. Suppose you have `x` and its prototype is `y`, and `y` |
| * has an interceptor. Then `info.This()` is `x` and `info.Holder()` is `y`. |
| * The Holder() could be a hidden object (the global object, rather |
| * than the global proxy). |
| * |
| * \note For security reasons, do not pass the object back into the runtime. |
| */ |
| V8_INLINE Local<Object> Holder() const; |
| |
| /** |
| * \return The return value of the callback. |
| * Can be changed by calling Set(). |
| * \code |
| * info.GetReturnValue().Set(...) |
| * \endcode |
| * |
| */ |
| V8_INLINE ReturnValue<T> GetReturnValue() const; |
| |
| /** |
| * \return True if the intercepted function should throw if an error occurs. |
| * Usually, `true` corresponds to `'use strict'`. |
| * |
| * \note Always `false` when intercepting `Reflect.set()` |
| * independent of the language mode. |
| */ |
| V8_INLINE bool ShouldThrowOnError() const; |
| |
| // This shouldn't be public, but the arm compiler needs it. |
| static const int kArgsLength = 7; |
| |
| protected: |
| friend class MacroAssembler; |
| friend class internal::PropertyCallbackArguments; |
| friend class internal::CustomArguments<PropertyCallbackInfo>; |
| static const int kShouldThrowOnErrorIndex = 0; |
| static const int kHolderIndex = 1; |
| static const int kIsolateIndex = 2; |
| static const int kReturnValueDefaultValueIndex = 3; |
| static const int kReturnValueIndex = 4; |
| static const int kDataIndex = 5; |
| static const int kThisIndex = 6; |
| |
| V8_INLINE PropertyCallbackInfo(internal::Object** args) : args_(args) {} |
| internal::Object** args_; |
| }; |
| |
| |
| typedef void (*FunctionCallback)(const FunctionCallbackInfo<Value>& info); |
| |
| enum class ConstructorBehavior { kThrow, kAllow }; |
| |
| /** |
| * A JavaScript function object (ECMA-262, 15.3). |
| */ |
| class V8_EXPORT Function : public Object { |
| public: |
| /** |
| * Create a function in the current execution context |
| * for a given FunctionCallback. |
| */ |
| static MaybeLocal<Function> New( |
| Local<Context> context, FunctionCallback callback, |
| Local<Value> data = Local<Value>(), int length = 0, |
| ConstructorBehavior behavior = ConstructorBehavior::kAllow, |
| SideEffectType side_effect_type = SideEffectType::kHasSideEffect); |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<Function> New(Isolate* isolate, FunctionCallback callback, |
| Local<Value> data = Local<Value>(), int length = 0)); |
| |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance( |
| Local<Context> context, int argc, Local<Value> argv[]) const; |
| |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance( |
| Local<Context> context) const { |
| return NewInstance(context, 0, nullptr); |
| } |
| |
| /** |
| * When side effect checks are enabled, passing kHasNoSideEffect allows the |
| * constructor to be invoked without throwing. Calls made within the |
| * constructor are still checked. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstanceWithSideEffectType( |
| Local<Context> context, int argc, Local<Value> argv[], |
| SideEffectType side_effect_type = SideEffectType::kHasSideEffect) const; |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Value> Call(Local<Value> recv, int argc, |
| Local<Value> argv[])); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Call(Local<Context> context, |
| Local<Value> recv, int argc, |
| Local<Value> argv[]); |
| |
| void SetName(Local<String> name); |
| Local<Value> GetName() const; |
| |
| /** |
| * Name inferred from variable or property assignment of this function. |
| * Used to facilitate debugging and profiling of JavaScript code written |
| * in an OO style, where many functions are anonymous but are assigned |
| * to object properties. |
| */ |
| Local<Value> GetInferredName() const; |
| |
| /** |
| * displayName if it is set, otherwise name if it is configured, otherwise |
| * function name, otherwise inferred name. |
| */ |
| Local<Value> GetDebugName() const; |
| |
| /** |
| * User-defined name assigned to the "displayName" property of this function. |
| * Used to facilitate debugging and profiling of JavaScript code. |
| */ |
| Local<Value> GetDisplayName() const; |
| |
| /** |
| * Returns zero based line number of function body and |
| * kLineOffsetNotFound if no information available. |
| */ |
| int GetScriptLineNumber() const; |
| /** |
| * Returns zero based column number of function body and |
| * kLineOffsetNotFound if no information available. |
| */ |
| int GetScriptColumnNumber() const; |
| |
| /** |
| * Returns scriptId. |
| */ |
| int ScriptId() const; |
| |
| /** |
| * Returns the original function if this function is bound, else returns |
| * v8::Undefined. |
| */ |
| Local<Value> GetBoundFunction() const; |
| |
| ScriptOrigin GetScriptOrigin() const; |
| V8_INLINE static Function* Cast(Value* obj); |
| static const int kLineOffsetNotFound; |
| |
| private: |
| Function(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| #ifndef V8_PROMISE_INTERNAL_FIELD_COUNT |
| // The number of required internal fields can be defined by embedder. |
| #define V8_PROMISE_INTERNAL_FIELD_COUNT 0 |
| #endif |
| |
| /** |
| * An instance of the built-in Promise constructor (ES6 draft). |
| */ |
| class V8_EXPORT Promise : public Object { |
| public: |
| /** |
| * State of the promise. Each value corresponds to one of the possible values |
| * of the [[PromiseState]] field. |
| */ |
| enum PromiseState { kPending, kFulfilled, kRejected }; |
| |
| class V8_EXPORT Resolver : public Object { |
| public: |
| /** |
| * Create a new resolver, along with an associated promise in pending state. |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Resolver> New( |
| Local<Context> context); |
| |
| /** |
| * Extract the associated promise. |
| */ |
| Local<Promise> GetPromise(); |
| |
| /** |
| * Resolve/reject the associated promise with a given value. |
| * Ignored if the promise is no longer pending. |
| */ |
| V8_WARN_UNUSED_RESULT Maybe<bool> Resolve(Local<Context> context, |
| Local<Value> value); |
| |
| V8_WARN_UNUSED_RESULT Maybe<bool> Reject(Local<Context> context, |
| Local<Value> value); |
| |
| V8_INLINE static Resolver* Cast(Value* obj); |
| |
| private: |
| Resolver(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * Register a resolution/rejection handler with a promise. |
| * The handler is given the respective resolution/rejection value as |
| * an argument. If the promise is already resolved/rejected, the handler is |
| * invoked at the end of turn. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Catch(Local<Context> context, |
| Local<Function> handler); |
| |
| V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Then(Local<Context> context, |
| Local<Function> handler); |
| |
| /** |
| * Returns true if the promise has at least one derived promise, and |
| * therefore resolve/reject handlers (including default handler). |
| */ |
| bool HasHandler(); |
| |
| /** |
| * Returns the content of the [[PromiseResult]] field. The Promise must not |
| * be pending. |
| */ |
| Local<Value> Result(); |
| |
| /** |
| * Returns the value of the [[PromiseState]] field. |
| */ |
| PromiseState State(); |
| |
| V8_INLINE static Promise* Cast(Value* obj); |
| |
| static const int kEmbedderFieldCount = V8_PROMISE_INTERNAL_FIELD_COUNT; |
| |
| private: |
| Promise(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * An instance of a Property Descriptor, see Ecma-262 6.2.4. |
| * |
| * Properties in a descriptor are present or absent. If you do not set |
| * `enumerable`, `configurable`, and `writable`, they are absent. If `value`, |
| * `get`, or `set` are absent, but you must specify them in the constructor, use |
| * empty handles. |
| * |
| * Accessors `get` and `set` must be callable or undefined if they are present. |
| * |
| * \note Only query properties if they are present, i.e., call `x()` only if |
| * `has_x()` returns true. |
| * |
| * \code |
| * // var desc = {writable: false} |
| * v8::PropertyDescriptor d(Local<Value>()), false); |
| * d.value(); // error, value not set |
| * if (d.has_writable()) { |
| * d.writable(); // false |
| * } |
| * |
| * // var desc = {value: undefined} |
| * v8::PropertyDescriptor d(v8::Undefined(isolate)); |
| * |
| * // var desc = {get: undefined} |
| * v8::PropertyDescriptor d(v8::Undefined(isolate), Local<Value>())); |
| * \endcode |
| */ |
| class V8_EXPORT PropertyDescriptor { |
| public: |
| // GenericDescriptor |
| PropertyDescriptor(); |
| |
| // DataDescriptor |
| PropertyDescriptor(Local<Value> value); |
| |
| // DataDescriptor with writable property |
| PropertyDescriptor(Local<Value> value, bool writable); |
| |
| // AccessorDescriptor |
| PropertyDescriptor(Local<Value> get, Local<Value> set); |
| |
| ~PropertyDescriptor(); |
| |
| Local<Value> value() const; |
| bool has_value() const; |
| |
| Local<Value> get() const; |
| bool has_get() const; |
| Local<Value> set() const; |
| bool has_set() const; |
| |
| void set_enumerable(bool enumerable); |
| bool enumerable() const; |
| bool has_enumerable() const; |
| |
| void set_configurable(bool configurable); |
| bool configurable() const; |
| bool has_configurable() const; |
| |
| bool writable() const; |
| bool has_writable() const; |
| |
| struct PrivateData; |
| PrivateData* get_private() const { return private_; } |
| |
| PropertyDescriptor(const PropertyDescriptor&) = delete; |
| void operator=(const PropertyDescriptor&) = delete; |
| |
| private: |
| PrivateData* private_; |
| }; |
| |
| /** |
| * An instance of the built-in Proxy constructor (ECMA-262, 6th Edition, |
| * 26.2.1). |
| */ |
| class V8_EXPORT Proxy : public Object { |
| public: |
| Local<Value> GetTarget(); |
| Local<Value> GetHandler(); |
| bool IsRevoked(); |
| void Revoke(); |
| |
| /** |
| * Creates a new Proxy for the target object. |
| */ |
| static MaybeLocal<Proxy> New(Local<Context> context, |
| Local<Object> local_target, |
| Local<Object> local_handler); |
| |
| V8_INLINE static Proxy* Cast(Value* obj); |
| |
| private: |
| Proxy(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| // TODO(mtrofin): rename WasmCompiledModule to WasmModuleObject, for |
| // consistency with internal APIs. |
| class V8_EXPORT WasmCompiledModule : public Object { |
| public: |
| typedef std::pair<std::unique_ptr<const uint8_t[]>, size_t> SerializedModule; |
| |
| // The COMMA macro allows us to use ',' inside of the V8_DEPRECATED macro. |
| #define COMMA , |
| V8_DEPRECATED( |
| "Use BufferReference.", |
| typedef std::pair<const uint8_t * COMMA size_t> CallerOwnedBuffer); |
| #undef COMMA |
| |
| /** |
| * A unowned reference to a byte buffer. |
| */ |
| struct BufferReference { |
| const uint8_t* start; |
| size_t size; |
| BufferReference(const uint8_t* start, size_t size) |
| : start(start), size(size) {} |
| // Temporarily allow conversion to and from CallerOwnedBuffer. |
| V8_DEPRECATED( |
| "Use BufferReference directly.", |
| inline BufferReference(CallerOwnedBuffer)); // NOLINT(runtime/explicit) |
| V8_DEPRECATED("Use BufferReference directly.", |
| inline operator CallerOwnedBuffer()); |
| }; |
| |
| /** |
| * An opaque, native heap object for transferring wasm modules. It |
| * supports move semantics, and does not support copy semantics. |
| */ |
| class TransferrableModule final { |
| public: |
| TransferrableModule(TransferrableModule&& src) = default; |
| TransferrableModule(const TransferrableModule& src) = delete; |
| |
| TransferrableModule& operator=(TransferrableModule&& src) = default; |
| TransferrableModule& operator=(const TransferrableModule& src) = delete; |
| |
| private: |
| typedef std::shared_ptr<internal::wasm::NativeModule> SharedModule; |
| typedef std::pair<std::unique_ptr<const uint8_t[]>, size_t> OwnedBuffer; |
| friend class WasmCompiledModule; |
| explicit TransferrableModule(SharedModule shared_module) |
| : shared_module_(std::move(shared_module)) {} |
| TransferrableModule(OwnedBuffer serialized, OwnedBuffer bytes) |
| : serialized_(std::move(serialized)), wire_bytes_(std::move(bytes)) {} |
| |
| SharedModule shared_module_; |
| OwnedBuffer serialized_ = {nullptr, 0}; |
| OwnedBuffer wire_bytes_ = {nullptr, 0}; |
| }; |
| |
| /** |
| * Get an in-memory, non-persistable, and context-independent (meaning, |
| * suitable for transfer to another Isolate and Context) representation |
| * of this wasm compiled module. |
| */ |
| TransferrableModule GetTransferrableModule(); |
| |
| /** |
| * Efficiently re-create a WasmCompiledModule, without recompiling, from |
| * a TransferrableModule. |
| */ |
| static MaybeLocal<WasmCompiledModule> FromTransferrableModule( |
| Isolate* isolate, const TransferrableModule&); |
| |
| /** |
| * Get the wasm-encoded bytes that were used to compile this module. |
| */ |
| BufferReference GetWasmWireBytesRef(); |
| V8_DEPRECATED("Use GetWasmWireBytesRef version.", |
| Local<String> GetWasmWireBytes()); |
| |
| /** |
| * Serialize the compiled module. The serialized data does not include the |
| * uncompiled bytes. |
| */ |
| SerializedModule Serialize(); |
| |
| /** |
| * If possible, deserialize the module, otherwise compile it from the provided |
| * uncompiled bytes. |
| */ |
| static MaybeLocal<WasmCompiledModule> DeserializeOrCompile( |
| Isolate* isolate, BufferReference serialized_module, |
| BufferReference wire_bytes); |
| V8_INLINE static WasmCompiledModule* Cast(Value* obj); |
| |
| private: |
| static MaybeLocal<WasmCompiledModule> Deserialize( |
| Isolate* isolate, BufferReference serialized_module, |
| BufferReference wire_bytes); |
| static MaybeLocal<WasmCompiledModule> Compile(Isolate* isolate, |
| const uint8_t* start, |
| size_t length); |
| static BufferReference AsReference( |
| const TransferrableModule::OwnedBuffer& buff) { |
| return {buff.first.get(), buff.second}; |
| } |
| |
| WasmCompiledModule(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| // TODO(clemensh): Remove after M70 branch. |
| WasmCompiledModule::BufferReference::BufferReference( |
| WasmCompiledModule::CallerOwnedBuffer buf) |
| : BufferReference(buf.first, buf.second) {} |
| WasmCompiledModule::BufferReference:: |
| operator WasmCompiledModule::CallerOwnedBuffer() { |
| return {start, size}; |
| } |
| |
| /** |
| * The V8 interface for WebAssembly streaming compilation. When streaming |
| * compilation is initiated, V8 passes a {WasmStreaming} object to the embedder |
| * such that the embedder can pass the input butes for streaming compilation to |
| * V8. |
| */ |
| class V8_EXPORT WasmStreaming final { |
| public: |
| class WasmStreamingImpl; |
| |
| WasmStreaming(std::unique_ptr<WasmStreamingImpl> impl); |
| |
| ~WasmStreaming(); |
| |
| /** |
| * Pass a new chunck of bytes to WebAssembly streaming compilation. |
| * The buffer passed into {OnBytesReceived} is owned by the caller. |
| */ |
| void OnBytesReceived(const uint8_t* bytes, size_t size); |
| |
| /** |
| * {Finish} should be called after all received bytes where passed to |
| * {OnBytesReceived} to tell V8 that there will be no more bytes. {Finish} |
| * does not have to be called after {Abort} has been called already. |
| */ |
| void Finish(); |
| |
| /** |
| * Abort streaming compilation. If {exception} has a value, then the promise |
| * associated with streaming compilation is rejected with that value. If |
| * {exception} does not have value, the promise does not get rejected. |
| */ |
| void Abort(MaybeLocal<Value> exception); |
| |
| /** |
| * Unpacks a {WasmStreaming} object wrapped in a {Managed} for the embedder. |
| * Since the embedder is on the other side of the API, it cannot unpack the |
| * {Managed} itself. |
| */ |
| static std::shared_ptr<WasmStreaming> Unpack(Isolate* isolate, |
| Local<Value> value); |
| |
| private: |
| std::unique_ptr<WasmStreamingImpl> impl_; |
| }; |
| |
| // TODO(mtrofin): when streaming compilation is done, we can rename this |
| // to simply WasmModuleObjectBuilder |
| class V8_EXPORT WasmModuleObjectBuilderStreaming final { |
| public: |
| explicit WasmModuleObjectBuilderStreaming(Isolate* isolate); |
| /** |
| * The buffer passed into OnBytesReceived is owned by the caller. |
| */ |
| void OnBytesReceived(const uint8_t*, size_t size); |
| void Finish(); |
| /** |
| * Abort streaming compilation. If {exception} has a value, then the promise |
| * associated with streaming compilation is rejected with that value. If |
| * {exception} does not have value, the promise does not get rejected. |
| */ |
| void Abort(MaybeLocal<Value> exception); |
| Local<Promise> GetPromise(); |
| |
| ~WasmModuleObjectBuilderStreaming(); |
| |
| private: |
| WasmModuleObjectBuilderStreaming(const WasmModuleObjectBuilderStreaming&) = |
| delete; |
| WasmModuleObjectBuilderStreaming(WasmModuleObjectBuilderStreaming&&) = |
| default; |
| WasmModuleObjectBuilderStreaming& operator=( |
| const WasmModuleObjectBuilderStreaming&) = delete; |
| WasmModuleObjectBuilderStreaming& operator=( |
| WasmModuleObjectBuilderStreaming&&) = default; |
| Isolate* isolate_ = nullptr; |
| |
| #if V8_CC_MSVC |
| /** |
| * We don't need the static Copy API, so the default |
| * NonCopyablePersistentTraits would be sufficient, however, |
| * MSVC eagerly instantiates the Copy. |
| * We ensure we don't use Copy, however, by compiling with the |
| * defaults everywhere else. |
| */ |
| Persistent<Promise, CopyablePersistentTraits<Promise>> promise_; |
| #else |
| Persistent<Promise> promise_; |
| #endif |
| std::shared_ptr<internal::wasm::StreamingDecoder> streaming_decoder_; |
| }; |
| |
| #ifndef V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT |
| // The number of required internal fields can be defined by embedder. |
| #define V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT 2 |
| #endif |
| |
| |
| enum class ArrayBufferCreationMode { kInternalized, kExternalized }; |
| |
| |
| /** |
| * An instance of the built-in ArrayBuffer constructor (ES6 draft 15.13.5). |
| */ |
| class V8_EXPORT ArrayBuffer : public Object { |
| public: |
| /** |
| * A thread-safe allocator that V8 uses to allocate |ArrayBuffer|'s memory. |
| * The allocator is a global V8 setting. It has to be set via |
| * Isolate::CreateParams. |
| * |
| * Memory allocated through this allocator by V8 is accounted for as external |
| * memory by V8. Note that V8 keeps track of the memory for all internalized |
| * |ArrayBuffer|s. Responsibility for tracking external memory (using |
| * Isolate::AdjustAmountOfExternalAllocatedMemory) is handed over to the |
| * embedder upon externalization and taken over upon internalization (creating |
| * an internalized buffer from an existing buffer). |
| * |
| * Note that it is unsafe to call back into V8 from any of the allocator |
| * functions. |
| */ |
| class V8_EXPORT Allocator { // NOLINT |
| public: |
| virtual ~Allocator() {} |
| |
| /** |
| * Allocate |length| bytes. Return NULL if allocation is not successful. |
| * Memory should be initialized to zeroes. |
| */ |
| virtual void* Allocate(size_t length) = 0; |
| |
| /** |
| * Allocate |length| bytes. Return NULL if allocation is not successful. |
| * Memory does not have to be initialized. |
| */ |
| virtual void* AllocateUninitialized(size_t length) = 0; |
| |
| /** |
| * Free the memory block of size |length|, pointed to by |data|. |
| * That memory is guaranteed to be previously allocated by |Allocate|. |
| */ |
| virtual void Free(void* data, size_t length) = 0; |
| |
| /** |
| * ArrayBuffer allocation mode. kNormal is a malloc/free style allocation, |
| * while kReservation is for larger allocations with the ability to set |
| * access permissions. |
| */ |
| enum class AllocationMode { kNormal, kReservation }; |
| |
| /** |
| * malloc/free based convenience allocator. |
| * |
| * Caller takes ownership, i.e. the returned object needs to be freed using |
| * |delete allocator| once it is no longer in use. |
| */ |
| static Allocator* NewDefaultAllocator(); |
| }; |
| |
| /** |
| * The contents of an |ArrayBuffer|. Externalization of |ArrayBuffer| |
| * returns an instance of this class, populated, with a pointer to data |
| * and byte length. |
| * |
| * The Data pointer of ArrayBuffer::Contents must be freed using the provided |
| * deleter, which will call ArrayBuffer::Allocator::Free if the buffer |
| * was allocated with ArraryBuffer::Allocator::Allocate. |
| */ |
| class V8_EXPORT Contents { // NOLINT |
| public: |
| using DeleterCallback = void (*)(void* buffer, size_t length, void* info); |
| |
| Contents() |
| : data_(nullptr), |
| byte_length_(0), |
| allocation_base_(nullptr), |
| allocation_length_(0), |
| allocation_mode_(Allocator::AllocationMode::kNormal), |
| deleter_(nullptr), |
| deleter_data_(nullptr) {} |
| |
| void* AllocationBase() const { return allocation_base_; } |
| size_t AllocationLength() const { return allocation_length_; } |
| Allocator::AllocationMode AllocationMode() const { |
| return allocation_mode_; |
| } |
| |
| void* Data() const { return data_; } |
| size_t ByteLength() const { return byte_length_; } |
| DeleterCallback Deleter() const { return deleter_; } |
| void* DeleterData() const { return deleter_data_; } |
| |
| private: |
| Contents(void* data, size_t byte_length, void* allocation_base, |
| size_t allocation_length, |
| Allocator::AllocationMode allocation_mode, DeleterCallback deleter, |
| void* deleter_data); |
| |
| void* data_; |
| size_t byte_length_; |
| void* allocation_base_; |
| size_t allocation_length_; |
| Allocator::AllocationMode allocation_mode_; |
| DeleterCallback deleter_; |
| void* deleter_data_; |
| |
| friend class ArrayBuffer; |
| }; |
| |
| |
| /** |
| * Data length in bytes. |
| */ |
| size_t ByteLength() const; |
| |
| /** |
| * Create a new ArrayBuffer. Allocate |byte_length| bytes. |
| * Allocated memory will be owned by a created ArrayBuffer and |
| * will be deallocated when it is garbage-collected, |
| * unless the object is externalized. |
| */ |
| static Local<ArrayBuffer> New(Isolate* isolate, size_t byte_length); |
| |
| /** |
| * Create a new ArrayBuffer over an existing memory block. |
| * The created array buffer is by default immediately in externalized state. |
| * In externalized state, the memory block will not be reclaimed when a |
| * created ArrayBuffer is garbage-collected. |
| * In internalized state, the memory block will be released using |
| * |Allocator::Free| once all ArrayBuffers referencing it are collected by |
| * the garbage collector. |
| */ |
| static Local<ArrayBuffer> New( |
| Isolate* isolate, void* data, size_t byte_length, |
| ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized); |
| |
| /** |
| * Returns true if ArrayBuffer is externalized, that is, does not |
| * own its memory block. |
| */ |
| bool IsExternal() const; |
| |
| /** |
| * Returns true if this ArrayBuffer may be neutered. |
| */ |
| bool IsNeuterable() const; |
| |
| /** |
| * Neuters this ArrayBuffer and all its views (typed arrays). |
| * Neutering sets the byte length of the buffer and all typed arrays to zero, |
| * preventing JavaScript from ever accessing underlying backing store. |
| * ArrayBuffer should have been externalized and must be neuterable. |
| */ |
| void Neuter(); |
| |
| /** |
| * Make this ArrayBuffer external. The pointer to underlying memory block |
| * and byte length are returned as |Contents| structure. After ArrayBuffer |
| * had been externalized, it does no longer own the memory block. The caller |
| * should take steps to free memory when it is no longer needed. |
| * |
| * The Data pointer of ArrayBuffer::Contents must be freed using the provided |
| * deleter, which will call ArrayBuffer::Allocator::Free if the buffer |
| * was allocated with ArraryBuffer::Allocator::Allocate. |
| */ |
| Contents Externalize(); |
| |
| /** |
| * Get a pointer to the ArrayBuffer's underlying memory block without |
| * externalizing it. If the ArrayBuffer is not externalized, this pointer |
| * will become invalid as soon as the ArrayBuffer gets garbage collected. |
| * |
| * The embedder should make sure to hold a strong reference to the |
| * ArrayBuffer while accessing this pointer. |
| */ |
| Contents GetContents(); |
| |
| V8_INLINE static ArrayBuffer* Cast(Value* obj); |
| |
| static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT; |
| static const int kEmbedderFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT; |
| |
| private: |
| ArrayBuffer(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| #ifndef V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT |
| // The number of required internal fields can be defined by embedder. |
| #define V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT 2 |
| #endif |
| |
| |
| /** |
| * A base class for an instance of one of "views" over ArrayBuffer, |
| * including TypedArrays and DataView (ES6 draft 15.13). |
| */ |
| class V8_EXPORT ArrayBufferView : public Object { |
| public: |
| /** |
| * Returns underlying ArrayBuffer. |
| */ |
| Local<ArrayBuffer> Buffer(); |
| /** |
| * Byte offset in |Buffer|. |
| */ |
| size_t ByteOffset(); |
| /** |
| * Size of a view in bytes. |
| */ |
| size_t ByteLength(); |
| |
| /** |
| * Copy the contents of the ArrayBufferView's buffer to an embedder defined |
| * memory without additional overhead that calling ArrayBufferView::Buffer |
| * might incur. |
| * |
| * Will write at most min(|byte_length|, ByteLength) bytes starting at |
| * ByteOffset of the underlying buffer to the memory starting at |dest|. |
| * Returns the number of bytes actually written. |
| */ |
| size_t CopyContents(void* dest, size_t byte_length); |
| |
| /** |
| * Returns true if ArrayBufferView's backing ArrayBuffer has already been |
| * allocated. |
| */ |
| bool HasBuffer() const; |
| |
| V8_INLINE static ArrayBufferView* Cast(Value* obj); |
| |
| static const int kInternalFieldCount = |
| V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT; |
| static const int kEmbedderFieldCount = |
| V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT; |
| |
| private: |
| ArrayBufferView(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * A base class for an instance of TypedArray series of constructors |
| * (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT TypedArray : public ArrayBufferView { |
| public: |
| /* |
| * The largest typed array size that can be constructed using New. |
| */ |
| static constexpr size_t kMaxLength = internal::kSmiMaxValue; |
| |
| /** |
| * Number of elements in this typed array |
| * (e.g. for Int16Array, |ByteLength|/2). |
| */ |
| size_t Length(); |
| |
| V8_INLINE static TypedArray* Cast(Value* obj); |
| |
| private: |
| TypedArray(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Uint8Array constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Uint8Array : public TypedArray { |
| public: |
| static Local<Uint8Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Uint8Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Uint8Array* Cast(Value* obj); |
| |
| private: |
| Uint8Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Uint8ClampedArray constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Uint8ClampedArray : public TypedArray { |
| public: |
| static Local<Uint8ClampedArray> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Uint8ClampedArray> New( |
| Local<SharedArrayBuffer> shared_array_buffer, size_t byte_offset, |
| size_t length); |
| V8_INLINE static Uint8ClampedArray* Cast(Value* obj); |
| |
| private: |
| Uint8ClampedArray(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * An instance of Int8Array constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Int8Array : public TypedArray { |
| public: |
| static Local<Int8Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Int8Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Int8Array* Cast(Value* obj); |
| |
| private: |
| Int8Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Uint16Array constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Uint16Array : public TypedArray { |
| public: |
| static Local<Uint16Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Uint16Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Uint16Array* Cast(Value* obj); |
| |
| private: |
| Uint16Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Int16Array constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Int16Array : public TypedArray { |
| public: |
| static Local<Int16Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Int16Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Int16Array* Cast(Value* obj); |
| |
| private: |
| Int16Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Uint32Array constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Uint32Array : public TypedArray { |
| public: |
| static Local<Uint32Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Uint32Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Uint32Array* Cast(Value* obj); |
| |
| private: |
| Uint32Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Int32Array constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Int32Array : public TypedArray { |
| public: |
| static Local<Int32Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Int32Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Int32Array* Cast(Value* obj); |
| |
| private: |
| Int32Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Float32Array constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Float32Array : public TypedArray { |
| public: |
| static Local<Float32Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Float32Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Float32Array* Cast(Value* obj); |
| |
| private: |
| Float32Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Float64Array constructor (ES6 draft 15.13.6). |
| */ |
| class V8_EXPORT Float64Array : public TypedArray { |
| public: |
| static Local<Float64Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Float64Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Float64Array* Cast(Value* obj); |
| |
| private: |
| Float64Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * An instance of BigInt64Array constructor. |
| */ |
| class V8_EXPORT BigInt64Array : public TypedArray { |
| public: |
| static Local<BigInt64Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<BigInt64Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static BigInt64Array* Cast(Value* obj); |
| |
| private: |
| BigInt64Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * An instance of BigUint64Array constructor. |
| */ |
| class V8_EXPORT BigUint64Array : public TypedArray { |
| public: |
| static Local<BigUint64Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<BigUint64Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static BigUint64Array* Cast(Value* obj); |
| |
| private: |
| BigUint64Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * An instance of DataView constructor (ES6 draft 15.13.7). |
| */ |
| class V8_EXPORT DataView : public ArrayBufferView { |
| public: |
| static Local<DataView> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<DataView> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static DataView* Cast(Value* obj); |
| |
| private: |
| DataView(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in SharedArrayBuffer constructor. |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT SharedArrayBuffer : public Object { |
| public: |
| /** |
| * The contents of an |SharedArrayBuffer|. Externalization of |
| * |SharedArrayBuffer| returns an instance of this class, populated, with a |
| * pointer to data and byte length. |
| * |
| * The Data pointer of ArrayBuffer::Contents must be freed using the provided |
| * deleter, which will call ArrayBuffer::Allocator::Free if the buffer |
| * was allocated with ArraryBuffer::Allocator::Allocate. |
| * |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Contents { // NOLINT |
| public: |
| using Allocator = v8::ArrayBuffer::Allocator; |
| using DeleterCallback = void (*)(void* buffer, size_t length, void* info); |
| |
| Contents() |
| : data_(nullptr), |
| byte_length_(0), |
| allocation_base_(nullptr), |
| allocation_length_(0), |
| allocation_mode_(Allocator::AllocationMode::kNormal), |
| deleter_(nullptr), |
| deleter_data_(nullptr) {} |
| |
| void* AllocationBase() const { return allocation_base_; } |
| size_t AllocationLength() const { return allocation_length_; } |
| Allocator::AllocationMode AllocationMode() const { |
| return allocation_mode_; |
| } |
| |
| void* Data() const { return data_; } |
| size_t ByteLength() const { return byte_length_; } |
| DeleterCallback Deleter() const { return deleter_; } |
| void* DeleterData() const { return deleter_data_; } |
| |
| private: |
| Contents(void* data, size_t byte_length, void* allocation_base, |
| size_t allocation_length, |
| Allocator::AllocationMode allocation_mode, DeleterCallback deleter, |
| void* deleter_data); |
| |
| void* data_; |
| size_t byte_length_; |
| void* allocation_base_; |
| size_t allocation_length_; |
| Allocator::AllocationMode allocation_mode_; |
| DeleterCallback deleter_; |
| void* deleter_data_; |
| |
| friend class SharedArrayBuffer; |
| }; |
| |
| /** |
| * Data length in bytes. |
| */ |
| size_t ByteLength() const; |
| |
| /** |
| * Create a new SharedArrayBuffer. Allocate |byte_length| bytes. |
| * Allocated memory will be owned by a created SharedArrayBuffer and |
| * will be deallocated when it is garbage-collected, |
| * unless the object is externalized. |
| */ |
| static Local<SharedArrayBuffer> New(Isolate* isolate, size_t byte_length); |
| |
| /** |
| * Create a new SharedArrayBuffer over an existing memory block. The created |
| * array buffer is immediately in externalized state unless otherwise |
| * specified. The memory block will not be reclaimed when a created |
| * SharedArrayBuffer is garbage-collected. |
| */ |
| static Local<SharedArrayBuffer> New( |
| Isolate* isolate, void* data, size_t byte_length, |
| ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized); |
| |
| /** |
| * Returns true if SharedArrayBuffer is externalized, that is, does not |
| * own its memory block. |
| */ |
| bool IsExternal() const; |
| |
| /** |
| * Make this SharedArrayBuffer external. The pointer to underlying memory |
| * block and byte length are returned as |Contents| structure. After |
| * SharedArrayBuffer had been externalized, it does no longer own the memory |
| * block. The caller should take steps to free memory when it is no longer |
| * needed. |
| * |
| * The memory block is guaranteed to be allocated with |Allocator::Allocate| |
| * by the allocator specified in |
| * v8::Isolate::CreateParams::array_buffer_allocator. |
| * |
| */ |
| Contents Externalize(); |
| |
| /** |
| * Get a pointer to the ArrayBuffer's underlying memory block without |
| * externalizing it. If the ArrayBuffer is not externalized, this pointer |
| * will become invalid as soon as the ArrayBuffer became garbage collected. |
| * |
| * The embedder should make sure to hold a strong reference to the |
| * ArrayBuffer while accessing this pointer. |
| * |
| * The memory block is guaranteed to be allocated with |Allocator::Allocate| |
| * by the allocator specified in |
| * v8::Isolate::CreateParams::array_buffer_allocator. |
| */ |
| Contents GetContents(); |
| |
| V8_INLINE static SharedArrayBuffer* Cast(Value* obj); |
| |
| static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT; |
| |
| private: |
| SharedArrayBuffer(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in Date constructor (ECMA-262, 15.9). |
| */ |
| class V8_EXPORT Date : public Object { |
| public: |
| static V8_DEPRECATE_SOON("Use maybe version.", |
| Local<Value> New(Isolate* isolate, double time)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Value> New(Local<Context> context, |
| double time); |
| |
| /** |
| * A specialization of Value::NumberValue that is more efficient |
| * because we know the structure of this object. |
| */ |
| double ValueOf() const; |
| |
| V8_INLINE static Date* Cast(Value* obj); |
| |
| /** |
| * Notification that the embedder has changed the time zone, |
| * daylight savings time, or other date / time configuration |
| * parameters. V8 keeps a cache of various values used for |
| * date / time computation. This notification will reset |
| * those cached values for the current context so that date / |
| * time configuration changes would be reflected in the Date |
| * object. |
| * |
| * This API should not be called more than needed as it will |
| * negatively impact the performance of date operations. |
| */ |
| static void DateTimeConfigurationChangeNotification(Isolate* isolate); |
| |
| private: |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * A Number object (ECMA-262, 4.3.21). |
| */ |
| class V8_EXPORT NumberObject : public Object { |
| public: |
| static Local<Value> New(Isolate* isolate, double value); |
| |
| double ValueOf() const; |
| |
| V8_INLINE static NumberObject* Cast(Value* obj); |
| |
| private: |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * A BigInt object (https://tc39.github.io/proposal-bigint) |
| */ |
| class V8_EXPORT BigIntObject : public Object { |
| public: |
| static Local<Value> New(Isolate* isolate, int64_t value); |
| |
| Local<BigInt> ValueOf() const; |
| |
| V8_INLINE static BigIntObject* Cast(Value* obj); |
| |
| private: |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * A Boolean object (ECMA-262, 4.3.15). |
| */ |
| class V8_EXPORT BooleanObject : public Object { |
| public: |
| static Local<Value> New(Isolate* isolate, bool value); |
| |
| bool ValueOf() const; |
| |
| V8_INLINE static BooleanObject* Cast(Value* obj); |
| |
| private: |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * A String object (ECMA-262, 4.3.18). |
| */ |
| class V8_EXPORT StringObject : public Object { |
| public: |
| static Local<Value> New(Isolate* isolate, Local<String> value); |
| |
| Local<String> ValueOf() const; |
| |
| V8_INLINE static StringObject* Cast(Value* obj); |
| |
| private: |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * A Symbol object (ECMA-262 edition 6). |
| */ |
| class V8_EXPORT SymbolObject : public Object { |
| public: |
| static Local<Value> New(Isolate* isolate, Local<Symbol> value); |
| |
| Local<Symbol> ValueOf() const; |
| |
| V8_INLINE static SymbolObject* Cast(Value* obj); |
| |
| private: |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in RegExp constructor (ECMA-262, 15.10). |
| */ |
| class V8_EXPORT RegExp : public Object { |
| public: |
| /** |
| * Regular expression flag bits. They can be or'ed to enable a set |
| * of flags. |
| */ |
| enum Flags { |
| kNone = 0, |
| kGlobal = 1 << 0, |
| kIgnoreCase = 1 << 1, |
| kMultiline = 1 << 2, |
| kSticky = 1 << 3, |
| kUnicode = 1 << 4, |
| kDotAll = 1 << 5, |
| }; |
| |
| /** |
| * Creates a regular expression from the given pattern string and |
| * the flags bit field. May throw a JavaScript exception as |
| * described in ECMA-262, 15.10.4.1. |
| * |
| * For example, |
| * RegExp::New(v8::String::New("foo"), |
| * static_cast<RegExp::Flags>(kGlobal | kMultiline)) |
| * is equivalent to evaluating "/foo/gm". |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<RegExp> New(Local<Context> context, |
| Local<String> pattern, |
| Flags flags); |
| |
| /** |
| * Returns the value of the source property: a string representing |
| * the regular expression. |
| */ |
| Local<String> GetSource() const; |
| |
| /** |
| * Returns the flags bit field. |
| */ |
| Flags GetFlags() const; |
| |
| V8_INLINE static RegExp* Cast(Value* obj); |
| |
| private: |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript value that wraps a C++ void*. This type of value is mainly used |
| * to associate C++ data structures with JavaScript objects. |
| */ |
| class V8_EXPORT External : public Value { |
| public: |
| static Local<External> New(Isolate* isolate, void* value); |
| V8_INLINE static External* Cast(Value* obj); |
| void* Value() const; |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| #define V8_INTRINSICS_LIST(F) \ |
| F(ArrayProto_entries, array_entries_iterator) \ |
| F(ArrayProto_forEach, array_for_each_iterator) \ |
| F(ArrayProto_keys, array_keys_iterator) \ |
| F(ArrayProto_values, array_values_iterator) \ |
| F(ErrorPrototype, initial_error_prototype) \ |
| F(IteratorPrototype, initial_iterator_prototype) |
| |
| enum Intrinsic { |
| #define V8_DECL_INTRINSIC(name, iname) k##name, |
| V8_INTRINSICS_LIST(V8_DECL_INTRINSIC) |
| #undef V8_DECL_INTRINSIC |
| }; |
| |
| |
| // --- Templates --- |
| |
| |
| /** |
| * The superclass of object and function templates. |
| */ |
| class V8_EXPORT Template : public Data { |
| public: |
| /** |
| * Adds a property to each instance created by this template. |
| * |
| * The property must be defined either as a primitive value, or a template. |
| */ |
| void Set(Local<Name> name, Local<Data> value, |
| PropertyAttribute attributes = None); |
| void SetPrivate(Local<Private> name, Local<Data> value, |
| PropertyAttribute attributes = None); |
| V8_INLINE void Set(Isolate* isolate, const char* name, Local<Data> value); |
| |
| void SetAccessorProperty( |
| Local<Name> name, |
| Local<FunctionTemplate> getter = Local<FunctionTemplate>(), |
| Local<FunctionTemplate> setter = Local<FunctionTemplate>(), |
| PropertyAttribute attribute = None, |
| AccessControl settings = DEFAULT); |
| |
| /** |
| * Whenever the property with the given name is accessed on objects |
| * created from this Template the getter and setter callbacks |
| * are called instead of getting and setting the property directly |
| * on the JavaScript object. |
| * |
| * \param name The name of the property for which an accessor is added. |
| * \param getter The callback to invoke when getting the property. |
| * \param setter The callback to invoke when setting the property. |
| * \param data A piece of data that will be passed to the getter and setter |
| * callbacks whenever they are invoked. |
| * \param settings Access control settings for the accessor. This is a bit |
| * field consisting of one of more of |
| * DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2. |
| * The default is to not allow cross-context access. |
| * ALL_CAN_READ means that all cross-context reads are allowed. |
| * ALL_CAN_WRITE means that all cross-context writes are allowed. |
| * The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all |
| * cross-context access. |
| * \param attribute The attributes of the property for which an accessor |
| * is added. |
| * \param signature The signature describes valid receivers for the accessor |
| * and is used to perform implicit instance checks against them. If the |
| * receiver is incompatible (i.e. is not an instance of the constructor as |
| * defined by FunctionTemplate::HasInstance()), an implicit TypeError is |
| * thrown and no callback is invoked. |
| */ |
| void SetNativeDataProperty( |
| Local<String> name, AccessorGetterCallback getter, |
| AccessorSetterCallback setter = 0, |
| // TODO(dcarney): gcc can't handle Local below |
| Local<Value> data = Local<Value>(), PropertyAttribute attribute = None, |
| Local<AccessorSignature> signature = Local<AccessorSignature>(), |
| AccessControl settings = DEFAULT, |
| SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect); |
| void SetNativeDataProperty( |
| Local<Name> name, AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter = 0, |
| // TODO(dcarney): gcc can't handle Local below |
| Local<Value> data = Local<Value>(), PropertyAttribute attribute = None, |
| Local<AccessorSignature> signature = Local<AccessorSignature>(), |
| AccessControl settings = DEFAULT, |
| SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect); |
| |
| /** |
| * Like SetNativeDataProperty, but V8 will replace the native data property |
| * with a real data property on first access. |
| */ |
| void SetLazyDataProperty( |
| Local<Name> name, AccessorNameGetterCallback getter, |
| Local<Value> data = Local<Value>(), PropertyAttribute attribute = None, |
| SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect); |
| |
| /** |
| * During template instantiation, sets the value with the intrinsic property |
| * from the correct context. |
| */ |
| void SetIntrinsicDataProperty(Local<Name> name, Intrinsic intrinsic, |
| PropertyAttribute attribute = None); |
| |
| private: |
| Template(); |
| |
| friend class ObjectTemplate; |
| friend class FunctionTemplate; |
| }; |
| |
| // TODO(dcarney): Replace GenericNamedPropertyFooCallback with just |
| // NamedPropertyFooCallback. |
| |
| /** |
| * Interceptor for get requests on an object. |
| * |
| * Use `info.GetReturnValue().Set()` to set the return value of the |
| * intercepted get request. |
| * |
| * \param property The name of the property for which the request was |
| * intercepted. |
| * \param info Information about the intercepted request, such as |
| * isolate, receiver, return value, or whether running in `'use strict`' mode. |
| * See `PropertyCallbackInfo`. |
| * |
| * \code |
| * void GetterCallback( |
| * Local<Name> name, |
| * const v8::PropertyCallbackInfo<v8::Value>& info) { |
| * info.GetReturnValue().Set(v8_num(42)); |
| * } |
| * |
| * v8::Local<v8::FunctionTemplate> templ = |
| * v8::FunctionTemplate::New(isolate); |
| * templ->InstanceTemplate()->SetHandler( |
| * v8::NamedPropertyHandlerConfiguration(GetterCallback)); |
| * LocalContext env; |
| * env->Global() |
| * ->Set(env.local(), v8_str("obj"), templ->GetFunction(env.local()) |
| * .ToLocalChecked() |
| * ->NewInstance(env.local()) |
| * .ToLocalChecked()) |
| * .FromJust(); |
| * v8::Local<v8::Value> result = CompileRun("obj.a = 17; obj.a"); |
| * CHECK(v8_num(42)->Equals(env.local(), result).FromJust()); |
| * \endcode |
| * |
| * See also `ObjectTemplate::SetHandler`. |
| */ |
| typedef void (*GenericNamedPropertyGetterCallback)( |
| Local<Name> property, const PropertyCallbackInfo<Value>& info); |
| |
| /** |
| * Interceptor for set requests on an object. |
| * |
| * Use `info.GetReturnValue()` to indicate whether the request was intercepted |
| * or not. If the setter successfully intercepts the request, i.e., if the |
| * request should not be further executed, call |
| * `info.GetReturnValue().Set(value)`. If the setter |
| * did not intercept the request, i.e., if the request should be handled as |
| * if no interceptor is present, do not not call `Set()`. |
| * |
| * \param property The name of the property for which the request was |
| * intercepted. |
| * \param value The value which the property will have if the request |
| * is not intercepted. |
| * \param info Information about the intercepted request, such as |
| * isolate, receiver, return value, or whether running in `'use strict'` mode. |
| * See `PropertyCallbackInfo`. |
| * |
| * See also |
| * `ObjectTemplate::SetHandler.` |
| */ |
| typedef void (*GenericNamedPropertySetterCallback)( |
| Local<Name> property, Local<Value> value, |
| const PropertyCallbackInfo<Value>& info); |
| |
| /** |
| * Intercepts all requests that query the attributes of the |
| * property, e.g., getOwnPropertyDescriptor(), propertyIsEnumerable(), and |
| * defineProperty(). |
| * |
| * Use `info.GetReturnValue().Set(value)` to set the property attributes. The |
| * value is an integer encoding a `v8::PropertyAttribute`. |
| * |
| * \param property The name of the property for which the request was |
| * intercepted. |
| * \param info Information about the intercepted request, such as |
| * isolate, receiver, return value, or whether running in `'use strict'` mode. |
| * See `PropertyCallbackInfo`. |
| * |
| * \note Some functions query the property attributes internally, even though |
| * they do not return the attributes. For example, `hasOwnProperty()` can |
| * trigger this interceptor depending on the state of the object. |
| * |
| * See also |
| * `ObjectTemplate::SetHandler.` |
| */ |
| typedef void (*GenericNamedPropertyQueryCallback)( |
| Local<Name> property, const PropertyCallbackInfo<Integer>& info); |
| |
| /** |
| * Interceptor for delete requests on an object. |
| * |
| * Use `info.GetReturnValue()` to indicate whether the request was intercepted |
| * or not. If the deleter successfully intercepts the request, i.e., if the |
| * request should not be further executed, call |
| * `info.GetReturnValue().Set(value)` with a boolean `value`. The `value` is |
| * used as the return value of `delete`. |
| * |
| * \param property The name of the property for which the request was |
| * intercepted. |
| * \param info Information about the intercepted request, such as |
| * isolate, receiver, return value, or whether running in `'use strict'` mode. |
| * See `PropertyCallbackInfo`. |
| * |
| * \note If you need to mimic the behavior of `delete`, i.e., throw in strict |
| * mode instead of returning false, use `info.ShouldThrowOnError()` to determine |
| * if you are in strict mode. |
| * |
| * See also `ObjectTemplate::SetHandler.` |
| */ |
| typedef void (*GenericNamedPropertyDeleterCallback)( |
| Local<Name> property, const PropertyCallbackInfo<Boolean>& info); |
| |
| /** |
| * Returns an array containing the names of the properties the named |
| * property getter intercepts. |
| * |
| * Note: The values in the array must be of type v8::Name. |
| */ |
| typedef void (*GenericNamedPropertyEnumeratorCallback)( |
| const PropertyCallbackInfo<Array>& info); |
| |
| /** |
| * Interceptor for defineProperty requests on an object. |
| * |
| * Use `info.GetReturnValue()` to indicate whether the request was intercepted |
| * or not. If the definer successfully intercepts the request, i.e., if the |
| * request should not be further executed, call |
| * `info.GetReturnValue().Set(value)`. If the definer |
| * did not intercept the request, i.e., if the request should be handled as |
| * if no interceptor is present, do not not call `Set()`. |
| * |
| * \param property The name of the property for which the request was |
| * intercepted. |
| * \param desc The property descriptor which is used to define the |
| * property if the request is not intercepted. |
| * \param info Information about the intercepted request, such as |
| * isolate, receiver, return value, or whether running in `'use strict'` mode. |
| * See `PropertyCallbackInfo`. |
| * |
| * See also `ObjectTemplate::SetHandler`. |
| */ |
| typedef void (*GenericNamedPropertyDefinerCallback)( |
| Local<Name> property, const PropertyDescriptor& desc, |
| const PropertyCallbackInfo<Value>& info); |
| |
| /** |
| * Interceptor for getOwnPropertyDescriptor requests on an object. |
| * |
| * Use `info.GetReturnValue().Set()` to set the return value of the |
| * intercepted request. The return value must be an object that |
| * can be converted to a PropertyDescriptor, e.g., a `v8::value` returned from |
| * `v8::Object::getOwnPropertyDescriptor`. |
| * |
| * \param property The name of the property for which the request was |
| * intercepted. |
| * \info Information about the intercepted request, such as |
| * isolate, receiver, return value, or whether running in `'use strict'` mode. |
| * See `PropertyCallbackInfo`. |
| * |
| * \note If GetOwnPropertyDescriptor is intercepted, it will |
| * always return true, i.e., indicate that the property was found. |
| * |
| * See also `ObjectTemplate::SetHandler`. |
| */ |
| typedef void (*GenericNamedPropertyDescriptorCallback)( |
| Local<Name> property, const PropertyCallbackInfo<Value>& info); |
| |
| /** |
| * See `v8::GenericNamedPropertyGetterCallback`. |
| */ |
| typedef void (*IndexedPropertyGetterCallback)( |
| uint32_t index, |
| const PropertyCallbackInfo<Value>& info); |
| |
| /** |
| * See `v8::GenericNamedPropertySetterCallback`. |
| */ |
| typedef void (*IndexedPropertySetterCallback)( |
| uint32_t index, |
| Local<Value> value, |
| const PropertyCallbackInfo<Value>& info); |
| |
| /** |
| * See `v8::GenericNamedPropertyQueryCallback`. |
| */ |
| typedef void (*IndexedPropertyQueryCallback)( |
| uint32_t index, |
| const PropertyCallbackInfo<Integer>& info); |
| |
| /** |
| * See `v8::GenericNamedPropertyDeleterCallback`. |
| */ |
| typedef void (*IndexedPropertyDeleterCallback)( |
| uint32_t index, |
| const PropertyCallbackInfo<Boolean>& info); |
| |
| /** |
| * Returns an array containing the indices of the properties the indexed |
| * property getter intercepts. |
| * |
| * Note: The values in the array must be uint32_t. |
| */ |
| typedef void (*IndexedPropertyEnumeratorCallback)( |
| const PropertyCallbackInfo<Array>& info); |
| |
| /** |
| * See `v8::GenericNamedPropertyDefinerCallback`. |
| */ |
| typedef void (*IndexedPropertyDefinerCallback)( |
| uint32_t index, const PropertyDescriptor& desc, |
| const PropertyCallbackInfo<Value>& info); |
| |
| /** |
| * See `v8::GenericNamedPropertyDescriptorCallback`. |
| */ |
| typedef void (*IndexedPropertyDescriptorCallback)( |
| uint32_t index, const PropertyCallbackInfo<Value>& info); |
| |
| /** |
| * Access type specification. |
| */ |
| enum AccessType { |
| ACCESS_GET, |
| ACCESS_SET, |
| ACCESS_HAS, |
| ACCESS_DELETE, |
| ACCESS_KEYS |
| }; |
| |
| |
| /** |
| * Returns true if the given context should be allowed to access the given |
| * object. |
| */ |
| typedef bool (*AccessCheckCallback)(Local<Context> accessing_context, |
| Local<Object> accessed_object, |
| Local<Value> data); |
| |
| /** |
| * A FunctionTemplate is used to create functions at runtime. There |
| * can only be one function created from a FunctionTemplate in a |
| * context. The lifetime of the created function is equal to the |
| * lifetime of the context. So in case the embedder needs to create |
| * temporary functions that can be collected using Scripts is |
| * preferred. |
| * |
| * Any modification of a FunctionTemplate after first instantiation will trigger |
| * a crash. |
| * |
| * A FunctionTemplate can have properties, these properties are added to the |
| * function object when it is created. |
| * |
| * A FunctionTemplate has a corresponding instance template which is |
| * used to create object instances when the function is used as a |
| * constructor. Properties added to the instance template are added to |
| * each object instance. |
| * |
| * A FunctionTemplate can have a prototype template. The prototype template |
| * is used to create the prototype object of the function. |
| * |
| * The following example shows how to use a FunctionTemplate: |
| * |
| * \code |
| * v8::Local<v8::FunctionTemplate> t = v8::FunctionTemplate::New(isolate); |
| * t->Set(isolate, "func_property", v8::Number::New(isolate, 1)); |
| * |
| * v8::Local<v8::Template> proto_t = t->PrototypeTemplate(); |
| * proto_t->Set(isolate, |
| * "proto_method", |
| * v8::FunctionTemplate::New(isolate, InvokeCallback)); |
| * proto_t->Set(isolate, "proto_const", v8::Number::New(isolate, 2)); |
| * |
| * v8::Local<v8::ObjectTemplate> instance_t = t->InstanceTemplate(); |
| * instance_t->SetAccessor(String::NewFromUtf8(isolate, "instance_accessor"), |
| * InstanceAccessorCallback); |
| * instance_t->SetHandler( |
| * NamedPropertyHandlerConfiguration(PropertyHandlerCallback)); |
| * instance_t->Set(String::NewFromUtf8(isolate, "instance_property"), |
| * Number::New(isolate, 3)); |
| * |
| * v8::Local<v8::Function> function = t->GetFunction(); |
| * v8::Local<v8::Object> instance = function->NewInstance(); |
| * \endcode |
| * |
| * Let's use "function" as the JS variable name of the function object |
| * and "instance" for the instance object created above. The function |
| * and the instance will have the following properties: |
| * |
| * \code |
| * func_property in function == true; |
| * function.func_property == 1; |
| * |
| * function.prototype.proto_method() invokes 'InvokeCallback' |
| * function.prototype.proto_const == 2; |
| * |
| * instance instanceof function == true; |
| * instance.instance_accessor calls 'InstanceAccessorCallback' |
| * instance.instance_property == 3; |
| * \endcode |
| * |
| * A FunctionTemplate can inherit from another one by calling the |
| * FunctionTemplate::Inherit method. The following graph illustrates |
| * the semantics of inheritance: |
| * |
| * \code |
| * FunctionTemplate Parent -> Parent() . prototype -> { } |
| * ^ ^ |
| * | Inherit(Parent) | .__proto__ |
| * | | |
| * FunctionTemplate Child -> Child() . prototype -> { } |
| * \endcode |
| * |
| * A FunctionTemplate 'Child' inherits from 'Parent', the prototype |
| * object of the Child() function has __proto__ pointing to the |
| * Parent() function's prototype object. An instance of the Child |
| * function has all properties on Parent's instance templates. |
| * |
| * Let Parent be the FunctionTemplate initialized in the previous |
| * section and create a Child FunctionTemplate by: |
| * |
| * \code |
| * Local<FunctionTemplate> parent = t; |
| * Local<FunctionTemplate> child = FunctionTemplate::New(); |
| * child->Inherit(parent); |
| * |
| * Local<Function> child_function = child->GetFunction(); |
| * Local<Object> child_instance = child_function->NewInstance(); |
| * \endcode |
| * |
| * The Child function and Child instance will have the following |
| * properties: |
| * |
| * \code |
| * child_func.prototype.__proto__ == function.prototype; |
| * child_instance.instance_accessor calls 'InstanceAccessorCallback' |
| * child_instance.instance_property == 3; |
| * \endcode |
| */ |
| class V8_EXPORT FunctionTemplate : public Template { |
| public: |
| /** Creates a function template.*/ |
| static Local<FunctionTemplate> New( |
| Isolate* isolate, FunctionCallback callback = 0, |
| Local<Value> data = Local<Value>(), |
| Local<Signature> signature = Local<Signature>(), int length = 0, |
| ConstructorBehavior behavior = ConstructorBehavior::kAllow, |
| SideEffectType side_effect_type = SideEffectType::kHasSideEffect); |
| |
| /** Get a template included in the snapshot by index. */ |
| static MaybeLocal<FunctionTemplate> FromSnapshot(Isolate* isolate, |
| size_t index); |
| |
| /** |
| * Creates a function template backed/cached by a private property. |
| */ |
| static Local<FunctionTemplate> NewWithCache( |
| Isolate* isolate, FunctionCallback callback, |
| Local<Private> cache_property, Local<Value> data = Local<Value>(), |
| Local<Signature> signature = Local<Signature>(), int length = 0, |
| SideEffectType side_effect_type = SideEffectType::kHasSideEffect); |
| |
| /** Returns the unique function instance in the current execution context.*/ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Function> GetFunction()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Function> GetFunction( |
| Local<Context> context); |
| |
| /** |
| * Similar to Context::NewRemoteContext, this creates an instance that |
| * isn't backed by an actual object. |
| * |
| * The InstanceTemplate of this FunctionTemplate must have access checks with |
| * handlers installed. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewRemoteInstance(); |
| |
| /** |
| * Set the call-handler callback for a FunctionTemplate. This |
| * callback is called whenever the function created from this |
| * FunctionTemplate is called. |
| */ |
| void SetCallHandler( |
| FunctionCallback callback, Local<Value> data = Local<Value>(), |
| SideEffectType side_effect_type = SideEffectType::kHasSideEffect); |
| |
| /** Set the predefined length property for the FunctionTemplate. */ |
| void SetLength(int length); |
| |
| /** Get the InstanceTemplate. */ |
| Local<ObjectTemplate> InstanceTemplate(); |
| |
| /** |
| * Causes the function template to inherit from a parent function template. |
| * This means the function's prototype.__proto__ is set to the parent |
| * function's prototype. |
| **/ |
| void Inherit(Local<FunctionTemplate> parent); |
| |
| /** |
| * A PrototypeTemplate is the template used to create the prototype object |
| * of the function created by this template. |
| */ |
| Local<ObjectTemplate> PrototypeTemplate(); |
| |
| /** |
| * A PrototypeProviderTemplate is another function template whose prototype |
| * property is used for this template. This is mutually exclusive with setting |
| * a prototype template indirectly by calling PrototypeTemplate() or using |
| * Inherit(). |
| **/ |
| void SetPrototypeProviderTemplate(Local<FunctionTemplate> prototype_provider); |
| |
| /** |
| * Set the class name of the FunctionTemplate. This is used for |
| * printing objects created with the function created from the |
| * FunctionTemplate as its constructor. |
| */ |
| void SetClassName(Local<String> name); |
| |
| |
| /** |
| * When set to true, no access check will be performed on the receiver of a |
| * function call. Currently defaults to true, but this is subject to change. |
| */ |
| void SetAcceptAnyReceiver(bool value); |
| |
| /** |
| * Determines whether the __proto__ accessor ignores instances of |
| * the function template. If instances of the function template are |
| * ignored, __proto__ skips all instances and instead returns the |
| * next object in the prototype chain. |
| * |
| * Call with a value of true to make the __proto__ accessor ignore |
| * instances of the function template. Call with a value of false |
| * to make the __proto__ accessor not ignore instances of the |
| * function template. By default, instances of a function template |
| * are not ignored. |
| */ |
| void SetHiddenPrototype(bool value); |
| |
| /** |
| * Sets the ReadOnly flag in the attributes of the 'prototype' property |
| * of functions created from this FunctionTemplate to true. |
| */ |
| void ReadOnlyPrototype(); |
| |
| /** |
| * Removes the prototype property from functions created from this |
| * FunctionTemplate. |
| */ |
| void RemovePrototype(); |
| |
| /** |
| * Returns true if the given object is an instance of this function |
| * template. |
| */ |
| bool HasInstance(Local<Value> object); |
| |
| V8_INLINE static FunctionTemplate* Cast(Data* data); |
| |
| private: |
| FunctionTemplate(); |
| |
| static void CheckCast(Data* that); |
| friend class Context; |
| friend class ObjectTemplate; |
| }; |
| |
| /** |
| * Configuration flags for v8::NamedPropertyHandlerConfiguration or |
| * v8::IndexedPropertyHandlerConfiguration. |
| */ |
| enum class PropertyHandlerFlags { |
| /** |
| * None. |
| */ |
| kNone = 0, |
| |
| /** |
| * See ALL_CAN_READ above. |
| */ |
| kAllCanRead = 1, |
| |
| /** Will not call into interceptor for properties on the receiver or prototype |
| * chain, i.e., only call into interceptor for properties that do not exist. |
| * Currently only valid for named interceptors. |
| */ |
| kNonMasking = 1 << 1, |
| |
| /** |
| * Will not call into interceptor for symbol lookup. Only meaningful for |
| * named interceptors. |
| */ |
| kOnlyInterceptStrings = 1 << 2, |
| |
| /** |
| * The getter, query, enumerator callbacks do not produce side effects. |
| */ |
| kHasNoSideEffect = 1 << 3, |
| }; |
| |
| struct NamedPropertyHandlerConfiguration { |
| NamedPropertyHandlerConfiguration( |
| GenericNamedPropertyGetterCallback getter, |
| GenericNamedPropertySetterCallback setter, |
| GenericNamedPropertyQueryCallback query, |
| GenericNamedPropertyDeleterCallback deleter, |
| GenericNamedPropertyEnumeratorCallback enumerator, |
| GenericNamedPropertyDefinerCallback definer, |
| GenericNamedPropertyDescriptorCallback descriptor, |
| Local<Value> data = Local<Value>(), |
| PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) |
| : getter(getter), |
| setter(setter), |
| query(query), |
| deleter(deleter), |
| enumerator(enumerator), |
| definer(definer), |
| descriptor(descriptor), |
| data(data), |
| flags(flags) {} |
| |
| NamedPropertyHandlerConfiguration( |
| /** Note: getter is required */ |
| GenericNamedPropertyGetterCallback getter = 0, |
| GenericNamedPropertySetterCallback setter = 0, |
| GenericNamedPropertyQueryCallback query = 0, |
| GenericNamedPropertyDeleterCallback deleter = 0, |
| GenericNamedPropertyEnumeratorCallback enumerator = 0, |
| Local<Value> data = Local<Value>(), |
| PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) |
| : getter(getter), |
| setter(setter), |
| query(query), |
| deleter(deleter), |
| enumerator(enumerator), |
| definer(0), |
| descriptor(0), |
| data(data), |
| flags(flags) {} |
| |
| NamedPropertyHandlerConfiguration( |
| GenericNamedPropertyGetterCallback getter, |
| GenericNamedPropertySetterCallback setter, |
| GenericNamedPropertyDescriptorCallback descriptor, |
| GenericNamedPropertyDeleterCallback deleter, |
| GenericNamedPropertyEnumeratorCallback enumerator, |
| GenericNamedPropertyDefinerCallback definer, |
| Local<Value> data = Local<Value>(), |
| PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) |
| : getter(getter), |
| setter(setter), |
| query(0), |
| deleter(deleter), |
| enumerator(enumerator), |
| definer(definer), |
| descriptor(descriptor), |
| data(data), |
| flags(flags) {} |
| |
| GenericNamedPropertyGetterCallback getter; |
| GenericNamedPropertySetterCallback setter; |
| GenericNamedPropertyQueryCallback query; |
| GenericNamedPropertyDeleterCallback deleter; |
| GenericNamedPropertyEnumeratorCallback enumerator; |
| GenericNamedPropertyDefinerCallback definer; |
| GenericNamedPropertyDescriptorCallback descriptor; |
| Local<Value> data; |
| PropertyHandlerFlags flags; |
| }; |
| |
| |
| struct IndexedPropertyHandlerConfiguration { |
| IndexedPropertyHandlerConfiguration( |
| IndexedPropertyGetterCallback getter, |
| IndexedPropertySetterCallback setter, IndexedPropertyQueryCallback query, |
| IndexedPropertyDeleterCallback deleter, |
| IndexedPropertyEnumeratorCallback enumerator, |
| IndexedPropertyDefinerCallback definer, |
| IndexedPropertyDescriptorCallback descriptor, |
| Local<Value> data = Local<Value>(), |
| PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) |
| : getter(getter), |
| setter(setter), |
| query(query), |
| deleter(deleter), |
| enumerator(enumerator), |
| definer(definer), |
| descriptor(descriptor), |
| data(data), |
| flags(flags) {} |
| |
| IndexedPropertyHandlerConfiguration( |
| /** Note: getter is required */ |
| IndexedPropertyGetterCallback getter = 0, |
| IndexedPropertySetterCallback setter = 0, |
| IndexedPropertyQueryCallback query = 0, |
| IndexedPropertyDeleterCallback deleter = 0, |
| IndexedPropertyEnumeratorCallback enumerator = 0, |
| Local<Value> data = Local<Value>(), |
| PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) |
| : getter(getter), |
| setter(setter), |
| query(query), |
| deleter(deleter), |
| enumerator(enumerator), |
| definer(0), |
| descriptor(0), |
| data(data), |
| flags(flags) {} |
| |
| IndexedPropertyHandlerConfiguration( |
| IndexedPropertyGetterCallback getter, |
| IndexedPropertySetterCallback setter, |
| IndexedPropertyDescriptorCallback descriptor, |
| IndexedPropertyDeleterCallback deleter, |
| IndexedPropertyEnumeratorCallback enumerator, |
| IndexedPropertyDefinerCallback definer, |
| Local<Value> data = Local<Value>(), |
| PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) |
| : getter(getter), |
| setter(setter), |
| query(0), |
| deleter(deleter), |
| enumerator(enumerator), |
| definer(definer), |
| descriptor(descriptor), |
| data(data), |
| flags(flags) {} |
| |
| IndexedPropertyGetterCallback getter; |
| IndexedPropertySetterCallback setter; |
| IndexedPropertyQueryCallback query; |
| IndexedPropertyDeleterCallback deleter; |
| IndexedPropertyEnumeratorCallback enumerator; |
| IndexedPropertyDefinerCallback definer; |
| IndexedPropertyDescriptorCallback descriptor; |
| Local<Value> data; |
| PropertyHandlerFlags flags; |
| }; |
| |
| |
| /** |
| * An ObjectTemplate is used to create objects at runtime. |
| * |
| * Properties added to an ObjectTemplate are added to each object |
| * created from the ObjectTemplate. |
| */ |
| class V8_EXPORT ObjectTemplate : public Template { |
| public: |
| /** Creates an ObjectTemplate. */ |
| static Local<ObjectTemplate> New( |
| Isolate* isolate, |
| Local<FunctionTemplate> constructor = Local<FunctionTemplate>()); |
| |
| /** Get a template included in the snapshot by index. */ |
| static MaybeLocal<ObjectTemplate> FromSnapshot(Isolate* isolate, |
| size_t index); |
| |
| /** Creates a new instance of this template.*/ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(Local<Context> context); |
| |
| /** |
| * Sets an accessor on the object template. |
| * |
| * Whenever the property with the given name is accessed on objects |
| * created from this ObjectTemplate the getter and setter callbacks |
| * are called instead of getting and setting the property directly |
| * on the JavaScript object. |
| * |
| * \param name The name of the property for which an accessor is added. |
| * \param getter The callback to invoke when getting the property. |
| * \param setter The callback to invoke when setting the property. |
| * \param data A piece of data that will be passed to the getter and setter |
| * callbacks whenever they are invoked. |
| * \param settings Access control settings for the accessor. This is a bit |
| * field consisting of one of more of |
| * DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2. |
| * The default is to not allow cross-context access. |
| * ALL_CAN_READ means that all cross-context reads are allowed. |
| * ALL_CAN_WRITE means that all cross-context writes are allowed. |
| * The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all |
| * cross-context access. |
| * \param attribute The attributes of the property for which an accessor |
| * is added. |
| * \param signature The signature describes valid receivers for the accessor |
| * and is used to perform implicit instance checks against them. If the |
| * receiver is incompatible (i.e. is not an instance of the constructor as |
| * defined by FunctionTemplate::HasInstance()), an implicit TypeError is |
| * thrown and no callback is invoked. |
| */ |
| void SetAccessor( |
| Local<String> name, AccessorGetterCallback getter, |
| AccessorSetterCallback setter = 0, Local<Value> data = Local<Value>(), |
| AccessControl settings = DEFAULT, PropertyAttribute attribute = None, |
| Local<AccessorSignature> signature = Local<AccessorSignature>(), |
| SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect); |
| void SetAccessor( |
| Local<Name> name, AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter = 0, Local<Value> data = Local<Value>(), |
| AccessControl settings = DEFAULT, PropertyAttribute attribute = None, |
| Local<AccessorSignature> signature = Local<AccessorSignature>(), |
| SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect); |
| |
| /** |
| * Sets a named property handler on the object template. |
| * |
| * Whenever a property whose name is a string or a symbol is accessed on |
| * objects created from this object template, the provided callback is |
| * invoked instead of accessing the property directly on the JavaScript |
| * object. |
| * |
| * @param configuration The NamedPropertyHandlerConfiguration that defines the |
| * callbacks to invoke when accessing a property. |
| */ |
| void SetHandler(const NamedPropertyHandlerConfiguration& configuration); |
| |
| /** |
| * Sets an indexed property handler on the object template. |
| * |
| * Whenever an indexed property is accessed on objects created from |
| * this object template, the provided callback is invoked instead of |
| * accessing the property directly on the JavaScript object. |
| * |
| * \param getter The callback to invoke when getting a property. |
| * \param setter The callback to invoke when setting a property. |
| * \param query The callback to invoke to check if an object has a property. |
| * \param deleter The callback to invoke when deleting a property. |
| * \param enumerator The callback to invoke to enumerate all the indexed |
| * properties of an object. |
| * \param data A piece of data that will be passed to the callbacks |
| * whenever they are invoked. |
| */ |
| // TODO(dcarney): deprecate |
| void SetIndexedPropertyHandler( |
| IndexedPropertyGetterCallback getter, |
| IndexedPropertySetterCallback setter = 0, |
| IndexedPropertyQueryCallback query = 0, |
| IndexedPropertyDeleterCallback deleter = 0, |
| IndexedPropertyEnumeratorCallback enumerator = 0, |
| Local<Value> data = Local<Value>()) { |
| SetHandler(IndexedPropertyHandlerConfiguration(getter, setter, query, |
| deleter, enumerator, data)); |
| } |
| |
| /** |
| * Sets an indexed property handler on the object template. |
| * |
| * Whenever an indexed property is accessed on objects created from |
| * this object template, the provided callback is invoked instead of |
| * accessing the property directly on the JavaScript object. |
| * |
| * @param configuration The IndexedPropertyHandlerConfiguration that defines |
| * the callbacks to invoke when accessing a property. |
| */ |
| void SetHandler(const IndexedPropertyHandlerConfiguration& configuration); |
| |
| /** |
| * Sets the callback to be used when calling instances created from |
| * this template as a function. If no callback is set, instances |
| * behave like normal JavaScript objects that cannot be called as a |
| * function. |
| */ |
| void SetCallAsFunctionHandler(FunctionCallback callback, |
| Local<Value> data = Local<Value>()); |
| |
| /** |
| * Mark object instances of the template as undetectable. |
| * |
| * In many ways, undetectable objects behave as though they are not |
| * there. They behave like 'undefined' in conditionals and when |
| * printed. However, properties can be accessed and called as on |
| * normal objects. |
| */ |
| void MarkAsUndetectable(); |
| |
| /** |
| * Sets access check callback on the object template and enables access |
| * checks. |
| * |
| * When accessing properties on instances of this object template, |
| * the access check callback will be called to determine whether or |
| * not to allow cross-context access to the properties. |
| */ |
| void SetAccessCheckCallback(AccessCheckCallback callback, |
| Local<Value> data = Local<Value>()); |
| |
| /** |
| * Like SetAccessCheckCallback but invokes an interceptor on failed access |
| * checks instead of looking up all-can-read properties. You can only use |
| * either this method or SetAccessCheckCallback, but not both at the same |
| * time. |
| */ |
| void SetAccessCheckCallbackAndHandler( |
| AccessCheckCallback callback, |
| const NamedPropertyHandlerConfiguration& named_handler, |
| const IndexedPropertyHandlerConfiguration& indexed_handler, |
| Local<Value> data = Local<Value>()); |
| |
| /** |
| * Gets the number of internal fields for objects generated from |
| * this template. |
| */ |
| int InternalFieldCount(); |
| |
| /** |
| * Sets the number of internal fields for objects generated from |
| * this template. |
| */ |
| void SetInternalFieldCount(int value); |
| |
| /** |
| * Returns true if the object will be an immutable prototype exotic object. |
| */ |
| bool IsImmutableProto(); |
| |
| /** |
| * Makes the ObjectTemplate for an immutable prototype exotic object, with an |
| * immutable __proto__. |
| */ |
| void SetImmutableProto(); |
| |
| V8_INLINE static ObjectTemplate* Cast(Data* data); |
| |
| private: |
| ObjectTemplate(); |
| static Local<ObjectTemplate> New(internal::Isolate* isolate, |
| Local<FunctionTemplate> constructor); |
| static void CheckCast(Data* that); |
| friend class FunctionTemplate; |
| }; |
| |
| /** |
| * A Signature specifies which receiver is valid for a function. |
| * |
| * A receiver matches a given signature if the receiver (or any of its |
| * hidden prototypes) was created from the signature's FunctionTemplate, or |
| * from a FunctionTemplate that inherits directly or indirectly from the |
| * signature's FunctionTemplate. |
| */ |
| class V8_EXPORT Signature : public Data { |
| public: |
| static Local<Signature> New( |
| Isolate* isolate, |
| Local<FunctionTemplate> receiver = Local<FunctionTemplate>()); |
| |
| V8_INLINE static Signature* Cast(Data* data); |
| |
| private: |
| Signature(); |
| |
| static void CheckCast(Data* that); |
| }; |
| |
| |
| /** |
| * An AccessorSignature specifies which receivers are valid parameters |
| * to an accessor callback. |
| */ |
| class V8_EXPORT AccessorSignature : public Data { |
| public: |
| static Local<AccessorSignature> New( |
| Isolate* isolate, |
| Local<FunctionTemplate> receiver = Local<FunctionTemplate>()); |
| |
| V8_INLINE static AccessorSignature* Cast(Data* data); |
| |
| private: |
| AccessorSignature(); |
| |
| static void CheckCast(Data* that); |
| }; |
| |
| |
| // --- Extensions --- |
| V8_DEPRECATE_SOON("Implementation detail", class) |
| V8_EXPORT ExternalOneByteStringResourceImpl |
| : public String::ExternalOneByteStringResource { |
| public: |
| ExternalOneByteStringResourceImpl() : data_(0), length_(0) {} |
| ExternalOneByteStringResourceImpl(const char* data, size_t length) |
| : data_(data), length_(length) {} |
| const char* data() const { return data_; } |
| size_t length() const { return length_; } |
| |
| private: |
| const char* data_; |
| size_t length_; |
| }; |
| |
| /** |
| * Ignore |
| */ |
| class V8_EXPORT Extension { // NOLINT |
| public: |
| // Note that the strings passed into this constructor must live as long |
| // as the Extension itself. |
| Extension(const char* name, |
| const char* source = 0, |
| int dep_count = 0, |
| const char** deps = 0, |
| int source_length = -1); |
| virtual ~Extension() { delete source_; } |
| virtual Local<FunctionTemplate> GetNativeFunctionTemplate( |
| Isolate* isolate, Local<String> name) { |
| return Local<FunctionTemplate>(); |
| } |
| |
| const char* name() const { return name_; } |
| size_t source_length() const { return source_length_; } |
| const String::ExternalOneByteStringResource* source() const { |
| return source_; |
| } |
| int dependency_count() { return dep_count_; } |
| const char** dependencies() { return deps_; } |
| void set_auto_enable(bool value) { auto_enable_ = value; } |
| bool auto_enable() { return auto_enable_; } |
| |
| // Disallow copying and assigning. |
| Extension(const Extension&) = delete; |
| void operator=(const Extension&) = delete; |
| |
| private: |
| const char* name_; |
| size_t source_length_; // expected to initialize before source_ |
| String::ExternalOneByteStringResource* source_; |
| int dep_count_; |
| const char** deps_; |
| bool auto_enable_; |
| }; |
| |
| |
| void V8_EXPORT RegisterExtension(Extension* extension); |
| |
| |
| // --- Statics --- |
| |
| V8_INLINE Local<Primitive> Undefined(Isolate* isolate); |
| V8_INLINE Local<Primitive> Null(Isolate* isolate); |
| V8_INLINE Local<Boolean> True(Isolate* isolate); |
| V8_INLINE Local<Boolean> False(Isolate* isolate); |
| |
| /** |
| * A set of constraints that specifies the limits of the runtime's memory use. |
| * You must set the heap size before initializing the VM - the size cannot be |
| * adjusted after the VM is initialized. |
| * |
| * If you are using threads then you should hold the V8::Locker lock while |
| * setting the stack limit and you must set a non-default stack limit separately |
| * for each thread. |
| * |
| * The arguments for set_max_semi_space_size, set_max_old_space_size, |
| * set_max_executable_size, set_code_range_size specify limits in MB. |
| * |
| * The argument for set_max_semi_space_size_in_kb is in KB. |
| */ |
| class V8_EXPORT ResourceConstraints { |
| public: |
| ResourceConstraints(); |
| |
| /** |
| * Configures the constraints with reasonable default values based on the |
| * capabilities of the current device the VM is running on. |
| * |
| * \param physical_memory The total amount of physical memory on the current |
| * device, in bytes. |
| * \param virtual_memory_limit The amount of virtual memory on the current |
| * device, in bytes, or zero, if there is no limit. |
| */ |
| void ConfigureDefaults(uint64_t physical_memory, |
| uint64_t virtual_memory_limit); |
| |
| // Returns the max semi-space size in MB. |
| V8_DEPRECATE_SOON("Use max_semi_space_size_in_kb()", |
| size_t max_semi_space_size()) { |
| return max_semi_space_size_in_kb_ / 1024; |
| } |
| |
| // Sets the max semi-space size in MB. |
| V8_DEPRECATE_SOON("Use set_max_semi_space_size_in_kb(size_t limit_in_kb)", |
| void set_max_semi_space_size(size_t limit_in_mb)) { |
| max_semi_space_size_in_kb_ = limit_in_mb * 1024; |
| } |
| |
| // Returns the max semi-space size in KB. |
| size_t max_semi_space_size_in_kb() const { |
| return max_semi_space_size_in_kb_; |
| } |
| |
| // Sets the max semi-space size in KB. |
| void set_max_semi_space_size_in_kb(size_t limit_in_kb) { |
| max_semi_space_size_in_kb_ = limit_in_kb; |
| } |
| |
| size_t max_old_space_size() const { return max_old_space_size_; } |
| void set_max_old_space_size(size_t limit_in_mb) { |
| max_old_space_size_ = limit_in_mb; |
| } |
| V8_DEPRECATE_SOON("max_executable_size_ is subsumed by max_old_space_size_", |
| size_t max_executable_size() const) { |
| return max_executable_size_; |
| } |
| V8_DEPRECATE_SOON("max_executable_size_ is subsumed by max_old_space_size_", |
| void set_max_executable_size(size_t limit_in_mb)) { |
| max_executable_size_ = limit_in_mb; |
| } |
| uint32_t* stack_limit() const { return stack_limit_; } |
| // Sets an address beyond which the VM's stack may not grow. |
| void set_stack_limit(uint32_t* value) { stack_limit_ = value; } |
| size_t code_range_size() const { return code_range_size_; } |
| void set_code_range_size(size_t limit_in_mb) { |
| code_range_size_ = limit_in_mb; |
| } |
| size_t max_zone_pool_size() const { return max_zone_pool_size_; } |
| void set_max_zone_pool_size(size_t bytes) { max_zone_pool_size_ = bytes; } |
| |
| private: |
| // max_semi_space_size_ is in KB |
| size_t max_semi_space_size_in_kb_; |
| |
| // The remaining limits are in MB |
| size_t max_old_space_size_; |
| size_t max_executable_size_; |
| uint32_t* stack_limit_; |
| size_t code_range_size_; |
| size_t max_zone_pool_size_; |
| }; |
| |
| |
| // --- Exceptions --- |
| |
| |
| typedef void (*FatalErrorCallback)(const char* location, const char* message); |
| |
| typedef void (*OOMErrorCallback)(const char* location, bool is_heap_oom); |
| |
| typedef void (*DcheckErrorCallback)(const char* file, int line, |
| const char* message); |
| |
| typedef void (*MessageCallback)(Local<Message> message, Local<Value> data); |
| |
| // --- Tracing --- |
| |
| typedef void (*LogEventCallback)(const char* name, int event); |
| |
| /** |
| * Create new error objects by calling the corresponding error object |
| * constructor with the message. |
| */ |
| class V8_EXPORT Exception { |
| public: |
| static Local<Value> RangeError(Local<String> message); |
| static Local<Value> ReferenceError(Local<String> message); |
| static Local<Value> SyntaxError(Local<String> message); |
| static Local<Value> TypeError(Local<String> message); |
| static Local<Value> Error(Local<String> message); |
| |
| /** |
| * Creates an error message for the given exception. |
| * Will try to reconstruct the original stack trace from the exception value, |
| * or capture the current stack trace if not available. |
| */ |
| static Local<Message> CreateMessage(Isolate* isolate, Local<Value> exception); |
| |
| /** |
| * Returns the original stack trace that was captured at the creation time |
| * of a given exception, or an empty handle if not available. |
| */ |
| static Local<StackTrace> GetStackTrace(Local<Value> exception); |
| }; |
| |
| |
| // --- Counters Callbacks --- |
| |
| typedef int* (*CounterLookupCallback)(const char* name); |
| |
| typedef void* (*CreateHistogramCallback)(const char* name, |
| int min, |
| int max, |
| size_t buckets); |
| |
| typedef void (*AddHistogramSampleCallback)(void* histogram, int sample); |
| |
| // --- Enter/Leave Script Callback --- |
| typedef void (*BeforeCallEnteredCallback)(Isolate*); |
| typedef void (*CallCompletedCallback)(Isolate*); |
| |
| /** |
| * HostImportModuleDynamicallyCallback is called when we require the |
| * embedder to load a module. This is used as part of the dynamic |
| * import syntax. |
| * |
| * The referrer contains metadata about the script/module that calls |
| * import. |
| * |
| * The specifier is the name of the module that should be imported. |
| * |
| * The embedder must compile, instantiate, evaluate the Module, and |
| * obtain it's namespace object. |
| * |
| * The Promise returned from this function is forwarded to userland |
| * JavaScript. The embedder must resolve this promise with the module |
| * namespace object. In case of an exception, the embedder must reject |
| * this promise with the exception. If the promise creation itself |
| * fails (e.g. due to stack overflow), the embedder must propagate |
| * that exception by returning an empty MaybeLocal. |
| */ |
| typedef MaybeLocal<Promise> (*HostImportModuleDynamicallyCallback)( |
| Local<Context> context, Local<ScriptOrModule> referrer, |
| Local<String> specifier); |
| |
| /** |
| * HostInitializeImportMetaObjectCallback is called the first time import.meta |
| * is accessed for a module. Subsequent access will reuse the same value. |
| * |
| * The method combines two implementation-defined abstract operations into one: |
| * HostGetImportMetaProperties and HostFinalizeImportMeta. |
| * |
| * The embedder should use v8::Object::CreateDataProperty to add properties on |
| * the meta object. |
| */ |
| typedef void (*HostInitializeImportMetaObjectCallback)(Local<Context> context, |
| Local<Module> module, |
| Local<Object> meta); |
| |
| /** |
| * PromiseHook with type kInit is called when a new promise is |
| * created. When a new promise is created as part of the chain in the |
| * case of Promise.then or in the intermediate promises created by |
| * Promise.{race, all}/AsyncFunctionAwait, we pass the parent promise |
| * otherwise we pass undefined. |
| * |
| * PromiseHook with type kResolve is called at the beginning of |
| * resolve or reject function defined by CreateResolvingFunctions. |
| * |
| * PromiseHook with type kBefore is called at the beginning of the |
| * PromiseReactionJob. |
| * |
| * PromiseHook with type kAfter is called right at the end of the |
| * PromiseReactionJob. |
| */ |
| enum class PromiseHookType { kInit, kResolve, kBefore, kAfter }; |
| |
| typedef void (*PromiseHook)(PromiseHookType type, Local<Promise> promise, |
| Local<Value> parent); |
| |
| // --- Promise Reject Callback --- |
| enum PromiseRejectEvent { |
| kPromiseRejectWithNoHandler = 0, |
| kPromiseHandlerAddedAfterReject = 1, |
| kPromiseRejectAfterResolved = 2, |
| kPromiseResolveAfterResolved = 3, |
| }; |
| |
| class PromiseRejectMessage { |
| public: |
| PromiseRejectMessage(Local<Promise> promise, PromiseRejectEvent event, |
| Local<Value> value, Local<StackTrace> stack_trace) |
| : promise_(promise), |
| event_(event), |
| value_(value), |
| stack_trace_(stack_trace) {} |
| |
| V8_INLINE Local<Promise> GetPromise() const { return promise_; } |
| V8_INLINE PromiseRejectEvent GetEvent() const { return event_; } |
| V8_INLINE Local<Value> GetValue() const { return value_; } |
| |
| private: |
| Local<Promise> promise_; |
| PromiseRejectEvent event_; |
| Local<Value> value_; |
| Local<StackTrace> stack_trace_; |
| }; |
| |
| typedef void (*PromiseRejectCallback)(PromiseRejectMessage message); |
| |
| // --- Microtasks Callbacks --- |
| typedef void (*MicrotasksCompletedCallback)(Isolate*); |
| typedef void (*MicrotaskCallback)(void* data); |
| |
| |
| /** |
| * Policy for running microtasks: |
| * - explicit: microtasks are invoked with Isolate::RunMicrotasks() method; |
| * - scoped: microtasks invocation is controlled by MicrotasksScope objects; |
| * - auto: microtasks are invoked when the script call depth decrements |
| * to zero. |
| */ |
| enum class MicrotasksPolicy { kExplicit, kScoped, kAuto }; |
| |
| |
| /** |
| * This scope is used to control microtasks when kScopeMicrotasksInvocation |
| * is used on Isolate. In this mode every non-primitive call to V8 should be |
| * done inside some MicrotasksScope. |
| * Microtasks are executed when topmost MicrotasksScope marked as kRunMicrotasks |
| * exits. |
| * kDoNotRunMicrotasks should be used to annotate calls not intended to trigger |
| * microtasks. |
| */ |
| class V8_EXPORT MicrotasksScope { |
| public: |
| enum Type { kRunMicrotasks, kDoNotRunMicrotasks }; |
| |
| MicrotasksScope(Isolate* isolate, Type type); |
| ~MicrotasksScope(); |
| |
| /** |
| * Runs microtasks if no kRunMicrotasks scope is currently active. |
| */ |
| static void PerformCheckpoint(Isolate* isolate); |
| |
| /** |
| * Returns current depth of nested kRunMicrotasks scopes. |
| */ |
| static int GetCurrentDepth(Isolate* isolate); |
| |
| /** |
| * Returns true while microtasks are being executed. |
| */ |
| static bool IsRunningMicrotasks(Isolate* isolate); |
| |
| // Prevent copying. |
| MicrotasksScope(const MicrotasksScope&) = delete; |
| MicrotasksScope& operator=(const MicrotasksScope&) = delete; |
| |
| private: |
| internal::Isolate* const isolate_; |
| bool run_; |
| }; |
| |
| |
| // --- Failed Access Check Callback --- |
| typedef void (*FailedAccessCheckCallback)(Local<Object> target, |
| AccessType type, |
| Local<Value> data); |
| |
| // --- AllowCodeGenerationFromStrings callbacks --- |
| |
| /** |
| * Callback to check if code generation from strings is allowed. See |
| * Context::AllowCodeGenerationFromStrings. |
| */ |
| typedef bool (*AllowCodeGenerationFromStringsCallback)(Local<Context> context, |
| Local<String> source); |
| |
| // --- WebAssembly compilation callbacks --- |
| typedef bool (*ExtensionCallback)(const FunctionCallbackInfo<Value>&); |
| |
| typedef bool (*AllowWasmCodeGenerationCallback)(Local<Context> context, |
| Local<String> source); |
| |
| // --- Callback for APIs defined on v8-supported objects, but implemented |
| // by the embedder. Example: WebAssembly.{compile|instantiate}Streaming --- |
| typedef void (*ApiImplementationCallback)(const FunctionCallbackInfo<Value>&); |
| |
| // --- Callback for WebAssembly.compileStreaming --- |
| typedef void (*WasmStreamingCallback)(const FunctionCallbackInfo<Value>&); |
| |
| // --- Callback for checking if WebAssembly threads are enabled --- |
| typedef bool (*WasmThreadsEnabledCallback)(Local<Context> context); |
| |
| // --- Garbage Collection Callbacks --- |
| |
| /** |
| * Applications can register callback functions which will be called before and |
| * after certain garbage collection operations. Allocations are not allowed in |
| * the callback functions, you therefore cannot manipulate objects (set or |
| * delete properties for example) since it is possible such operations will |
| * result in the allocation of objects. |
| */ |
| enum GCType { |
| kGCTypeScavenge = 1 << 0, |
| kGCTypeMarkSweepCompact = 1 << 1, |
| kGCTypeIncrementalMarking = 1 << 2, |
| kGCTypeProcessWeakCallbacks = 1 << 3, |
| kGCTypeAll = kGCTypeScavenge | kGCTypeMarkSweepCompact | |
| kGCTypeIncrementalMarking | kGCTypeProcessWeakCallbacks |
| }; |
| |
| /** |
| * GCCallbackFlags is used to notify additional information about the GC |
| * callback. |
| * - kGCCallbackFlagConstructRetainedObjectInfos: The GC callback is for |
| * constructing retained object infos. |
| * - kGCCallbackFlagForced: The GC callback is for a forced GC for testing. |
| * - kGCCallbackFlagSynchronousPhantomCallbackProcessing: The GC callback |
| * is called synchronously without getting posted to an idle task. |
| * - kGCCallbackFlagCollectAllAvailableGarbage: The GC callback is called |
| * in a phase where V8 is trying to collect all available garbage |
| * (e.g., handling a low memory notification). |
| * - kGCCallbackScheduleIdleGarbageCollection: The GC callback is called to |
| * trigger an idle garbage collection. |
| */ |
| enum GCCallbackFlags { |
| kNoGCCallbackFlags = 0, |
| kGCCallbackFlagConstructRetainedObjectInfos = 1 << 1, |
| kGCCallbackFlagForced = 1 << 2, |
| kGCCallbackFlagSynchronousPhantomCallbackProcessing = 1 << 3, |
| kGCCallbackFlagCollectAllAvailableGarbage = 1 << 4, |
| kGCCallbackFlagCollectAllExternalMemory = 1 << 5, |
| kGCCallbackScheduleIdleGarbageCollection = 1 << 6, |
| }; |
| |
| typedef void (*GCCallback)(GCType type, GCCallbackFlags flags); |
| |
| typedef void (*InterruptCallback)(Isolate* isolate, void* data); |
| |
| /** |
| * This callback is invoked when the heap size is close to the heap limit and |
| * V8 is likely to abort with out-of-memory error. |
| * The callback can extend the heap limit by returning a value that is greater |
| * than the current_heap_limit. The initial heap limit is the limit that was |
| * set after heap setup. |
| */ |
| typedef size_t (*NearHeapLimitCallback)(void* data, size_t current_heap_limit, |
| size_t initial_heap_limit); |
| |
| /** |
| * Collection of V8 heap information. |
| * |
| * Instances of this class can be passed to v8::V8::HeapStatistics to |
| * get heap statistics from V8. |
| */ |
| class V8_EXPORT HeapStatistics { |
| public: |
| HeapStatistics(); |
| size_t total_heap_size() { return total_heap_size_; } |
| size_t total_heap_size_executable() { return total_heap_size_executable_; } |
| size_t total_physical_size() { return total_physical_size_; } |
| size_t total_available_size() { return total_available_size_; } |
| size_t used_heap_size() { return used_heap_size_; } |
| size_t heap_size_limit() { return heap_size_limit_; } |
| size_t malloced_memory() { return malloced_memory_; } |
| size_t external_memory() { return external_memory_; } |
| size_t peak_malloced_memory() { return peak_malloced_memory_; } |
| size_t number_of_native_contexts() { return number_of_native_contexts_; } |
| size_t number_of_detached_contexts() { return number_of_detached_contexts_; } |
| |
| /** |
| * Returns a 0/1 boolean, which signifies whether the V8 overwrite heap |
| * garbage with a bit pattern. |
| */ |
| size_t does_zap_garbage() { return does_zap_garbage_; } |
| |
| private: |
| size_t total_heap_size_; |
| size_t total_heap_size_executable_; |
| size_t total_physical_size_; |
| size_t total_available_size_; |
| size_t used_heap_size_; |
| size_t heap_size_limit_; |
| size_t malloced_memory_; |
| size_t external_memory_; |
| size_t peak_malloced_memory_; |
| bool does_zap_garbage_; |
| size_t number_of_native_contexts_; |
| size_t number_of_detached_contexts_; |
| |
| friend class V8; |
| friend class Isolate; |
| }; |
| |
| |
| class V8_EXPORT HeapSpaceStatistics { |
| public: |
| HeapSpaceStatistics(); |
| const char* space_name() { return space_name_; } |
| size_t space_size() { return space_size_; } |
| size_t space_used_size() { return space_used_size_; } |
| size_t space_available_size() { return space_available_size_; } |
| size_t physical_space_size() { return physical_space_size_; } |
| |
| private: |
| const char* space_name_; |
| size_t space_size_; |
| size_t space_used_size_; |
| size_t space_available_size_; |
| size_t physical_space_size_; |
| |
| friend class Isolate; |
| }; |
| |
| |
| class V8_EXPORT HeapObjectStatistics { |
| public: |
| HeapObjectStatistics(); |
| const char* object_type() { return object_type_; } |
| const char* object_sub_type() { return object_sub_type_; } |
| size_t object_count() { return object_count_; } |
| size_t object_size() { return object_size_; } |
| |
| private: |
| const char* object_type_; |
| const char* object_sub_type_; |
| size_t object_count_; |
| size_t object_size_; |
| |
| friend class Isolate; |
| }; |
| |
| class V8_EXPORT HeapCodeStatistics { |
| public: |
| HeapCodeStatistics(); |
| size_t code_and_metadata_size() { return code_and_metadata_size_; } |
| size_t bytecode_and_metadata_size() { return bytecode_and_metadata_size_; } |
| size_t external_script_source_size() { return external_script_source_size_; } |
| |
| private: |
| size_t code_and_metadata_size_; |
| size_t bytecode_and_metadata_size_; |
| size_t external_script_source_size_; |
| |
| friend class Isolate; |
| }; |
| |
| class RetainedObjectInfo; |
| |
| |
| /** |
| * FunctionEntryHook is the type of the profile entry hook called at entry to |
| * any generated function when function-level profiling is enabled. |
| * |
| * \param function the address of the function that's being entered. |
| * \param return_addr_location points to a location on stack where the machine |
| * return address resides. This can be used to identify the caller of |
| * \p function, and/or modified to divert execution when \p function exits. |
| * |
| * \note the entry hook must not cause garbage collection. |
| */ |
| typedef void (*FunctionEntryHook)(uintptr_t function, |
| uintptr_t return_addr_location); |
| |
| /** |
| * A JIT code event is issued each time code is added, moved or removed. |
| * |
| * \note removal events are not currently issued. |
| */ |
| struct JitCodeEvent { |
| enum EventType { |
| CODE_ADDED, |
| CODE_MOVED, |
| CODE_REMOVED, |
| CODE_ADD_LINE_POS_INFO, |
| CODE_START_LINE_INFO_RECORDING, |
| CODE_END_LINE_INFO_RECORDING |
| }; |
| // Definition of the code position type. The "POSITION" type means the place |
| // in the source code which are of interest when making stack traces to |
| // pin-point the source location of a stack frame as close as possible. |
| // The "STATEMENT_POSITION" means the place at the beginning of each |
| // statement, and is used to indicate possible break locations. |
| enum PositionType { POSITION, STATEMENT_POSITION }; |
| |
| // There are two different kinds of JitCodeEvents, one for JIT code generated |
| // by the optimizing compiler, and one for byte code generated for the |
| // interpreter. For JIT_CODE events, the |code_start| member of the event |
| // points to the beginning of jitted assembly code, while for BYTE_CODE |
| // events, |code_start| points to the first bytecode of the interpreted |
| // function. |
| enum CodeType { BYTE_CODE, JIT_CODE }; |
| |
| // Type of event. |
| EventType type; |
| CodeType code_type; |
| // Start of the instructions. |
| void* code_start; |
| // Size of the instructions. |
| size_t code_len; |
| // Script info for CODE_ADDED event. |
| Local<UnboundScript> script; |
| // User-defined data for *_LINE_INFO_* event. It's used to hold the source |
| // code line information which is returned from the |
| // CODE_START_LINE_INFO_RECORDING event. And it's passed to subsequent |
| // CODE_ADD_LINE_POS_INFO and CODE_END_LINE_INFO_RECORDING events. |
| void* user_data; |
| |
| struct name_t { |
| // Name of the object associated with the code, note that the string is not |
| // zero-terminated. |
| const char* str; |
| // Number of chars in str. |
| size_t len; |
| }; |
| |
| struct line_info_t { |
| // PC offset |
| size_t offset; |
| // Code position |
| size_t pos; |
| // The position type. |
| PositionType position_type; |
| }; |
| |
| union { |
| // Only valid for CODE_ADDED. |
| struct name_t name; |
| |
| // Only valid for CODE_ADD_LINE_POS_INFO |
| struct line_info_t line_info; |
| |
| // New location of instructions. Only valid for CODE_MOVED. |
| void* new_code_start; |
| }; |
| |
| Isolate* isolate; |
| }; |
| |
| /** |
| * Option flags passed to the SetRAILMode function. |
| * See documentation https://developers.google.com/web/tools/chrome-devtools/ |
| * profile/evaluate-performance/rail |
| */ |
| enum RAILMode { |
| // Response performance mode: In this mode very low virtual machine latency |
| // is provided. V8 will try to avoid JavaScript execution interruptions. |
| // Throughput may be throttled. |
| PERFORMANCE_RESPONSE, |
| // Animation performance mode: In this mode low virtual machine latency is |
| // provided. V8 will try to avoid as many JavaScript execution interruptions |
| // as possible. Throughput may be throttled. This is the default mode. |
| PERFORMANCE_ANIMATION, |
| // Idle performance mode: The embedder is idle. V8 can complete deferred work |
| // in this mode. |
| PERFORMANCE_IDLE, |
| // Load performance mode: In this mode high throughput is provided. V8 may |
| // turn off latency optimizations. |
| PERFORMANCE_LOAD |
| }; |
| |
| /** |
| * Option flags passed to the SetJitCodeEventHandler function. |
| */ |
| enum JitCodeEventOptions { |
| kJitCodeEventDefault = 0, |
| // Generate callbacks for already existent code. |
| kJitCodeEventEnumExisting = 1 |
| }; |
| |
| |
| /** |
| * Callback function passed to SetJitCodeEventHandler. |
| * |
| * \param event code add, move or removal event. |
| */ |
| typedef void (*JitCodeEventHandler)(const JitCodeEvent* event); |
| |
| |
| /** |
| * Interface for iterating through all external resources in the heap. |
| */ |
| class V8_EXPORT ExternalResourceVisitor { // NOLINT |
| public: |
| virtual ~ExternalResourceVisitor() {} |
| virtual void VisitExternalString(Local<String> string) {} |
| }; |
| |
| |
| /** |
| * Interface for iterating through all the persistent handles in the heap. |
| */ |
| class V8_EXPORT PersistentHandleVisitor { // NOLINT |
| public: |
| virtual ~PersistentHandleVisitor() {} |
| virtual void VisitPersistentHandle(Persistent<Value>* value, |
| uint16_t class_id) {} |
| }; |
| |
| /** |
| * Memory pressure level for the MemoryPressureNotification. |
| * kNone hints V8 that there is no memory pressure. |
| * kModerate hints V8 to speed up incremental garbage collection at the cost of |
| * of higher latency due to garbage collection pauses. |
| * kCritical hints V8 to free memory as soon as possible. Garbage collection |
| * pauses at this level will be large. |
| */ |
| enum class MemoryPressureLevel { kNone, kModerate, kCritical }; |
| |
| /** |
| * Interface for tracing through the embedder heap. During a V8 garbage |
| * collection, V8 collects hidden fields of all potential wrappers, and at the |
| * end of its marking phase iterates the collection and asks the embedder to |
| * trace through its heap and use reporter to report each JavaScript object |
| * reachable from any of the given wrappers. |
| */ |
| class V8_EXPORT EmbedderHeapTracer { |
| public: |
| // Indicator for the stack state of the embedder. |
| enum EmbedderStackState { |
| kUnknown, |
| kNonEmpty, |
| kEmpty, |
| }; |
| |
| enum ForceCompletionAction { FORCE_COMPLETION, DO_NOT_FORCE_COMPLETION }; |
| |
| struct AdvanceTracingActions { |
| explicit AdvanceTracingActions(ForceCompletionAction force_completion_) |
| : force_completion(force_completion_) {} |
| |
| ForceCompletionAction force_completion; |
| }; |
| |
| virtual ~EmbedderHeapTracer() = default; |
| |
| /** |
| * Called by v8 to register internal fields of found wrappers. |
| * |
| * The embedder is expected to store them somewhere and trace reachable |
| * wrappers from them when called through |AdvanceTracing|. |
| */ |
| virtual void RegisterV8References( |
| const std::vector<std::pair<void*, void*> >& embedder_fields) = 0; |
| |
| /** |
| * Called at the beginning of a GC cycle. |
| */ |
| virtual void TracePrologue() = 0; |
| |
| /** |
| * Called to make a tracing step in the embedder. |
| * |
| * The embedder is expected to trace its heap starting from wrappers reported |
| * by RegisterV8References method, and report back all reachable wrappers. |
| * Furthermore, the embedder is expected to stop tracing by the given |
| * deadline. |
| * |
| * Returns true if there is still work to do. |
| * |
| * Note: Only one of the AdvanceTracing methods needs to be overriden by the |
| * embedder. |
| */ |
| V8_DEPRECATE_SOON("Use void AdvanceTracing(deadline_in_ms)", |
| virtual bool AdvanceTracing( |
| double deadline_in_ms, AdvanceTracingActions actions)) { |
| return false; |
| } |
| |
| /** |
| * Called to advance tracing in the embedder. |
| * |
| * The embedder is expected to trace its heap starting from wrappers reported |
| * by RegisterV8References method, and report back all reachable wrappers. |
| * Furthermore, the embedder is expected to stop tracing by the given |
| * deadline. A deadline of infinity means that tracing should be finished. |
| * |
| * Returns |true| if tracing is done, and false otherwise. |
| * |
| * Note: Only one of the AdvanceTracing methods needs to be overriden by the |
| * embedder. |
| */ |
| virtual bool AdvanceTracing(double deadline_in_ms); |
| |
| /* |
| * Returns true if there no more tracing work to be done (see AdvanceTracing) |
| * and false otherwise. |
| */ |
| virtual bool IsTracingDone(); |
| |
| /** |
| * Called at the end of a GC cycle. |
| * |
| * Note that allocation is *not* allowed within |TraceEpilogue|. |
| */ |
| virtual void TraceEpilogue() = 0; |
| |
| /** |
| * Called upon entering the final marking pause. No more incremental marking |
| * steps will follow this call. |
| * |
| * Note: Only one of the EnterFinalPause methods needs to be overriden by the |
| * embedder. |
| */ |
| V8_DEPRECATE_SOON("Use void EnterFinalPause(EmbedderStackState)", |
| virtual void EnterFinalPause()) {} |
| virtual void EnterFinalPause(EmbedderStackState stack_state); |
| |
| /** |
| * Called when tracing is aborted. |
| * |
| * The embedder is expected to throw away all intermediate data and reset to |
| * the initial state. |
| */ |
| virtual void AbortTracing() = 0; |
| |
| /* |
| * Called by the embedder to request immediate finalization of the currently |
| * running tracing phase that has been started with TracePrologue and not |
| * yet finished with TraceEpilogue. |
| * |
| * Will be a noop when currently not in tracing. |
| * |
| * This is an experimental feature. |
| */ |
| void FinalizeTracing(); |
| |
| /* |
| * Called by the embedder to immediately perform a full garbage collection. |
| * |
| * Should only be used in testing code. |
| */ |
| void GarbageCollectionForTesting(EmbedderStackState stack_state); |
| |
| /* |
| * Returns the v8::Isolate this tracer is attached too and |nullptr| if it |
| * is not attached to any v8::Isolate. |
| */ |
| v8::Isolate* isolate() const { return isolate_; } |
| |
| /** |
| * Returns the number of wrappers that are still to be traced by the embedder. |
| */ |
| V8_DEPRECATE_SOON("Use IsTracingDone", |
| virtual size_t NumberOfWrappersToTrace()) { |
| return 0; |
| } |
| |
| protected: |
| v8::Isolate* isolate_ = nullptr; |
| |
| friend class internal::LocalEmbedderHeapTracer; |
| }; |
| |
| /** |
| * Callback and supporting data used in SnapshotCreator to implement embedder |
| * logic to serialize internal fields. |
| */ |
| struct SerializeInternalFieldsCallback { |
| typedef StartupData (*CallbackFunction)(Local<Object> holder, int index, |
| void* data); |
| SerializeInternalFieldsCallback(CallbackFunction function = nullptr, |
| void* data_arg = nullptr) |
| : callback(function), data(data_arg) {} |
| CallbackFunction callback; |
| void* data; |
| }; |
| // Note that these fields are called "internal fields" in the API and called |
| // "embedder fields" within V8. |
| typedef SerializeInternalFieldsCallback SerializeEmbedderFieldsCallback; |
| |
| /** |
| * Callback and supporting data used to implement embedder logic to deserialize |
| * internal fields. |
| */ |
| struct DeserializeInternalFieldsCallback { |
| typedef void (*CallbackFunction)(Local<Object> holder, int index, |
| StartupData payload, void* data); |
| DeserializeInternalFieldsCallback(CallbackFunction function = nullptr, |
| void* data_arg = nullptr) |
| : callback(function), data(data_arg) {} |
| void (*callback)(Local<Object> holder, int index, StartupData payload, |
| void* data); |
| void* data; |
| }; |
| typedef DeserializeInternalFieldsCallback DeserializeEmbedderFieldsCallback; |
| |
| /** |
| * Isolate represents an isolated instance of the V8 engine. V8 isolates have |
| * completely separate states. Objects from one isolate must not be used in |
| * other isolates. The embedder can create multiple isolates and use them in |
| * parallel in multiple threads. An isolate can be entered by at most one |
| * thread at any given time. The Locker/Unlocker API must be used to |
| * synchronize. |
| */ |
| class V8_EXPORT Isolate { |
| public: |
| /** |
| * Initial configuration parameters for a new Isolate. |
| */ |
| struct CreateParams { |
| CreateParams() |
| : entry_hook(nullptr), |
| code_event_handler(nullptr), |
| snapshot_blob(nullptr), |
| counter_lookup_callback(nullptr), |
| create_histogram_callback(nullptr), |
| add_histogram_sample_callback(nullptr), |
| array_buffer_allocator(nullptr), |
| external_references(nullptr), |
| allow_atomics_wait(true), |
| only_terminate_in_safe_scope(false) {} |
| |
| /** |
| * The optional entry_hook allows the host application to provide the |
| * address of a function that's invoked on entry to every V8-generated |
| * function. Note that entry_hook is invoked at the very start of each |
| * generated function. |
| * An entry_hook can only be provided in no-snapshot builds; in snapshot |
| * builds it must be nullptr. |
| */ |
| FunctionEntryHook entry_hook; |
| |
| /** |
| * Allows the host application to provide the address of a function that is |
| * notified each time code is added, moved or removed. |
| */ |
| JitCodeEventHandler code_event_handler; |
| |
| /** |
| * ResourceConstraints to use for the new Isolate. |
| */ |
| ResourceConstraints constraints; |
| |
| /** |
| * Explicitly specify a startup snapshot blob. The embedder owns the blob. |
| */ |
| StartupData* snapshot_blob; |
| |
| |
| /** |
| * Enables the host application to provide a mechanism for recording |
| * statistics counters. |
| */ |
| CounterLookupCallback counter_lookup_callback; |
| |
| /** |
| * Enables the host application to provide a mechanism for recording |
| * histograms. The CreateHistogram function returns a |
| * histogram which will later be passed to the AddHistogramSample |
| * function. |
| */ |
| CreateHistogramCallback create_histogram_callback; |
| AddHistogramSampleCallback add_histogram_sample_callback; |
| |
| /** |
| * The ArrayBuffer::Allocator to use for allocating and freeing the backing |
| * store of ArrayBuffers. |
| */ |
| ArrayBuffer::Allocator* array_buffer_allocator; |
| |
| /** |
| * Specifies an optional nullptr-terminated array of raw addresses in the |
| * embedder that V8 can match against during serialization and use for |
| * deserialization. This array and its content must stay valid for the |
| * entire lifetime of the isolate. |
| */ |
| const intptr_t* external_references; |
| |
| /** |
| * Whether calling Atomics.wait (a function that may block) is allowed in |
| * this isolate. This can also be configured via SetAllowAtomicsWait. |
| */ |
| bool allow_atomics_wait; |
| |
| /** |
| * Termination is postponed when there is no active SafeForTerminationScope. |
| */ |
| bool only_terminate_in_safe_scope; |
| }; |
| |
| |
| /** |
| * Stack-allocated class which sets the isolate for all operations |
| * executed within a local scope. |
| */ |
| class V8_EXPORT Scope { |
| public: |
| explicit Scope(Isolate* isolate) : isolate_(isolate) { |
| isolate->Enter(); |
| } |
| |
| ~Scope() { isolate_->Exit(); } |
| |
| // Prevent copying of Scope objects. |
| Scope(const Scope&) = delete; |
| Scope& operator=(const Scope&) = delete; |
| |
| private: |
| Isolate* const isolate_; |
| }; |
| |
| |
| /** |
| * Assert that no Javascript code is invoked. |
| */ |
| class V8_EXPORT DisallowJavascriptExecutionScope { |
| public: |
| enum OnFailure { CRASH_ON_FAILURE, THROW_ON_FAILURE }; |
| |
| DisallowJavascriptExecutionScope(Isolate* isolate, OnFailure on_failure); |
| ~DisallowJavascriptExecutionScope(); |
| |
| // Prevent copying of Scope objects. |
| DisallowJavascriptExecutionScope(const DisallowJavascriptExecutionScope&) = |
| delete; |
| DisallowJavascriptExecutionScope& operator=( |
| const DisallowJavascriptExecutionScope&) = delete; |
| |
| private: |
| bool on_failure_; |
| void* internal_; |
| }; |
| |
| |
| /** |
| * Introduce exception to DisallowJavascriptExecutionScope. |
| */ |
| class V8_EXPORT AllowJavascriptExecutionScope { |
| public: |
| explicit AllowJavascriptExecutionScope(Isolate* isolate); |
| ~AllowJavascriptExecutionScope(); |
| |
| // Prevent copying of Scope objects. |
| AllowJavascriptExecutionScope(const AllowJavascriptExecutionScope&) = |
| delete; |
| AllowJavascriptExecutionScope& operator=( |
| const AllowJavascriptExecutionScope&) = delete; |
| |
| private: |
| void* internal_throws_; |
| void* internal_assert_; |
| }; |
| |
| /** |
| * Do not run microtasks while this scope is active, even if microtasks are |
| * automatically executed otherwise. |
| */ |
| class V8_EXPORT SuppressMicrotaskExecutionScope { |
| public: |
| explicit SuppressMicrotaskExecutionScope(Isolate* isolate); |
| ~SuppressMicrotaskExecutionScope(); |
| |
| // Prevent copying of Scope objects. |
| SuppressMicrotaskExecutionScope(const SuppressMicrotaskExecutionScope&) = |
| delete; |
| SuppressMicrotaskExecutionScope& operator=( |
| const SuppressMicrotaskExecutionScope&) = delete; |
| |
| private: |
| internal::Isolate* const isolate_; |
| }; |
| |
| /** |
| * This scope allows terminations inside direct V8 API calls and forbid them |
| * inside any recursice API calls without explicit SafeForTerminationScope. |
| */ |
| class V8_EXPORT SafeForTerminationScope { |
| public: |
| explicit SafeForTerminationScope(v8::Isolate* isolate); |
| ~SafeForTerminationScope(); |
| |
| // Prevent copying of Scope objects. |
| SafeForTerminationScope(const SafeForTerminationScope&) = delete; |
| SafeForTerminationScope& operator=(const SafeForTerminationScope&) = delete; |
| |
| private: |
| internal::Isolate* isolate_; |
| bool prev_value_; |
| }; |
| |
| /** |
| * Types of garbage collections that can be requested via |
| * RequestGarbageCollectionForTesting. |
| */ |
| enum GarbageCollectionType { |
| kFullGarbageCollection, |
| kMinorGarbageCollection |
| }; |
| |
| /** |
| * Features reported via the SetUseCounterCallback callback. Do not change |
| * assigned numbers of existing items; add new features to the end of this |
| * list. |
| */ |
| enum UseCounterFeature { |
| kUseAsm = 0, |
| kBreakIterator = 1, |
| kLegacyConst = 2, |
| kMarkDequeOverflow = 3, |
| kStoreBufferOverflow = 4, |
| kSlotsBufferOverflow = 5, |
| kObjectObserve = 6, |
| kForcedGC = 7, |
| kSloppyMode = 8, |
| kStrictMode = 9, |
| kStrongMode = 10, |
| kRegExpPrototypeStickyGetter = 11, |
| kRegExpPrototypeToString = 12, |
| kRegExpPrototypeUnicodeGetter = 13, |
| kIntlV8Parse = 14, |
| kIntlPattern = 15, |
| kIntlResolved = 16, |
| kPromiseChain = 17, |
| kPromiseAccept = 18, |
| kPromiseDefer = 19, |
| kHtmlCommentInExternalScript = 20, |
| kHtmlComment = 21, |
| kSloppyModeBlockScopedFunctionRedefinition = 22, |
| kForInInitializer = 23, |
| kArrayProtectorDirtied = 24, |
| kArraySpeciesModified = 25, |
| kArrayPrototypeConstructorModified = 26, |
| kArrayInstanceProtoModified = 27, |
| kArrayInstanceConstructorModified = 28, |
| kLegacyFunctionDeclaration = 29, |
| kRegExpPrototypeSourceGetter = 30, |
| kRegExpPrototypeOldFlagGetter = 31, |
| kDecimalWithLeadingZeroInStrictMode = 32, |
| kLegacyDateParser = 33, |
| kDefineGetterOrSetterWouldThrow = 34, |
| kFunctionConstructorReturnedUndefined = 35, |
| kAssigmentExpressionLHSIsCallInSloppy = 36, |
| kAssigmentExpressionLHSIsCallInStrict = 37, |
| kPromiseConstructorReturnedUndefined = 38, |
| kConstructorNonUndefinedPrimitiveReturn = 39, |
| kLabeledExpressionStatement = 40, |
| kLineOrParagraphSeparatorAsLineTerminator = 41, |
| kIndexAccessor = 42, |
| kErrorCaptureStackTrace = 43, |
| kErrorPrepareStackTrace = 44, |
| kErrorStackTraceLimit = 45, |
| kWebAssemblyInstantiation = 46, |
| kDeoptimizerDisableSpeculation = 47, |
| kArrayPrototypeSortJSArrayModifiedPrototype = 48, |
| kFunctionTokenOffsetTooLongForToString = 49, |
| kWasmSharedMemory = 50, |
| kWasmThreadOpcodes = 51, |
| |
| // If you add new values here, you'll also need to update Chromium's: |
| // web_feature.mojom, UseCounterCallback.cpp, and enums.xml. V8 changes to |
| // this list need to be landed first, then changes on the Chromium side. |
| kUseCounterFeatureCount // This enum value must be last. |
| }; |
| |
| enum MessageErrorLevel { |
| kMessageLog = (1 << 0), |
| kMessageDebug = (1 << 1), |
| kMessageInfo = (1 << 2), |
| kMessageError = (1 << 3), |
| kMessageWarning = (1 << 4), |
| kMessageAll = kMessageLog | kMessageDebug | kMessageInfo | kMessageError | |
| kMessageWarning, |
| }; |
| |
| typedef void (*UseCounterCallback)(Isolate* isolate, |
| UseCounterFeature feature); |
| |
| /** |
| * Allocates a new isolate but does not initialize it. Does not change the |
| * currently entered isolate. |
| * |
| * Only Isolate::GetData() and Isolate::SetData(), which access the |
| * embedder-controlled parts of the isolate, are allowed to be called on the |
| * uninitialized isolate. To initialize the isolate, call |
| * Isolate::Initialize(). |
| * |
| * When an isolate is no longer used its resources should be freed |
| * by calling Dispose(). Using the delete operator is not allowed. |
| * |
| * V8::Initialize() must have run prior to this. |
| */ |
| static Isolate* Allocate(); |
| |
| /** |
| * Initialize an Isolate previously allocated by Isolate::Allocate(). |
| */ |
| static void Initialize(Isolate* isolate, const CreateParams& params); |
| |
| /** |
| * Creates a new isolate. Does not change the currently entered |
| * isolate. |
| * |
| * When an isolate is no longer used its resources should be freed |
| * by calling Dispose(). Using the delete operator is not allowed. |
| * |
| * V8::Initialize() must have run prior to this. |
| */ |
| static Isolate* New(const CreateParams& params); |
| |
| /** |
| * Returns the entered isolate for the current thread or NULL in |
| * case there is no current isolate. |
| * |
| * This method must not be invoked before V8::Initialize() was invoked. |
| */ |
| static Isolate* GetCurrent(); |
| |
| /** |
| * Custom callback used by embedders to help V8 determine if it should abort |
| * when it throws and no internal handler is predicted to catch the |
| * exception. If --abort-on-uncaught-exception is used on the command line, |
| * then V8 will abort if either: |
| * - no custom callback is set. |
| * - the custom callback set returns true. |
| * Otherwise, the custom callback will not be called and V8 will not abort. |
| */ |
| typedef bool (*AbortOnUncaughtExceptionCallback)(Isolate*); |
| void SetAbortOnUncaughtExceptionCallback( |
| AbortOnUncaughtExceptionCallback callback); |
| |
| /** |
| * This specifies the callback called by the upcoming dynamic |
| * import() language feature to load modules. |
| */ |
| void SetHostImportModuleDynamicallyCallback( |
| HostImportModuleDynamicallyCallback callback); |
| |
| /** |
| * This specifies the callback called by the upcoming importa.meta |
| * language feature to retrieve host-defined meta data for a module. |
| */ |
| void SetHostInitializeImportMetaObjectCallback( |
| HostInitializeImportMetaObjectCallback callback); |
| |
| /** |
| * Optional notification that the system is running low on memory. |
| * V8 uses these notifications to guide heuristics. |
| * It is allowed to call this function from another thread while |
| * the isolate is executing long running JavaScript code. |
| */ |
| void MemoryPressureNotification(MemoryPressureLevel level); |
| |
| /** |
| * Methods below this point require holding a lock (using Locker) in |
| * a multi-threaded environment. |
| */ |
| |
| /** |
| * Sets this isolate as the entered one for the current thread. |
| * Saves the previously entered one (if any), so that it can be |
| * restored when exiting. Re-entering an isolate is allowed. |
| */ |
| void Enter(); |
| |
| /** |
| * Exits this isolate by restoring the previously entered one in the |
| * current thread. The isolate may still stay the same, if it was |
| * entered more than once. |
| * |
| * Requires: this == Isolate::GetCurrent(). |
| */ |
| void Exit(); |
| |
| /** |
| * Disposes the isolate. The isolate must not be entered by any |
| * thread to be disposable. |
| */ |
| void Dispose(); |
| |
| /** |
| * Dumps activated low-level V8 internal stats. This can be used instead |
| * of performing a full isolate disposal. |
| */ |
| void DumpAndResetStats(); |
| |
| /** |
| * Discards all V8 thread-specific data for the Isolate. Should be used |
| * if a thread is terminating and it has used an Isolate that will outlive |
| * the thread -- all thread-specific data for an Isolate is discarded when |
| * an Isolate is disposed so this call is pointless if an Isolate is about |
| * to be Disposed. |
| */ |
| void DiscardThreadSpecificMetadata(); |
| |
| /** |
| * Associate embedder-specific data with the isolate. |slot| has to be |
| * between 0 and GetNumberOfDataSlots() - 1. |
| */ |
| V8_INLINE void SetData(uint32_t slot, void* data); |
| |
| /** |
| * Retrieve embedder-specific data from the isolate. |
| * Returns NULL if SetData has never been called for the given |slot|. |
| */ |
| V8_INLINE void* GetData(uint32_t slot); |
| |
| /** |
| * Returns the maximum number of available embedder data slots. Valid slots |
| * are in the range of 0 - GetNumberOfDataSlots() - 1. |
| */ |
| V8_INLINE static uint32_t GetNumberOfDataSlots(); |
| |
| /** |
| * Return data that was previously attached to the isolate snapshot via |
| * SnapshotCreator, and removes the reference to it. |
| * Repeated call with the same index returns an empty MaybeLocal. |
| */ |
| template <class T> |
| V8_INLINE MaybeLocal<T> GetDataFromSnapshotOnce(size_t index); |
| |
| /** |
| * Get statistics about the heap memory usage. |
| */ |
| void GetHeapStatistics(HeapStatistics* heap_statistics); |
| |
| /** |
| * Returns the number of spaces in the heap. |
| */ |
| size_t NumberOfHeapSpaces(); |
| |
| /** |
| * Get the memory usage of a space in the heap. |
| * |
| * \param space_statistics The HeapSpaceStatistics object to fill in |
| * statistics. |
| * \param index The index of the space to get statistics from, which ranges |
| * from 0 to NumberOfHeapSpaces() - 1. |
| * \returns true on success. |
| */ |
| bool GetHeapSpaceStatistics(HeapSpaceStatistics* space_statistics, |
| size_t index); |
| |
| /** |
| * Returns the number of types of objects tracked in the heap at GC. |
| */ |
| size_t NumberOfTrackedHeapObjectTypes(); |
| |
| /** |
| * Get statistics about objects in the heap. |
| * |
| * \param object_statistics The HeapObjectStatistics object to fill in |
| * statistics of objects of given type, which were live in the previous GC. |
| * \param type_index The index of the type of object to fill details about, |
| * which ranges from 0 to NumberOfTrackedHeapObjectTypes() - 1. |
| * \returns true on success. |
| */ |
| bool GetHeapObjectStatisticsAtLastGC(HeapObjectStatistics* object_statistics, |
| size_t type_index); |
| |
| /** |
| * Get statistics about code and its metadata in the heap. |
| * |
| * \param object_statistics The HeapCodeStatistics object to fill in |
| * statistics of code, bytecode and their metadata. |
| * \returns true on success. |
| */ |
| bool GetHeapCodeAndMetadataStatistics(HeapCodeStatistics* object_statistics); |
| |
| /** |
| * Get a call stack sample from the isolate. |
| * \param state Execution state. |
| * \param frames Caller allocated buffer to store stack frames. |
| * \param frames_limit Maximum number of frames to capture. The buffer must |
| * be large enough to hold the number of frames. |
| * \param sample_info The sample info is filled up by the function |
| * provides number of actual captured stack frames and |
| * the current VM state. |
| * \note GetStackSample should only be called when the JS thread is paused or |
| * interrupted. Otherwise the behavior is undefined. |
| */ |
| void GetStackSample(const RegisterState& state, void** frames, |
| size_t frames_limit, SampleInfo* sample_info); |
| |
| /** |
| * Adjusts the amount of registered external memory. Used to give V8 an |
| * indication of the amount of externally allocated memory that is kept alive |
| * by JavaScript objects. V8 uses this to decide when to perform global |
| * garbage collections. Registering externally allocated memory will trigger |
| * global garbage collections more often than it would otherwise in an attempt |
| * to garbage collect the JavaScript objects that keep the externally |
| * allocated memory alive. |
| * |
| * \param change_in_bytes the change in externally allocated memory that is |
| * kept alive by JavaScript objects. |
| * \returns the adjusted value. |
| */ |
| V8_INLINE int64_t |
| AdjustAmountOfExternalAllocatedMemory(int64_t change_in_bytes); |
| |
| /** |
| * Returns the number of phantom handles without callbacks that were reset |
| * by the garbage collector since the last call to this function. |
| */ |
| size_t NumberOfPhantomHandleResetsSinceLastCall(); |
| |
| /** |
| * Returns heap profiler for this isolate. Will return NULL until the isolate |
| * is initialized. |
| */ |
| HeapProfiler* GetHeapProfiler(); |
| |
| /** |
| * Tells the VM whether the embedder is idle or not. |
| */ |
| void SetIdle(bool is_idle); |
| |
| /** Returns true if this isolate has a current context. */ |
| bool InContext(); |
| |
| /** |
| * Returns the context of the currently running JavaScript, or the context |
| * on the top of the stack if no JavaScript is running. |
| */ |
| Local<Context> GetCurrentContext(); |
| |
| /** Returns the last context entered through V8's C++ API. */ |
| Local<Context> GetEnteredContext(); |
| |
| /** |
| * Returns either the last context entered through V8's C++ API, or the |
| * context of the currently running microtask while processing microtasks. |
| * If a context is entered while executing a microtask, that context is |
| * returned. |
| */ |
| Local<Context> GetEnteredOrMicrotaskContext(); |
| |
| /** |
| * Returns the Context that corresponds to the Incumbent realm in HTML spec. |
| * https://html.spec.whatwg.org/multipage/webappapis.html#incumbent |
| */ |
| Local<Context> GetIncumbentContext(); |
| |
| /** |
| * Schedules an exception to be thrown when returning to JavaScript. When an |
| * exception has been scheduled it is illegal to invoke any JavaScript |
| * operation; the caller must return immediately and only after the exception |
| * has been handled does it become legal to invoke JavaScript operations. |
| */ |
| Local<Value> ThrowException(Local<Value> exception); |
| |
| typedef void (*GCCallback)(Isolate* isolate, GCType type, |
| GCCallbackFlags flags); |
| typedef void (*GCCallbackWithData)(Isolate* isolate, GCType type, |
| GCCallbackFlags flags, void* data); |
| |
| /** |
| * Enables the host application to receive a notification before a |
| * garbage collection. Allocations are allowed in the callback function, |
| * but the callback is not re-entrant: if the allocation inside it will |
| * trigger the garbage collection, the callback won't be called again. |
| * It is possible to specify the GCType filter for your callback. But it is |
| * not possible to register the same callback function two times with |
| * different GCType filters. |
| */ |
| void AddGCPrologueCallback(GCCallbackWithData callback, void* data = nullptr, |
| GCType gc_type_filter = kGCTypeAll); |
| void AddGCPrologueCallback(GCCallback callback, |
| GCType gc_type_filter = kGCTypeAll); |
| |
| /** |
| * This function removes callback which was installed by |
| * AddGCPrologueCallback function. |
| */ |
| void RemoveGCPrologueCallback(GCCallbackWithData, void* data = nullptr); |
| void RemoveGCPrologueCallback(GCCallback callback); |
| |
| /** |
| * Sets the embedder heap tracer for the isolate. |
| */ |
| void SetEmbedderHeapTracer(EmbedderHeapTracer* tracer); |
| |
| /** |
| * Use for |AtomicsWaitCallback| to indicate the type of event it receives. |
| */ |
| enum class AtomicsWaitEvent { |
| /** Indicates that this call is happening before waiting. */ |
| kStartWait, |
| /** `Atomics.wait()` finished because of an `Atomics.wake()` call. */ |
| kWokenUp, |
| /** `Atomics.wait()` finished because it timed out. */ |
| kTimedOut, |
| /** `Atomics.wait()` was interrupted through |TerminateExecution()|. */ |
| kTerminatedExecution, |
| /** `Atomics.wait()` was stopped through |AtomicsWaitWakeHandle|. */ |
| kAPIStopped, |
| /** `Atomics.wait()` did not wait, as the initial condition was not met. */ |
| kNotEqual |
| }; |
| |
| /** |
| * Passed to |AtomicsWaitCallback| as a means of stopping an ongoing |
| * `Atomics.wait` call. |
| */ |
| class V8_EXPORT AtomicsWaitWakeHandle { |
| public: |
| /** |
| * Stop this `Atomics.wait()` call and call the |AtomicsWaitCallback| |
| * with |kAPIStopped|. |
| * |
| * This function may be called from another thread. The caller has to ensure |
| * through proper synchronization that it is not called after |
| * the finishing |AtomicsWaitCallback|. |
| * |
| * Note that the ECMAScript specification does not plan for the possibility |
| * of wakeups that are neither coming from a timeout or an `Atomics.wake()` |
| * call, so this may invalidate assumptions made by existing code. |
| * The embedder may accordingly wish to schedule an exception in the |
| * finishing |AtomicsWaitCallback|. |
| */ |
| void Wake(); |
| }; |
| |
| /** |
| * Embedder callback for `Atomics.wait()` that can be added through |
| * |SetAtomicsWaitCallback|. |
| * |
| * This will be called just before starting to wait with the |event| value |
| * |kStartWait| and after finishing waiting with one of the other |
| * values of |AtomicsWaitEvent| inside of an `Atomics.wait()` call. |
| * |
| * |array_buffer| will refer to the underlying SharedArrayBuffer, |
| * |offset_in_bytes| to the location of the waited-on memory address inside |
| * the SharedArrayBuffer. |
| * |
| * |value| and |timeout_in_ms| will be the values passed to |
| * the `Atomics.wait()` call. If no timeout was used, |timeout_in_ms| |
| * will be `INFINITY`. |
| * |
| * In the |kStartWait| callback, |stop_handle| will be an object that |
| * is only valid until the corresponding finishing callback and that |
| * can be used to stop the wait process while it is happening. |
| * |
| * This callback may schedule exceptions, *unless* |event| is equal to |
| * |kTerminatedExecution|. |
| */ |
| typedef void (*AtomicsWaitCallback)(AtomicsWaitEvent event, |
| Local<SharedArrayBuffer> array_buffer, |
| size_t offset_in_bytes, int32_t value, |
| double timeout_in_ms, |
| AtomicsWaitWakeHandle* stop_handle, |
| void* data); |
| |
| /** |
| * Set a new |AtomicsWaitCallback|. This overrides an earlier |
| * |AtomicsWaitCallback|, if there was any. If |callback| is nullptr, |
| * this unsets the callback. |data| will be passed to the callback |
| * as its last parameter. |
| */ |
| void SetAtomicsWaitCallback(AtomicsWaitCallback callback, void* data); |
| |
| /** |
| * Enables the host application to receive a notification after a |
| * garbage collection. Allocations are allowed in the callback function, |
| * but the callback is not re-entrant: if the allocation inside it will |
| * trigger the garbage collection, the callback won't be called again. |
| * It is possible to specify the GCType filter for your callback. But it is |
| * not possible to register the same callback function two times with |
| * different GCType filters. |
| */ |
| void AddGCEpilogueCallback(GCCallbackWithData callback, void* data = nullptr, |
| GCType gc_type_filter = kGCTypeAll); |
| void AddGCEpilogueCallback(GCCallback callback, |
| GCType gc_type_filter = kGCTypeAll); |
| |
| /** |
| * This function removes callback which was installed by |
| * AddGCEpilogueCallback function. |
| */ |
| void RemoveGCEpilogueCallback(GCCallbackWithData callback, |
| void* data = nullptr); |
| void RemoveGCEpilogueCallback(GCCallback callback); |
| |
| typedef size_t (*GetExternallyAllocatedMemoryInBytesCallback)(); |
| |
| /** |
| * Set the callback that tells V8 how much memory is currently allocated |
| * externally of the V8 heap. Ideally this memory is somehow connected to V8 |
| * objects and may get freed-up when the corresponding V8 objects get |
| * collected by a V8 garbage collection. |
| */ |
| void SetGetExternallyAllocatedMemoryInBytesCallback( |
| GetExternallyAllocatedMemoryInBytesCallback callback); |
| |
| /** |
| * Forcefully terminate the current thread of JavaScript execution |
| * in the given isolate. |
| * |
| * This method can be used by any thread even if that thread has not |
| * acquired the V8 lock with a Locker object. |
| */ |
| void TerminateExecution(); |
| |
| /** |
| * Is V8 terminating JavaScript execution. |
| * |
| * Returns true if JavaScript execution is currently terminating |
| * because of a call to TerminateExecution. In that case there are |
| * still JavaScript frames on the stack and the termination |
| * exception is still active. |
| */ |
| bool IsExecutionTerminating(); |
| |
| /** |
| * Resume execution capability in the given isolate, whose execution |
| * was previously forcefully terminated using TerminateExecution(). |
| * |
| * When execution is forcefully terminated using TerminateExecution(), |
| * the isolate can not resume execution until all JavaScript frames |
| * have propagated the uncatchable exception which is generated. This |
| * method allows the program embedding the engine to handle the |
| * termination event and resume execution capability, even if |
| * JavaScript frames remain on the stack. |
| * |
| * This method can be used by any thread even if that thread has not |
| * acquired the V8 lock with a Locker object. |
| */ |
| void CancelTerminateExecution(); |
| |
| /** |
| * Request V8 to interrupt long running JavaScript code and invoke |
| * the given |callback| passing the given |data| to it. After |callback| |
| * returns control will be returned to the JavaScript code. |
| * There may be a number of interrupt requests in flight. |
| * Can be called from another thread without acquiring a |Locker|. |
| * Registered |callback| must not reenter interrupted Isolate. |
| */ |
| void RequestInterrupt(InterruptCallback callback, void* data); |
| |
| /** |
| * Request garbage collection in this Isolate. It is only valid to call this |
| * function if --expose_gc was specified. |
| * |
| * This should only be used for testing purposes and not to enforce a garbage |
| * collection schedule. It has strong negative impact on the garbage |
| * collection performance. Use IdleNotificationDeadline() or |
| * LowMemoryNotification() instead to influence the garbage collection |
| * schedule. |
| */ |
| void RequestGarbageCollectionForTesting(GarbageCollectionType type); |
| |
| /** |
| * Set the callback to invoke for logging event. |
| */ |
| void SetEventLogger(LogEventCallback that); |
| |
| /** |
| * Adds a callback to notify the host application right before a script |
| * is about to run. If a script re-enters the runtime during executing, the |
| * BeforeCallEnteredCallback is invoked for each re-entrance. |
| * Executing scripts inside the callback will re-trigger the callback. |
| */ |
| void AddBeforeCallEnteredCallback(BeforeCallEnteredCallback callback); |
| |
| /** |
| * Removes callback that was installed by AddBeforeCallEnteredCallback. |
| */ |
| void RemoveBeforeCallEnteredCallback(BeforeCallEnteredCallback callback); |
| |
| /** |
| * Adds a callback to notify the host application when a script finished |
| * running. If a script re-enters the runtime during executing, the |
| * CallCompletedCallback is only invoked when the outer-most script |
| * execution ends. Executing scripts inside the callback do not trigger |
| * further callbacks. |
| */ |
| void AddCallCompletedCallback(CallCompletedCallback callback); |
| |
| /** |
| * Removes callback that was installed by AddCallCompletedCallback. |
| */ |
| void RemoveCallCompletedCallback(CallCompletedCallback callback); |
| |
| /** |
| * Set the PromiseHook callback for various promise lifecycle |
| * events. |
| */ |
| void SetPromiseHook(PromiseHook hook); |
| |
| /** |
| * Set callback to notify about promise reject with no handler, or |
| * revocation of such a previous notification once the handler is added. |
| */ |
| void SetPromiseRejectCallback(PromiseRejectCallback callback); |
| |
| /** |
| * Runs the Microtask Work Queue until empty |
| * Any exceptions thrown by microtask callbacks are swallowed. |
| */ |
| void RunMicrotasks(); |
| |
| /** |
| * Enqueues the callback to the Microtask Work Queue |
| */ |
| void EnqueueMicrotask(Local<Function> microtask); |
| |
| /** |
| * Enqueues the callback to the Microtask Work Queue |
| */ |
| void EnqueueMicrotask(MicrotaskCallback callback, void* data = nullptr); |
| |
| /** |
| * Controls how Microtasks are invoked. See MicrotasksPolicy for details. |
| */ |
| void SetMicrotasksPolicy(MicrotasksPolicy policy); |
| |
| /** |
| * Returns the policy controlling how Microtasks are invoked. |
| */ |
| MicrotasksPolicy GetMicrotasksPolicy() const; |
| |
| /** |
| * Adds a callback to notify the host application after |
| * microtasks were run. The callback is triggered by explicit RunMicrotasks |
| * call or automatic microtasks execution (see SetAutorunMicrotasks). |
| * |
| * Callback will trigger even if microtasks were attempted to run, |
| * but the microtasks queue was empty and no single microtask was actually |
| * executed. |
| * |
| * Executing scriptsinside the callback will not re-trigger microtasks and |
| * the callback. |
| */ |
| void AddMicrotasksCompletedCallback(MicrotasksCompletedCallback callback); |
| |
| /** |
| * Removes callback that was installed by AddMicrotasksCompletedCallback. |
| */ |
| void RemoveMicrotasksCompletedCallback(MicrotasksCompletedCallback callback); |
| |
| /** |
| * Sets a callback for counting the number of times a feature of V8 is used. |
| */ |
| void SetUseCounterCallback(UseCounterCallback callback); |
| |
| /** |
| * Enables the host application to provide a mechanism for recording |
| * statistics counters. |
| */ |
| void SetCounterFunction(CounterLookupCallback); |
| |
| /** |
| * Enables the host application to provide a mechanism for recording |
| * histograms. The CreateHistogram function returns a |
| * histogram which will later be passed to the AddHistogramSample |
| * function. |
| */ |
| void SetCreateHistogramFunction(CreateHistogramCallback); |
| void SetAddHistogramSampleFunction(AddHistogramSampleCallback); |
| |
| /** |
| * Optional notification that the embedder is idle. |
| * V8 uses the notification to perform garbage collection. |
| * This call can be used repeatedly if the embedder remains idle. |
| * Returns true if the embedder should stop calling IdleNotificationDeadline |
| * until real work has been done. This indicates that V8 has done |
| * as much cleanup as it will be able to do. |
| * |
| * The deadline_in_seconds argument specifies the deadline V8 has to finish |
| * garbage collection work. deadline_in_seconds is compared with |
| * MonotonicallyIncreasingTime() and should be based on the same timebase as |
| * that function. There is no guarantee that the actual work will be done |
| * within the time limit. |
| */ |
| bool IdleNotificationDeadline(double deadline_in_seconds); |
| |
| /** |
| * Optional notification that the system is running low on memory. |
| * V8 uses these notifications to attempt to free memory. |
| */ |
| void LowMemoryNotification(); |
| |
| /** |
| * Optional notification that a context has been disposed. V8 uses |
| * these notifications to guide the GC heuristic. Returns the number |
| * of context disposals - including this one - since the last time |
| * V8 had a chance to clean up. |
| * |
| * The optional parameter |dependant_context| specifies whether the disposed |
| * context was depending on state from other contexts or not. |
| */ |
| int ContextDisposedNotification(bool dependant_context = true); |
| |
| /** |
| * Optional notification that the isolate switched to the foreground. |
| * V8 uses these notifications to guide heuristics. |
| */ |
| void IsolateInForegroundNotification(); |
| |
| /** |
| * Optional notification that the isolate switched to the background. |
| * V8 uses these notifications to guide heuristics. |
| */ |
| void IsolateInBackgroundNotification(); |
| |
| /** |
| * Optional notification which will enable the memory savings mode. |
| * V8 uses this notification to guide heuristics which may result in a |
| * smaller memory footprint at the cost of reduced runtime performance. |
| */ |
| void EnableMemorySavingsMode(); |
| |
| /** |
| * Optional notification which will disable the memory savings mode. |
| */ |
| void DisableMemorySavingsMode(); |
| |
| /** |
| * Optional notification to tell V8 the current performance requirements |
| * of the embedder based on RAIL. |
| * V8 uses these notifications to guide heuristics. |
| * This is an unfinished experimental feature. Semantics and implementation |
| * may change frequently. |
| */ |
| void SetRAILMode(RAILMode rail_mode); |
| |
| /** |
| * Optional notification to tell V8 the current isolate is used for debugging |
| * and requires higher heap limit. |
| */ |
| void IncreaseHeapLimitForDebugging(); |
| |
| /** |
| * Restores the original heap limit after IncreaseHeapLimitForDebugging(). |
| */ |
| void RestoreOriginalHeapLimit(); |
| |
| /** |
| * Returns true if the heap limit was increased for debugging and the |
| * original heap limit was not restored yet. |
| */ |
| bool IsHeapLimitIncreasedForDebugging(); |
| |
| /** |
| * Allows the host application to provide the address of a function that is |
| * notified each time code is added, moved or removed. |
| * |
| * \param options options for the JIT code event handler. |
| * \param event_handler the JIT code event handler, which will be invoked |
| * each time code is added, moved or removed. |
| * \note \p event_handler won't get notified of existent code. |
| * \note since code removal notifications are not currently issued, the |
| * \p event_handler may get notifications of code that overlaps earlier |
| * code notifications. This happens when code areas are reused, and the |
| * earlier overlapping code areas should therefore be discarded. |
| * \note the events passed to \p event_handler and the strings they point to |
| * are not guaranteed to live past each call. The \p event_handler must |
| * copy strings and other parameters it needs to keep around. |
| * \note the set of events declared in JitCodeEvent::EventType is expected to |
| * grow over time, and the JitCodeEvent structure is expected to accrue |
| * new members. The \p event_handler function must ignore event codes |
| * it does not recognize to maintain future compatibility. |
| * \note Use Isolate::CreateParams to get events for code executed during |
| * Isolate setup. |
| */ |
| void SetJitCodeEventHandler(JitCodeEventOptions options, |
| JitCodeEventHandler event_handler); |
| |
| /** |
| * Modifies the stack limit for this Isolate. |
| * |
| * \param stack_limit An address beyond which the Vm's stack may not grow. |
| * |
| * \note If you are using threads then you should hold the V8::Locker lock |
| * while setting the stack limit and you must set a non-default stack |
| * limit separately for each thread. |
| */ |
| void SetStackLimit(uintptr_t stack_limit); |
| |
| /** |
| * Returns a memory range that can potentially contain jitted code. |
| * |
| * On Win64, embedders are advised to install function table callbacks for |
| * these ranges, as default SEH won't be able to unwind through jitted code. |
| * |
| * The first page of the code range is reserved for the embedder and is |
| * committed, writable, and executable. |
| * |
| * Might be empty on other platforms. |
| * |
| * https://code.google.com/p/v8/issues/detail?id=3598 |
| */ |
| void GetCodeRange(void** start, size_t* length_in_bytes); |
| |
| /** Set the callback to invoke in case of fatal errors. */ |
| void SetFatalErrorHandler(FatalErrorCallback that); |
| |
| /** Set the callback to invoke in case of OOM errors. */ |
| void SetOOMErrorHandler(OOMErrorCallback that); |
| |
| /** |
| * Add a callback to invoke in case the heap size is close to the heap limit. |
| * If multiple callbacks are added, only the most recently added callback is |
| * invoked. |
| */ |
| void AddNearHeapLimitCallback(NearHeapLimitCallback callback, void* data); |
| |
| /** |
| * Remove the given callback and restore the heap limit to the |
| * given limit. If the given limit is zero, then it is ignored. |
| * If the current heap size is greater than the given limit, |
| * then the heap limit is restored to the minimal limit that |
| * is possible for the current heap size. |
| */ |
| void RemoveNearHeapLimitCallback(NearHeapLimitCallback callback, |
| size_t heap_limit); |
| |
| /** |
| * Set the callback to invoke to check if code generation from |
| * strings should be allowed. |
| */ |
| void SetAllowCodeGenerationFromStringsCallback( |
| AllowCodeGenerationFromStringsCallback callback); |
| |
| /** |
| * Set the callback to invoke to check if wasm code generation should |
| * be allowed. |
| */ |
| void SetAllowWasmCodeGenerationCallback( |
| AllowWasmCodeGenerationCallback callback); |
| |
| /** |
| * Embedder over{ride|load} injection points for wasm APIs. The expectation |
| * is that the embedder sets them at most once. |
| */ |
| void SetWasmModuleCallback(ExtensionCallback callback); |
| void SetWasmInstanceCallback(ExtensionCallback callback); |
| |
| void SetWasmCompileStreamingCallback(ApiImplementationCallback callback); |
| |
| void SetWasmStreamingCallback(WasmStreamingCallback callback); |
| |
| void SetWasmThreadsEnabledCallback(WasmThreadsEnabledCallback callback); |
| |
| /** |
| * Check if V8 is dead and therefore unusable. This is the case after |
| * fatal errors such as out-of-memory situations. |
| */ |
| bool IsDead(); |
| |
| /** |
| * Adds a message listener (errors only). |
| * |
| * The same message listener can be added more than once and in that |
| * case it will be called more than once for each message. |
| * |
| * If data is specified, it will be passed to the callback when it is called. |
| * Otherwise, the exception object will be passed to the callback instead. |
| */ |
| bool AddMessageListener(MessageCallback that, |
| Local<Value> data = Local<Value>()); |
| |
| /** |
| * Adds a message listener. |
| * |
| * The same message listener can be added more than once and in that |
| * case it will be called more than once for each message. |
| * |
| * If data is specified, it will be passed to the callback when it is called. |
| * Otherwise, the exception object will be passed to the callback instead. |
| * |
| * A listener can listen for particular error levels by providing a mask. |
| */ |
| bool AddMessageListenerWithErrorLevel(MessageCallback that, |
| int message_levels, |
| Local<Value> data = Local<Value>()); |
| |
| /** |
| * Remove all message listeners from the specified callback function. |
| */ |
| void RemoveMessageListeners(MessageCallback that); |
| |
| /** Callback function for reporting failed access checks.*/ |
| void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback); |
| |
| /** |
| * Tells V8 to capture current stack trace when uncaught exception occurs |
| * and report it to the message listeners. The option is off by default. |
| */ |
| void SetCaptureStackTraceForUncaughtExceptions( |
| bool capture, int frame_limit = 10, |
| StackTrace::StackTraceOptions options = StackTrace::kOverview); |
| |
| /** |
| * Iterates through all external resources referenced from current isolate |
| * heap. GC is not invoked prior to iterating, therefore there is no |
| * guarantee that visited objects are still alive. |
| */ |
| void VisitExternalResources(ExternalResourceVisitor* visitor); |
| |
| /** |
| * Iterates through all the persistent handles in the current isolate's heap |
| * that have class_ids. |
| */ |
| void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor); |
| |
| /** |
| * Iterates through all the persistent handles in the current isolate's heap |
| * that have class_ids and are candidates to be marked as partially dependent |
| * handles. This will visit handles to young objects created since the last |
| * garbage collection but is free to visit an arbitrary superset of these |
| * objects. |
| */ |
| void VisitHandlesForPartialDependence(PersistentHandleVisitor* visitor); |
| |
| /** |
| * Iterates through all the persistent handles in the current isolate's heap |
| * that have class_ids and are weak to be marked as inactive if there is no |
| * pending activity for the handle. |
| */ |
| void VisitWeakHandles(PersistentHandleVisitor* visitor); |
| |
| /** |
| * Check if this isolate is in use. |
| * True if at least one thread Enter'ed this isolate. |
| */ |
| bool IsInUse(); |
| |
| /** |
| * Set whether calling Atomics.wait (a function that may block) is allowed in |
| * this isolate. This can also be configured via |
| * CreateParams::allow_atomics_wait. |
| */ |
| void SetAllowAtomicsWait(bool allow); |
| |
| Isolate() = delete; |
| ~Isolate() = delete; |
| Isolate(const Isolate&) = delete; |
| Isolate& operator=(const Isolate&) = delete; |
| // Deleting operator new and delete here is allowed as ctor and dtor is also |
| // deleted. |
| void* operator new(size_t size) = delete; |
| void* operator new[](size_t size) = delete; |
| void operator delete(void*, size_t) = delete; |
| void operator delete[](void*, size_t) = delete; |
| |
| private: |
| template <class K, class V, class Traits> |
| friend class PersistentValueMapBase; |
| |
| internal::Object** GetDataFromSnapshotOnce(size_t index); |
| void ReportExternalAllocationLimitReached(); |
| void CheckMemoryPressure(); |
| }; |
| |
| class V8_EXPORT StartupData { |
| public: |
| const char* data; |
| int raw_size; |
| }; |
| |
| |
| /** |
| * EntropySource is used as a callback function when v8 needs a source |
| * of entropy. |
| */ |
| typedef bool (*EntropySource)(unsigned char* buffer, size_t length); |
| |
| /** |
| * ReturnAddressLocationResolver is used as a callback function when v8 is |
| * resolving the location of a return address on the stack. Profilers that |
| * change the return address on the stack can use this to resolve the stack |
| * location to wherever the profiler stashed the original return address. |
| * |
| * \param return_addr_location A location on stack where a machine |
| * return address resides. |
| * \returns Either return_addr_location, or else a pointer to the profiler's |
| * copy of the original return address. |
| * |
| * \note The resolver function must not cause garbage collection. |
| */ |
| typedef uintptr_t (*ReturnAddressLocationResolver)( |
| uintptr_t return_addr_location); |
| |
| |
| /** |
| * Container class for static utility functions. |
| */ |
| class V8_EXPORT V8 { |
| public: |
| /** |
| * Hand startup data to V8, in case the embedder has chosen to build |
| * V8 with external startup data. |
| * |
| * Note: |
| * - By default the startup data is linked into the V8 library, in which |
| * case this function is not meaningful. |
| * - If this needs to be called, it needs to be called before V8 |
| * tries to make use of its built-ins. |
| * - To avoid unnecessary copies of data, V8 will point directly into the |
| * given data blob, so pretty please keep it around until V8 exit. |
| * - Compression of the startup blob might be useful, but needs to |
| * handled entirely on the embedders' side. |
| * - The call will abort if the data is invalid. |
| */ |
| static void SetNativesDataBlob(StartupData* startup_blob); |
| static void SetSnapshotDataBlob(StartupData* startup_blob); |
| |
| /** Set the callback to invoke in case of Dcheck failures. */ |
| static void SetDcheckErrorHandler(DcheckErrorCallback that); |
| |
| |
| /** |
| * Sets V8 flags from a string. |
| */ |
| static void SetFlagsFromString(const char* str, int length); |
| |
| /** |
| * Sets V8 flags from the command line. |
| */ |
| static void SetFlagsFromCommandLine(int* argc, |
| char** argv, |
| bool remove_flags); |
| |
| /** Get the version string. */ |
| static const char* GetVersion(); |
| |
| /** |
| * Initializes V8. This function needs to be called before the first Isolate |
| * is created. It always returns true. |
| */ |
| static bool Initialize(); |
| |
| /** |
| * Allows the host application to provide a callback which can be used |
| * as a source of entropy for random number generators. |
| */ |
| static void SetEntropySource(EntropySource source); |
| |
| /** |
| * Allows the host application to provide a callback that allows v8 to |
| * cooperate with a profiler that rewrites return addresses on stack. |
| */ |
| static void SetReturnAddressLocationResolver( |
| ReturnAddressLocationResolver return_address_resolver); |
| |
| /** |
| * Releases any resources used by v8 and stops any utility threads |
| * that may be running. Note that disposing v8 is permanent, it |
| * cannot be reinitialized. |
| * |
| * It should generally not be necessary to dispose v8 before exiting |
| * a process, this should happen automatically. It is only necessary |
| * to use if the process needs the resources taken up by v8. |
| */ |
| static bool Dispose(); |
| |
| /** |
| * Initialize the ICU library bundled with V8. The embedder should only |
| * invoke this method when using the bundled ICU. Returns true on success. |
| * |
| * If V8 was compiled with the ICU data in an external file, the location |
| * of the data file has to be provided. |
| */ |
| static bool InitializeICU(const char* icu_data_file = nullptr); |
| |
| /** |
| * Initialize the ICU library bundled with V8. The embedder should only |
| * invoke this method when using the bundled ICU. If V8 was compiled with |
| * the ICU data in an external file and when the default location of that |
| * file should be used, a path to the executable must be provided. |
| * Returns true on success. |
| * |
| * The default is a file called icudtl.dat side-by-side with the executable. |
| * |
| * Optionally, the location of the data file can be provided to override the |
| * default. |
| */ |
| static bool InitializeICUDefaultLocation(const char* exec_path, |
| const char* icu_data_file = nullptr); |
| |
| /** |
| * Initialize the external startup data. The embedder only needs to |
| * invoke this method when external startup data was enabled in a build. |
| * |
| * If V8 was compiled with the startup data in an external file, then |
| * V8 needs to be given those external files during startup. There are |
| * three ways to do this: |
| * - InitializeExternalStartupData(const char*) |
| * This will look in the given directory for files "natives_blob.bin" |
| * and "snapshot_blob.bin" - which is what the default build calls them. |
| * - InitializeExternalStartupData(const char*, const char*) |
| * As above, but will directly use the two given file names. |
| * - Call SetNativesDataBlob, SetNativesDataBlob. |
| * This will read the blobs from the given data structures and will |
| * not perform any file IO. |
| */ |
| static void InitializeExternalStartupData(const char* directory_path); |
| static void InitializeExternalStartupData(const char* natives_blob, |
| const char* snapshot_blob); |
| /** |
| * Sets the v8::Platform to use. This should be invoked before V8 is |
| * initialized. |
| */ |
| static void InitializePlatform(Platform* platform); |
| |
| /** |
| * Clears all references to the v8::Platform. This should be invoked after |
| * V8 was disposed. |
| */ |
| static void ShutdownPlatform(); |
| |
| #if V8_OS_POSIX |
| /** |
| * Give the V8 signal handler a chance to handle a fault. |
| * |
| * This function determines whether a memory access violation can be recovered |
| * by V8. If so, it will return true and modify context to return to a code |
| * fragment that can recover from the fault. Otherwise, TryHandleSignal will |
| * return false. |
| * |
| * The parameters to this function correspond to those passed to a Linux |
| * signal handler. |
| * |
| * \param signal_number The signal number. |
| * |
| * \param info A pointer to the siginfo_t structure provided to the signal |
| * handler. |
| * |
| * \param context The third argument passed to the Linux signal handler, which |
| * points to a ucontext_t structure. |
| */ |
| static bool TryHandleSignal(int signal_number, void* info, void* context); |
| #endif // V8_OS_POSIX |
| |
| /** |
| * Enable the default signal handler rather than using one provided by the |
| * embedder. |
| */ |
| V8_DEPRECATE_SOON("Use EnableWebAssemblyTrapHandler", |
| static bool RegisterDefaultSignalHandler()); |
| |
| /** |
| * Activate trap-based bounds checking for WebAssembly. |
| * |
| * \param use_v8_signal_handler Whether V8 should install its own signal |
| * handler or rely on the embedder's. |
| */ |
| static bool EnableWebAssemblyTrapHandler(bool use_v8_signal_handler); |
| |
| private: |
| V8(); |
| |
| static internal::Object** GlobalizeReference(internal::Isolate* isolate, |
| internal::Object** handle); |
| static internal::Object** CopyPersistent(internal::Object** handle); |
| static void DisposeGlobal(internal::Object** global_handle); |
| static void MakeWeak(internal::Object** location, void* data, |
| WeakCallbackInfo<void>::Callback weak_callback, |
| WeakCallbackType type); |
| static void MakeWeak(internal::Object** location, void* data, |
| // Must be 0 or -1. |
| int internal_field_index1, |
| // Must be 1 or -1. |
| int internal_field_index2, |
| WeakCallbackInfo<void>::Callback weak_callback); |
| static void MakeWeak(internal::Object*** location_addr); |
| static void* ClearWeak(internal::Object** location); |
| static void AnnotateStrongRetainer(internal::Object** location, |
| const char* label); |
| static Value* Eternalize(Isolate* isolate, Value* handle); |
| |
| static void RegisterExternallyReferencedObject(internal::Object** object, |
| internal::Isolate* isolate); |
| |
| template <class K, class V, class T> |
| friend class PersistentValueMapBase; |
| |
| static void FromJustIsNothing(); |
| static void ToLocalEmpty(); |
| static void InternalFieldOutOfBounds(int index); |
| template <class T> friend class Local; |
| template <class T> |
| friend class MaybeLocal; |
| template <class T> |
| friend class Maybe; |
| template <class T> |
| friend class WeakCallbackInfo; |
| template <class T> friend class Eternal; |
| template <class T> friend class PersistentBase; |
| template <class T, class M> friend class Persistent; |
| friend class Context; |
| }; |
| |
| /** |
| * Helper class to create a snapshot data blob. |
| */ |
| class V8_EXPORT SnapshotCreator { |
| public: |
| enum class FunctionCodeHandling { kClear, kKeep }; |
| |
| /** |
| * Initialize and enter an isolate, and set it up for serialization. |
| * The isolate is either created from scratch or from an existing snapshot. |
| * The caller keeps ownership of the argument snapshot. |
| * \param existing_blob existing snapshot from which to create this one. |
| * \param external_references a null-terminated array of external references |
| * that must be equivalent to CreateParams::external_references. |
| */ |
| SnapshotCreator(Isolate* isolate, |
| const intptr_t* external_references = nullptr, |
| StartupData* existing_blob = nullptr); |
| |
| /** |
| * Create and enter an isolate, and set it up for serialization. |
| * The isolate is either created from scratch or from an existing snapshot. |
| * The caller keeps ownership of the argument snapshot. |
| * \param existing_blob existing snapshot from which to create this one. |
| * \param external_references a null-terminated array of external references |
| * that must be equivalent to CreateParams::external_references. |
| */ |
| SnapshotCreator(const intptr_t* external_references = nullptr, |
| StartupData* existing_blob = nullptr); |
| |
| ~SnapshotCreator(); |
| |
| /** |
| * \returns the isolate prepared by the snapshot creator. |
| */ |
| Isolate* GetIsolate(); |
| |
| /** |
| * Set the default context to be included in the snapshot blob. |
| * The snapshot will not contain the global proxy, and we expect one or a |
| * global object template to create one, to be provided upon deserialization. |
| * |
| * \param callback optional callback to serialize internal fields. |
| */ |
| void SetDefaultContext(Local<Context> context, |
| SerializeInternalFieldsCallback callback = |
| SerializeInternalFieldsCallback()); |
| |
| /** |
| * Add additional context to be included in the snapshot blob. |
| * The snapshot will include the global proxy. |
| * |
| * \param callback optional callback to serialize internal fields. |
| * |
| * \returns the index of the context in the snapshot blob. |
| */ |
| size_t AddContext(Local<Context> context, |
| SerializeInternalFieldsCallback callback = |
| SerializeInternalFieldsCallback()); |
| |
| /** |
| * Add a template to be included in the snapshot blob. |
| * \returns the index of the template in the snapshot blob. |
| */ |
| size_t AddTemplate(Local<Template> template_obj); |
| |
| /** |
| * Attach arbitrary V8::Data to the context snapshot, which can be retrieved |
| * via Context::GetDataFromSnapshot after deserialization. This data does not |
| * survive when a new snapshot is created from an existing snapshot. |
| * \returns the index for retrieval. |
| */ |
| template <class T> |
| V8_INLINE size_t AddData(Local<Context> context, Local<T> object); |
| |
| /** |
| * Attach arbitrary V8::Data to the isolate snapshot, which can be retrieved |
| * via Isolate::GetDataFromSnapshot after deserialization. This data does not |
| * survive when a new snapshot is created from an existing snapshot. |
| * \returns the index for retrieval. |
| */ |
| template <class T> |
| V8_INLINE size_t AddData(Local<T> object); |
| |
| /** |
| * Created a snapshot data blob. |
| * This must not be called from within a handle scope. |
| * \param function_code_handling whether to include compiled function code |
| * in the snapshot. |
| * \returns { nullptr, 0 } on failure, and a startup snapshot on success. The |
| * caller acquires ownership of the data array in the return value. |
| */ |
| StartupData CreateBlob(FunctionCodeHandling function_code_handling); |
| |
| // Disallow copying and assigning. |
| SnapshotCreator(const SnapshotCreator&) = delete; |
| void operator=(const SnapshotCreator&) = delete; |
| |
| private: |
| size_t AddData(Local<Context> context, internal::Object* object); |
| size_t AddData(internal::Object* object); |
| |
| void* data_; |
| }; |
| |
| /** |
| * A simple Maybe type, representing an object which may or may not have a |
| * value, see https://hackage.haskell.org/package/base/docs/Data-Maybe.html. |
| * |
| * If an API method returns a Maybe<>, the API method can potentially fail |
| * either because an exception is thrown, or because an exception is pending, |
| * e.g. because a previous API call threw an exception that hasn't been caught |
| * yet, or because a TerminateExecution exception was thrown. In that case, a |
| * "Nothing" value is returned. |
| */ |
| template <class T> |
| class Maybe { |
| public: |
| V8_INLINE bool IsNothing() const { return !has_value_; } |
| V8_INLINE bool IsJust() const { return has_value_; } |
| |
| /** |
| * An alias for |FromJust|. Will crash if the Maybe<> is nothing. |
| */ |
| V8_INLINE T ToChecked() const { return FromJust(); } |
| |
| /** |
| * Converts this Maybe<> to a value of type T. If this Maybe<> is |
| * nothing (empty), |false| is returned and |out| is left untouched. |
| */ |
| V8_WARN_UNUSED_RESULT V8_INLINE bool To(T* out) const { |
| if (V8_LIKELY(IsJust())) *out = value_; |
| return IsJust(); |
| } |
| |
| /** |
| * Converts this Maybe<> to a value of type T. If this Maybe<> is |
| * nothing (empty), V8 will crash the process. |
| */ |
| V8_INLINE T FromJust() const { |
| if (V8_UNLIKELY(!IsJust())) V8::FromJustIsNothing(); |
| return value_; |
| } |
| |
| /** |
| * Converts this Maybe<> to a value of type T, using a default value if this |
| * Maybe<> is nothing (empty). |
| */ |
| V8_INLINE T FromMaybe(const T& default_value) const { |
| return has_value_ ? value_ : default_value; |
| } |
| |
| V8_INLINE bool operator==(const Maybe& other) const { |
| return (IsJust() == other.IsJust()) && |
| (!IsJust() || FromJust() == other.FromJust()); |
| } |
| |
| V8_INLINE bool operator!=(const Maybe& other) const { |
| return !operator==(other); |
| } |
| |
| private: |
| Maybe() : has_value_(false) {} |
| explicit Maybe(const T& t) : has_value_(true), value_(t) {} |
| |
| bool has_value_; |
| T value_; |
| |
| template <class U> |
| friend Maybe<U> Nothing(); |
| template <class U> |
| friend Maybe<U> Just(const U& u); |
| }; |
| |
| template <class T> |
| inline Maybe<T> Nothing() { |
| return Maybe<T>(); |
| } |
| |
| template <class T> |
| inline Maybe<T> Just(const T& t) { |
| return Maybe<T>(t); |
| } |
| |
| // A template specialization of Maybe<T> for the case of T = void. |
| template <> |
| class Maybe<void> { |
| public: |
| V8_INLINE bool IsNothing() const { return !is_valid_; } |
| V8_INLINE bool IsJust() const { return is_valid_; } |
| |
| V8_INLINE bool operator==(const Maybe& other) const { |
| return IsJust() == other.IsJust(); |
| } |
| |
| V8_INLINE bool operator!=(const Maybe& other) const { |
| return !operator==(other); |
| } |
| |
| private: |
| struct JustTag {}; |
| |
| Maybe() : is_valid_(false) {} |
| explicit Maybe(JustTag) : is_valid_(true) {} |
| |
| bool is_valid_; |
| |
| template <class U> |
| friend Maybe<U> Nothing(); |
| friend Maybe<void> JustVoid(); |
| }; |
| |
| inline Maybe<void> JustVoid() { return Maybe<void>(Maybe<void>::JustTag()); } |
| |
| /** |
| * An external exception handler. |
| */ |
| class V8_EXPORT TryCatch { |
| public: |
| /** |
| * Creates a new try/catch block and registers it with v8. Note that |
| * all TryCatch blocks should be stack allocated because the memory |
| * location itself is compared against JavaScript try/catch blocks. |
| */ |
| explicit TryCatch(Isolate* isolate); |
| |
| /** |
| * Unregisters and deletes this try/catch block. |
| */ |
| ~TryCatch(); |
| |
| /** |
| * Returns true if an exception has been caught by this try/catch block. |
| */ |
| bool HasCaught() const; |
| |
| /** |
| * For certain types of exceptions, it makes no sense to continue execution. |
| * |
| * If CanContinue returns false, the correct action is to perform any C++ |
| * cleanup needed and then return. If CanContinue returns false and |
| * HasTerminated returns true, it is possible to call |
| * CancelTerminateExecution in order to continue calling into the engine. |
| */ |
| bool CanContinue() const; |
| |
| /** |
| * Returns true if an exception has been caught due to script execution |
| * being terminated. |
| * |
| * There is no JavaScript representation of an execution termination |
| * exception. Such exceptions are thrown when the TerminateExecution |
| * methods are called to terminate a long-running script. |
| * |
| * If such an exception has been thrown, HasTerminated will return true, |
| * indicating that it is possible to call CancelTerminateExecution in order |
| * to continue calling into the engine. |
| */ |
| bool HasTerminated() const; |
| |
| /** |
| * Throws the exception caught by this TryCatch in a way that avoids |
| * it being caught again by this same TryCatch. As with ThrowException |
| * it is illegal to execute any JavaScript operations after calling |
| * ReThrow; the caller must return immediately to where the exception |
| * is caught. |
| */ |
| Local<Value> ReThrow(); |
| |
| /** |
| * Returns the exception caught by this try/catch block. If no exception has |
| * been caught an empty handle is returned. |
| * |
| * The returned handle is valid until this TryCatch block has been destroyed. |
| */ |
| Local<Value> Exception() const; |
| |
| /** |
| * Returns the .stack property of the thrown object. If no .stack |
| * property is present an empty handle is returned. |
| */ |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> StackTrace( |
| Local<Context> context) const; |
| |
| /** |
| * Returns the message associated with this exception. If there is |
| * no message associated an empty handle is returned. |
| * |
| * The returned handle is valid until this TryCatch block has been |
| * destroyed. |
| */ |
| Local<v8::Message> Message() const; |
| |
| /** |
| * Clears any exceptions that may have been caught by this try/catch block. |
| * After this method has been called, HasCaught() will return false. Cancels |
| * the scheduled exception if it is caught and ReThrow() is not called before. |
| * |
| * It is not necessary to clear a try/catch block before using it again; if |
| * another exception is thrown the previously caught exception will just be |
| * overwritten. However, it is often a good idea since it makes it easier |
| * to determine which operation threw a given exception. |
| */ |
| void Reset(); |
| |
| /** |
| * Set verbosity of the external exception handler. |
| * |
| * By default, exceptions that are caught by an external exception |
| * handler are not reported. Call SetVerbose with true on an |
| * external exception handler to have exceptions caught by the |
| * handler reported as if they were not caught. |
| */ |
| void SetVerbose(bool value); |
| |
| /** |
| * Returns true if verbosity is enabled. |
| */ |
| bool IsVerbose() const; |
| |
| /** |
| * Set whether or not this TryCatch should capture a Message object |
| * which holds source information about where the exception |
| * occurred. True by default. |
| */ |
| void SetCaptureMessage(bool value); |
| |
| /** |
| * There are cases when the raw address of C++ TryCatch object cannot be |
| * used for comparisons with addresses into the JS stack. The cases are: |
| * 1) ARM, ARM64 and MIPS simulators which have separate JS stack. |
| * 2) Address sanitizer allocates local C++ object in the heap when |
| * UseAfterReturn mode is enabled. |
| * This method returns address that can be used for comparisons with |
| * addresses into the JS stack. When neither simulator nor ASAN's |
| * UseAfterReturn is enabled, then the address returned will be the address |
| * of the C++ try catch handler itself. |
| */ |
| static void* JSStackComparableAddress(TryCatch* handler) { |
| if (handler == NULL) return NULL; |
| return handler->js_stack_comparable_address_; |
| } |
| |
| TryCatch(const TryCatch&) = delete; |
| void operator=(const TryCatch&) = delete; |
| |
| private: |
| // Declaring operator new and delete as deleted is not spec compliant. |
| // Therefore declare them private instead to disable dynamic alloc |
| void* operator new(size_t size); |
| void* operator new[](size_t size); |
| void operator delete(void*, size_t); |
| void operator delete[](void*, size_t); |
| |
| void ResetInternal(); |
| |
| internal::Isolate* isolate_; |
| TryCatch* next_; |
| void* exception_; |
| void* message_obj_; |
| void* js_stack_comparable_address_; |
| bool is_verbose_ : 1; |
| bool can_continue_ : 1; |
| bool capture_message_ : 1; |
| bool rethrow_ : 1; |
| bool has_terminated_ : 1; |
| |
| friend class internal::Isolate; |
| }; |
| |
| |
| // --- Context --- |
| |
| |
| /** |
| * A container for extension names. |
| */ |
| class V8_EXPORT ExtensionConfiguration { |
| public: |
| ExtensionConfiguration() : name_count_(0), names_(NULL) { } |
| ExtensionConfiguration(int name_count, const char* names[]) |
| : name_count_(name_count), names_(names) { } |
| |
| const char** begin() const { return &names_[0]; } |
| const char** end() const { return &names_[name_count_]; } |
| |
| private: |
| const int name_count_; |
| const char** names_; |
| }; |
| |
| /** |
| * A sandboxed execution context with its own set of built-in objects |
| * and functions. |
| */ |
| class V8_EXPORT Context { |
| public: |
| /** |
| * Returns the global proxy object. |
| * |
| * Global proxy object is a thin wrapper whose prototype points to actual |
| * context's global object with the properties like Object, etc. This is done |
| * that way for security reasons (for more details see |
| * https://wiki.mozilla.org/Gecko:SplitWindow). |
| * |
| * Please note that changes to global proxy object prototype most probably |
| * would break VM---v8 expects only global object as a prototype of global |
| * proxy object. |
| */ |
| Local<Object> Global(); |
| |
| /** |
| * Detaches the global object from its context before |
| * the global object can be reused to create a new context. |
| */ |
| void DetachGlobal(); |
| |
| /** |
| * Creates a new context and returns a handle to the newly allocated |
| * context. |
| * |
| * \param isolate The isolate in which to create the context. |
| * |
| * \param extensions An optional extension configuration containing |
| * the extensions to be installed in the newly created context. |
| * |
| * \param global_template An optional object template from which the |
| * global object for the newly created context will be created. |
| * |
| * \param global_object An optional global object to be reused for |
| * the newly created context. This global object must have been |
| * created by a previous call to Context::New with the same global |
| * template. The state of the global object will be completely reset |
| * and only object identify will remain. |
| */ |
| static Local<Context> New( |
| Isolate* isolate, ExtensionConfiguration* extensions = NULL, |
| MaybeLocal<ObjectTemplate> global_template = MaybeLocal<ObjectTemplate>(), |
| MaybeLocal<Value> global_object = MaybeLocal<Value>(), |
| DeserializeInternalFieldsCallback internal_fields_deserializer = |
| DeserializeInternalFieldsCallback()); |
| |
| /** |
| * Create a new context from a (non-default) context snapshot. There |
| * is no way to provide a global object template since we do not create |
| * a new global object from template, but we can reuse a global object. |
| * |
| * \param isolate See v8::Context::New. |
| * |
| * \param context_snapshot_index The index of the context snapshot to |
| * deserialize from. Use v8::Context::New for the default snapshot. |
| * |
| * \param embedder_fields_deserializer Optional callback to deserialize |
| * internal fields. It should match the SerializeInternalFieldCallback used |
| * to serialize. |
| * |
| * \param extensions See v8::Context::New. |
| * |
| * \param global_object See v8::Context::New. |
| */ |
| |
| static MaybeLocal<Context> FromSnapshot( |
| Isolate* isolate, size_t context_snapshot_index, |
| DeserializeInternalFieldsCallback embedder_fields_deserializer = |
| DeserializeInternalFieldsCallback(), |
| ExtensionConfiguration* extensions = nullptr, |
| MaybeLocal<Value> global_object = MaybeLocal<Value>()); |
| |
| /** |
| * Returns an global object that isn't backed by an actual context. |
| * |
| * The global template needs to have access checks with handlers installed. |
| * If an existing global object is passed in, the global object is detached |
| * from its context. |
| * |
| * Note that this is different from a detached context where all accesses to |
| * the global proxy will fail. Instead, the access check handlers are invoked. |
| * |
| * It is also not possible to detach an object returned by this method. |
| * Instead, the access check handlers need to return nothing to achieve the |
| * same effect. |
| * |
| * It is possible, however, to create a new context from the global object |
| * returned by this method. |
| */ |
| static MaybeLocal<Object> NewRemoteContext( |
| Isolate* isolate, Local<ObjectTemplate> global_template, |
| MaybeLocal<Value> global_object = MaybeLocal<Value>()); |
| |
| /** |
| * Sets the security token for the context. To access an object in |
| * another context, the security tokens must match. |
| */ |
| void SetSecurityToken(Local<Value> token); |
| |
| /** Restores the security token to the default value. */ |
| void UseDefaultSecurityToken(); |
| |
| /** Returns the security token of this context.*/ |
| Local<Value> GetSecurityToken(); |
| |
| /** |
| * Enter this context. After entering a context, all code compiled |
| * and run is compiled and run in this context. If another context |
| * is already entered, this old context is saved so it can be |
| * restored when the new context is exited. |
| */ |
| void Enter(); |
| |
| /** |
| * Exit this context. Exiting the current context restores the |
| * context that was in place when entering the current context. |
| */ |
| void Exit(); |
| |
| /** Returns an isolate associated with a current context. */ |
| Isolate* GetIsolate(); |
| |
| /** |
| * The field at kDebugIdIndex used to be reserved for the inspector. |
| * It now serves no purpose. |
| */ |
| enum EmbedderDataFields { kDebugIdIndex = 0 }; |
| |
| /** |
| * Return the number of fields allocated for embedder data. |
| */ |
| uint32_t GetNumberOfEmbedderDataFields(); |
| |
| /** |
| * Gets the embedder data with the given index, which must have been set by a |
| * previous call to SetEmbedderData with the same index. |
| */ |
| V8_INLINE Local<Value> GetEmbedderData(int index); |
| |
| /** |
| * Gets the binding object used by V8 extras. Extra natives get a reference |
| * to this object and can use it to "export" functionality by adding |
| * properties. Extra natives can also "import" functionality by accessing |
| * properties added by the embedder using the V8 API. |
| */ |
| Local<Object> GetExtrasBindingObject(); |
| |
| /** |
| * Sets the embedder data with the given index, growing the data as |
| * needed. Note that index 0 currently has a special meaning for Chrome's |
| * debugger. |
| */ |
| void SetEmbedderData(int index, Local<Value> value); |
| |
| /** |
| * Gets a 2-byte-aligned native pointer from the embedder data with the given |
| * index, which must have been set by a previous call to |
| * SetAlignedPointerInEmbedderData with the same index. Note that index 0 |
| * currently has a special meaning for Chrome's debugger. |
| */ |
| V8_INLINE void* GetAlignedPointerFromEmbedderData(int index); |
| |
| /** |
| * Sets a 2-byte-aligned native pointer in the embedder data with the given |
| * index, growing the data as needed. Note that index 0 currently has a |
| * special meaning for Chrome's debugger. |
| */ |
| void SetAlignedPointerInEmbedderData(int index, void* value); |
| |
| /** |
| * Control whether code generation from strings is allowed. Calling |
| * this method with false will disable 'eval' and the 'Function' |
| * constructor for code running in this context. If 'eval' or the |
| * 'Function' constructor are used an exception will be thrown. |
| * |
| * If code generation from strings is not allowed the |
| * V8::AllowCodeGenerationFromStrings callback will be invoked if |
| * set before blocking the call to 'eval' or the 'Function' |
| * constructor. If that callback returns true, the call will be |
| * allowed, otherwise an exception will be thrown. If no callback is |
| * set an exception will be thrown. |
| */ |
| void AllowCodeGenerationFromStrings(bool allow); |
| |
| /** |
| * Returns true if code generation from strings is allowed for the context. |
| * For more details see AllowCodeGenerationFromStrings(bool) documentation. |
| */ |
| bool IsCodeGenerationFromStringsAllowed(); |
| |
| /** |
| * Sets the error description for the exception that is thrown when |
| * code generation from strings is not allowed and 'eval' or the 'Function' |
| * constructor are called. |
| */ |
| void SetErrorMessageForCodeGenerationFromStrings(Local<String> message); |
| |
| /** |
| * Return data that was previously attached to the context snapshot via |
| * SnapshotCreator, and removes the reference to it. |
| * Repeated call with the same index returns an empty MaybeLocal. |
| */ |
| template <class T> |
| V8_INLINE MaybeLocal<T> GetDataFromSnapshotOnce(size_t index); |
| |
| /** |
| * Stack-allocated class which sets the execution context for all |
| * operations executed within a local scope. |
| */ |
| class Scope { |
| public: |
| explicit V8_INLINE Scope(Local<Context> context) : context_(context) { |
| context_->Enter(); |
| } |
| V8_INLINE ~Scope() { context_->Exit(); } |
| |
| private: |
| Local<Context> context_; |
| }; |
| |
| /** |
| * Stack-allocated class to support the backup incumbent settings object |
| * stack. |
| * https://html.spec.whatwg.org/multipage/webappapis.html#backup-incumbent-settings-object-stack |
| */ |
| class V8_EXPORT BackupIncumbentScope { |
| public: |
| /** |
| * |backup_incumbent_context| is pushed onto the backup incumbent settings |
| * object stack. |
| */ |
| explicit BackupIncumbentScope(Local<Context> backup_incumbent_context); |
| ~BackupIncumbentScope(); |
| |
| private: |
| friend class internal::Isolate; |
| |
| Local<Context> backup_incumbent_context_; |
| const BackupIncumbentScope* prev_ = nullptr; |
| }; |
| |
| private: |
| friend class Value; |
| friend class Script; |
| friend class Object; |
| friend class Function; |
| |
| internal::Object** GetDataFromSnapshotOnce(size_t index); |
| Local<Value> SlowGetEmbedderData(int index); |
| void* SlowGetAlignedPointerFromEmbedderData(int index); |
| }; |
| |
| |
| /** |
| * Multiple threads in V8 are allowed, but only one thread at a time is allowed |
| * to use any given V8 isolate, see the comments in the Isolate class. The |
| * definition of 'using a V8 isolate' includes accessing handles or holding onto |
| * object pointers obtained from V8 handles while in the particular V8 isolate. |
| * It is up to the user of V8 to ensure, perhaps with locking, that this |
| * constraint is not violated. In addition to any other synchronization |
| * mechanism that may be used, the v8::Locker and v8::Unlocker classes must be |
| * used to signal thread switches to V8. |
| * |
| * v8::Locker is a scoped lock object. While it's active, i.e. between its |
| * construction and destruction, the current thread is allowed to use the locked |
| * isolate. V8 guarantees that an isolate can be locked by at most one thread at |
| * any time. In other words, the scope of a v8::Locker is a critical section. |
| * |
| * Sample usage: |
| * \code |
| * ... |
| * { |
| * v8::Locker locker(isolate); |
| * v8::Isolate::Scope isolate_scope(isolate); |
| * ... |
| * // Code using V8 and isolate goes here. |
| * ... |
| * } // Destructor called here |
| * \endcode |
| * |
| * If you wish to stop using V8 in a thread A you can do this either by |
| * destroying the v8::Locker object as above or by constructing a v8::Unlocker |
| * object: |
| * |
| * \code |
| * { |
| * isolate->Exit(); |
| * v8::Unlocker unlocker(isolate); |
| * ... |
| * // Code not using V8 goes here while V8 can run in another thread. |
| * ... |
| * } // Destructor called here. |
| * isolate->Enter(); |
| * \endcode |
| * |
| * The Unlocker object is intended for use in a long-running callback from V8, |
| * where you want to release the V8 lock for other threads to use. |
| * |
| * The v8::Locker is a recursive lock, i.e. you can lock more than once in a |
| * given thread. This can be useful if you have code that can be called either |
| * from code that holds the lock or from code that does not. The Unlocker is |
| * not recursive so you can not have several Unlockers on the stack at once, and |
| * you can not use an Unlocker in a thread that is not inside a Locker's scope. |
| * |
| * An unlocker will unlock several lockers if it has to and reinstate the |
| * correct depth of locking on its destruction, e.g.: |
| * |
| * \code |
| * // V8 not locked. |
| * { |
| * v8::Locker locker(isolate); |
| * Isolate::Scope isolate_scope(isolate); |
| * // V8 locked. |
| * { |
| * v8::Locker another_locker(isolate); |
| * // V8 still locked (2 levels). |
| * { |
| * isolate->Exit(); |
| * v8::Unlocker unlocker(isolate); |
| * // V8 not locked. |
| * } |
| * isolate->Enter(); |
| * // V8 locked again (2 levels). |
| * } |
| * // V8 still locked (1 level). |
| * } |
| * // V8 Now no longer locked. |
| * \endcode |
| */ |
| class V8_EXPORT Unlocker { |
| public: |
| /** |
| * Initialize Unlocker for a given Isolate. |
| */ |
| V8_INLINE explicit Unlocker(Isolate* isolate) { Initialize(isolate); } |
| |
| ~Unlocker(); |
| private: |
| void Initialize(Isolate* isolate); |
| |
| internal::Isolate* isolate_; |
| }; |
| |
| |
| class V8_EXPORT Locker { |
| public: |
| /** |
| * Initialize Locker for a given Isolate. |
| */ |
| V8_INLINE explicit Locker(Isolate* isolate) { Initialize(isolate); } |
| |
| ~Locker(); |
| |
| /** |
| * Returns whether or not the locker for a given isolate, is locked by the |
| * current thread. |
| */ |
| static bool IsLocked(Isolate* isolate); |
| |
| /** |
| * Returns whether v8::Locker is being used by this V8 instance. |
| */ |
| static bool IsActive(); |
| |
| // Disallow copying and assigning. |
| Locker(const Locker&) = delete; |
| void operator=(const Locker&) = delete; |
| |
| private: |
| void Initialize(Isolate* isolate); |
| |
| bool has_lock_; |
| bool top_level_; |
| internal::Isolate* isolate_; |
| }; |
| |
| |
| // --- Implementation --- |
| |
| |
| namespace internal { |
| |
| /** |
| * This class exports constants and functionality from within v8 that |
| * is necessary to implement inline functions in the v8 api. Don't |
| * depend on functions and constants defined here. |
| */ |
| class Internals { |
| public: |
| // These values match non-compiler-dependent values defined within |
| // the implementation of v8. |
| static const int kHeapObjectMapOffset = 0; |
| static const int kMapInstanceTypeOffset = 1 * kApiPointerSize + kApiIntSize; |
| static const int kStringResourceOffset = 3 * kApiPointerSize; |
| |
| static const int kOddballKindOffset = 4 * kApiPointerSize + kApiDoubleSize; |
| static const int kForeignAddressOffset = kApiPointerSize; |
| static const int kJSObjectHeaderSize = 3 * kApiPointerSize; |
| static const int kFixedArrayHeaderSize = 2 * kApiPointerSize; |
| static const int kContextHeaderSize = 2 * kApiPointerSize; |
| static const int kContextEmbedderDataIndex = 5; |
| static const int kFullStringRepresentationMask = 0x0f; |
| static const int kStringEncodingMask = 0x8; |
| static const int kExternalTwoByteRepresentationTag = 0x02; |
| static const int kExternalOneByteRepresentationTag = 0x0a; |
| |
| static const int kIsolateEmbedderDataOffset = 0 * kApiPointerSize; |
| static const int kExternalMemoryOffset = 4 * kApiPointerSize; |
| static const int kExternalMemoryLimitOffset = |
| kExternalMemoryOffset + kApiInt64Size; |
| static const int kExternalMemoryAtLastMarkCompactOffset = |
| kExternalMemoryLimitOffset + kApiInt64Size; |
| static const int kIsolateRootsOffset = kExternalMemoryLimitOffset + |
| kApiInt64Size + kApiInt64Size + |
| kApiPointerSize + kApiPointerSize; |
| static const int kUndefinedValueRootIndex = 4; |
| static const int kTheHoleValueRootIndex = 5; |
| static const int kNullValueRootIndex = 6; |
| static const int kTrueValueRootIndex = 7; |
| static const int kFalseValueRootIndex = 8; |
| static const int kEmptyStringRootIndex = 9; |
| |
| static const int kNodeClassIdOffset = 1 * kApiPointerSize; |
| static const int kNodeFlagsOffset = 1 * kApiPointerSize + 3; |
| static const int kNodeStateMask = 0x7; |
| static const int kNodeStateIsWeakValue = 2; |
| static const int kNodeStateIsPendingValue = 3; |
| static const int kNodeStateIsNearDeathValue = 4; |
| static const int kNodeIsIndependentShift = 3; |
| static const int kNodeIsActiveShift = 4; |
| |
| static const int kFirstNonstringType = 0x80; |
| static const int kOddballType = 0x83; |
| static const int kForeignType = 0x87; |
| static const int kJSSpecialApiObjectType = 0x410; |
| static const int kJSApiObjectType = 0x420; |
| static const int kJSObjectType = 0x421; |
| |
| static const int kUndefinedOddballKind = 5; |
| static const int kNullOddballKind = 3; |
| |
| static const uint32_t kNumIsolateDataSlots = 4; |
| |
| V8_EXPORT static void CheckInitializedImpl(v8::Isolate* isolate); |
| V8_INLINE static void CheckInitialized(v8::Isolate* isolate) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckInitializedImpl(isolate); |
| #endif |
| } |
| |
| V8_INLINE static bool HasHeapObjectTag(const internal::Object* value) { |
| return ((reinterpret_cast<intptr_t>(value) & kHeapObjectTagMask) == |
| kHeapObjectTag); |
| } |
| |
| V8_INLINE static int SmiValue(const internal::Object* value) { |
| return PlatformSmiTagging::SmiToInt(value); |
| } |
| |
| V8_INLINE static internal::Object* IntToSmi(int value) { |
| return PlatformSmiTagging::IntToSmi(value); |
| } |
| |
| V8_INLINE static constexpr bool IsValidSmi(intptr_t value) { |
| return PlatformSmiTagging::IsValidSmi(value); |
| } |
| |
| V8_INLINE static int GetInstanceType(const internal::Object* obj) { |
| typedef internal::Object O; |
| O* map = ReadField<O*>(obj, kHeapObjectMapOffset); |
| return ReadField<uint16_t>(map, kMapInstanceTypeOffset); |
| } |
| |
| V8_INLINE static int GetOddballKind(const internal::Object* obj) { |
| typedef internal::Object O; |
| return SmiValue(ReadField<O*>(obj, kOddballKindOffset)); |
| } |
| |
| V8_INLINE static bool IsExternalTwoByteString(int instance_type) { |
| int representation = (instance_type & kFullStringRepresentationMask); |
| return representation == kExternalTwoByteRepresentationTag; |
| } |
| |
| V8_INLINE static uint8_t GetNodeFlag(internal::Object** obj, int shift) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; |
| return *addr & static_cast<uint8_t>(1U << shift); |
| } |
| |
| V8_INLINE static void UpdateNodeFlag(internal::Object** obj, |
| bool value, int shift) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; |
| uint8_t mask = static_cast<uint8_t>(1U << shift); |
| *addr = static_cast<uint8_t>((*addr & ~mask) | (value << shift)); |
| } |
| |
| V8_INLINE static uint8_t GetNodeState(internal::Object** obj) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; |
| return *addr & kNodeStateMask; |
| } |
| |
| V8_INLINE static void UpdateNodeState(internal::Object** obj, |
| uint8_t value) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; |
| *addr = static_cast<uint8_t>((*addr & ~kNodeStateMask) | value); |
| } |
| |
| V8_INLINE static void SetEmbedderData(v8::Isolate* isolate, |
| uint32_t slot, |
| void* data) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(isolate) + |
| kIsolateEmbedderDataOffset + slot * kApiPointerSize; |
| *reinterpret_cast<void**>(addr) = data; |
| } |
| |
| V8_INLINE static void* GetEmbedderData(const v8::Isolate* isolate, |
| uint32_t slot) { |
| const uint8_t* addr = reinterpret_cast<const uint8_t*>(isolate) + |
| kIsolateEmbedderDataOffset + slot * kApiPointerSize; |
| return *reinterpret_cast<void* const*>(addr); |
| } |
| |
| V8_INLINE static internal::Object** GetRoot(v8::Isolate* isolate, |
| int index) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(isolate) + kIsolateRootsOffset; |
| return reinterpret_cast<internal::Object**>(addr + index * kApiPointerSize); |
| } |
| |
| template <typename T> |
| V8_INLINE static T ReadField(const internal::Object* ptr, int offset) { |
| const uint8_t* addr = |
| reinterpret_cast<const uint8_t*>(ptr) + offset - kHeapObjectTag; |
| return *reinterpret_cast<const T*>(addr); |
| } |
| |
| template <typename T> |
| V8_INLINE static T ReadEmbedderData(const v8::Context* context, int index) { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* ctx = *reinterpret_cast<O* const*>(context); |
| int embedder_data_offset = I::kContextHeaderSize + |
| (internal::kApiPointerSize * I::kContextEmbedderDataIndex); |
| O* embedder_data = I::ReadField<O*>(ctx, embedder_data_offset); |
| int value_offset = |
| I::kFixedArrayHeaderSize + (internal::kApiPointerSize * index); |
| return I::ReadField<T>(embedder_data, value_offset); |
| } |
| }; |
| |
| // Only perform cast check for types derived from v8::Data since |
| // other types do not implement the Cast method. |
| template <bool PerformCheck> |
| struct CastCheck { |
| template <class T> |
| static void Perform(T* data); |
| }; |
| |
| template <> |
| template <class T> |
| void CastCheck<true>::Perform(T* data) { |
| T::Cast(data); |
| } |
| |
| template <> |
| template <class T> |
| void CastCheck<false>::Perform(T* data) {} |
| |
| template <class T> |
| V8_INLINE void PerformCastCheck(T* data) { |
| CastCheck<std::is_base_of<Data, T>::value>::Perform(data); |
| } |
| |
| } // namespace internal |
| |
| |
| template <class T> |
| Local<T> Local<T>::New(Isolate* isolate, Local<T> that) { |
| return New(isolate, that.val_); |
| } |
| |
| template <class T> |
| Local<T> Local<T>::New(Isolate* isolate, const PersistentBase<T>& that) { |
| return New(isolate, that.val_); |
| } |
| |
| |
| template <class T> |
| Local<T> Local<T>::New(Isolate* isolate, T* that) { |
| if (that == NULL) return Local<T>(); |
| T* that_ptr = that; |
| internal::Object** p = reinterpret_cast<internal::Object**>(that_ptr); |
| return Local<T>(reinterpret_cast<T*>(HandleScope::CreateHandle( |
| reinterpret_cast<internal::Isolate*>(isolate), *p))); |
| } |
| |
| |
| template<class T> |
| template<class S> |
| void Eternal<T>::Set(Isolate* isolate, Local<S> handle) { |
| TYPE_CHECK(T, S); |
| val_ = reinterpret_cast<T*>( |
| V8::Eternalize(isolate, reinterpret_cast<Value*>(*handle))); |
| } |
| |
| template <class T> |
| Local<T> Eternal<T>::Get(Isolate* isolate) const { |
| // The eternal handle will never go away, so as with the roots, we don't even |
| // need to open a handle. |
| return Local<T>(val_); |
| } |
| |
| |
| template <class T> |
| Local<T> MaybeLocal<T>::ToLocalChecked() { |
| if (V8_UNLIKELY(val_ == nullptr)) V8::ToLocalEmpty(); |
| return Local<T>(val_); |
| } |
| |
| |
| template <class T> |
| void* WeakCallbackInfo<T>::GetInternalField(int index) const { |
| #ifdef V8_ENABLE_CHECKS |
| if (index < 0 || index >= kEmbedderFieldsInWeakCallback) { |
| V8::InternalFieldOutOfBounds(index); |
| } |
| #endif |
| return embedder_fields_[index]; |
| } |
| |
| |
| template <class T> |
| T* PersistentBase<T>::New(Isolate* isolate, T* that) { |
| if (that == NULL) return NULL; |
| internal::Object** p = reinterpret_cast<internal::Object**>(that); |
| return reinterpret_cast<T*>( |
| V8::GlobalizeReference(reinterpret_cast<internal::Isolate*>(isolate), |
| p)); |
| } |
| |
| |
| template <class T, class M> |
| template <class S, class M2> |
| void Persistent<T, M>::Copy(const Persistent<S, M2>& that) { |
| TYPE_CHECK(T, S); |
| this->Reset(); |
| if (that.IsEmpty()) return; |
| internal::Object** p = reinterpret_cast<internal::Object**>(that.val_); |
| this->val_ = reinterpret_cast<T*>(V8::CopyPersistent(p)); |
| M::Copy(that, this); |
| } |
| |
| template <class T> |
| bool PersistentBase<T>::IsIndependent() const { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return false; |
| return I::GetNodeFlag(reinterpret_cast<internal::Object**>(this->val_), |
| I::kNodeIsIndependentShift); |
| } |
| |
| template <class T> |
| bool PersistentBase<T>::IsNearDeath() const { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return false; |
| uint8_t node_state = |
| I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_)); |
| return node_state == I::kNodeStateIsNearDeathValue || |
| node_state == I::kNodeStateIsPendingValue; |
| } |
| |
| |
| template <class T> |
| bool PersistentBase<T>::IsWeak() const { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return false; |
| return I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_)) == |
| I::kNodeStateIsWeakValue; |
| } |
| |
| |
| template <class T> |
| void PersistentBase<T>::Reset() { |
| if (this->IsEmpty()) return; |
| V8::DisposeGlobal(reinterpret_cast<internal::Object**>(this->val_)); |
| val_ = 0; |
| } |
| |
| |
| template <class T> |
| template <class S> |
| void PersistentBase<T>::Reset(Isolate* isolate, const Local<S>& other) { |
| TYPE_CHECK(T, S); |
| Reset(); |
| if (other.IsEmpty()) return; |
| this->val_ = New(isolate, other.val_); |
| } |
| |
| |
| template <class T> |
| template <class S> |
| void PersistentBase<T>::Reset(Isolate* isolate, |
| const PersistentBase<S>& other) { |
| TYPE_CHECK(T, S); |
| Reset(); |
| if (other.IsEmpty()) return; |
| this->val_ = New(isolate, other.val_); |
| } |
| |
| |
| template <class T> |
| template <typename P> |
| V8_INLINE void PersistentBase<T>::SetWeak( |
| P* parameter, typename WeakCallbackInfo<P>::Callback callback, |
| WeakCallbackType type) { |
| typedef typename WeakCallbackInfo<void>::Callback Callback; |
| V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter, |
| reinterpret_cast<Callback>(callback), type); |
| } |
| |
| template <class T> |
| void PersistentBase<T>::SetWeak() { |
| V8::MakeWeak(reinterpret_cast<internal::Object***>(&this->val_)); |
| } |
| |
| template <class T> |
| template <typename P> |
| P* PersistentBase<T>::ClearWeak() { |
| return reinterpret_cast<P*>( |
| V8::ClearWeak(reinterpret_cast<internal::Object**>(this->val_))); |
| } |
| |
| template <class T> |
| void PersistentBase<T>::AnnotateStrongRetainer(const char* label) { |
| V8::AnnotateStrongRetainer(reinterpret_cast<internal::Object**>(this->val_), |
| label); |
| } |
| |
| template <class T> |
| void PersistentBase<T>::RegisterExternalReference(Isolate* isolate) const { |
| if (IsEmpty()) return; |
| V8::RegisterExternallyReferencedObject( |
| reinterpret_cast<internal::Object**>(this->val_), |
| reinterpret_cast<internal::Isolate*>(isolate)); |
| } |
| |
| template <class T> |
| void PersistentBase<T>::MarkIndependent() { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return; |
| I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), true, |
| I::kNodeIsIndependentShift); |
| } |
| |
| template <class T> |
| void PersistentBase<T>::MarkActive() { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return; |
| I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), true, |
| I::kNodeIsActiveShift); |
| } |
| |
| |
| template <class T> |
| void PersistentBase<T>::SetWrapperClassId(uint16_t class_id) { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return; |
| internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_); |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset; |
| *reinterpret_cast<uint16_t*>(addr) = class_id; |
| } |
| |
| |
| template <class T> |
| uint16_t PersistentBase<T>::WrapperClassId() const { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return 0; |
| internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_); |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset; |
| return *reinterpret_cast<uint16_t*>(addr); |
| } |
| |
| |
| template<typename T> |
| ReturnValue<T>::ReturnValue(internal::Object** slot) : value_(slot) {} |
| |
| template<typename T> |
| template<typename S> |
| void ReturnValue<T>::Set(const Persistent<S>& handle) { |
| TYPE_CHECK(T, S); |
| if (V8_UNLIKELY(handle.IsEmpty())) { |
| *value_ = GetDefaultValue(); |
| } else { |
| *value_ = *reinterpret_cast<internal::Object**>(*handle); |
| } |
| } |
| |
| template <typename T> |
| template <typename S> |
| void ReturnValue<T>::Set(const Global<S>& handle) { |
| TYPE_CHECK(T, S); |
| if (V8_UNLIKELY(handle.IsEmpty())) { |
| *value_ = GetDefaultValue(); |
| } else { |
| *value_ = *reinterpret_cast<internal::Object**>(*handle); |
| } |
| } |
| |
| template <typename T> |
| template <typename S> |
| void ReturnValue<T>::Set(const Local<S> handle) { |
| TYPE_CHECK(T, S); |
| if (V8_UNLIKELY(handle.IsEmpty())) { |
| *value_ = GetDefaultValue(); |
| } else { |
| *value_ = *reinterpret_cast<internal::Object**>(*handle); |
| } |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::Set(double i) { |
| TYPE_CHECK(T, Number); |
| Set(Number::New(GetIsolate(), i)); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::Set(int32_t i) { |
| TYPE_CHECK(T, Integer); |
| typedef internal::Internals I; |
| if (V8_LIKELY(I::IsValidSmi(i))) { |
| *value_ = I::IntToSmi(i); |
| return; |
| } |
| Set(Integer::New(GetIsolate(), i)); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::Set(uint32_t i) { |
| TYPE_CHECK(T, Integer); |
| // Can't simply use INT32_MAX here for whatever reason. |
| bool fits_into_int32_t = (i & (1U << 31)) == 0; |
| if (V8_LIKELY(fits_into_int32_t)) { |
| Set(static_cast<int32_t>(i)); |
| return; |
| } |
| Set(Integer::NewFromUnsigned(GetIsolate(), i)); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::Set(bool value) { |
| TYPE_CHECK(T, Boolean); |
| typedef internal::Internals I; |
| int root_index; |
| if (value) { |
| root_index = I::kTrueValueRootIndex; |
| } else { |
| root_index = I::kFalseValueRootIndex; |
| } |
| *value_ = *I::GetRoot(GetIsolate(), root_index); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::SetNull() { |
| TYPE_CHECK(T, Primitive); |
| typedef internal::Internals I; |
| *value_ = *I::GetRoot(GetIsolate(), I::kNullValueRootIndex); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::SetUndefined() { |
| TYPE_CHECK(T, Primitive); |
| typedef internal::Internals I; |
| *value_ = *I::GetRoot(GetIsolate(), I::kUndefinedValueRootIndex); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::SetEmptyString() { |
| TYPE_CHECK(T, String); |
| typedef internal::Internals I; |
| *value_ = *I::GetRoot(GetIsolate(), I::kEmptyStringRootIndex); |
| } |
| |
| template <typename T> |
| Isolate* ReturnValue<T>::GetIsolate() const { |
| // Isolate is always the pointer below the default value on the stack. |
| return *reinterpret_cast<Isolate**>(&value_[-2]); |
| } |
| |
| template <typename T> |
| Local<Value> ReturnValue<T>::Get() const { |
| typedef internal::Internals I; |
| if (*value_ == *I::GetRoot(GetIsolate(), I::kTheHoleValueRootIndex)) |
| return Local<Value>(*Undefined(GetIsolate())); |
| return Local<Value>::New(GetIsolate(), reinterpret_cast<Value*>(value_)); |
| } |
| |
| template <typename T> |
| template <typename S> |
| void ReturnValue<T>::Set(S* whatever) { |
| // Uncompilable to prevent inadvertent misuse. |
| TYPE_CHECK(S*, Primitive); |
| } |
| |
| template<typename T> |
| internal::Object* ReturnValue<T>::GetDefaultValue() { |
| // Default value is always the pointer below value_ on the stack. |
| return value_[-1]; |
| } |
| |
| template <typename T> |
| FunctionCallbackInfo<T>::FunctionCallbackInfo(internal::Object** implicit_args, |
| internal::Object** values, |
| int length) |
| : implicit_args_(implicit_args), values_(values), length_(length) {} |
| |
| template<typename T> |
| Local<Value> FunctionCallbackInfo<T>::operator[](int i) const { |
| if (i < 0 || length_ <= i) return Local<Value>(*Undefined(GetIsolate())); |
| return Local<Value>(reinterpret_cast<Value*>(values_ - i)); |
| } |
| |
| |
| template<typename T> |
| Local<Object> FunctionCallbackInfo<T>::This() const { |
| return Local<Object>(reinterpret_cast<Object*>(values_ + 1)); |
| } |
| |
| |
| template<typename T> |
| Local<Object> FunctionCallbackInfo<T>::Holder() const { |
| return Local<Object>(reinterpret_cast<Object*>( |
| &implicit_args_[kHolderIndex])); |
| } |
| |
| template <typename T> |
| Local<Value> FunctionCallbackInfo<T>::NewTarget() const { |
| return Local<Value>( |
| reinterpret_cast<Value*>(&implicit_args_[kNewTargetIndex])); |
| } |
| |
| template <typename T> |
| Local<Value> FunctionCallbackInfo<T>::Data() const { |
| return Local<Value>(reinterpret_cast<Value*>(&implicit_args_[kDataIndex])); |
| } |
| |
| |
| template<typename T> |
| Isolate* FunctionCallbackInfo<T>::GetIsolate() const { |
| return *reinterpret_cast<Isolate**>(&implicit_args_[kIsolateIndex]); |
| } |
| |
| |
| template<typename T> |
| ReturnValue<T> FunctionCallbackInfo<T>::GetReturnValue() const { |
| return ReturnValue<T>(&implicit_args_[kReturnValueIndex]); |
| } |
| |
| |
| template<typename T> |
| bool FunctionCallbackInfo<T>::IsConstructCall() const { |
| return !NewTarget()->IsUndefined(); |
| } |
| |
| |
| template<typename T> |
| int FunctionCallbackInfo<T>::Length() const { |
| return length_; |
| } |
| |
| ScriptOrigin::ScriptOrigin(Local<Value> resource_name, |
| Local<Integer> resource_line_offset, |
| Local<Integer> resource_column_offset, |
| Local<Boolean> resource_is_shared_cross_origin, |
| Local<Integer> script_id, |
| Local<Value> source_map_url, |
| Local<Boolean> resource_is_opaque, |
| Local<Boolean> is_wasm, Local<Boolean> is_module, |
| Local<PrimitiveArray> host_defined_options) |
| : resource_name_(resource_name), |
| resource_line_offset_(resource_line_offset), |
| resource_column_offset_(resource_column_offset), |
| options_(!resource_is_shared_cross_origin.IsEmpty() && |
| resource_is_shared_cross_origin->IsTrue(), |
| !resource_is_opaque.IsEmpty() && resource_is_opaque->IsTrue(), |
| !is_wasm.IsEmpty() && is_wasm->IsTrue(), |
| !is_module.IsEmpty() && is_module->IsTrue()), |
| script_id_(script_id), |
| source_map_url_(source_map_url), |
| host_defined_options_(host_defined_options) {} |
| |
| Local<Value> ScriptOrigin::ResourceName() const { return resource_name_; } |
| |
| Local<PrimitiveArray> ScriptOrigin::HostDefinedOptions() const { |
| return host_defined_options_; |
| } |
| |
| Local<Integer> ScriptOrigin::ResourceLineOffset() const { |
| return resource_line_offset_; |
| } |
| |
| |
| Local<Integer> ScriptOrigin::ResourceColumnOffset() const { |
| return resource_column_offset_; |
| } |
| |
| |
| Local<Integer> ScriptOrigin::ScriptID() const { return script_id_; } |
| |
| |
| Local<Value> ScriptOrigin::SourceMapUrl() const { return source_map_url_; } |
| |
| ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin, |
| CachedData* data) |
| : source_string(string), |
| resource_name(origin.ResourceName()), |
| resource_line_offset(origin.ResourceLineOffset()), |
| resource_column_offset(origin.ResourceColumnOffset()), |
| resource_options(origin.Options()), |
| source_map_url(origin.SourceMapUrl()), |
| host_defined_options(origin.HostDefinedOptions()), |
| cached_data(data) {} |
| |
| ScriptCompiler::Source::Source(Local<String> string, |
| CachedData* data) |
| : source_string(string), cached_data(data) {} |
| |
| |
| ScriptCompiler::Source::~Source() { |
| delete cached_data; |
| } |
| |
| |
| const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData() |
| const { |
| return cached_data; |
| } |
| |
| const ScriptOriginOptions& ScriptCompiler::Source::GetResourceOptions() const { |
| return resource_options; |
| } |
| |
| Local<Boolean> Boolean::New(Isolate* isolate, bool value) { |
| return value ? True(isolate) : False(isolate); |
| } |
| |
| void Template::Set(Isolate* isolate, const char* name, Local<Data> value) { |
| Set(String::NewFromUtf8(isolate, name, NewStringType::kInternalized) |
| .ToLocalChecked(), |
| value); |
| } |
| |
| FunctionTemplate* FunctionTemplate::Cast(Data* data) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(data); |
| #endif |
| return reinterpret_cast<FunctionTemplate*>(data); |
| } |
| |
| ObjectTemplate* ObjectTemplate::Cast(Data* data) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(data); |
| #endif |
| return reinterpret_cast<ObjectTemplate*>(data); |
| } |
| |
| Signature* Signature::Cast(Data* data) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(data); |
| #endif |
| return reinterpret_cast<Signature*>(data); |
| } |
| |
| AccessorSignature* AccessorSignature::Cast(Data* data) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(data); |
| #endif |
| return reinterpret_cast<AccessorSignature*>(data); |
| } |
| |
| Local<Value> Object::GetInternalField(int index) { |
| #ifndef V8_ENABLE_CHECKS |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O**>(this); |
| // Fast path: If the object is a plain JSObject, which is the common case, we |
| // know where to find the internal fields and can return the value directly. |
| auto instance_type = I::GetInstanceType(obj); |
| if (instance_type == I::kJSObjectType || |
| instance_type == I::kJSApiObjectType || |
| instance_type == I::kJSSpecialApiObjectType) { |
| int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index); |
| O* value = I::ReadField<O*>(obj, offset); |
| O** result = HandleScope::CreateHandle( |
| reinterpret_cast<internal::NeverReadOnlySpaceObject*>(obj), value); |
| return Local<Value>(reinterpret_cast<Value*>(result)); |
| } |
| #endif |
| return SlowGetInternalField(index); |
| } |
| |
| |
| void* Object::GetAlignedPointerFromInternalField(int index) { |
| #ifndef V8_ENABLE_CHECKS |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O**>(this); |
| // Fast path: If the object is a plain JSObject, which is the common case, we |
| // know where to find the internal fields and can return the value directly. |
| auto instance_type = I::GetInstanceType(obj); |
| if (V8_LIKELY(instance_type == I::kJSObjectType || |
| instance_type == I::kJSApiObjectType || |
| instance_type == I::kJSSpecialApiObjectType)) { |
| int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index); |
| return I::ReadField<void*>(obj, offset); |
| } |
| #endif |
| return SlowGetAlignedPointerFromInternalField(index); |
| } |
| |
| String* String::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<String*>(value); |
| } |
| |
| |
| Local<String> String::Empty(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kEmptyStringRootIndex); |
| return Local<String>(reinterpret_cast<String*>(slot)); |
| } |
| |
| |
| String::ExternalStringResource* String::GetExternalStringResource() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| |
| ExternalStringResource* result; |
| if (I::IsExternalTwoByteString(I::GetInstanceType(obj))) { |
| void* value = I::ReadField<void*>(obj, I::kStringResourceOffset); |
| result = reinterpret_cast<String::ExternalStringResource*>(value); |
| } else { |
| result = GetExternalStringResourceSlow(); |
| } |
| #ifdef V8_ENABLE_CHECKS |
| VerifyExternalStringResource(result); |
| #endif |
| return result; |
| } |
| |
| |
| String::ExternalStringResourceBase* String::GetExternalStringResourceBase( |
| String::Encoding* encoding_out) const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| int type = I::GetInstanceType(obj) & I::kFullStringRepresentationMask; |
| *encoding_out = static_cast<Encoding>(type & I::kStringEncodingMask); |
| ExternalStringResourceBase* resource; |
| if (type == I::kExternalOneByteRepresentationTag || |
| type == I::kExternalTwoByteRepresentationTag) { |
| void* value = I::ReadField<void*>(obj, I::kStringResourceOffset); |
| resource = static_cast<ExternalStringResourceBase*>(value); |
| } else { |
| resource = GetExternalStringResourceBaseSlow(encoding_out); |
| } |
| #ifdef V8_ENABLE_CHECKS |
| VerifyExternalStringResourceBase(resource, *encoding_out); |
| #endif |
| return resource; |
| } |
| |
| |
| bool Value::IsUndefined() const { |
| #ifdef V8_ENABLE_CHECKS |
| return FullIsUndefined(); |
| #else |
| return QuickIsUndefined(); |
| #endif |
| } |
| |
| bool Value::QuickIsUndefined() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| if (!I::HasHeapObjectTag(obj)) return false; |
| if (I::GetInstanceType(obj) != I::kOddballType) return false; |
| return (I::GetOddballKind(obj) == I::kUndefinedOddballKind); |
| } |
| |
| |
| bool Value::IsNull() const { |
| #ifdef V8_ENABLE_CHECKS |
| return FullIsNull(); |
| #else |
| return QuickIsNull(); |
| #endif |
| } |
| |
| bool Value::QuickIsNull() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| if (!I::HasHeapObjectTag(obj)) return false; |
| if (I::GetInstanceType(obj) != I::kOddballType) return false; |
| return (I::GetOddballKind(obj) == I::kNullOddballKind); |
| } |
| |
| bool Value::IsNullOrUndefined() const { |
| #ifdef V8_ENABLE_CHECKS |
| return FullIsNull() || FullIsUndefined(); |
| #else |
| return QuickIsNullOrUndefined(); |
| #endif |
| } |
| |
| bool Value::QuickIsNullOrUndefined() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| if (!I::HasHeapObjectTag(obj)) return false; |
| if (I::GetInstanceType(obj) != I::kOddballType) return false; |
| int kind = I::GetOddballKind(obj); |
| return kind == I::kNullOddballKind || kind == I::kUndefinedOddballKind; |
| } |
| |
| bool Value::IsString() const { |
| #ifdef V8_ENABLE_CHECKS |
| return FullIsString(); |
| #else |
| return QuickIsString(); |
| #endif |
| } |
| |
| bool Value::QuickIsString() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| if (!I::HasHeapObjectTag(obj)) return false; |
| return (I::GetInstanceType(obj) < I::kFirstNonstringType); |
| } |
| |
| |
| template <class T> Value* Value::Cast(T* value) { |
| return static_cast<Value*>(value); |
| } |
| |
| |
| Boolean* Boolean::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Boolean*>(value); |
| } |
| |
| |
| Name* Name::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Name*>(value); |
| } |
| |
| |
| Symbol* Symbol::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Symbol*>(value); |
| } |
| |
| |
| Private* Private::Cast(Data* data) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(data); |
| #endif |
| return reinterpret_cast<Private*>(data); |
| } |
| |
| |
| Number* Number::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Number*>(value); |
| } |
| |
| |
| Integer* Integer::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Integer*>(value); |
| } |
| |
| |
| Int32* Int32::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Int32*>(value); |
| } |
| |
| |
| Uint32* Uint32::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint32*>(value); |
| } |
| |
| BigInt* BigInt::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<BigInt*>(value); |
| } |
| |
| Date* Date::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Date*>(value); |
| } |
| |
| |
| StringObject* StringObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<StringObject*>(value); |
| } |
| |
| |
| SymbolObject* SymbolObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<SymbolObject*>(value); |
| } |
| |
| |
| NumberObject* NumberObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<NumberObject*>(value); |
| } |
| |
| BigIntObject* BigIntObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<BigIntObject*>(value); |
| } |
| |
| BooleanObject* BooleanObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<BooleanObject*>(value); |
| } |
| |
| |
| RegExp* RegExp::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<RegExp*>(value); |
| } |
| |
| |
| Object* Object::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Object*>(value); |
| } |
| |
| |
| Array* Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Array*>(value); |
| } |
| |
| |
| Map* Map::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Map*>(value); |
| } |
| |
| |
| Set* Set::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Set*>(value); |
| } |
| |
| |
| Promise* Promise::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Promise*>(value); |
| } |
| |
| |
| Proxy* Proxy::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Proxy*>(value); |
| } |
| |
| WasmCompiledModule* WasmCompiledModule::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<WasmCompiledModule*>(value); |
| } |
| |
| Promise::Resolver* Promise::Resolver::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Promise::Resolver*>(value); |
| } |
| |
| |
| ArrayBuffer* ArrayBuffer::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<ArrayBuffer*>(value); |
| } |
| |
| |
| ArrayBufferView* ArrayBufferView::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<ArrayBufferView*>(value); |
| } |
| |
| |
| TypedArray* TypedArray::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<TypedArray*>(value); |
| } |
| |
| |
| Uint8Array* Uint8Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint8Array*>(value); |
| } |
| |
| |
| Int8Array* Int8Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Int8Array*>(value); |
| } |
| |
| |
| Uint16Array* Uint16Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint16Array*>(value); |
| } |
| |
| |
| Int16Array* Int16Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Int16Array*>(value); |
| } |
| |
| |
| Uint32Array* Uint32Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint32Array*>(value); |
| } |
| |
| |
| Int32Array* Int32Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Int32Array*>(value); |
| } |
| |
| |
| Float32Array* Float32Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Float32Array*>(value); |
| } |
| |
| |
| Float64Array* Float64Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Float64Array*>(value); |
| } |
| |
| BigInt64Array* BigInt64Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<BigInt64Array*>(value); |
| } |
| |
| BigUint64Array* BigUint64Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<BigUint64Array*>(value); |
| } |
| |
| Uint8ClampedArray* Uint8ClampedArray::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint8ClampedArray*>(value); |
| } |
| |
| |
| DataView* DataView::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<DataView*>(value); |
| } |
| |
| |
| SharedArrayBuffer* SharedArrayBuffer::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<SharedArrayBuffer*>(value); |
| } |
| |
| |
| Function* Function::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Function*>(value); |
| } |
| |
| |
| External* External::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<External*>(value); |
| } |
| |
| |
| template<typename T> |
| Isolate* PropertyCallbackInfo<T>::GetIsolate() const { |
| return *reinterpret_cast<Isolate**>(&args_[kIsolateIndex]); |
| } |
| |
| |
| template<typename T> |
| Local<Value> PropertyCallbackInfo<T>::Data() const { |
| return Local<Value>(reinterpret_cast<Value*>(&args_[kDataIndex])); |
| } |
| |
| |
| template<typename T> |
| Local<Object> PropertyCallbackInfo<T>::This() const { |
| return Local<Object>(reinterpret_cast<Object*>(&args_[kThisIndex])); |
| } |
| |
| |
| template<typename T> |
| Local<Object> PropertyCallbackInfo<T>::Holder() const { |
| return Local<Object>(reinterpret_cast<Object*>(&args_[kHolderIndex])); |
| } |
| |
| |
| template<typename T> |
| ReturnValue<T> PropertyCallbackInfo<T>::GetReturnValue() const { |
| return ReturnValue<T>(&args_[kReturnValueIndex]); |
| } |
| |
| template <typename T> |
| bool PropertyCallbackInfo<T>::ShouldThrowOnError() const { |
| typedef internal::Internals I; |
| return args_[kShouldThrowOnErrorIndex] != I::IntToSmi(0); |
| } |
| |
| |
| Local<Primitive> Undefined(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kUndefinedValueRootIndex); |
| return Local<Primitive>(reinterpret_cast<Primitive*>(slot)); |
| } |
| |
| |
| Local<Primitive> Null(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kNullValueRootIndex); |
| return Local<Primitive>(reinterpret_cast<Primitive*>(slot)); |
| } |
| |
| |
| Local<Boolean> True(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kTrueValueRootIndex); |
| return Local<Boolean>(reinterpret_cast<Boolean*>(slot)); |
| } |
| |
| |
| Local<Boolean> False(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kFalseValueRootIndex); |
| return Local<Boolean>(reinterpret_cast<Boolean*>(slot)); |
| } |
| |
| |
| void Isolate::SetData(uint32_t slot, void* data) { |
| typedef internal::Internals I; |
| I::SetEmbedderData(this, slot, data); |
| } |
| |
| |
| void* Isolate::GetData(uint32_t slot) { |
| typedef internal::Internals I; |
| return I::GetEmbedderData(this, slot); |
| } |
| |
| |
| uint32_t Isolate::GetNumberOfDataSlots() { |
| typedef internal::Internals I; |
| return I::kNumIsolateDataSlots; |
| } |
| |
| template <class T> |
| MaybeLocal<T> Isolate::GetDataFromSnapshotOnce(size_t index) { |
| T* data = reinterpret_cast<T*>(GetDataFromSnapshotOnce(index)); |
| if (data) internal::PerformCastCheck(data); |
| return Local<T>(data); |
| } |
| |
| int64_t Isolate::AdjustAmountOfExternalAllocatedMemory( |
| int64_t change_in_bytes) { |
| typedef internal::Internals I; |
| const int64_t kMemoryReducerActivationLimit = 32 * 1024 * 1024; |
| int64_t* external_memory = reinterpret_cast<int64_t*>( |
| reinterpret_cast<uint8_t*>(this) + I::kExternalMemoryOffset); |
| int64_t* external_memory_limit = reinterpret_cast<int64_t*>( |
| reinterpret_cast<uint8_t*>(this) + I::kExternalMemoryLimitOffset); |
| int64_t* external_memory_at_last_mc = |
| reinterpret_cast<int64_t*>(reinterpret_cast<uint8_t*>(this) + |
| I::kExternalMemoryAtLastMarkCompactOffset); |
| const int64_t amount = *external_memory + change_in_bytes; |
| |
| *external_memory = amount; |
| |
| int64_t allocation_diff_since_last_mc = |
| *external_memory_at_last_mc - *external_memory; |
| allocation_diff_since_last_mc = allocation_diff_since_last_mc < 0 |
| ? -allocation_diff_since_last_mc |
| : allocation_diff_since_last_mc; |
| if (allocation_diff_since_last_mc > kMemoryReducerActivationLimit) { |
| CheckMemoryPressure(); |
| } |
| |
| if (change_in_bytes < 0) { |
| *external_memory_limit += change_in_bytes; |
| } |
| |
| if (change_in_bytes > 0 && amount > *external_memory_limit) { |
| ReportExternalAllocationLimitReached(); |
| } |
| return *external_memory; |
| } |
| |
| Local<Value> Context::GetEmbedderData(int index) { |
| #ifndef V8_ENABLE_CHECKS |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| auto* context = *reinterpret_cast<internal::NeverReadOnlySpaceObject**>(this); |
| O** result = |
| HandleScope::CreateHandle(context, I::ReadEmbedderData<O*>(this, index)); |
| return Local<Value>(reinterpret_cast<Value*>(result)); |
| #else |
| return SlowGetEmbedderData(index); |
| #endif |
| } |
| |
| |
| void* Context::GetAlignedPointerFromEmbedderData(int index) { |
| #ifndef V8_ENABLE_CHECKS |
| typedef internal::Internals I; |
| return I::ReadEmbedderData<void*>(this, index); |
| #else |
| return SlowGetAlignedPointerFromEmbedderData(index); |
| #endif |
| } |
| |
| template <class T> |
| MaybeLocal<T> Context::GetDataFromSnapshotOnce(size_t index) { |
| T* data = reinterpret_cast<T*>(GetDataFromSnapshotOnce(index)); |
| if (data) internal::PerformCastCheck(data); |
| return Local<T>(data); |
| } |
| |
| template <class T> |
| size_t SnapshotCreator::AddData(Local<Context> context, Local<T> object) { |
| T* object_ptr = *object; |
| internal::Object** p = reinterpret_cast<internal::Object**>(object_ptr); |
| return AddData(context, *p); |
| } |
| |
| template <class T> |
| size_t SnapshotCreator::AddData(Local<T> object) { |
| T* object_ptr = *object; |
| internal::Object** p = reinterpret_cast<internal::Object**>(object_ptr); |
| return AddData(*p); |
| } |
| |
| /** |
| * \example shell.cc |
| * A simple shell that takes a list of expressions on the |
| * command-line and executes them. |
| */ |
| |
| |
| /** |
| * \example process.cc |
| */ |
| |
| |
| } // namespace v8 |
| |
| |
| #undef TYPE_CHECK |
| |
| |
| #endif // INCLUDE_V8_H_ |