| // Copyright 2012 the V8 project authors. All rights reserved. |
| // Use of this source code is governed by a BSD-style license that can be |
| // found in the LICENSE file. |
| |
| #include "src/api.h" |
| |
| #include <string.h> // For memcpy, strlen. |
| #ifdef V8_USE_ADDRESS_SANITIZER |
| #include <sanitizer/asan_interface.h> |
| #endif // V8_USE_ADDRESS_SANITIZER |
| #if defined(LEAK_SANITIZER) |
| #include <sanitizer/lsan_interface.h> |
| #endif // defined(LEAK_SANITIZER) |
| #include <cmath> // For isnan. |
| #include <limits> |
| #include <vector> |
| #include "include/v8-debug.h" |
| #include "include/v8-profiler.h" |
| #include "include/v8-testing.h" |
| #include "include/v8-util.h" |
| #include "src/accessors.h" |
| #include "src/api-natives.h" |
| #include "src/assert-scope.h" |
| #include "src/base/functional.h" |
| #include "src/base/logging.h" |
| #include "src/base/platform/platform.h" |
| #include "src/base/platform/time.h" |
| #include "src/base/safe_conversions.h" |
| #include "src/base/utils/random-number-generator.h" |
| #include "src/bootstrapper.h" |
| #include "src/builtins/builtins-utils.h" |
| #include "src/char-predicates-inl.h" |
| #include "src/code-stubs.h" |
| #include "src/compiler-dispatcher/compiler-dispatcher.h" |
| #include "src/compiler.h" |
| #include "src/contexts.h" |
| #include "src/conversions-inl.h" |
| #include "src/counters.h" |
| #include "src/debug/debug-coverage.h" |
| #include "src/debug/debug-type-profile.h" |
| #include "src/debug/debug.h" |
| #include "src/deoptimizer.h" |
| #include "src/detachable-vector.h" |
| #include "src/execution.h" |
| #include "src/frames-inl.h" |
| #include "src/gdb-jit.h" |
| #include "src/global-handles.h" |
| #include "src/globals.h" |
| #include "src/icu_util.h" |
| #include "src/isolate-inl.h" |
| #include "src/json-parser.h" |
| #include "src/json-stringifier.h" |
| #include "src/messages.h" |
| #include "src/objects-inl.h" |
| #include "src/parsing/background-parsing-task.h" |
| #include "src/parsing/parser.h" |
| #include "src/parsing/scanner-character-streams.h" |
| #include "src/pending-compilation-error-handler.h" |
| #include "src/profiler/cpu-profiler.h" |
| #include "src/profiler/heap-profiler.h" |
| #include "src/profiler/heap-snapshot-generator-inl.h" |
| #include "src/profiler/profile-generator-inl.h" |
| #include "src/profiler/tick-sample.h" |
| #include "src/property-descriptor.h" |
| #include "src/property-details.h" |
| #include "src/property.h" |
| #include "src/prototype.h" |
| #include "src/runtime-profiler.h" |
| #include "src/runtime/runtime.h" |
| #include "src/simulator.h" |
| #include "src/snapshot/builtin-serializer.h" |
| #include "src/snapshot/code-serializer.h" |
| #include "src/snapshot/natives.h" |
| #include "src/snapshot/snapshot.h" |
| #include "src/startup-data-util.h" |
| #include "src/tracing/trace-event.h" |
| #include "src/trap-handler/trap-handler.h" |
| #include "src/unicode-cache-inl.h" |
| #include "src/unicode-inl.h" |
| #include "src/v8.h" |
| #include "src/v8threads.h" |
| #include "src/value-serializer.h" |
| #include "src/version.h" |
| #include "src/vm-state-inl.h" |
| #include "src/wasm/compilation-manager.h" |
| #include "src/wasm/streaming-decoder.h" |
| #include "src/wasm/wasm-objects-inl.h" |
| #include "src/wasm/wasm-result.h" |
| #include "src/wasm/wasm-serialization.h" |
| |
| namespace v8 { |
| |
| /* |
| * Most API methods should use one of the three macros: |
| * |
| * ENTER_V8, ENTER_V8_NO_SCRIPT, ENTER_V8_NO_SCRIPT_NO_EXCEPTION. |
| * |
| * The latter two assume that no script is executed, and no exceptions are |
| * scheduled in addition (respectively). Creating a pending exception and |
| * removing it before returning is ok. |
| * |
| * Exceptions should be handled either by invoking one of the |
| * RETURN_ON_FAILED_EXECUTION* macros. |
| * |
| * Don't use macros with DO_NOT_USE in their name. |
| * |
| * TODO(jochen): Document debugger specific macros. |
| * TODO(jochen): Document LOG_API and other RuntimeCallStats macros. |
| * TODO(jochen): All API methods should invoke one of the ENTER_V8* macros. |
| * TODO(jochen): Remove calls form API methods to DO_NOT_USE macros. |
| */ |
| |
| #define LOG_API(isolate, class_name, function_name) \ |
| i::RuntimeCallTimerScope _runtime_timer( \ |
| isolate, &i::RuntimeCallStats::API_##class_name##_##function_name); \ |
| LOG(isolate, ApiEntryCall("v8::" #class_name "::" #function_name)) |
| |
| #define ENTER_V8_DO_NOT_USE(isolate) i::VMState<v8::OTHER> __state__((isolate)) |
| |
| #define ENTER_V8_HELPER_DO_NOT_USE(isolate, context, class_name, \ |
| function_name, bailout_value, \ |
| HandleScopeClass, do_callback) \ |
| if (IsExecutionTerminatingCheck(isolate)) { \ |
| return bailout_value; \ |
| } \ |
| HandleScopeClass handle_scope(isolate); \ |
| CallDepthScope<do_callback> call_depth_scope(isolate, context); \ |
| LOG_API(isolate, class_name, function_name); \ |
| i::VMState<v8::OTHER> __state__((isolate)); \ |
| bool has_pending_exception = false |
| |
| #define PREPARE_FOR_DEBUG_INTERFACE_EXECUTION_WITH_ISOLATE(isolate, T) \ |
| if (IsExecutionTerminatingCheck(isolate)) { \ |
| return MaybeLocal<T>(); \ |
| } \ |
| InternalEscapableScope handle_scope(isolate); \ |
| CallDepthScope<false> call_depth_scope(isolate, v8::Local<v8::Context>()); \ |
| i::VMState<v8::OTHER> __state__((isolate)); \ |
| bool has_pending_exception = false |
| |
| #define PREPARE_FOR_EXECUTION_WITH_CONTEXT(context, class_name, function_name, \ |
| bailout_value, HandleScopeClass, \ |
| do_callback) \ |
| auto isolate = context.IsEmpty() \ |
| ? i::Isolate::Current() \ |
| : reinterpret_cast<i::Isolate*>(context->GetIsolate()); \ |
| ENTER_V8_HELPER_DO_NOT_USE(isolate, context, class_name, function_name, \ |
| bailout_value, HandleScopeClass, do_callback); |
| |
| #define PREPARE_FOR_EXECUTION(context, class_name, function_name, T) \ |
| PREPARE_FOR_EXECUTION_WITH_CONTEXT(context, class_name, function_name, \ |
| MaybeLocal<T>(), InternalEscapableScope, \ |
| false) |
| |
| #define ENTER_V8(isolate, context, class_name, function_name, bailout_value, \ |
| HandleScopeClass) \ |
| ENTER_V8_HELPER_DO_NOT_USE(isolate, context, class_name, function_name, \ |
| bailout_value, HandleScopeClass, true) |
| |
| #ifdef DEBUG |
| #define ENTER_V8_NO_SCRIPT(isolate, context, class_name, function_name, \ |
| bailout_value, HandleScopeClass) \ |
| ENTER_V8_HELPER_DO_NOT_USE(isolate, context, class_name, function_name, \ |
| bailout_value, HandleScopeClass, false); \ |
| i::DisallowJavascriptExecutionDebugOnly __no_script__((isolate)) |
| |
| #define ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate) \ |
| i::VMState<v8::OTHER> __state__((isolate)); \ |
| i::DisallowJavascriptExecutionDebugOnly __no_script__((isolate)); \ |
| i::DisallowExceptions __no_exceptions__((isolate)) |
| |
| #define ENTER_V8_FOR_NEW_CONTEXT(isolate) \ |
| i::VMState<v8::OTHER> __state__((isolate)); \ |
| i::DisallowExceptions __no_exceptions__((isolate)) |
| #else |
| #define ENTER_V8_NO_SCRIPT(isolate, context, class_name, function_name, \ |
| bailout_value, HandleScopeClass) \ |
| ENTER_V8_HELPER_DO_NOT_USE(isolate, context, class_name, function_name, \ |
| bailout_value, HandleScopeClass, false) |
| |
| #define ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate) \ |
| i::VMState<v8::OTHER> __state__((isolate)); |
| |
| #define ENTER_V8_FOR_NEW_CONTEXT(isolate) \ |
| i::VMState<v8::OTHER> __state__((isolate)); |
| #endif // DEBUG |
| |
| #define EXCEPTION_BAILOUT_CHECK_SCOPED_DO_NOT_USE(isolate, value) \ |
| do { \ |
| if (has_pending_exception) { \ |
| call_depth_scope.Escape(); \ |
| return value; \ |
| } \ |
| } while (false) |
| |
| #define RETURN_ON_FAILED_EXECUTION(T) \ |
| EXCEPTION_BAILOUT_CHECK_SCOPED_DO_NOT_USE(isolate, MaybeLocal<T>()) |
| |
| #define RETURN_ON_FAILED_EXECUTION_PRIMITIVE(T) \ |
| EXCEPTION_BAILOUT_CHECK_SCOPED_DO_NOT_USE(isolate, Nothing<T>()) |
| |
| #define RETURN_TO_LOCAL_UNCHECKED(maybe_local, T) \ |
| return maybe_local.FromMaybe(Local<T>()); |
| |
| |
| #define RETURN_ESCAPED(value) return handle_scope.Escape(value); |
| |
| |
| namespace { |
| |
| Local<Context> ContextFromHeapObject(i::Handle<i::Object> obj) { |
| return reinterpret_cast<v8::Isolate*>(i::HeapObject::cast(*obj)->GetIsolate()) |
| ->GetCurrentContext(); |
| } |
| |
| class InternalEscapableScope : public v8::EscapableHandleScope { |
| public: |
| explicit inline InternalEscapableScope(i::Isolate* isolate) |
| : v8::EscapableHandleScope(reinterpret_cast<v8::Isolate*>(isolate)) {} |
| }; |
| |
| // TODO(jochen): This should be #ifdef DEBUG |
| #ifdef V8_CHECK_MICROTASKS_SCOPES_CONSISTENCY |
| void CheckMicrotasksScopesConsistency(i::Isolate* isolate) { |
| auto handle_scope_implementer = isolate->handle_scope_implementer(); |
| if (handle_scope_implementer->microtasks_policy() == |
| v8::MicrotasksPolicy::kScoped) { |
| DCHECK(handle_scope_implementer->GetMicrotasksScopeDepth() || |
| !handle_scope_implementer->DebugMicrotasksScopeDepthIsZero()); |
| } |
| } |
| #endif |
| |
| template <bool do_callback> |
| class CallDepthScope { |
| public: |
| explicit CallDepthScope(i::Isolate* isolate, Local<Context> context) |
| : isolate_(isolate), context_(context), escaped_(false) { |
| // TODO(dcarney): remove this when blink stops crashing. |
| DCHECK(!isolate_->external_caught_exception()); |
| isolate_->handle_scope_implementer()->IncrementCallDepth(); |
| if (!context.IsEmpty()) { |
| i::Handle<i::Context> env = Utils::OpenHandle(*context); |
| i::HandleScopeImplementer* impl = isolate->handle_scope_implementer(); |
| if (isolate->context() != nullptr && |
| isolate->context()->native_context() == env->native_context()) { |
| context_ = Local<Context>(); |
| } else { |
| impl->SaveContext(isolate->context()); |
| isolate->set_context(*env); |
| } |
| } |
| if (do_callback) isolate_->FireBeforeCallEnteredCallback(); |
| } |
| ~CallDepthScope() { |
| if (!context_.IsEmpty()) { |
| i::HandleScopeImplementer* impl = isolate_->handle_scope_implementer(); |
| isolate_->set_context(impl->RestoreContext()); |
| } |
| if (!escaped_) isolate_->handle_scope_implementer()->DecrementCallDepth(); |
| if (do_callback) isolate_->FireCallCompletedCallback(); |
| // TODO(jochen): This should be #ifdef DEBUG |
| #ifdef V8_CHECK_MICROTASKS_SCOPES_CONSISTENCY |
| if (do_callback) CheckMicrotasksScopesConsistency(isolate_); |
| #endif |
| } |
| |
| void Escape() { |
| DCHECK(!escaped_); |
| escaped_ = true; |
| auto handle_scope_implementer = isolate_->handle_scope_implementer(); |
| handle_scope_implementer->DecrementCallDepth(); |
| bool call_depth_is_zero = handle_scope_implementer->CallDepthIsZero(); |
| isolate_->OptionalRescheduleException(call_depth_is_zero); |
| } |
| |
| private: |
| i::Isolate* const isolate_; |
| Local<Context> context_; |
| bool escaped_; |
| bool do_callback_; |
| }; |
| |
| } // namespace |
| |
| |
| static ScriptOrigin GetScriptOriginForScript(i::Isolate* isolate, |
| i::Handle<i::Script> script) { |
| i::Handle<i::Object> scriptName(script->GetNameOrSourceURL(), isolate); |
| i::Handle<i::Object> source_map_url(script->source_mapping_url(), isolate); |
| i::Handle<i::FixedArray> host_defined_options(script->host_defined_options(), |
| isolate); |
| v8::Isolate* v8_isolate = |
| reinterpret_cast<v8::Isolate*>(script->GetIsolate()); |
| ScriptOriginOptions options(script->origin_options()); |
| v8::ScriptOrigin origin( |
| Utils::ToLocal(scriptName), |
| v8::Integer::New(v8_isolate, script->line_offset()), |
| v8::Integer::New(v8_isolate, script->column_offset()), |
| v8::Boolean::New(v8_isolate, options.IsSharedCrossOrigin()), |
| v8::Integer::New(v8_isolate, script->id()), |
| Utils::ToLocal(source_map_url), |
| v8::Boolean::New(v8_isolate, options.IsOpaque()), |
| v8::Boolean::New(v8_isolate, script->type() == i::Script::TYPE_WASM), |
| v8::Boolean::New(v8_isolate, options.IsModule()), |
| Utils::ToLocal(host_defined_options)); |
| return origin; |
| } |
| |
| |
| // --- E x c e p t i o n B e h a v i o r --- |
| |
| |
| void i::FatalProcessOutOfMemory(const char* location) { |
| i::V8::FatalProcessOutOfMemory(location, false); |
| } |
| |
| // When V8 cannot allocate memory FatalProcessOutOfMemory is called. The default |
| // OOM error handler is called and execution is stopped. |
| void i::V8::FatalProcessOutOfMemory(const char* location, bool is_heap_oom) { |
| i::Isolate* isolate = i::Isolate::Current(); |
| char last_few_messages[Heap::kTraceRingBufferSize + 1]; |
| char js_stacktrace[Heap::kStacktraceBufferSize + 1]; |
| i::HeapStats heap_stats; |
| |
| if (isolate == nullptr) { |
| // On a background thread -> we cannot retrieve memory information from the |
| // Isolate. Write easy-to-recognize values on the stack. |
| memset(last_few_messages, 0x0badc0de, Heap::kTraceRingBufferSize + 1); |
| memset(js_stacktrace, 0x0badc0de, Heap::kStacktraceBufferSize + 1); |
| memset(&heap_stats, 0xbadc0de, sizeof(heap_stats)); |
| // Note that the embedder's oom handler won't be called in this case. We |
| // just crash. |
| FATAL("API fatal error handler returned after process out of memory"); |
| return; |
| } |
| |
| memset(last_few_messages, 0, Heap::kTraceRingBufferSize + 1); |
| memset(js_stacktrace, 0, Heap::kStacktraceBufferSize + 1); |
| |
| intptr_t start_marker; |
| heap_stats.start_marker = &start_marker; |
| size_t new_space_size; |
| heap_stats.new_space_size = &new_space_size; |
| size_t new_space_capacity; |
| heap_stats.new_space_capacity = &new_space_capacity; |
| size_t old_space_size; |
| heap_stats.old_space_size = &old_space_size; |
| size_t old_space_capacity; |
| heap_stats.old_space_capacity = &old_space_capacity; |
| size_t code_space_size; |
| heap_stats.code_space_size = &code_space_size; |
| size_t code_space_capacity; |
| heap_stats.code_space_capacity = &code_space_capacity; |
| size_t map_space_size; |
| heap_stats.map_space_size = &map_space_size; |
| size_t map_space_capacity; |
| heap_stats.map_space_capacity = &map_space_capacity; |
| size_t lo_space_size; |
| heap_stats.lo_space_size = &lo_space_size; |
| size_t global_handle_count; |
| heap_stats.global_handle_count = &global_handle_count; |
| size_t weak_global_handle_count; |
| heap_stats.weak_global_handle_count = &weak_global_handle_count; |
| size_t pending_global_handle_count; |
| heap_stats.pending_global_handle_count = &pending_global_handle_count; |
| size_t near_death_global_handle_count; |
| heap_stats.near_death_global_handle_count = &near_death_global_handle_count; |
| size_t free_global_handle_count; |
| heap_stats.free_global_handle_count = &free_global_handle_count; |
| size_t memory_allocator_size; |
| heap_stats.memory_allocator_size = &memory_allocator_size; |
| size_t memory_allocator_capacity; |
| heap_stats.memory_allocator_capacity = &memory_allocator_capacity; |
| size_t malloced_memory; |
| heap_stats.malloced_memory = &malloced_memory; |
| size_t malloced_peak_memory; |
| heap_stats.malloced_peak_memory = &malloced_peak_memory; |
| size_t objects_per_type[LAST_TYPE + 1] = {0}; |
| heap_stats.objects_per_type = objects_per_type; |
| size_t size_per_type[LAST_TYPE + 1] = {0}; |
| heap_stats.size_per_type = size_per_type; |
| int os_error; |
| heap_stats.os_error = &os_error; |
| heap_stats.last_few_messages = last_few_messages; |
| heap_stats.js_stacktrace = js_stacktrace; |
| intptr_t end_marker; |
| heap_stats.end_marker = &end_marker; |
| if (isolate->heap()->HasBeenSetUp()) { |
| // BUG(1718): Don't use the take_snapshot since we don't support |
| // HeapIterator here without doing a special GC. |
| isolate->heap()->RecordStats(&heap_stats, false); |
| char* first_newline = strchr(last_few_messages, '\n'); |
| if (first_newline == nullptr || first_newline[1] == '\0') |
| first_newline = last_few_messages; |
| PrintF("\n<--- Last few GCs --->\n%s\n", first_newline); |
| PrintF("\n<--- JS stacktrace --->\n%s\n", js_stacktrace); |
| } |
| Utils::ReportOOMFailure(location, is_heap_oom); |
| // If the fatal error handler returns, we stop execution. |
| FATAL("API fatal error handler returned after process out of memory"); |
| } |
| |
| |
| void Utils::ReportApiFailure(const char* location, const char* message) { |
| i::Isolate* isolate = i::Isolate::Current(); |
| FatalErrorCallback callback = isolate->exception_behavior(); |
| if (callback == nullptr) { |
| base::OS::PrintError("\n#\n# Fatal error in %s\n# %s\n#\n\n", location, |
| message); |
| base::OS::Abort(); |
| } else { |
| callback(location, message); |
| } |
| isolate->SignalFatalError(); |
| } |
| |
| void Utils::ReportOOMFailure(const char* location, bool is_heap_oom) { |
| i::Isolate* isolate = i::Isolate::Current(); |
| OOMErrorCallback oom_callback = isolate->oom_behavior(); |
| if (oom_callback == nullptr) { |
| // TODO(wfh): Remove this fallback once Blink is setting OOM handler. See |
| // crbug.com/614440. |
| FatalErrorCallback fatal_callback = isolate->exception_behavior(); |
| if (fatal_callback == nullptr) { |
| base::OS::PrintError("\n#\n# Fatal %s OOM in %s\n#\n\n", |
| is_heap_oom ? "javascript" : "process", location); |
| base::OS::Abort(); |
| } else { |
| fatal_callback(location, |
| is_heap_oom |
| ? "Allocation failed - JavaScript heap out of memory" |
| : "Allocation failed - process out of memory"); |
| } |
| } else { |
| oom_callback(location, is_heap_oom); |
| } |
| isolate->SignalFatalError(); |
| } |
| |
| static inline bool IsExecutionTerminatingCheck(i::Isolate* isolate) { |
| if (isolate->has_scheduled_exception()) { |
| return isolate->scheduled_exception() == |
| isolate->heap()->termination_exception(); |
| } |
| return false; |
| } |
| |
| |
| void V8::SetNativesDataBlob(StartupData* natives_blob) { |
| i::V8::SetNativesBlob(natives_blob); |
| } |
| |
| |
| void V8::SetSnapshotDataBlob(StartupData* snapshot_blob) { |
| i::V8::SetSnapshotBlob(snapshot_blob); |
| } |
| |
| void* v8::ArrayBuffer::Allocator::Reserve(size_t length) { UNIMPLEMENTED(); } |
| |
| void v8::ArrayBuffer::Allocator::Free(void* data, size_t length, |
| AllocationMode mode) { |
| switch (mode) { |
| case AllocationMode::kNormal: { |
| Free(data, length); |
| return; |
| } |
| case AllocationMode::kReservation: { |
| UNIMPLEMENTED(); |
| return; |
| } |
| } |
| } |
| |
| void v8::ArrayBuffer::Allocator::SetProtection( |
| void* data, size_t length, |
| v8::ArrayBuffer::Allocator::Protection protection) { |
| UNIMPLEMENTED(); |
| } |
| |
| namespace { |
| |
| class ArrayBufferAllocator : public v8::ArrayBuffer::Allocator { |
| public: |
| virtual void* Allocate(size_t length) { |
| void* data = AllocateUninitialized(length); |
| return data == nullptr ? data : memset(data, 0, length); |
| } |
| virtual void* AllocateUninitialized(size_t length) { return malloc(length); } |
| virtual void Free(void* data, size_t) { free(data); } |
| |
| virtual void* Reserve(size_t length) { |
| size_t page_size = base::OS::AllocatePageSize(); |
| size_t allocated = RoundUp(length, page_size); |
| void* address = |
| base::OS::Allocate(base::OS::GetRandomMmapAddr(), allocated, page_size, |
| base::OS::MemoryPermission::kNoAccess); |
| #if defined(LEAK_SANITIZER) |
| if (address != nullptr) { |
| __lsan_register_root_region(address, allocated); |
| } |
| #endif |
| return address; |
| } |
| |
| virtual void Free(void* data, size_t length, |
| v8::ArrayBuffer::Allocator::AllocationMode mode) { |
| switch (mode) { |
| case v8::ArrayBuffer::Allocator::AllocationMode::kNormal: { |
| return Free(data, length); |
| } |
| case v8::ArrayBuffer::Allocator::AllocationMode::kReservation: { |
| CHECK(base::OS::Free(data, length)); |
| return; |
| } |
| } |
| } |
| |
| virtual void SetProtection( |
| void* data, size_t length, |
| v8::ArrayBuffer::Allocator::Protection protection) { |
| DCHECK(protection == v8::ArrayBuffer::Allocator::Protection::kNoAccess || |
| protection == v8::ArrayBuffer::Allocator::Protection::kReadWrite); |
| base::OS::MemoryPermission permission = |
| (protection == v8::ArrayBuffer::Allocator::Protection::kReadWrite) |
| ? base::OS::MemoryPermission::kReadWrite |
| : base::OS::MemoryPermission::kNoAccess; |
| CHECK(base::OS::SetPermissions(data, length, permission)); |
| } |
| }; |
| |
| bool RunExtraCode(Isolate* isolate, Local<Context> context, |
| const char* utf8_source, const char* name) { |
| base::ElapsedTimer timer; |
| timer.Start(); |
| Context::Scope context_scope(context); |
| TryCatch try_catch(isolate); |
| Local<String> source_string; |
| if (!String::NewFromUtf8(isolate, utf8_source, NewStringType::kNormal) |
| .ToLocal(&source_string)) { |
| return false; |
| } |
| Local<String> resource_name = |
| String::NewFromUtf8(isolate, name, NewStringType::kNormal) |
| .ToLocalChecked(); |
| ScriptOrigin origin(resource_name); |
| ScriptCompiler::Source source(source_string, origin); |
| Local<Script> script; |
| if (!ScriptCompiler::Compile(context, &source).ToLocal(&script)) return false; |
| if (script->Run(context).IsEmpty()) return false; |
| if (i::FLAG_profile_deserialization) { |
| i::PrintF("Executing custom snapshot script %s took %0.3f ms\n", name, |
| timer.Elapsed().InMillisecondsF()); |
| } |
| timer.Stop(); |
| CHECK(!try_catch.HasCaught()); |
| return true; |
| } |
| |
| struct SnapshotCreatorData { |
| explicit SnapshotCreatorData(Isolate* isolate) |
| : isolate_(isolate), |
| default_context_(), |
| contexts_(isolate), |
| templates_(isolate), |
| created_(false) {} |
| |
| static SnapshotCreatorData* cast(void* data) { |
| return reinterpret_cast<SnapshotCreatorData*>(data); |
| } |
| |
| ArrayBufferAllocator allocator_; |
| Isolate* isolate_; |
| Persistent<Context> default_context_; |
| SerializeInternalFieldsCallback default_embedder_fields_serializer_; |
| PersistentValueVector<Context> contexts_; |
| PersistentValueVector<Template> templates_; |
| std::vector<SerializeInternalFieldsCallback> embedder_fields_serializers_; |
| bool created_; |
| }; |
| |
| } // namespace |
| |
| SnapshotCreator::SnapshotCreator(const intptr_t* external_references, |
| StartupData* existing_snapshot) { |
| i::Isolate* internal_isolate = new i::Isolate(true); |
| Isolate* isolate = reinterpret_cast<Isolate*>(internal_isolate); |
| SnapshotCreatorData* data = new SnapshotCreatorData(isolate); |
| data->isolate_ = isolate; |
| internal_isolate->set_array_buffer_allocator(&data->allocator_); |
| internal_isolate->set_api_external_references(external_references); |
| isolate->Enter(); |
| const StartupData* blob = existing_snapshot |
| ? existing_snapshot |
| : i::Snapshot::DefaultSnapshotBlob(); |
| if (blob && blob->raw_size > 0) { |
| internal_isolate->set_snapshot_blob(blob); |
| i::Snapshot::Initialize(internal_isolate); |
| } else { |
| internal_isolate->Init(nullptr); |
| } |
| data_ = data; |
| } |
| |
| SnapshotCreator::~SnapshotCreator() { |
| SnapshotCreatorData* data = SnapshotCreatorData::cast(data_); |
| DCHECK(data->created_); |
| Isolate* isolate = data->isolate_; |
| isolate->Exit(); |
| isolate->Dispose(); |
| delete data; |
| } |
| |
| Isolate* SnapshotCreator::GetIsolate() { |
| return SnapshotCreatorData::cast(data_)->isolate_; |
| } |
| |
| void SnapshotCreator::SetDefaultContext( |
| Local<Context> context, SerializeInternalFieldsCallback callback) { |
| DCHECK(!context.IsEmpty()); |
| SnapshotCreatorData* data = SnapshotCreatorData::cast(data_); |
| DCHECK(!data->created_); |
| DCHECK(data->default_context_.IsEmpty()); |
| Isolate* isolate = data->isolate_; |
| CHECK_EQ(isolate, context->GetIsolate()); |
| data->default_context_.Reset(isolate, context); |
| data->default_embedder_fields_serializer_ = callback; |
| } |
| |
| size_t SnapshotCreator::AddContext(Local<Context> context, |
| SerializeInternalFieldsCallback callback) { |
| DCHECK(!context.IsEmpty()); |
| SnapshotCreatorData* data = SnapshotCreatorData::cast(data_); |
| DCHECK(!data->created_); |
| Isolate* isolate = data->isolate_; |
| CHECK_EQ(isolate, context->GetIsolate()); |
| size_t index = static_cast<int>(data->contexts_.Size()); |
| data->contexts_.Append(context); |
| data->embedder_fields_serializers_.push_back(callback); |
| return index; |
| } |
| |
| size_t SnapshotCreator::AddTemplate(Local<Template> template_obj) { |
| DCHECK(!template_obj.IsEmpty()); |
| SnapshotCreatorData* data = SnapshotCreatorData::cast(data_); |
| DCHECK(!data->created_); |
| DCHECK_EQ(reinterpret_cast<i::Isolate*>(data->isolate_), |
| Utils::OpenHandle(*template_obj)->GetIsolate()); |
| size_t index = static_cast<int>(data->templates_.Size()); |
| data->templates_.Append(template_obj); |
| return index; |
| } |
| |
| StartupData SnapshotCreator::CreateBlob( |
| SnapshotCreator::FunctionCodeHandling function_code_handling) { |
| SnapshotCreatorData* data = SnapshotCreatorData::cast(data_); |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(data->isolate_); |
| DCHECK(!data->created_); |
| DCHECK(!data->default_context_.IsEmpty()); |
| |
| int num_additional_contexts = static_cast<int>(data->contexts_.Size()); |
| |
| { |
| int num_templates = static_cast<int>(data->templates_.Size()); |
| i::HandleScope scope(isolate); |
| i::Handle<i::FixedArray> templates = |
| isolate->factory()->NewFixedArray(num_templates, i::TENURED); |
| for (int i = 0; i < num_templates; i++) { |
| templates->set(i, *v8::Utils::OpenHandle(*data->templates_.Get(i))); |
| } |
| isolate->heap()->SetSerializedTemplates(*templates); |
| data->templates_.Clear(); |
| |
| // We need to store the global proxy size upfront in case we need the |
| // bootstrapper to create a global proxy before we deserialize the context. |
| i::Handle<i::FixedArray> global_proxy_sizes = |
| isolate->factory()->NewFixedArray(num_additional_contexts, i::TENURED); |
| for (int i = 0; i < num_additional_contexts; i++) { |
| i::Handle<i::Context> context = |
| v8::Utils::OpenHandle(*data->contexts_.Get(i)); |
| global_proxy_sizes->set(i, |
| i::Smi::FromInt(context->global_proxy()->Size())); |
| } |
| isolate->heap()->SetSerializedGlobalProxySizes(*global_proxy_sizes); |
| } |
| |
| // We might rehash strings and re-sort descriptors. Clear the lookup cache. |
| isolate->descriptor_lookup_cache()->Clear(); |
| |
| // If we don't do this then we end up with a stray root pointing at the |
| // context even after we have disposed of the context. |
| isolate->heap()->CollectAllAvailableGarbage( |
| i::GarbageCollectionReason::kSnapshotCreator); |
| isolate->heap()->CompactWeakFixedArrays(); |
| |
| i::DisallowHeapAllocation no_gc_from_here_on; |
| |
| std::vector<i::Object*> contexts; |
| contexts.reserve(num_additional_contexts); |
| i::Object* default_context; |
| { |
| i::HandleScope scope(isolate); |
| default_context = |
| *v8::Utils::OpenHandle(*data->default_context_.Get(data->isolate_)); |
| data->default_context_.Reset(); |
| for (int i = 0; i < num_additional_contexts; i++) { |
| i::Handle<i::Context> context = |
| v8::Utils::OpenHandle(*data->contexts_.Get(i)); |
| contexts.push_back(*context); |
| } |
| data->contexts_.Clear(); |
| } |
| |
| // Complete in-object slack tracking for all functions. |
| i::HeapIterator heap_iterator(isolate->heap()); |
| while (i::HeapObject* current_obj = heap_iterator.next()) { |
| if (!current_obj->IsJSFunction()) continue; |
| i::JSFunction* fun = i::JSFunction::cast(current_obj); |
| fun->CompleteInobjectSlackTrackingIfActive(); |
| } |
| |
| i::StartupSerializer startup_serializer(isolate, function_code_handling); |
| startup_serializer.SerializeStrongReferences(); |
| |
| // Serialize each context with a new partial serializer. |
| std::vector<i::SnapshotData*> context_snapshots; |
| context_snapshots.reserve(num_additional_contexts + 1); |
| |
| // TODO(6593): generalize rehashing, and remove this flag. |
| bool can_be_rehashed = true; |
| |
| { |
| // The default context is created with a handler for embedder fields which |
| // determines how they are handled if encountered during serialization. |
| i::PartialSerializer partial_serializer( |
| isolate, &startup_serializer, |
| data->default_embedder_fields_serializer_); |
| partial_serializer.Serialize(&default_context, false); |
| can_be_rehashed = can_be_rehashed && partial_serializer.can_be_rehashed(); |
| context_snapshots.push_back(new i::SnapshotData(&partial_serializer)); |
| } |
| |
| for (int i = 0; i < num_additional_contexts; i++) { |
| i::PartialSerializer partial_serializer( |
| isolate, &startup_serializer, data->embedder_fields_serializers_[i]); |
| partial_serializer.Serialize(&contexts[i], true); |
| can_be_rehashed = can_be_rehashed && partial_serializer.can_be_rehashed(); |
| context_snapshots.push_back(new i::SnapshotData(&partial_serializer)); |
| } |
| |
| // Builtin serialization places additional objects into the partial snapshot |
| // cache and thus needs to happen before SerializeWeakReferencesAndDeferred |
| // is called below. |
| i::BuiltinSerializer builtin_serializer(isolate, &startup_serializer); |
| builtin_serializer.SerializeBuiltinsAndHandlers(); |
| |
| startup_serializer.SerializeWeakReferencesAndDeferred(); |
| can_be_rehashed = can_be_rehashed && startup_serializer.can_be_rehashed(); |
| |
| i::SnapshotData startup_snapshot(&startup_serializer); |
| i::BuiltinSnapshotData builtin_snapshot(&builtin_serializer); |
| StartupData result = i::Snapshot::CreateSnapshotBlob( |
| &startup_snapshot, &builtin_snapshot, context_snapshots, can_be_rehashed); |
| |
| // Delete heap-allocated context snapshot instances. |
| for (const auto context_snapshot : context_snapshots) { |
| delete context_snapshot; |
| } |
| data->created_ = true; |
| return result; |
| } |
| |
| StartupData V8::CreateSnapshotDataBlob(const char* embedded_source) { |
| // Create a new isolate and a new context from scratch, optionally run |
| // a script to embed, and serialize to create a snapshot blob. |
| StartupData result = {nullptr, 0}; |
| base::ElapsedTimer timer; |
| timer.Start(); |
| { |
| SnapshotCreator snapshot_creator; |
| Isolate* isolate = snapshot_creator.GetIsolate(); |
| { |
| HandleScope scope(isolate); |
| Local<Context> context = Context::New(isolate); |
| if (embedded_source != nullptr && |
| !RunExtraCode(isolate, context, embedded_source, "<embedded>")) { |
| return result; |
| } |
| snapshot_creator.SetDefaultContext(context); |
| } |
| result = snapshot_creator.CreateBlob( |
| SnapshotCreator::FunctionCodeHandling::kClear); |
| } |
| |
| if (i::FLAG_profile_deserialization) { |
| i::PrintF("Creating snapshot took %0.3f ms\n", |
| timer.Elapsed().InMillisecondsF()); |
| } |
| timer.Stop(); |
| return result; |
| } |
| |
| StartupData V8::WarmUpSnapshotDataBlob(StartupData cold_snapshot_blob, |
| const char* warmup_source) { |
| CHECK(cold_snapshot_blob.raw_size > 0 && cold_snapshot_blob.data != nullptr); |
| CHECK_NOT_NULL(warmup_source); |
| // Use following steps to create a warmed up snapshot blob from a cold one: |
| // - Create a new isolate from the cold snapshot. |
| // - Create a new context to run the warmup script. This will trigger |
| // compilation of executed functions. |
| // - Create a new context. This context will be unpolluted. |
| // - Serialize the isolate and the second context into a new snapshot blob. |
| StartupData result = {nullptr, 0}; |
| base::ElapsedTimer timer; |
| timer.Start(); |
| { |
| SnapshotCreator snapshot_creator(nullptr, &cold_snapshot_blob); |
| Isolate* isolate = snapshot_creator.GetIsolate(); |
| { |
| HandleScope scope(isolate); |
| Local<Context> context = Context::New(isolate); |
| if (!RunExtraCode(isolate, context, warmup_source, "<warm-up>")) { |
| return result; |
| } |
| } |
| { |
| HandleScope handle_scope(isolate); |
| isolate->ContextDisposedNotification(false); |
| Local<Context> context = Context::New(isolate); |
| snapshot_creator.SetDefaultContext(context); |
| } |
| result = snapshot_creator.CreateBlob( |
| SnapshotCreator::FunctionCodeHandling::kKeep); |
| } |
| |
| if (i::FLAG_profile_deserialization) { |
| i::PrintF("Warming up snapshot took %0.3f ms\n", |
| timer.Elapsed().InMillisecondsF()); |
| } |
| timer.Stop(); |
| return result; |
| } |
| |
| void V8::SetDcheckErrorHandler(DcheckErrorCallback that) { |
| v8::base::SetDcheckFunction(that); |
| } |
| |
| void V8::SetFlagsFromString(const char* str, int length) { |
| i::FlagList::SetFlagsFromString(str, length); |
| i::FlagList::EnforceFlagImplications(); |
| } |
| |
| |
| void V8::SetFlagsFromCommandLine(int* argc, char** argv, bool remove_flags) { |
| i::FlagList::SetFlagsFromCommandLine(argc, argv, remove_flags); |
| } |
| |
| RegisteredExtension* RegisteredExtension::first_extension_ = nullptr; |
| |
| RegisteredExtension::RegisteredExtension(Extension* extension) |
| : extension_(extension) { } |
| |
| |
| void RegisteredExtension::Register(RegisteredExtension* that) { |
| that->next_ = first_extension_; |
| first_extension_ = that; |
| } |
| |
| |
| void RegisteredExtension::UnregisterAll() { |
| RegisteredExtension* re = first_extension_; |
| while (re != nullptr) { |
| RegisteredExtension* next = re->next(); |
| delete re; |
| re = next; |
| } |
| first_extension_ = nullptr; |
| } |
| |
| |
| void RegisterExtension(Extension* that) { |
| RegisteredExtension* extension = new RegisteredExtension(that); |
| RegisteredExtension::Register(extension); |
| } |
| |
| |
| Extension::Extension(const char* name, |
| const char* source, |
| int dep_count, |
| const char** deps, |
| int source_length) |
| : name_(name), |
| source_length_(source_length >= 0 ? |
| source_length : |
| (source ? static_cast<int>(strlen(source)) : 0)), |
| source_(source, source_length_), |
| dep_count_(dep_count), |
| deps_(deps), |
| auto_enable_(false) { |
| CHECK(source != nullptr || source_length_ == 0); |
| } |
| |
| ResourceConstraints::ResourceConstraints() |
| : max_semi_space_size_in_kb_(0), |
| max_old_space_size_(0), |
| stack_limit_(nullptr), |
| code_range_size_(0), |
| max_zone_pool_size_(0) {} |
| |
| void ResourceConstraints::ConfigureDefaults(uint64_t physical_memory, |
| uint64_t virtual_memory_limit) { |
| set_max_semi_space_size_in_kb( |
| i::Heap::ComputeMaxSemiSpaceSize(physical_memory)); |
| set_max_old_space_size( |
| static_cast<int>(i::Heap::ComputeMaxOldGenerationSize(physical_memory))); |
| set_max_zone_pool_size(i::AccountingAllocator::kMaxPoolSize); |
| |
| if (virtual_memory_limit > 0 && i::kRequiresCodeRange) { |
| // Reserve no more than 1/8 of the memory for the code range, but at most |
| // kMaximalCodeRangeSize. |
| set_code_range_size( |
| i::Min(i::kMaximalCodeRangeSize / i::MB, |
| static_cast<size_t>((virtual_memory_limit >> 3) / i::MB))); |
| } |
| } |
| |
| void SetResourceConstraints(i::Isolate* isolate, |
| const ResourceConstraints& constraints) { |
| size_t semi_space_size = constraints.max_semi_space_size_in_kb(); |
| int old_space_size = constraints.max_old_space_size(); |
| size_t code_range_size = constraints.code_range_size(); |
| size_t max_pool_size = constraints.max_zone_pool_size(); |
| if (semi_space_size != 0 || old_space_size != 0 || code_range_size != 0) { |
| isolate->heap()->ConfigureHeap(semi_space_size, old_space_size, |
| code_range_size); |
| } |
| isolate->allocator()->ConfigureSegmentPool(max_pool_size); |
| |
| if (constraints.stack_limit() != nullptr) { |
| uintptr_t limit = reinterpret_cast<uintptr_t>(constraints.stack_limit()); |
| isolate->stack_guard()->SetStackLimit(limit); |
| } |
| } |
| |
| |
| i::Object** V8::GlobalizeReference(i::Isolate* isolate, i::Object** obj) { |
| LOG_API(isolate, Persistent, New); |
| i::Handle<i::Object> result = isolate->global_handles()->Create(*obj); |
| #ifdef VERIFY_HEAP |
| if (i::FLAG_verify_heap) { |
| (*obj)->ObjectVerify(); |
| } |
| #endif // VERIFY_HEAP |
| return result.location(); |
| } |
| |
| |
| i::Object** V8::CopyPersistent(i::Object** obj) { |
| i::Handle<i::Object> result = i::GlobalHandles::CopyGlobal(obj); |
| #ifdef VERIFY_HEAP |
| if (i::FLAG_verify_heap) { |
| (*obj)->ObjectVerify(); |
| } |
| #endif // VERIFY_HEAP |
| return result.location(); |
| } |
| |
| void V8::RegisterExternallyReferencedObject(i::Object** object, |
| i::Isolate* isolate) { |
| isolate->heap()->RegisterExternallyReferencedObject(object); |
| } |
| |
| void V8::MakeWeak(i::Object** location, void* parameter, |
| int embedder_field_index1, int embedder_field_index2, |
| WeakCallbackInfo<void>::Callback weak_callback) { |
| WeakCallbackType type = WeakCallbackType::kParameter; |
| if (embedder_field_index1 == 0) { |
| if (embedder_field_index2 == 1) { |
| type = WeakCallbackType::kInternalFields; |
| } else { |
| DCHECK_EQ(embedder_field_index2, -1); |
| type = WeakCallbackType::kInternalFields; |
| } |
| } else { |
| DCHECK_EQ(embedder_field_index1, -1); |
| DCHECK_EQ(embedder_field_index2, -1); |
| } |
| i::GlobalHandles::MakeWeak(location, parameter, weak_callback, type); |
| } |
| |
| void V8::MakeWeak(i::Object** location, void* parameter, |
| WeakCallbackInfo<void>::Callback weak_callback, |
| WeakCallbackType type) { |
| i::GlobalHandles::MakeWeak(location, parameter, weak_callback, type); |
| } |
| |
| void V8::MakeWeak(i::Object*** location_addr) { |
| i::GlobalHandles::MakeWeak(location_addr); |
| } |
| |
| void* V8::ClearWeak(i::Object** location) { |
| return i::GlobalHandles::ClearWeakness(location); |
| } |
| |
| void V8::DisposeGlobal(i::Object** location) { |
| i::GlobalHandles::Destroy(location); |
| } |
| |
| Value* V8::Eternalize(Isolate* v8_isolate, Value* value) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| i::Object* object = *Utils::OpenHandle(value); |
| int index = -1; |
| isolate->eternal_handles()->Create(isolate, object, &index); |
| return reinterpret_cast<Value*>( |
| isolate->eternal_handles()->Get(index).location()); |
| } |
| |
| |
| void V8::FromJustIsNothing() { |
| Utils::ApiCheck(false, "v8::FromJust", "Maybe value is Nothing."); |
| } |
| |
| |
| void V8::ToLocalEmpty() { |
| Utils::ApiCheck(false, "v8::ToLocalChecked", "Empty MaybeLocal."); |
| } |
| |
| void V8::InternalFieldOutOfBounds(int index) { |
| Utils::ApiCheck(0 <= index && index < kInternalFieldsInWeakCallback, |
| "WeakCallbackInfo::GetInternalField", |
| "Internal field out of bounds."); |
| } |
| |
| |
| // --- H a n d l e s --- |
| |
| |
| HandleScope::HandleScope(Isolate* isolate) { |
| Initialize(isolate); |
| } |
| |
| |
| void HandleScope::Initialize(Isolate* isolate) { |
| i::Isolate* internal_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| // We do not want to check the correct usage of the Locker class all over the |
| // place, so we do it only here: Without a HandleScope, an embedder can do |
| // almost nothing, so it is enough to check in this central place. |
| // We make an exception if the serializer is enabled, which means that the |
| // Isolate is exclusively used to create a snapshot. |
| Utils::ApiCheck( |
| !v8::Locker::IsActive() || |
| internal_isolate->thread_manager()->IsLockedByCurrentThread() || |
| internal_isolate->serializer_enabled(), |
| "HandleScope::HandleScope", |
| "Entering the V8 API without proper locking in place"); |
| i::HandleScopeData* current = internal_isolate->handle_scope_data(); |
| isolate_ = internal_isolate; |
| prev_next_ = current->next; |
| prev_limit_ = current->limit; |
| current->level++; |
| } |
| |
| |
| HandleScope::~HandleScope() { |
| i::HandleScope::CloseScope(isolate_, prev_next_, prev_limit_); |
| } |
| |
| void* HandleScope::operator new(size_t) { base::OS::Abort(); } |
| void* HandleScope::operator new[](size_t) { base::OS::Abort(); } |
| void HandleScope::operator delete(void*, size_t) { base::OS::Abort(); } |
| void HandleScope::operator delete[](void*, size_t) { base::OS::Abort(); } |
| |
| int HandleScope::NumberOfHandles(Isolate* isolate) { |
| return i::HandleScope::NumberOfHandles( |
| reinterpret_cast<i::Isolate*>(isolate)); |
| } |
| |
| |
| i::Object** HandleScope::CreateHandle(i::Isolate* isolate, i::Object* value) { |
| return i::HandleScope::CreateHandle(isolate, value); |
| } |
| |
| |
| i::Object** HandleScope::CreateHandle(i::HeapObject* heap_object, |
| i::Object* value) { |
| DCHECK(heap_object->IsHeapObject()); |
| return i::HandleScope::CreateHandle(heap_object->GetIsolate(), value); |
| } |
| |
| |
| EscapableHandleScope::EscapableHandleScope(Isolate* v8_isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| escape_slot_ = CreateHandle(isolate, isolate->heap()->the_hole_value()); |
| Initialize(v8_isolate); |
| } |
| |
| |
| i::Object** EscapableHandleScope::Escape(i::Object** escape_value) { |
| i::Heap* heap = reinterpret_cast<i::Isolate*>(GetIsolate())->heap(); |
| Utils::ApiCheck((*escape_slot_)->IsTheHole(heap->isolate()), |
| "EscapableHandleScope::Escape", "Escape value set twice"); |
| if (escape_value == nullptr) { |
| *escape_slot_ = heap->undefined_value(); |
| return nullptr; |
| } |
| *escape_slot_ = *escape_value; |
| return escape_slot_; |
| } |
| |
| void* EscapableHandleScope::operator new(size_t) { base::OS::Abort(); } |
| void* EscapableHandleScope::operator new[](size_t) { base::OS::Abort(); } |
| void EscapableHandleScope::operator delete(void*, size_t) { base::OS::Abort(); } |
| void EscapableHandleScope::operator delete[](void*, size_t) { |
| base::OS::Abort(); |
| } |
| |
| SealHandleScope::SealHandleScope(Isolate* isolate) |
| : isolate_(reinterpret_cast<i::Isolate*>(isolate)) { |
| i::HandleScopeData* current = isolate_->handle_scope_data(); |
| prev_limit_ = current->limit; |
| current->limit = current->next; |
| prev_sealed_level_ = current->sealed_level; |
| current->sealed_level = current->level; |
| } |
| |
| |
| SealHandleScope::~SealHandleScope() { |
| i::HandleScopeData* current = isolate_->handle_scope_data(); |
| DCHECK_EQ(current->next, current->limit); |
| current->limit = prev_limit_; |
| DCHECK_EQ(current->level, current->sealed_level); |
| current->sealed_level = prev_sealed_level_; |
| } |
| |
| void* SealHandleScope::operator new(size_t) { base::OS::Abort(); } |
| void* SealHandleScope::operator new[](size_t) { base::OS::Abort(); } |
| void SealHandleScope::operator delete(void*, size_t) { base::OS::Abort(); } |
| void SealHandleScope::operator delete[](void*, size_t) { base::OS::Abort(); } |
| |
| void Context::Enter() { |
| i::Handle<i::Context> env = Utils::OpenHandle(this); |
| i::Isolate* isolate = env->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScopeImplementer* impl = isolate->handle_scope_implementer(); |
| impl->EnterContext(env); |
| impl->SaveContext(isolate->context()); |
| isolate->set_context(*env); |
| } |
| |
| void Context::Exit() { |
| i::Handle<i::Context> env = Utils::OpenHandle(this); |
| i::Isolate* isolate = env->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScopeImplementer* impl = isolate->handle_scope_implementer(); |
| if (!Utils::ApiCheck(impl->LastEnteredContextWas(env), |
| "v8::Context::Exit()", |
| "Cannot exit non-entered context")) { |
| return; |
| } |
| impl->LeaveContext(); |
| isolate->set_context(impl->RestoreContext()); |
| } |
| |
| Context::BackupIncumbentScope::BackupIncumbentScope( |
| Local<Context> backup_incumbent_context) |
| : backup_incumbent_context_(backup_incumbent_context) { |
| DCHECK(!backup_incumbent_context_.IsEmpty()); |
| |
| i::Handle<i::Context> env = Utils::OpenHandle(*backup_incumbent_context_); |
| i::Isolate* isolate = env->GetIsolate(); |
| prev_ = isolate->top_backup_incumbent_scope(); |
| isolate->set_top_backup_incumbent_scope(this); |
| } |
| |
| Context::BackupIncumbentScope::~BackupIncumbentScope() { |
| i::Handle<i::Context> env = Utils::OpenHandle(*backup_incumbent_context_); |
| i::Isolate* isolate = env->GetIsolate(); |
| isolate->set_top_backup_incumbent_scope(prev_); |
| } |
| |
| static void* DecodeSmiToAligned(i::Object* value, const char* location) { |
| Utils::ApiCheck(value->IsSmi(), location, "Not a Smi"); |
| return reinterpret_cast<void*>(value); |
| } |
| |
| |
| static i::Smi* EncodeAlignedAsSmi(void* value, const char* location) { |
| i::Smi* smi = reinterpret_cast<i::Smi*>(value); |
| Utils::ApiCheck(smi->IsSmi(), location, "Pointer is not aligned"); |
| return smi; |
| } |
| |
| |
| static i::Handle<i::FixedArray> EmbedderDataFor(Context* context, |
| int index, |
| bool can_grow, |
| const char* location) { |
| i::Handle<i::Context> env = Utils::OpenHandle(context); |
| i::Isolate* isolate = env->GetIsolate(); |
| bool ok = |
| Utils::ApiCheck(env->IsNativeContext(), |
| location, |
| "Not a native context") && |
| Utils::ApiCheck(index >= 0, location, "Negative index"); |
| if (!ok) return i::Handle<i::FixedArray>(); |
| i::Handle<i::FixedArray> data(env->embedder_data()); |
| if (index < data->length()) return data; |
| if (!Utils::ApiCheck(can_grow, location, "Index too large")) { |
| return i::Handle<i::FixedArray>(); |
| } |
| int new_size = i::Max(index, data->length() << 1) + 1; |
| int grow_by = new_size - data->length(); |
| data = isolate->factory()->CopyFixedArrayAndGrow(data, grow_by); |
| env->set_embedder_data(*data); |
| return data; |
| } |
| |
| |
| v8::Local<v8::Value> Context::SlowGetEmbedderData(int index) { |
| const char* location = "v8::Context::GetEmbedderData()"; |
| i::Handle<i::FixedArray> data = EmbedderDataFor(this, index, false, location); |
| if (data.is_null()) return Local<Value>(); |
| i::Handle<i::Object> result(data->get(index), data->GetIsolate()); |
| return Utils::ToLocal(result); |
| } |
| |
| |
| void Context::SetEmbedderData(int index, v8::Local<Value> value) { |
| const char* location = "v8::Context::SetEmbedderData()"; |
| i::Handle<i::FixedArray> data = EmbedderDataFor(this, index, true, location); |
| if (data.is_null()) return; |
| i::Handle<i::Object> val = Utils::OpenHandle(*value); |
| data->set(index, *val); |
| DCHECK_EQ(*Utils::OpenHandle(*value), |
| *Utils::OpenHandle(*GetEmbedderData(index))); |
| } |
| |
| |
| void* Context::SlowGetAlignedPointerFromEmbedderData(int index) { |
| const char* location = "v8::Context::GetAlignedPointerFromEmbedderData()"; |
| i::Handle<i::FixedArray> data = EmbedderDataFor(this, index, false, location); |
| if (data.is_null()) return nullptr; |
| return DecodeSmiToAligned(data->get(index), location); |
| } |
| |
| |
| void Context::SetAlignedPointerInEmbedderData(int index, void* value) { |
| const char* location = "v8::Context::SetAlignedPointerInEmbedderData()"; |
| i::Handle<i::FixedArray> data = EmbedderDataFor(this, index, true, location); |
| data->set(index, EncodeAlignedAsSmi(value, location)); |
| DCHECK_EQ(value, GetAlignedPointerFromEmbedderData(index)); |
| } |
| |
| |
| // --- T e m p l a t e --- |
| |
| |
| static void InitializeTemplate(i::Handle<i::TemplateInfo> that, int type) { |
| that->set_number_of_properties(0); |
| that->set_tag(i::Smi::FromInt(type)); |
| } |
| |
| |
| void Template::Set(v8::Local<Name> name, v8::Local<Data> value, |
| v8::PropertyAttribute attribute) { |
| auto templ = Utils::OpenHandle(this); |
| i::Isolate* isolate = templ->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| auto value_obj = Utils::OpenHandle(*value); |
| CHECK(!value_obj->IsJSReceiver() || value_obj->IsTemplateInfo()); |
| if (value_obj->IsObjectTemplateInfo()) { |
| templ->set_serial_number(i::Smi::kZero); |
| if (templ->IsFunctionTemplateInfo()) { |
| i::Handle<i::FunctionTemplateInfo>::cast(templ)->set_do_not_cache(true); |
| } |
| } |
| i::ApiNatives::AddDataProperty(isolate, templ, Utils::OpenHandle(*name), |
| value_obj, |
| static_cast<i::PropertyAttributes>(attribute)); |
| } |
| |
| void Template::SetPrivate(v8::Local<Private> name, v8::Local<Data> value, |
| v8::PropertyAttribute attribute) { |
| Set(Utils::ToLocal(Utils::OpenHandle(reinterpret_cast<Name*>(*name))), value, |
| attribute); |
| } |
| |
| void Template::SetAccessorProperty( |
| v8::Local<v8::Name> name, |
| v8::Local<FunctionTemplate> getter, |
| v8::Local<FunctionTemplate> setter, |
| v8::PropertyAttribute attribute, |
| v8::AccessControl access_control) { |
| // TODO(verwaest): Remove |access_control|. |
| DCHECK_EQ(v8::DEFAULT, access_control); |
| auto templ = Utils::OpenHandle(this); |
| auto isolate = templ->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| DCHECK(!name.IsEmpty()); |
| DCHECK(!getter.IsEmpty() || !setter.IsEmpty()); |
| i::HandleScope scope(isolate); |
| i::ApiNatives::AddAccessorProperty( |
| isolate, templ, Utils::OpenHandle(*name), |
| Utils::OpenHandle(*getter, true), Utils::OpenHandle(*setter, true), |
| static_cast<i::PropertyAttributes>(attribute)); |
| } |
| |
| |
| // --- F u n c t i o n T e m p l a t e --- |
| static void InitializeFunctionTemplate( |
| i::Handle<i::FunctionTemplateInfo> info) { |
| InitializeTemplate(info, Consts::FUNCTION_TEMPLATE); |
| info->set_flag(0); |
| } |
| |
| static Local<ObjectTemplate> ObjectTemplateNew( |
| i::Isolate* isolate, v8::Local<FunctionTemplate> constructor, |
| bool do_not_cache); |
| |
| Local<ObjectTemplate> FunctionTemplate::PrototypeTemplate() { |
| i::Isolate* i_isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::Object> result(Utils::OpenHandle(this)->prototype_template(), |
| i_isolate); |
| if (result->IsUndefined(i_isolate)) { |
| // Do not cache prototype objects. |
| result = Utils::OpenHandle( |
| *ObjectTemplateNew(i_isolate, Local<FunctionTemplate>(), true)); |
| Utils::OpenHandle(this)->set_prototype_template(*result); |
| } |
| return ToApiHandle<ObjectTemplate>(result); |
| } |
| |
| void FunctionTemplate::SetPrototypeProviderTemplate( |
| Local<FunctionTemplate> prototype_provider) { |
| i::Isolate* i_isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::Object> result = Utils::OpenHandle(*prototype_provider); |
| auto info = Utils::OpenHandle(this); |
| CHECK(info->prototype_template()->IsUndefined(i_isolate)); |
| CHECK(info->parent_template()->IsUndefined(i_isolate)); |
| info->set_prototype_provider_template(*result); |
| } |
| |
| static void EnsureNotInstantiated(i::Handle<i::FunctionTemplateInfo> info, |
| const char* func) { |
| Utils::ApiCheck(!info->instantiated(), func, |
| "FunctionTemplate already instantiated"); |
| } |
| |
| |
| void FunctionTemplate::Inherit(v8::Local<FunctionTemplate> value) { |
| auto info = Utils::OpenHandle(this); |
| EnsureNotInstantiated(info, "v8::FunctionTemplate::Inherit"); |
| i::Isolate* i_isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| CHECK(info->prototype_provider_template()->IsUndefined(i_isolate)); |
| info->set_parent_template(*Utils::OpenHandle(*value)); |
| } |
| |
| static Local<FunctionTemplate> FunctionTemplateNew( |
| i::Isolate* isolate, FunctionCallback callback, v8::Local<Value> data, |
| v8::Local<Signature> signature, int length, bool do_not_cache, |
| v8::Local<Private> cached_property_name = v8::Local<Private>()) { |
| i::Handle<i::Struct> struct_obj = |
| isolate->factory()->NewStruct(i::FUNCTION_TEMPLATE_INFO_TYPE, i::TENURED); |
| i::Handle<i::FunctionTemplateInfo> obj = |
| i::Handle<i::FunctionTemplateInfo>::cast(struct_obj); |
| InitializeFunctionTemplate(obj); |
| obj->set_do_not_cache(do_not_cache); |
| int next_serial_number = i::FunctionTemplateInfo::kInvalidSerialNumber; |
| if (!do_not_cache) { |
| next_serial_number = isolate->heap()->GetNextTemplateSerialNumber(); |
| } |
| obj->set_serial_number(i::Smi::FromInt(next_serial_number)); |
| if (callback != 0) { |
| Utils::ToLocal(obj)->SetCallHandler(callback, data); |
| } |
| obj->set_length(length); |
| obj->set_undetectable(false); |
| obj->set_needs_access_check(false); |
| obj->set_accept_any_receiver(true); |
| if (!signature.IsEmpty()) { |
| obj->set_signature(*Utils::OpenHandle(*signature)); |
| } |
| obj->set_cached_property_name( |
| cached_property_name.IsEmpty() |
| ? isolate->heap()->the_hole_value() |
| : *Utils::OpenHandle(*cached_property_name)); |
| return Utils::ToLocal(obj); |
| } |
| |
| Local<FunctionTemplate> FunctionTemplate::New( |
| Isolate* isolate, FunctionCallback callback, v8::Local<Value> data, |
| v8::Local<Signature> signature, int length, ConstructorBehavior behavior) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| // Changes to the environment cannot be captured in the snapshot. Expect no |
| // function templates when the isolate is created for serialization. |
| LOG_API(i_isolate, FunctionTemplate, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| auto templ = |
| FunctionTemplateNew(i_isolate, callback, data, signature, length, false); |
| if (behavior == ConstructorBehavior::kThrow) templ->RemovePrototype(); |
| return templ; |
| } |
| |
| MaybeLocal<FunctionTemplate> FunctionTemplate::FromSnapshot(Isolate* isolate, |
| size_t index) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| i::FixedArray* templates = i_isolate->heap()->serialized_templates(); |
| int int_index = static_cast<int>(index); |
| if (int_index < templates->length()) { |
| i::Object* info = templates->get(int_index); |
| if (info->IsFunctionTemplateInfo()) { |
| return Utils::ToLocal(i::Handle<i::FunctionTemplateInfo>( |
| i::FunctionTemplateInfo::cast(info))); |
| } |
| } |
| return Local<FunctionTemplate>(); |
| } |
| |
| Local<FunctionTemplate> FunctionTemplate::NewWithCache( |
| Isolate* isolate, FunctionCallback callback, Local<Private> cache_property, |
| Local<Value> data, Local<Signature> signature, int length) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, FunctionTemplate, NewWithCache); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| return FunctionTemplateNew(i_isolate, callback, data, signature, length, |
| false, cache_property); |
| } |
| |
| Local<Signature> Signature::New(Isolate* isolate, |
| Local<FunctionTemplate> receiver) { |
| return Utils::SignatureToLocal(Utils::OpenHandle(*receiver)); |
| } |
| |
| |
| Local<AccessorSignature> AccessorSignature::New( |
| Isolate* isolate, Local<FunctionTemplate> receiver) { |
| return Utils::AccessorSignatureToLocal(Utils::OpenHandle(*receiver)); |
| } |
| |
| |
| #define SET_FIELD_WRAPPED(obj, setter, cdata) do { \ |
| i::Handle<i::Object> foreign = FromCData(obj->GetIsolate(), cdata); \ |
| (obj)->setter(*foreign); \ |
| } while (false) |
| |
| void FunctionTemplate::SetCallHandler(FunctionCallback callback, |
| v8::Local<Value> data) { |
| auto info = Utils::OpenHandle(this); |
| EnsureNotInstantiated(info, "v8::FunctionTemplate::SetCallHandler"); |
| i::Isolate* isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| i::Handle<i::Struct> struct_obj = |
| isolate->factory()->NewStruct(i::TUPLE3_TYPE, i::TENURED); |
| i::Handle<i::CallHandlerInfo> obj = |
| i::Handle<i::CallHandlerInfo>::cast(struct_obj); |
| SET_FIELD_WRAPPED(obj, set_callback, callback); |
| SET_FIELD_WRAPPED(obj, set_js_callback, obj->redirected_callback()); |
| if (data.IsEmpty()) { |
| data = v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| obj->set_data(*Utils::OpenHandle(*data)); |
| info->set_call_code(*obj); |
| } |
| |
| |
| namespace { |
| |
| template <typename Getter, typename Setter> |
| i::Handle<i::AccessorInfo> MakeAccessorInfo( |
| i::Isolate* isolate, v8::Local<Name> name, Getter getter, Setter setter, |
| v8::Local<Value> data, v8::AccessControl settings, |
| v8::Local<AccessorSignature> signature, bool is_special_data_property, |
| bool replace_on_access) { |
| i::Handle<i::AccessorInfo> obj = isolate->factory()->NewAccessorInfo(); |
| SET_FIELD_WRAPPED(obj, set_getter, getter); |
| DCHECK_IMPLIES(replace_on_access, |
| is_special_data_property && setter == nullptr); |
| if (is_special_data_property && setter == nullptr) { |
| setter = reinterpret_cast<Setter>(&i::Accessors::ReconfigureToDataProperty); |
| } |
| SET_FIELD_WRAPPED(obj, set_setter, setter); |
| i::Address redirected = obj->redirected_getter(); |
| if (redirected != nullptr) SET_FIELD_WRAPPED(obj, set_js_getter, redirected); |
| if (data.IsEmpty()) { |
| data = v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| obj->set_data(*Utils::OpenHandle(*data)); |
| obj->set_is_special_data_property(is_special_data_property); |
| obj->set_replace_on_access(replace_on_access); |
| i::Handle<i::Name> accessor_name = Utils::OpenHandle(*name); |
| if (!accessor_name->IsUniqueName()) { |
| accessor_name = isolate->factory()->InternalizeString( |
| i::Handle<i::String>::cast(accessor_name)); |
| } |
| obj->set_name(*accessor_name); |
| if (settings & ALL_CAN_READ) obj->set_all_can_read(true); |
| if (settings & ALL_CAN_WRITE) obj->set_all_can_write(true); |
| obj->set_initial_property_attributes(i::NONE); |
| if (!signature.IsEmpty()) { |
| obj->set_expected_receiver_type(*Utils::OpenHandle(*signature)); |
| } |
| return obj; |
| } |
| |
| } // namespace |
| |
| Local<ObjectTemplate> FunctionTemplate::InstanceTemplate() { |
| i::Handle<i::FunctionTemplateInfo> handle = Utils::OpenHandle(this, true); |
| if (!Utils::ApiCheck(!handle.is_null(), |
| "v8::FunctionTemplate::InstanceTemplate()", |
| "Reading from empty handle")) { |
| return Local<ObjectTemplate>(); |
| } |
| i::Isolate* isolate = handle->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| if (handle->instance_template()->IsUndefined(isolate)) { |
| Local<ObjectTemplate> templ = |
| ObjectTemplate::New(isolate, ToApiHandle<FunctionTemplate>(handle)); |
| handle->set_instance_template(*Utils::OpenHandle(*templ)); |
| } |
| i::Handle<i::ObjectTemplateInfo> result( |
| i::ObjectTemplateInfo::cast(handle->instance_template())); |
| return Utils::ToLocal(result); |
| } |
| |
| |
| void FunctionTemplate::SetLength(int length) { |
| auto info = Utils::OpenHandle(this); |
| EnsureNotInstantiated(info, "v8::FunctionTemplate::SetLength"); |
| auto isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| info->set_length(length); |
| } |
| |
| |
| void FunctionTemplate::SetClassName(Local<String> name) { |
| auto info = Utils::OpenHandle(this); |
| EnsureNotInstantiated(info, "v8::FunctionTemplate::SetClassName"); |
| auto isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| info->set_class_name(*Utils::OpenHandle(*name)); |
| } |
| |
| |
| void FunctionTemplate::SetAcceptAnyReceiver(bool value) { |
| auto info = Utils::OpenHandle(this); |
| EnsureNotInstantiated(info, "v8::FunctionTemplate::SetAcceptAnyReceiver"); |
| auto isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| info->set_accept_any_receiver(value); |
| } |
| |
| |
| void FunctionTemplate::SetHiddenPrototype(bool value) { |
| auto info = Utils::OpenHandle(this); |
| EnsureNotInstantiated(info, "v8::FunctionTemplate::SetHiddenPrototype"); |
| auto isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| info->set_hidden_prototype(value); |
| } |
| |
| |
| void FunctionTemplate::ReadOnlyPrototype() { |
| auto info = Utils::OpenHandle(this); |
| EnsureNotInstantiated(info, "v8::FunctionTemplate::ReadOnlyPrototype"); |
| auto isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| info->set_read_only_prototype(true); |
| } |
| |
| |
| void FunctionTemplate::RemovePrototype() { |
| auto info = Utils::OpenHandle(this); |
| EnsureNotInstantiated(info, "v8::FunctionTemplate::RemovePrototype"); |
| auto isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| info->set_remove_prototype(true); |
| } |
| |
| |
| // --- O b j e c t T e m p l a t e --- |
| |
| |
| Local<ObjectTemplate> ObjectTemplate::New( |
| Isolate* isolate, v8::Local<FunctionTemplate> constructor) { |
| return New(reinterpret_cast<i::Isolate*>(isolate), constructor); |
| } |
| |
| |
| Local<ObjectTemplate> ObjectTemplate::New() { |
| return New(i::Isolate::Current(), Local<FunctionTemplate>()); |
| } |
| |
| static Local<ObjectTemplate> ObjectTemplateNew( |
| i::Isolate* isolate, v8::Local<FunctionTemplate> constructor, |
| bool do_not_cache) { |
| LOG_API(isolate, ObjectTemplate, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::Handle<i::Struct> struct_obj = |
| isolate->factory()->NewStruct(i::OBJECT_TEMPLATE_INFO_TYPE, i::TENURED); |
| i::Handle<i::ObjectTemplateInfo> obj = |
| i::Handle<i::ObjectTemplateInfo>::cast(struct_obj); |
| InitializeTemplate(obj, Consts::OBJECT_TEMPLATE); |
| int next_serial_number = 0; |
| if (!do_not_cache) { |
| next_serial_number = isolate->heap()->GetNextTemplateSerialNumber(); |
| } |
| obj->set_serial_number(i::Smi::FromInt(next_serial_number)); |
| if (!constructor.IsEmpty()) |
| obj->set_constructor(*Utils::OpenHandle(*constructor)); |
| obj->set_data(i::Smi::kZero); |
| return Utils::ToLocal(obj); |
| } |
| |
| Local<ObjectTemplate> ObjectTemplate::New( |
| i::Isolate* isolate, v8::Local<FunctionTemplate> constructor) { |
| return ObjectTemplateNew(isolate, constructor, false); |
| } |
| |
| MaybeLocal<ObjectTemplate> ObjectTemplate::FromSnapshot(Isolate* isolate, |
| size_t index) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| i::FixedArray* templates = i_isolate->heap()->serialized_templates(); |
| int int_index = static_cast<int>(index); |
| if (int_index < templates->length()) { |
| i::Object* info = templates->get(int_index); |
| if (info->IsObjectTemplateInfo()) { |
| return Utils::ToLocal( |
| i::Handle<i::ObjectTemplateInfo>(i::ObjectTemplateInfo::cast(info))); |
| } |
| } |
| return Local<ObjectTemplate>(); |
| } |
| |
| // Ensure that the object template has a constructor. If no |
| // constructor is available we create one. |
| static i::Handle<i::FunctionTemplateInfo> EnsureConstructor( |
| i::Isolate* isolate, |
| ObjectTemplate* object_template) { |
| i::Object* obj = Utils::OpenHandle(object_template)->constructor(); |
| if (!obj->IsUndefined(isolate)) { |
| i::FunctionTemplateInfo* info = i::FunctionTemplateInfo::cast(obj); |
| return i::Handle<i::FunctionTemplateInfo>(info, isolate); |
| } |
| Local<FunctionTemplate> templ = |
| FunctionTemplate::New(reinterpret_cast<Isolate*>(isolate)); |
| i::Handle<i::FunctionTemplateInfo> constructor = Utils::OpenHandle(*templ); |
| constructor->set_instance_template(*Utils::OpenHandle(object_template)); |
| Utils::OpenHandle(object_template)->set_constructor(*constructor); |
| return constructor; |
| } |
| |
| template <typename Getter, typename Setter, typename Data, typename Template> |
| static void TemplateSetAccessor(Template* template_obj, v8::Local<Name> name, |
| Getter getter, Setter setter, Data data, |
| AccessControl settings, |
| PropertyAttribute attribute, |
| v8::Local<AccessorSignature> signature, |
| bool is_special_data_property, |
| bool replace_on_access) { |
| auto info = Utils::OpenHandle(template_obj); |
| auto isolate = info->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| i::Handle<i::AccessorInfo> accessor_info = |
| MakeAccessorInfo(isolate, name, getter, setter, data, settings, signature, |
| is_special_data_property, replace_on_access); |
| accessor_info->set_initial_property_attributes( |
| static_cast<i::PropertyAttributes>(attribute)); |
| i::ApiNatives::AddNativeDataProperty(isolate, info, accessor_info); |
| } |
| |
| |
| void Template::SetNativeDataProperty(v8::Local<String> name, |
| AccessorGetterCallback getter, |
| AccessorSetterCallback setter, |
| v8::Local<Value> data, |
| PropertyAttribute attribute, |
| v8::Local<AccessorSignature> signature, |
| AccessControl settings) { |
| TemplateSetAccessor(this, name, getter, setter, data, settings, attribute, |
| signature, true, false); |
| } |
| |
| |
| void Template::SetNativeDataProperty(v8::Local<Name> name, |
| AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter, |
| v8::Local<Value> data, |
| PropertyAttribute attribute, |
| v8::Local<AccessorSignature> signature, |
| AccessControl settings) { |
| TemplateSetAccessor(this, name, getter, setter, data, settings, attribute, |
| signature, true, false); |
| } |
| |
| void Template::SetLazyDataProperty(v8::Local<Name> name, |
| AccessorNameGetterCallback getter, |
| v8::Local<Value> data, |
| PropertyAttribute attribute) { |
| TemplateSetAccessor( |
| this, name, getter, static_cast<AccessorNameSetterCallback>(nullptr), |
| data, DEFAULT, attribute, Local<AccessorSignature>(), true, true); |
| } |
| |
| void Template::SetIntrinsicDataProperty(Local<Name> name, Intrinsic intrinsic, |
| PropertyAttribute attribute) { |
| auto templ = Utils::OpenHandle(this); |
| i::Isolate* isolate = templ->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| i::ApiNatives::AddDataProperty(isolate, templ, Utils::OpenHandle(*name), |
| intrinsic, |
| static_cast<i::PropertyAttributes>(attribute)); |
| } |
| |
| |
| void ObjectTemplate::SetAccessor(v8::Local<String> name, |
| AccessorGetterCallback getter, |
| AccessorSetterCallback setter, |
| v8::Local<Value> data, AccessControl settings, |
| PropertyAttribute attribute, |
| v8::Local<AccessorSignature> signature) { |
| TemplateSetAccessor(this, name, getter, setter, data, settings, attribute, |
| signature, i::FLAG_disable_old_api_accessors, false); |
| } |
| |
| |
| void ObjectTemplate::SetAccessor(v8::Local<Name> name, |
| AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter, |
| v8::Local<Value> data, AccessControl settings, |
| PropertyAttribute attribute, |
| v8::Local<AccessorSignature> signature) { |
| TemplateSetAccessor(this, name, getter, setter, data, settings, attribute, |
| signature, i::FLAG_disable_old_api_accessors, false); |
| } |
| |
| template <typename Getter, typename Setter, typename Query, typename Descriptor, |
| typename Deleter, typename Enumerator, typename Definer> |
| static i::Handle<i::InterceptorInfo> CreateInterceptorInfo( |
| i::Isolate* isolate, Getter getter, Setter setter, Query query, |
| Descriptor descriptor, Deleter remover, Enumerator enumerator, |
| Definer definer, Local<Value> data, PropertyHandlerFlags flags) { |
| DCHECK(query == nullptr || |
| descriptor == nullptr); // Either intercept attributes or descriptor. |
| DCHECK(query == nullptr || |
| definer == |
| nullptr); // Only use descriptor callback with definer callback. |
| auto obj = i::Handle<i::InterceptorInfo>::cast( |
| isolate->factory()->NewStruct(i::INTERCEPTOR_INFO_TYPE, i::TENURED)); |
| obj->set_flags(0); |
| |
| if (getter != 0) SET_FIELD_WRAPPED(obj, set_getter, getter); |
| if (setter != 0) SET_FIELD_WRAPPED(obj, set_setter, setter); |
| if (query != 0) SET_FIELD_WRAPPED(obj, set_query, query); |
| if (descriptor != 0) SET_FIELD_WRAPPED(obj, set_descriptor, descriptor); |
| if (remover != 0) SET_FIELD_WRAPPED(obj, set_deleter, remover); |
| if (enumerator != 0) SET_FIELD_WRAPPED(obj, set_enumerator, enumerator); |
| if (definer != 0) SET_FIELD_WRAPPED(obj, set_definer, definer); |
| obj->set_can_intercept_symbols( |
| !(static_cast<int>(flags) & |
| static_cast<int>(PropertyHandlerFlags::kOnlyInterceptStrings))); |
| obj->set_all_can_read(static_cast<int>(flags) & |
| static_cast<int>(PropertyHandlerFlags::kAllCanRead)); |
| obj->set_non_masking(static_cast<int>(flags) & |
| static_cast<int>(PropertyHandlerFlags::kNonMasking)); |
| |
| if (data.IsEmpty()) { |
| data = v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| obj->set_data(*Utils::OpenHandle(*data)); |
| return obj; |
| } |
| |
| template <typename Getter, typename Setter, typename Query, typename Descriptor, |
| typename Deleter, typename Enumerator, typename Definer> |
| static void ObjectTemplateSetNamedPropertyHandler( |
| ObjectTemplate* templ, Getter getter, Setter setter, Query query, |
| Descriptor descriptor, Deleter remover, Enumerator enumerator, |
| Definer definer, Local<Value> data, PropertyHandlerFlags flags) { |
| i::Isolate* isolate = Utils::OpenHandle(templ)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| auto cons = EnsureConstructor(isolate, templ); |
| EnsureNotInstantiated(cons, "ObjectTemplateSetNamedPropertyHandler"); |
| auto obj = CreateInterceptorInfo(isolate, getter, setter, query, descriptor, |
| remover, enumerator, definer, data, flags); |
| cons->set_named_property_handler(*obj); |
| } |
| |
| void ObjectTemplate::SetNamedPropertyHandler( |
| NamedPropertyGetterCallback getter, NamedPropertySetterCallback setter, |
| NamedPropertyQueryCallback query, NamedPropertyDeleterCallback remover, |
| NamedPropertyEnumeratorCallback enumerator, Local<Value> data) { |
| ObjectTemplateSetNamedPropertyHandler( |
| this, getter, setter, query, nullptr, remover, enumerator, nullptr, data, |
| PropertyHandlerFlags::kOnlyInterceptStrings); |
| } |
| |
| void ObjectTemplate::SetHandler( |
| const NamedPropertyHandlerConfiguration& config) { |
| ObjectTemplateSetNamedPropertyHandler( |
| this, config.getter, config.setter, config.query, config.descriptor, |
| config.deleter, config.enumerator, config.definer, config.data, |
| config.flags); |
| } |
| |
| |
| void ObjectTemplate::MarkAsUndetectable() { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| auto cons = EnsureConstructor(isolate, this); |
| EnsureNotInstantiated(cons, "v8::ObjectTemplate::MarkAsUndetectable"); |
| cons->set_undetectable(true); |
| } |
| |
| |
| void ObjectTemplate::SetAccessCheckCallback(AccessCheckCallback callback, |
| Local<Value> data) { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| auto cons = EnsureConstructor(isolate, this); |
| EnsureNotInstantiated(cons, "v8::ObjectTemplate::SetAccessCheckCallback"); |
| |
| i::Handle<i::Struct> struct_info = |
| isolate->factory()->NewStruct(i::ACCESS_CHECK_INFO_TYPE, i::TENURED); |
| i::Handle<i::AccessCheckInfo> info = |
| i::Handle<i::AccessCheckInfo>::cast(struct_info); |
| |
| SET_FIELD_WRAPPED(info, set_callback, callback); |
| info->set_named_interceptor(nullptr); |
| info->set_indexed_interceptor(nullptr); |
| |
| if (data.IsEmpty()) { |
| data = v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| info->set_data(*Utils::OpenHandle(*data)); |
| |
| cons->set_access_check_info(*info); |
| cons->set_needs_access_check(true); |
| } |
| |
| void ObjectTemplate::SetAccessCheckCallbackAndHandler( |
| AccessCheckCallback callback, |
| const NamedPropertyHandlerConfiguration& named_handler, |
| const IndexedPropertyHandlerConfiguration& indexed_handler, |
| Local<Value> data) { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| auto cons = EnsureConstructor(isolate, this); |
| EnsureNotInstantiated( |
| cons, "v8::ObjectTemplate::SetAccessCheckCallbackWithHandler"); |
| |
| i::Handle<i::Struct> struct_info = |
| isolate->factory()->NewStruct(i::ACCESS_CHECK_INFO_TYPE, i::TENURED); |
| i::Handle<i::AccessCheckInfo> info = |
| i::Handle<i::AccessCheckInfo>::cast(struct_info); |
| |
| SET_FIELD_WRAPPED(info, set_callback, callback); |
| auto named_interceptor = CreateInterceptorInfo( |
| isolate, named_handler.getter, named_handler.setter, named_handler.query, |
| named_handler.descriptor, named_handler.deleter, named_handler.enumerator, |
| named_handler.definer, named_handler.data, named_handler.flags); |
| info->set_named_interceptor(*named_interceptor); |
| auto indexed_interceptor = CreateInterceptorInfo( |
| isolate, indexed_handler.getter, indexed_handler.setter, |
| indexed_handler.query, indexed_handler.descriptor, |
| indexed_handler.deleter, indexed_handler.enumerator, |
| indexed_handler.definer, indexed_handler.data, indexed_handler.flags); |
| info->set_indexed_interceptor(*indexed_interceptor); |
| |
| if (data.IsEmpty()) { |
| data = v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| info->set_data(*Utils::OpenHandle(*data)); |
| |
| cons->set_access_check_info(*info); |
| cons->set_needs_access_check(true); |
| } |
| |
| void ObjectTemplate::SetHandler( |
| const IndexedPropertyHandlerConfiguration& config) { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| auto cons = EnsureConstructor(isolate, this); |
| EnsureNotInstantiated(cons, "v8::ObjectTemplate::SetHandler"); |
| auto obj = CreateInterceptorInfo(isolate, config.getter, config.setter, |
| config.query, config.descriptor, |
| config.deleter, config.enumerator, |
| config.definer, config.data, config.flags); |
| cons->set_indexed_property_handler(*obj); |
| } |
| |
| |
| void ObjectTemplate::SetCallAsFunctionHandler(FunctionCallback callback, |
| Local<Value> data) { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| auto cons = EnsureConstructor(isolate, this); |
| EnsureNotInstantiated(cons, "v8::ObjectTemplate::SetCallAsFunctionHandler"); |
| i::Handle<i::Struct> struct_obj = |
| isolate->factory()->NewStruct(i::TUPLE3_TYPE, i::TENURED); |
| i::Handle<i::CallHandlerInfo> obj = |
| i::Handle<i::CallHandlerInfo>::cast(struct_obj); |
| SET_FIELD_WRAPPED(obj, set_callback, callback); |
| SET_FIELD_WRAPPED(obj, set_js_callback, obj->redirected_callback()); |
| if (data.IsEmpty()) { |
| data = v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| obj->set_data(*Utils::OpenHandle(*data)); |
| cons->set_instance_call_handler(*obj); |
| } |
| |
| int ObjectTemplate::InternalFieldCount() { |
| return Utils::OpenHandle(this)->embedder_field_count(); |
| } |
| |
| void ObjectTemplate::SetInternalFieldCount(int value) { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| if (!Utils::ApiCheck(i::Smi::IsValid(value), |
| "v8::ObjectTemplate::SetInternalFieldCount()", |
| "Invalid embedder field count")) { |
| return; |
| } |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| if (value > 0) { |
| // The embedder field count is set by the constructor function's |
| // construct code, so we ensure that there is a constructor |
| // function to do the setting. |
| EnsureConstructor(isolate, this); |
| } |
| Utils::OpenHandle(this)->set_embedder_field_count(value); |
| } |
| |
| bool ObjectTemplate::IsImmutableProto() { |
| return Utils::OpenHandle(this)->immutable_proto(); |
| } |
| |
| void ObjectTemplate::SetImmutableProto() { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| Utils::OpenHandle(this)->set_immutable_proto(true); |
| } |
| |
| // --- S c r i p t s --- |
| |
| |
| // Internally, UnboundScript is a SharedFunctionInfo, and Script is a |
| // JSFunction. |
| |
| ScriptCompiler::CachedData::CachedData(const uint8_t* data_, int length_, |
| BufferPolicy buffer_policy_) |
| : data(data_), |
| length(length_), |
| rejected(false), |
| buffer_policy(buffer_policy_) {} |
| |
| |
| ScriptCompiler::CachedData::~CachedData() { |
| if (buffer_policy == BufferOwned) { |
| delete[] data; |
| } |
| } |
| |
| |
| bool ScriptCompiler::ExternalSourceStream::SetBookmark() { return false; } |
| |
| |
| void ScriptCompiler::ExternalSourceStream::ResetToBookmark() { UNREACHABLE(); } |
| |
| |
| ScriptCompiler::StreamedSource::StreamedSource(ExternalSourceStream* stream, |
| Encoding encoding) |
| : impl_(new i::StreamedSource(stream, encoding)) {} |
| |
| |
| ScriptCompiler::StreamedSource::~StreamedSource() { delete impl_; } |
| |
| |
| const ScriptCompiler::CachedData* |
| ScriptCompiler::StreamedSource::GetCachedData() const { |
| return impl_->cached_data.get(); |
| } |
| |
| |
| Local<Script> UnboundScript::BindToCurrentContext() { |
| i::Handle<i::HeapObject> obj = |
| i::Handle<i::HeapObject>::cast(Utils::OpenHandle(this)); |
| i::Isolate* isolate = obj->GetIsolate(); |
| i::Handle<i::SharedFunctionInfo> function_info( |
| i::SharedFunctionInfo::cast(*obj), isolate); |
| i::Handle<i::JSFunction> function = |
| isolate->factory()->NewFunctionFromSharedFunctionInfo( |
| function_info, isolate->native_context()); |
| return ToApiHandle<Script>(function); |
| } |
| |
| |
| int UnboundScript::GetId() { |
| i::Handle<i::HeapObject> obj = |
| i::Handle<i::HeapObject>::cast(Utils::OpenHandle(this)); |
| i::Isolate* isolate = obj->GetIsolate(); |
| LOG_API(isolate, UnboundScript, GetId); |
| i::HandleScope scope(isolate); |
| i::Handle<i::SharedFunctionInfo> function_info( |
| i::SharedFunctionInfo::cast(*obj)); |
| i::Handle<i::Script> script(i::Script::cast(function_info->script())); |
| return script->id(); |
| } |
| |
| |
| int UnboundScript::GetLineNumber(int code_pos) { |
| i::Handle<i::SharedFunctionInfo> obj = |
| i::Handle<i::SharedFunctionInfo>::cast(Utils::OpenHandle(this)); |
| i::Isolate* isolate = obj->GetIsolate(); |
| LOG_API(isolate, UnboundScript, GetLineNumber); |
| if (obj->script()->IsScript()) { |
| i::Handle<i::Script> script(i::Script::cast(obj->script())); |
| return i::Script::GetLineNumber(script, code_pos); |
| } else { |
| return -1; |
| } |
| } |
| |
| |
| Local<Value> UnboundScript::GetScriptName() { |
| i::Handle<i::SharedFunctionInfo> obj = |
| i::Handle<i::SharedFunctionInfo>::cast(Utils::OpenHandle(this)); |
| i::Isolate* isolate = obj->GetIsolate(); |
| LOG_API(isolate, UnboundScript, GetName); |
| if (obj->script()->IsScript()) { |
| i::Object* name = i::Script::cast(obj->script())->name(); |
| return Utils::ToLocal(i::Handle<i::Object>(name, isolate)); |
| } else { |
| return Local<String>(); |
| } |
| } |
| |
| |
| Local<Value> UnboundScript::GetSourceURL() { |
| i::Handle<i::SharedFunctionInfo> obj = |
| i::Handle<i::SharedFunctionInfo>::cast(Utils::OpenHandle(this)); |
| i::Isolate* isolate = obj->GetIsolate(); |
| LOG_API(isolate, UnboundScript, GetSourceURL); |
| if (obj->script()->IsScript()) { |
| i::Object* url = i::Script::cast(obj->script())->source_url(); |
| return Utils::ToLocal(i::Handle<i::Object>(url, isolate)); |
| } else { |
| return Local<String>(); |
| } |
| } |
| |
| |
| Local<Value> UnboundScript::GetSourceMappingURL() { |
| i::Handle<i::SharedFunctionInfo> obj = |
| i::Handle<i::SharedFunctionInfo>::cast(Utils::OpenHandle(this)); |
| i::Isolate* isolate = obj->GetIsolate(); |
| LOG_API(isolate, UnboundScript, GetSourceMappingURL); |
| if (obj->script()->IsScript()) { |
| i::Object* url = i::Script::cast(obj->script())->source_mapping_url(); |
| return Utils::ToLocal(i::Handle<i::Object>(url, isolate)); |
| } else { |
| return Local<String>(); |
| } |
| } |
| |
| |
| MaybeLocal<Value> Script::Run(Local<Context> context) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.Execute"); |
| ENTER_V8(isolate, context, Script, Run, MaybeLocal<Value>(), |
| InternalEscapableScope); |
| i::HistogramTimerScope execute_timer(isolate->counters()->execute(), true); |
| i::AggregatingHistogramTimerScope timer(isolate->counters()->compile_lazy()); |
| i::TimerEventScope<i::TimerEventExecute> timer_scope(isolate); |
| auto fun = i::Handle<i::JSFunction>::cast(Utils::OpenHandle(this)); |
| |
| i::Handle<i::Object> receiver = isolate->global_proxy(); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>( |
| i::Execution::Call(isolate, fun, receiver, 0, nullptr), &result); |
| |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<Value> Script::Run() { |
| auto self = Utils::OpenHandle(this, true); |
| // If execution is terminating, Compile(..)->Run() requires this |
| // check. |
| if (self.is_null()) return Local<Value>(); |
| auto context = ContextFromHeapObject(self); |
| RETURN_TO_LOCAL_UNCHECKED(Run(context), Value); |
| } |
| |
| Local<Value> ScriptOrModule::GetResourceName() { |
| i::Handle<i::Script> obj = Utils::OpenHandle(this); |
| i::Isolate* isolate = obj->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::Handle<i::Object> val(obj->name(), isolate); |
| return ToApiHandle<Value>(val); |
| } |
| |
| Local<PrimitiveArray> ScriptOrModule::GetHostDefinedOptions() { |
| i::Handle<i::Script> obj = Utils::OpenHandle(this); |
| i::Isolate* isolate = obj->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::Handle<i::FixedArray> val(obj->host_defined_options(), isolate); |
| return ToApiHandle<PrimitiveArray>(val); |
| } |
| |
| Local<UnboundScript> Script::GetUnboundScript() { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| return ToApiHandle<UnboundScript>( |
| i::Handle<i::SharedFunctionInfo>(i::JSFunction::cast(*obj)->shared())); |
| } |
| |
| // static |
| Local<PrimitiveArray> PrimitiveArray::New(Isolate* v8_isolate, int length) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| Utils::ApiCheck(length >= 0, "v8::PrimitiveArray::New", |
| "length must be equal or greater than zero"); |
| i::Handle<i::FixedArray> array = isolate->factory()->NewFixedArray(length); |
| return ToApiHandle<PrimitiveArray>(array); |
| } |
| |
| int PrimitiveArray::Length() const { |
| i::Handle<i::FixedArray> array = Utils::OpenHandle(this); |
| i::Isolate* isolate = array->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| return array->length(); |
| } |
| |
| void PrimitiveArray::Set(int index, Local<Primitive> item) { |
| i::Handle<i::FixedArray> array = Utils::OpenHandle(this); |
| i::Isolate* isolate = array->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| Utils::ApiCheck(index >= 0 && index < array->length(), |
| "v8::PrimitiveArray::Set", |
| "index must be greater than or equal to 0 and less than the " |
| "array length"); |
| i::Handle<i::Object> i_item = Utils::OpenHandle(*item); |
| array->set(index, *i_item); |
| } |
| |
| Local<Primitive> PrimitiveArray::Get(int index) { |
| i::Handle<i::FixedArray> array = Utils::OpenHandle(this); |
| i::Isolate* isolate = array->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| Utils::ApiCheck(index >= 0 && index < array->length(), |
| "v8::PrimitiveArray::Get", |
| "index must be greater than or equal to 0 and less than the " |
| "array length"); |
| i::Handle<i::Object> i_item(array->get(index), isolate); |
| return ToApiHandle<Primitive>(i_item); |
| } |
| |
| Module::Status Module::GetStatus() const { |
| i::Handle<i::Module> self = Utils::OpenHandle(this); |
| switch (self->status()) { |
| case i::Module::kUninstantiated: |
| case i::Module::kPreInstantiating: |
| return kUninstantiated; |
| case i::Module::kInstantiating: |
| return kInstantiating; |
| case i::Module::kInstantiated: |
| return kInstantiated; |
| case i::Module::kEvaluating: |
| return kEvaluating; |
| case i::Module::kEvaluated: |
| return kEvaluated; |
| case i::Module::kErrored: |
| return kErrored; |
| } |
| UNREACHABLE(); |
| } |
| |
| Local<Value> Module::GetException() const { |
| Utils::ApiCheck(GetStatus() == kErrored, "v8::Module::GetException", |
| "Module status must be kErrored"); |
| i::Handle<i::Module> self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| return ToApiHandle<Value>(i::handle(self->GetException(), isolate)); |
| } |
| |
| int Module::GetModuleRequestsLength() const { |
| i::Handle<i::Module> self = Utils::OpenHandle(this); |
| return self->info()->module_requests()->length(); |
| } |
| |
| Local<String> Module::GetModuleRequest(int i) const { |
| CHECK_GE(i, 0); |
| i::Handle<i::Module> self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| i::Handle<i::FixedArray> module_requests(self->info()->module_requests(), |
| isolate); |
| CHECK_LT(i, module_requests->length()); |
| return ToApiHandle<String>(i::handle(module_requests->get(i), isolate)); |
| } |
| |
| Location Module::GetModuleRequestLocation(int i) const { |
| CHECK_GE(i, 0); |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| i::HandleScope scope(isolate); |
| i::Handle<i::Module> self = Utils::OpenHandle(this); |
| i::Handle<i::FixedArray> module_request_positions( |
| self->info()->module_request_positions(), isolate); |
| CHECK_LT(i, module_request_positions->length()); |
| int position = i::Smi::ToInt(module_request_positions->get(i)); |
| i::Handle<i::Script> script(self->script(), isolate); |
| i::Script::PositionInfo info; |
| i::Script::GetPositionInfo(script, position, &info, i::Script::WITH_OFFSET); |
| return v8::Location(info.line, info.column); |
| } |
| |
| Local<Value> Module::GetModuleNamespace() { |
| Utils::ApiCheck( |
| GetStatus() == kEvaluated, "v8::Module::GetModuleNamespace", |
| "v8::Module::GetModuleNamespace can only be used on a module with " |
| "status kEvaluated"); |
| i::Handle<i::Module> self = Utils::OpenHandle(this); |
| i::Handle<i::JSModuleNamespace> module_namespace = |
| i::Module::GetModuleNamespace(self); |
| return ToApiHandle<Value>(module_namespace); |
| } |
| |
| int Module::GetIdentityHash() const { return Utils::OpenHandle(this)->hash(); } |
| |
| bool Module::Instantiate(Local<Context> context, |
| Module::ResolveCallback callback) { |
| return InstantiateModule(context, callback).FromMaybe(false); |
| } |
| |
| Maybe<bool> Module::InstantiateModule(Local<Context> context, |
| Module::ResolveCallback callback) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Module, InstantiateModule, Nothing<bool>(), |
| i::HandleScope); |
| has_pending_exception = |
| !i::Module::Instantiate(Utils::OpenHandle(this), context, callback); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(true); |
| } |
| |
| MaybeLocal<Value> Module::Evaluate(Local<Context> context) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.Execute"); |
| ENTER_V8(isolate, context, Module, Evaluate, MaybeLocal<Value>(), |
| InternalEscapableScope); |
| i::HistogramTimerScope execute_timer(isolate->counters()->execute(), true); |
| i::AggregatingHistogramTimerScope timer(isolate->counters()->compile_lazy()); |
| i::TimerEventScope<i::TimerEventExecute> timer_scope(isolate); |
| |
| i::Handle<i::Module> self = Utils::OpenHandle(this); |
| // It's an API error to call Evaluate before Instantiate. |
| CHECK_GE(self->status(), i::Module::kInstantiated); |
| |
| Local<Value> result; |
| has_pending_exception = !ToLocal(i::Module::Evaluate(self), &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| MaybeLocal<UnboundScript> ScriptCompiler::CompileUnboundInternal( |
| Isolate* v8_isolate, Source* source, CompileOptions options, |
| NoCacheReason no_cache_reason) { |
| auto isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.ScriptCompiler"); |
| ENTER_V8_NO_SCRIPT(isolate, v8_isolate->GetCurrentContext(), ScriptCompiler, |
| CompileUnbound, MaybeLocal<UnboundScript>(), |
| InternalEscapableScope); |
| bool produce_cache = options == kProduceParserCache || |
| options == kProduceCodeCache || |
| options == kProduceFullCodeCache; |
| |
| // Don't try to produce any kind of cache when the debugger is loaded. |
| if (isolate->debug()->is_loaded() && produce_cache) { |
| options = kNoCompileOptions; |
| } |
| |
| i::ScriptData* script_data = nullptr; |
| if (options == kConsumeParserCache || options == kConsumeCodeCache) { |
| DCHECK(source->cached_data); |
| // ScriptData takes care of pointer-aligning the data. |
| script_data = new i::ScriptData(source->cached_data->data, |
| source->cached_data->length); |
| } |
| |
| i::Handle<i::String> str = Utils::OpenHandle(*(source->source_string)); |
| i::Handle<i::SharedFunctionInfo> result; |
| TRACE_EVENT0(TRACE_DISABLED_BY_DEFAULT("v8.compile"), "V8.CompileScript"); |
| i::MaybeHandle<i::Object> name_obj; |
| i::MaybeHandle<i::Object> source_map_url; |
| i::MaybeHandle<i::FixedArray> host_defined_options = |
| isolate->factory()->empty_fixed_array(); |
| int line_offset = 0; |
| int column_offset = 0; |
| if (!source->resource_name.IsEmpty()) { |
| name_obj = Utils::OpenHandle(*(source->resource_name)); |
| } |
| if (!source->host_defined_options.IsEmpty()) { |
| host_defined_options = Utils::OpenHandle(*(source->host_defined_options)); |
| } |
| if (!source->resource_line_offset.IsEmpty()) { |
| line_offset = static_cast<int>(source->resource_line_offset->Value()); |
| } |
| if (!source->resource_column_offset.IsEmpty()) { |
| column_offset = static_cast<int>(source->resource_column_offset->Value()); |
| } |
| if (!source->source_map_url.IsEmpty()) { |
| source_map_url = Utils::OpenHandle(*(source->source_map_url)); |
| } |
| i::MaybeHandle<i::SharedFunctionInfo> maybe_function_info = |
| i::Compiler::GetSharedFunctionInfoForScript( |
| str, name_obj, line_offset, column_offset, source->resource_options, |
| source_map_url, isolate->native_context(), nullptr, &script_data, |
| options, no_cache_reason, i::NOT_NATIVES_CODE, host_defined_options); |
| has_pending_exception = !maybe_function_info.ToHandle(&result); |
| if (has_pending_exception && script_data != nullptr) { |
| // This case won't happen during normal operation; we have compiled |
| // successfully and produced cached data, and but the second compilation |
| // of the same source code fails. |
| delete script_data; |
| script_data = nullptr; |
| } |
| RETURN_ON_FAILED_EXECUTION(UnboundScript); |
| |
| if (produce_cache && script_data != nullptr) { |
| // script_data now contains the data that was generated. source will |
| // take the ownership. |
| source->cached_data = new CachedData( |
| script_data->data(), script_data->length(), CachedData::BufferOwned); |
| script_data->ReleaseDataOwnership(); |
| } else if (options == kConsumeParserCache || options == kConsumeCodeCache) { |
| source->cached_data->rejected = script_data->rejected(); |
| } |
| delete script_data; |
| RETURN_ESCAPED(ToApiHandle<UnboundScript>(result)); |
| } |
| |
| MaybeLocal<UnboundScript> ScriptCompiler::CompileUnboundScript( |
| Isolate* v8_isolate, Source* source, CompileOptions options, |
| NoCacheReason no_cache_reason) { |
| Utils::ApiCheck( |
| !source->GetResourceOptions().IsModule(), |
| "v8::ScriptCompiler::CompileUnboundScript", |
| "v8::ScriptCompiler::CompileModule must be used to compile modules"); |
| return CompileUnboundInternal(v8_isolate, source, options, no_cache_reason); |
| } |
| |
| Local<UnboundScript> ScriptCompiler::CompileUnbound( |
| Isolate* v8_isolate, Source* source, CompileOptions options, |
| NoCacheReason no_cache_reason) { |
| Utils::ApiCheck( |
| !source->GetResourceOptions().IsModule(), |
| "v8::ScriptCompiler::CompileUnbound", |
| "v8::ScriptCompiler::CompileModule must be used to compile modules"); |
| RETURN_TO_LOCAL_UNCHECKED( |
| CompileUnboundInternal(v8_isolate, source, options, no_cache_reason), |
| UnboundScript); |
| } |
| |
| MaybeLocal<Script> ScriptCompiler::Compile(Local<Context> context, |
| Source* source, |
| CompileOptions options, |
| NoCacheReason no_cache_reason) { |
| Utils::ApiCheck( |
| !source->GetResourceOptions().IsModule(), "v8::ScriptCompiler::Compile", |
| "v8::ScriptCompiler::CompileModule must be used to compile modules"); |
| auto isolate = context->GetIsolate(); |
| auto maybe = |
| CompileUnboundInternal(isolate, source, options, no_cache_reason); |
| Local<UnboundScript> result; |
| if (!maybe.ToLocal(&result)) return MaybeLocal<Script>(); |
| v8::Context::Scope scope(context); |
| return result->BindToCurrentContext(); |
| } |
| |
| Local<Script> ScriptCompiler::Compile(Isolate* v8_isolate, Source* source, |
| CompileOptions options, |
| NoCacheReason no_cache_reason) { |
| auto context = v8_isolate->GetCurrentContext(); |
| RETURN_TO_LOCAL_UNCHECKED(Compile(context, source, options), Script); |
| } |
| |
| MaybeLocal<Module> ScriptCompiler::CompileModule(Isolate* isolate, |
| Source* source) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| |
| Utils::ApiCheck(source->GetResourceOptions().IsModule(), |
| "v8::ScriptCompiler::CompileModule", |
| "Invalid ScriptOrigin: is_module must be true"); |
| auto maybe = CompileUnboundInternal(isolate, source, kNoCompileOptions, |
| kNoCacheBecauseModule); |
| Local<UnboundScript> unbound; |
| if (!maybe.ToLocal(&unbound)) return MaybeLocal<Module>(); |
| |
| i::Handle<i::SharedFunctionInfo> shared = Utils::OpenHandle(*unbound); |
| return ToApiHandle<Module>(i_isolate->factory()->NewModule(shared)); |
| } |
| |
| |
| class IsIdentifierHelper { |
| public: |
| IsIdentifierHelper() : is_identifier_(false), first_char_(true) {} |
| |
| bool Check(i::String* string) { |
| i::ConsString* cons_string = i::String::VisitFlat(this, string, 0); |
| if (cons_string == nullptr) return is_identifier_; |
| // We don't support cons strings here. |
| return false; |
| } |
| void VisitOneByteString(const uint8_t* chars, int length) { |
| for (int i = 0; i < length; ++i) { |
| if (first_char_) { |
| first_char_ = false; |
| is_identifier_ = unicode_cache_.IsIdentifierStart(chars[0]); |
| } else { |
| is_identifier_ &= unicode_cache_.IsIdentifierPart(chars[i]); |
| } |
| } |
| } |
| void VisitTwoByteString(const uint16_t* chars, int length) { |
| for (int i = 0; i < length; ++i) { |
| if (first_char_) { |
| first_char_ = false; |
| is_identifier_ = unicode_cache_.IsIdentifierStart(chars[0]); |
| } else { |
| is_identifier_ &= unicode_cache_.IsIdentifierPart(chars[i]); |
| } |
| } |
| } |
| |
| private: |
| bool is_identifier_; |
| bool first_char_; |
| i::UnicodeCache unicode_cache_; |
| DISALLOW_COPY_AND_ASSIGN(IsIdentifierHelper); |
| }; |
| |
| |
| MaybeLocal<Function> ScriptCompiler::CompileFunctionInContext( |
| Local<Context> v8_context, Source* source, size_t arguments_count, |
| Local<String> arguments[], size_t context_extension_count, |
| Local<Object> context_extensions[]) { |
| PREPARE_FOR_EXECUTION(v8_context, ScriptCompiler, CompileFunctionInContext, |
| Function); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.ScriptCompiler"); |
| i::Handle<i::String> source_string; |
| auto factory = isolate->factory(); |
| if (arguments_count) { |
| source_string = factory->NewStringFromStaticChars("(function("); |
| for (size_t i = 0; i < arguments_count; ++i) { |
| IsIdentifierHelper helper; |
| if (!helper.Check(*Utils::OpenHandle(*arguments[i]))) { |
| return Local<Function>(); |
| } |
| has_pending_exception = |
| !factory->NewConsString(source_string, |
| Utils::OpenHandle(*arguments[i])) |
| .ToHandle(&source_string); |
| RETURN_ON_FAILED_EXECUTION(Function); |
| if (i + 1 == arguments_count) continue; |
| has_pending_exception = |
| !factory->NewConsString(source_string, |
| factory->LookupSingleCharacterStringFromCode( |
| ',')).ToHandle(&source_string); |
| RETURN_ON_FAILED_EXECUTION(Function); |
| } |
| i::Handle<i::String> brackets; |
| brackets = factory->NewStringFromStaticChars("){"); |
| has_pending_exception = !factory->NewConsString(source_string, brackets) |
| .ToHandle(&source_string); |
| RETURN_ON_FAILED_EXECUTION(Function); |
| } else { |
| source_string = factory->NewStringFromStaticChars("(function(){"); |
| } |
| |
| int scope_position = source_string->length(); |
| has_pending_exception = |
| !factory->NewConsString(source_string, |
| Utils::OpenHandle(*source->source_string)) |
| .ToHandle(&source_string); |
| RETURN_ON_FAILED_EXECUTION(Function); |
| // Include \n in case the source contains a line end comment. |
| auto brackets = factory->NewStringFromStaticChars("\n})"); |
| has_pending_exception = |
| !factory->NewConsString(source_string, brackets).ToHandle(&source_string); |
| RETURN_ON_FAILED_EXECUTION(Function); |
| |
| i::Handle<i::Context> context = Utils::OpenHandle(*v8_context); |
| i::Handle<i::SharedFunctionInfo> outer_info(context->closure()->shared(), |
| isolate); |
| for (size_t i = 0; i < context_extension_count; ++i) { |
| i::Handle<i::JSReceiver> extension = |
| Utils::OpenHandle(*context_extensions[i]); |
| if (!extension->IsJSObject()) return Local<Function>(); |
| i::Handle<i::JSFunction> closure(context->closure(), isolate); |
| context = factory->NewWithContext( |
| closure, context, |
| i::ScopeInfo::CreateForWithScope( |
| isolate, context->IsNativeContext() |
| ? i::Handle<i::ScopeInfo>::null() |
| : i::Handle<i::ScopeInfo>(context->scope_info())), |
| extension); |
| } |
| |
| i::Handle<i::Object> name_obj; |
| int eval_scope_position = 0; |
| int eval_position = i::kNoSourcePosition; |
| int line_offset = 0; |
| int column_offset = 0; |
| if (!source->resource_name.IsEmpty()) { |
| name_obj = Utils::OpenHandle(*(source->resource_name)); |
| } |
| if (!source->resource_line_offset.IsEmpty()) { |
| line_offset = static_cast<int>(source->resource_line_offset->Value()); |
| } |
| if (!source->resource_column_offset.IsEmpty()) { |
| column_offset = static_cast<int>(source->resource_column_offset->Value()); |
| } |
| i::Handle<i::JSFunction> fun; |
| has_pending_exception = |
| !i::Compiler::GetFunctionFromEval( |
| source_string, outer_info, context, i::LanguageMode::kSloppy, |
| i::ONLY_SINGLE_FUNCTION_LITERAL, i::kNoSourcePosition, |
| eval_scope_position, eval_position, line_offset, |
| column_offset - scope_position, name_obj, source->resource_options) |
| .ToHandle(&fun); |
| if (has_pending_exception) { |
| isolate->ReportPendingMessages(); |
| } |
| RETURN_ON_FAILED_EXECUTION(Function); |
| |
| i::Handle<i::Object> result; |
| has_pending_exception = |
| !i::Execution::Call(isolate, fun, |
| Utils::OpenHandle(*v8_context->Global()), 0, |
| nullptr).ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(Function); |
| RETURN_ESCAPED( |
| Utils::CallableToLocal(i::Handle<i::JSFunction>::cast(result))); |
| } |
| |
| |
| Local<Function> ScriptCompiler::CompileFunctionInContext( |
| Isolate* v8_isolate, Source* source, Local<Context> v8_context, |
| size_t arguments_count, Local<String> arguments[], |
| size_t context_extension_count, Local<Object> context_extensions[]) { |
| RETURN_TO_LOCAL_UNCHECKED( |
| CompileFunctionInContext(v8_context, source, arguments_count, arguments, |
| context_extension_count, context_extensions), |
| Function); |
| } |
| |
| |
| ScriptCompiler::ScriptStreamingTask* ScriptCompiler::StartStreamingScript( |
| Isolate* v8_isolate, StreamedSource* source, CompileOptions options) { |
| if (!i::FLAG_script_streaming) { |
| return nullptr; |
| } |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| return new i::BackgroundParsingTask(source->impl(), options, |
| i::FLAG_stack_size, isolate); |
| } |
| |
| |
| MaybeLocal<Script> ScriptCompiler::Compile(Local<Context> context, |
| StreamedSource* v8_source, |
| Local<String> full_source_string, |
| const ScriptOrigin& origin) { |
| PREPARE_FOR_EXECUTION(context, ScriptCompiler, Compile, Script); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.ScriptCompiler"); |
| i::StreamedSource* source = v8_source->impl(); |
| i::Handle<i::String> str = Utils::OpenHandle(*(full_source_string)); |
| i::Handle<i::Script> script = isolate->factory()->NewScript(str); |
| if (!origin.ResourceName().IsEmpty()) { |
| script->set_name(*Utils::OpenHandle(*(origin.ResourceName()))); |
| } |
| if (!origin.HostDefinedOptions().IsEmpty()) { |
| script->set_host_defined_options( |
| *Utils::OpenHandle(*(origin.HostDefinedOptions()))); |
| } |
| if (!origin.ResourceLineOffset().IsEmpty()) { |
| script->set_line_offset( |
| static_cast<int>(origin.ResourceLineOffset()->Value())); |
| } |
| if (!origin.ResourceColumnOffset().IsEmpty()) { |
| script->set_column_offset( |
| static_cast<int>(origin.ResourceColumnOffset()->Value())); |
| } |
| script->set_origin_options(origin.Options()); |
| if (!origin.SourceMapUrl().IsEmpty()) { |
| script->set_source_mapping_url( |
| *Utils::OpenHandle(*(origin.SourceMapUrl()))); |
| } |
| |
| source->info->set_script(script); |
| source->parser->UpdateStatistics(isolate, script); |
| source->info->UpdateBackgroundParseStatisticsOnMainThread(isolate); |
| source->parser->HandleSourceURLComments(isolate, script); |
| |
| i::Handle<i::SharedFunctionInfo> result; |
| if (source->info->literal() == nullptr) { |
| // Parsing has failed - report error messages. |
| source->info->pending_error_handler()->ReportErrors( |
| isolate, script, source->info->ast_value_factory()); |
| } else { |
| // Parsing has succeeded - finalize compile. |
| if (i::FLAG_background_compile) { |
| result = i::Compiler::GetSharedFunctionInfoForBackgroundCompile( |
| script, source->info.get(), str->length(), |
| source->outer_function_job.get(), &source->inner_function_jobs); |
| } else { |
| result = i::Compiler::GetSharedFunctionInfoForStreamedScript( |
| script, source->info.get(), str->length()); |
| } |
| } |
| has_pending_exception = result.is_null(); |
| if (has_pending_exception) isolate->ReportPendingMessages(); |
| |
| source->Release(); |
| |
| RETURN_ON_FAILED_EXECUTION(Script); |
| |
| Local<UnboundScript> generic = ToApiHandle<UnboundScript>(result); |
| if (generic.IsEmpty()) return Local<Script>(); |
| Local<Script> bound = generic->BindToCurrentContext(); |
| if (bound.IsEmpty()) return Local<Script>(); |
| RETURN_ESCAPED(bound); |
| } |
| |
| |
| Local<Script> ScriptCompiler::Compile(Isolate* v8_isolate, |
| StreamedSource* v8_source, |
| Local<String> full_source_string, |
| const ScriptOrigin& origin) { |
| auto context = v8_isolate->GetCurrentContext(); |
| RETURN_TO_LOCAL_UNCHECKED( |
| Compile(context, v8_source, full_source_string, origin), Script); |
| } |
| |
| |
| uint32_t ScriptCompiler::CachedDataVersionTag() { |
| return static_cast<uint32_t>(base::hash_combine( |
| internal::Version::Hash(), internal::FlagList::Hash(), |
| static_cast<uint32_t>(internal::CpuFeatures::SupportedFeatures()))); |
| } |
| |
| |
| MaybeLocal<Script> Script::Compile(Local<Context> context, Local<String> source, |
| ScriptOrigin* origin) { |
| if (origin) { |
| ScriptCompiler::Source script_source(source, *origin); |
| return ScriptCompiler::Compile(context, &script_source); |
| } |
| ScriptCompiler::Source script_source(source); |
| return ScriptCompiler::Compile(context, &script_source); |
| } |
| |
| |
| Local<Script> Script::Compile(v8::Local<String> source, |
| v8::ScriptOrigin* origin) { |
| auto str = Utils::OpenHandle(*source); |
| auto context = ContextFromHeapObject(str); |
| RETURN_TO_LOCAL_UNCHECKED(Compile(context, source, origin), Script); |
| } |
| |
| |
| Local<Script> Script::Compile(v8::Local<String> source, |
| v8::Local<String> file_name) { |
| auto str = Utils::OpenHandle(*source); |
| auto context = ContextFromHeapObject(str); |
| ScriptOrigin origin(file_name); |
| return Compile(context, source, &origin).FromMaybe(Local<Script>()); |
| } |
| |
| |
| // --- E x c e p t i o n s --- |
| |
| |
| v8::TryCatch::TryCatch() |
| : isolate_(i::Isolate::Current()), |
| next_(isolate_->try_catch_handler()), |
| is_verbose_(false), |
| can_continue_(true), |
| capture_message_(true), |
| rethrow_(false), |
| has_terminated_(false) { |
| ResetInternal(); |
| // Special handling for simulators which have a separate JS stack. |
| js_stack_comparable_address_ = |
| reinterpret_cast<void*>(i::SimulatorStack::RegisterCTryCatch( |
| isolate_, i::GetCurrentStackPosition())); |
| isolate_->RegisterTryCatchHandler(this); |
| } |
| |
| |
| v8::TryCatch::TryCatch(v8::Isolate* isolate) |
| : isolate_(reinterpret_cast<i::Isolate*>(isolate)), |
| next_(isolate_->try_catch_handler()), |
| is_verbose_(false), |
| can_continue_(true), |
| capture_message_(true), |
| rethrow_(false), |
| has_terminated_(false) { |
| ResetInternal(); |
| // Special handling for simulators which have a separate JS stack. |
| js_stack_comparable_address_ = |
| reinterpret_cast<void*>(i::SimulatorStack::RegisterCTryCatch( |
| isolate_, i::GetCurrentStackPosition())); |
| isolate_->RegisterTryCatchHandler(this); |
| } |
| |
| |
| v8::TryCatch::~TryCatch() { |
| if (rethrow_) { |
| v8::Isolate* isolate = reinterpret_cast<Isolate*>(isolate_); |
| v8::HandleScope scope(isolate); |
| v8::Local<v8::Value> exc = v8::Local<v8::Value>::New(isolate, Exception()); |
| if (HasCaught() && capture_message_) { |
| // If an exception was caught and rethrow_ is indicated, the saved |
| // message, script, and location need to be restored to Isolate TLS |
| // for reuse. capture_message_ needs to be disabled so that Throw() |
| // does not create a new message. |
| isolate_->thread_local_top()->rethrowing_message_ = true; |
| isolate_->RestorePendingMessageFromTryCatch(this); |
| } |
| isolate_->UnregisterTryCatchHandler(this); |
| i::SimulatorStack::UnregisterCTryCatch(isolate_); |
| reinterpret_cast<Isolate*>(isolate_)->ThrowException(exc); |
| DCHECK(!isolate_->thread_local_top()->rethrowing_message_); |
| } else { |
| if (HasCaught() && isolate_->has_scheduled_exception()) { |
| // If an exception was caught but is still scheduled because no API call |
| // promoted it, then it is canceled to prevent it from being propagated. |
| // Note that this will not cancel termination exceptions. |
| isolate_->CancelScheduledExceptionFromTryCatch(this); |
| } |
| isolate_->UnregisterTryCatchHandler(this); |
| i::SimulatorStack::UnregisterCTryCatch(isolate_); |
| } |
| } |
| |
| void* v8::TryCatch::operator new(size_t) { base::OS::Abort(); } |
| void* v8::TryCatch::operator new[](size_t) { base::OS::Abort(); } |
| void v8::TryCatch::operator delete(void*, size_t) { base::OS::Abort(); } |
| void v8::TryCatch::operator delete[](void*, size_t) { base::OS::Abort(); } |
| |
| bool v8::TryCatch::HasCaught() const { |
| return !reinterpret_cast<i::Object*>(exception_)->IsTheHole(isolate_); |
| } |
| |
| |
| bool v8::TryCatch::CanContinue() const { |
| return can_continue_; |
| } |
| |
| |
| bool v8::TryCatch::HasTerminated() const { |
| return has_terminated_; |
| } |
| |
| |
| v8::Local<v8::Value> v8::TryCatch::ReThrow() { |
| if (!HasCaught()) return v8::Local<v8::Value>(); |
| rethrow_ = true; |
| return v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate_)); |
| } |
| |
| |
| v8::Local<Value> v8::TryCatch::Exception() const { |
| if (HasCaught()) { |
| // Check for out of memory exception. |
| i::Object* exception = reinterpret_cast<i::Object*>(exception_); |
| return v8::Utils::ToLocal(i::Handle<i::Object>(exception, isolate_)); |
| } else { |
| return v8::Local<Value>(); |
| } |
| } |
| |
| |
| MaybeLocal<Value> v8::TryCatch::StackTrace(Local<Context> context) const { |
| if (!HasCaught()) return v8::Local<Value>(); |
| i::Object* raw_obj = reinterpret_cast<i::Object*>(exception_); |
| if (!raw_obj->IsJSObject()) return v8::Local<Value>(); |
| PREPARE_FOR_EXECUTION(context, TryCatch, StackTrace, Value); |
| i::Handle<i::JSObject> obj(i::JSObject::cast(raw_obj), isolate_); |
| i::Handle<i::String> name = isolate->factory()->stack_string(); |
| Maybe<bool> maybe = i::JSReceiver::HasProperty(obj, name); |
| has_pending_exception = maybe.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| if (!maybe.FromJust()) return v8::Local<Value>(); |
| Local<Value> result; |
| has_pending_exception = |
| !ToLocal<Value>(i::JSReceiver::GetProperty(obj, name), &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| v8::Local<Value> v8::TryCatch::StackTrace() const { |
| auto context = reinterpret_cast<v8::Isolate*>(isolate_)->GetCurrentContext(); |
| RETURN_TO_LOCAL_UNCHECKED(StackTrace(context), Value); |
| } |
| |
| |
| v8::Local<v8::Message> v8::TryCatch::Message() const { |
| i::Object* message = reinterpret_cast<i::Object*>(message_obj_); |
| DCHECK(message->IsJSMessageObject() || message->IsTheHole(isolate_)); |
| if (HasCaught() && !message->IsTheHole(isolate_)) { |
| return v8::Utils::MessageToLocal(i::Handle<i::Object>(message, isolate_)); |
| } else { |
| return v8::Local<v8::Message>(); |
| } |
| } |
| |
| |
| void v8::TryCatch::Reset() { |
| if (!rethrow_ && HasCaught() && isolate_->has_scheduled_exception()) { |
| // If an exception was caught but is still scheduled because no API call |
| // promoted it, then it is canceled to prevent it from being propagated. |
| // Note that this will not cancel termination exceptions. |
| isolate_->CancelScheduledExceptionFromTryCatch(this); |
| } |
| ResetInternal(); |
| } |
| |
| |
| void v8::TryCatch::ResetInternal() { |
| i::Object* the_hole = isolate_->heap()->the_hole_value(); |
| exception_ = the_hole; |
| message_obj_ = the_hole; |
| } |
| |
| |
| void v8::TryCatch::SetVerbose(bool value) { |
| is_verbose_ = value; |
| } |
| |
| bool v8::TryCatch::IsVerbose() const { return is_verbose_; } |
| |
| void v8::TryCatch::SetCaptureMessage(bool value) { |
| capture_message_ = value; |
| } |
| |
| |
| // --- M e s s a g e --- |
| |
| |
| Local<String> Message::Get() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| EscapableHandleScope scope(reinterpret_cast<Isolate*>(isolate)); |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| i::Handle<i::String> raw_result = i::MessageHandler::GetMessage(isolate, obj); |
| Local<String> result = Utils::ToLocal(raw_result); |
| return scope.Escape(result); |
| } |
| |
| |
| ScriptOrigin Message::GetScriptOrigin() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| auto message = i::Handle<i::JSMessageObject>::cast(Utils::OpenHandle(this)); |
| auto script_wraper = i::Handle<i::Object>(message->script(), isolate); |
| auto script_value = i::Handle<i::JSValue>::cast(script_wraper); |
| i::Handle<i::Script> script(i::Script::cast(script_value->value())); |
| return GetScriptOriginForScript(isolate, script); |
| } |
| |
| |
| v8::Local<Value> Message::GetScriptResourceName() const { |
| return GetScriptOrigin().ResourceName(); |
| } |
| |
| |
| v8::Local<v8::StackTrace> Message::GetStackTrace() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| EscapableHandleScope scope(reinterpret_cast<Isolate*>(isolate)); |
| auto message = i::Handle<i::JSMessageObject>::cast(Utils::OpenHandle(this)); |
| i::Handle<i::Object> stackFramesObj(message->stack_frames(), isolate); |
| if (!stackFramesObj->IsFixedArray()) return v8::Local<v8::StackTrace>(); |
| auto stackTrace = i::Handle<i::FixedArray>::cast(stackFramesObj); |
| return scope.Escape(Utils::StackTraceToLocal(stackTrace)); |
| } |
| |
| |
| Maybe<int> Message::GetLineNumber(Local<Context> context) const { |
| auto self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| EscapableHandleScope handle_scope(reinterpret_cast<Isolate*>(isolate)); |
| auto msg = i::Handle<i::JSMessageObject>::cast(self); |
| return Just(msg->GetLineNumber()); |
| } |
| |
| |
| int Message::GetLineNumber() const { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return GetLineNumber(context).FromMaybe(0); |
| } |
| |
| |
| int Message::GetStartPosition() const { |
| auto self = Utils::OpenHandle(this); |
| return self->start_position(); |
| } |
| |
| |
| int Message::GetEndPosition() const { |
| auto self = Utils::OpenHandle(this); |
| return self->end_position(); |
| } |
| |
| int Message::ErrorLevel() const { |
| auto self = Utils::OpenHandle(this); |
| return self->error_level(); |
| } |
| |
| Maybe<int> Message::GetStartColumn(Local<Context> context) const { |
| auto self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| EscapableHandleScope handle_scope(reinterpret_cast<Isolate*>(isolate)); |
| auto msg = i::Handle<i::JSMessageObject>::cast(self); |
| return Just(msg->GetColumnNumber()); |
| } |
| |
| |
| int Message::GetStartColumn() const { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| const int default_value = kNoColumnInfo; |
| return GetStartColumn(context).FromMaybe(default_value); |
| } |
| |
| |
| Maybe<int> Message::GetEndColumn(Local<Context> context) const { |
| auto self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| EscapableHandleScope handle_scope(reinterpret_cast<Isolate*>(isolate)); |
| auto msg = i::Handle<i::JSMessageObject>::cast(self); |
| const int column_number = msg->GetColumnNumber(); |
| if (column_number == -1) return Just(-1); |
| const int start = self->start_position(); |
| const int end = self->end_position(); |
| return Just(column_number + (end - start)); |
| } |
| |
| |
| int Message::GetEndColumn() const { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| const int default_value = kNoColumnInfo; |
| return GetEndColumn(context).FromMaybe(default_value); |
| } |
| |
| |
| bool Message::IsSharedCrossOrigin() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| auto self = Utils::OpenHandle(this); |
| auto script = i::Handle<i::JSValue>::cast( |
| i::Handle<i::Object>(self->script(), isolate)); |
| return i::Script::cast(script->value()) |
| ->origin_options() |
| .IsSharedCrossOrigin(); |
| } |
| |
| bool Message::IsOpaque() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| auto self = Utils::OpenHandle(this); |
| auto script = i::Handle<i::JSValue>::cast( |
| i::Handle<i::Object>(self->script(), isolate)); |
| return i::Script::cast(script->value())->origin_options().IsOpaque(); |
| } |
| |
| |
| MaybeLocal<String> Message::GetSourceLine(Local<Context> context) const { |
| auto self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| EscapableHandleScope handle_scope(reinterpret_cast<Isolate*>(isolate)); |
| auto msg = i::Handle<i::JSMessageObject>::cast(self); |
| RETURN_ESCAPED(Utils::ToLocal(msg->GetSourceLine())); |
| } |
| |
| |
| Local<String> Message::GetSourceLine() const { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(GetSourceLine(context), String) |
| } |
| |
| |
| void Message::PrintCurrentStackTrace(Isolate* isolate, FILE* out) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i_isolate->PrintCurrentStackTrace(out); |
| } |
| |
| |
| // --- S t a c k T r a c e --- |
| |
| Local<StackFrame> StackTrace::GetFrame(uint32_t index) const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| EscapableHandleScope scope(reinterpret_cast<Isolate*>(isolate)); |
| auto obj = handle(Utils::OpenHandle(this)->get(index), isolate); |
| auto info = i::Handle<i::StackFrameInfo>::cast(obj); |
| return scope.Escape(Utils::StackFrameToLocal(info)); |
| } |
| |
| |
| int StackTrace::GetFrameCount() const { |
| return Utils::OpenHandle(this)->length(); |
| } |
| |
| namespace { |
| i::Handle<i::JSObject> NewFrameObject(i::Isolate* isolate, |
| i::Handle<i::StackFrameInfo> frame) { |
| i::Handle<i::JSObject> frame_obj = |
| isolate->factory()->NewJSObject(isolate->object_function()); |
| i::JSObject::AddProperty( |
| frame_obj, handle(isolate->heap()->line_string()), |
| handle(i::Smi::FromInt(frame->line_number() + 1), isolate), i::NONE); |
| i::JSObject::AddProperty( |
| frame_obj, handle(isolate->heap()->column_string()), |
| handle(i::Smi::FromInt(frame->column_number() + 1), isolate), i::NONE); |
| i::JSObject::AddProperty(frame_obj, |
| isolate->factory()->InternalizeOneByteString( |
| STATIC_CHAR_VECTOR("scriptId")), |
| handle(i::Smi::FromInt(frame->script_id()), isolate), |
| i::NONE); |
| i::JSObject::AddProperty(frame_obj, |
| isolate->factory()->InternalizeOneByteString( |
| STATIC_CHAR_VECTOR("scriptName")), |
| handle(frame->script_name(), isolate), i::NONE); |
| i::JSObject::AddProperty(frame_obj, |
| isolate->factory()->InternalizeOneByteString( |
| STATIC_CHAR_VECTOR("scriptNameOrSourceURL")), |
| handle(frame->script_name_or_source_url(), isolate), |
| i::NONE); |
| i::JSObject::AddProperty(frame_obj, |
| isolate->factory()->InternalizeOneByteString( |
| STATIC_CHAR_VECTOR("functionName")), |
| handle(frame->function_name(), isolate), i::NONE); |
| i::JSObject::AddProperty(frame_obj, |
| isolate->factory()->InternalizeOneByteString( |
| STATIC_CHAR_VECTOR("isEval")), |
| isolate->factory()->ToBoolean(frame->is_eval()), |
| i::NONE); |
| i::JSObject::AddProperty( |
| frame_obj, |
| isolate->factory()->InternalizeOneByteString( |
| STATIC_CHAR_VECTOR("isConstructor")), |
| isolate->factory()->ToBoolean(frame->is_constructor()), i::NONE); |
| return frame_obj; |
| } |
| } // namespace |
| |
| Local<Array> StackTrace::AsArray() { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| i::Handle<i::FixedArray> self = Utils::OpenHandle(this); |
| int frame_count = self->length(); |
| i::Handle<i::FixedArray> frames = |
| isolate->factory()->NewFixedArray(frame_count); |
| for (int i = 0; i < frame_count; ++i) { |
| auto obj = handle(self->get(i), isolate); |
| auto frame = i::Handle<i::StackFrameInfo>::cast(obj); |
| i::Handle<i::JSObject> frame_obj = NewFrameObject(isolate, frame); |
| frames->set(i, *frame_obj); |
| } |
| return Utils::ToLocal(isolate->factory()->NewJSArrayWithElements( |
| frames, i::PACKED_ELEMENTS, frame_count)); |
| } |
| |
| |
| Local<StackTrace> StackTrace::CurrentStackTrace( |
| Isolate* isolate, |
| int frame_limit, |
| StackTraceOptions options) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::FixedArray> stackTrace = |
| i_isolate->CaptureCurrentStackTrace(frame_limit, options); |
| return Utils::StackTraceToLocal(stackTrace); |
| } |
| |
| |
| // --- S t a c k F r a m e --- |
| |
| int StackFrame::GetLineNumber() const { |
| int v = Utils::OpenHandle(this)->line_number(); |
| return v ? v : Message::kNoLineNumberInfo; |
| } |
| |
| |
| int StackFrame::GetColumn() const { |
| int v = Utils::OpenHandle(this)->column_number(); |
| return v ? v : Message::kNoLineNumberInfo; |
| } |
| |
| |
| int StackFrame::GetScriptId() const { |
| int v = Utils::OpenHandle(this)->script_id(); |
| return v ? v : Message::kNoScriptIdInfo; |
| } |
| |
| Local<String> StackFrame::GetScriptName() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| EscapableHandleScope scope(reinterpret_cast<Isolate*>(isolate)); |
| i::Handle<i::StackFrameInfo> self = Utils::OpenHandle(this); |
| i::Handle<i::Object> obj(self->script_name(), isolate); |
| return obj->IsString() |
| ? scope.Escape(Local<String>::Cast(Utils::ToLocal(obj))) |
| : Local<String>(); |
| } |
| |
| |
| Local<String> StackFrame::GetScriptNameOrSourceURL() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| EscapableHandleScope scope(reinterpret_cast<Isolate*>(isolate)); |
| i::Handle<i::StackFrameInfo> self = Utils::OpenHandle(this); |
| i::Handle<i::Object> obj(self->script_name_or_source_url(), isolate); |
| return obj->IsString() |
| ? scope.Escape(Local<String>::Cast(Utils::ToLocal(obj))) |
| : Local<String>(); |
| } |
| |
| |
| Local<String> StackFrame::GetFunctionName() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| EscapableHandleScope scope(reinterpret_cast<Isolate*>(isolate)); |
| i::Handle<i::StackFrameInfo> self = Utils::OpenHandle(this); |
| i::Handle<i::Object> obj(self->function_name(), isolate); |
| return obj->IsString() |
| ? scope.Escape(Local<String>::Cast(Utils::ToLocal(obj))) |
| : Local<String>(); |
| } |
| |
| bool StackFrame::IsEval() const { return Utils::OpenHandle(this)->is_eval(); } |
| |
| bool StackFrame::IsConstructor() const { |
| return Utils::OpenHandle(this)->is_constructor(); |
| } |
| |
| bool StackFrame::IsWasm() const { return Utils::OpenHandle(this)->is_wasm(); } |
| |
| |
| // --- J S O N --- |
| |
| MaybeLocal<Value> JSON::Parse(Isolate* v8_isolate, Local<String> json_string) { |
| PREPARE_FOR_EXECUTION(v8_isolate->GetCurrentContext(), JSON, Parse, Value); |
| i::Handle<i::String> string = Utils::OpenHandle(*json_string); |
| i::Handle<i::String> source = i::String::Flatten(string); |
| i::Handle<i::Object> undefined = isolate->factory()->undefined_value(); |
| auto maybe = source->IsSeqOneByteString() |
| ? i::JsonParser<true>::Parse(isolate, source, undefined) |
| : i::JsonParser<false>::Parse(isolate, source, undefined); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>(maybe, &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| MaybeLocal<Value> JSON::Parse(Local<Context> context, |
| Local<String> json_string) { |
| PREPARE_FOR_EXECUTION(context, JSON, Parse, Value); |
| i::Handle<i::String> string = Utils::OpenHandle(*json_string); |
| i::Handle<i::String> source = i::String::Flatten(string); |
| i::Handle<i::Object> undefined = isolate->factory()->undefined_value(); |
| auto maybe = source->IsSeqOneByteString() |
| ? i::JsonParser<true>::Parse(isolate, source, undefined) |
| : i::JsonParser<false>::Parse(isolate, source, undefined); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>(maybe, &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| Local<Value> JSON::Parse(Local<String> json_string) { |
| RETURN_TO_LOCAL_UNCHECKED(Parse(Local<Context>(), json_string), Value); |
| } |
| |
| MaybeLocal<String> JSON::Stringify(Local<Context> context, |
| Local<Value> json_object, |
| Local<String> gap) { |
| PREPARE_FOR_EXECUTION(context, JSON, Stringify, String); |
| i::Handle<i::Object> object = Utils::OpenHandle(*json_object); |
| i::Handle<i::Object> replacer = isolate->factory()->undefined_value(); |
| i::Handle<i::String> gap_string = gap.IsEmpty() |
| ? isolate->factory()->empty_string() |
| : Utils::OpenHandle(*gap); |
| i::Handle<i::Object> maybe; |
| has_pending_exception = !i::JsonStringifier(isolate) |
| .Stringify(object, replacer, gap_string) |
| .ToHandle(&maybe); |
| RETURN_ON_FAILED_EXECUTION(String); |
| Local<String> result; |
| has_pending_exception = |
| !ToLocal<String>(i::Object::ToString(isolate, maybe), &result); |
| RETURN_ON_FAILED_EXECUTION(String); |
| RETURN_ESCAPED(result); |
| } |
| |
| // --- V a l u e S e r i a l i z a t i o n --- |
| |
| Maybe<bool> ValueSerializer::Delegate::WriteHostObject(Isolate* v8_isolate, |
| Local<Object> object) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| isolate->ScheduleThrow(*isolate->factory()->NewError( |
| isolate->error_function(), i::MessageTemplate::kDataCloneError, |
| Utils::OpenHandle(*object))); |
| return Nothing<bool>(); |
| } |
| |
| Maybe<uint32_t> ValueSerializer::Delegate::GetSharedArrayBufferId( |
| Isolate* v8_isolate, Local<SharedArrayBuffer> shared_array_buffer) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| isolate->ScheduleThrow(*isolate->factory()->NewError( |
| isolate->error_function(), i::MessageTemplate::kDataCloneError, |
| Utils::OpenHandle(*shared_array_buffer))); |
| return Nothing<uint32_t>(); |
| } |
| |
| Maybe<uint32_t> ValueSerializer::Delegate::GetWasmModuleTransferId( |
| Isolate* v8_isolate, Local<WasmCompiledModule> module) { |
| return Nothing<uint32_t>(); |
| } |
| |
| void* ValueSerializer::Delegate::ReallocateBufferMemory(void* old_buffer, |
| size_t size, |
| size_t* actual_size) { |
| *actual_size = size; |
| return realloc(old_buffer, size); |
| } |
| |
| void ValueSerializer::Delegate::FreeBufferMemory(void* buffer) { |
| return free(buffer); |
| } |
| |
| struct ValueSerializer::PrivateData { |
| explicit PrivateData(i::Isolate* i, ValueSerializer::Delegate* delegate) |
| : isolate(i), serializer(i, delegate) {} |
| i::Isolate* isolate; |
| i::ValueSerializer serializer; |
| }; |
| |
| ValueSerializer::ValueSerializer(Isolate* isolate) |
| : ValueSerializer(isolate, nullptr) {} |
| |
| ValueSerializer::ValueSerializer(Isolate* isolate, Delegate* delegate) |
| : private_( |
| new PrivateData(reinterpret_cast<i::Isolate*>(isolate), delegate)) {} |
| |
| ValueSerializer::~ValueSerializer() { delete private_; } |
| |
| void ValueSerializer::WriteHeader() { private_->serializer.WriteHeader(); } |
| |
| void ValueSerializer::SetTreatArrayBufferViewsAsHostObjects(bool mode) { |
| private_->serializer.SetTreatArrayBufferViewsAsHostObjects(mode); |
| } |
| |
| Maybe<bool> ValueSerializer::WriteValue(Local<Context> context, |
| Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, ValueSerializer, WriteValue, Nothing<bool>(), |
| i::HandleScope); |
| i::Handle<i::Object> object = Utils::OpenHandle(*value); |
| Maybe<bool> result = private_->serializer.WriteObject(object); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| std::vector<uint8_t> ValueSerializer::ReleaseBuffer() { |
| return private_->serializer.ReleaseBuffer(); |
| } |
| |
| std::pair<uint8_t*, size_t> ValueSerializer::Release() { |
| return private_->serializer.Release(); |
| } |
| |
| void ValueSerializer::TransferArrayBuffer(uint32_t transfer_id, |
| Local<ArrayBuffer> array_buffer) { |
| private_->serializer.TransferArrayBuffer(transfer_id, |
| Utils::OpenHandle(*array_buffer)); |
| } |
| |
| void ValueSerializer::TransferSharedArrayBuffer( |
| uint32_t transfer_id, Local<SharedArrayBuffer> shared_array_buffer) { |
| private_->serializer.TransferArrayBuffer( |
| transfer_id, Utils::OpenHandle(*shared_array_buffer)); |
| } |
| |
| void ValueSerializer::WriteUint32(uint32_t value) { |
| private_->serializer.WriteUint32(value); |
| } |
| |
| void ValueSerializer::WriteUint64(uint64_t value) { |
| private_->serializer.WriteUint64(value); |
| } |
| |
| void ValueSerializer::WriteDouble(double value) { |
| private_->serializer.WriteDouble(value); |
| } |
| |
| void ValueSerializer::WriteRawBytes(const void* source, size_t length) { |
| private_->serializer.WriteRawBytes(source, length); |
| } |
| |
| MaybeLocal<Object> ValueDeserializer::Delegate::ReadHostObject( |
| Isolate* v8_isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| isolate->ScheduleThrow(*isolate->factory()->NewError( |
| isolate->error_function(), |
| i::MessageTemplate::kDataCloneDeserializationError)); |
| return MaybeLocal<Object>(); |
| } |
| |
| MaybeLocal<WasmCompiledModule> ValueDeserializer::Delegate::GetWasmModuleFromId( |
| Isolate* v8_isolate, uint32_t id) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| isolate->ScheduleThrow(*isolate->factory()->NewError( |
| isolate->error_function(), |
| i::MessageTemplate::kDataCloneDeserializationError)); |
| return MaybeLocal<WasmCompiledModule>(); |
| } |
| |
| struct ValueDeserializer::PrivateData { |
| PrivateData(i::Isolate* i, i::Vector<const uint8_t> data, Delegate* delegate) |
| : isolate(i), deserializer(i, data, delegate) {} |
| i::Isolate* isolate; |
| i::ValueDeserializer deserializer; |
| bool has_aborted = false; |
| bool supports_legacy_wire_format = false; |
| }; |
| |
| ValueDeserializer::ValueDeserializer(Isolate* isolate, const uint8_t* data, |
| size_t size) |
| : ValueDeserializer(isolate, data, size, nullptr) {} |
| |
| ValueDeserializer::ValueDeserializer(Isolate* isolate, const uint8_t* data, |
| size_t size, Delegate* delegate) { |
| if (base::IsValueInRangeForNumericType<int>(size)) { |
| private_ = new PrivateData( |
| reinterpret_cast<i::Isolate*>(isolate), |
| i::Vector<const uint8_t>(data, static_cast<int>(size)), delegate); |
| } else { |
| private_ = new PrivateData(reinterpret_cast<i::Isolate*>(isolate), |
| i::Vector<const uint8_t>(nullptr, 0), nullptr); |
| private_->has_aborted = true; |
| } |
| } |
| |
| ValueDeserializer::~ValueDeserializer() { delete private_; } |
| |
| Maybe<bool> ValueDeserializer::ReadHeader(Local<Context> context) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, ValueDeserializer, ReadHeader, |
| Nothing<bool>(), i::HandleScope); |
| |
| // We could have aborted during the constructor. |
| // If so, ReadHeader is where we report it. |
| if (private_->has_aborted) { |
| isolate->Throw(*isolate->factory()->NewError( |
| i::MessageTemplate::kDataCloneDeserializationError)); |
| has_pending_exception = true; |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| } |
| |
| bool read_header = false; |
| has_pending_exception = !private_->deserializer.ReadHeader().To(&read_header); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| DCHECK(read_header); |
| |
| static const uint32_t kMinimumNonLegacyVersion = 13; |
| if (GetWireFormatVersion() < kMinimumNonLegacyVersion && |
| !private_->supports_legacy_wire_format) { |
| isolate->Throw(*isolate->factory()->NewError( |
| i::MessageTemplate::kDataCloneDeserializationVersionError)); |
| has_pending_exception = true; |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| } |
| |
| return Just(true); |
| } |
| |
| void ValueDeserializer::SetSupportsLegacyWireFormat( |
| bool supports_legacy_wire_format) { |
| private_->supports_legacy_wire_format = supports_legacy_wire_format; |
| } |
| |
| void ValueDeserializer::SetExpectInlineWasm(bool expect_inline_wasm) { |
| private_->deserializer.set_expect_inline_wasm(expect_inline_wasm); |
| } |
| |
| uint32_t ValueDeserializer::GetWireFormatVersion() const { |
| CHECK(!private_->has_aborted); |
| return private_->deserializer.GetWireFormatVersion(); |
| } |
| |
| MaybeLocal<Value> ValueDeserializer::ReadValue(Local<Context> context) { |
| CHECK(!private_->has_aborted); |
| PREPARE_FOR_EXECUTION(context, ValueDeserializer, ReadValue, Value); |
| i::MaybeHandle<i::Object> result; |
| if (GetWireFormatVersion() > 0) { |
| result = private_->deserializer.ReadObject(); |
| } else { |
| result = |
| private_->deserializer.ReadObjectUsingEntireBufferForLegacyFormat(); |
| } |
| Local<Value> value; |
| has_pending_exception = !ToLocal(result, &value); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(value); |
| } |
| |
| void ValueDeserializer::TransferArrayBuffer(uint32_t transfer_id, |
| Local<ArrayBuffer> array_buffer) { |
| CHECK(!private_->has_aborted); |
| private_->deserializer.TransferArrayBuffer(transfer_id, |
| Utils::OpenHandle(*array_buffer)); |
| } |
| |
| void ValueDeserializer::TransferSharedArrayBuffer( |
| uint32_t transfer_id, Local<SharedArrayBuffer> shared_array_buffer) { |
| CHECK(!private_->has_aborted); |
| private_->deserializer.TransferArrayBuffer( |
| transfer_id, Utils::OpenHandle(*shared_array_buffer)); |
| } |
| |
| bool ValueDeserializer::ReadUint32(uint32_t* value) { |
| return private_->deserializer.ReadUint32(value); |
| } |
| |
| bool ValueDeserializer::ReadUint64(uint64_t* value) { |
| return private_->deserializer.ReadUint64(value); |
| } |
| |
| bool ValueDeserializer::ReadDouble(double* value) { |
| return private_->deserializer.ReadDouble(value); |
| } |
| |
| bool ValueDeserializer::ReadRawBytes(size_t length, const void** data) { |
| return private_->deserializer.ReadRawBytes(length, data); |
| } |
| |
| // --- D a t a --- |
| |
| bool Value::FullIsUndefined() const { |
| i::Handle<i::Object> object = Utils::OpenHandle(this); |
| bool result = false; |
| if (!object->IsSmi()) { |
| result = object->IsUndefined(i::HeapObject::cast(*object)->GetIsolate()); |
| } |
| DCHECK_EQ(result, QuickIsUndefined()); |
| return result; |
| } |
| |
| |
| bool Value::FullIsNull() const { |
| i::Handle<i::Object> object = Utils::OpenHandle(this); |
| bool result = false; |
| if (!object->IsSmi()) { |
| result = object->IsNull(i::HeapObject::cast(*object)->GetIsolate()); |
| } |
| DCHECK_EQ(result, QuickIsNull()); |
| return result; |
| } |
| |
| |
| bool Value::IsTrue() const { |
| i::Handle<i::Object> object = Utils::OpenHandle(this); |
| if (object->IsSmi()) return false; |
| return object->IsTrue(i::HeapObject::cast(*object)->GetIsolate()); |
| } |
| |
| |
| bool Value::IsFalse() const { |
| i::Handle<i::Object> object = Utils::OpenHandle(this); |
| if (object->IsSmi()) return false; |
| return object->IsFalse(i::HeapObject::cast(*object)->GetIsolate()); |
| } |
| |
| |
| bool Value::IsFunction() const { return Utils::OpenHandle(this)->IsCallable(); } |
| |
| |
| bool Value::IsName() const { |
| return Utils::OpenHandle(this)->IsName(); |
| } |
| |
| |
| bool Value::FullIsString() const { |
| bool result = Utils::OpenHandle(this)->IsString(); |
| DCHECK_EQ(result, QuickIsString()); |
| return result; |
| } |
| |
| |
| bool Value::IsSymbol() const { |
| return Utils::OpenHandle(this)->IsSymbol(); |
| } |
| |
| |
| bool Value::IsArray() const { |
| return Utils::OpenHandle(this)->IsJSArray(); |
| } |
| |
| |
| bool Value::IsArrayBuffer() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| return obj->IsJSArrayBuffer() && !i::JSArrayBuffer::cast(*obj)->is_shared(); |
| } |
| |
| |
| bool Value::IsArrayBufferView() const { |
| return Utils::OpenHandle(this)->IsJSArrayBufferView(); |
| } |
| |
| |
| bool Value::IsTypedArray() const { |
| return Utils::OpenHandle(this)->IsJSTypedArray(); |
| } |
| |
| |
| #define VALUE_IS_TYPED_ARRAY(Type, typeName, TYPE, ctype, size) \ |
| bool Value::Is##Type##Array() const { \ |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); \ |
| return obj->IsJSTypedArray() && \ |
| i::JSTypedArray::cast(*obj)->type() == i::kExternal##Type##Array; \ |
| } |
| |
| |
| TYPED_ARRAYS(VALUE_IS_TYPED_ARRAY) |
| |
| #undef VALUE_IS_TYPED_ARRAY |
| |
| |
| bool Value::IsDataView() const { |
| return Utils::OpenHandle(this)->IsJSDataView(); |
| } |
| |
| |
| bool Value::IsSharedArrayBuffer() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| return obj->IsJSArrayBuffer() && i::JSArrayBuffer::cast(*obj)->is_shared(); |
| } |
| |
| |
| bool Value::IsObject() const { return Utils::OpenHandle(this)->IsJSReceiver(); } |
| |
| |
| bool Value::IsNumber() const { |
| return Utils::OpenHandle(this)->IsNumber(); |
| } |
| |
| |
| bool Value::IsProxy() const { return Utils::OpenHandle(this)->IsJSProxy(); } |
| |
| bool Value::IsWebAssemblyCompiledModule() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (!obj->IsJSObject()) return false; |
| i::Handle<i::JSObject> js_obj = i::Handle<i::JSObject>::cast(obj); |
| return js_obj->GetIsolate()->native_context()->wasm_module_constructor() == |
| js_obj->map()->GetConstructor(); |
| } |
| |
| #define VALUE_IS_SPECIFIC_TYPE(Type, Class) \ |
| bool Value::Is##Type() const { \ |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); \ |
| if (!obj->IsHeapObject()) return false; \ |
| i::Isolate* isolate = i::HeapObject::cast(*obj)->GetIsolate(); \ |
| return obj->HasSpecificClassOf(isolate->heap()->Class##_string()); \ |
| } |
| |
| VALUE_IS_SPECIFIC_TYPE(ArgumentsObject, Arguments) |
| VALUE_IS_SPECIFIC_TYPE(BooleanObject, Boolean) |
| VALUE_IS_SPECIFIC_TYPE(NumberObject, Number) |
| VALUE_IS_SPECIFIC_TYPE(StringObject, String) |
| VALUE_IS_SPECIFIC_TYPE(SymbolObject, Symbol) |
| VALUE_IS_SPECIFIC_TYPE(Date, Date) |
| VALUE_IS_SPECIFIC_TYPE(Map, Map) |
| VALUE_IS_SPECIFIC_TYPE(Set, Set) |
| VALUE_IS_SPECIFIC_TYPE(WeakMap, WeakMap) |
| VALUE_IS_SPECIFIC_TYPE(WeakSet, WeakSet) |
| |
| #undef VALUE_IS_SPECIFIC_TYPE |
| |
| |
| bool Value::IsBoolean() const { |
| return Utils::OpenHandle(this)->IsBoolean(); |
| } |
| |
| |
| bool Value::IsExternal() const { |
| return Utils::OpenHandle(this)->IsExternal(); |
| } |
| |
| |
| bool Value::IsInt32() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (obj->IsSmi()) return true; |
| if (obj->IsNumber()) { |
| return i::IsInt32Double(obj->Number()); |
| } |
| return false; |
| } |
| |
| |
| bool Value::IsUint32() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (obj->IsSmi()) return i::Smi::ToInt(*obj) >= 0; |
| if (obj->IsNumber()) { |
| double value = obj->Number(); |
| return !i::IsMinusZero(value) && |
| value >= 0 && |
| value <= i::kMaxUInt32 && |
| value == i::FastUI2D(i::FastD2UI(value)); |
| } |
| return false; |
| } |
| |
| |
| bool Value::IsNativeError() const { |
| return Utils::OpenHandle(this)->IsJSError(); |
| } |
| |
| |
| bool Value::IsRegExp() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| return obj->IsJSRegExp(); |
| } |
| |
| bool Value::IsAsyncFunction() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (!obj->IsJSFunction()) return false; |
| i::Handle<i::JSFunction> func = i::Handle<i::JSFunction>::cast(obj); |
| return i::IsAsyncFunction(func->shared()->kind()); |
| } |
| |
| bool Value::IsGeneratorFunction() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (!obj->IsJSFunction()) return false; |
| i::Handle<i::JSFunction> func = i::Handle<i::JSFunction>::cast(obj); |
| return i::IsGeneratorFunction(func->shared()->kind()); |
| } |
| |
| |
| bool Value::IsGeneratorObject() const { |
| return Utils::OpenHandle(this)->IsJSGeneratorObject(); |
| } |
| |
| |
| bool Value::IsMapIterator() const { |
| return Utils::OpenHandle(this)->IsJSMapIterator(); |
| } |
| |
| |
| bool Value::IsSetIterator() const { |
| return Utils::OpenHandle(this)->IsJSSetIterator(); |
| } |
| |
| bool Value::IsPromise() const { return Utils::OpenHandle(this)->IsJSPromise(); } |
| |
| MaybeLocal<String> Value::ToString(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsString()) return ToApiHandle<String>(obj); |
| PREPARE_FOR_EXECUTION(context, Object, ToString, String); |
| Local<String> result; |
| has_pending_exception = |
| !ToLocal<String>(i::Object::ToString(isolate, obj), &result); |
| RETURN_ON_FAILED_EXECUTION(String); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<String> Value::ToString(Isolate* isolate) const { |
| RETURN_TO_LOCAL_UNCHECKED(ToString(isolate->GetCurrentContext()), String); |
| } |
| |
| |
| MaybeLocal<String> Value::ToDetailString(Local<Context> context) const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (obj->IsString()) return ToApiHandle<String>(obj); |
| PREPARE_FOR_EXECUTION(context, Object, ToDetailString, String); |
| Local<String> result = |
| Utils::ToLocal(i::Object::NoSideEffectsToString(isolate, obj)); |
| RETURN_ON_FAILED_EXECUTION(String); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<String> Value::ToDetailString(Isolate* isolate) const { |
| RETURN_TO_LOCAL_UNCHECKED(ToDetailString(isolate->GetCurrentContext()), |
| String); |
| } |
| |
| |
| MaybeLocal<Object> Value::ToObject(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsJSReceiver()) return ToApiHandle<Object>(obj); |
| PREPARE_FOR_EXECUTION(context, Object, ToObject, Object); |
| Local<Object> result; |
| has_pending_exception = |
| !ToLocal<Object>(i::Object::ToObject(isolate, obj), &result); |
| RETURN_ON_FAILED_EXECUTION(Object); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::Object> Value::ToObject(Isolate* isolate) const { |
| RETURN_TO_LOCAL_UNCHECKED(ToObject(isolate->GetCurrentContext()), Object); |
| } |
| |
| |
| MaybeLocal<Boolean> Value::ToBoolean(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsBoolean()) return ToApiHandle<Boolean>(obj); |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| auto val = isolate->factory()->ToBoolean(obj->BooleanValue()); |
| return ToApiHandle<Boolean>(val); |
| } |
| |
| |
| Local<Boolean> Value::ToBoolean(Isolate* v8_isolate) const { |
| return ToBoolean(v8_isolate->GetCurrentContext()).ToLocalChecked(); |
| } |
| |
| |
| MaybeLocal<Number> Value::ToNumber(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) return ToApiHandle<Number>(obj); |
| PREPARE_FOR_EXECUTION(context, Object, ToNumber, Number); |
| Local<Number> result; |
| has_pending_exception = !ToLocal<Number>(i::Object::ToNumber(obj), &result); |
| RETURN_ON_FAILED_EXECUTION(Number); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<Number> Value::ToNumber(Isolate* isolate) const { |
| RETURN_TO_LOCAL_UNCHECKED(ToNumber(isolate->GetCurrentContext()), Number); |
| } |
| |
| |
| MaybeLocal<Integer> Value::ToInteger(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsSmi()) return ToApiHandle<Integer>(obj); |
| PREPARE_FOR_EXECUTION(context, Object, ToInteger, Integer); |
| Local<Integer> result; |
| has_pending_exception = |
| !ToLocal<Integer>(i::Object::ToInteger(isolate, obj), &result); |
| RETURN_ON_FAILED_EXECUTION(Integer); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<Integer> Value::ToInteger(Isolate* isolate) const { |
| RETURN_TO_LOCAL_UNCHECKED(ToInteger(isolate->GetCurrentContext()), Integer); |
| } |
| |
| |
| MaybeLocal<Int32> Value::ToInt32(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsSmi()) return ToApiHandle<Int32>(obj); |
| Local<Int32> result; |
| PREPARE_FOR_EXECUTION(context, Object, ToInt32, Int32); |
| has_pending_exception = |
| !ToLocal<Int32>(i::Object::ToInt32(isolate, obj), &result); |
| RETURN_ON_FAILED_EXECUTION(Int32); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<Int32> Value::ToInt32(Isolate* isolate) const { |
| RETURN_TO_LOCAL_UNCHECKED(ToInt32(isolate->GetCurrentContext()), Int32); |
| } |
| |
| |
| MaybeLocal<Uint32> Value::ToUint32(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsSmi()) return ToApiHandle<Uint32>(obj); |
| Local<Uint32> result; |
| PREPARE_FOR_EXECUTION(context, Object, ToUint32, Uint32); |
| has_pending_exception = |
| !ToLocal<Uint32>(i::Object::ToUint32(isolate, obj), &result); |
| RETURN_ON_FAILED_EXECUTION(Uint32); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<Uint32> Value::ToUint32(Isolate* isolate) const { |
| RETURN_TO_LOCAL_UNCHECKED(ToUint32(isolate->GetCurrentContext()), Uint32); |
| } |
| |
| |
| void i::Internals::CheckInitializedImpl(v8::Isolate* external_isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(external_isolate); |
| Utils::ApiCheck(isolate != nullptr && !isolate->IsDead(), |
| "v8::internal::Internals::CheckInitialized", |
| "Isolate is not initialized or V8 has died"); |
| } |
| |
| |
| void External::CheckCast(v8::Value* that) { |
| Utils::ApiCheck(Utils::OpenHandle(that)->IsExternal(), "v8::External::Cast", |
| "Could not convert to external"); |
| } |
| |
| |
| void v8::Object::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsJSReceiver(), "v8::Object::Cast", |
| "Could not convert to object"); |
| } |
| |
| |
| void v8::Function::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsCallable(), "v8::Function::Cast", |
| "Could not convert to function"); |
| } |
| |
| |
| void v8::Boolean::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsBoolean(), "v8::Boolean::Cast", |
| "Could not convert to boolean"); |
| } |
| |
| |
| void v8::Name::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsName(), "v8::Name::Cast", "Could not convert to name"); |
| } |
| |
| |
| void v8::String::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsString(), "v8::String::Cast", |
| "Could not convert to string"); |
| } |
| |
| |
| void v8::Symbol::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsSymbol(), "v8::Symbol::Cast", |
| "Could not convert to symbol"); |
| } |
| |
| |
| void v8::Number::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsNumber(), |
| "v8::Number::Cast()", |
| "Could not convert to number"); |
| } |
| |
| |
| void v8::Integer::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsNumber(), "v8::Integer::Cast", |
| "Could not convert to number"); |
| } |
| |
| |
| void v8::Int32::CheckCast(v8::Value* that) { |
| Utils::ApiCheck(that->IsInt32(), "v8::Int32::Cast", |
| "Could not convert to 32-bit signed integer"); |
| } |
| |
| |
| void v8::Uint32::CheckCast(v8::Value* that) { |
| Utils::ApiCheck(that->IsUint32(), "v8::Uint32::Cast", |
| "Could not convert to 32-bit unsigned integer"); |
| } |
| |
| |
| void v8::Array::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsJSArray(), "v8::Array::Cast", |
| "Could not convert to array"); |
| } |
| |
| |
| void v8::Map::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsJSMap(), "v8::Map::Cast", "Could not convert to Map"); |
| } |
| |
| |
| void v8::Set::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsJSSet(), "v8_Set_Cast", "Could not convert to Set"); |
| } |
| |
| |
| void v8::Promise::CheckCast(Value* that) { |
| Utils::ApiCheck(that->IsPromise(), "v8::Promise::Cast", |
| "Could not convert to promise"); |
| } |
| |
| |
| void v8::Promise::Resolver::CheckCast(Value* that) { |
| Utils::ApiCheck(that->IsPromise(), "v8::Promise::Resolver::Cast", |
| "Could not convert to promise resolver"); |
| } |
| |
| |
| void v8::Proxy::CheckCast(Value* that) { |
| Utils::ApiCheck(that->IsProxy(), "v8::Proxy::Cast", |
| "Could not convert to proxy"); |
| } |
| |
| void v8::WasmCompiledModule::CheckCast(Value* that) { |
| Utils::ApiCheck(that->IsWebAssemblyCompiledModule(), |
| "v8::WasmCompiledModule::Cast", |
| "Could not convert to wasm compiled module"); |
| } |
| |
| void v8::ArrayBuffer::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck( |
| obj->IsJSArrayBuffer() && !i::JSArrayBuffer::cast(*obj)->is_shared(), |
| "v8::ArrayBuffer::Cast()", "Could not convert to ArrayBuffer"); |
| } |
| |
| |
| void v8::ArrayBufferView::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsJSArrayBufferView(), |
| "v8::ArrayBufferView::Cast()", |
| "Could not convert to ArrayBufferView"); |
| } |
| |
| |
| void v8::TypedArray::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsJSTypedArray(), |
| "v8::TypedArray::Cast()", |
| "Could not convert to TypedArray"); |
| } |
| |
| |
| #define CHECK_TYPED_ARRAY_CAST(Type, typeName, TYPE, ctype, size) \ |
| void v8::Type##Array::CheckCast(Value* that) { \ |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); \ |
| Utils::ApiCheck( \ |
| obj->IsJSTypedArray() && \ |
| i::JSTypedArray::cast(*obj)->type() == i::kExternal##Type##Array, \ |
| "v8::" #Type "Array::Cast()", "Could not convert to " #Type "Array"); \ |
| } |
| |
| |
| TYPED_ARRAYS(CHECK_TYPED_ARRAY_CAST) |
| |
| #undef CHECK_TYPED_ARRAY_CAST |
| |
| |
| void v8::DataView::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsJSDataView(), |
| "v8::DataView::Cast()", |
| "Could not convert to DataView"); |
| } |
| |
| |
| void v8::SharedArrayBuffer::CheckCast(Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck( |
| obj->IsJSArrayBuffer() && i::JSArrayBuffer::cast(*obj)->is_shared(), |
| "v8::SharedArrayBuffer::Cast()", |
| "Could not convert to SharedArrayBuffer"); |
| } |
| |
| |
| void v8::Date::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| i::Isolate* isolate = nullptr; |
| if (obj->IsHeapObject()) isolate = i::HeapObject::cast(*obj)->GetIsolate(); |
| Utils::ApiCheck(isolate != nullptr && |
| obj->HasSpecificClassOf(isolate->heap()->Date_string()), |
| "v8::Date::Cast()", "Could not convert to date"); |
| } |
| |
| |
| void v8::StringObject::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| i::Isolate* isolate = nullptr; |
| if (obj->IsHeapObject()) isolate = i::HeapObject::cast(*obj)->GetIsolate(); |
| Utils::ApiCheck(isolate != nullptr && |
| obj->HasSpecificClassOf(isolate->heap()->String_string()), |
| "v8::StringObject::Cast()", |
| "Could not convert to StringObject"); |
| } |
| |
| |
| void v8::SymbolObject::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| i::Isolate* isolate = nullptr; |
| if (obj->IsHeapObject()) isolate = i::HeapObject::cast(*obj)->GetIsolate(); |
| Utils::ApiCheck(isolate != nullptr && |
| obj->HasSpecificClassOf(isolate->heap()->Symbol_string()), |
| "v8::SymbolObject::Cast()", |
| "Could not convert to SymbolObject"); |
| } |
| |
| |
| void v8::NumberObject::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| i::Isolate* isolate = nullptr; |
| if (obj->IsHeapObject()) isolate = i::HeapObject::cast(*obj)->GetIsolate(); |
| Utils::ApiCheck(isolate != nullptr && |
| obj->HasSpecificClassOf(isolate->heap()->Number_string()), |
| "v8::NumberObject::Cast()", |
| "Could not convert to NumberObject"); |
| } |
| |
| |
| void v8::BooleanObject::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| i::Isolate* isolate = nullptr; |
| if (obj->IsHeapObject()) isolate = i::HeapObject::cast(*obj)->GetIsolate(); |
| Utils::ApiCheck( |
| isolate != nullptr && |
| obj->HasSpecificClassOf(isolate->heap()->Boolean_string()), |
| "v8::BooleanObject::Cast()", "Could not convert to BooleanObject"); |
| } |
| |
| |
| void v8::RegExp::CheckCast(v8::Value* that) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(that); |
| Utils::ApiCheck(obj->IsJSRegExp(), |
| "v8::RegExp::Cast()", |
| "Could not convert to regular expression"); |
| } |
| |
| |
| Maybe<bool> Value::BooleanValue(Local<Context> context) const { |
| return Just(Utils::OpenHandle(this)->BooleanValue()); |
| } |
| |
| |
| bool Value::BooleanValue() const { |
| return Utils::OpenHandle(this)->BooleanValue(); |
| } |
| |
| |
| Maybe<double> Value::NumberValue(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) return Just(obj->Number()); |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Value, NumberValue, Nothing<double>(), |
| i::HandleScope); |
| i::Handle<i::Object> num; |
| has_pending_exception = !i::Object::ToNumber(obj).ToHandle(&num); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(double); |
| return Just(num->Number()); |
| } |
| |
| |
| double Value::NumberValue() const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) return obj->Number(); |
| return NumberValue(ContextFromHeapObject(obj)) |
| .FromMaybe(std::numeric_limits<double>::quiet_NaN()); |
| } |
| |
| |
| Maybe<int64_t> Value::IntegerValue(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) { |
| return Just(NumberToInt64(*obj)); |
| } |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Value, IntegerValue, Nothing<int64_t>(), |
| i::HandleScope); |
| i::Handle<i::Object> num; |
| has_pending_exception = !i::Object::ToInteger(isolate, obj).ToHandle(&num); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(int64_t); |
| return Just(NumberToInt64(*num)); |
| } |
| |
| |
| int64_t Value::IntegerValue() const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) { |
| if (obj->IsSmi()) { |
| return i::Smi::ToInt(*obj); |
| } else { |
| return static_cast<int64_t>(obj->Number()); |
| } |
| } |
| return IntegerValue(ContextFromHeapObject(obj)).FromMaybe(0); |
| } |
| |
| |
| Maybe<int32_t> Value::Int32Value(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) return Just(NumberToInt32(*obj)); |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Value, Int32Value, Nothing<int32_t>(), |
| i::HandleScope); |
| i::Handle<i::Object> num; |
| has_pending_exception = !i::Object::ToInt32(isolate, obj).ToHandle(&num); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(int32_t); |
| return Just(num->IsSmi() ? i::Smi::ToInt(*num) |
| : static_cast<int32_t>(num->Number())); |
| } |
| |
| |
| int32_t Value::Int32Value() const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) return NumberToInt32(*obj); |
| return Int32Value(ContextFromHeapObject(obj)).FromMaybe(0); |
| } |
| |
| |
| Maybe<uint32_t> Value::Uint32Value(Local<Context> context) const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) return Just(NumberToUint32(*obj)); |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Value, Uint32Value, Nothing<uint32_t>(), |
| i::HandleScope); |
| i::Handle<i::Object> num; |
| has_pending_exception = !i::Object::ToUint32(isolate, obj).ToHandle(&num); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(uint32_t); |
| return Just(num->IsSmi() ? static_cast<uint32_t>(i::Smi::ToInt(*num)) |
| : static_cast<uint32_t>(num->Number())); |
| } |
| |
| |
| uint32_t Value::Uint32Value() const { |
| auto obj = Utils::OpenHandle(this); |
| if (obj->IsNumber()) return NumberToUint32(*obj); |
| return Uint32Value(ContextFromHeapObject(obj)).FromMaybe(0); |
| } |
| |
| |
| MaybeLocal<Uint32> Value::ToArrayIndex(Local<Context> context) const { |
| auto self = Utils::OpenHandle(this); |
| if (self->IsSmi()) { |
| if (i::Smi::ToInt(*self) >= 0) return Utils::Uint32ToLocal(self); |
| return Local<Uint32>(); |
| } |
| PREPARE_FOR_EXECUTION(context, Object, ToArrayIndex, Uint32); |
| i::Handle<i::Object> string_obj; |
| has_pending_exception = |
| !i::Object::ToString(isolate, self).ToHandle(&string_obj); |
| RETURN_ON_FAILED_EXECUTION(Uint32); |
| i::Handle<i::String> str = i::Handle<i::String>::cast(string_obj); |
| uint32_t index; |
| if (str->AsArrayIndex(&index)) { |
| i::Handle<i::Object> value; |
| if (index <= static_cast<uint32_t>(i::Smi::kMaxValue)) { |
| value = i::Handle<i::Object>(i::Smi::FromInt(index), isolate); |
| } else { |
| value = isolate->factory()->NewNumber(index); |
| } |
| RETURN_ESCAPED(Utils::Uint32ToLocal(value)); |
| } |
| return Local<Uint32>(); |
| } |
| |
| |
| Local<Uint32> Value::ToArrayIndex() const { |
| auto self = Utils::OpenHandle(this); |
| if (self->IsSmi()) { |
| if (i::Smi::ToInt(*self) >= 0) return Utils::Uint32ToLocal(self); |
| return Local<Uint32>(); |
| } |
| auto context = ContextFromHeapObject(self); |
| RETURN_TO_LOCAL_UNCHECKED(ToArrayIndex(context), Uint32); |
| } |
| |
| |
| Maybe<bool> Value::Equals(Local<Context> context, Local<Value> that) const { |
| auto self = Utils::OpenHandle(this); |
| auto other = Utils::OpenHandle(*that); |
| return i::Object::Equals(self, other); |
| } |
| |
| |
| bool Value::Equals(Local<Value> that) const { |
| auto self = Utils::OpenHandle(this); |
| auto other = Utils::OpenHandle(*that); |
| if (self->IsSmi() && other->IsSmi()) { |
| return self->Number() == other->Number(); |
| } |
| if (self->IsJSObject() && other->IsJSObject()) { |
| return *self == *other; |
| } |
| auto heap_object = self->IsSmi() ? other : self; |
| auto context = ContextFromHeapObject(heap_object); |
| return Equals(context, that).FromMaybe(false); |
| } |
| |
| |
| bool Value::StrictEquals(Local<Value> that) const { |
| auto self = Utils::OpenHandle(this); |
| auto other = Utils::OpenHandle(*that); |
| return self->StrictEquals(*other); |
| } |
| |
| |
| bool Value::SameValue(Local<Value> that) const { |
| auto self = Utils::OpenHandle(this); |
| auto other = Utils::OpenHandle(*that); |
| return self->SameValue(*other); |
| } |
| |
| Local<String> Value::TypeOf(v8::Isolate* external_isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(external_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| LOG_API(isolate, Value, TypeOf); |
| return Utils::ToLocal(i::Object::TypeOf(isolate, Utils::OpenHandle(this))); |
| } |
| |
| Maybe<bool> Value::InstanceOf(v8::Local<v8::Context> context, |
| v8::Local<v8::Object> object) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Value, InstanceOf, Nothing<bool>(), |
| i::HandleScope); |
| auto left = Utils::OpenHandle(this); |
| auto right = Utils::OpenHandle(*object); |
| i::Handle<i::Object> result; |
| has_pending_exception = |
| !i::Object::InstanceOf(isolate, left, right).ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(result->IsTrue(isolate)); |
| } |
| |
| Maybe<bool> v8::Object::Set(v8::Local<v8::Context> context, |
| v8::Local<Value> key, v8::Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, Set, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(*key); |
| auto value_obj = Utils::OpenHandle(*value); |
| has_pending_exception = |
| i::Runtime::SetObjectProperty(isolate, self, key_obj, value_obj, |
| i::LanguageMode::kSloppy) |
| .is_null(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(true); |
| } |
| |
| |
| bool v8::Object::Set(v8::Local<Value> key, v8::Local<Value> value) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return Set(context, key, value).FromMaybe(false); |
| } |
| |
| |
| Maybe<bool> v8::Object::Set(v8::Local<v8::Context> context, uint32_t index, |
| v8::Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, Set, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto value_obj = Utils::OpenHandle(*value); |
| has_pending_exception = i::Object::SetElement(isolate, self, index, value_obj, |
| i::LanguageMode::kSloppy) |
| .is_null(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(true); |
| } |
| |
| |
| bool v8::Object::Set(uint32_t index, v8::Local<Value> value) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return Set(context, index, value).FromMaybe(false); |
| } |
| |
| |
| Maybe<bool> v8::Object::CreateDataProperty(v8::Local<v8::Context> context, |
| v8::Local<Name> key, |
| v8::Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, CreateDataProperty, Nothing<bool>(), |
| i::HandleScope); |
| i::Handle<i::JSReceiver> self = Utils::OpenHandle(this); |
| i::Handle<i::Name> key_obj = Utils::OpenHandle(*key); |
| i::Handle<i::Object> value_obj = Utils::OpenHandle(*value); |
| |
| i::LookupIterator it = i::LookupIterator::PropertyOrElement( |
| isolate, self, key_obj, self, i::LookupIterator::OWN); |
| Maybe<bool> result = |
| i::JSReceiver::CreateDataProperty(&it, value_obj, i::kDontThrow); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| |
| Maybe<bool> v8::Object::CreateDataProperty(v8::Local<v8::Context> context, |
| uint32_t index, |
| v8::Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, CreateDataProperty, Nothing<bool>(), |
| i::HandleScope); |
| i::Handle<i::JSReceiver> self = Utils::OpenHandle(this); |
| i::Handle<i::Object> value_obj = Utils::OpenHandle(*value); |
| |
| i::LookupIterator it(isolate, self, index, self, i::LookupIterator::OWN); |
| Maybe<bool> result = |
| i::JSReceiver::CreateDataProperty(&it, value_obj, i::kDontThrow); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| struct v8::PropertyDescriptor::PrivateData { |
| PrivateData() : desc() {} |
| i::PropertyDescriptor desc; |
| }; |
| |
| v8::PropertyDescriptor::PropertyDescriptor() : private_(new PrivateData()) {} |
| |
| // DataDescriptor |
| v8::PropertyDescriptor::PropertyDescriptor(v8::Local<v8::Value> value) |
| : private_(new PrivateData()) { |
| private_->desc.set_value(Utils::OpenHandle(*value, true)); |
| } |
| |
| // DataDescriptor with writable field |
| v8::PropertyDescriptor::PropertyDescriptor(v8::Local<v8::Value> value, |
| bool writable) |
| : private_(new PrivateData()) { |
| private_->desc.set_value(Utils::OpenHandle(*value, true)); |
| private_->desc.set_writable(writable); |
| } |
| |
| // AccessorDescriptor |
| v8::PropertyDescriptor::PropertyDescriptor(v8::Local<v8::Value> get, |
| v8::Local<v8::Value> set) |
| : private_(new PrivateData()) { |
| DCHECK(get.IsEmpty() || get->IsUndefined() || get->IsFunction()); |
| DCHECK(set.IsEmpty() || set->IsUndefined() || set->IsFunction()); |
| private_->desc.set_get(Utils::OpenHandle(*get, true)); |
| private_->desc.set_set(Utils::OpenHandle(*set, true)); |
| } |
| |
| v8::PropertyDescriptor::~PropertyDescriptor() { delete private_; } |
| |
| v8::Local<Value> v8::PropertyDescriptor::value() const { |
| DCHECK(private_->desc.has_value()); |
| return Utils::ToLocal(private_->desc.value()); |
| } |
| |
| v8::Local<Value> v8::PropertyDescriptor::get() const { |
| DCHECK(private_->desc.has_get()); |
| return Utils::ToLocal(private_->desc.get()); |
| } |
| |
| v8::Local<Value> v8::PropertyDescriptor::set() const { |
| DCHECK(private_->desc.has_set()); |
| return Utils::ToLocal(private_->desc.set()); |
| } |
| |
| bool v8::PropertyDescriptor::has_value() const { |
| return private_->desc.has_value(); |
| } |
| bool v8::PropertyDescriptor::has_get() const { |
| return private_->desc.has_get(); |
| } |
| bool v8::PropertyDescriptor::has_set() const { |
| return private_->desc.has_set(); |
| } |
| |
| bool v8::PropertyDescriptor::writable() const { |
| DCHECK(private_->desc.has_writable()); |
| return private_->desc.writable(); |
| } |
| |
| bool v8::PropertyDescriptor::has_writable() const { |
| return private_->desc.has_writable(); |
| } |
| |
| void v8::PropertyDescriptor::set_enumerable(bool enumerable) { |
| private_->desc.set_enumerable(enumerable); |
| } |
| |
| bool v8::PropertyDescriptor::enumerable() const { |
| DCHECK(private_->desc.has_enumerable()); |
| return private_->desc.enumerable(); |
| } |
| |
| bool v8::PropertyDescriptor::has_enumerable() const { |
| return private_->desc.has_enumerable(); |
| } |
| |
| void v8::PropertyDescriptor::set_configurable(bool configurable) { |
| private_->desc.set_configurable(configurable); |
| } |
| |
| bool v8::PropertyDescriptor::configurable() const { |
| DCHECK(private_->desc.has_configurable()); |
| return private_->desc.configurable(); |
| } |
| |
| bool v8::PropertyDescriptor::has_configurable() const { |
| return private_->desc.has_configurable(); |
| } |
| |
| Maybe<bool> v8::Object::DefineOwnProperty(v8::Local<v8::Context> context, |
| v8::Local<Name> key, |
| v8::Local<Value> value, |
| v8::PropertyAttribute attributes) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| i::Handle<i::JSReceiver> self = Utils::OpenHandle(this); |
| i::Handle<i::Name> key_obj = Utils::OpenHandle(*key); |
| i::Handle<i::Object> value_obj = Utils::OpenHandle(*value); |
| |
| i::PropertyDescriptor desc; |
| desc.set_writable(!(attributes & v8::ReadOnly)); |
| desc.set_enumerable(!(attributes & v8::DontEnum)); |
| desc.set_configurable(!(attributes & v8::DontDelete)); |
| desc.set_value(value_obj); |
| |
| if (self->IsJSProxy()) { |
| ENTER_V8(isolate, context, Object, DefineOwnProperty, Nothing<bool>(), |
| i::HandleScope); |
| Maybe<bool> success = i::JSReceiver::DefineOwnProperty( |
| isolate, self, key_obj, &desc, i::kDontThrow); |
| // Even though we said kDontThrow, there might be accessors that do throw. |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return success; |
| } else { |
| // If it's not a JSProxy, i::JSReceiver::DefineOwnProperty should never run |
| // a script. |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, DefineOwnProperty, |
| Nothing<bool>(), i::HandleScope); |
| Maybe<bool> success = i::JSReceiver::DefineOwnProperty( |
| isolate, self, key_obj, &desc, i::kDontThrow); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return success; |
| } |
| } |
| |
| Maybe<bool> v8::Object::DefineProperty(v8::Local<v8::Context> context, |
| v8::Local<Name> key, |
| PropertyDescriptor& descriptor) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, DefineOwnProperty, Nothing<bool>(), |
| i::HandleScope); |
| i::Handle<i::JSReceiver> self = Utils::OpenHandle(this); |
| i::Handle<i::Name> key_obj = Utils::OpenHandle(*key); |
| |
| Maybe<bool> success = i::JSReceiver::DefineOwnProperty( |
| isolate, self, key_obj, &descriptor.get_private()->desc, i::kDontThrow); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return success; |
| } |
| |
| MUST_USE_RESULT |
| static i::MaybeHandle<i::Object> DefineObjectProperty( |
| i::Handle<i::JSObject> js_object, i::Handle<i::Object> key, |
| i::Handle<i::Object> value, i::PropertyAttributes attrs) { |
| i::Isolate* isolate = js_object->GetIsolate(); |
| bool success = false; |
| i::LookupIterator it = i::LookupIterator::PropertyOrElement( |
| isolate, js_object, key, &success, i::LookupIterator::OWN); |
| if (!success) return i::MaybeHandle<i::Object>(); |
| |
| return i::JSObject::DefineOwnPropertyIgnoreAttributes( |
| &it, value, attrs, i::JSObject::FORCE_FIELD); |
| } |
| |
| |
| Maybe<bool> v8::Object::ForceSet(v8::Local<v8::Context> context, |
| v8::Local<Value> key, v8::Local<Value> value, |
| v8::PropertyAttribute attribs) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, ForceSet, Nothing<bool>(), |
| i::HandleScope); |
| auto self = i::Handle<i::JSObject>::cast(Utils::OpenHandle(this)); |
| auto key_obj = Utils::OpenHandle(*key); |
| auto value_obj = Utils::OpenHandle(*value); |
| has_pending_exception = |
| DefineObjectProperty(self, key_obj, value_obj, |
| static_cast<i::PropertyAttributes>(attribs)) |
| .is_null(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(true); |
| } |
| |
| |
| Maybe<bool> v8::Object::SetPrivate(Local<Context> context, Local<Private> key, |
| Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, SetPrivate, Nothing<bool>(), |
| i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(reinterpret_cast<Name*>(*key)); |
| auto value_obj = Utils::OpenHandle(*value); |
| if (self->IsJSProxy()) { |
| i::PropertyDescriptor desc; |
| desc.set_writable(true); |
| desc.set_enumerable(false); |
| desc.set_configurable(true); |
| desc.set_value(value_obj); |
| return i::JSProxy::SetPrivateProperty( |
| isolate, i::Handle<i::JSProxy>::cast(self), |
| i::Handle<i::Symbol>::cast(key_obj), &desc, i::kDontThrow); |
| } |
| auto js_object = i::Handle<i::JSObject>::cast(self); |
| i::LookupIterator it(js_object, key_obj, js_object); |
| has_pending_exception = i::JSObject::DefineOwnPropertyIgnoreAttributes( |
| &it, value_obj, i::DONT_ENUM) |
| .is_null(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(true); |
| } |
| |
| |
| MaybeLocal<Value> v8::Object::Get(Local<v8::Context> context, |
| Local<Value> key) { |
| PREPARE_FOR_EXECUTION(context, Object, Get, Value); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(*key); |
| i::Handle<i::Object> result; |
| has_pending_exception = |
| !i::Runtime::GetObjectProperty(isolate, self, key_obj).ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(Utils::ToLocal(result)); |
| } |
| |
| |
| Local<Value> v8::Object::Get(v8::Local<Value> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(Get(context, key), Value); |
| } |
| |
| |
| MaybeLocal<Value> v8::Object::Get(Local<Context> context, uint32_t index) { |
| PREPARE_FOR_EXECUTION(context, Object, Get, Value); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> result; |
| has_pending_exception = |
| !i::JSReceiver::GetElement(isolate, self, index).ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(Utils::ToLocal(result)); |
| } |
| |
| |
| Local<Value> v8::Object::Get(uint32_t index) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(Get(context, index), Value); |
| } |
| |
| |
| MaybeLocal<Value> v8::Object::GetPrivate(Local<Context> context, |
| Local<Private> key) { |
| return Get(context, Local<Value>(reinterpret_cast<Value*>(*key))); |
| } |
| |
| |
| Maybe<PropertyAttribute> v8::Object::GetPropertyAttributes( |
| Local<Context> context, Local<Value> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, GetPropertyAttributes, |
| Nothing<PropertyAttribute>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(*key); |
| if (!key_obj->IsName()) { |
| has_pending_exception = |
| !i::Object::ToString(isolate, key_obj).ToHandle(&key_obj); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(PropertyAttribute); |
| } |
| auto key_name = i::Handle<i::Name>::cast(key_obj); |
| auto result = i::JSReceiver::GetPropertyAttributes(self, key_name); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(PropertyAttribute); |
| if (result.FromJust() == i::ABSENT) { |
| return Just(static_cast<PropertyAttribute>(i::NONE)); |
| } |
| return Just(static_cast<PropertyAttribute>(result.FromJust())); |
| } |
| |
| |
| PropertyAttribute v8::Object::GetPropertyAttributes(v8::Local<Value> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return GetPropertyAttributes(context, key) |
| .FromMaybe(static_cast<PropertyAttribute>(i::NONE)); |
| } |
| |
| MaybeLocal<Value> v8::Object::GetOwnPropertyDescriptor(Local<Context> context, |
| Local<Name> key) { |
| PREPARE_FOR_EXECUTION(context, Object, GetOwnPropertyDescriptor, Value); |
| i::Handle<i::JSReceiver> obj = Utils::OpenHandle(this); |
| i::Handle<i::Name> key_name = Utils::OpenHandle(*key); |
| |
| i::PropertyDescriptor desc; |
| Maybe<bool> found = |
| i::JSReceiver::GetOwnPropertyDescriptor(isolate, obj, key_name, &desc); |
| has_pending_exception = found.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| if (!found.FromJust()) { |
| return v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| RETURN_ESCAPED(Utils::ToLocal(desc.ToObject(isolate))); |
| } |
| |
| Local<Value> v8::Object::GetOwnPropertyDescriptor(Local<Name> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(GetOwnPropertyDescriptor(context, key), Value); |
| } |
| |
| |
| Local<Value> v8::Object::GetPrototype() { |
| auto isolate = Utils::OpenHandle(this)->GetIsolate(); |
| auto self = Utils::OpenHandle(this); |
| i::PrototypeIterator iter(isolate, self); |
| return Utils::ToLocal(i::PrototypeIterator::GetCurrent(iter)); |
| } |
| |
| |
| Maybe<bool> v8::Object::SetPrototype(Local<Context> context, |
| Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, SetPrototype, Nothing<bool>(), |
| i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto value_obj = Utils::OpenHandle(*value); |
| // We do not allow exceptions thrown while setting the prototype |
| // to propagate outside. |
| TryCatch try_catch(reinterpret_cast<v8::Isolate*>(isolate)); |
| auto result = |
| i::JSReceiver::SetPrototype(self, value_obj, false, i::kThrowOnError); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(true); |
| } |
| |
| |
| bool v8::Object::SetPrototype(Local<Value> value) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return SetPrototype(context, value).FromMaybe(false); |
| } |
| |
| Local<Object> v8::Object::FindInstanceInPrototypeChain( |
| v8::Local<FunctionTemplate> tmpl) { |
| auto self = Utils::OpenHandle(this); |
| auto isolate = self->GetIsolate(); |
| i::PrototypeIterator iter(isolate, *self, i::kStartAtReceiver); |
| auto tmpl_info = *Utils::OpenHandle(*tmpl); |
| while (!tmpl_info->IsTemplateFor(iter.GetCurrent<i::JSObject>())) { |
| iter.Advance(); |
| if (iter.IsAtEnd()) return Local<Object>(); |
| if (!iter.GetCurrent()->IsJSObject()) return Local<Object>(); |
| } |
| // IsTemplateFor() ensures that iter.GetCurrent() can't be a Proxy here. |
| return Utils::ToLocal(i::handle(iter.GetCurrent<i::JSObject>(), isolate)); |
| } |
| |
| MaybeLocal<Array> v8::Object::GetPropertyNames(Local<Context> context) { |
| return GetPropertyNames( |
| context, v8::KeyCollectionMode::kIncludePrototypes, |
| static_cast<v8::PropertyFilter>(ONLY_ENUMERABLE | SKIP_SYMBOLS), |
| v8::IndexFilter::kIncludeIndices); |
| } |
| |
| MaybeLocal<Array> v8::Object::GetPropertyNames(Local<Context> context, |
| KeyCollectionMode mode, |
| PropertyFilter property_filter, |
| IndexFilter index_filter) { |
| PREPARE_FOR_EXECUTION(context, Object, GetPropertyNames, Array); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::FixedArray> value; |
| i::KeyAccumulator accumulator( |
| isolate, static_cast<i::KeyCollectionMode>(mode), |
| static_cast<i::PropertyFilter>(property_filter)); |
| accumulator.set_skip_indices(index_filter == IndexFilter::kSkipIndices); |
| has_pending_exception = accumulator.CollectKeys(self, self).IsNothing(); |
| RETURN_ON_FAILED_EXECUTION(Array); |
| value = accumulator.GetKeys(i::GetKeysConversion::kKeepNumbers); |
| DCHECK(self->map()->EnumLength() == i::kInvalidEnumCacheSentinel || |
| self->map()->EnumLength() == 0 || |
| self->map()->instance_descriptors()->GetEnumCache()->keys() != *value); |
| auto result = isolate->factory()->NewJSArrayWithElements(value); |
| RETURN_ESCAPED(Utils::ToLocal(result)); |
| } |
| |
| |
| Local<Array> v8::Object::GetPropertyNames() { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(GetPropertyNames(context), Array); |
| } |
| |
| MaybeLocal<Array> v8::Object::GetOwnPropertyNames(Local<Context> context) { |
| return GetOwnPropertyNames( |
| context, static_cast<v8::PropertyFilter>(ONLY_ENUMERABLE | SKIP_SYMBOLS)); |
| } |
| |
| Local<Array> v8::Object::GetOwnPropertyNames() { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(GetOwnPropertyNames(context), Array); |
| } |
| |
| MaybeLocal<Array> v8::Object::GetOwnPropertyNames(Local<Context> context, |
| PropertyFilter filter) { |
| return GetPropertyNames(context, KeyCollectionMode::kOwnOnly, filter, |
| v8::IndexFilter::kIncludeIndices); |
| } |
| |
| MaybeLocal<String> v8::Object::ObjectProtoToString(Local<Context> context) { |
| PREPARE_FOR_EXECUTION(context, Object, ObjectProtoToString, String); |
| auto self = Utils::OpenHandle(this); |
| Local<Value> result; |
| has_pending_exception = |
| !ToLocal<Value>(i::Execution::Call(isolate, isolate->object_to_string(), |
| self, 0, nullptr), |
| &result); |
| RETURN_ON_FAILED_EXECUTION(String); |
| RETURN_ESCAPED(Local<String>::Cast(result)); |
| } |
| |
| |
| Local<String> v8::Object::ObjectProtoToString() { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(ObjectProtoToString(context), String); |
| } |
| |
| |
| Local<String> v8::Object::GetConstructorName() { |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::String> name = i::JSReceiver::GetConstructorName(self); |
| return Utils::ToLocal(name); |
| } |
| |
| Maybe<bool> v8::Object::SetIntegrityLevel(Local<Context> context, |
| IntegrityLevel level) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, SetIntegrityLevel, Nothing<bool>(), |
| i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| i::JSReceiver::IntegrityLevel i_level = |
| level == IntegrityLevel::kFrozen ? i::FROZEN : i::SEALED; |
| Maybe<bool> result = |
| i::JSReceiver::SetIntegrityLevel(self, i_level, i::kThrowOnError); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| Maybe<bool> v8::Object::Delete(Local<Context> context, Local<Value> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(*key); |
| if (self->IsJSProxy()) { |
| ENTER_V8(isolate, context, Object, Delete, Nothing<bool>(), i::HandleScope); |
| Maybe<bool> result = i::Runtime::DeleteObjectProperty( |
| isolate, self, key_obj, i::LanguageMode::kSloppy); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } else { |
| // If it's not a JSProxy, i::Runtime::DeleteObjectProperty should never run |
| // a script. |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, Delete, Nothing<bool>(), |
| i::HandleScope); |
| Maybe<bool> result = i::Runtime::DeleteObjectProperty( |
| isolate, self, key_obj, i::LanguageMode::kSloppy); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| } |
| |
| bool v8::Object::Delete(v8::Local<Value> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return Delete(context, key).FromMaybe(false); |
| } |
| |
| Maybe<bool> v8::Object::DeletePrivate(Local<Context> context, |
| Local<Private> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| // In case of private symbols, i::Runtime::DeleteObjectProperty does not run |
| // any author script. |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, Delete, Nothing<bool>(), |
| i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(*key); |
| Maybe<bool> result = i::Runtime::DeleteObjectProperty( |
| isolate, self, key_obj, i::LanguageMode::kSloppy); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| Maybe<bool> v8::Object::Has(Local<Context> context, Local<Value> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, Has, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(*key); |
| Maybe<bool> maybe = Nothing<bool>(); |
| // Check if the given key is an array index. |
| uint32_t index = 0; |
| if (key_obj->ToArrayIndex(&index)) { |
| maybe = i::JSReceiver::HasElement(self, index); |
| } else { |
| // Convert the key to a name - possibly by calling back into JavaScript. |
| i::Handle<i::Name> name; |
| if (i::Object::ToName(isolate, key_obj).ToHandle(&name)) { |
| maybe = i::JSReceiver::HasProperty(self, name); |
| } |
| } |
| has_pending_exception = maybe.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return maybe; |
| } |
| |
| |
| bool v8::Object::Has(v8::Local<Value> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return Has(context, key).FromMaybe(false); |
| } |
| |
| |
| Maybe<bool> v8::Object::HasPrivate(Local<Context> context, Local<Private> key) { |
| return HasOwnProperty(context, Local<Name>(reinterpret_cast<Name*>(*key))); |
| } |
| |
| |
| Maybe<bool> v8::Object::Delete(Local<Context> context, uint32_t index) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, Delete, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| Maybe<bool> result = i::JSReceiver::DeleteElement(self, index); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| |
| bool v8::Object::Delete(uint32_t index) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return Delete(context, index).FromMaybe(false); |
| } |
| |
| |
| Maybe<bool> v8::Object::Has(Local<Context> context, uint32_t index) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, Has, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto maybe = i::JSReceiver::HasElement(self, index); |
| has_pending_exception = maybe.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return maybe; |
| } |
| |
| |
| bool v8::Object::Has(uint32_t index) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return Has(context, index).FromMaybe(false); |
| } |
| |
| template <typename Getter, typename Setter, typename Data> |
| static Maybe<bool> ObjectSetAccessor(Local<Context> context, Object* self, |
| Local<Name> name, Getter getter, |
| Setter setter, Data data, |
| AccessControl settings, |
| PropertyAttribute attributes, |
| bool is_special_data_property) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, SetAccessor, Nothing<bool>(), |
| i::HandleScope); |
| if (!Utils::OpenHandle(self)->IsJSObject()) return Just(false); |
| i::Handle<i::JSObject> obj = |
| i::Handle<i::JSObject>::cast(Utils::OpenHandle(self)); |
| v8::Local<AccessorSignature> signature; |
| i::Handle<i::AccessorInfo> info = |
| MakeAccessorInfo(isolate, name, getter, setter, data, settings, signature, |
| is_special_data_property, false); |
| if (info.is_null()) return Nothing<bool>(); |
| bool fast = obj->HasFastProperties(); |
| i::Handle<i::Object> result; |
| |
| i::Handle<i::Name> accessor_name(info->name(), isolate); |
| i::PropertyAttributes attrs = static_cast<i::PropertyAttributes>(attributes); |
| has_pending_exception = |
| !i::JSObject::SetAccessor(obj, accessor_name, info, attrs) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| if (result->IsUndefined(obj->GetIsolate())) return Just(false); |
| if (fast) { |
| i::JSObject::MigrateSlowToFast(obj, 0, "APISetAccessor"); |
| } |
| return Just(true); |
| } |
| |
| |
| Maybe<bool> Object::SetAccessor(Local<Context> context, Local<Name> name, |
| AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter, |
| MaybeLocal<Value> data, AccessControl settings, |
| PropertyAttribute attribute) { |
| return ObjectSetAccessor(context, this, name, getter, setter, |
| data.FromMaybe(Local<Value>()), settings, attribute, |
| i::FLAG_disable_old_api_accessors); |
| } |
| |
| |
| bool Object::SetAccessor(Local<String> name, AccessorGetterCallback getter, |
| AccessorSetterCallback setter, v8::Local<Value> data, |
| AccessControl settings, PropertyAttribute attributes) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return ObjectSetAccessor(context, this, name, getter, setter, data, settings, |
| attributes, i::FLAG_disable_old_api_accessors) |
| .FromMaybe(false); |
| } |
| |
| |
| bool Object::SetAccessor(Local<Name> name, AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter, |
| v8::Local<Value> data, AccessControl settings, |
| PropertyAttribute attributes) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return ObjectSetAccessor(context, this, name, getter, setter, data, settings, |
| attributes, i::FLAG_disable_old_api_accessors) |
| .FromMaybe(false); |
| } |
| |
| |
| void Object::SetAccessorProperty(Local<Name> name, Local<Function> getter, |
| Local<Function> setter, |
| PropertyAttribute attribute, |
| AccessControl settings) { |
| // TODO(verwaest): Remove |settings|. |
| DCHECK_EQ(v8::DEFAULT, settings); |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSObject()) return; |
| i::Handle<i::Object> getter_i = v8::Utils::OpenHandle(*getter); |
| i::Handle<i::Object> setter_i = v8::Utils::OpenHandle(*setter, true); |
| if (setter_i.is_null()) setter_i = isolate->factory()->null_value(); |
| i::JSObject::DefineAccessor(i::Handle<i::JSObject>::cast(self), |
| v8::Utils::OpenHandle(*name), getter_i, setter_i, |
| static_cast<i::PropertyAttributes>(attribute)); |
| } |
| |
| Maybe<bool> Object::SetNativeDataProperty(v8::Local<v8::Context> context, |
| v8::Local<Name> name, |
| AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter, |
| v8::Local<Value> data, |
| PropertyAttribute attributes) { |
| return ObjectSetAccessor(context, this, name, getter, setter, data, DEFAULT, |
| attributes, true); |
| } |
| |
| Maybe<bool> v8::Object::HasOwnProperty(Local<Context> context, |
| Local<Name> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, HasOwnProperty, Nothing<bool>(), |
| i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto key_val = Utils::OpenHandle(*key); |
| auto result = i::JSReceiver::HasOwnProperty(self, key_val); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| Maybe<bool> v8::Object::HasOwnProperty(Local<Context> context, uint32_t index) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Object, HasOwnProperty, Nothing<bool>(), |
| i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto result = i::JSReceiver::HasOwnProperty(self, index); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| bool v8::Object::HasOwnProperty(Local<String> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return HasOwnProperty(context, key).FromMaybe(false); |
| } |
| |
| |
| Maybe<bool> v8::Object::HasRealNamedProperty(Local<Context> context, |
| Local<Name> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, HasRealNamedProperty, |
| Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSObject()) return Just(false); |
| auto key_val = Utils::OpenHandle(*key); |
| auto result = i::JSObject::HasRealNamedProperty( |
| i::Handle<i::JSObject>::cast(self), key_val); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| |
| bool v8::Object::HasRealNamedProperty(Local<String> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return HasRealNamedProperty(context, key).FromMaybe(false); |
| } |
| |
| |
| Maybe<bool> v8::Object::HasRealIndexedProperty(Local<Context> context, |
| uint32_t index) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, HasRealIndexedProperty, |
| Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSObject()) return Just(false); |
| auto result = i::JSObject::HasRealElementProperty( |
| i::Handle<i::JSObject>::cast(self), index); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| |
| bool v8::Object::HasRealIndexedProperty(uint32_t index) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return HasRealIndexedProperty(context, index).FromMaybe(false); |
| } |
| |
| |
| Maybe<bool> v8::Object::HasRealNamedCallbackProperty(Local<Context> context, |
| Local<Name> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, HasRealNamedCallbackProperty, |
| Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSObject()) return Just(false); |
| auto key_val = Utils::OpenHandle(*key); |
| auto result = i::JSObject::HasRealNamedCallbackProperty( |
| i::Handle<i::JSObject>::cast(self), key_val); |
| has_pending_exception = result.IsNothing(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return result; |
| } |
| |
| |
| bool v8::Object::HasRealNamedCallbackProperty(Local<String> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return HasRealNamedCallbackProperty(context, key).FromMaybe(false); |
| } |
| |
| |
| bool v8::Object::HasNamedLookupInterceptor() { |
| auto self = Utils::OpenHandle(this); |
| return self->IsJSObject() && |
| i::Handle<i::JSObject>::cast(self)->HasNamedInterceptor(); |
| } |
| |
| |
| bool v8::Object::HasIndexedLookupInterceptor() { |
| auto self = Utils::OpenHandle(this); |
| return self->IsJSObject() && |
| i::Handle<i::JSObject>::cast(self)->HasIndexedInterceptor(); |
| } |
| |
| |
| MaybeLocal<Value> v8::Object::GetRealNamedPropertyInPrototypeChain( |
| Local<Context> context, Local<Name> key) { |
| PREPARE_FOR_EXECUTION(context, Object, GetRealNamedPropertyInPrototypeChain, |
| Value); |
| i::Handle<i::JSReceiver> self = Utils::OpenHandle(this); |
| if (!self->IsJSObject()) return MaybeLocal<Value>(); |
| i::Handle<i::Name> key_obj = Utils::OpenHandle(*key); |
| i::PrototypeIterator iter(isolate, self); |
| if (iter.IsAtEnd()) return MaybeLocal<Value>(); |
| i::Handle<i::JSReceiver> proto = |
| i::PrototypeIterator::GetCurrent<i::JSReceiver>(iter); |
| i::LookupIterator it = i::LookupIterator::PropertyOrElement( |
| isolate, self, key_obj, proto, |
| i::LookupIterator::PROTOTYPE_CHAIN_SKIP_INTERCEPTOR); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>(i::Object::GetProperty(&it), &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| if (!it.IsFound()) return MaybeLocal<Value>(); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<Value> v8::Object::GetRealNamedPropertyInPrototypeChain( |
| Local<String> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(GetRealNamedPropertyInPrototypeChain(context, key), |
| Value); |
| } |
| |
| |
| Maybe<PropertyAttribute> |
| v8::Object::GetRealNamedPropertyAttributesInPrototypeChain( |
| Local<Context> context, Local<Name> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, |
| GetRealNamedPropertyAttributesInPrototypeChain, |
| Nothing<PropertyAttribute>(), i::HandleScope); |
| i::Handle<i::JSReceiver> self = Utils::OpenHandle(this); |
| if (!self->IsJSObject()) return Nothing<PropertyAttribute>(); |
| i::Handle<i::Name> key_obj = Utils::OpenHandle(*key); |
| i::PrototypeIterator iter(isolate, self); |
| if (iter.IsAtEnd()) return Nothing<PropertyAttribute>(); |
| i::Handle<i::JSReceiver> proto = |
| i::PrototypeIterator::GetCurrent<i::JSReceiver>(iter); |
| i::LookupIterator it = i::LookupIterator::PropertyOrElement( |
| isolate, self, key_obj, proto, |
| i::LookupIterator::PROTOTYPE_CHAIN_SKIP_INTERCEPTOR); |
| Maybe<i::PropertyAttributes> result = |
| i::JSReceiver::GetPropertyAttributes(&it); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(PropertyAttribute); |
| if (!it.IsFound()) return Nothing<PropertyAttribute>(); |
| if (result.FromJust() == i::ABSENT) return Just(None); |
| return Just(static_cast<PropertyAttribute>(result.FromJust())); |
| } |
| |
| |
| Maybe<PropertyAttribute> |
| v8::Object::GetRealNamedPropertyAttributesInPrototypeChain(Local<String> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return GetRealNamedPropertyAttributesInPrototypeChain(context, key); |
| } |
| |
| |
| MaybeLocal<Value> v8::Object::GetRealNamedProperty(Local<Context> context, |
| Local<Name> key) { |
| PREPARE_FOR_EXECUTION(context, Object, GetRealNamedProperty, Value); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(*key); |
| i::LookupIterator it = i::LookupIterator::PropertyOrElement( |
| isolate, self, key_obj, self, |
| i::LookupIterator::PROTOTYPE_CHAIN_SKIP_INTERCEPTOR); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>(i::Object::GetProperty(&it), &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| if (!it.IsFound()) return MaybeLocal<Value>(); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<Value> v8::Object::GetRealNamedProperty(Local<String> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(GetRealNamedProperty(context, key), Value); |
| } |
| |
| |
| Maybe<PropertyAttribute> v8::Object::GetRealNamedPropertyAttributes( |
| Local<Context> context, Local<Name> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT(isolate, context, Object, GetRealNamedPropertyAttributes, |
| Nothing<PropertyAttribute>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| auto key_obj = Utils::OpenHandle(*key); |
| i::LookupIterator it = i::LookupIterator::PropertyOrElement( |
| isolate, self, key_obj, self, |
| i::LookupIterator::PROTOTYPE_CHAIN_SKIP_INTERCEPTOR); |
| auto result = i::JSReceiver::GetPropertyAttributes(&it); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(PropertyAttribute); |
| if (!it.IsFound()) return Nothing<PropertyAttribute>(); |
| if (result.FromJust() == i::ABSENT) { |
| return Just(static_cast<PropertyAttribute>(i::NONE)); |
| } |
| return Just<PropertyAttribute>( |
| static_cast<PropertyAttribute>(result.FromJust())); |
| } |
| |
| |
| Maybe<PropertyAttribute> v8::Object::GetRealNamedPropertyAttributes( |
| Local<String> key) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| return GetRealNamedPropertyAttributes(context, key); |
| } |
| |
| |
| Local<v8::Object> v8::Object::Clone() { |
| auto self = i::Handle<i::JSObject>::cast(Utils::OpenHandle(this)); |
| auto isolate = self->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| auto result = isolate->factory()->CopyJSObject(self); |
| CHECK(!result.is_null()); |
| return Utils::ToLocal(result); |
| } |
| |
| |
| Local<v8::Context> v8::Object::CreationContext() { |
| auto self = Utils::OpenHandle(this); |
| return Utils::ToLocal(self->GetCreationContext()); |
| } |
| |
| |
| int v8::Object::GetIdentityHash() { |
| i::DisallowHeapAllocation no_gc; |
| auto isolate = Utils::OpenHandle(this)->GetIsolate(); |
| i::HandleScope scope(isolate); |
| auto self = Utils::OpenHandle(this); |
| return self->GetOrCreateIdentityHash(isolate)->value(); |
| } |
| |
| |
| bool v8::Object::IsCallable() { |
| auto self = Utils::OpenHandle(this); |
| return self->IsCallable(); |
| } |
| |
| bool v8::Object::IsConstructor() { |
| auto self = Utils::OpenHandle(this); |
| return self->IsConstructor(); |
| } |
| |
| MaybeLocal<Value> Object::CallAsFunction(Local<Context> context, |
| Local<Value> recv, int argc, |
| Local<Value> argv[]) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.Execute"); |
| ENTER_V8(isolate, context, Object, CallAsFunction, MaybeLocal<Value>(), |
| InternalEscapableScope); |
| i::TimerEventScope<i::TimerEventExecute> timer_scope(isolate); |
| auto self = Utils::OpenHandle(this); |
| auto recv_obj = Utils::OpenHandle(*recv); |
| STATIC_ASSERT(sizeof(v8::Local<v8::Value>) == sizeof(i::Object**)); |
| i::Handle<i::Object>* args = reinterpret_cast<i::Handle<i::Object>*>(argv); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>( |
| i::Execution::Call(isolate, self, recv_obj, argc, args), &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::Value> Object::CallAsFunction(v8::Local<v8::Value> recv, int argc, |
| v8::Local<v8::Value> argv[]) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| Local<Value>* argv_cast = reinterpret_cast<Local<Value>*>(argv); |
| RETURN_TO_LOCAL_UNCHECKED(CallAsFunction(context, recv, argc, argv_cast), |
| Value); |
| } |
| |
| |
| MaybeLocal<Value> Object::CallAsConstructor(Local<Context> context, int argc, |
| Local<Value> argv[]) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.Execute"); |
| ENTER_V8(isolate, context, Object, CallAsConstructor, MaybeLocal<Value>(), |
| InternalEscapableScope); |
| i::TimerEventScope<i::TimerEventExecute> timer_scope(isolate); |
| auto self = Utils::OpenHandle(this); |
| STATIC_ASSERT(sizeof(v8::Local<v8::Value>) == sizeof(i::Object**)); |
| i::Handle<i::Object>* args = reinterpret_cast<i::Handle<i::Object>*>(argv); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>( |
| i::Execution::New(isolate, self, self, argc, args), &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::Value> Object::CallAsConstructor(int argc, |
| v8::Local<v8::Value> argv[]) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| Local<Value>* argv_cast = reinterpret_cast<Local<Value>*>(argv); |
| RETURN_TO_LOCAL_UNCHECKED(CallAsConstructor(context, argc, argv_cast), Value); |
| } |
| |
| MaybeLocal<Function> Function::New(Local<Context> context, |
| FunctionCallback callback, Local<Value> data, |
| int length, ConstructorBehavior behavior) { |
| i::Isolate* isolate = Utils::OpenHandle(*context)->GetIsolate(); |
| LOG_API(isolate, Function, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| auto templ = FunctionTemplateNew(isolate, callback, data, Local<Signature>(), |
| length, true); |
| if (behavior == ConstructorBehavior::kThrow) templ->RemovePrototype(); |
| return templ->GetFunction(context); |
| } |
| |
| |
| Local<Function> Function::New(Isolate* v8_isolate, FunctionCallback callback, |
| Local<Value> data, int length) { |
| return Function::New(v8_isolate->GetCurrentContext(), callback, data, length, |
| ConstructorBehavior::kAllow) |
| .FromMaybe(Local<Function>()); |
| } |
| |
| |
| Local<v8::Object> Function::NewInstance() const { |
| return NewInstance(Isolate::GetCurrent()->GetCurrentContext(), 0, nullptr) |
| .FromMaybe(Local<Object>()); |
| } |
| |
| |
| MaybeLocal<Object> Function::NewInstance(Local<Context> context, int argc, |
| v8::Local<v8::Value> argv[]) const { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.Execute"); |
| ENTER_V8(isolate, context, Function, NewInstance, MaybeLocal<Object>(), |
| InternalEscapableScope); |
| i::TimerEventScope<i::TimerEventExecute> timer_scope(isolate); |
| auto self = Utils::OpenHandle(this); |
| STATIC_ASSERT(sizeof(v8::Local<v8::Value>) == sizeof(i::Object**)); |
| i::Handle<i::Object>* args = reinterpret_cast<i::Handle<i::Object>*>(argv); |
| Local<Object> result; |
| has_pending_exception = !ToLocal<Object>( |
| i::Execution::New(isolate, self, self, argc, args), &result); |
| RETURN_ON_FAILED_EXECUTION(Object); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::Object> Function::NewInstance(int argc, |
| v8::Local<v8::Value> argv[]) const { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(NewInstance(context, argc, argv), Object); |
| } |
| |
| |
| MaybeLocal<v8::Value> Function::Call(Local<Context> context, |
| v8::Local<v8::Value> recv, int argc, |
| v8::Local<v8::Value> argv[]) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.Execute"); |
| ENTER_V8(isolate, context, Function, Call, MaybeLocal<Value>(), |
| InternalEscapableScope); |
| i::TimerEventScope<i::TimerEventExecute> timer_scope(isolate); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> recv_obj = Utils::OpenHandle(*recv); |
| STATIC_ASSERT(sizeof(v8::Local<v8::Value>) == sizeof(i::Object**)); |
| i::Handle<i::Object>* args = reinterpret_cast<i::Handle<i::Object>*>(argv); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>( |
| i::Execution::Call(isolate, self, recv_obj, argc, args), &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::Value> Function::Call(v8::Local<v8::Value> recv, int argc, |
| v8::Local<v8::Value> argv[]) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(Call(context, recv, argc, argv), Value); |
| } |
| |
| |
| void Function::SetName(v8::Local<v8::String> name) { |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) return; |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| func->shared()->set_name(*Utils::OpenHandle(*name)); |
| } |
| |
| |
| Local<Value> Function::GetName() const { |
| auto self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| if (self->IsJSBoundFunction()) { |
| auto func = i::Handle<i::JSBoundFunction>::cast(self); |
| i::Handle<i::Object> name; |
| ASSIGN_RETURN_ON_EXCEPTION_VALUE(isolate, name, |
| i::JSBoundFunction::GetName(isolate, func), |
| Local<Value>()); |
| return Utils::ToLocal(name); |
| } |
| if (self->IsJSFunction()) { |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| return Utils::ToLocal(handle(func->shared()->name(), isolate)); |
| } |
| return ToApiHandle<Primitive>(isolate->factory()->undefined_value()); |
| } |
| |
| |
| Local<Value> Function::GetInferredName() const { |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) { |
| return ToApiHandle<Primitive>( |
| self->GetIsolate()->factory()->undefined_value()); |
| } |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| return Utils::ToLocal(i::Handle<i::Object>(func->shared()->inferred_name(), |
| func->GetIsolate())); |
| } |
| |
| |
| Local<Value> Function::GetDebugName() const { |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) { |
| return ToApiHandle<Primitive>( |
| self->GetIsolate()->factory()->undefined_value()); |
| } |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| i::Handle<i::String> name = i::JSFunction::GetDebugName(func); |
| return Utils::ToLocal(i::Handle<i::Object>(*name, name->GetIsolate())); |
| } |
| |
| |
| Local<Value> Function::GetDisplayName() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) { |
| return ToApiHandle<Primitive>(isolate->factory()->undefined_value()); |
| } |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| i::Handle<i::String> property_name = |
| isolate->factory()->NewStringFromStaticChars("displayName"); |
| i::Handle<i::Object> value = |
| i::JSReceiver::GetDataProperty(func, property_name); |
| if (value->IsString()) { |
| i::Handle<i::String> name = i::Handle<i::String>::cast(value); |
| if (name->length() > 0) return Utils::ToLocal(name); |
| } |
| return ToApiHandle<Primitive>(isolate->factory()->undefined_value()); |
| } |
| |
| |
| ScriptOrigin Function::GetScriptOrigin() const { |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) { |
| return v8::ScriptOrigin(Local<Value>()); |
| } |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| if (func->shared()->script()->IsScript()) { |
| i::Handle<i::Script> script(i::Script::cast(func->shared()->script())); |
| return GetScriptOriginForScript(func->GetIsolate(), script); |
| } |
| return v8::ScriptOrigin(Local<Value>()); |
| } |
| |
| |
| const int Function::kLineOffsetNotFound = -1; |
| |
| |
| int Function::GetScriptLineNumber() const { |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) { |
| return kLineOffsetNotFound; |
| } |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| if (func->shared()->script()->IsScript()) { |
| i::Handle<i::Script> script(i::Script::cast(func->shared()->script())); |
| return i::Script::GetLineNumber(script, func->shared()->start_position()); |
| } |
| return kLineOffsetNotFound; |
| } |
| |
| |
| int Function::GetScriptColumnNumber() const { |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) { |
| return kLineOffsetNotFound; |
| } |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| if (func->shared()->script()->IsScript()) { |
| i::Handle<i::Script> script(i::Script::cast(func->shared()->script())); |
| return i::Script::GetColumnNumber(script, func->shared()->start_position()); |
| } |
| return kLineOffsetNotFound; |
| } |
| |
| |
| bool Function::IsBuiltin() const { |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) { |
| return false; |
| } |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| return !func->shared()->IsUserJavaScript(); |
| } |
| |
| |
| int Function::ScriptId() const { |
| auto self = Utils::OpenHandle(this); |
| if (!self->IsJSFunction()) { |
| return v8::UnboundScript::kNoScriptId; |
| } |
| auto func = i::Handle<i::JSFunction>::cast(self); |
| if (!func->shared()->script()->IsScript()) { |
| return v8::UnboundScript::kNoScriptId; |
| } |
| i::Handle<i::Script> script(i::Script::cast(func->shared()->script())); |
| return script->id(); |
| } |
| |
| |
| Local<v8::Value> Function::GetBoundFunction() const { |
| auto self = Utils::OpenHandle(this); |
| if (self->IsJSBoundFunction()) { |
| auto bound_function = i::Handle<i::JSBoundFunction>::cast(self); |
| auto bound_target_function = i::handle( |
| bound_function->bound_target_function(), bound_function->GetIsolate()); |
| return Utils::CallableToLocal(bound_target_function); |
| } |
| return v8::Undefined(reinterpret_cast<v8::Isolate*>(self->GetIsolate())); |
| } |
| |
| int Name::GetIdentityHash() { |
| auto self = Utils::OpenHandle(this); |
| return static_cast<int>(self->Hash()); |
| } |
| |
| |
| int String::Length() const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| return str->length(); |
| } |
| |
| |
| bool String::IsOneByte() const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| return str->HasOnlyOneByteChars(); |
| } |
| |
| |
| // Helpers for ContainsOnlyOneByteHelper |
| template<size_t size> struct OneByteMask; |
| template<> struct OneByteMask<4> { |
| static const uint32_t value = 0xFF00FF00; |
| }; |
| template<> struct OneByteMask<8> { |
| static const uint64_t value = V8_2PART_UINT64_C(0xFF00FF00, FF00FF00); |
| }; |
| static const uintptr_t kOneByteMask = OneByteMask<sizeof(uintptr_t)>::value; |
| static const uintptr_t kAlignmentMask = sizeof(uintptr_t) - 1; |
| static inline bool Unaligned(const uint16_t* chars) { |
| return reinterpret_cast<const uintptr_t>(chars) & kAlignmentMask; |
| } |
| |
| |
| static inline const uint16_t* Align(const uint16_t* chars) { |
| return reinterpret_cast<uint16_t*>( |
| reinterpret_cast<uintptr_t>(chars) & ~kAlignmentMask); |
| } |
| |
| class ContainsOnlyOneByteHelper { |
| public: |
| ContainsOnlyOneByteHelper() : is_one_byte_(true) {} |
| bool Check(i::String* string) { |
| i::ConsString* cons_string = i::String::VisitFlat(this, string, 0); |
| if (cons_string == nullptr) return is_one_byte_; |
| return CheckCons(cons_string); |
| } |
| void VisitOneByteString(const uint8_t* chars, int length) { |
| // Nothing to do. |
| } |
| void VisitTwoByteString(const uint16_t* chars, int length) { |
| // Accumulated bits. |
| uintptr_t acc = 0; |
| // Align to uintptr_t. |
| const uint16_t* end = chars + length; |
| while (Unaligned(chars) && chars != end) { |
| acc |= *chars++; |
| } |
| // Read word aligned in blocks, |
| // checking the return value at the end of each block. |
| const uint16_t* aligned_end = Align(end); |
| const int increment = sizeof(uintptr_t)/sizeof(uint16_t); |
| const int inner_loops = 16; |
| while (chars + inner_loops*increment < aligned_end) { |
| for (int i = 0; i < inner_loops; i++) { |
| acc |= *reinterpret_cast<const uintptr_t*>(chars); |
| chars += increment; |
| } |
| // Check for early return. |
| if ((acc & kOneByteMask) != 0) { |
| is_one_byte_ = false; |
| return; |
| } |
| } |
| // Read the rest. |
| while (chars != end) { |
| acc |= *chars++; |
| } |
| // Check result. |
| if ((acc & kOneByteMask) != 0) is_one_byte_ = false; |
| } |
| |
| private: |
| bool CheckCons(i::ConsString* cons_string) { |
| while (true) { |
| // Check left side if flat. |
| i::String* left = cons_string->first(); |
| i::ConsString* left_as_cons = |
| i::String::VisitFlat(this, left, 0); |
| if (!is_one_byte_) return false; |
| // Check right side if flat. |
| i::String* right = cons_string->second(); |
| i::ConsString* right_as_cons = |
| i::String::VisitFlat(this, right, 0); |
| if (!is_one_byte_) return false; |
| // Standard recurse/iterate trick. |
| if (left_as_cons != nullptr && right_as_cons != nullptr) { |
| if (left->length() < right->length()) { |
| CheckCons(left_as_cons); |
| cons_string = right_as_cons; |
| } else { |
| CheckCons(right_as_cons); |
| cons_string = left_as_cons; |
| } |
| // Check fast return. |
| if (!is_one_byte_) return false; |
| continue; |
| } |
| // Descend left in place. |
| if (left_as_cons != nullptr) { |
| cons_string = left_as_cons; |
| continue; |
| } |
| // Descend right in place. |
| if (right_as_cons != nullptr) { |
| cons_string = right_as_cons; |
| continue; |
| } |
| // Terminate. |
| break; |
| } |
| return is_one_byte_; |
| } |
| bool is_one_byte_; |
| DISALLOW_COPY_AND_ASSIGN(ContainsOnlyOneByteHelper); |
| }; |
| |
| |
| bool String::ContainsOnlyOneByte() const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| if (str->HasOnlyOneByteChars()) return true; |
| ContainsOnlyOneByteHelper helper; |
| return helper.Check(*str); |
| } |
| |
| |
| class Utf8LengthHelper : public i::AllStatic { |
| public: |
| enum State { |
| kEndsWithLeadingSurrogate = 1 << 0, |
| kStartsWithTrailingSurrogate = 1 << 1, |
| kLeftmostEdgeIsCalculated = 1 << 2, |
| kRightmostEdgeIsCalculated = 1 << 3, |
| kLeftmostEdgeIsSurrogate = 1 << 4, |
| kRightmostEdgeIsSurrogate = 1 << 5 |
| }; |
| |
| static const uint8_t kInitialState = 0; |
| |
| static inline bool EndsWithSurrogate(uint8_t state) { |
| return state & kEndsWithLeadingSurrogate; |
| } |
| |
| static inline bool StartsWithSurrogate(uint8_t state) { |
| return state & kStartsWithTrailingSurrogate; |
| } |
| |
| class Visitor { |
| public: |
| Visitor() : utf8_length_(0), state_(kInitialState) {} |
| |
| void VisitOneByteString(const uint8_t* chars, int length) { |
| int utf8_length = 0; |
| // Add in length 1 for each non-Latin1 character. |
| for (int i = 0; i < length; i++) { |
| utf8_length += *chars++ >> 7; |
| } |
| // Add in length 1 for each character. |
| utf8_length_ = utf8_length + length; |
| state_ = kInitialState; |
| } |
| |
| void VisitTwoByteString(const uint16_t* chars, int length) { |
| int utf8_length = 0; |
| int last_character = unibrow::Utf16::kNoPreviousCharacter; |
| for (int i = 0; i < length; i++) { |
| uint16_t c = chars[i]; |
| utf8_length += unibrow::Utf8::Length(c, last_character); |
| last_character = c; |
| } |
| utf8_length_ = utf8_length; |
| uint8_t state = 0; |
| if (unibrow::Utf16::IsTrailSurrogate(chars[0])) { |
| state |= kStartsWithTrailingSurrogate; |
| } |
| if (unibrow::Utf16::IsLeadSurrogate(chars[length-1])) { |
| state |= kEndsWithLeadingSurrogate; |
| } |
| state_ = state; |
| } |
| |
| static i::ConsString* VisitFlat(i::String* string, |
| int* length, |
| uint8_t* state) { |
| Visitor visitor; |
| i::ConsString* cons_string = i::String::VisitFlat(&visitor, string); |
| *length = visitor.utf8_length_; |
| *state = visitor.state_; |
| return cons_string; |
| } |
| |
| private: |
| int utf8_length_; |
| uint8_t state_; |
| DISALLOW_COPY_AND_ASSIGN(Visitor); |
| }; |
| |
| static inline void MergeLeafLeft(int* length, |
| uint8_t* state, |
| uint8_t leaf_state) { |
| bool edge_surrogate = StartsWithSurrogate(leaf_state); |
| if (!(*state & kLeftmostEdgeIsCalculated)) { |
| DCHECK(!(*state & kLeftmostEdgeIsSurrogate)); |
| *state |= kLeftmostEdgeIsCalculated |
| | (edge_surrogate ? kLeftmostEdgeIsSurrogate : 0); |
| } else if (EndsWithSurrogate(*state) && edge_surrogate) { |
| *length -= unibrow::Utf8::kBytesSavedByCombiningSurrogates; |
| } |
| if (EndsWithSurrogate(leaf_state)) { |
| *state |= kEndsWithLeadingSurrogate; |
| } else { |
| *state &= ~kEndsWithLeadingSurrogate; |
| } |
| } |
| |
| static inline void MergeLeafRight(int* length, |
| uint8_t* state, |
| uint8_t leaf_state) { |
| bool edge_surrogate = EndsWithSurrogate(leaf_state); |
| if (!(*state & kRightmostEdgeIsCalculated)) { |
| DCHECK(!(*state & kRightmostEdgeIsSurrogate)); |
| *state |= (kRightmostEdgeIsCalculated |
| | (edge_surrogate ? kRightmostEdgeIsSurrogate : 0)); |
| } else if (edge_surrogate && StartsWithSurrogate(*state)) { |
| *length -= unibrow::Utf8::kBytesSavedByCombiningSurrogates; |
| } |
| if (StartsWithSurrogate(leaf_state)) { |
| *state |= kStartsWithTrailingSurrogate; |
| } else { |
| *state &= ~kStartsWithTrailingSurrogate; |
| } |
| } |
| |
| static inline void MergeTerminal(int* length, |
| uint8_t state, |
| uint8_t* state_out) { |
| DCHECK((state & kLeftmostEdgeIsCalculated) && |
| (state & kRightmostEdgeIsCalculated)); |
| if (EndsWithSurrogate(state) && StartsWithSurrogate(state)) { |
| *length -= unibrow::Utf8::kBytesSavedByCombiningSurrogates; |
| } |
| *state_out = kInitialState | |
| (state & kLeftmostEdgeIsSurrogate ? kStartsWithTrailingSurrogate : 0) | |
| (state & kRightmostEdgeIsSurrogate ? kEndsWithLeadingSurrogate : 0); |
| } |
| |
| static int Calculate(i::ConsString* current, uint8_t* state_out) { |
| using internal::ConsString; |
| int total_length = 0; |
| uint8_t state = kInitialState; |
| while (true) { |
| i::String* left = current->first(); |
| i::String* right = current->second(); |
| uint8_t right_leaf_state; |
| uint8_t left_leaf_state; |
| int leaf_length; |
| ConsString* left_as_cons = |
| Visitor::VisitFlat(left, &leaf_length, &left_leaf_state); |
| if (left_as_cons == nullptr) { |
| total_length += leaf_length; |
| MergeLeafLeft(&total_length, &state, left_leaf_state); |
| } |
| ConsString* right_as_cons = |
| Visitor::VisitFlat(right, &leaf_length, &right_leaf_state); |
| if (right_as_cons == nullptr) { |
| total_length += leaf_length; |
| MergeLeafRight(&total_length, &state, right_leaf_state); |
| if (left_as_cons != nullptr) { |
| // 1 Leaf node. Descend in place. |
| current = left_as_cons; |
| continue; |
| } else { |
| // Terminal node. |
| MergeTerminal(&total_length, state, state_out); |
| return total_length; |
| } |
| } else if (left_as_cons == nullptr) { |
| // 1 Leaf node. Descend in place. |
| current = right_as_cons; |
| continue; |
| } |
| // Both strings are ConsStrings. |
| // Recurse on smallest. |
| if (left->length() < right->length()) { |
| total_length += Calculate(left_as_cons, &left_leaf_state); |
| MergeLeafLeft(&total_length, &state, left_leaf_state); |
| current = right_as_cons; |
| } else { |
| total_length += Calculate(right_as_cons, &right_leaf_state); |
| MergeLeafRight(&total_length, &state, right_leaf_state); |
| current = left_as_cons; |
| } |
| } |
| UNREACHABLE(); |
| } |
| |
| static inline int Calculate(i::ConsString* current) { |
| uint8_t state = kInitialState; |
| return Calculate(current, &state); |
| } |
| |
| private: |
| DISALLOW_IMPLICIT_CONSTRUCTORS(Utf8LengthHelper); |
| }; |
| |
| |
| static int Utf8Length(i::String* str, i::Isolate* isolate) { |
| int length = str->length(); |
| if (length == 0) return 0; |
| uint8_t state; |
| i::ConsString* cons_string = |
| Utf8LengthHelper::Visitor::VisitFlat(str, &length, &state); |
| if (cons_string == nullptr) return length; |
| return Utf8LengthHelper::Calculate(cons_string); |
| } |
| |
| |
| int String::Utf8Length() const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| i::Isolate* isolate = str->GetIsolate(); |
| return v8::Utf8Length(*str, isolate); |
| } |
| |
| |
| class Utf8WriterVisitor { |
| public: |
| Utf8WriterVisitor( |
| char* buffer, |
| int capacity, |
| bool skip_capacity_check, |
| bool replace_invalid_utf8) |
| : early_termination_(false), |
| last_character_(unibrow::Utf16::kNoPreviousCharacter), |
| buffer_(buffer), |
| start_(buffer), |
| capacity_(capacity), |
| skip_capacity_check_(capacity == -1 || skip_capacity_check), |
| replace_invalid_utf8_(replace_invalid_utf8), |
| utf16_chars_read_(0) { |
| } |
| |
| static int WriteEndCharacter(uint16_t character, |
| int last_character, |
| int remaining, |
| char* const buffer, |
| bool replace_invalid_utf8) { |
| DCHECK_GT(remaining, 0); |
| // We can't use a local buffer here because Encode needs to modify |
| // previous characters in the stream. We know, however, that |
| // exactly one character will be advanced. |
| if (unibrow::Utf16::IsSurrogatePair(last_character, character)) { |
| int written = unibrow::Utf8::Encode(buffer, character, last_character, |
| replace_invalid_utf8); |
| DCHECK_EQ(written, 1); |
| return written; |
| } |
| // Use a scratch buffer to check the required characters. |
| char temp_buffer[unibrow::Utf8::kMaxEncodedSize]; |
| // Can't encode using last_character as gcc has array bounds issues. |
| int written = unibrow::Utf8::Encode(temp_buffer, character, |
| unibrow::Utf16::kNoPreviousCharacter, |
| replace_invalid_utf8); |
| // Won't fit. |
| if (written > remaining) return 0; |
| // Copy over the character from temp_buffer. |
| for (int j = 0; j < written; j++) { |
| buffer[j] = temp_buffer[j]; |
| } |
| return written; |
| } |
| |
| // Visit writes out a group of code units (chars) of a v8::String to the |
| // internal buffer_. This is done in two phases. The first phase calculates a |
| // pesimistic estimate (writable_length) on how many code units can be safely |
| // written without exceeding the buffer capacity and without writing the last |
| // code unit (it could be a lead surrogate). The estimated number of code |
| // units is then written out in one go, and the reported byte usage is used |
| // to correct the estimate. This is repeated until the estimate becomes <= 0 |
| // or all code units have been written out. The second phase writes out code |
| // units until the buffer capacity is reached, would be exceeded by the next |
| // unit, or all units have been written out. |
| template<typename Char> |
| void Visit(const Char* chars, const int length) { |
| DCHECK(!early_termination_); |
| if (length == 0) return; |
| // Copy state to stack. |
| char* buffer = buffer_; |
| int last_character = sizeof(Char) == 1 |
| ? unibrow::Utf16::kNoPreviousCharacter |
| : last_character_; |
| int i = 0; |
| // Do a fast loop where there is no exit capacity check. |
| while (true) { |
| int fast_length; |
| if (skip_capacity_check_) { |
| fast_length = length; |
| } else { |
| int remaining_capacity = capacity_ - static_cast<int>(buffer - start_); |
| // Need enough space to write everything but one character. |
| STATIC_ASSERT(unibrow::Utf16::kMaxExtraUtf8BytesForOneUtf16CodeUnit == |
| 3); |
| int max_size_per_char = sizeof(Char) == 1 ? 2 : 3; |
| int writable_length = |
| (remaining_capacity - max_size_per_char)/max_size_per_char; |
| // Need to drop into slow loop. |
| if (writable_length <= 0) break; |
| fast_length = i + writable_length; |
| if (fast_length > length) fast_length = length; |
| } |
| // Write the characters to the stream. |
| if (sizeof(Char) == 1) { |
| for (; i < fast_length; i++) { |
| buffer += unibrow::Utf8::EncodeOneByte( |
| buffer, static_cast<uint8_t>(*chars++)); |
| DCHECK(capacity_ == -1 || (buffer - start_) <= capacity_); |
| } |
| } else { |
| for (; i < fast_length; i++) { |
| uint16_t character = *chars++; |
| buffer += unibrow::Utf8::Encode(buffer, character, last_character, |
| replace_invalid_utf8_); |
| last_character = character; |
| DCHECK(capacity_ == -1 || (buffer - start_) <= capacity_); |
| } |
| } |
| // Array is fully written. Exit. |
| if (fast_length == length) { |
| // Write state back out to object. |
| last_character_ = last_character; |
| buffer_ = buffer; |
| utf16_chars_read_ += length; |
| return; |
| } |
| } |
| DCHECK(!skip_capacity_check_); |
| // Slow loop. Must check capacity on each iteration. |
| int remaining_capacity = capacity_ - static_cast<int>(buffer - start_); |
| DCHECK_GE(remaining_capacity, 0); |
| for (; i < length && remaining_capacity > 0; i++) { |
| uint16_t character = *chars++; |
| // remaining_capacity is <= 3 bytes at this point, so we do not write out |
| // an umatched lead surrogate. |
| if (replace_invalid_utf8_ && unibrow::Utf16::IsLeadSurrogate(character)) { |
| early_termination_ = true; |
| break; |
| } |
| int written = WriteEndCharacter(character, |
| last_character, |
| remaining_capacity, |
| buffer, |
| replace_invalid_utf8_); |
| if (written == 0) { |
| early_termination_ = true; |
| break; |
| } |
| buffer += written; |
| remaining_capacity -= written; |
| last_character = character; |
| } |
| // Write state back out to object. |
| last_character_ = last_character; |
| buffer_ = buffer; |
| utf16_chars_read_ += i; |
| } |
| |
| inline bool IsDone() { |
| return early_termination_; |
| } |
| |
| inline void VisitOneByteString(const uint8_t* chars, int length) { |
| Visit(chars, length); |
| } |
| |
| inline void VisitTwoByteString(const uint16_t* chars, int length) { |
| Visit(chars, length); |
| } |
| |
| int CompleteWrite(bool write_null, int* utf16_chars_read_out) { |
| // Write out number of utf16 characters written to the stream. |
| if (utf16_chars_read_out != nullptr) { |
| *utf16_chars_read_out = utf16_chars_read_; |
| } |
| // Only null terminate if all of the string was written and there's space. |
| if (write_null && |
| !early_termination_ && |
| (capacity_ == -1 || (buffer_ - start_) < capacity_)) { |
| *buffer_++ = '\0'; |
| } |
| return static_cast<int>(buffer_ - start_); |
| } |
| |
| private: |
| bool early_termination_; |
| int last_character_; |
| char* buffer_; |
| char* const start_; |
| int capacity_; |
| bool const skip_capacity_check_; |
| bool const replace_invalid_utf8_; |
| int utf16_chars_read_; |
| DISALLOW_IMPLICIT_CONSTRUCTORS(Utf8WriterVisitor); |
| }; |
| |
| |
| static bool RecursivelySerializeToUtf8(i::String* current, |
| Utf8WriterVisitor* writer, |
| int recursion_budget) { |
| while (!writer->IsDone()) { |
| i::ConsString* cons_string = i::String::VisitFlat(writer, current); |
| if (cons_string == nullptr) return true; // Leaf node. |
| if (recursion_budget <= 0) return false; |
| // Must write the left branch first. |
| i::String* first = cons_string->first(); |
| bool success = RecursivelySerializeToUtf8(first, |
| writer, |
| recursion_budget - 1); |
| if (!success) return false; |
| // Inline tail recurse for right branch. |
| current = cons_string->second(); |
| } |
| return true; |
| } |
| |
| |
| int String::WriteUtf8(char* buffer, |
| int capacity, |
| int* nchars_ref, |
| int options) const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| i::Isolate* isolate = str->GetIsolate(); |
| LOG_API(isolate, String, WriteUtf8); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| if (options & HINT_MANY_WRITES_EXPECTED) { |
| str = i::String::Flatten(str); // Flatten the string for efficiency. |
| } |
| const int string_length = str->length(); |
| bool write_null = !(options & NO_NULL_TERMINATION); |
| bool replace_invalid_utf8 = (options & REPLACE_INVALID_UTF8); |
| int max16BitCodeUnitSize = unibrow::Utf8::kMax16BitCodeUnitSize; |
| // First check if we can just write the string without checking capacity. |
| if (capacity == -1 || capacity / max16BitCodeUnitSize >= string_length) { |
| Utf8WriterVisitor writer(buffer, capacity, true, replace_invalid_utf8); |
| const int kMaxRecursion = 100; |
| bool success = RecursivelySerializeToUtf8(*str, &writer, kMaxRecursion); |
| if (success) return writer.CompleteWrite(write_null, nchars_ref); |
| } else if (capacity >= string_length) { |
| // First check that the buffer is large enough. |
| int utf8_bytes = v8::Utf8Length(*str, isolate); |
| if (utf8_bytes <= capacity) { |
| // one-byte fast path. |
| if (utf8_bytes == string_length) { |
| WriteOneByte(reinterpret_cast<uint8_t*>(buffer), 0, capacity, options); |
| if (nchars_ref != nullptr) *nchars_ref = string_length; |
| if (write_null && (utf8_bytes+1 <= capacity)) { |
| return string_length + 1; |
| } |
| return string_length; |
| } |
| if (write_null && (utf8_bytes+1 > capacity)) { |
| options |= NO_NULL_TERMINATION; |
| } |
| // Recurse once without a capacity limit. |
| // This will get into the first branch above. |
| // TODO(dcarney) Check max left rec. in Utf8Length and fall through. |
| return WriteUtf8(buffer, -1, nchars_ref, options); |
| } |
| } |
| // Recursive slow path can potentially be unreasonable slow. Flatten. |
| str = i::String::Flatten(str); |
| Utf8WriterVisitor writer(buffer, capacity, false, replace_invalid_utf8); |
| i::String::VisitFlat(&writer, *str); |
| return writer.CompleteWrite(write_null, nchars_ref); |
| } |
| |
| |
| template<typename CharType> |
| static inline int WriteHelper(const String* string, |
| CharType* buffer, |
| int start, |
| int length, |
| int options) { |
| i::Isolate* isolate = Utils::OpenHandle(string)->GetIsolate(); |
| LOG_API(isolate, String, Write); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| DCHECK(start >= 0 && length >= -1); |
| i::Handle<i::String> str = Utils::OpenHandle(string); |
| if (options & String::HINT_MANY_WRITES_EXPECTED) { |
| // Flatten the string for efficiency. This applies whether we are |
| // using StringCharacterStream or Get(i) to access the characters. |
| str = i::String::Flatten(str); |
| } |
| int end = start + length; |
| if ((length == -1) || (length > str->length() - start) ) |
| end = str->length(); |
| if (end < 0) return 0; |
| i::String::WriteToFlat(*str, buffer, start, end); |
| if (!(options & String::NO_NULL_TERMINATION) && |
| (length == -1 || end - start < length)) { |
| buffer[end - start] = '\0'; |
| } |
| return end - start; |
| } |
| |
| |
| int String::WriteOneByte(uint8_t* buffer, |
| int start, |
| int length, |
| int options) const { |
| return WriteHelper(this, buffer, start, length, options); |
| } |
| |
| |
| int String::Write(uint16_t* buffer, |
| int start, |
| int length, |
| int options) const { |
| return WriteHelper(this, buffer, start, length, options); |
| } |
| |
| |
| bool v8::String::IsExternal() const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| return i::StringShape(*str).IsExternalTwoByte(); |
| } |
| |
| |
| bool v8::String::IsExternalOneByte() const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| return i::StringShape(*str).IsExternalOneByte(); |
| } |
| |
| |
| void v8::String::VerifyExternalStringResource( |
| v8::String::ExternalStringResource* value) const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| const v8::String::ExternalStringResource* expected; |
| if (i::StringShape(*str).IsExternalTwoByte()) { |
| const void* resource = |
| i::Handle<i::ExternalTwoByteString>::cast(str)->resource(); |
| expected = reinterpret_cast<const ExternalStringResource*>(resource); |
| } else { |
| expected = nullptr; |
| } |
| CHECK_EQ(expected, value); |
| } |
| |
| void v8::String::VerifyExternalStringResourceBase( |
| v8::String::ExternalStringResourceBase* value, Encoding encoding) const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| const v8::String::ExternalStringResourceBase* expected; |
| Encoding expectedEncoding; |
| if (i::StringShape(*str).IsExternalOneByte()) { |
| const void* resource = |
| i::Handle<i::ExternalOneByteString>::cast(str)->resource(); |
| expected = reinterpret_cast<const ExternalStringResourceBase*>(resource); |
| expectedEncoding = ONE_BYTE_ENCODING; |
| } else if (i::StringShape(*str).IsExternalTwoByte()) { |
| const void* resource = |
| i::Handle<i::ExternalTwoByteString>::cast(str)->resource(); |
| expected = reinterpret_cast<const ExternalStringResourceBase*>(resource); |
| expectedEncoding = TWO_BYTE_ENCODING; |
| } else { |
| expected = nullptr; |
| expectedEncoding = |
| str->IsOneByteRepresentation() ? ONE_BYTE_ENCODING : TWO_BYTE_ENCODING; |
| } |
| CHECK_EQ(expected, value); |
| CHECK_EQ(expectedEncoding, encoding); |
| } |
| |
| const v8::String::ExternalOneByteStringResource* |
| v8::String::GetExternalOneByteStringResource() const { |
| i::Handle<i::String> str = Utils::OpenHandle(this); |
| if (i::StringShape(*str).IsExternalOneByte()) { |
| const void* resource = |
| i::Handle<i::ExternalOneByteString>::cast(str)->resource(); |
| return reinterpret_cast<const ExternalOneByteStringResource*>(resource); |
| } else { |
| return nullptr; |
| } |
| } |
| |
| |
| Local<Value> Symbol::Name() const { |
| i::Handle<i::Symbol> sym = Utils::OpenHandle(this); |
| i::Handle<i::Object> name(sym->name(), sym->GetIsolate()); |
| return Utils::ToLocal(name); |
| } |
| |
| |
| Local<Value> Private::Name() const { |
| return reinterpret_cast<const Symbol*>(this)->Name(); |
| } |
| |
| |
| double Number::Value() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| return obj->Number(); |
| } |
| |
| |
| bool Boolean::Value() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| return obj->IsTrue(i::HeapObject::cast(*obj)->GetIsolate()); |
| } |
| |
| |
| int64_t Integer::Value() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (obj->IsSmi()) { |
| return i::Smi::ToInt(*obj); |
| } else { |
| return static_cast<int64_t>(obj->Number()); |
| } |
| } |
| |
| |
| int32_t Int32::Value() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (obj->IsSmi()) { |
| return i::Smi::ToInt(*obj); |
| } else { |
| return static_cast<int32_t>(obj->Number()); |
| } |
| } |
| |
| |
| uint32_t Uint32::Value() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| if (obj->IsSmi()) { |
| return i::Smi::ToInt(*obj); |
| } else { |
| return static_cast<uint32_t>(obj->Number()); |
| } |
| } |
| |
| int v8::Object::InternalFieldCount() { |
| i::Handle<i::JSReceiver> self = Utils::OpenHandle(this); |
| if (!self->IsJSObject()) return 0; |
| return i::Handle<i::JSObject>::cast(self)->GetEmbedderFieldCount(); |
| } |
| |
| static bool InternalFieldOK(i::Handle<i::JSReceiver> obj, int index, |
| const char* location) { |
| return Utils::ApiCheck( |
| obj->IsJSObject() && |
| (index < i::Handle<i::JSObject>::cast(obj)->GetEmbedderFieldCount()), |
| location, "Internal field out of bounds"); |
| } |
| |
| Local<Value> v8::Object::SlowGetInternalField(int index) { |
| i::Handle<i::JSReceiver> obj = Utils::OpenHandle(this); |
| const char* location = "v8::Object::GetInternalField()"; |
| if (!InternalFieldOK(obj, index, location)) return Local<Value>(); |
| i::Handle<i::Object> value( |
| i::Handle<i::JSObject>::cast(obj)->GetEmbedderField(index), |
| obj->GetIsolate()); |
| return Utils::ToLocal(value); |
| } |
| |
| void v8::Object::SetInternalField(int index, v8::Local<Value> value) { |
| i::Handle<i::JSReceiver> obj = Utils::OpenHandle(this); |
| const char* location = "v8::Object::SetInternalField()"; |
| if (!InternalFieldOK(obj, index, location)) return; |
| i::Handle<i::Object> val = Utils::OpenHandle(*value); |
| i::Handle<i::JSObject>::cast(obj)->SetEmbedderField(index, *val); |
| } |
| |
| void* v8::Object::SlowGetAlignedPointerFromInternalField(int index) { |
| i::Handle<i::JSReceiver> obj = Utils::OpenHandle(this); |
| const char* location = "v8::Object::GetAlignedPointerFromInternalField()"; |
| if (!InternalFieldOK(obj, index, location)) return nullptr; |
| return DecodeSmiToAligned( |
| i::Handle<i::JSObject>::cast(obj)->GetEmbedderField(index), location); |
| } |
| |
| void v8::Object::SetAlignedPointerInInternalField(int index, void* value) { |
| i::Handle<i::JSReceiver> obj = Utils::OpenHandle(this); |
| const char* location = "v8::Object::SetAlignedPointerInInternalField()"; |
| if (!InternalFieldOK(obj, index, location)) return; |
| i::Handle<i::JSObject>::cast(obj)->SetEmbedderField( |
| index, EncodeAlignedAsSmi(value, location)); |
| DCHECK_EQ(value, GetAlignedPointerFromInternalField(index)); |
| } |
| |
| void v8::Object::SetAlignedPointerInInternalFields(int argc, int indices[], |
| void* values[]) { |
| i::Handle<i::JSReceiver> obj = Utils::OpenHandle(this); |
| const char* location = "v8::Object::SetAlignedPointerInInternalFields()"; |
| i::DisallowHeapAllocation no_gc; |
| i::JSObject* object = i::JSObject::cast(*obj); |
| int nof_embedder_fields = object->GetEmbedderFieldCount(); |
| for (int i = 0; i < argc; i++) { |
| int index = indices[i]; |
| if (!Utils::ApiCheck(index < nof_embedder_fields, location, |
| "Internal field out of bounds")) { |
| return; |
| } |
| void* value = values[i]; |
| object->SetEmbedderField(index, EncodeAlignedAsSmi(value, location)); |
| DCHECK_EQ(value, GetAlignedPointerFromInternalField(index)); |
| } |
| } |
| |
| static void* ExternalValue(i::Object* obj) { |
| // Obscure semantics for undefined, but somehow checked in our unit tests... |
| if (!obj->IsSmi() && |
| obj->IsUndefined(i::HeapObject::cast(obj)->GetIsolate())) { |
| return nullptr; |
| } |
| i::Object* foreign = i::JSObject::cast(obj)->GetEmbedderField(0); |
| return i::Foreign::cast(foreign)->foreign_address(); |
| } |
| |
| |
| // --- E n v i r o n m e n t --- |
| |
| |
| void v8::V8::InitializePlatform(Platform* platform) { |
| i::V8::InitializePlatform(platform); |
| } |
| |
| |
| void v8::V8::ShutdownPlatform() { |
| i::V8::ShutdownPlatform(); |
| } |
| |
| |
| bool v8::V8::Initialize() { |
| i::V8::Initialize(); |
| #ifdef V8_USE_EXTERNAL_STARTUP_DATA |
| i::ReadNatives(); |
| #endif |
| return true; |
| } |
| |
| #if V8_OS_POSIX |
| bool V8::TryHandleSignal(int signum, void* info, void* context) { |
| #if V8_OS_LINUX && V8_TARGET_ARCH_X64 && !V8_OS_ANDROID |
| return v8::internal::trap_handler::TryHandleSignal( |
| signum, static_cast<siginfo_t*>(info), static_cast<ucontext_t*>(context)); |
| #else // V8_OS_LINUX && V8_TARGET_ARCH_X64 && !V8_OS_ANDROID |
| return false; |
| #endif |
| } |
| #endif |
| |
| bool V8::RegisterDefaultSignalHandler() { |
| return v8::internal::trap_handler::RegisterDefaultSignalHandler(); |
| } |
| |
| void v8::V8::SetEntropySource(EntropySource entropy_source) { |
| base::RandomNumberGenerator::SetEntropySource(entropy_source); |
| } |
| |
| |
| void v8::V8::SetReturnAddressLocationResolver( |
| ReturnAddressLocationResolver return_address_resolver) { |
| i::StackFrame::SetReturnAddressLocationResolver(return_address_resolver); |
| } |
| |
| |
| bool v8::V8::Dispose() { |
| i::V8::TearDown(); |
| #ifdef V8_USE_EXTERNAL_STARTUP_DATA |
| i::DisposeNatives(); |
| #endif |
| return true; |
| } |
| |
| HeapStatistics::HeapStatistics() |
| : total_heap_size_(0), |
| total_heap_size_executable_(0), |
| total_physical_size_(0), |
| total_available_size_(0), |
| used_heap_size_(0), |
| heap_size_limit_(0), |
| malloced_memory_(0), |
| peak_malloced_memory_(0), |
| does_zap_garbage_(0) {} |
| |
| HeapSpaceStatistics::HeapSpaceStatistics(): space_name_(0), |
| space_size_(0), |
| space_used_size_(0), |
| space_available_size_(0), |
| physical_space_size_(0) { } |
| |
| |
| HeapObjectStatistics::HeapObjectStatistics() |
| : object_type_(nullptr), |
| object_sub_type_(nullptr), |
| object_count_(0), |
| object_size_(0) {} |
| |
| HeapCodeStatistics::HeapCodeStatistics() |
| : code_and_metadata_size_(0), bytecode_and_metadata_size_(0) {} |
| |
| bool v8::V8::InitializeICU(const char* icu_data_file) { |
| return i::InitializeICU(icu_data_file); |
| } |
| |
| bool v8::V8::InitializeICUDefaultLocation(const char* exec_path, |
| const char* icu_data_file) { |
| return i::InitializeICUDefaultLocation(exec_path, icu_data_file); |
| } |
| |
| void v8::V8::InitializeExternalStartupData(const char* directory_path) { |
| i::InitializeExternalStartupData(directory_path); |
| } |
| |
| |
| void v8::V8::InitializeExternalStartupData(const char* natives_blob, |
| const char* snapshot_blob) { |
| i::InitializeExternalStartupData(natives_blob, snapshot_blob); |
| } |
| |
| |
| const char* v8::V8::GetVersion() { |
| return i::Version::GetVersion(); |
| } |
| |
| template <typename ObjectType> |
| struct InvokeBootstrapper; |
| |
| template <> |
| struct InvokeBootstrapper<i::Context> { |
| i::Handle<i::Context> Invoke( |
| i::Isolate* isolate, i::MaybeHandle<i::JSGlobalProxy> maybe_global_proxy, |
| v8::Local<v8::ObjectTemplate> global_proxy_template, |
| v8::ExtensionConfiguration* extensions, size_t context_snapshot_index, |
| v8::DeserializeInternalFieldsCallback embedder_fields_deserializer) { |
| return isolate->bootstrapper()->CreateEnvironment( |
| maybe_global_proxy, global_proxy_template, extensions, |
| context_snapshot_index, embedder_fields_deserializer); |
| } |
| }; |
| |
| template <> |
| struct InvokeBootstrapper<i::JSGlobalProxy> { |
| i::Handle<i::JSGlobalProxy> Invoke( |
| i::Isolate* isolate, i::MaybeHandle<i::JSGlobalProxy> maybe_global_proxy, |
| v8::Local<v8::ObjectTemplate> global_proxy_template, |
| v8::ExtensionConfiguration* extensions, size_t context_snapshot_index, |
| v8::DeserializeInternalFieldsCallback embedder_fields_deserializer) { |
| USE(extensions); |
| USE(context_snapshot_index); |
| return isolate->bootstrapper()->NewRemoteContext(maybe_global_proxy, |
| global_proxy_template); |
| } |
| }; |
| |
| template <typename ObjectType> |
| static i::Handle<ObjectType> CreateEnvironment( |
| i::Isolate* isolate, v8::ExtensionConfiguration* extensions, |
| v8::MaybeLocal<ObjectTemplate> maybe_global_template, |
| v8::MaybeLocal<Value> maybe_global_proxy, size_t context_snapshot_index, |
| v8::DeserializeInternalFieldsCallback embedder_fields_deserializer) { |
| i::Handle<ObjectType> result; |
| |
| { |
| ENTER_V8_FOR_NEW_CONTEXT(isolate); |
| v8::Local<ObjectTemplate> proxy_template; |
| i::Handle<i::FunctionTemplateInfo> proxy_constructor; |
| i::Handle<i::FunctionTemplateInfo> global_constructor; |
| i::Handle<i::Object> named_interceptor( |
| isolate->factory()->undefined_value()); |
| i::Handle<i::Object> indexed_interceptor( |
| isolate->factory()->undefined_value()); |
| |
| if (!maybe_global_template.IsEmpty()) { |
| v8::Local<v8::ObjectTemplate> global_template = |
| maybe_global_template.ToLocalChecked(); |
| // Make sure that the global_template has a constructor. |
| global_constructor = EnsureConstructor(isolate, *global_template); |
| |
| // Create a fresh template for the global proxy object. |
| proxy_template = ObjectTemplate::New( |
| reinterpret_cast<v8::Isolate*>(isolate)); |
| proxy_constructor = EnsureConstructor(isolate, *proxy_template); |
| |
| // Set the global template to be the prototype template of |
| // global proxy template. |
| proxy_constructor->set_prototype_template( |
| *Utils::OpenHandle(*global_template)); |
| |
| proxy_template->SetInternalFieldCount( |
| global_template->InternalFieldCount()); |
| |
| // Migrate security handlers from global_template to |
| // proxy_template. Temporarily removing access check |
| // information from the global template. |
| if (!global_constructor->access_check_info()->IsUndefined(isolate)) { |
| proxy_constructor->set_access_check_info( |
| global_constructor->access_check_info()); |
| proxy_constructor->set_needs_access_check( |
| global_constructor->needs_access_check()); |
| global_constructor->set_needs_access_check(false); |
| global_constructor->set_access_check_info( |
| isolate->heap()->undefined_value()); |
| } |
| |
| // Same for other interceptors. If the global constructor has |
| // interceptors, we need to replace them temporarily with noop |
| // interceptors, so the map is correctly marked as having interceptors, |
| // but we don't invoke any. |
| if (!global_constructor->named_property_handler()->IsUndefined(isolate)) { |
| named_interceptor = |
| handle(global_constructor->named_property_handler(), isolate); |
| global_constructor->set_named_property_handler( |
| isolate->heap()->noop_interceptor_info()); |
| } |
| if (!global_constructor->indexed_property_handler()->IsUndefined( |
| isolate)) { |
| indexed_interceptor = |
| handle(global_constructor->indexed_property_handler(), isolate); |
| global_constructor->set_indexed_property_handler( |
| isolate->heap()->noop_interceptor_info()); |
| } |
| } |
| |
| i::MaybeHandle<i::JSGlobalProxy> maybe_proxy; |
| if (!maybe_global_proxy.IsEmpty()) { |
| maybe_proxy = i::Handle<i::JSGlobalProxy>::cast( |
| Utils::OpenHandle(*maybe_global_proxy.ToLocalChecked())); |
| } |
| // Create the environment. |
| InvokeBootstrapper<ObjectType> invoke; |
| result = |
| invoke.Invoke(isolate, maybe_proxy, proxy_template, extensions, |
| context_snapshot_index, embedder_fields_deserializer); |
| |
| // Restore the access check info and interceptors on the global template. |
| if (!maybe_global_template.IsEmpty()) { |
| DCHECK(!global_constructor.is_null()); |
| DCHECK(!proxy_constructor.is_null()); |
| global_constructor->set_access_check_info( |
| proxy_constructor->access_check_info()); |
| global_constructor->set_needs_access_check( |
| proxy_constructor->needs_access_check()); |
| global_constructor->set_named_property_handler(*named_interceptor); |
| global_constructor->set_indexed_property_handler(*indexed_interceptor); |
| } |
| } |
| // Leave V8. |
| |
| return result; |
| } |
| |
| Local<Context> NewContext( |
| v8::Isolate* external_isolate, v8::ExtensionConfiguration* extensions, |
| v8::MaybeLocal<ObjectTemplate> global_template, |
| v8::MaybeLocal<Value> global_object, size_t context_snapshot_index, |
| v8::DeserializeInternalFieldsCallback embedder_fields_deserializer) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(external_isolate); |
| // TODO(jkummerow): This is for crbug.com/713699. Remove it if it doesn't |
| // fail. |
| // Sanity-check that the isolate is initialized and usable. |
| CHECK(isolate->builtins()->builtin(i::Builtins::kIllegal)->IsCode()); |
| |
| TRACE_EVENT_CALL_STATS_SCOPED(isolate, "v8", "V8.NewContext"); |
| LOG_API(isolate, Context, New); |
| i::HandleScope scope(isolate); |
| ExtensionConfiguration no_extensions; |
| if (extensions == nullptr) extensions = &no_extensions; |
| i::Handle<i::Context> env = CreateEnvironment<i::Context>( |
| isolate, extensions, global_template, global_object, |
| context_snapshot_index, embedder_fields_deserializer); |
| if (env.is_null()) { |
| if (isolate->has_pending_exception()) isolate->clear_pending_exception(); |
| return Local<Context>(); |
| } |
| return Utils::ToLocal(scope.CloseAndEscape(env)); |
| } |
| |
| Local<Context> v8::Context::New( |
| v8::Isolate* external_isolate, v8::ExtensionConfiguration* extensions, |
| v8::MaybeLocal<ObjectTemplate> global_template, |
| v8::MaybeLocal<Value> global_object, |
| DeserializeInternalFieldsCallback internal_fields_deserializer) { |
| return NewContext(external_isolate, extensions, global_template, |
| global_object, 0, internal_fields_deserializer); |
| } |
| |
| MaybeLocal<Context> v8::Context::FromSnapshot( |
| v8::Isolate* external_isolate, size_t context_snapshot_index, |
| v8::DeserializeInternalFieldsCallback embedder_fields_deserializer, |
| v8::ExtensionConfiguration* extensions, MaybeLocal<Value> global_object) { |
| size_t index_including_default_context = context_snapshot_index + 1; |
| if (!i::Snapshot::HasContextSnapshot( |
| reinterpret_cast<i::Isolate*>(external_isolate), |
| index_including_default_context)) { |
| return MaybeLocal<Context>(); |
| } |
| return NewContext(external_isolate, extensions, MaybeLocal<ObjectTemplate>(), |
| global_object, index_including_default_context, |
| embedder_fields_deserializer); |
| } |
| |
| MaybeLocal<Object> v8::Context::NewRemoteContext( |
| v8::Isolate* external_isolate, v8::Local<ObjectTemplate> global_template, |
| v8::MaybeLocal<v8::Value> global_object) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(external_isolate); |
| LOG_API(isolate, Context, NewRemoteContext); |
| i::HandleScope scope(isolate); |
| i::Handle<i::FunctionTemplateInfo> global_constructor = |
| EnsureConstructor(isolate, *global_template); |
| Utils::ApiCheck(global_constructor->needs_access_check(), |
| "v8::Context::NewRemoteContext", |
| "Global template needs to have access checks enabled."); |
| i::Handle<i::AccessCheckInfo> access_check_info = i::handle( |
| i::AccessCheckInfo::cast(global_constructor->access_check_info()), |
| isolate); |
| Utils::ApiCheck(access_check_info->named_interceptor() != nullptr, |
| "v8::Context::NewRemoteContext", |
| "Global template needs to have access check handlers."); |
| i::Handle<i::JSGlobalProxy> global_proxy = |
| CreateEnvironment<i::JSGlobalProxy>(isolate, nullptr, global_template, |
| global_object, 0, |
| DeserializeInternalFieldsCallback()); |
| if (global_proxy.is_null()) { |
| if (isolate->has_pending_exception()) isolate->clear_pending_exception(); |
| return MaybeLocal<Object>(); |
| } |
| return Utils::ToLocal( |
| scope.CloseAndEscape(i::Handle<i::JSObject>::cast(global_proxy))); |
| } |
| |
| void v8::Context::SetSecurityToken(Local<Value> token) { |
| i::Handle<i::Context> env = Utils::OpenHandle(this); |
| i::Handle<i::Object> token_handle = Utils::OpenHandle(*token); |
| env->set_security_token(*token_handle); |
| } |
| |
| |
| void v8::Context::UseDefaultSecurityToken() { |
| i::Handle<i::Context> env = Utils::OpenHandle(this); |
| env->set_security_token(env->global_object()); |
| } |
| |
| |
| Local<Value> v8::Context::GetSecurityToken() { |
| i::Handle<i::Context> env = Utils::OpenHandle(this); |
| i::Isolate* isolate = env->GetIsolate(); |
| i::Object* security_token = env->security_token(); |
| i::Handle<i::Object> token_handle(security_token, isolate); |
| return Utils::ToLocal(token_handle); |
| } |
| |
| |
| v8::Isolate* Context::GetIsolate() { |
| i::Handle<i::Context> env = Utils::OpenHandle(this); |
| return reinterpret_cast<Isolate*>(env->GetIsolate()); |
| } |
| |
| v8::Local<v8::Object> Context::Global() { |
| i::Handle<i::Context> context = Utils::OpenHandle(this); |
| i::Isolate* isolate = context->GetIsolate(); |
| i::Handle<i::Object> global(context->global_proxy(), isolate); |
| // TODO(dcarney): This should always return the global proxy |
| // but can't presently as calls to GetProtoype will return the wrong result. |
| if (i::Handle<i::JSGlobalProxy>::cast( |
| global)->IsDetachedFrom(context->global_object())) { |
| global = i::Handle<i::Object>(context->global_object(), isolate); |
| } |
| return Utils::ToLocal(i::Handle<i::JSObject>::cast(global)); |
| } |
| |
| |
| void Context::DetachGlobal() { |
| i::Handle<i::Context> context = Utils::OpenHandle(this); |
| i::Isolate* isolate = context->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| isolate->bootstrapper()->DetachGlobal(context); |
| } |
| |
| |
| Local<v8::Object> Context::GetExtrasBindingObject() { |
| i::Handle<i::Context> context = Utils::OpenHandle(this); |
| i::Isolate* isolate = context->GetIsolate(); |
| i::Handle<i::JSObject> binding(context->extras_binding_object(), isolate); |
| return Utils::ToLocal(binding); |
| } |
| |
| |
| void Context::AllowCodeGenerationFromStrings(bool allow) { |
| i::Handle<i::Context> context = Utils::OpenHandle(this); |
| i::Isolate* isolate = context->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| context->set_allow_code_gen_from_strings( |
| allow ? isolate->heap()->true_value() : isolate->heap()->false_value()); |
| } |
| |
| |
| bool Context::IsCodeGenerationFromStringsAllowed() { |
| i::Handle<i::Context> context = Utils::OpenHandle(this); |
| return !context->allow_code_gen_from_strings()->IsFalse( |
| context->GetIsolate()); |
| } |
| |
| |
| void Context::SetErrorMessageForCodeGenerationFromStrings(Local<String> error) { |
| i::Handle<i::Context> context = Utils::OpenHandle(this); |
| i::Handle<i::String> error_handle = Utils::OpenHandle(*error); |
| context->set_error_message_for_code_gen_from_strings(*error_handle); |
| } |
| |
| size_t Context::EstimatedSize() { return 0; } |
| |
| MaybeLocal<v8::Object> ObjectTemplate::NewInstance(Local<Context> context) { |
| PREPARE_FOR_EXECUTION(context, ObjectTemplate, NewInstance, Object); |
| auto self = Utils::OpenHandle(this); |
| Local<Object> result; |
| has_pending_exception = |
| !ToLocal<Object>(i::ApiNatives::InstantiateObject(self), &result); |
| RETURN_ON_FAILED_EXECUTION(Object); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::Object> ObjectTemplate::NewInstance() { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(NewInstance(context), Object); |
| } |
| |
| |
| MaybeLocal<v8::Function> FunctionTemplate::GetFunction(Local<Context> context) { |
| PREPARE_FOR_EXECUTION(context, FunctionTemplate, GetFunction, Function); |
| auto self = Utils::OpenHandle(this); |
| Local<Function> result; |
| has_pending_exception = |
| !ToLocal<Function>(i::ApiNatives::InstantiateFunction(self), &result); |
| RETURN_ON_FAILED_EXECUTION(Function); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::Function> FunctionTemplate::GetFunction() { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(GetFunction(context), Function); |
| } |
| |
| MaybeLocal<v8::Object> FunctionTemplate::NewRemoteInstance() { |
| auto self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| LOG_API(isolate, FunctionTemplate, NewRemoteInstance); |
| i::HandleScope scope(isolate); |
| i::Handle<i::FunctionTemplateInfo> constructor = |
| EnsureConstructor(isolate, *InstanceTemplate()); |
| Utils::ApiCheck(constructor->needs_access_check(), |
| "v8::FunctionTemplate::NewRemoteInstance", |
| "InstanceTemplate needs to have access checks enabled."); |
| i::Handle<i::AccessCheckInfo> access_check_info = i::handle( |
| i::AccessCheckInfo::cast(constructor->access_check_info()), isolate); |
| Utils::ApiCheck(access_check_info->named_interceptor() != nullptr, |
| "v8::FunctionTemplate::NewRemoteInstance", |
| "InstanceTemplate needs to have access check handlers."); |
| i::Handle<i::JSObject> object; |
| if (!i::ApiNatives::InstantiateRemoteObject( |
| Utils::OpenHandle(*InstanceTemplate())) |
| .ToHandle(&object)) { |
| if (isolate->has_pending_exception()) { |
| isolate->OptionalRescheduleException(true); |
| } |
| return MaybeLocal<Object>(); |
| } |
| return Utils::ToLocal(scope.CloseAndEscape(object)); |
| } |
| |
| bool FunctionTemplate::HasInstance(v8::Local<v8::Value> value) { |
| auto self = Utils::OpenHandle(this); |
| auto obj = Utils::OpenHandle(*value); |
| if (obj->IsJSObject() && self->IsTemplateFor(i::JSObject::cast(*obj))) { |
| return true; |
| } |
| if (obj->IsJSGlobalProxy()) { |
| // If it's a global proxy, then test with the global object. Note that the |
| // inner global object may not necessarily be a JSGlobalObject. |
| i::PrototypeIterator iter(i::JSObject::cast(*obj)->map()); |
| // The global proxy should always have a prototype, as it is a bug to call |
| // this on a detached JSGlobalProxy. |
| DCHECK(!iter.IsAtEnd()); |
| return self->IsTemplateFor(iter.GetCurrent<i::JSObject>()); |
| } |
| return false; |
| } |
| |
| |
| Local<External> v8::External::New(Isolate* isolate, void* value) { |
| STATIC_ASSERT(sizeof(value) == sizeof(i::Address)); |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, External, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::JSObject> external = i_isolate->factory()->NewExternal(value); |
| return Utils::ExternalToLocal(external); |
| } |
| |
| |
| void* External::Value() const { |
| return ExternalValue(*Utils::OpenHandle(this)); |
| } |
| |
| |
| // anonymous namespace for string creation helper functions |
| namespace { |
| |
| inline int StringLength(const char* string) { |
| return i::StrLength(string); |
| } |
| |
| |
| inline int StringLength(const uint8_t* string) { |
| return i::StrLength(reinterpret_cast<const char*>(string)); |
| } |
| |
| |
| inline int StringLength(const uint16_t* string) { |
| int length = 0; |
| while (string[length] != '\0') |
| length++; |
| return length; |
| } |
| |
| |
| MUST_USE_RESULT |
| inline i::MaybeHandle<i::String> NewString(i::Factory* factory, |
| v8::NewStringType type, |
| i::Vector<const char> string) { |
| if (type == v8::NewStringType::kInternalized) { |
| return factory->InternalizeUtf8String(string); |
| } |
| return factory->NewStringFromUtf8(string); |
| } |
| |
| |
| MUST_USE_RESULT |
| inline i::MaybeHandle<i::String> NewString(i::Factory* factory, |
| v8::NewStringType type, |
| i::Vector<const uint8_t> string) { |
| if (type == v8::NewStringType::kInternalized) { |
| return factory->InternalizeOneByteString(string); |
| } |
| return factory->NewStringFromOneByte(string); |
| } |
| |
| |
| MUST_USE_RESULT |
| inline i::MaybeHandle<i::String> NewString(i::Factory* factory, |
| v8::NewStringType type, |
| i::Vector<const uint16_t> string) { |
| if (type == v8::NewStringType::kInternalized) { |
| return factory->InternalizeTwoByteString(string); |
| } |
| return factory->NewStringFromTwoByte(string); |
| } |
| |
| |
| STATIC_ASSERT(v8::String::kMaxLength == i::String::kMaxLength); |
| |
| } // anonymous namespace |
| |
| // TODO(dcarney): throw a context free exception. |
| #define NEW_STRING(isolate, class_name, function_name, Char, data, type, \ |
| length) \ |
| MaybeLocal<String> result; \ |
| if (length == 0) { \ |
| result = String::Empty(isolate); \ |
| } else if (length > i::String::kMaxLength) { \ |
| result = MaybeLocal<String>(); \ |
| } else { \ |
| i::Isolate* i_isolate = reinterpret_cast<internal::Isolate*>(isolate); \ |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); \ |
| LOG_API(i_isolate, class_name, function_name); \ |
| if (length < 0) length = StringLength(data); \ |
| i::Handle<i::String> handle_result = \ |
| NewString(i_isolate->factory(), type, \ |
| i::Vector<const Char>(data, length)) \ |
| .ToHandleChecked(); \ |
| result = Utils::ToLocal(handle_result); \ |
| } |
| |
| Local<String> String::NewFromUtf8(Isolate* isolate, |
| const char* data, |
| NewStringType type, |
| int length) { |
| NEW_STRING(isolate, String, NewFromUtf8, char, data, |
| static_cast<v8::NewStringType>(type), length); |
| RETURN_TO_LOCAL_UNCHECKED(result, String); |
| } |
| |
| |
| MaybeLocal<String> String::NewFromUtf8(Isolate* isolate, const char* data, |
| v8::NewStringType type, int length) { |
| NEW_STRING(isolate, String, NewFromUtf8, char, data, type, length); |
| return result; |
| } |
| |
| |
| Local<String> String::NewFromOneByte(Isolate* isolate, |
| const uint8_t* data, |
| NewStringType type, |
| int length) { |
| NEW_STRING(isolate, String, NewFromOneByte, uint8_t, data, |
| static_cast<v8::NewStringType>(type), length); |
| RETURN_TO_LOCAL_UNCHECKED(result, String); |
| } |
| |
| |
| MaybeLocal<String> String::NewFromOneByte(Isolate* isolate, const uint8_t* data, |
| v8::NewStringType type, int length) { |
| NEW_STRING(isolate, String, NewFromOneByte, uint8_t, data, type, length); |
| return result; |
| } |
| |
| |
| Local<String> String::NewFromTwoByte(Isolate* isolate, |
| const uint16_t* data, |
| NewStringType type, |
| int length) { |
| NEW_STRING(isolate, String, NewFromTwoByte, uint16_t, data, |
| static_cast<v8::NewStringType>(type), length); |
| RETURN_TO_LOCAL_UNCHECKED(result, String); |
| } |
| |
| |
| MaybeLocal<String> String::NewFromTwoByte(Isolate* isolate, |
| const uint16_t* data, |
| v8::NewStringType type, int length) { |
| NEW_STRING(isolate, String, NewFromTwoByte, uint16_t, data, type, length); |
| return result; |
| } |
| |
| |
| Local<String> v8::String::Concat(Local<String> left, Local<String> right) { |
| i::Handle<i::String> left_string = Utils::OpenHandle(*left); |
| i::Isolate* isolate = left_string->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| LOG_API(isolate, String, Concat); |
| i::Handle<i::String> right_string = Utils::OpenHandle(*right); |
| // If we are steering towards a range error, do not wait for the error to be |
| // thrown, and return the null handle instead. |
| if (left_string->length() + right_string->length() > i::String::kMaxLength) { |
| return Local<String>(); |
| } |
| i::Handle<i::String> result = isolate->factory()->NewConsString( |
| left_string, right_string).ToHandleChecked(); |
| return Utils::ToLocal(result); |
| } |
| |
| |
| MaybeLocal<String> v8::String::NewExternalTwoByte( |
| Isolate* isolate, v8::String::ExternalStringResource* resource) { |
| CHECK(resource && resource->data()); |
| // TODO(dcarney): throw a context free exception. |
| if (resource->length() > static_cast<size_t>(i::String::kMaxLength)) { |
| return MaybeLocal<String>(); |
| } |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| LOG_API(i_isolate, String, NewExternalTwoByte); |
| if (resource->length() > 0) { |
| i::Handle<i::String> string = i_isolate->factory() |
| ->NewExternalStringFromTwoByte(resource) |
| .ToHandleChecked(); |
| i_isolate->heap()->RegisterExternalString(*string); |
| return Utils::ToLocal(string); |
| } else { |
| // The resource isn't going to be used, free it immediately. |
| resource->Dispose(); |
| return Utils::ToLocal(i_isolate->factory()->empty_string()); |
| } |
| } |
| |
| |
| Local<String> v8::String::NewExternal( |
| Isolate* isolate, v8::String::ExternalStringResource* resource) { |
| RETURN_TO_LOCAL_UNCHECKED(NewExternalTwoByte(isolate, resource), String); |
| } |
| |
| |
| MaybeLocal<String> v8::String::NewExternalOneByte( |
| Isolate* isolate, v8::String::ExternalOneByteStringResource* resource) { |
| CHECK(resource && resource->data()); |
| // TODO(dcarney): throw a context free exception. |
| if (resource->length() > static_cast<size_t>(i::String::kMaxLength)) { |
| return MaybeLocal<String>(); |
| } |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| LOG_API(i_isolate, String, NewExternalOneByte); |
| if (resource->length() > 0) { |
| i::Handle<i::String> string = i_isolate->factory() |
| ->NewExternalStringFromOneByte(resource) |
| .ToHandleChecked(); |
| i_isolate->heap()->RegisterExternalString(*string); |
| return Utils::ToLocal(string); |
| } else { |
| // The resource isn't going to be used, free it immediately. |
| resource->Dispose(); |
| return Utils::ToLocal(i_isolate->factory()->empty_string()); |
| } |
| } |
| |
| |
| Local<String> v8::String::NewExternal( |
| Isolate* isolate, v8::String::ExternalOneByteStringResource* resource) { |
| RETURN_TO_LOCAL_UNCHECKED(NewExternalOneByte(isolate, resource), String); |
| } |
| |
| |
| bool v8::String::MakeExternal(v8::String::ExternalStringResource* resource) { |
| i::Handle<i::String> obj = Utils::OpenHandle(this); |
| i::Isolate* isolate = obj->GetIsolate(); |
| if (i::StringShape(*obj).IsExternal()) { |
| return false; // Already an external string. |
| } |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| if (isolate->heap()->IsInGCPostProcessing()) { |
| return false; |
| } |
| CHECK(resource && resource->data()); |
| |
| bool result = obj->MakeExternal(resource); |
| // Assert that if CanMakeExternal(), then externalizing actually succeeds. |
| DCHECK(!CanMakeExternal() || result); |
| if (result) { |
| DCHECK(obj->IsExternalString()); |
| isolate->heap()->RegisterExternalString(*obj); |
| } |
| return result; |
| } |
| |
| |
| bool v8::String::MakeExternal( |
| v8::String::ExternalOneByteStringResource* resource) { |
| i::Handle<i::String> obj = Utils::OpenHandle(this); |
| i::Isolate* isolate = obj->GetIsolate(); |
| if (i::StringShape(*obj).IsExternal()) { |
| return false; // Already an external string. |
| } |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| if (isolate->heap()->IsInGCPostProcessing()) { |
| return false; |
| } |
| CHECK(resource && resource->data()); |
| |
| bool result = obj->MakeExternal(resource); |
| // Assert that if CanMakeExternal(), then externalizing actually succeeds. |
| DCHECK(!CanMakeExternal() || result); |
| if (result) { |
| DCHECK(obj->IsExternalString()); |
| isolate->heap()->RegisterExternalString(*obj); |
| } |
| return result; |
| } |
| |
| |
| bool v8::String::CanMakeExternal() { |
| i::Handle<i::String> obj = Utils::OpenHandle(this); |
| if (obj->IsExternalString()) return false; |
| |
| // Old space strings should be externalized. |
| i::Isolate* isolate = obj->GetIsolate(); |
| return !isolate->heap()->new_space()->Contains(*obj); |
| } |
| |
| |
| Isolate* v8::Object::GetIsolate() { |
| i::Isolate* i_isolate = Utils::OpenHandle(this)->GetIsolate(); |
| return reinterpret_cast<Isolate*>(i_isolate); |
| } |
| |
| |
| Local<v8::Object> v8::Object::New(Isolate* isolate) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, Object, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::JSObject> obj = |
| i_isolate->factory()->NewJSObject(i_isolate->object_function()); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| Local<v8::Value> v8::NumberObject::New(Isolate* isolate, double value) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, NumberObject, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::Object> number = i_isolate->factory()->NewNumber(value); |
| i::Handle<i::Object> obj = |
| i::Object::ToObject(i_isolate, number).ToHandleChecked(); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| double v8::NumberObject::ValueOf() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| i::Handle<i::JSValue> jsvalue = i::Handle<i::JSValue>::cast(obj); |
| i::Isolate* isolate = jsvalue->GetIsolate(); |
| LOG_API(isolate, NumberObject, NumberValue); |
| return jsvalue->value()->Number(); |
| } |
| |
| |
| Local<v8::Value> v8::BooleanObject::New(Isolate* isolate, bool value) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, BooleanObject, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::Object> boolean(value ? i_isolate->heap()->true_value() |
| : i_isolate->heap()->false_value(), |
| i_isolate); |
| i::Handle<i::Object> obj = |
| i::Object::ToObject(i_isolate, boolean).ToHandleChecked(); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| Local<v8::Value> v8::BooleanObject::New(bool value) { |
| return New(Isolate::GetCurrent(), value); |
| } |
| |
| |
| bool v8::BooleanObject::ValueOf() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| i::Handle<i::JSValue> jsvalue = i::Handle<i::JSValue>::cast(obj); |
| i::Isolate* isolate = jsvalue->GetIsolate(); |
| LOG_API(isolate, BooleanObject, BooleanValue); |
| return jsvalue->value()->IsTrue(isolate); |
| } |
| |
| |
| Local<v8::Value> v8::StringObject::New(Local<String> value) { |
| i::Handle<i::String> string = Utils::OpenHandle(*value); |
| i::Isolate* isolate = string->GetIsolate(); |
| LOG_API(isolate, StringObject, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::Handle<i::Object> obj = |
| i::Object::ToObject(isolate, string).ToHandleChecked(); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| Local<v8::String> v8::StringObject::ValueOf() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| i::Handle<i::JSValue> jsvalue = i::Handle<i::JSValue>::cast(obj); |
| i::Isolate* isolate = jsvalue->GetIsolate(); |
| LOG_API(isolate, StringObject, StringValue); |
| return Utils::ToLocal( |
| i::Handle<i::String>(i::String::cast(jsvalue->value()))); |
| } |
| |
| |
| Local<v8::Value> v8::SymbolObject::New(Isolate* isolate, Local<Symbol> value) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, SymbolObject, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::Object> obj = i::Object::ToObject( |
| i_isolate, Utils::OpenHandle(*value)).ToHandleChecked(); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| Local<v8::Symbol> v8::SymbolObject::ValueOf() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| i::Handle<i::JSValue> jsvalue = i::Handle<i::JSValue>::cast(obj); |
| i::Isolate* isolate = jsvalue->GetIsolate(); |
| LOG_API(isolate, SymbolObject, SymbolValue); |
| return Utils::ToLocal( |
| i::Handle<i::Symbol>(i::Symbol::cast(jsvalue->value()))); |
| } |
| |
| |
| MaybeLocal<v8::Value> v8::Date::New(Local<Context> context, double time) { |
| if (std::isnan(time)) { |
| // Introduce only canonical NaN value into the VM, to avoid signaling NaNs. |
| time = std::numeric_limits<double>::quiet_NaN(); |
| } |
| PREPARE_FOR_EXECUTION(context, Date, New, Value); |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>( |
| i::JSDate::New(isolate->date_function(), isolate->date_function(), time), |
| &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::Value> v8::Date::New(Isolate* isolate, double time) { |
| auto context = isolate->GetCurrentContext(); |
| RETURN_TO_LOCAL_UNCHECKED(New(context, time), Value); |
| } |
| |
| |
| double v8::Date::ValueOf() const { |
| i::Handle<i::Object> obj = Utils::OpenHandle(this); |
| i::Handle<i::JSDate> jsdate = i::Handle<i::JSDate>::cast(obj); |
| i::Isolate* isolate = jsdate->GetIsolate(); |
| LOG_API(isolate, Date, NumberValue); |
| return jsdate->value()->Number(); |
| } |
| |
| |
| void v8::Date::DateTimeConfigurationChangeNotification(Isolate* isolate) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, Date, DateTimeConfigurationChangeNotification); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i_isolate->date_cache()->ResetDateCache(); |
| if (!i_isolate->eternal_handles()->Exists( |
| i::EternalHandles::DATE_CACHE_VERSION)) { |
| return; |
| } |
| i::Handle<i::FixedArray> date_cache_version = |
| i::Handle<i::FixedArray>::cast(i_isolate->eternal_handles()->GetSingleton( |
| i::EternalHandles::DATE_CACHE_VERSION)); |
| DCHECK_EQ(1, date_cache_version->length()); |
| CHECK(date_cache_version->get(0)->IsSmi()); |
| date_cache_version->set( |
| 0, i::Smi::FromInt(i::Smi::ToInt(date_cache_version->get(0)) + 1)); |
| } |
| |
| |
| MaybeLocal<v8::RegExp> v8::RegExp::New(Local<Context> context, |
| Local<String> pattern, Flags flags) { |
| PREPARE_FOR_EXECUTION(context, RegExp, New, RegExp); |
| Local<v8::RegExp> result; |
| has_pending_exception = |
| !ToLocal<RegExp>(i::JSRegExp::New(Utils::OpenHandle(*pattern), |
| static_cast<i::JSRegExp::Flags>(flags)), |
| &result); |
| RETURN_ON_FAILED_EXECUTION(RegExp); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<v8::RegExp> v8::RegExp::New(Local<String> pattern, Flags flags) { |
| auto isolate = |
| reinterpret_cast<Isolate*>(Utils::OpenHandle(*pattern)->GetIsolate()); |
| auto context = isolate->GetCurrentContext(); |
| RETURN_TO_LOCAL_UNCHECKED(New(context, pattern, flags), RegExp); |
| } |
| |
| |
| Local<v8::String> v8::RegExp::GetSource() const { |
| i::Handle<i::JSRegExp> obj = Utils::OpenHandle(this); |
| return Utils::ToLocal(i::Handle<i::String>(obj->Pattern())); |
| } |
| |
| |
| // Assert that the static flags cast in GetFlags is valid. |
| #define REGEXP_FLAG_ASSERT_EQ(flag) \ |
| STATIC_ASSERT(static_cast<int>(v8::RegExp::flag) == \ |
| static_cast<int>(i::JSRegExp::flag)) |
| REGEXP_FLAG_ASSERT_EQ(kNone); |
| REGEXP_FLAG_ASSERT_EQ(kGlobal); |
| REGEXP_FLAG_ASSERT_EQ(kIgnoreCase); |
| REGEXP_FLAG_ASSERT_EQ(kMultiline); |
| REGEXP_FLAG_ASSERT_EQ(kSticky); |
| REGEXP_FLAG_ASSERT_EQ(kUnicode); |
| #undef REGEXP_FLAG_ASSERT_EQ |
| |
| v8::RegExp::Flags v8::RegExp::GetFlags() const { |
| i::Handle<i::JSRegExp> obj = Utils::OpenHandle(this); |
| return RegExp::Flags(static_cast<int>(obj->GetFlags())); |
| } |
| |
| |
| Local<v8::Array> v8::Array::New(Isolate* isolate, int length) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, Array, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| int real_length = length > 0 ? length : 0; |
| i::Handle<i::JSArray> obj = i_isolate->factory()->NewJSArray(real_length); |
| i::Handle<i::Object> length_obj = |
| i_isolate->factory()->NewNumberFromInt(real_length); |
| obj->set_length(*length_obj); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| uint32_t v8::Array::Length() const { |
| i::Handle<i::JSArray> obj = Utils::OpenHandle(this); |
| i::Object* length = obj->length(); |
| if (length->IsSmi()) { |
| return i::Smi::ToInt(length); |
| } else { |
| return static_cast<uint32_t>(length->Number()); |
| } |
| } |
| |
| |
| MaybeLocal<Object> Array::CloneElementAt(Local<Context> context, |
| uint32_t index) { |
| PREPARE_FOR_EXECUTION(context, Array, CloneElementAt, Object); |
| auto self = Utils::OpenHandle(this); |
| if (!self->HasObjectElements()) return Local<Object>(); |
| i::FixedArray* elms = i::FixedArray::cast(self->elements()); |
| i::Object* paragon = elms->get(index); |
| if (!paragon->IsJSObject()) return Local<Object>(); |
| i::Handle<i::JSObject> paragon_handle(i::JSObject::cast(paragon)); |
| Local<Object> result; |
| has_pending_exception = |
| !ToLocal<Object>(isolate->factory()->CopyJSObject(paragon_handle), |
| &result); |
| RETURN_ON_FAILED_EXECUTION(Object); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| Local<Object> Array::CloneElementAt(uint32_t index) { return Local<Object>(); } |
| |
| |
| Local<v8::Map> v8::Map::New(Isolate* isolate) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, Map, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::JSMap> obj = i_isolate->factory()->NewJSMap(); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| size_t v8::Map::Size() const { |
| i::Handle<i::JSMap> obj = Utils::OpenHandle(this); |
| return i::OrderedHashMap::cast(obj->table())->NumberOfElements(); |
| } |
| |
| |
| void Map::Clear() { |
| auto self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| LOG_API(isolate, Map, Clear); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::JSMap::Clear(self); |
| } |
| |
| |
| MaybeLocal<Value> Map::Get(Local<Context> context, Local<Value> key) { |
| PREPARE_FOR_EXECUTION(context, Map, Get, Value); |
| auto self = Utils::OpenHandle(this); |
| Local<Value> result; |
| i::Handle<i::Object> argv[] = {Utils::OpenHandle(*key)}; |
| has_pending_exception = |
| !ToLocal<Value>(i::Execution::Call(isolate, isolate->map_get(), self, |
| arraysize(argv), argv), |
| &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| |
| MaybeLocal<Map> Map::Set(Local<Context> context, Local<Value> key, |
| Local<Value> value) { |
| PREPARE_FOR_EXECUTION(context, Map, Set, Map); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> result; |
| i::Handle<i::Object> argv[] = {Utils::OpenHandle(*key), |
| Utils::OpenHandle(*value)}; |
| has_pending_exception = !i::Execution::Call(isolate, isolate->map_set(), self, |
| arraysize(argv), argv) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(Map); |
| RETURN_ESCAPED(Local<Map>::Cast(Utils::ToLocal(result))); |
| } |
| |
| |
| Maybe<bool> Map::Has(Local<Context> context, Local<Value> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Map, Has, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> result; |
| i::Handle<i::Object> argv[] = {Utils::OpenHandle(*key)}; |
| has_pending_exception = !i::Execution::Call(isolate, isolate->map_has(), self, |
| arraysize(argv), argv) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(result->IsTrue(isolate)); |
| } |
| |
| |
| Maybe<bool> Map::Delete(Local<Context> context, Local<Value> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Map, Delete, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> result; |
| i::Handle<i::Object> argv[] = {Utils::OpenHandle(*key)}; |
| has_pending_exception = !i::Execution::Call(isolate, isolate->map_delete(), |
| self, arraysize(argv), argv) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(result->IsTrue(isolate)); |
| } |
| |
| namespace { |
| |
| enum class MapAsArrayKind { |
| kEntries = i::JS_MAP_KEY_VALUE_ITERATOR_TYPE, |
| kKeys = i::JS_MAP_KEY_ITERATOR_TYPE, |
| kValues = i::JS_MAP_VALUE_ITERATOR_TYPE |
| }; |
| |
| i::Handle<i::JSArray> MapAsArray(i::Isolate* isolate, i::Object* table_obj, |
| int offset, MapAsArrayKind kind) { |
| i::Factory* factory = isolate->factory(); |
| i::Handle<i::OrderedHashMap> table(i::OrderedHashMap::cast(table_obj)); |
| if (offset >= table->NumberOfElements()) return factory->NewJSArray(0); |
| int length = (table->NumberOfElements() - offset) * |
| (kind == MapAsArrayKind::kEntries ? 2 : 1); |
| i::Handle<i::FixedArray> result = factory->NewFixedArray(length); |
| int result_index = 0; |
| { |
| i::DisallowHeapAllocation no_gc; |
| int capacity = table->UsedCapacity(); |
| i::Oddball* the_hole = isolate->heap()->the_hole_value(); |
| for (int i = 0; i < capacity; ++i) { |
| i::Object* key = table->KeyAt(i); |
| if (key == the_hole) continue; |
| if (offset-- > 0) continue; |
| if (kind == MapAsArrayKind::kEntries || kind == MapAsArrayKind::kKeys) { |
| result->set(result_index++, key); |
| } |
| if (kind == MapAsArrayKind::kEntries || kind == MapAsArrayKind::kValues) { |
| result->set(result_index++, table->ValueAt(i)); |
| } |
| } |
| } |
| DCHECK_EQ(result_index, result->length()); |
| DCHECK_EQ(result_index, length); |
| return factory->NewJSArrayWithElements(result, i::PACKED_ELEMENTS, length); |
| } |
| |
| } // namespace |
| |
| Local<Array> Map::AsArray() const { |
| i::Handle<i::JSMap> obj = Utils::OpenHandle(this); |
| i::Isolate* isolate = obj->GetIsolate(); |
| LOG_API(isolate, Map, AsArray); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| return Utils::ToLocal( |
| MapAsArray(isolate, obj->table(), 0, MapAsArrayKind::kEntries)); |
| } |
| |
| |
| Local<v8::Set> v8::Set::New(Isolate* isolate) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, Set, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::JSSet> obj = i_isolate->factory()->NewJSSet(); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| size_t v8::Set::Size() const { |
| i::Handle<i::JSSet> obj = Utils::OpenHandle(this); |
| return i::OrderedHashSet::cast(obj->table())->NumberOfElements(); |
| } |
| |
| |
| void Set::Clear() { |
| auto self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| LOG_API(isolate, Set, Clear); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::JSSet::Clear(self); |
| } |
| |
| |
| MaybeLocal<Set> Set::Add(Local<Context> context, Local<Value> key) { |
| PREPARE_FOR_EXECUTION(context, Set, Add, Set); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> result; |
| i::Handle<i::Object> argv[] = {Utils::OpenHandle(*key)}; |
| has_pending_exception = !i::Execution::Call(isolate, isolate->set_add(), self, |
| arraysize(argv), argv) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(Set); |
| RETURN_ESCAPED(Local<Set>::Cast(Utils::ToLocal(result))); |
| } |
| |
| |
| Maybe<bool> Set::Has(Local<Context> context, Local<Value> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Set, Has, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> result; |
| i::Handle<i::Object> argv[] = {Utils::OpenHandle(*key)}; |
| has_pending_exception = !i::Execution::Call(isolate, isolate->set_has(), self, |
| arraysize(argv), argv) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(result->IsTrue(isolate)); |
| } |
| |
| |
| Maybe<bool> Set::Delete(Local<Context> context, Local<Value> key) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Set, Delete, Nothing<bool>(), i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> result; |
| i::Handle<i::Object> argv[] = {Utils::OpenHandle(*key)}; |
| has_pending_exception = !i::Execution::Call(isolate, isolate->set_delete(), |
| self, arraysize(argv), argv) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(result->IsTrue(isolate)); |
| } |
| |
| namespace { |
| i::Handle<i::JSArray> SetAsArray(i::Isolate* isolate, i::Object* table_obj, |
| int offset) { |
| i::Factory* factory = isolate->factory(); |
| i::Handle<i::OrderedHashSet> table(i::OrderedHashSet::cast(table_obj)); |
| int length = table->NumberOfElements() - offset; |
| if (length <= 0) return factory->NewJSArray(0); |
| i::Handle<i::FixedArray> result = factory->NewFixedArray(length); |
| int result_index = 0; |
| { |
| i::DisallowHeapAllocation no_gc; |
| int capacity = table->UsedCapacity(); |
| i::Oddball* the_hole = isolate->heap()->the_hole_value(); |
| for (int i = 0; i < capacity; ++i) { |
| i::Object* key = table->KeyAt(i); |
| if (key == the_hole) continue; |
| if (offset-- > 0) continue; |
| result->set(result_index++, key); |
| } |
| } |
| DCHECK_EQ(result_index, result->length()); |
| DCHECK_EQ(result_index, length); |
| return factory->NewJSArrayWithElements(result, i::PACKED_ELEMENTS, length); |
| } |
| } // namespace |
| |
| Local<Array> Set::AsArray() const { |
| i::Handle<i::JSSet> obj = Utils::OpenHandle(this); |
| i::Isolate* isolate = obj->GetIsolate(); |
| LOG_API(isolate, Set, AsArray); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| return Utils::ToLocal(SetAsArray(isolate, obj->table(), 0)); |
| } |
| |
| |
| MaybeLocal<Promise::Resolver> Promise::Resolver::New(Local<Context> context) { |
| PREPARE_FOR_EXECUTION(context, Promise_Resolver, New, Resolver); |
| i::Handle<i::Object> result; |
| has_pending_exception = |
| !i::Execution::Call(isolate, isolate->promise_internal_constructor(), |
| isolate->factory()->undefined_value(), 0, nullptr) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(Promise::Resolver); |
| RETURN_ESCAPED(Local<Promise::Resolver>::Cast(Utils::ToLocal(result))); |
| } |
| |
| |
| Local<Promise::Resolver> Promise::Resolver::New(Isolate* isolate) { |
| RETURN_TO_LOCAL_UNCHECKED(New(isolate->GetCurrentContext()), |
| Promise::Resolver); |
| } |
| |
| |
| Local<Promise> Promise::Resolver::GetPromise() { |
| i::Handle<i::JSReceiver> promise = Utils::OpenHandle(this); |
| return Local<Promise>::Cast(Utils::ToLocal(promise)); |
| } |
| |
| |
| Maybe<bool> Promise::Resolver::Resolve(Local<Context> context, |
| Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Promise_Resolver, Resolve, Nothing<bool>(), |
| i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> argv[] = {self, Utils::OpenHandle(*value)}; |
| has_pending_exception = |
| i::Execution::Call(isolate, isolate->promise_resolve(), |
| isolate->factory()->undefined_value(), arraysize(argv), |
| argv) |
| .is_null(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(true); |
| } |
| |
| |
| void Promise::Resolver::Resolve(Local<Value> value) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| USE(Resolve(context, value)); |
| } |
| |
| |
| Maybe<bool> Promise::Resolver::Reject(Local<Context> context, |
| Local<Value> value) { |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| ENTER_V8(isolate, context, Promise_Resolver, Reject, Nothing<bool>(), |
| i::HandleScope); |
| auto self = Utils::OpenHandle(this); |
| |
| // We pass true to trigger the debugger's on exception handler. |
| i::Handle<i::Object> argv[] = {self, Utils::OpenHandle(*value), |
| isolate->factory()->ToBoolean(true)}; |
| has_pending_exception = |
| i::Execution::Call(isolate, isolate->promise_internal_reject(), |
| isolate->factory()->undefined_value(), arraysize(argv), |
| argv) |
| .is_null(); |
| RETURN_ON_FAILED_EXECUTION_PRIMITIVE(bool); |
| return Just(true); |
| } |
| |
| |
| void Promise::Resolver::Reject(Local<Value> value) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| USE(Reject(context, value)); |
| } |
| |
| |
| MaybeLocal<Promise> Promise::Catch(Local<Context> context, |
| Local<Function> handler) { |
| PREPARE_FOR_EXECUTION(context, Promise, Catch, Promise); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> argv[] = { Utils::OpenHandle(*handler) }; |
| i::Handle<i::Object> result; |
| has_pending_exception = !i::Execution::Call(isolate, isolate->promise_catch(), |
| self, arraysize(argv), argv) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(Promise); |
| RETURN_ESCAPED(Local<Promise>::Cast(Utils::ToLocal(result))); |
| } |
| |
| |
| Local<Promise> Promise::Catch(Local<Function> handler) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(Catch(context, handler), Promise); |
| } |
| |
| |
| MaybeLocal<Promise> Promise::Then(Local<Context> context, |
| Local<Function> handler) { |
| PREPARE_FOR_EXECUTION(context, Promise, Then, Promise); |
| auto self = Utils::OpenHandle(this); |
| i::Handle<i::Object> argv[] = { Utils::OpenHandle(*handler) }; |
| i::Handle<i::Object> result; |
| has_pending_exception = !i::Execution::Call(isolate, isolate->promise_then(), |
| self, arraysize(argv), argv) |
| .ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(Promise); |
| RETURN_ESCAPED(Local<Promise>::Cast(Utils::ToLocal(result))); |
| } |
| |
| |
| Local<Promise> Promise::Then(Local<Function> handler) { |
| auto context = ContextFromHeapObject(Utils::OpenHandle(this)); |
| RETURN_TO_LOCAL_UNCHECKED(Then(context, handler), Promise); |
| } |
| |
| |
| bool Promise::HasHandler() { |
| i::Handle<i::JSReceiver> promise = Utils::OpenHandle(this); |
| i::Isolate* isolate = promise->GetIsolate(); |
| LOG_API(isolate, Promise, HasRejectHandler); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| if (promise->IsJSPromise()) { |
| i::Handle<i::JSPromise> js_promise = i::Handle<i::JSPromise>::cast(promise); |
| return js_promise->has_handler(); |
| } |
| return false; |
| } |
| |
| Local<Value> Promise::Result() { |
| i::Handle<i::JSReceiver> promise = Utils::OpenHandle(this); |
| i::Isolate* isolate = promise->GetIsolate(); |
| LOG_API(isolate, Promise, Result); |
| i::Handle<i::JSPromise> js_promise = i::Handle<i::JSPromise>::cast(promise); |
| Utils::ApiCheck(js_promise->status() != kPending, "v8_Promise_Result", |
| "Promise is still pending"); |
| i::Handle<i::Object> result(js_promise->result(), isolate); |
| return Utils::ToLocal(result); |
| } |
| |
| Promise::PromiseState Promise::State() { |
| i::Handle<i::JSReceiver> promise = Utils::OpenHandle(this); |
| i::Isolate* isolate = promise->GetIsolate(); |
| LOG_API(isolate, Promise, Status); |
| i::Handle<i::JSPromise> js_promise = i::Handle<i::JSPromise>::cast(promise); |
| return static_cast<PromiseState>(js_promise->status()); |
| } |
| |
| Local<Object> Proxy::GetTarget() { |
| i::Handle<i::JSProxy> self = Utils::OpenHandle(this); |
| i::Handle<i::JSReceiver> target(self->target()); |
| return Utils::ToLocal(target); |
| } |
| |
| |
| Local<Value> Proxy::GetHandler() { |
| i::Handle<i::JSProxy> self = Utils::OpenHandle(this); |
| i::Handle<i::Object> handler(self->handler(), self->GetIsolate()); |
| return Utils::ToLocal(handler); |
| } |
| |
| |
| bool Proxy::IsRevoked() { |
| i::Handle<i::JSProxy> self = Utils::OpenHandle(this); |
| return self->IsRevoked(); |
| } |
| |
| |
| void Proxy::Revoke() { |
| i::Handle<i::JSProxy> self = Utils::OpenHandle(this); |
| i::JSProxy::Revoke(self); |
| } |
| |
| |
| MaybeLocal<Proxy> Proxy::New(Local<Context> context, Local<Object> local_target, |
| Local<Object> local_handler) { |
| PREPARE_FOR_EXECUTION(context, Proxy, New, Proxy); |
| i::Handle<i::JSReceiver> target = Utils::OpenHandle(*local_target); |
| i::Handle<i::JSReceiver> handler = Utils::OpenHandle(*local_handler); |
| Local<Proxy> result; |
| has_pending_exception = |
| !ToLocal<Proxy>(i::JSProxy::New(isolate, target, handler), &result); |
| RETURN_ON_FAILED_EXECUTION(Proxy); |
| RETURN_ESCAPED(result); |
| } |
| |
| Local<String> WasmCompiledModule::GetWasmWireBytes() { |
| i::Handle<i::WasmModuleObject> obj = |
| i::Handle<i::WasmModuleObject>::cast(Utils::OpenHandle(this)); |
| i::Handle<i::WasmCompiledModule> compiled_part = |
| i::handle(i::WasmCompiledModule::cast(obj->compiled_module())); |
| i::Handle<i::String> wire_bytes(compiled_part->module_bytes()); |
| return Local<String>::Cast(Utils::ToLocal(wire_bytes)); |
| } |
| |
| // Currently, wasm modules are bound, both to Isolate and to |
| // the Context they were created in. The currently-supported means to |
| // decontextualize and then re-contextualize a module is via |
| // serialization/deserialization. |
| WasmCompiledModule::TransferrableModule |
| WasmCompiledModule::GetTransferrableModule() { |
| i::DisallowHeapAllocation no_gc; |
| WasmCompiledModule::SerializedModule compiled_part = Serialize(); |
| |
| Local<String> wire_bytes = GetWasmWireBytes(); |
| size_t wire_size = static_cast<size_t>(wire_bytes->Length()); |
| uint8_t* bytes = new uint8_t[wire_size]; |
| wire_bytes->WriteOneByte(bytes, 0, wire_bytes->Length()); |
| |
| return TransferrableModule( |
| std::move(compiled_part), |
| std::make_pair( |
| std::unique_ptr<const uint8_t[]>(const_cast<const uint8_t*>(bytes)), |
| wire_size)); |
| } |
| |
| MaybeLocal<WasmCompiledModule> WasmCompiledModule::FromTransferrableModule( |
| Isolate* isolate, |
| const WasmCompiledModule::TransferrableModule& transferrable_module) { |
| MaybeLocal<WasmCompiledModule> ret = |
| Deserialize(isolate, AsCallerOwned(transferrable_module.compiled_code), |
| AsCallerOwned(transferrable_module.wire_bytes)); |
| return ret; |
| } |
| |
| WasmCompiledModule::SerializedModule WasmCompiledModule::Serialize() { |
| i::Handle<i::WasmModuleObject> obj = |
| i::Handle<i::WasmModuleObject>::cast(Utils::OpenHandle(this)); |
| i::Handle<i::WasmCompiledModule> compiled_part = |
| i::handle(i::WasmCompiledModule::cast(obj->compiled_module())); |
| if (i::FLAG_wasm_jit_to_native) { |
| i::Isolate* isolate = obj->GetIsolate(); |
| |
| return i::wasm::NativeModuleSerializer::SerializeWholeModule(isolate, |
| compiled_part); |
| } else { |
| std::unique_ptr<i::ScriptData> script_data = |
| i::WasmCompiledModuleSerializer::SerializeWasmModule(obj->GetIsolate(), |
| compiled_part); |
| script_data->ReleaseDataOwnership(); |
| |
| size_t size = static_cast<size_t>(script_data->length()); |
| return {std::unique_ptr<const uint8_t[]>(script_data->data()), size}; |
| } |
| } |
| |
| MaybeLocal<WasmCompiledModule> WasmCompiledModule::Deserialize( |
| Isolate* isolate, |
| const WasmCompiledModule::CallerOwnedBuffer& serialized_module, |
| const WasmCompiledModule::CallerOwnedBuffer& wire_bytes) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| i::MaybeHandle<i::FixedArray> maybe_compiled_part; |
| if (i::FLAG_wasm_jit_to_native) { |
| maybe_compiled_part = |
| i::wasm::NativeModuleDeserializer::DeserializeFullBuffer( |
| i_isolate, {serialized_module.first, serialized_module.second}, |
| {wire_bytes.first, wire_bytes.second}); |
| } else { |
| int size = static_cast<int>(serialized_module.second); |
| i::ScriptData sc(serialized_module.first, size); |
| maybe_compiled_part = |
| i::WasmCompiledModuleSerializer::DeserializeWasmModule( |
| i_isolate, &sc, {wire_bytes.first, wire_bytes.second}); |
| } |
| i::Handle<i::FixedArray> compiled_part; |
| if (!maybe_compiled_part.ToHandle(&compiled_part)) { |
| return MaybeLocal<WasmCompiledModule>(); |
| } |
| i::Handle<i::WasmCompiledModule> compiled_module = |
| handle(i::WasmCompiledModule::cast(*compiled_part)); |
| return Local<WasmCompiledModule>::Cast( |
| Utils::ToLocal(i::Handle<i::JSObject>::cast( |
| i::WasmModuleObject::New(i_isolate, compiled_module)))); |
| } |
| |
| MaybeLocal<WasmCompiledModule> WasmCompiledModule::DeserializeOrCompile( |
| Isolate* isolate, |
| const WasmCompiledModule::CallerOwnedBuffer& serialized_module, |
| const WasmCompiledModule::CallerOwnedBuffer& wire_bytes) { |
| MaybeLocal<WasmCompiledModule> ret = |
| Deserialize(isolate, serialized_module, wire_bytes); |
| if (!ret.IsEmpty()) { |
| return ret; |
| } |
| return Compile(isolate, wire_bytes.first, wire_bytes.second); |
| } |
| |
| MaybeLocal<WasmCompiledModule> WasmCompiledModule::Compile(Isolate* isolate, |
| const uint8_t* start, |
| size_t length) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| i::wasm::ErrorThrower thrower(i_isolate, "WasmCompiledModule::Compile()"); |
| if (!i::wasm::IsWasmCodegenAllowed(i_isolate, i_isolate->native_context())) { |
| return MaybeLocal<WasmCompiledModule>(); |
| } |
| i::MaybeHandle<i::JSObject> maybe_compiled = i::wasm::SyncCompile( |
| i_isolate, &thrower, i::wasm::ModuleWireBytes(start, start + length)); |
| if (maybe_compiled.is_null()) return MaybeLocal<WasmCompiledModule>(); |
| return Local<WasmCompiledModule>::Cast( |
| Utils::ToLocal(maybe_compiled.ToHandleChecked())); |
| } |
| |
| WasmModuleObjectBuilderStreaming::WasmModuleObjectBuilderStreaming( |
| Isolate* isolate) |
| : isolate_(isolate) { |
| MaybeLocal<Promise::Resolver> maybe_resolver = |
| Promise::Resolver::New(isolate->GetCurrentContext()); |
| Local<Promise::Resolver> resolver = maybe_resolver.ToLocalChecked(); |
| promise_.Reset(isolate, resolver->GetPromise()); |
| |
| if (i::FLAG_wasm_stream_compilation) { |
| i::Handle<i::JSPromise> promise = Utils::OpenHandle(*GetPromise()); |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| streaming_decoder_ = |
| i_isolate->wasm_compilation_manager()->StartStreamingCompilation( |
| i_isolate, handle(i_isolate->context()), promise); |
| } |
| } |
| |
| Local<Promise> WasmModuleObjectBuilderStreaming::GetPromise() { |
| return promise_.Get(isolate_); |
| } |
| |
| void WasmModuleObjectBuilderStreaming::OnBytesReceived(const uint8_t* bytes, |
| size_t size) { |
| if (i::FLAG_wasm_stream_compilation) { |
| streaming_decoder_->OnBytesReceived(i::Vector<const uint8_t>(bytes, size)); |
| return; |
| } |
| std::unique_ptr<uint8_t[]> cloned_bytes(new uint8_t[size]); |
| memcpy(cloned_bytes.get(), bytes, size); |
| received_buffers_.push_back( |
| Buffer(std::unique_ptr<const uint8_t[]>( |
| const_cast<const uint8_t*>(cloned_bytes.release())), |
| size)); |
| total_size_ += size; |
| } |
| |
| void WasmModuleObjectBuilderStreaming::Finish() { |
| if (i::FLAG_wasm_stream_compilation) { |
| streaming_decoder_->Finish(); |
| return; |
| } |
| std::unique_ptr<uint8_t[]> wire_bytes(new uint8_t[total_size_]); |
| uint8_t* insert_at = wire_bytes.get(); |
| |
| for (size_t i = 0; i < received_buffers_.size(); ++i) { |
| const Buffer& buff = received_buffers_[i]; |
| memcpy(insert_at, buff.first.get(), buff.second); |
| insert_at += buff.second; |
| } |
| // AsyncCompile makes its own copy of the wire bytes. This inefficiency |
| // will be resolved when we move to true streaming compilation. |
| i::wasm::AsyncCompile(reinterpret_cast<i::Isolate*>(isolate_), |
| Utils::OpenHandle(*promise_.Get(isolate_)), |
| {wire_bytes.get(), wire_bytes.get() + total_size_}); |
| } |
| |
| void WasmModuleObjectBuilderStreaming::Abort(Local<Value> exception) { |
| Local<Promise> promise = GetPromise(); |
| // The promise has already been resolved, e.g. because of a compilation |
| // error. |
| if (promise->State() != v8::Promise::kPending) return; |
| if (i::FLAG_wasm_stream_compilation) streaming_decoder_->Abort(); |
| |
| Local<Promise::Resolver> resolver = promise.As<Promise::Resolver>(); |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate_); |
| i::HandleScope scope(i_isolate); |
| Local<Context> context = Utils::ToLocal(handle(i_isolate->context())); |
| auto maybe = resolver->Reject(context, exception); |
| CHECK_IMPLIES(!maybe.FromMaybe(false), i_isolate->has_scheduled_exception()); |
| } |
| |
| WasmModuleObjectBuilderStreaming::~WasmModuleObjectBuilderStreaming() { |
| promise_.Reset(); |
| } |
| |
| void WasmModuleObjectBuilder::OnBytesReceived(const uint8_t* bytes, |
| size_t size) { |
| std::unique_ptr<uint8_t[]> cloned_bytes(new uint8_t[size]); |
| memcpy(cloned_bytes.get(), bytes, size); |
| received_buffers_.push_back( |
| Buffer(std::unique_ptr<const uint8_t[]>( |
| const_cast<const uint8_t*>(cloned_bytes.release())), |
| size)); |
| total_size_ += size; |
| } |
| |
| MaybeLocal<WasmCompiledModule> WasmModuleObjectBuilder::Finish() { |
| std::unique_ptr<uint8_t[]> wire_bytes(new uint8_t[total_size_]); |
| uint8_t* insert_at = wire_bytes.get(); |
| |
| for (size_t i = 0; i < received_buffers_.size(); ++i) { |
| const Buffer& buff = received_buffers_[i]; |
| memcpy(insert_at, buff.first.get(), buff.second); |
| insert_at += buff.second; |
| } |
| return WasmCompiledModule::Compile(isolate_, wire_bytes.get(), total_size_); |
| } |
| |
| // static |
| v8::ArrayBuffer::Allocator* v8::ArrayBuffer::Allocator::NewDefaultAllocator() { |
| return new ArrayBufferAllocator(); |
| } |
| |
| bool v8::ArrayBuffer::IsExternal() const { |
| return Utils::OpenHandle(this)->is_external(); |
| } |
| |
| |
| bool v8::ArrayBuffer::IsNeuterable() const { |
| return Utils::OpenHandle(this)->is_neuterable(); |
| } |
| |
| |
| v8::ArrayBuffer::Contents v8::ArrayBuffer::Externalize() { |
| i::Handle<i::JSArrayBuffer> self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| Utils::ApiCheck(!self->is_external(), "v8_ArrayBuffer_Externalize", |
| "ArrayBuffer already externalized"); |
| self->set_is_external(true); |
| isolate->heap()->UnregisterArrayBuffer(*self); |
| |
| return GetContents(); |
| } |
| |
| |
| v8::ArrayBuffer::Contents v8::ArrayBuffer::GetContents() { |
| i::Handle<i::JSArrayBuffer> self = Utils::OpenHandle(this); |
| size_t byte_length = static_cast<size_t>(self->byte_length()->Number()); |
| Contents contents; |
| contents.allocation_base_ = self->allocation_base(); |
| contents.allocation_length_ = self->allocation_length(); |
| contents.allocation_mode_ = self->has_guard_region() |
| ? Allocator::AllocationMode::kReservation |
| : Allocator::AllocationMode::kNormal; |
| contents.data_ = self->backing_store(); |
| contents.byte_length_ = byte_length; |
| return contents; |
| } |
| |
| |
| void v8::ArrayBuffer::Neuter() { |
| i::Handle<i::JSArrayBuffer> obj = Utils::OpenHandle(this); |
| i::Isolate* isolate = obj->GetIsolate(); |
| Utils::ApiCheck(obj->is_external(), |
| "v8::ArrayBuffer::Neuter", |
| "Only externalized ArrayBuffers can be neutered"); |
| Utils::ApiCheck(obj->is_neuterable(), "v8::ArrayBuffer::Neuter", |
| "Only neuterable ArrayBuffers can be neutered"); |
| LOG_API(isolate, ArrayBuffer, Neuter); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| obj->Neuter(); |
| } |
| |
| |
| size_t v8::ArrayBuffer::ByteLength() const { |
| i::Handle<i::JSArrayBuffer> obj = Utils::OpenHandle(this); |
| return static_cast<size_t>(obj->byte_length()->Number()); |
| } |
| |
| |
| Local<ArrayBuffer> v8::ArrayBuffer::New(Isolate* isolate, size_t byte_length) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, ArrayBuffer, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::JSArrayBuffer> obj = |
| i_isolate->factory()->NewJSArrayBuffer(i::SharedFlag::kNotShared); |
| // TODO(jbroman): It may be useful in the future to provide a MaybeLocal |
| // version that throws an exception or otherwise does not crash. |
| if (!i::JSArrayBuffer::SetupAllocatingData(obj, i_isolate, byte_length)) { |
| i::FatalProcessOutOfMemory("v8::ArrayBuffer::New"); |
| } |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| Local<ArrayBuffer> v8::ArrayBuffer::New(Isolate* isolate, void* data, |
| size_t byte_length, |
| ArrayBufferCreationMode mode) { |
| // Embedders must guarantee that the external backing store is valid. |
| CHECK(byte_length == 0 || data != nullptr); |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, ArrayBuffer, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::JSArrayBuffer> obj = |
| i_isolate->factory()->NewJSArrayBuffer(i::SharedFlag::kNotShared); |
| i::JSArrayBuffer::Setup(obj, i_isolate, |
| mode == ArrayBufferCreationMode::kExternalized, data, |
| byte_length); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| Local<ArrayBuffer> v8::ArrayBufferView::Buffer() { |
| i::Handle<i::JSArrayBufferView> obj = Utils::OpenHandle(this); |
| i::Handle<i::JSArrayBuffer> buffer; |
| if (obj->IsJSDataView()) { |
| i::Handle<i::JSDataView> data_view(i::JSDataView::cast(*obj)); |
| DCHECK(data_view->buffer()->IsJSArrayBuffer()); |
| buffer = i::handle(i::JSArrayBuffer::cast(data_view->buffer())); |
| } else { |
| DCHECK(obj->IsJSTypedArray()); |
| buffer = i::JSTypedArray::cast(*obj)->GetBuffer(); |
| } |
| return Utils::ToLocal(buffer); |
| } |
| |
| |
| size_t v8::ArrayBufferView::CopyContents(void* dest, size_t byte_length) { |
| i::Handle<i::JSArrayBufferView> self = Utils::OpenHandle(this); |
| size_t byte_offset = i::NumberToSize(self->byte_offset()); |
| size_t bytes_to_copy = |
| i::Min(byte_length, i::NumberToSize(self->byte_length())); |
| if (bytes_to_copy) { |
| i::DisallowHeapAllocation no_gc; |
| i::Handle<i::JSArrayBuffer> buffer(i::JSArrayBuffer::cast(self->buffer())); |
| const char* source = reinterpret_cast<char*>(buffer->backing_store()); |
| if (source == nullptr) { |
| DCHECK(self->IsJSTypedArray()); |
| i::Handle<i::JSTypedArray> typed_array(i::JSTypedArray::cast(*self)); |
| i::Handle<i::FixedTypedArrayBase> fixed_array( |
| i::FixedTypedArrayBase::cast(typed_array->elements())); |
| source = reinterpret_cast<char*>(fixed_array->DataPtr()); |
| } |
| memcpy(dest, source + byte_offset, bytes_to_copy); |
| } |
| return bytes_to_copy; |
| } |
| |
| |
| bool v8::ArrayBufferView::HasBuffer() const { |
| i::Handle<i::JSArrayBufferView> self = Utils::OpenHandle(this); |
| i::Handle<i::JSArrayBuffer> buffer(i::JSArrayBuffer::cast(self->buffer())); |
| return buffer->backing_store() != nullptr; |
| } |
| |
| |
| size_t v8::ArrayBufferView::ByteOffset() { |
| i::Handle<i::JSArrayBufferView> obj = Utils::OpenHandle(this); |
| return static_cast<size_t>(obj->byte_offset()->Number()); |
| } |
| |
| |
| size_t v8::ArrayBufferView::ByteLength() { |
| i::Handle<i::JSArrayBufferView> obj = Utils::OpenHandle(this); |
| return static_cast<size_t>(obj->byte_length()->Number()); |
| } |
| |
| |
| size_t v8::TypedArray::Length() { |
| i::Handle<i::JSTypedArray> obj = Utils::OpenHandle(this); |
| return static_cast<size_t>(obj->length_value()); |
| } |
| |
| static_assert(v8::TypedArray::kMaxLength == i::Smi::kMaxValue, |
| "v8::TypedArray::kMaxLength must match i::Smi::kMaxValue"); |
| |
| #define TYPED_ARRAY_NEW(Type, type, TYPE, ctype, size) \ |
| Local<Type##Array> Type##Array::New(Local<ArrayBuffer> array_buffer, \ |
| size_t byte_offset, size_t length) { \ |
| i::Isolate* isolate = Utils::OpenHandle(*array_buffer)->GetIsolate(); \ |
| LOG_API(isolate, Type##Array, New); \ |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); \ |
| if (!Utils::ApiCheck(length <= kMaxLength, \ |
| "v8::" #Type \ |
| "Array::New(Local<ArrayBuffer>, size_t, size_t)", \ |
| "length exceeds max allowed value")) { \ |
| return Local<Type##Array>(); \ |
| } \ |
| i::Handle<i::JSArrayBuffer> buffer = Utils::OpenHandle(*array_buffer); \ |
| i::Handle<i::JSTypedArray> obj = isolate->factory()->NewJSTypedArray( \ |
| i::kExternal##Type##Array, buffer, byte_offset, length); \ |
| return Utils::ToLocal##Type##Array(obj); \ |
| } \ |
| Local<Type##Array> Type##Array::New( \ |
| Local<SharedArrayBuffer> shared_array_buffer, size_t byte_offset, \ |
| size_t length) { \ |
| CHECK(i::FLAG_harmony_sharedarraybuffer); \ |
| i::Isolate* isolate = \ |
| Utils::OpenHandle(*shared_array_buffer)->GetIsolate(); \ |
| LOG_API(isolate, Type##Array, New); \ |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); \ |
| if (!Utils::ApiCheck( \ |
| length <= kMaxLength, \ |
| "v8::" #Type \ |
| "Array::New(Local<SharedArrayBuffer>, size_t, size_t)", \ |
| "length exceeds max allowed value")) { \ |
| return Local<Type##Array>(); \ |
| } \ |
| i::Handle<i::JSArrayBuffer> buffer = \ |
| Utils::OpenHandle(*shared_array_buffer); \ |
| i::Handle<i::JSTypedArray> obj = isolate->factory()->NewJSTypedArray( \ |
| i::kExternal##Type##Array, buffer, byte_offset, length); \ |
| return Utils::ToLocal##Type##Array(obj); \ |
| } |
| |
| TYPED_ARRAYS(TYPED_ARRAY_NEW) |
| #undef TYPED_ARRAY_NEW |
| |
| Local<DataView> DataView::New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t byte_length) { |
| i::Handle<i::JSArrayBuffer> buffer = Utils::OpenHandle(*array_buffer); |
| i::Isolate* isolate = buffer->GetIsolate(); |
| LOG_API(isolate, DataView, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::Handle<i::JSDataView> obj = |
| isolate->factory()->NewJSDataView(buffer, byte_offset, byte_length); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| Local<DataView> DataView::New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t byte_length) { |
| CHECK(i::FLAG_harmony_sharedarraybuffer); |
| i::Handle<i::JSArrayBuffer> buffer = Utils::OpenHandle(*shared_array_buffer); |
| i::Isolate* isolate = buffer->GetIsolate(); |
| LOG_API(isolate, DataView, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::Handle<i::JSDataView> obj = |
| isolate->factory()->NewJSDataView(buffer, byte_offset, byte_length); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| bool v8::SharedArrayBuffer::IsExternal() const { |
| return Utils::OpenHandle(this)->is_external(); |
| } |
| |
| |
| v8::SharedArrayBuffer::Contents v8::SharedArrayBuffer::Externalize() { |
| i::Handle<i::JSArrayBuffer> self = Utils::OpenHandle(this); |
| i::Isolate* isolate = self->GetIsolate(); |
| Utils::ApiCheck(!self->is_external(), "v8_SharedArrayBuffer_Externalize", |
| "SharedArrayBuffer already externalized"); |
| self->set_is_external(true); |
| isolate->heap()->UnregisterArrayBuffer(*self); |
| return GetContents(); |
| } |
| |
| |
| v8::SharedArrayBuffer::Contents v8::SharedArrayBuffer::GetContents() { |
| i::Handle<i::JSArrayBuffer> self = Utils::OpenHandle(this); |
| size_t byte_length = static_cast<size_t>(self->byte_length()->Number()); |
| Contents contents; |
| contents.data_ = self->backing_store(); |
| contents.byte_length_ = byte_length; |
| // SharedArrayBuffers never have guard regions, so their allocation and data |
| // are equivalent. |
| contents.allocation_base_ = self->backing_store(); |
| contents.allocation_length_ = byte_length; |
| contents.allocation_mode_ = |
| ArrayBufferAllocator::Allocator::AllocationMode::kNormal; |
| return contents; |
| } |
| |
| |
| size_t v8::SharedArrayBuffer::ByteLength() const { |
| i::Handle<i::JSArrayBuffer> obj = Utils::OpenHandle(this); |
| return static_cast<size_t>(obj->byte_length()->Number()); |
| } |
| |
| |
| Local<SharedArrayBuffer> v8::SharedArrayBuffer::New(Isolate* isolate, |
| size_t byte_length) { |
| CHECK(i::FLAG_harmony_sharedarraybuffer); |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, SharedArrayBuffer, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::JSArrayBuffer> obj = |
| i_isolate->factory()->NewJSArrayBuffer(i::SharedFlag::kShared); |
| // TODO(jbroman): It may be useful in the future to provide a MaybeLocal |
| // version that throws an exception or otherwise does not crash. |
| if (!i::JSArrayBuffer::SetupAllocatingData(obj, i_isolate, byte_length, true, |
| i::SharedFlag::kShared)) { |
| i::FatalProcessOutOfMemory("v8::SharedArrayBuffer::New"); |
| } |
| return Utils::ToLocalShared(obj); |
| } |
| |
| |
| Local<SharedArrayBuffer> v8::SharedArrayBuffer::New( |
| Isolate* isolate, void* data, size_t byte_length, |
| ArrayBufferCreationMode mode) { |
| CHECK(i::FLAG_harmony_sharedarraybuffer); |
| // Embedders must guarantee that the external backing store is valid. |
| CHECK(byte_length == 0 || data != nullptr); |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, SharedArrayBuffer, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::JSArrayBuffer> obj = |
| i_isolate->factory()->NewJSArrayBuffer(i::SharedFlag::kShared); |
| i::JSArrayBuffer::Setup(obj, i_isolate, |
| mode == ArrayBufferCreationMode::kExternalized, data, |
| byte_length, i::SharedFlag::kShared); |
| return Utils::ToLocalShared(obj); |
| } |
| |
| |
| Local<Symbol> v8::Symbol::New(Isolate* isolate, Local<String> name) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, Symbol, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::Symbol> result = i_isolate->factory()->NewSymbol(); |
| if (!name.IsEmpty()) result->set_name(*Utils::OpenHandle(*name)); |
| return Utils::ToLocal(result); |
| } |
| |
| |
| Local<Symbol> v8::Symbol::For(Isolate* isolate, Local<String> name) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| i::Handle<i::String> i_name = Utils::OpenHandle(*name); |
| return Utils::ToLocal(i_isolate->SymbolFor( |
| i::Heap::kPublicSymbolTableRootIndex, i_name, false)); |
| } |
| |
| |
| Local<Symbol> v8::Symbol::ForApi(Isolate* isolate, Local<String> name) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| i::Handle<i::String> i_name = Utils::OpenHandle(*name); |
| return Utils::ToLocal( |
| i_isolate->SymbolFor(i::Heap::kApiSymbolTableRootIndex, i_name, false)); |
| } |
| |
| #define WELL_KNOWN_SYMBOLS(V) \ |
| V(HasInstance, has_instance) \ |
| V(IsConcatSpreadable, is_concat_spreadable) \ |
| V(Iterator, iterator) \ |
| V(Match, match) \ |
| V(Replace, replace) \ |
| V(Search, search) \ |
| V(Split, split) \ |
| V(ToPrimitive, to_primitive) \ |
| V(ToStringTag, to_string_tag) \ |
| V(Unscopables, unscopables) |
| |
| #define SYMBOL_GETTER(Name, name) \ |
| Local<Symbol> v8::Symbol::Get##Name(Isolate* isolate) { \ |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); \ |
| return Utils::ToLocal(i_isolate->factory()->name##_symbol()); \ |
| } |
| |
| WELL_KNOWN_SYMBOLS(SYMBOL_GETTER) |
| |
| #undef SYMBOL_GETTER |
| #undef WELL_KNOWN_SYMBOLS |
| |
| Local<Private> v8::Private::New(Isolate* isolate, Local<String> name) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| LOG_API(i_isolate, Private, New); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::Handle<i::Symbol> symbol = i_isolate->factory()->NewPrivateSymbol(); |
| if (!name.IsEmpty()) symbol->set_name(*Utils::OpenHandle(*name)); |
| Local<Symbol> result = Utils::ToLocal(symbol); |
| return v8::Local<Private>(reinterpret_cast<Private*>(*result)); |
| } |
| |
| |
| Local<Private> v8::Private::ForApi(Isolate* isolate, Local<String> name) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| i::Handle<i::String> i_name = Utils::OpenHandle(*name); |
| Local<Symbol> result = Utils::ToLocal(i_isolate->SymbolFor( |
| i::Heap::kApiPrivateSymbolTableRootIndex, i_name, true)); |
| return v8::Local<Private>(reinterpret_cast<Private*>(*result)); |
| } |
| |
| |
| Local<Number> v8::Number::New(Isolate* isolate, double value) { |
| i::Isolate* internal_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| if (std::isnan(value)) { |
| // Introduce only canonical NaN value into the VM, to avoid signaling NaNs. |
| value = std::numeric_limits<double>::quiet_NaN(); |
| } |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(internal_isolate); |
| i::Handle<i::Object> result = internal_isolate->factory()->NewNumber(value); |
| return Utils::NumberToLocal(result); |
| } |
| |
| |
| Local<Integer> v8::Integer::New(Isolate* isolate, int32_t value) { |
| i::Isolate* internal_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| if (i::Smi::IsValid(value)) { |
| return Utils::IntegerToLocal(i::Handle<i::Object>(i::Smi::FromInt(value), |
| internal_isolate)); |
| } |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(internal_isolate); |
| i::Handle<i::Object> result = internal_isolate->factory()->NewNumber(value); |
| return Utils::IntegerToLocal(result); |
| } |
| |
| |
| Local<Integer> v8::Integer::NewFromUnsigned(Isolate* isolate, uint32_t value) { |
| i::Isolate* internal_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| bool fits_into_int32_t = (value & (1 << 31)) == 0; |
| if (fits_into_int32_t) { |
| return Integer::New(isolate, static_cast<int32_t>(value)); |
| } |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(internal_isolate); |
| i::Handle<i::Object> result = internal_isolate->factory()->NewNumber(value); |
| return Utils::IntegerToLocal(result); |
| } |
| |
| |
| void Isolate::ReportExternalAllocationLimitReached() { |
| i::Heap* heap = reinterpret_cast<i::Isolate*>(this)->heap(); |
| if (heap->gc_state() != i::Heap::NOT_IN_GC) return; |
| heap->ReportExternalMemoryPressure(); |
| } |
| |
| void Isolate::CheckMemoryPressure() { |
| i::Heap* heap = reinterpret_cast<i::Isolate*>(this)->heap(); |
| if (heap->gc_state() != i::Heap::NOT_IN_GC) return; |
| heap->CheckMemoryPressure(); |
| } |
| |
| HeapProfiler* Isolate::GetHeapProfiler() { |
| i::HeapProfiler* heap_profiler = |
| reinterpret_cast<i::Isolate*>(this)->heap_profiler(); |
| return reinterpret_cast<HeapProfiler*>(heap_profiler); |
| } |
| |
| |
| CpuProfiler* Isolate::GetCpuProfiler() { |
| i::CpuProfiler* cpu_profiler = |
| reinterpret_cast<i::Isolate*>(this)->cpu_profiler(); |
| return reinterpret_cast<CpuProfiler*>(cpu_profiler); |
| } |
| |
| |
| bool Isolate::InContext() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return isolate->context() != nullptr; |
| } |
| |
| |
| v8::Local<v8::Context> Isolate::GetCurrentContext() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Context* context = isolate->context(); |
| if (context == nullptr) return Local<Context>(); |
| i::Context* native_context = context->native_context(); |
| if (native_context == nullptr) return Local<Context>(); |
| return Utils::ToLocal(i::Handle<i::Context>(native_context)); |
| } |
| |
| |
| v8::Local<v8::Context> Isolate::GetCallingContext() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Handle<i::Object> calling = isolate->GetCallingNativeContext(); |
| if (calling.is_null()) return Local<Context>(); |
| return Utils::ToLocal(i::Handle<i::Context>::cast(calling)); |
| } |
| |
| |
| v8::Local<v8::Context> Isolate::GetEnteredContext() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Handle<i::Object> last = |
| isolate->handle_scope_implementer()->LastEnteredContext(); |
| if (last.is_null()) return Local<Context>(); |
| return Utils::ToLocal(i::Handle<i::Context>::cast(last)); |
| } |
| |
| v8::Local<v8::Context> Isolate::GetEnteredOrMicrotaskContext() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Handle<i::Object> last; |
| if (isolate->handle_scope_implementer() |
| ->MicrotaskContextIsLastEnteredContext()) { |
| last = isolate->handle_scope_implementer()->MicrotaskContext(); |
| } else { |
| last = isolate->handle_scope_implementer()->LastEnteredContext(); |
| } |
| if (last.is_null()) return Local<Context>(); |
| return Utils::ToLocal(i::Handle<i::Context>::cast(last)); |
| } |
| |
| v8::Local<v8::Context> Isolate::GetIncumbentContext() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Handle<i::Context> context = isolate->GetIncumbentContext(); |
| return Utils::ToLocal(context); |
| } |
| |
| v8::Local<Value> Isolate::ThrowException(v8::Local<v8::Value> value) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| ENTER_V8_DO_NOT_USE(isolate); |
| // If we're passed an empty handle, we throw an undefined exception |
| // to deal more gracefully with out of memory situations. |
| if (value.IsEmpty()) { |
| isolate->ScheduleThrow(isolate->heap()->undefined_value()); |
| } else { |
| isolate->ScheduleThrow(*Utils::OpenHandle(*value)); |
| } |
| return v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| |
| void Isolate::AddGCPrologueCallback(GCCallbackWithData callback, void* data, |
| GCType gc_type) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->AddGCPrologueCallback(callback, gc_type, data); |
| } |
| |
| void Isolate::RemoveGCPrologueCallback(GCCallbackWithData callback, |
| void* data) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->RemoveGCPrologueCallback(callback, data); |
| } |
| |
| void Isolate::AddGCEpilogueCallback(GCCallbackWithData callback, void* data, |
| GCType gc_type) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->AddGCEpilogueCallback(callback, gc_type, data); |
| } |
| |
| void Isolate::RemoveGCEpilogueCallback(GCCallbackWithData callback, |
| void* data) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->RemoveGCEpilogueCallback(callback, data); |
| } |
| |
| static void CallGCCallbackWithoutData(Isolate* isolate, GCType type, |
| GCCallbackFlags flags, void* data) { |
| reinterpret_cast<Isolate::GCCallback>(data)(isolate, type, flags); |
| } |
| |
| void Isolate::AddGCPrologueCallback(GCCallback callback, GCType gc_type) { |
| void* data = reinterpret_cast<void*>(callback); |
| AddGCPrologueCallback(CallGCCallbackWithoutData, data, gc_type); |
| } |
| |
| void Isolate::RemoveGCPrologueCallback(GCCallback callback) { |
| void* data = reinterpret_cast<void*>(callback); |
| RemoveGCPrologueCallback(CallGCCallbackWithoutData, data); |
| } |
| |
| void Isolate::AddGCEpilogueCallback(GCCallback callback, GCType gc_type) { |
| void* data = reinterpret_cast<void*>(callback); |
| AddGCEpilogueCallback(CallGCCallbackWithoutData, data, gc_type); |
| } |
| |
| void Isolate::RemoveGCEpilogueCallback(GCCallback callback) { |
| void* data = reinterpret_cast<void*>(callback); |
| RemoveGCEpilogueCallback(CallGCCallbackWithoutData, data); |
| } |
| |
| void Isolate::SetEmbedderHeapTracer(EmbedderHeapTracer* tracer) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->SetEmbedderHeapTracer(tracer); |
| } |
| |
| void Isolate::SetGetExternallyAllocatedMemoryInBytesCallback( |
| GetExternallyAllocatedMemoryInBytesCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->SetGetExternallyAllocatedMemoryInBytesCallback(callback); |
| } |
| |
| void Isolate::TerminateExecution() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->stack_guard()->RequestTerminateExecution(); |
| } |
| |
| |
| bool Isolate::IsExecutionTerminating() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return IsExecutionTerminatingCheck(isolate); |
| } |
| |
| |
| void Isolate::CancelTerminateExecution() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->stack_guard()->ClearTerminateExecution(); |
| isolate->CancelTerminateExecution(); |
| } |
| |
| |
| void Isolate::RequestInterrupt(InterruptCallback callback, void* data) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->RequestInterrupt(callback, data); |
| } |
| |
| |
| void Isolate::RequestGarbageCollectionForTesting(GarbageCollectionType type) { |
| CHECK(i::FLAG_expose_gc); |
| if (type == kMinorGarbageCollection) { |
| reinterpret_cast<i::Isolate*>(this)->heap()->CollectGarbage( |
| i::NEW_SPACE, i::GarbageCollectionReason::kTesting, |
| kGCCallbackFlagForced); |
| } else { |
| DCHECK_EQ(kFullGarbageCollection, type); |
| reinterpret_cast<i::Isolate*>(this)->heap()->CollectAllGarbage( |
| i::Heap::kAbortIncrementalMarkingMask, |
| i::GarbageCollectionReason::kTesting, kGCCallbackFlagForced); |
| } |
| } |
| |
| |
| Isolate* Isolate::GetCurrent() { |
| i::Isolate* isolate = i::Isolate::Current(); |
| return reinterpret_cast<Isolate*>(isolate); |
| } |
| |
| |
| Isolate* Isolate::New(const Isolate::CreateParams& params) { |
| i::Isolate* isolate = new i::Isolate(false); |
| return IsolateNewImpl(isolate, params); |
| } |
| |
| // This is separate so that tests can provide a different |isolate|. |
| Isolate* IsolateNewImpl(internal::Isolate* isolate, |
| const v8::Isolate::CreateParams& params) { |
| Isolate* v8_isolate = reinterpret_cast<Isolate*>(isolate); |
| CHECK_NOT_NULL(params.array_buffer_allocator); |
| isolate->set_array_buffer_allocator(params.array_buffer_allocator); |
| if (params.snapshot_blob != nullptr) { |
| isolate->set_snapshot_blob(params.snapshot_blob); |
| } else { |
| isolate->set_snapshot_blob(i::Snapshot::DefaultSnapshotBlob()); |
| } |
| if (params.entry_hook) { |
| #ifdef V8_USE_SNAPSHOT |
| // Setting a FunctionEntryHook is only supported in no-snapshot builds. |
| Utils::ApiCheck( |
| false, "v8::Isolate::New", |
| "Setting a FunctionEntryHook is only supported in no-snapshot builds."); |
| #endif |
| isolate->set_function_entry_hook(params.entry_hook); |
| } |
| auto code_event_handler = params.code_event_handler; |
| #ifdef ENABLE_GDB_JIT_INTERFACE |
| if (code_event_handler == nullptr && i::FLAG_gdbjit) { |
| code_event_handler = i::GDBJITInterface::EventHandler; |
| } |
| #endif // ENABLE_GDB_JIT_INTERFACE |
| if (code_event_handler) { |
| isolate->InitializeLoggingAndCounters(); |
| isolate->logger()->SetCodeEventHandler(kJitCodeEventDefault, |
| code_event_handler); |
| } |
| if (params.counter_lookup_callback) { |
| v8_isolate->SetCounterFunction(params.counter_lookup_callback); |
| } |
| |
| if (params.create_histogram_callback) { |
| v8_isolate->SetCreateHistogramFunction(params.create_histogram_callback); |
| } |
| |
| if (params.add_histogram_sample_callback) { |
| v8_isolate->SetAddHistogramSampleFunction( |
| params.add_histogram_sample_callback); |
| } |
| |
| isolate->set_api_external_references(params.external_references); |
| isolate->set_allow_atomics_wait(params.allow_atomics_wait); |
| |
| SetResourceConstraints(isolate, params.constraints); |
| // TODO(jochen): Once we got rid of Isolate::Current(), we can remove this. |
| Isolate::Scope isolate_scope(v8_isolate); |
| if (params.entry_hook || !i::Snapshot::Initialize(isolate)) { |
| // If snapshot data was provided and we failed to deserialize it must |
| // have been corrupted. |
| CHECK_NULL(isolate->snapshot_blob()); |
| base::ElapsedTimer timer; |
| if (i::FLAG_profile_deserialization) timer.Start(); |
| isolate->Init(nullptr); |
| if (i::FLAG_profile_deserialization) { |
| double ms = timer.Elapsed().InMillisecondsF(); |
| i::PrintF("[Initializing isolate from scratch took %0.3f ms]\n", ms); |
| } |
| } |
| return v8_isolate; |
| } |
| |
| |
| void Isolate::Dispose() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| if (!Utils::ApiCheck(!isolate->IsInUse(), |
| "v8::Isolate::Dispose()", |
| "Disposing the isolate that is entered by a thread.")) { |
| return; |
| } |
| isolate->TearDown(); |
| } |
| |
| void Isolate::DumpAndResetStats() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->DumpAndResetStats(); |
| } |
| |
| void Isolate::DiscardThreadSpecificMetadata() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->DiscardPerThreadDataForThisThread(); |
| } |
| |
| |
| void Isolate::Enter() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->Enter(); |
| } |
| |
| |
| void Isolate::Exit() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->Exit(); |
| } |
| |
| |
| void Isolate::SetAbortOnUncaughtExceptionCallback( |
| AbortOnUncaughtExceptionCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->SetAbortOnUncaughtExceptionCallback(callback); |
| } |
| |
| void Isolate::SetHostImportModuleDynamicallyCallback( |
| HostImportModuleDynamicallyCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->SetHostImportModuleDynamicallyCallback(callback); |
| } |
| |
| void Isolate::SetHostInitializeImportMetaObjectCallback( |
| HostInitializeImportMetaObjectCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->SetHostInitializeImportMetaObjectCallback(callback); |
| } |
| |
| Isolate::DisallowJavascriptExecutionScope::DisallowJavascriptExecutionScope( |
| Isolate* isolate, |
| Isolate::DisallowJavascriptExecutionScope::OnFailure on_failure) |
| : on_failure_(on_failure) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| if (on_failure_ == CRASH_ON_FAILURE) { |
| internal_ = reinterpret_cast<void*>( |
| new i::DisallowJavascriptExecution(i_isolate)); |
| } else { |
| DCHECK_EQ(THROW_ON_FAILURE, on_failure); |
| internal_ = reinterpret_cast<void*>( |
| new i::ThrowOnJavascriptExecution(i_isolate)); |
| } |
| } |
| |
| |
| Isolate::DisallowJavascriptExecutionScope::~DisallowJavascriptExecutionScope() { |
| if (on_failure_ == CRASH_ON_FAILURE) { |
| delete reinterpret_cast<i::DisallowJavascriptExecution*>(internal_); |
| } else { |
| delete reinterpret_cast<i::ThrowOnJavascriptExecution*>(internal_); |
| } |
| } |
| |
| |
| Isolate::AllowJavascriptExecutionScope::AllowJavascriptExecutionScope( |
| Isolate* isolate) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| internal_assert_ = reinterpret_cast<void*>( |
| new i::AllowJavascriptExecution(i_isolate)); |
| internal_throws_ = reinterpret_cast<void*>( |
| new i::NoThrowOnJavascriptExecution(i_isolate)); |
| } |
| |
| |
| Isolate::AllowJavascriptExecutionScope::~AllowJavascriptExecutionScope() { |
| delete reinterpret_cast<i::AllowJavascriptExecution*>(internal_assert_); |
| delete reinterpret_cast<i::NoThrowOnJavascriptExecution*>(internal_throws_); |
| } |
| |
| |
| Isolate::SuppressMicrotaskExecutionScope::SuppressMicrotaskExecutionScope( |
| Isolate* isolate) |
| : isolate_(reinterpret_cast<i::Isolate*>(isolate)) { |
| isolate_->handle_scope_implementer()->IncrementCallDepth(); |
| isolate_->handle_scope_implementer()->IncrementMicrotasksSuppressions(); |
| } |
| |
| |
| Isolate::SuppressMicrotaskExecutionScope::~SuppressMicrotaskExecutionScope() { |
| isolate_->handle_scope_implementer()->DecrementMicrotasksSuppressions(); |
| isolate_->handle_scope_implementer()->DecrementCallDepth(); |
| } |
| |
| |
| void Isolate::GetHeapStatistics(HeapStatistics* heap_statistics) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Heap* heap = isolate->heap(); |
| heap_statistics->total_heap_size_ = heap->CommittedMemory(); |
| heap_statistics->total_heap_size_executable_ = |
| heap->CommittedMemoryExecutable(); |
| heap_statistics->total_physical_size_ = heap->CommittedPhysicalMemory(); |
| heap_statistics->total_available_size_ = heap->Available(); |
| heap_statistics->used_heap_size_ = heap->SizeOfObjects(); |
| heap_statistics->heap_size_limit_ = heap->MaxReserved(); |
| heap_statistics->malloced_memory_ = |
| isolate->allocator()->GetCurrentMemoryUsage(); |
| heap_statistics->peak_malloced_memory_ = |
| isolate->allocator()->GetMaxMemoryUsage(); |
| heap_statistics->does_zap_garbage_ = heap->ShouldZapGarbage(); |
| } |
| |
| |
| size_t Isolate::NumberOfHeapSpaces() { |
| return i::LAST_SPACE - i::FIRST_SPACE + 1; |
| } |
| |
| |
| bool Isolate::GetHeapSpaceStatistics(HeapSpaceStatistics* space_statistics, |
| size_t index) { |
| if (!space_statistics) return false; |
| if (!i::Heap::IsValidAllocationSpace(static_cast<i::AllocationSpace>(index))) |
| return false; |
| |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Heap* heap = isolate->heap(); |
| i::Space* space = heap->space(static_cast<int>(index)); |
| |
| space_statistics->space_name_ = heap->GetSpaceName(static_cast<int>(index)); |
| space_statistics->space_size_ = space->CommittedMemory(); |
| space_statistics->space_used_size_ = space->SizeOfObjects(); |
| space_statistics->space_available_size_ = space->Available(); |
| space_statistics->physical_space_size_ = space->CommittedPhysicalMemory(); |
| return true; |
| } |
| |
| |
| size_t Isolate::NumberOfTrackedHeapObjectTypes() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Heap* heap = isolate->heap(); |
| return heap->NumberOfTrackedHeapObjectTypes(); |
| } |
| |
| |
| bool Isolate::GetHeapObjectStatisticsAtLastGC( |
| HeapObjectStatistics* object_statistics, size_t type_index) { |
| if (!object_statistics) return false; |
| if (V8_LIKELY(!i::FLAG_gc_stats)) return false; |
| |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::Heap* heap = isolate->heap(); |
| if (type_index >= heap->NumberOfTrackedHeapObjectTypes()) return false; |
| |
| const char* object_type; |
| const char* object_sub_type; |
| size_t object_count = heap->ObjectCountAtLastGC(type_index); |
| size_t object_size = heap->ObjectSizeAtLastGC(type_index); |
| if (!heap->GetObjectTypeName(type_index, &object_type, &object_sub_type)) { |
| // There should be no objects counted when the type is unknown. |
| DCHECK_EQ(object_count, 0U); |
| DCHECK_EQ(object_size, 0U); |
| return false; |
| } |
| |
| object_statistics->object_type_ = object_type; |
| object_statistics->object_sub_type_ = object_sub_type; |
| object_statistics->object_count_ = object_count; |
| object_statistics->object_size_ = object_size; |
| return true; |
| } |
| |
| bool Isolate::GetHeapCodeAndMetadataStatistics( |
| HeapCodeStatistics* code_statistics) { |
| if (!code_statistics) return false; |
| |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->CollectCodeStatistics(); |
| |
| code_statistics->code_and_metadata_size_ = isolate->code_and_metadata_size(); |
| code_statistics->bytecode_and_metadata_size_ = |
| isolate->bytecode_and_metadata_size(); |
| return true; |
| } |
| |
| void Isolate::GetStackSample(const RegisterState& state, void** frames, |
| size_t frames_limit, SampleInfo* sample_info) { |
| RegisterState regs = state; |
| if (TickSample::GetStackSample(this, ®s, TickSample::kSkipCEntryFrame, |
| frames, frames_limit, sample_info)) { |
| return; |
| } |
| sample_info->frames_count = 0; |
| sample_info->vm_state = OTHER; |
| sample_info->external_callback_entry = nullptr; |
| } |
| |
| size_t Isolate::NumberOfPhantomHandleResetsSinceLastCall() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| size_t result = isolate->global_handles()->NumberOfPhantomHandleResets(); |
| isolate->global_handles()->ResetNumberOfPhantomHandleResets(); |
| return result; |
| } |
| |
| void Isolate::SetEventLogger(LogEventCallback that) { |
| // Do not overwrite the event logger if we want to log explicitly. |
| if (i::FLAG_log_internal_timer_events) return; |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->set_event_logger(that); |
| } |
| |
| |
| void Isolate::AddBeforeCallEnteredCallback(BeforeCallEnteredCallback callback) { |
| if (callback == nullptr) return; |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->AddBeforeCallEnteredCallback(callback); |
| } |
| |
| |
| void Isolate::RemoveBeforeCallEnteredCallback( |
| BeforeCallEnteredCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->RemoveBeforeCallEnteredCallback(callback); |
| } |
| |
| |
| void Isolate::AddCallCompletedCallback(CallCompletedCallback callback) { |
| if (callback == nullptr) return; |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->AddCallCompletedCallback(callback); |
| } |
| |
| |
| void Isolate::RemoveCallCompletedCallback(CallCompletedCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->RemoveCallCompletedCallback(callback); |
| } |
| |
| |
| void Isolate::AddCallCompletedCallback( |
| DeprecatedCallCompletedCallback callback) { |
| AddCallCompletedCallback(reinterpret_cast<CallCompletedCallback>(callback)); |
| } |
| |
| |
| void Isolate::RemoveCallCompletedCallback( |
| DeprecatedCallCompletedCallback callback) { |
| RemoveCallCompletedCallback( |
| reinterpret_cast<CallCompletedCallback>(callback)); |
| } |
| |
| void Isolate::SetPromiseHook(PromiseHook hook) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->SetPromiseHook(hook); |
| } |
| |
| void Isolate::SetPromiseRejectCallback(PromiseRejectCallback callback) { |
| if (callback == nullptr) return; |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->SetPromiseRejectCallback(callback); |
| } |
| |
| |
| void Isolate::RunMicrotasks() { |
| DCHECK_NE(MicrotasksPolicy::kScoped, GetMicrotasksPolicy()); |
| reinterpret_cast<i::Isolate*>(this)->RunMicrotasks(); |
| } |
| |
| |
| void Isolate::EnqueueMicrotask(Local<Function> microtask) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->EnqueueMicrotask(Utils::OpenHandle(*microtask)); |
| } |
| |
| |
| void Isolate::EnqueueMicrotask(MicrotaskCallback microtask, void* data) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::HandleScope scope(isolate); |
| i::Handle<i::CallHandlerInfo> callback_info = |
| i::Handle<i::CallHandlerInfo>::cast( |
| isolate->factory()->NewStruct(i::TUPLE3_TYPE, i::NOT_TENURED)); |
| SET_FIELD_WRAPPED(callback_info, set_callback, microtask); |
| SET_FIELD_WRAPPED(callback_info, set_js_callback, |
| callback_info->redirected_callback()); |
| SET_FIELD_WRAPPED(callback_info, set_data, data); |
| isolate->EnqueueMicrotask(callback_info); |
| } |
| |
| |
| void Isolate::SetAutorunMicrotasks(bool autorun) { |
| SetMicrotasksPolicy( |
| autorun ? MicrotasksPolicy::kAuto : MicrotasksPolicy::kExplicit); |
| } |
| |
| |
| bool Isolate::WillAutorunMicrotasks() const { |
| return GetMicrotasksPolicy() == MicrotasksPolicy::kAuto; |
| } |
| |
| |
| void Isolate::SetMicrotasksPolicy(MicrotasksPolicy policy) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->handle_scope_implementer()->set_microtasks_policy(policy); |
| } |
| |
| |
| MicrotasksPolicy Isolate::GetMicrotasksPolicy() const { |
| i::Isolate* isolate = |
| reinterpret_cast<i::Isolate*>(const_cast<Isolate*>(this)); |
| return isolate->handle_scope_implementer()->microtasks_policy(); |
| } |
| |
| |
| void Isolate::AddMicrotasksCompletedCallback( |
| MicrotasksCompletedCallback callback) { |
| DCHECK(callback); |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->AddMicrotasksCompletedCallback(callback); |
| } |
| |
| |
| void Isolate::RemoveMicrotasksCompletedCallback( |
| MicrotasksCompletedCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->RemoveMicrotasksCompletedCallback(callback); |
| } |
| |
| |
| void Isolate::SetUseCounterCallback(UseCounterCallback callback) { |
| reinterpret_cast<i::Isolate*>(this)->SetUseCounterCallback(callback); |
| } |
| |
| |
| void Isolate::SetCounterFunction(CounterLookupCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->counters()->ResetCounterFunction(callback); |
| } |
| |
| |
| void Isolate::SetCreateHistogramFunction(CreateHistogramCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->counters()->ResetCreateHistogramFunction(callback); |
| } |
| |
| |
| void Isolate::SetAddHistogramSampleFunction( |
| AddHistogramSampleCallback callback) { |
| reinterpret_cast<i::Isolate*>(this) |
| ->counters() |
| ->SetAddHistogramSampleFunction(callback); |
| } |
| |
| |
| bool Isolate::IdleNotification(int idle_time_in_ms) { |
| // Returning true tells the caller that it need not |
| // continue to call IdleNotification. |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| if (!i::FLAG_use_idle_notification) return true; |
| return isolate->heap()->IdleNotification(idle_time_in_ms); |
| } |
| |
| |
| bool Isolate::IdleNotificationDeadline(double deadline_in_seconds) { |
| // Returning true tells the caller that it need not |
| // continue to call IdleNotification. |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| if (!i::FLAG_use_idle_notification) return true; |
| return isolate->heap()->IdleNotification(deadline_in_seconds); |
| } |
| |
| void Isolate::LowMemoryNotification() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| { |
| i::HistogramTimerScope idle_notification_scope( |
| isolate->counters()->gc_low_memory_notification()); |
| TRACE_EVENT0("v8", "V8.GCLowMemoryNotification"); |
| isolate->heap()->CollectAllAvailableGarbage( |
| i::GarbageCollectionReason::kLowMemoryNotification); |
| } |
| { |
| i::HeapIterator iterator(isolate->heap()); |
| i::HeapObject* obj; |
| while ((obj = iterator.next()) != nullptr) { |
| if (obj->IsAbstractCode()) { |
| i::AbstractCode::cast(obj)->DropStackFrameCache(); |
| } |
| } |
| } |
| } |
| |
| |
| int Isolate::ContextDisposedNotification(bool dependant_context) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return isolate->heap()->NotifyContextDisposed(dependant_context); |
| } |
| |
| |
| void Isolate::IsolateInForegroundNotification() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return isolate->IsolateInForegroundNotification(); |
| } |
| |
| |
| void Isolate::IsolateInBackgroundNotification() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return isolate->IsolateInBackgroundNotification(); |
| } |
| |
| void Isolate::MemoryPressureNotification(MemoryPressureLevel level) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| bool on_isolate_thread = |
| v8::Locker::IsActive() |
| ? isolate->thread_manager()->IsLockedByCurrentThread() |
| : i::ThreadId::Current().Equals(isolate->thread_id()); |
| isolate->heap()->MemoryPressureNotification(level, on_isolate_thread); |
| isolate->allocator()->MemoryPressureNotification(level); |
| isolate->compiler_dispatcher()->MemoryPressureNotification(level, |
| on_isolate_thread); |
| } |
| |
| void Isolate::SetRAILMode(RAILMode rail_mode) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return isolate->SetRAILMode(rail_mode); |
| } |
| |
| void Isolate::IncreaseHeapLimitForDebugging() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->IncreaseHeapLimitForDebugging(); |
| } |
| |
| void Isolate::RestoreOriginalHeapLimit() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->RestoreOriginalHeapLimit(); |
| } |
| |
| bool Isolate::IsHeapLimitIncreasedForDebugging() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return isolate->heap()->IsHeapLimitIncreasedForDebugging(); |
| } |
| |
| void Isolate::SetJitCodeEventHandler(JitCodeEventOptions options, |
| JitCodeEventHandler event_handler) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| // Ensure that logging is initialized for our isolate. |
| isolate->InitializeLoggingAndCounters(); |
| isolate->logger()->SetCodeEventHandler(options, event_handler); |
| } |
| |
| |
| void Isolate::SetStackLimit(uintptr_t stack_limit) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| CHECK(stack_limit); |
| isolate->stack_guard()->SetStackLimit(stack_limit); |
| } |
| |
| void Isolate::GetCodeRange(void** start, size_t* length_in_bytes) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| if (isolate->heap()->memory_allocator()->code_range()->valid()) { |
| *start = isolate->heap()->memory_allocator()->code_range()->start(); |
| *length_in_bytes = |
| isolate->heap()->memory_allocator()->code_range()->size(); |
| } else { |
| *start = nullptr; |
| *length_in_bytes = 0; |
| } |
| } |
| |
| |
| #define CALLBACK_SETTER(ExternalName, Type, InternalName) \ |
| void Isolate::Set##ExternalName(Type callback) { \ |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); \ |
| isolate->set_##InternalName(callback); \ |
| } |
| |
| CALLBACK_SETTER(FatalErrorHandler, FatalErrorCallback, exception_behavior) |
| CALLBACK_SETTER(OOMErrorHandler, OOMErrorCallback, oom_behavior) |
| CALLBACK_SETTER(AllowCodeGenerationFromStringsCallback, |
| AllowCodeGenerationFromStringsCallback, allow_code_gen_callback) |
| CALLBACK_SETTER(AllowWasmCodeGenerationCallback, |
| AllowWasmCodeGenerationCallback, allow_wasm_code_gen_callback) |
| |
| CALLBACK_SETTER(WasmModuleCallback, ExtensionCallback, wasm_module_callback) |
| CALLBACK_SETTER(WasmInstanceCallback, ExtensionCallback, wasm_instance_callback) |
| |
| CALLBACK_SETTER(WasmCompileStreamingCallback, ApiImplementationCallback, |
| wasm_compile_streaming_callback) |
| |
| bool Isolate::IsDead() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return isolate->IsDead(); |
| } |
| |
| bool Isolate::AddMessageListener(MessageCallback that, Local<Value> data) { |
| return AddMessageListenerWithErrorLevel(that, kMessageError, data); |
| } |
| |
| bool Isolate::AddMessageListenerWithErrorLevel(MessageCallback that, |
| int message_levels, |
| Local<Value> data) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| i::Handle<i::TemplateList> list = isolate->factory()->message_listeners(); |
| i::Handle<i::FixedArray> listener = isolate->factory()->NewFixedArray(3); |
| i::Handle<i::Foreign> foreign = |
| isolate->factory()->NewForeign(FUNCTION_ADDR(that)); |
| listener->set(0, *foreign); |
| listener->set(1, data.IsEmpty() ? isolate->heap()->undefined_value() |
| : *Utils::OpenHandle(*data)); |
| listener->set(2, i::Smi::FromInt(message_levels)); |
| list = i::TemplateList::Add(isolate, list, listener); |
| isolate->heap()->SetMessageListeners(*list); |
| return true; |
| } |
| |
| |
| void Isolate::RemoveMessageListeners(MessageCallback that) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope scope(isolate); |
| i::DisallowHeapAllocation no_gc; |
| i::TemplateList* listeners = isolate->heap()->message_listeners(); |
| for (int i = 0; i < listeners->length(); i++) { |
| if (listeners->get(i)->IsUndefined(isolate)) continue; // skip deleted ones |
| i::FixedArray* listener = i::FixedArray::cast(listeners->get(i)); |
| i::Foreign* callback_obj = i::Foreign::cast(listener->get(0)); |
| if (callback_obj->foreign_address() == FUNCTION_ADDR(that)) { |
| listeners->set(i, isolate->heap()->undefined_value()); |
| } |
| } |
| } |
| |
| |
| void Isolate::SetFailedAccessCheckCallbackFunction( |
| FailedAccessCheckCallback callback) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->SetFailedAccessCheckCallback(callback); |
| } |
| |
| |
| void Isolate::SetCaptureStackTraceForUncaughtExceptions( |
| bool capture, int frame_limit, StackTrace::StackTraceOptions options) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->SetCaptureStackTraceForUncaughtExceptions(capture, frame_limit, |
| options); |
| } |
| |
| |
| void Isolate::VisitExternalResources(ExternalResourceVisitor* visitor) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->heap()->VisitExternalResources(visitor); |
| } |
| |
| |
| bool Isolate::IsInUse() { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| return isolate->IsInUse(); |
| } |
| |
| |
| void Isolate::VisitHandlesWithClassIds(PersistentHandleVisitor* visitor) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::DisallowHeapAllocation no_allocation; |
| isolate->global_handles()->IterateAllRootsWithClassIds(visitor); |
| } |
| |
| |
| void Isolate::VisitHandlesForPartialDependence( |
| PersistentHandleVisitor* visitor) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::DisallowHeapAllocation no_allocation; |
| isolate->global_handles()->IterateAllRootsInNewSpaceWithClassIds(visitor); |
| } |
| |
| |
| void Isolate::VisitWeakHandles(PersistentHandleVisitor* visitor) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| i::DisallowHeapAllocation no_allocation; |
| isolate->global_handles()->IterateWeakRootsInNewSpaceWithClassIds(visitor); |
| } |
| |
| void Isolate::SetAllowAtomicsWait(bool allow) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(this); |
| isolate->set_allow_atomics_wait(allow); |
| } |
| |
| MicrotasksScope::MicrotasksScope(Isolate* isolate, MicrotasksScope::Type type) |
| : isolate_(reinterpret_cast<i::Isolate*>(isolate)), |
| run_(type == MicrotasksScope::kRunMicrotasks) { |
| auto handle_scope_implementer = isolate_->handle_scope_implementer(); |
| if (run_) handle_scope_implementer->IncrementMicrotasksScopeDepth(); |
| #ifdef DEBUG |
| if (!run_) handle_scope_implementer->IncrementDebugMicrotasksScopeDepth(); |
| #endif |
| } |
| |
| |
| MicrotasksScope::~MicrotasksScope() { |
| auto handle_scope_implementer = isolate_->handle_scope_implementer(); |
| if (run_) { |
| handle_scope_implementer->DecrementMicrotasksScopeDepth(); |
| if (MicrotasksPolicy::kScoped == |
| handle_scope_implementer->microtasks_policy()) { |
| PerformCheckpoint(reinterpret_cast<Isolate*>(isolate_)); |
| } |
| } |
| #ifdef DEBUG |
| if (!run_) handle_scope_implementer->DecrementDebugMicrotasksScopeDepth(); |
| #endif |
| } |
| |
| |
| void MicrotasksScope::PerformCheckpoint(Isolate* v8Isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8Isolate); |
| if (IsExecutionTerminatingCheck(isolate)) return; |
| auto handle_scope_implementer = isolate->handle_scope_implementer(); |
| if (!handle_scope_implementer->GetMicrotasksScopeDepth() && |
| !handle_scope_implementer->HasMicrotasksSuppressions()) { |
| isolate->RunMicrotasks(); |
| } |
| } |
| |
| |
| int MicrotasksScope::GetCurrentDepth(Isolate* v8Isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8Isolate); |
| return isolate->handle_scope_implementer()->GetMicrotasksScopeDepth(); |
| } |
| |
| bool MicrotasksScope::IsRunningMicrotasks(Isolate* v8Isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8Isolate); |
| return isolate->IsRunningMicrotasks(); |
| } |
| |
| String::Utf8Value::Utf8Value(v8::Isolate* isolate, v8::Local<v8::Value> obj) |
| : str_(nullptr), length_(0) { |
| if (obj.IsEmpty()) return; |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_DO_NOT_USE(i_isolate); |
| i::HandleScope scope(i_isolate); |
| Local<Context> context = isolate->GetCurrentContext(); |
| TryCatch try_catch(isolate); |
| Local<String> str; |
| if (!obj->ToString(context).ToLocal(&str)) return; |
| i::Handle<i::String> i_str = Utils::OpenHandle(*str); |
| length_ = v8::Utf8Length(*i_str, i_isolate); |
| str_ = i::NewArray<char>(length_ + 1); |
| str->WriteUtf8(str_); |
| } |
| |
| String::Utf8Value::Utf8Value(v8::Local<v8::Value> obj) |
| : String::Utf8Value::Utf8Value(Isolate::GetCurrent(), obj) {} |
| |
| String::Utf8Value::~Utf8Value() { |
| i::DeleteArray(str_); |
| } |
| |
| String::Value::Value(v8::Isolate* isolate, v8::Local<v8::Value> obj) |
| : str_(nullptr), length_(0) { |
| if (obj.IsEmpty()) return; |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_DO_NOT_USE(i_isolate); |
| i::HandleScope scope(i_isolate); |
| Local<Context> context = isolate->GetCurrentContext(); |
| TryCatch try_catch(isolate); |
| Local<String> str; |
| if (!obj->ToString(context).ToLocal(&str)) return; |
| length_ = str->Length(); |
| str_ = i::NewArray<uint16_t>(length_ + 1); |
| str->Write(str_); |
| } |
| |
| String::Value::Value(v8::Local<v8::Value> obj) |
| : String::Value::Value(v8::Isolate::GetCurrent(), obj) {} |
| |
| String::Value::~Value() { |
| i::DeleteArray(str_); |
| } |
| |
| #define DEFINE_ERROR(NAME, name) \ |
| Local<Value> Exception::NAME(v8::Local<v8::String> raw_message) { \ |
| i::Isolate* isolate = i::Isolate::Current(); \ |
| LOG_API(isolate, NAME, New); \ |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); \ |
| i::Object* error; \ |
| { \ |
| i::HandleScope scope(isolate); \ |
| i::Handle<i::String> message = Utils::OpenHandle(*raw_message); \ |
| i::Handle<i::JSFunction> constructor = isolate->name##_function(); \ |
| error = *isolate->factory()->NewError(constructor, message); \ |
| } \ |
| i::Handle<i::Object> result(error, isolate); \ |
| return Utils::ToLocal(result); \ |
| } |
| |
| DEFINE_ERROR(RangeError, range_error) |
| DEFINE_ERROR(ReferenceError, reference_error) |
| DEFINE_ERROR(SyntaxError, syntax_error) |
| DEFINE_ERROR(TypeError, type_error) |
| DEFINE_ERROR(Error, error) |
| |
| #undef DEFINE_ERROR |
| |
| |
| Local<Message> Exception::CreateMessage(Isolate* isolate, |
| Local<Value> exception) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(*exception); |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::HandleScope scope(i_isolate); |
| return Utils::MessageToLocal( |
| scope.CloseAndEscape(i_isolate->CreateMessage(obj, nullptr))); |
| } |
| |
| |
| Local<Message> Exception::CreateMessage(Local<Value> exception) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(*exception); |
| if (!obj->IsHeapObject()) return Local<Message>(); |
| i::Isolate* isolate = i::HeapObject::cast(*obj)->GetIsolate(); |
| return CreateMessage(reinterpret_cast<Isolate*>(isolate), exception); |
| } |
| |
| |
| Local<StackTrace> Exception::GetStackTrace(Local<Value> exception) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(*exception); |
| if (!obj->IsJSObject()) return Local<StackTrace>(); |
| i::Handle<i::JSObject> js_obj = i::Handle<i::JSObject>::cast(obj); |
| i::Isolate* isolate = js_obj->GetIsolate(); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| return Utils::StackTraceToLocal(isolate->GetDetailedStackTrace(js_obj)); |
| } |
| |
| |
| // --- D e b u g S u p p o r t --- |
| |
| bool Debug::SetDebugEventListener(Isolate* isolate, EventCallback that, |
| Local<Value> data) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| if (that == nullptr) { |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i::HandleScope scope(i_isolate); |
| i_isolate->debug()->SetDebugDelegate(nullptr, false); |
| } else { |
| // Might create the Debug context. |
| ENTER_V8_FOR_NEW_CONTEXT(i_isolate); |
| i::HandleScope scope(i_isolate); |
| i::Handle<i::Object> i_data = i_isolate->factory()->undefined_value(); |
| if (!data.IsEmpty()) i_data = Utils::OpenHandle(*data); |
| i::NativeDebugDelegate* delegate = |
| new i::NativeDebugDelegate(i_isolate, that, i_data); |
| i_isolate->debug()->SetDebugDelegate(delegate, true); |
| } |
| return true; |
| } |
| |
| void Debug::DebugBreak(Isolate* isolate) { debug::DebugBreak(isolate); } |
| |
| void Debug::CancelDebugBreak(Isolate* isolate) { |
| debug::CancelDebugBreak(isolate); |
| } |
| |
| bool Debug::CheckDebugBreak(Isolate* isolate) { |
| i::Isolate* internal_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| return internal_isolate->stack_guard()->CheckDebugBreak(); |
| } |
| |
| void Debug::SetMessageHandler(Isolate* isolate, |
| v8::Debug::MessageHandler handler) {} |
| |
| void Debug::SendCommand(Isolate* isolate, const uint16_t* command, int length, |
| ClientData* client_data) {} |
| |
| MaybeLocal<Value> Debug::Call(Local<Context> context, |
| v8::Local<v8::Function> fun, |
| v8::Local<v8::Value> data) { |
| return debug::Call(context, fun, data); |
| } |
| |
| void Debug::ProcessDebugMessages(Isolate* isolate) {} |
| |
| Local<Context> Debug::GetDebugContext(Isolate* isolate) { |
| return debug::GetDebugContext(isolate); |
| } |
| |
| MaybeLocal<Context> Debug::GetDebuggedContext(Isolate* isolate) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| if (!i_isolate->debug()->in_debug_scope()) return MaybeLocal<Context>(); |
| i::Handle<i::Object> calling = i_isolate->GetCallingNativeContext(); |
| if (calling.is_null()) return MaybeLocal<Context>(); |
| return Utils::ToLocal(i::Handle<i::Context>::cast(calling)); |
| } |
| |
| void Debug::SetLiveEditEnabled(Isolate* isolate, bool enable) { |
| debug::SetLiveEditEnabled(isolate, enable); |
| } |
| |
| bool Debug::IsTailCallEliminationEnabled(Isolate* isolate) { return false; } |
| |
| void Debug::SetTailCallEliminationEnabled(Isolate* isolate, bool enabled) { |
| } |
| |
| MaybeLocal<Array> Debug::GetInternalProperties(Isolate* v8_isolate, |
| Local<Value> value) { |
| return debug::GetInternalProperties(v8_isolate, value); |
| } |
| |
| void debug::SetContextId(Local<Context> context, int id) { |
| Utils::OpenHandle(*context)->set_debug_context_id(i::Smi::FromInt(id)); |
| } |
| |
| int debug::GetContextId(Local<Context> context) { |
| i::Object* value = Utils::OpenHandle(*context)->debug_context_id(); |
| return (value->IsSmi()) ? i::Smi::ToInt(value) : 0; |
| } |
| |
| Local<Context> debug::GetDebugContext(Isolate* isolate) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| return Utils::ToLocal(i_isolate->debug()->GetDebugContext()); |
| } |
| |
| MaybeLocal<Value> debug::Call(Local<Context> context, |
| v8::Local<v8::Function> fun, |
| v8::Local<v8::Value> data) { |
| PREPARE_FOR_EXECUTION(context, Debug, Call, Value); |
| i::Handle<i::Object> data_obj; |
| if (data.IsEmpty()) { |
| data_obj = isolate->factory()->undefined_value(); |
| } else { |
| data_obj = Utils::OpenHandle(*data); |
| } |
| Local<Value> result; |
| has_pending_exception = !ToLocal<Value>( |
| isolate->debug()->Call(Utils::OpenHandle(*fun), data_obj), &result); |
| RETURN_ON_FAILED_EXECUTION(Value); |
| RETURN_ESCAPED(result); |
| } |
| |
| void debug::SetLiveEditEnabled(Isolate* isolate, bool enable) { |
| i::Isolate* internal_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| internal_isolate->debug()->set_live_edit_enabled(enable); |
| } |
| |
| void debug::DebugBreak(Isolate* isolate) { |
| reinterpret_cast<i::Isolate*>(isolate)->stack_guard()->RequestDebugBreak(); |
| } |
| |
| void debug::CancelDebugBreak(Isolate* isolate) { |
| i::Isolate* internal_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| internal_isolate->stack_guard()->ClearDebugBreak(); |
| } |
| |
| MaybeLocal<Array> debug::GetInternalProperties(Isolate* v8_isolate, |
| Local<Value> value) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::Handle<i::Object> val = Utils::OpenHandle(*value); |
| i::Handle<i::JSArray> result; |
| if (!i::Runtime::GetInternalProperties(isolate, val).ToHandle(&result)) |
| return MaybeLocal<Array>(); |
| return Utils::ToLocal(result); |
| } |
| |
| void debug::ChangeBreakOnException(Isolate* isolate, ExceptionBreakState type) { |
| i::Isolate* internal_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| internal_isolate->debug()->ChangeBreakOnException( |
| i::BreakException, type == BreakOnAnyException); |
| internal_isolate->debug()->ChangeBreakOnException(i::BreakUncaughtException, |
| type != NoBreakOnException); |
| } |
| |
| void debug::SetBreakPointsActive(Isolate* v8_isolate, bool is_active) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| isolate->debug()->set_break_points_active(is_active); |
| } |
| |
| void debug::SetOutOfMemoryCallback(Isolate* isolate, |
| OutOfMemoryCallback callback, void* data) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(i_isolate); |
| i_isolate->heap()->SetOutOfMemoryCallback(callback, data); |
| } |
| |
| void debug::PrepareStep(Isolate* v8_isolate, StepAction action) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_DO_NOT_USE(isolate); |
| CHECK(isolate->debug()->CheckExecutionState()); |
| // Clear all current stepping setup. |
| isolate->debug()->ClearStepping(); |
| // Prepare step. |
| isolate->debug()->PrepareStep(static_cast<i::StepAction>(action)); |
| } |
| |
| void debug::ClearStepping(Isolate* v8_isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| // Clear all current stepping setup. |
| isolate->debug()->ClearStepping(); |
| } |
| |
| void debug::BreakRightNow(Isolate* v8_isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_DO_NOT_USE(isolate); |
| isolate->debug()->HandleDebugBreak(i::kIgnoreIfAllFramesBlackboxed); |
| } |
| |
| bool debug::AllFramesOnStackAreBlackboxed(Isolate* v8_isolate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_DO_NOT_USE(isolate); |
| return isolate->debug()->AllFramesOnStackAreBlackboxed(); |
| } |
| |
| v8::Isolate* debug::Script::GetIsolate() const { |
| return reinterpret_cast<v8::Isolate*>(Utils::OpenHandle(this)->GetIsolate()); |
| } |
| |
| ScriptOriginOptions debug::Script::OriginOptions() const { |
| return Utils::OpenHandle(this)->origin_options(); |
| } |
| |
| bool debug::Script::WasCompiled() const { |
| return Utils::OpenHandle(this)->compilation_state() == |
| i::Script::COMPILATION_STATE_COMPILED; |
| } |
| |
| bool debug::Script::IsEmbedded() const { |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| return script->context_data() == script->GetHeap()->uninitialized_symbol(); |
| } |
| |
| int debug::Script::Id() const { return Utils::OpenHandle(this)->id(); } |
| |
| int debug::Script::LineOffset() const { |
| return Utils::OpenHandle(this)->line_offset(); |
| } |
| |
| int debug::Script::ColumnOffset() const { |
| return Utils::OpenHandle(this)->column_offset(); |
| } |
| |
| std::vector<int> debug::Script::LineEnds() const { |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| if (script->type() == i::Script::TYPE_WASM) return std::vector<int>(); |
| i::Isolate* isolate = script->GetIsolate(); |
| i::HandleScope scope(isolate); |
| i::Script::InitLineEnds(script); |
| CHECK(script->line_ends()->IsFixedArray()); |
| i::Handle<i::FixedArray> line_ends(i::FixedArray::cast(script->line_ends())); |
| std::vector<int> result(line_ends->length()); |
| for (int i = 0; i < line_ends->length(); ++i) { |
| i::Smi* line_end = i::Smi::cast(line_ends->get(i)); |
| result[i] = line_end->value(); |
| } |
| return result; |
| } |
| |
| MaybeLocal<String> debug::Script::Name() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| i::HandleScope handle_scope(isolate); |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| i::Handle<i::Object> value(script->name(), isolate); |
| if (!value->IsString()) return MaybeLocal<String>(); |
| return Utils::ToLocal( |
| handle_scope.CloseAndEscape(i::Handle<i::String>::cast(value))); |
| } |
| |
| MaybeLocal<String> debug::Script::SourceURL() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| i::HandleScope handle_scope(isolate); |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| i::Handle<i::Object> value(script->source_url(), isolate); |
| if (!value->IsString()) return MaybeLocal<String>(); |
| return Utils::ToLocal( |
| handle_scope.CloseAndEscape(i::Handle<i::String>::cast(value))); |
| } |
| |
| MaybeLocal<String> debug::Script::SourceMappingURL() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| i::HandleScope handle_scope(isolate); |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| i::Handle<i::Object> value(script->source_mapping_url(), isolate); |
| if (!value->IsString()) return MaybeLocal<String>(); |
| return Utils::ToLocal( |
| handle_scope.CloseAndEscape(i::Handle<i::String>::cast(value))); |
| } |
| |
| Maybe<int> debug::Script::ContextId() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| i::HandleScope handle_scope(isolate); |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| i::Object* value = script->context_data(); |
| if (value->IsSmi()) return Just(i::Smi::ToInt(value)); |
| return Nothing<int>(); |
| } |
| |
| MaybeLocal<String> debug::Script::Source() const { |
| i::Isolate* isolate = Utils::OpenHandle(this)->GetIsolate(); |
| i::HandleScope handle_scope(isolate); |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| i::Handle<i::Object> value(script->source(), isolate); |
| if (!value->IsString()) return MaybeLocal<String>(); |
| return Utils::ToLocal( |
| handle_scope.CloseAndEscape(i::Handle<i::String>::cast(value))); |
| } |
| |
| bool debug::Script::IsWasm() const { |
| return Utils::OpenHandle(this)->type() == i::Script::TYPE_WASM; |
| } |
| |
| bool debug::Script::IsModule() const { |
| return Utils::OpenHandle(this)->origin_options().IsModule(); |
| } |
| |
| namespace { |
| int GetSmiValue(i::Handle<i::FixedArray> array, int index) { |
| return i::Smi::ToInt(array->get(index)); |
| } |
| |
| bool CompareBreakLocation(const i::BreakLocation& loc1, |
| const i::BreakLocation& loc2) { |
| return loc1.position() < loc2.position(); |
| } |
| } // namespace |
| |
| bool debug::Script::GetPossibleBreakpoints( |
| const debug::Location& start, const debug::Location& end, |
| bool restrict_to_function, |
| std::vector<debug::BreakLocation>* locations) const { |
| CHECK(!start.IsEmpty()); |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| if (script->type() == i::Script::TYPE_WASM) { |
| i::Handle<i::WasmCompiledModule> compiled_module( |
| i::WasmCompiledModule::cast(script->wasm_compiled_module())); |
| return compiled_module->GetPossibleBreakpoints(start, end, locations); |
| } |
| |
| i::Script::InitLineEnds(script); |
| CHECK(script->line_ends()->IsFixedArray()); |
| i::Isolate* isolate = script->GetIsolate(); |
| i::Handle<i::FixedArray> line_ends = |
| i::Handle<i::FixedArray>::cast(i::handle(script->line_ends(), isolate)); |
| CHECK(line_ends->length()); |
| |
| int start_offset = GetSourceOffset(start); |
| int end_offset = end.IsEmpty() |
| ? GetSmiValue(line_ends, line_ends->length() - 1) + 1 |
| : GetSourceOffset(end); |
| if (start_offset >= end_offset) return true; |
| |
| std::vector<i::BreakLocation> v8_locations; |
| if (!isolate->debug()->GetPossibleBreakpoints( |
| script, start_offset, end_offset, restrict_to_function, |
| &v8_locations)) { |
| return false; |
| } |
| |
| std::sort(v8_locations.begin(), v8_locations.end(), CompareBreakLocation); |
| int current_line_end_index = 0; |
| for (const auto& v8_location : v8_locations) { |
| int offset = v8_location.position(); |
| while (offset > GetSmiValue(line_ends, current_line_end_index)) { |
| ++current_line_end_index; |
| CHECK(current_line_end_index < line_ends->length()); |
| } |
| int line_offset = 0; |
| |
| if (current_line_end_index > 0) { |
| line_offset = GetSmiValue(line_ends, current_line_end_index - 1) + 1; |
| } |
| locations->emplace_back( |
| current_line_end_index + script->line_offset(), |
| offset - line_offset + |
| (current_line_end_index == 0 ? script->column_offset() : 0), |
| v8_location.type()); |
| } |
| return true; |
| } |
| |
| int debug::Script::GetSourceOffset(const debug::Location& location) const { |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| if (script->type() == i::Script::TYPE_WASM) { |
| return i::WasmCompiledModule::cast(script->wasm_compiled_module()) |
| ->GetFunctionOffset(location.GetLineNumber()) + |
| location.GetColumnNumber(); |
| } |
| |
| int line = std::max(location.GetLineNumber() - script->line_offset(), 0); |
| int column = location.GetColumnNumber(); |
| if (line == 0) { |
| column = std::max(0, column - script->column_offset()); |
| } |
| |
| i::Script::InitLineEnds(script); |
| CHECK(script->line_ends()->IsFixedArray()); |
| i::Handle<i::FixedArray> line_ends = i::Handle<i::FixedArray>::cast( |
| i::handle(script->line_ends(), script->GetIsolate())); |
| CHECK(line_ends->length()); |
| if (line >= line_ends->length()) |
| return GetSmiValue(line_ends, line_ends->length() - 1); |
| int line_offset = GetSmiValue(line_ends, line); |
| if (line == 0) return std::min(column, line_offset); |
| int prev_line_offset = GetSmiValue(line_ends, line - 1); |
| return std::min(prev_line_offset + column + 1, line_offset); |
| } |
| |
| v8::debug::Location debug::Script::GetSourceLocation(int offset) const { |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| i::Script::PositionInfo info; |
| i::Script::GetPositionInfo(script, offset, &info, i::Script::WITH_OFFSET); |
| return debug::Location(info.line, info.column); |
| } |
| |
| bool debug::Script::SetScriptSource(v8::Local<v8::String> newSource, |
| bool preview, bool* stack_changed) const { |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| i::Isolate* isolate = script->GetIsolate(); |
| return isolate->debug()->SetScriptSource( |
| script, Utils::OpenHandle(*newSource), preview, stack_changed); |
| } |
| |
| bool debug::Script::SetBreakpoint(v8::Local<v8::String> condition, |
| debug::Location* location, |
| debug::BreakpointId* id) const { |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| i::Isolate* isolate = script->GetIsolate(); |
| int offset = GetSourceOffset(*location); |
| if (!isolate->debug()->SetBreakpoint(script, Utils::OpenHandle(*condition), |
| &offset, id)) { |
| return false; |
| } |
| *location = GetSourceLocation(offset); |
| return true; |
| } |
| |
| void debug::RemoveBreakpoint(Isolate* v8_isolate, BreakpointId id) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| i::HandleScope handle_scope(isolate); |
| isolate->debug()->RemoveBreakpoint(id); |
| } |
| |
| debug::WasmScript* debug::WasmScript::Cast(debug::Script* script) { |
| CHECK(script->IsWasm()); |
| return static_cast<WasmScript*>(script); |
| } |
| |
| int debug::WasmScript::NumFunctions() const { |
| i::DisallowHeapAllocation no_gc; |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| DCHECK_EQ(i::Script::TYPE_WASM, script->type()); |
| i::WasmCompiledModule* compiled_module = |
| i::WasmCompiledModule::cast(script->wasm_compiled_module()); |
| DCHECK_GE(i::kMaxInt, compiled_module->module()->functions.size()); |
| return static_cast<int>(compiled_module->module()->functions.size()); |
| } |
| |
| int debug::WasmScript::NumImportedFunctions() const { |
| i::DisallowHeapAllocation no_gc; |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| DCHECK_EQ(i::Script::TYPE_WASM, script->type()); |
| i::WasmCompiledModule* compiled_module = |
| i::WasmCompiledModule::cast(script->wasm_compiled_module()); |
| DCHECK_GE(i::kMaxInt, compiled_module->module()->num_imported_functions); |
| return static_cast<int>(compiled_module->module()->num_imported_functions); |
| } |
| |
| std::pair<int, int> debug::WasmScript::GetFunctionRange( |
| int function_index) const { |
| i::DisallowHeapAllocation no_gc; |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| DCHECK_EQ(i::Script::TYPE_WASM, script->type()); |
| i::WasmCompiledModule* compiled_module = |
| i::WasmCompiledModule::cast(script->wasm_compiled_module()); |
| DCHECK_LE(0, function_index); |
| DCHECK_GT(compiled_module->module()->functions.size(), function_index); |
| i::wasm::WasmFunction& func = |
| compiled_module->module()->functions[function_index]; |
| DCHECK_GE(i::kMaxInt, func.code.offset()); |
| DCHECK_GE(i::kMaxInt, func.code.end_offset()); |
| return std::make_pair(static_cast<int>(func.code.offset()), |
| static_cast<int>(func.code.end_offset())); |
| } |
| |
| debug::WasmDisassembly debug::WasmScript::DisassembleFunction( |
| int function_index) const { |
| i::DisallowHeapAllocation no_gc; |
| i::Handle<i::Script> script = Utils::OpenHandle(this); |
| DCHECK_EQ(i::Script::TYPE_WASM, script->type()); |
| i::WasmCompiledModule* compiled_module = |
| i::WasmCompiledModule::cast(script->wasm_compiled_module()); |
| return compiled_module->DisassembleFunction(function_index); |
| } |
| |
| debug::Location::Location(int line_number, int column_number) |
| : line_number_(line_number), |
| column_number_(column_number), |
| is_empty_(false) {} |
| |
| debug::Location::Location() |
| : line_number_(v8::Function::kLineOffsetNotFound), |
| column_number_(v8::Function::kLineOffsetNotFound), |
| is_empty_(true) {} |
| |
| int debug::Location::GetLineNumber() const { |
| DCHECK(!IsEmpty()); |
| return line_number_; |
| } |
| |
| int debug::Location::GetColumnNumber() const { |
| DCHECK(!IsEmpty()); |
| return column_number_; |
| } |
| |
| bool debug::Location::IsEmpty() const { return is_empty_; } |
| |
| void debug::GetLoadedScripts(v8::Isolate* v8_isolate, |
| PersistentValueVector<debug::Script>& scripts) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| // TODO(kozyatinskiy): remove this GC once tests are dealt with. |
| isolate->heap()->CollectAllGarbage(i::Heap::kMakeHeapIterableMask, |
| i::GarbageCollectionReason::kDebugger); |
| { |
| i::DisallowHeapAllocation no_gc; |
| i::Script::Iterator iterator(isolate); |
| i::Script* script; |
| while ((script = iterator.Next()) != nullptr) { |
| if (!script->IsUserJavaScript()) continue; |
| if (script->HasValidSource()) { |
| i::HandleScope handle_scope(isolate); |
| i::Handle<i::Script> script_handle(script, isolate); |
| scripts.Append(ToApiHandle<Script>(script_handle)); |
| } |
| } |
| } |
| } |
| |
| MaybeLocal<UnboundScript> debug::CompileInspectorScript(Isolate* v8_isolate, |
| Local<String> source) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| PREPARE_FOR_DEBUG_INTERFACE_EXECUTION_WITH_ISOLATE(isolate, UnboundScript); |
| i::ScriptData* script_data = nullptr; |
| i::Handle<i::String> str = Utils::OpenHandle(*source); |
| i::Handle<i::SharedFunctionInfo> result; |
| { |
| ScriptOriginOptions origin_options; |
| i::MaybeHandle<i::SharedFunctionInfo> maybe_function_info = |
| i::Compiler::GetSharedFunctionInfoForScript( |
| str, i::MaybeHandle<i::Object>(), 0, 0, origin_options, |
| i::MaybeHandle<i::Object>(), isolate->native_context(), nullptr, |
| &script_data, ScriptCompiler::kNoCompileOptions, |
| ScriptCompiler::kNoCacheBecauseInspector, |
| i::FLAG_expose_inspector_scripts ? i::NOT_NATIVES_CODE |
| : i::INSPECTOR_CODE, |
| i::MaybeHandle<i::FixedArray>()); |
| has_pending_exception = !maybe_function_info.ToHandle(&result); |
| RETURN_ON_FAILED_EXECUTION(UnboundScript); |
| } |
| RETURN_ESCAPED(ToApiHandle<UnboundScript>(result)); |
| } |
| |
| void debug::SetDebugDelegate(Isolate* v8_isolate, |
| debug::DebugDelegate* delegate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| // Might create the Debug context. |
| ENTER_V8_FOR_NEW_CONTEXT(isolate); |
| isolate->debug()->SetDebugDelegate(delegate, false); |
| } |
| |
| void debug::ResetBlackboxedStateCache(Isolate* v8_isolate, |
| v8::Local<debug::Script> script) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::DisallowHeapAllocation no_gc; |
| i::SharedFunctionInfo::ScriptIterator iter(Utils::OpenHandle(*script)); |
| while (i::SharedFunctionInfo* info = iter.Next()) { |
| info->set_computed_debug_is_blackboxed(false); |
| } |
| } |
| |
| int debug::EstimatedValueSize(Isolate* v8_isolate, v8::Local<v8::Value> value) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::Handle<i::Object> object = Utils::OpenHandle(*value); |
| if (object->IsSmi()) return i::kPointerSize; |
| CHECK(object->IsHeapObject()); |
| return i::Handle<i::HeapObject>::cast(object)->Size(); |
| } |
| |
| v8::MaybeLocal<v8::Array> debug::EntriesPreview(Isolate* v8_isolate, |
| v8::Local<v8::Value> value, |
| bool* is_key_value) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| if (value->IsMap()) { |
| *is_key_value = true; |
| return value.As<Map>()->AsArray(); |
| } |
| if (value->IsSet()) { |
| *is_key_value = false; |
| return value.As<Set>()->AsArray(); |
| } |
| |
| i::Handle<i::Object> object = Utils::OpenHandle(*value); |
| if (object->IsJSWeakCollection()) { |
| *is_key_value = object->IsJSWeakMap(); |
| return Utils::ToLocal(i::JSWeakCollection::GetEntries( |
| i::Handle<i::JSWeakCollection>::cast(object), 0)); |
| } |
| if (object->IsJSMapIterator()) { |
| i::Handle<i::JSMapIterator> iterator = |
| i::Handle<i::JSMapIterator>::cast(object); |
| MapAsArrayKind const kind = |
| static_cast<MapAsArrayKind>(iterator->map()->instance_type()); |
| *is_key_value = kind == MapAsArrayKind::kEntries; |
| if (!iterator->HasMore()) return v8::Array::New(v8_isolate); |
| return Utils::ToLocal(MapAsArray(isolate, iterator->table(), |
| i::Smi::ToInt(iterator->index()), kind)); |
| } |
| if (object->IsJSSetIterator()) { |
| i::Handle<i::JSSetIterator> it = i::Handle<i::JSSetIterator>::cast(object); |
| *is_key_value = false; |
| if (!it->HasMore()) return v8::Array::New(v8_isolate); |
| return Utils::ToLocal( |
| SetAsArray(isolate, it->table(), i::Smi::ToInt(it->index()))); |
| } |
| return v8::MaybeLocal<v8::Array>(); |
| } |
| |
| Local<Function> debug::GetBuiltin(Isolate* v8_isolate, Builtin builtin) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| i::HandleScope handle_scope(isolate); |
| i::Builtins::Name builtin_id; |
| switch (builtin) { |
| case kObjectKeys: |
| builtin_id = i::Builtins::kObjectKeys; |
| break; |
| case kObjectGetPrototypeOf: |
| builtin_id = i::Builtins::kObjectGetPrototypeOf; |
| break; |
| case kObjectGetOwnPropertyDescriptor: |
| builtin_id = i::Builtins::kObjectGetOwnPropertyDescriptor; |
| break; |
| case kObjectGetOwnPropertyNames: |
| builtin_id = i::Builtins::kObjectGetOwnPropertyNames; |
| break; |
| case kObjectGetOwnPropertySymbols: |
| builtin_id = i::Builtins::kObjectGetOwnPropertySymbols; |
| break; |
| default: |
| UNREACHABLE(); |
| } |
| |
| i::Handle<i::String> name = isolate->factory()->empty_string(); |
| i::Handle<i::Code> code(isolate->builtins()->builtin(builtin_id)); |
| i::NewFunctionArgs args = i::NewFunctionArgs::ForBuiltinWithoutPrototype( |
| name, code, builtin_id, i::LanguageMode::kSloppy); |
| i::Handle<i::JSFunction> fun = isolate->factory()->NewFunction(args); |
| |
| fun->shared()->DontAdaptArguments(); |
| return Utils::ToLocal(handle_scope.CloseAndEscape(fun)); |
| } |
| |
| void debug::SetConsoleDelegate(Isolate* v8_isolate, ConsoleDelegate* delegate) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| isolate->set_console_delegate(delegate); |
| } |
| |
| debug::ConsoleCallArguments::ConsoleCallArguments( |
| const v8::FunctionCallbackInfo<v8::Value>& info) |
| : v8::FunctionCallbackInfo<v8::Value>(nullptr, info.values_, info.length_) { |
| } |
| |
| debug::ConsoleCallArguments::ConsoleCallArguments( |
| internal::BuiltinArguments& args) |
| : v8::FunctionCallbackInfo<v8::Value>(nullptr, &args[0] - 1, |
| args.length() - 1) {} |
| |
| int debug::GetStackFrameId(v8::Local<v8::StackFrame> frame) { |
| return Utils::OpenHandle(*frame)->id(); |
| } |
| |
| v8::Local<v8::StackTrace> debug::GetDetailedStackTrace( |
| Isolate* v8_isolate, v8::Local<v8::Object> v8_error) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| i::Handle<i::JSReceiver> error = Utils::OpenHandle(*v8_error); |
| if (!error->IsJSObject()) { |
| return v8::Local<v8::StackTrace>(); |
| } |
| i::Handle<i::FixedArray> stack_trace = |
| isolate->GetDetailedStackTrace(i::Handle<i::JSObject>::cast(error)); |
| return Utils::StackTraceToLocal(stack_trace); |
| } |
| |
| MaybeLocal<debug::Script> debug::GeneratorObject::Script() { |
| i::Handle<i::JSGeneratorObject> obj = Utils::OpenHandle(this); |
| i::Object* maybe_script = obj->function()->shared()->script(); |
| if (!maybe_script->IsScript()) return MaybeLocal<debug::Script>(); |
| i::Handle<i::Script> script(i::Script::cast(maybe_script), obj->GetIsolate()); |
| return ToApiHandle<debug::Script>(script); |
| } |
| |
| Local<Function> debug::GeneratorObject::Function() { |
| i::Handle<i::JSGeneratorObject> obj = Utils::OpenHandle(this); |
| return Utils::ToLocal(handle(obj->function())); |
| } |
| |
| debug::Location debug::GeneratorObject::SuspendedLocation() { |
| i::Handle<i::JSGeneratorObject> obj = Utils::OpenHandle(this); |
| CHECK(obj->is_suspended()); |
| i::Object* maybe_script = obj->function()->shared()->script(); |
| if (!maybe_script->IsScript()) return debug::Location(); |
| i::Handle<i::Script> script(i::Script::cast(maybe_script), obj->GetIsolate()); |
| i::Script::PositionInfo info; |
| i::Script::GetPositionInfo(script, obj->source_position(), &info, |
| i::Script::WITH_OFFSET); |
| return debug::Location(info.line, info.column); |
| } |
| |
| bool debug::GeneratorObject::IsSuspended() { |
| return Utils::OpenHandle(this)->is_suspended(); |
| } |
| |
| v8::Local<debug::GeneratorObject> debug::GeneratorObject::Cast( |
| v8::Local<v8::Value> value) { |
| CHECK(value->IsGeneratorObject()); |
| return ToApiHandle<debug::GeneratorObject>(Utils::OpenHandle(*value)); |
| } |
| |
| void debug::QueryObjects(v8::Local<v8::Context> v8_context, |
| QueryObjectPredicate* predicate, |
| PersistentValueVector<v8::Object>* objects) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_context->GetIsolate()); |
| ENTER_V8_NO_SCRIPT_NO_EXCEPTION(isolate); |
| isolate->heap_profiler()->QueryObjects(Utils::OpenHandle(*v8_context), |
| predicate, objects); |
| } |
| |
| void debug::GlobalLexicalScopeNames( |
| v8::Local<v8::Context> v8_context, |
| v8::PersistentValueVector<v8::String>* names) { |
| i::Handle<i::Context> context = Utils::OpenHandle(*v8_context); |
| i::Handle<i::ScriptContextTable> table( |
| context->global_object()->native_context()->script_context_table()); |
| for (int i = 0; i < table->used(); i++) { |
| i::Handle<i::Context> context = i::ScriptContextTable::GetContext(table, i); |
| DCHECK(context->IsScriptContext()); |
| i::Handle<i::ScopeInfo> scope_info(context->scope_info()); |
| int local_count = scope_info->ContextLocalCount(); |
| for (int j = 0; j < local_count; ++j) { |
| i::String* name = scope_info->ContextLocalName(j); |
| if (i::ScopeInfo::VariableIsSynthetic(name)) continue; |
| names->Append(Utils::ToLocal(handle(name))); |
| } |
| } |
| } |
| |
| void debug::SetReturnValue(v8::Isolate* v8_isolate, |
| v8::Local<v8::Value> value) { |
| i::Isolate* isolate = reinterpret_cast<i::Isolate*>(v8_isolate); |
| if (!isolate->debug()->break_id()) return; |
| isolate->debug()->set_return_value(*Utils::OpenHandle(*value)); |
| } |
| |
| int debug::GetNativeAccessorDescriptor(v8::Local<v8::Context> context, |
| v8::Local<v8::Object> v8_object, |
| v8::Local<v8::Name> v8_name) { |
| i::Handle<i::JSReceiver> object = Utils::OpenHandle(*v8_object); |
| i::Handle<i::Name> name = Utils::OpenHandle(*v8_name); |
| uint32_t index; |
| if (name->AsArrayIndex(&index)) { |
| return static_cast<int>(debug::NativeAccessorType::None); |
| } |
| i::LookupIterator it = |
| i::LookupIterator(object, name, i::LookupIterator::OWN); |
| if (!it.IsFound()) return static_cast<int>(debug::NativeAccessorType::None); |
| if (it.state() != i::LookupIterator::ACCESSOR) { |
| return static_cast<int>(debug::NativeAccessorType::None); |
| } |
| i::Handle<i::Object> structure = it.GetAccessors(); |
| if (!structure->IsAccessorInfo()) { |
| return static_cast<int>(debug::NativeAccessorType::None); |
| } |
| auto isolate = reinterpret_cast<i::Isolate*>(context->GetIsolate()); |
| int result = 0; |
| #define IS_BUILTIN_ACESSOR(name, _) \ |
| if (*structure == *isolate->factory()->name##_accessor()) \ |
| result |= static_cast<int>(debug::NativeAccessorType::IsBuiltin); |
| ACCESSOR_INFO_LIST(IS_BUILTIN_ACESSOR) |
| #undef IS_BUILTIN_ACESSOR |
| i::Handle<i::AccessorInfo> accessor_info = |
| i::Handle<i::AccessorInfo>::cast(structure); |
| if (accessor_info->getter()) |
| result |= static_cast<int>(debug::NativeAccessorType::HasGetter); |
| if (accessor_info->setter()) |
| result |= static_cast<int>(debug::NativeAccessorType::HasSetter); |
| return result; |
| } |
| |
| int64_t debug::GetNextRandomInt64(v8::Isolate* v8_isolate) { |
| return reinterpret_cast<i::Isolate*>(v8_isolate) |
| ->random_number_generator() |
| ->NextInt64(); |
| } |
| |
| Local<String> CpuProfileNode::GetFunctionName() const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| i::Isolate* isolate = node->isolate(); |
| const i::CodeEntry* entry = node->entry(); |
| i::Handle<i::String> name = |
| isolate->factory()->InternalizeUtf8String(entry->name()); |
| if (!entry->has_name_prefix()) { |
| return ToApiHandle<String>(name); |
| } else { |
| // We do not expect this to fail. Change this if it does. |
| i::Handle<i::String> cons = isolate->factory()->NewConsString( |
| isolate->factory()->InternalizeUtf8String(entry->name_prefix()), |
| name).ToHandleChecked(); |
| return ToApiHandle<String>(cons); |
| } |
| } |
| |
| int debug::Coverage::BlockData::StartOffset() const { return block_->start; } |
| int debug::Coverage::BlockData::EndOffset() const { return block_->end; } |
| uint32_t debug::Coverage::BlockData::Count() const { return block_->count; } |
| |
| int debug::Coverage::FunctionData::StartOffset() const { |
| return function_->start; |
| } |
| int debug::Coverage::FunctionData::EndOffset() const { return function_->end; } |
| uint32_t debug::Coverage::FunctionData::Count() const { |
| return function_->count; |
| } |
| |
| MaybeLocal<String> debug::Coverage::FunctionData::Name() const { |
| return ToApiHandle<String>(function_->name); |
| } |
| |
| size_t debug::Coverage::FunctionData::BlockCount() const { |
| return function_->blocks.size(); |
| } |
| |
| bool debug::Coverage::FunctionData::HasBlockCoverage() const { |
| return function_->has_block_coverage; |
| } |
| |
| debug::Coverage::BlockData debug::Coverage::FunctionData::GetBlockData( |
| size_t i) const { |
| return BlockData(&function_->blocks.at(i), coverage_); |
| } |
| |
| Local<debug::Script> debug::Coverage::ScriptData::GetScript() const { |
| return ToApiHandle<debug::Script>(script_->script); |
| } |
| |
| size_t debug::Coverage::ScriptData::FunctionCount() const { |
| return script_->functions.size(); |
| } |
| |
| debug::Coverage::FunctionData debug::Coverage::ScriptData::GetFunctionData( |
| size_t i) const { |
| return FunctionData(&script_->functions.at(i), coverage_); |
| } |
| |
| debug::Coverage::ScriptData::ScriptData(size_t index, |
| std::shared_ptr<i::Coverage> coverage) |
| : script_(&coverage->at(index)), coverage_(std::move(coverage)) {} |
| |
| size_t debug::Coverage::ScriptCount() const { return coverage_->size(); } |
| |
| debug::Coverage::ScriptData debug::Coverage::GetScriptData(size_t i) const { |
| return ScriptData(i, coverage_); |
| } |
| |
| debug::Coverage debug::Coverage::CollectPrecise(Isolate* isolate) { |
| return Coverage( |
| i::Coverage::CollectPrecise(reinterpret_cast<i::Isolate*>(isolate))); |
| } |
| |
| debug::Coverage debug::Coverage::CollectBestEffort(Isolate* isolate) { |
| return Coverage( |
| i::Coverage::CollectBestEffort(reinterpret_cast<i::Isolate*>(isolate))); |
| } |
| |
| void debug::Coverage::SelectMode(Isolate* isolate, debug::Coverage::Mode mode) { |
| i::Coverage::SelectMode(reinterpret_cast<i::Isolate*>(isolate), mode); |
| } |
| |
| int debug::TypeProfile::Entry::SourcePosition() const { |
| return entry_->position; |
| } |
| |
| std::vector<MaybeLocal<String>> debug::TypeProfile::Entry::Types() const { |
| std::vector<MaybeLocal<String>> result; |
| for (const internal::Handle<internal::String>& type : entry_->types) { |
| result.emplace_back(ToApiHandle<String>(type)); |
| } |
| return result; |
| } |
| |
| debug::TypeProfile::ScriptData::ScriptData( |
| size_t index, std::shared_ptr<i::TypeProfile> type_profile) |
| : script_(&type_profile->at(index)), |
| type_profile_(std::move(type_profile)) {} |
| |
| Local<debug::Script> debug::TypeProfile::ScriptData::GetScript() const { |
| return ToApiHandle<debug::Script>(script_->script); |
| } |
| |
| std::vector<debug::TypeProfile::Entry> debug::TypeProfile::ScriptData::Entries() |
| const { |
| std::vector<debug::TypeProfile::Entry> result; |
| for (const internal::TypeProfileEntry& entry : script_->entries) { |
| result.push_back(debug::TypeProfile::Entry(&entry, type_profile_)); |
| } |
| return result; |
| } |
| |
| debug::TypeProfile debug::TypeProfile::Collect(Isolate* isolate) { |
| return TypeProfile( |
| i::TypeProfile::Collect(reinterpret_cast<i::Isolate*>(isolate))); |
| } |
| |
| void debug::TypeProfile::SelectMode(Isolate* isolate, |
| debug::TypeProfile::Mode mode) { |
| i::TypeProfile::SelectMode(reinterpret_cast<i::Isolate*>(isolate), mode); |
| } |
| |
| size_t debug::TypeProfile::ScriptCount() const { return type_profile_->size(); } |
| |
| debug::TypeProfile::ScriptData debug::TypeProfile::GetScriptData( |
| size_t i) const { |
| return ScriptData(i, type_profile_); |
| } |
| |
| const char* CpuProfileNode::GetFunctionNameStr() const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| return node->entry()->name(); |
| } |
| |
| int CpuProfileNode::GetScriptId() const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| const i::CodeEntry* entry = node->entry(); |
| return entry->script_id(); |
| } |
| |
| Local<String> CpuProfileNode::GetScriptResourceName() const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| i::Isolate* isolate = node->isolate(); |
| return ToApiHandle<String>(isolate->factory()->InternalizeUtf8String( |
| node->entry()->resource_name())); |
| } |
| |
| const char* CpuProfileNode::GetScriptResourceNameStr() const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| return node->entry()->resource_name(); |
| } |
| |
| int CpuProfileNode::GetLineNumber() const { |
| return reinterpret_cast<const i::ProfileNode*>(this)->entry()->line_number(); |
| } |
| |
| |
| int CpuProfileNode::GetColumnNumber() const { |
| return reinterpret_cast<const i::ProfileNode*>(this)-> |
| entry()->column_number(); |
| } |
| |
| |
| unsigned int CpuProfileNode::GetHitLineCount() const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| return node->GetHitLineCount(); |
| } |
| |
| |
| bool CpuProfileNode::GetLineTicks(LineTick* entries, |
| unsigned int length) const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| return node->GetLineTicks(entries, length); |
| } |
| |
| |
| const char* CpuProfileNode::GetBailoutReason() const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| return node->entry()->bailout_reason(); |
| } |
| |
| |
| unsigned CpuProfileNode::GetHitCount() const { |
| return reinterpret_cast<const i::ProfileNode*>(this)->self_ticks(); |
| } |
| |
| |
| unsigned CpuProfileNode::GetCallUid() const { |
| return reinterpret_cast<const i::ProfileNode*>(this)->function_id(); |
| } |
| |
| |
| unsigned CpuProfileNode::GetNodeId() const { |
| return reinterpret_cast<const i::ProfileNode*>(this)->id(); |
| } |
| |
| |
| int CpuProfileNode::GetChildrenCount() const { |
| return static_cast<int>( |
| reinterpret_cast<const i::ProfileNode*>(this)->children()->size()); |
| } |
| |
| |
| const CpuProfileNode* CpuProfileNode::GetChild(int index) const { |
| const i::ProfileNode* child = |
| reinterpret_cast<const i::ProfileNode*>(this)->children()->at(index); |
| return reinterpret_cast<const CpuProfileNode*>(child); |
| } |
| |
| |
| const std::vector<CpuProfileDeoptInfo>& CpuProfileNode::GetDeoptInfos() const { |
| const i::ProfileNode* node = reinterpret_cast<const i::ProfileNode*>(this); |
| return node->deopt_infos(); |
| } |
| |
| |
| void CpuProfile::Delete() { |
| i::CpuProfile* profile = reinterpret_cast<i::CpuProfile*>(this); |
| i::CpuProfiler* profiler = profile->cpu_profiler(); |
| DCHECK_NOT_NULL(profiler); |
| profiler->DeleteProfile(profile); |
| } |
| |
| |
| Local<String> CpuProfile::GetTitle() const { |
| const i::CpuProfile* profile = reinterpret_cast<const i::CpuProfile*>(this); |
| i::Isolate* isolate = profile->top_down()->isolate(); |
| return ToApiHandle<String>(isolate->factory()->InternalizeUtf8String( |
| profile->title())); |
| } |
| |
| |
| const CpuProfileNode* CpuProfile::GetTopDownRoot() const { |
| const i::CpuProfile* profile = reinterpret_cast<const i::CpuProfile*>(this); |
| return reinterpret_cast<const CpuProfileNode*>(profile->top_down()->root()); |
| } |
| |
| |
| const CpuProfileNode* CpuProfile::GetSample(int index) const { |
| const i::CpuProfile* profile = reinterpret_cast<const i::CpuProfile*>(this); |
| return reinterpret_cast<const CpuProfileNode*>(profile->sample(index)); |
| } |
| |
| |
| int64_t CpuProfile::GetSampleTimestamp(int index) const { |
| const i::CpuProfile* profile = reinterpret_cast<const i::CpuProfile*>(this); |
| return (profile->sample_timestamp(index) - base::TimeTicks()) |
| .InMicroseconds(); |
| } |
| |
| |
| int64_t CpuProfile::GetStartTime() const { |
| const i::CpuProfile* profile = reinterpret_cast<const i::CpuProfile*>(this); |
| return (profile->start_time() - base::TimeTicks()).InMicroseconds(); |
| } |
| |
| |
| int64_t CpuProfile::GetEndTime() const { |
| const i::CpuProfile* profile = reinterpret_cast<const i::CpuProfile*>(this); |
| return (profile->end_time() - base::TimeTicks()).InMicroseconds(); |
| } |
| |
| |
| int CpuProfile::GetSamplesCount() const { |
| return reinterpret_cast<const i::CpuProfile*>(this)->samples_count(); |
| } |
| |
| CpuProfiler* CpuProfiler::New(Isolate* isolate) { |
| return reinterpret_cast<CpuProfiler*>( |
| new i::CpuProfiler(reinterpret_cast<i::Isolate*>(isolate))); |
| } |
| |
| void CpuProfiler::Dispose() { delete reinterpret_cast<i::CpuProfiler*>(this); } |
| |
| // static |
| void CpuProfiler::CollectSample(Isolate* isolate) { |
| i::CpuProfiler::CollectSample(reinterpret_cast<i::Isolate*>(isolate)); |
| } |
| |
| void CpuProfiler::SetSamplingInterval(int us) { |
| DCHECK_GE(us, 0); |
| return reinterpret_cast<i::CpuProfiler*>(this)->set_sampling_interval( |
| base::TimeDelta::FromMicroseconds(us)); |
| } |
| |
| void CpuProfiler::CollectSample() { |
| reinterpret_cast<i::CpuProfiler*>(this)->CollectSample(); |
| } |
| |
| void CpuProfiler::StartProfiling(Local<String> title, bool record_samples) { |
| reinterpret_cast<i::CpuProfiler*>(this)->StartProfiling( |
| *Utils::OpenHandle(*title), record_samples); |
| } |
| |
| |
| CpuProfile* CpuProfiler::StopProfiling(Local<String> title) { |
| return reinterpret_cast<CpuProfile*>( |
| reinterpret_cast<i::CpuProfiler*>(this)->StopProfiling( |
| *Utils::OpenHandle(*title))); |
| } |
| |
| |
| void CpuProfiler::SetIdle(bool is_idle) { |
| i::CpuProfiler* profiler = reinterpret_cast<i::CpuProfiler*>(this); |
| i::Isolate* isolate = profiler->isolate(); |
| if (!isolate->is_profiling()) return; |
| v8::StateTag state = isolate->current_vm_state(); |
| DCHECK(state == v8::EXTERNAL || state == v8::IDLE); |
| if (isolate->js_entry_sp() != nullptr) return; |
| if (is_idle) { |
| isolate->set_current_vm_state(v8::IDLE); |
| } else if (state == v8::IDLE) { |
| isolate->set_current_vm_state(v8::EXTERNAL); |
| } |
| } |
| |
| |
| static i::HeapGraphEdge* ToInternal(const HeapGraphEdge* edge) { |
| return const_cast<i::HeapGraphEdge*>( |
| reinterpret_cast<const i::HeapGraphEdge*>(edge)); |
| } |
| |
| |
| HeapGraphEdge::Type HeapGraphEdge::GetType() const { |
| return static_cast<HeapGraphEdge::Type>(ToInternal(this)->type()); |
| } |
| |
| |
| Local<Value> HeapGraphEdge::GetName() const { |
| i::HeapGraphEdge* edge = ToInternal(this); |
| i::Isolate* isolate = edge->isolate(); |
| switch (edge->type()) { |
| case i::HeapGraphEdge::kContextVariable: |
| case i::HeapGraphEdge::kInternal: |
| case i::HeapGraphEdge::kProperty: |
| case i::HeapGraphEdge::kShortcut: |
| case i::HeapGraphEdge::kWeak: |
| return ToApiHandle<String>( |
| isolate->factory()->InternalizeUtf8String(edge->name())); |
| case i::HeapGraphEdge::kElement: |
| case i::HeapGraphEdge::kHidden: |
| return ToApiHandle<Number>( |
| isolate->factory()->NewNumberFromInt(edge->index())); |
| default: UNREACHABLE(); |
| } |
| return v8::Undefined(reinterpret_cast<v8::Isolate*>(isolate)); |
| } |
| |
| |
| const HeapGraphNode* HeapGraphEdge::GetFromNode() const { |
| const i::HeapEntry* from = ToInternal(this)->from(); |
| return reinterpret_cast<const HeapGraphNode*>(from); |
| } |
| |
| |
| const HeapGraphNode* HeapGraphEdge::GetToNode() const { |
| const i::HeapEntry* to = ToInternal(this)->to(); |
| return reinterpret_cast<const HeapGraphNode*>(to); |
| } |
| |
| |
| static i::HeapEntry* ToInternal(const HeapGraphNode* entry) { |
| return const_cast<i::HeapEntry*>( |
| reinterpret_cast<const i::HeapEntry*>(entry)); |
| } |
| |
| |
| HeapGraphNode::Type HeapGraphNode::GetType() const { |
| return static_cast<HeapGraphNode::Type>(ToInternal(this)->type()); |
| } |
| |
| |
| Local<String> HeapGraphNode::GetName() const { |
| i::Isolate* isolate = ToInternal(this)->isolate(); |
| return ToApiHandle<String>( |
| isolate->factory()->InternalizeUtf8String(ToInternal(this)->name())); |
| } |
| |
| |
| SnapshotObjectId HeapGraphNode::GetId() const { |
| return ToInternal(this)->id(); |
| } |
| |
| |
| size_t HeapGraphNode::GetShallowSize() const { |
| return ToInternal(this)->self_size(); |
| } |
| |
| |
| int HeapGraphNode::GetChildrenCount() const { |
| return ToInternal(this)->children_count(); |
| } |
| |
| |
| const HeapGraphEdge* HeapGraphNode::GetChild(int index) const { |
| return reinterpret_cast<const HeapGraphEdge*>(ToInternal(this)->child(index)); |
| } |
| |
| |
| static i::HeapSnapshot* ToInternal(const HeapSnapshot* snapshot) { |
| return const_cast<i::HeapSnapshot*>( |
| reinterpret_cast<const i::HeapSnapshot*>(snapshot)); |
| } |
| |
| |
| void HeapSnapshot::Delete() { |
| i::Isolate* isolate = ToInternal(this)->profiler()->isolate(); |
| if (isolate->heap_profiler()->GetSnapshotsCount() > 1) { |
| ToInternal(this)->Delete(); |
| } else { |
| // If this is the last snapshot, clean up all accessory data as well. |
| isolate->heap_profiler()->DeleteAllSnapshots(); |
| } |
| } |
| |
| |
| const HeapGraphNode* HeapSnapshot::GetRoot() const { |
| return reinterpret_cast<const HeapGraphNode*>(ToInternal(this)->root()); |
| } |
| |
| |
| const HeapGraphNode* HeapSnapshot::GetNodeById(SnapshotObjectId id) const { |
| return reinterpret_cast<const HeapGraphNode*>( |
| ToInternal(this)->GetEntryById(id)); |
| } |
| |
| |
| int HeapSnapshot::GetNodesCount() const { |
| return static_cast<int>(ToInternal(this)->entries().size()); |
| } |
| |
| |
| const HeapGraphNode* HeapSnapshot::GetNode(int index) const { |
| return reinterpret_cast<const HeapGraphNode*>( |
| &ToInternal(this)->entries().at(index)); |
| } |
| |
| |
| SnapshotObjectId HeapSnapshot::GetMaxSnapshotJSObjectId() const { |
| return ToInternal(this)->max_snapshot_js_object_id(); |
| } |
| |
| |
| void HeapSnapshot::Serialize(OutputStream* stream, |
| HeapSnapshot::SerializationFormat format) const { |
| Utils::ApiCheck(format == kJSON, |
| "v8::HeapSnapshot::Serialize", |
| "Unknown serialization format"); |
| Utils::ApiCheck(stream->GetChunkSize() > 0, |
| "v8::HeapSnapshot::Serialize", |
| "Invalid stream chunk size"); |
| i::HeapSnapshotJSONSerializer serializer(ToInternal(this)); |
| serializer.Serialize(stream); |
| } |
| |
| |
| // static |
| STATIC_CONST_MEMBER_DEFINITION const SnapshotObjectId |
| HeapProfiler::kUnknownObjectId; |
| |
| |
| int HeapProfiler::GetSnapshotCount() { |
| return reinterpret_cast<i::HeapProfiler*>(this)->GetSnapshotsCount(); |
| } |
| |
| |
| const HeapSnapshot* HeapProfiler::GetHeapSnapshot(int index) { |
| return reinterpret_cast<const HeapSnapshot*>( |
| reinterpret_cast<i::HeapProfiler*>(this)->GetSnapshot(index)); |
| } |
| |
| |
| SnapshotObjectId HeapProfiler::GetObjectId(Local<Value> value) { |
| i::Handle<i::Object> obj = Utils::OpenHandle(*value); |
| return reinterpret_cast<i::HeapProfiler*>(this)->GetSnapshotObjectId(obj); |
| } |
| |
| |
| Local<Value> HeapProfiler::FindObjectById(SnapshotObjectId id) { |
| i::Handle<i::Object> obj = |
| reinterpret_cast<i::HeapProfiler*>(this)->FindHeapObjectById(id); |
| if (obj.is_null()) return Local<Value>(); |
| return Utils::ToLocal(obj); |
| } |
| |
| |
| void HeapProfiler::ClearObjectIds() { |
| reinterpret_cast<i::HeapProfiler*>(this)->ClearHeapObjectMap(); |
| } |
| |
| |
| const HeapSnapshot* HeapProfiler::TakeHeapSnapshot( |
| ActivityControl* control, ObjectNameResolver* resolver) { |
| return reinterpret_cast<const HeapSnapshot*>( |
| reinterpret_cast<i::HeapProfiler*>(this) |
| ->TakeSnapshot(control, resolver)); |
| } |
| |
| |
| void HeapProfiler::StartTrackingHeapObjects(bool track_allocations) { |
| reinterpret_cast<i::HeapProfiler*>(this)->StartHeapObjectsTracking( |
| track_allocations); |
| } |
| |
| |
| void HeapProfiler::StopTrackingHeapObjects() { |
| reinterpret_cast<i::HeapProfiler*>(this)->StopHeapObjectsTracking(); |
| } |
| |
| |
| SnapshotObjectId HeapProfiler::GetHeapStats(OutputStream* stream, |
| int64_t* timestamp_us) { |
| i::HeapProfiler* heap_profiler = reinterpret_cast<i::HeapProfiler*>(this); |
| return heap_profiler->PushHeapObjectsStats(stream, timestamp_us); |
| } |
| |
| bool HeapProfiler::StartSamplingHeapProfiler(uint64_t sample_interval, |
| int stack_depth, |
| SamplingFlags flags) { |
| return reinterpret_cast<i::HeapProfiler*>(this)->StartSamplingHeapProfiler( |
| sample_interval, stack_depth, flags); |
| } |
| |
| |
| void HeapProfiler::StopSamplingHeapProfiler() { |
| reinterpret_cast<i::HeapProfiler*>(this)->StopSamplingHeapProfiler(); |
| } |
| |
| |
| AllocationProfile* HeapProfiler::GetAllocationProfile() { |
| return reinterpret_cast<i::HeapProfiler*>(this)->GetAllocationProfile(); |
| } |
| |
| |
| void HeapProfiler::DeleteAllHeapSnapshots() { |
| reinterpret_cast<i::HeapProfiler*>(this)->DeleteAllSnapshots(); |
| } |
| |
| |
| void HeapProfiler::SetWrapperClassInfoProvider(uint16_t class_id, |
| WrapperInfoCallback callback) { |
| reinterpret_cast<i::HeapProfiler*>(this)->DefineWrapperClass(class_id, |
| callback); |
| } |
| |
| void HeapProfiler::SetGetRetainerInfosCallback( |
| GetRetainerInfosCallback callback) { |
| reinterpret_cast<i::HeapProfiler*>(this)->SetGetRetainerInfosCallback( |
| callback); |
| } |
| |
| v8::Testing::StressType internal::Testing::stress_type_ = |
| v8::Testing::kStressTypeOpt; |
| |
| |
| void Testing::SetStressRunType(Testing::StressType type) { |
| internal::Testing::set_stress_type(type); |
| } |
| |
| |
| int Testing::GetStressRuns() { |
| if (internal::FLAG_stress_runs != 0) return internal::FLAG_stress_runs; |
| #ifdef DEBUG |
| // In debug mode the code runs much slower so stressing will only make two |
| // runs. |
| return 2; |
| #else |
| return 5; |
| #endif |
| } |
| |
| |
| static void SetFlagsFromString(const char* flags) { |
| V8::SetFlagsFromString(flags, i::StrLength(flags)); |
| } |
| |
| |
| void Testing::PrepareStressRun(int run) { |
| static const char* kLazyOptimizations = |
| "--prepare-always-opt " |
| "--max-inlined-bytecode-size=999999 " |
| "--max-inlined-bytecode-size-cumulative=999999 " |
| "--noalways-opt"; |
| static const char* kForcedOptimizations = "--always-opt"; |
| |
| // If deoptimization stressed turn on frequent deoptimization. If no value |
| // is spefified through --deopt-every-n-times use a default default value. |
| static const char* kDeoptEvery13Times = "--deopt-every-n-times=13"; |
| if (internal::Testing::stress_type() == Testing::kStressTypeDeopt && |
| internal::FLAG_deopt_every_n_times == 0) { |
| SetFlagsFromString(kDeoptEvery13Times); |
| } |
| |
| #ifdef DEBUG |
| // As stressing in debug mode only make two runs skip the deopt stressing |
| // here. |
| if (run == GetStressRuns() - 1) { |
| SetFlagsFromString(kForcedOptimizations); |
| } else { |
| SetFlagsFromString(kLazyOptimizations); |
| } |
| #else |
| if (run == GetStressRuns() - 1) { |
| SetFlagsFromString(kForcedOptimizations); |
| } else if (run != GetStressRuns() - 2) { |
| SetFlagsFromString(kLazyOptimizations); |
| } |
| #endif |
| } |
| |
| |
| void Testing::DeoptimizeAll(Isolate* isolate) { |
| i::Isolate* i_isolate = reinterpret_cast<i::Isolate*>(isolate); |
| i::HandleScope scope(i_isolate); |
| internal::Deoptimizer::DeoptimizeAll(i_isolate); |
| } |
| |
| |
| namespace internal { |
| |
| void HandleScopeImplementer::FreeThreadResources() { |
| Free(); |
| } |
| |
| |
| char* HandleScopeImplementer::ArchiveThread(char* storage) { |
| HandleScopeData* current = isolate_->handle_scope_data(); |
| handle_scope_data_ = *current; |
| MemCopy(storage, this, sizeof(*this)); |
| |
| ResetAfterArchive(); |
| current->Initialize(); |
| |
| return storage + ArchiveSpacePerThread(); |
| } |
| |
| |
| int HandleScopeImplementer::ArchiveSpacePerThread() { |
| return sizeof(HandleScopeImplementer); |
| } |
| |
| |
| char* HandleScopeImplementer::RestoreThread(char* storage) { |
| MemCopy(this, storage, sizeof(*this)); |
| *isolate_->handle_scope_data() = handle_scope_data_; |
| return storage + ArchiveSpacePerThread(); |
| } |
| |
| void HandleScopeImplementer::IterateThis(RootVisitor* v) { |
| #ifdef DEBUG |
| bool found_block_before_deferred = false; |
| #endif |
| // Iterate over all handles in the blocks except for the last. |
| for (int i = static_cast<int>(blocks()->size()) - 2; i >= 0; --i) { |
| Object** block = blocks()->at(i); |
| if (last_handle_before_deferred_block_ != nullptr && |
| (last_handle_before_deferred_block_ <= &block[kHandleBlockSize]) && |
| (last_handle_before_deferred_block_ >= block)) { |
| v->VisitRootPointers(Root::kHandleScope, block, |
| last_handle_before_deferred_block_); |
| DCHECK(!found_block_before_deferred); |
| #ifdef DEBUG |
| found_block_before_deferred = true; |
| #endif |
| } else { |
| v->VisitRootPointers(Root::kHandleScope, block, &block[kHandleBlockSize]); |
| } |
| } |
| |
| DCHECK(last_handle_before_deferred_block_ == nullptr || |
| found_block_before_deferred); |
| |
| // Iterate over live handles in the last block (if any). |
| if (!blocks()->empty()) { |
| v->VisitRootPointers(Root::kHandleScope, blocks()->back(), |
| handle_scope_data_.next); |
| } |
| |
| DetachableVector<Context*>* context_lists[2] = {&saved_contexts_, |
| &entered_contexts_}; |
| for (unsigned i = 0; i < arraysize(context_lists); i++) { |
| if (context_lists[i]->empty()) continue; |
| Object** start = reinterpret_cast<Object**>(&context_lists[i]->front()); |
| v->VisitRootPointers(Root::kHandleScope, start, |
| start + context_lists[i]->size()); |
| } |
| if (microtask_context_) { |
| v->VisitRootPointer(Root::kHandleScope, |
| reinterpret_cast<Object**>(µtask_context_)); |
| } |
| } |
| |
| void HandleScopeImplementer::Iterate(RootVisitor* v) { |
| HandleScopeData* current = isolate_->handle_scope_data(); |
| handle_scope_data_ = *current; |
| IterateThis(v); |
| } |
| |
| char* HandleScopeImplementer::Iterate(RootVisitor* v, char* storage) { |
| HandleScopeImplementer* scope_implementer = |
| reinterpret_cast<HandleScopeImplementer*>(storage); |
| scope_implementer->IterateThis(v); |
| return storage + ArchiveSpacePerThread(); |
| } |
| |
| |
| DeferredHandles* HandleScopeImplementer::Detach(Object** prev_limit) { |
| DeferredHandles* deferred = |
| new DeferredHandles(isolate()->handle_scope_data()->next, isolate()); |
| |
| while (!blocks_.empty()) { |
| Object** block_start = blocks_.back(); |
| Object** block_limit = &block_start[kHandleBlockSize]; |
| // We should not need to check for SealHandleScope here. Assert this. |
| DCHECK(prev_limit == block_limit || |
| !(block_start <= prev_limit && prev_limit <= block_limit)); |
| if (prev_limit == block_limit) break; |
| deferred->blocks_.push_back(blocks_.back()); |
| blocks_.pop_back(); |
| } |
| |
| // deferred->blocks_ now contains the blocks installed on the |
| // HandleScope stack since BeginDeferredScope was called, but in |
| // reverse order. |
| |
| DCHECK(prev_limit == nullptr || !blocks_.empty()); |
| |
| DCHECK(!blocks_.empty() && prev_limit != nullptr); |
| DCHECK_NOT_NULL(last_handle_before_deferred_block_); |
| last_handle_before_deferred_block_ = nullptr; |
| return deferred; |
| } |
| |
| |
| void HandleScopeImplementer::BeginDeferredScope() { |
| DCHECK_NULL(last_handle_before_deferred_block_); |
| last_handle_before_deferred_block_ = isolate()->handle_scope_data()->next; |
| } |
| |
| |
| DeferredHandles::~DeferredHandles() { |
| isolate_->UnlinkDeferredHandles(this); |
| |
| for (size_t i = 0; i < blocks_.size(); i++) { |
| #ifdef ENABLE_HANDLE_ZAPPING |
| HandleScope::ZapRange(blocks_[i], &blocks_[i][kHandleBlockSize]); |
| #endif |
| isolate_->handle_scope_implementer()->ReturnBlock(blocks_[i]); |
| } |
| } |
| |
| void DeferredHandles::Iterate(RootVisitor* v) { |
| DCHECK(!blocks_.empty()); |
| |
| DCHECK((first_block_limit_ >= blocks_.front()) && |
| (first_block_limit_ <= &(blocks_.front())[kHandleBlockSize])); |
| |
| v->VisitRootPointers(Root::kHandleScope, blocks_.front(), first_block_limit_); |
| |
| for (size_t i = 1; i < blocks_.size(); i++) { |
| v->VisitRootPointers(Root::kHandleScope, blocks_[i], |
| &blocks_[i][kHandleBlockSize]); |
| } |
| } |
| |
| |
| void InvokeAccessorGetterCallback( |
| v8::Local<v8::Name> property, |
| const v8::PropertyCallbackInfo<v8::Value>& info, |
| v8::AccessorNameGetterCallback getter) { |
| // Leaving JavaScript. |
| Isolate* isolate = reinterpret_cast<Isolate*>(info.GetIsolate()); |
| RuntimeCallTimerScope timer(isolate, |
| &RuntimeCallStats::AccessorGetterCallback); |
| Address getter_address = reinterpret_cast<Address>(reinterpret_cast<intptr_t>( |
| getter)); |
| VMState<EXTERNAL> state(isolate); |
| ExternalCallbackScope call_scope(isolate, getter_address); |
| getter(property, info); |
| } |
| |
| |
| void InvokeFunctionCallback(const v8::FunctionCallbackInfo<v8::Value>& info, |
| v8::FunctionCallback callback) { |
| Isolate* isolate = reinterpret_cast<Isolate*>(info.GetIsolate()); |
| RuntimeCallTimerScope timer(isolate, |
| &RuntimeCallStats::InvokeFunctionCallback); |
| Address callback_address = |
| reinterpret_cast<Address>(reinterpret_cast<intptr_t>(callback)); |
| VMState<EXTERNAL> state(isolate); |
| ExternalCallbackScope call_scope(isolate, callback_address); |
| callback(info); |
| } |
| |
| |
| } // namespace internal |
| } // namespace v8 |