| // Copyright 2012 the V8 project authors. All rights reserved. |
| // Use of this source code is governed by a BSD-style license that can be |
| // found in the LICENSE file. |
| |
| /** \mainpage V8 API Reference Guide |
| * |
| * V8 is Google's open source JavaScript engine. |
| * |
| * This set of documents provides reference material generated from the |
| * V8 header file, include/v8.h. |
| * |
| * For other documentation see http://code.google.com/apis/v8/ |
| */ |
| |
| #ifndef V8_H_ |
| #define V8_H_ |
| |
| #include <stddef.h> |
| #include <stdint.h> |
| #include <stdio.h> |
| |
| #include "v8-version.h" // NOLINT(build/include) |
| #include "v8config.h" // NOLINT(build/include) |
| |
| // We reserve the V8_* prefix for macros defined in V8 public API and |
| // assume there are no name conflicts with the embedder's code. |
| |
| #ifdef V8_OS_WIN |
| |
| // Setup for Windows DLL export/import. When building the V8 DLL the |
| // BUILDING_V8_SHARED needs to be defined. When building a program which uses |
| // the V8 DLL USING_V8_SHARED needs to be defined. When either building the V8 |
| // static library or building a program which uses the V8 static library neither |
| // BUILDING_V8_SHARED nor USING_V8_SHARED should be defined. |
| #if defined(BUILDING_V8_SHARED) && defined(USING_V8_SHARED) |
| #error both BUILDING_V8_SHARED and USING_V8_SHARED are set - please check the\ |
| build configuration to ensure that at most one of these is set |
| #endif |
| |
| #ifdef BUILDING_V8_SHARED |
| # define V8_EXPORT __declspec(dllexport) |
| #elif USING_V8_SHARED |
| # define V8_EXPORT __declspec(dllimport) |
| #else |
| # define V8_EXPORT |
| #endif // BUILDING_V8_SHARED |
| |
| #else // V8_OS_WIN |
| |
| // Setup for Linux shared library export. |
| #if V8_HAS_ATTRIBUTE_VISIBILITY && defined(V8_SHARED) |
| # ifdef BUILDING_V8_SHARED |
| # define V8_EXPORT __attribute__ ((visibility("default"))) |
| # else |
| # define V8_EXPORT |
| # endif |
| #else |
| # define V8_EXPORT |
| #endif |
| |
| #endif // V8_OS_WIN |
| |
| /** |
| * The v8 JavaScript engine. |
| */ |
| namespace v8 { |
| |
| class AccessorSignature; |
| class Array; |
| class Boolean; |
| class BooleanObject; |
| class Context; |
| class CpuProfiler; |
| class Data; |
| class Date; |
| class External; |
| class Function; |
| class FunctionTemplate; |
| class HeapProfiler; |
| class ImplementationUtilities; |
| class Int32; |
| class Integer; |
| class Isolate; |
| template <class T> |
| class Maybe; |
| class Name; |
| class Number; |
| class NumberObject; |
| class Object; |
| class ObjectOperationDescriptor; |
| class ObjectTemplate; |
| class Platform; |
| class Primitive; |
| class Promise; |
| class RawOperationDescriptor; |
| class Script; |
| class SharedArrayBuffer; |
| class Signature; |
| class StartupData; |
| class StackFrame; |
| class StackTrace; |
| class String; |
| class StringObject; |
| class Symbol; |
| class SymbolObject; |
| class Private; |
| class Uint32; |
| class Utils; |
| class Value; |
| template <class T> class Local; |
| template <class T> |
| class MaybeLocal; |
| template <class T> class Eternal; |
| template<class T> class NonCopyablePersistentTraits; |
| template<class T> class PersistentBase; |
| template <class T, class M = NonCopyablePersistentTraits<T> > |
| class Persistent; |
| template <class T> |
| class Global; |
| template<class K, class V, class T> class PersistentValueMap; |
| template <class K, class V, class T> |
| class PersistentValueMapBase; |
| template <class K, class V, class T> |
| class GlobalValueMap; |
| template<class V, class T> class PersistentValueVector; |
| template<class T, class P> class WeakCallbackObject; |
| class FunctionTemplate; |
| class ObjectTemplate; |
| class Data; |
| template<typename T> class FunctionCallbackInfo; |
| template<typename T> class PropertyCallbackInfo; |
| class StackTrace; |
| class StackFrame; |
| class Isolate; |
| class CallHandlerHelper; |
| class EscapableHandleScope; |
| template<typename T> class ReturnValue; |
| |
| namespace internal { |
| class Arguments; |
| class Heap; |
| class HeapObject; |
| class Isolate; |
| class Object; |
| struct StreamedSource; |
| template<typename T> class CustomArguments; |
| class PropertyCallbackArguments; |
| class FunctionCallbackArguments; |
| class GlobalHandles; |
| } // namespace internal |
| |
| |
| /** |
| * General purpose unique identifier. |
| */ |
| class UniqueId { |
| public: |
| explicit UniqueId(intptr_t data) |
| : data_(data) {} |
| |
| bool operator==(const UniqueId& other) const { |
| return data_ == other.data_; |
| } |
| |
| bool operator!=(const UniqueId& other) const { |
| return data_ != other.data_; |
| } |
| |
| bool operator<(const UniqueId& other) const { |
| return data_ < other.data_; |
| } |
| |
| private: |
| intptr_t data_; |
| }; |
| |
| // --- Handles --- |
| |
| #define TYPE_CHECK(T, S) \ |
| while (false) { \ |
| *(static_cast<T* volatile*>(0)) = static_cast<S*>(0); \ |
| } |
| |
| |
| /** |
| * An object reference managed by the v8 garbage collector. |
| * |
| * All objects returned from v8 have to be tracked by the garbage |
| * collector so that it knows that the objects are still alive. Also, |
| * because the garbage collector may move objects, it is unsafe to |
| * point directly to an object. Instead, all objects are stored in |
| * handles which are known by the garbage collector and updated |
| * whenever an object moves. Handles should always be passed by value |
| * (except in cases like out-parameters) and they should never be |
| * allocated on the heap. |
| * |
| * There are two types of handles: local and persistent handles. |
| * Local handles are light-weight and transient and typically used in |
| * local operations. They are managed by HandleScopes. Persistent |
| * handles can be used when storing objects across several independent |
| * operations and have to be explicitly deallocated when they're no |
| * longer used. |
| * |
| * It is safe to extract the object stored in the handle by |
| * dereferencing the handle (for instance, to extract the Object* from |
| * a Local<Object>); the value will still be governed by a handle |
| * behind the scenes and the same rules apply to these values as to |
| * their handles. |
| */ |
| template <class T> |
| class Local { |
| public: |
| V8_INLINE Local() : val_(0) {} |
| template <class S> |
| V8_INLINE Local(Local<S> that) |
| : val_(reinterpret_cast<T*>(*that)) { |
| /** |
| * This check fails when trying to convert between incompatible |
| * handles. For example, converting from a Local<String> to a |
| * Local<Number>. |
| */ |
| TYPE_CHECK(T, S); |
| } |
| |
| /** |
| * Returns true if the handle is empty. |
| */ |
| V8_INLINE bool IsEmpty() const { return val_ == 0; } |
| |
| /** |
| * Sets the handle to be empty. IsEmpty() will then return true. |
| */ |
| V8_INLINE void Clear() { val_ = 0; } |
| |
| V8_INLINE T* operator->() const { return val_; } |
| |
| V8_INLINE T* operator*() const { return val_; } |
| |
| /** |
| * Checks whether two handles are the same. |
| * Returns true if both are empty, or if the objects |
| * to which they refer are identical. |
| * The handles' references are not checked. |
| */ |
| template <class S> |
| V8_INLINE bool operator==(const Local<S>& that) const { |
| internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); |
| internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); |
| if (a == 0) return b == 0; |
| if (b == 0) return false; |
| return *a == *b; |
| } |
| |
| template <class S> V8_INLINE bool operator==( |
| const PersistentBase<S>& that) const { |
| internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); |
| internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); |
| if (a == 0) return b == 0; |
| if (b == 0) return false; |
| return *a == *b; |
| } |
| |
| /** |
| * Checks whether two handles are different. |
| * Returns true if only one of the handles is empty, or if |
| * the objects to which they refer are different. |
| * The handles' references are not checked. |
| */ |
| template <class S> |
| V8_INLINE bool operator!=(const Local<S>& that) const { |
| return !operator==(that); |
| } |
| |
| template <class S> V8_INLINE bool operator!=( |
| const Persistent<S>& that) const { |
| return !operator==(that); |
| } |
| |
| template <class S> V8_INLINE static Local<T> Cast(Local<S> that) { |
| #ifdef V8_ENABLE_CHECKS |
| // If we're going to perform the type check then we have to check |
| // that the handle isn't empty before doing the checked cast. |
| if (that.IsEmpty()) return Local<T>(); |
| #endif |
| return Local<T>(T::Cast(*that)); |
| } |
| |
| |
| template <class S> V8_INLINE Local<S> As() { |
| return Local<S>::Cast(*this); |
| } |
| |
| /** |
| * Create a local handle for the content of another handle. |
| * The referee is kept alive by the local handle even when |
| * the original handle is destroyed/disposed. |
| */ |
| V8_INLINE static Local<T> New(Isolate* isolate, Local<T> that); |
| V8_INLINE static Local<T> New(Isolate* isolate, |
| const PersistentBase<T>& that); |
| |
| private: |
| friend class Utils; |
| template<class F> friend class Eternal; |
| template<class F> friend class PersistentBase; |
| template<class F, class M> friend class Persistent; |
| template<class F> friend class Local; |
| template <class F> |
| friend class MaybeLocal; |
| template<class F> friend class FunctionCallbackInfo; |
| template<class F> friend class PropertyCallbackInfo; |
| friend class String; |
| friend class Object; |
| friend class Context; |
| friend class Private; |
| template<class F> friend class internal::CustomArguments; |
| friend Local<Primitive> Undefined(Isolate* isolate); |
| friend Local<Primitive> Null(Isolate* isolate); |
| friend Local<Boolean> True(Isolate* isolate); |
| friend Local<Boolean> False(Isolate* isolate); |
| friend class HandleScope; |
| friend class EscapableHandleScope; |
| template <class F1, class F2, class F3> |
| friend class PersistentValueMapBase; |
| template<class F1, class F2> friend class PersistentValueVector; |
| |
| template <class S> |
| V8_INLINE Local(S* that) |
| : val_(that) {} |
| V8_INLINE static Local<T> New(Isolate* isolate, T* that); |
| T* val_; |
| }; |
| |
| |
| #if !defined(V8_IMMINENT_DEPRECATION_WARNINGS) |
| // Local is an alias for Local for historical reasons. |
| template <class T> |
| using Handle = Local<T>; |
| #endif |
| |
| |
| /** |
| * A MaybeLocal<> is a wrapper around Local<> that enforces a check whether |
| * the Local<> is empty before it can be used. |
| * |
| * If an API method returns a MaybeLocal<>, the API method can potentially fail |
| * either because an exception is thrown, or because an exception is pending, |
| * e.g. because a previous API call threw an exception that hasn't been caught |
| * yet, or because a TerminateExecution exception was thrown. In that case, an |
| * empty MaybeLocal is returned. |
| */ |
| template <class T> |
| class MaybeLocal { |
| public: |
| V8_INLINE MaybeLocal() : val_(nullptr) {} |
| template <class S> |
| V8_INLINE MaybeLocal(Local<S> that) |
| : val_(reinterpret_cast<T*>(*that)) { |
| TYPE_CHECK(T, S); |
| } |
| |
| V8_INLINE bool IsEmpty() const { return val_ == nullptr; } |
| |
| template <class S> |
| V8_WARN_UNUSED_RESULT V8_INLINE bool ToLocal(Local<S>* out) const { |
| out->val_ = IsEmpty() ? nullptr : this->val_; |
| return !IsEmpty(); |
| } |
| |
| // Will crash if the MaybeLocal<> is empty. |
| V8_INLINE Local<T> ToLocalChecked(); |
| |
| template <class S> |
| V8_INLINE Local<S> FromMaybe(Local<S> default_value) const { |
| return IsEmpty() ? default_value : Local<S>(val_); |
| } |
| |
| private: |
| T* val_; |
| }; |
| |
| |
| // Eternal handles are set-once handles that live for the life of the isolate. |
| template <class T> class Eternal { |
| public: |
| V8_INLINE Eternal() : index_(kInitialValue) { } |
| template<class S> |
| V8_INLINE Eternal(Isolate* isolate, Local<S> handle) : index_(kInitialValue) { |
| Set(isolate, handle); |
| } |
| // Can only be safely called if already set. |
| V8_INLINE Local<T> Get(Isolate* isolate); |
| V8_INLINE bool IsEmpty() { return index_ == kInitialValue; } |
| template<class S> V8_INLINE void Set(Isolate* isolate, Local<S> handle); |
| |
| private: |
| static const int kInitialValue = -1; |
| int index_; |
| }; |
| |
| |
| static const int kInternalFieldsInWeakCallback = 2; |
| |
| |
| template <typename T> |
| class WeakCallbackInfo { |
| public: |
| typedef void (*Callback)(const WeakCallbackInfo<T>& data); |
| |
| WeakCallbackInfo(Isolate* isolate, T* parameter, |
| void* internal_fields[kInternalFieldsInWeakCallback], |
| Callback* callback) |
| : isolate_(isolate), parameter_(parameter), callback_(callback) { |
| for (int i = 0; i < kInternalFieldsInWeakCallback; ++i) { |
| internal_fields_[i] = internal_fields[i]; |
| } |
| } |
| |
| V8_INLINE Isolate* GetIsolate() const { return isolate_; } |
| V8_INLINE T* GetParameter() const { return parameter_; } |
| V8_INLINE void* GetInternalField(int index) const; |
| |
| V8_INLINE V8_DEPRECATE_SOON("use indexed version", |
| void* GetInternalField1() const) { |
| return internal_fields_[0]; |
| } |
| V8_INLINE V8_DEPRECATE_SOON("use indexed version", |
| void* GetInternalField2() const) { |
| return internal_fields_[1]; |
| } |
| |
| bool IsFirstPass() const { return callback_ != nullptr; } |
| |
| // When first called, the embedder MUST Reset() the Global which triggered the |
| // callback. The Global itself is unusable for anything else. No v8 other api |
| // calls may be called in the first callback. Should additional work be |
| // required, the embedder must set a second pass callback, which will be |
| // called after all the initial callbacks are processed. |
| // Calling SetSecondPassCallback on the second pass will immediately crash. |
| void SetSecondPassCallback(Callback callback) const { *callback_ = callback; } |
| |
| private: |
| Isolate* isolate_; |
| T* parameter_; |
| Callback* callback_; |
| void* internal_fields_[kInternalFieldsInWeakCallback]; |
| }; |
| |
| |
| template <class T, class P> |
| class WeakCallbackData { |
| public: |
| typedef void (*Callback)(const WeakCallbackData<T, P>& data); |
| |
| WeakCallbackData(Isolate* isolate, P* parameter, Local<T> handle) |
| : isolate_(isolate), parameter_(parameter), handle_(handle) {} |
| |
| V8_INLINE Isolate* GetIsolate() const { return isolate_; } |
| V8_INLINE P* GetParameter() const { return parameter_; } |
| V8_INLINE Local<T> GetValue() const { return handle_; } |
| |
| private: |
| Isolate* isolate_; |
| P* parameter_; |
| Local<T> handle_; |
| }; |
| |
| |
| // TODO(dcarney): delete this with WeakCallbackData |
| template <class T> |
| using PhantomCallbackData = WeakCallbackInfo<T>; |
| |
| |
| enum class WeakCallbackType { kParameter, kInternalFields }; |
| |
| |
| /** |
| * An object reference that is independent of any handle scope. Where |
| * a Local handle only lives as long as the HandleScope in which it was |
| * allocated, a PersistentBase handle remains valid until it is explicitly |
| * disposed. |
| * |
| * A persistent handle contains a reference to a storage cell within |
| * the v8 engine which holds an object value and which is updated by |
| * the garbage collector whenever the object is moved. A new storage |
| * cell can be created using the constructor or PersistentBase::Reset and |
| * existing handles can be disposed using PersistentBase::Reset. |
| * |
| */ |
| template <class T> class PersistentBase { |
| public: |
| /** |
| * If non-empty, destroy the underlying storage cell |
| * IsEmpty() will return true after this call. |
| */ |
| V8_INLINE void Reset(); |
| /** |
| * If non-empty, destroy the underlying storage cell |
| * and create a new one with the contents of other if other is non empty |
| */ |
| template <class S> |
| V8_INLINE void Reset(Isolate* isolate, const Local<S>& other); |
| |
| /** |
| * If non-empty, destroy the underlying storage cell |
| * and create a new one with the contents of other if other is non empty |
| */ |
| template <class S> |
| V8_INLINE void Reset(Isolate* isolate, const PersistentBase<S>& other); |
| |
| V8_INLINE bool IsEmpty() const { return val_ == NULL; } |
| V8_INLINE void Empty() { val_ = 0; } |
| |
| V8_INLINE Local<T> Get(Isolate* isolate) const { |
| return Local<T>::New(isolate, *this); |
| } |
| |
| template <class S> |
| V8_INLINE bool operator==(const PersistentBase<S>& that) const { |
| internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); |
| internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); |
| if (a == NULL) return b == NULL; |
| if (b == NULL) return false; |
| return *a == *b; |
| } |
| |
| template <class S> |
| V8_INLINE bool operator==(const Local<S>& that) const { |
| internal::Object** a = reinterpret_cast<internal::Object**>(this->val_); |
| internal::Object** b = reinterpret_cast<internal::Object**>(that.val_); |
| if (a == NULL) return b == NULL; |
| if (b == NULL) return false; |
| return *a == *b; |
| } |
| |
| template <class S> |
| V8_INLINE bool operator!=(const PersistentBase<S>& that) const { |
| return !operator==(that); |
| } |
| |
| template <class S> |
| V8_INLINE bool operator!=(const Local<S>& that) const { |
| return !operator==(that); |
| } |
| |
| /** |
| * Install a finalization callback on this object. |
| * NOTE: There is no guarantee as to *when* or even *if* the callback is |
| * invoked. The invocation is performed solely on a best effort basis. |
| * As always, GC-based finalization should *not* be relied upon for any |
| * critical form of resource management! |
| */ |
| template <typename P> |
| V8_INLINE V8_DEPRECATE_SOON( |
| "use WeakCallbackInfo version", |
| void SetWeak(P* parameter, |
| typename WeakCallbackData<T, P>::Callback callback)); |
| |
| template <typename S, typename P> |
| V8_INLINE V8_DEPRECATE_SOON( |
| "use WeakCallbackInfo version", |
| void SetWeak(P* parameter, |
| typename WeakCallbackData<S, P>::Callback callback)); |
| |
| // Phantom persistents work like weak persistents, except that the pointer to |
| // the object being collected is not available in the finalization callback. |
| // This enables the garbage collector to collect the object and any objects |
| // it references transitively in one GC cycle. At the moment you can either |
| // specify a parameter for the callback or the location of two internal |
| // fields in the dying object. |
| template <typename P> |
| V8_INLINE V8_DEPRECATE_SOON( |
| "use SetWeak", |
| void SetPhantom(P* parameter, |
| typename WeakCallbackInfo<P>::Callback callback, |
| int internal_field_index1 = -1, |
| int internal_field_index2 = -1)); |
| |
| template <typename P> |
| V8_INLINE void SetWeak(P* parameter, |
| typename WeakCallbackInfo<P>::Callback callback, |
| WeakCallbackType type); |
| |
| template<typename P> |
| V8_INLINE P* ClearWeak(); |
| |
| // TODO(dcarney): remove this. |
| V8_INLINE void ClearWeak() { ClearWeak<void>(); } |
| |
| /** |
| * Marks the reference to this object independent. Garbage collector is free |
| * to ignore any object groups containing this object. Weak callback for an |
| * independent handle should not assume that it will be preceded by a global |
| * GC prologue callback or followed by a global GC epilogue callback. |
| */ |
| V8_INLINE void MarkIndependent(); |
| |
| /** |
| * Marks the reference to this object partially dependent. Partially dependent |
| * handles only depend on other partially dependent handles and these |
| * dependencies are provided through object groups. It provides a way to build |
| * smaller object groups for young objects that represent only a subset of all |
| * external dependencies. This mark is automatically cleared after each |
| * garbage collection. |
| */ |
| V8_INLINE void MarkPartiallyDependent(); |
| |
| /** |
| * Marks the reference to this object as active. The scavenge garbage |
| * collection should not reclaim the objects marked as active. |
| * This bit is cleared after the each garbage collection pass. |
| */ |
| V8_INLINE void MarkActive(); |
| |
| V8_INLINE bool IsIndependent() const; |
| |
| /** Checks if the handle holds the only reference to an object. */ |
| V8_INLINE bool IsNearDeath() const; |
| |
| /** Returns true if the handle's reference is weak. */ |
| V8_INLINE bool IsWeak() const; |
| |
| /** |
| * Assigns a wrapper class ID to the handle. See RetainedObjectInfo interface |
| * description in v8-profiler.h for details. |
| */ |
| V8_INLINE void SetWrapperClassId(uint16_t class_id); |
| |
| /** |
| * Returns the class ID previously assigned to this handle or 0 if no class ID |
| * was previously assigned. |
| */ |
| V8_INLINE uint16_t WrapperClassId() const; |
| |
| private: |
| friend class Isolate; |
| friend class Utils; |
| template<class F> friend class Local; |
| template<class F1, class F2> friend class Persistent; |
| template <class F> |
| friend class Global; |
| template<class F> friend class PersistentBase; |
| template<class F> friend class ReturnValue; |
| template <class F1, class F2, class F3> |
| friend class PersistentValueMapBase; |
| template<class F1, class F2> friend class PersistentValueVector; |
| friend class Object; |
| |
| explicit V8_INLINE PersistentBase(T* val) : val_(val) {} |
| PersistentBase(const PersistentBase& other) = delete; // NOLINT |
| void operator=(const PersistentBase&) = delete; |
| V8_INLINE static T* New(Isolate* isolate, T* that); |
| |
| T* val_; |
| }; |
| |
| |
| /** |
| * Default traits for Persistent. This class does not allow |
| * use of the copy constructor or assignment operator. |
| * At present kResetInDestructor is not set, but that will change in a future |
| * version. |
| */ |
| template<class T> |
| class NonCopyablePersistentTraits { |
| public: |
| typedef Persistent<T, NonCopyablePersistentTraits<T> > NonCopyablePersistent; |
| static const bool kResetInDestructor = false; |
| template<class S, class M> |
| V8_INLINE static void Copy(const Persistent<S, M>& source, |
| NonCopyablePersistent* dest) { |
| Uncompilable<Object>(); |
| } |
| // TODO(dcarney): come up with a good compile error here. |
| template<class O> V8_INLINE static void Uncompilable() { |
| TYPE_CHECK(O, Primitive); |
| } |
| }; |
| |
| |
| /** |
| * Helper class traits to allow copying and assignment of Persistent. |
| * This will clone the contents of storage cell, but not any of the flags, etc. |
| */ |
| template<class T> |
| struct CopyablePersistentTraits { |
| typedef Persistent<T, CopyablePersistentTraits<T> > CopyablePersistent; |
| static const bool kResetInDestructor = true; |
| template<class S, class M> |
| static V8_INLINE void Copy(const Persistent<S, M>& source, |
| CopyablePersistent* dest) { |
| // do nothing, just allow copy |
| } |
| }; |
| |
| |
| /** |
| * A PersistentBase which allows copy and assignment. |
| * |
| * Copy, assignment and destructor bevavior is controlled by the traits |
| * class M. |
| * |
| * Note: Persistent class hierarchy is subject to future changes. |
| */ |
| template <class T, class M> class Persistent : public PersistentBase<T> { |
| public: |
| /** |
| * A Persistent with no storage cell. |
| */ |
| V8_INLINE Persistent() : PersistentBase<T>(0) { } |
| /** |
| * Construct a Persistent from a Local. |
| * When the Local is non-empty, a new storage cell is created |
| * pointing to the same object, and no flags are set. |
| */ |
| template <class S> |
| V8_INLINE Persistent(Isolate* isolate, Local<S> that) |
| : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { |
| TYPE_CHECK(T, S); |
| } |
| /** |
| * Construct a Persistent from a Persistent. |
| * When the Persistent is non-empty, a new storage cell is created |
| * pointing to the same object, and no flags are set. |
| */ |
| template <class S, class M2> |
| V8_INLINE Persistent(Isolate* isolate, const Persistent<S, M2>& that) |
| : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { |
| TYPE_CHECK(T, S); |
| } |
| /** |
| * The copy constructors and assignment operator create a Persistent |
| * exactly as the Persistent constructor, but the Copy function from the |
| * traits class is called, allowing the setting of flags based on the |
| * copied Persistent. |
| */ |
| V8_INLINE Persistent(const Persistent& that) : PersistentBase<T>(0) { |
| Copy(that); |
| } |
| template <class S, class M2> |
| V8_INLINE Persistent(const Persistent<S, M2>& that) : PersistentBase<T>(0) { |
| Copy(that); |
| } |
| V8_INLINE Persistent& operator=(const Persistent& that) { // NOLINT |
| Copy(that); |
| return *this; |
| } |
| template <class S, class M2> |
| V8_INLINE Persistent& operator=(const Persistent<S, M2>& that) { // NOLINT |
| Copy(that); |
| return *this; |
| } |
| /** |
| * The destructor will dispose the Persistent based on the |
| * kResetInDestructor flags in the traits class. Since not calling dispose |
| * can result in a memory leak, it is recommended to always set this flag. |
| */ |
| V8_INLINE ~Persistent() { |
| if (M::kResetInDestructor) this->Reset(); |
| } |
| |
| // TODO(dcarney): this is pretty useless, fix or remove |
| template <class S> |
| V8_INLINE static Persistent<T>& Cast(Persistent<S>& that) { // NOLINT |
| #ifdef V8_ENABLE_CHECKS |
| // If we're going to perform the type check then we have to check |
| // that the handle isn't empty before doing the checked cast. |
| if (!that.IsEmpty()) T::Cast(*that); |
| #endif |
| return reinterpret_cast<Persistent<T>&>(that); |
| } |
| |
| // TODO(dcarney): this is pretty useless, fix or remove |
| template <class S> V8_INLINE Persistent<S>& As() { // NOLINT |
| return Persistent<S>::Cast(*this); |
| } |
| |
| private: |
| friend class Isolate; |
| friend class Utils; |
| template<class F> friend class Local; |
| template<class F1, class F2> friend class Persistent; |
| template<class F> friend class ReturnValue; |
| |
| template <class S> V8_INLINE Persistent(S* that) : PersistentBase<T>(that) { } |
| V8_INLINE T* operator*() const { return this->val_; } |
| template<class S, class M2> |
| V8_INLINE void Copy(const Persistent<S, M2>& that); |
| }; |
| |
| |
| /** |
| * A PersistentBase which has move semantics. |
| * |
| * Note: Persistent class hierarchy is subject to future changes. |
| */ |
| template <class T> |
| class Global : public PersistentBase<T> { |
| public: |
| /** |
| * A Global with no storage cell. |
| */ |
| V8_INLINE Global() : PersistentBase<T>(nullptr) {} |
| /** |
| * Construct a Global from a Local. |
| * When the Local is non-empty, a new storage cell is created |
| * pointing to the same object, and no flags are set. |
| */ |
| template <class S> |
| V8_INLINE Global(Isolate* isolate, Local<S> that) |
| : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) { |
| TYPE_CHECK(T, S); |
| } |
| /** |
| * Construct a Global from a PersistentBase. |
| * When the Persistent is non-empty, a new storage cell is created |
| * pointing to the same object, and no flags are set. |
| */ |
| template <class S> |
| V8_INLINE Global(Isolate* isolate, const PersistentBase<S>& that) |
| : PersistentBase<T>(PersistentBase<T>::New(isolate, that.val_)) { |
| TYPE_CHECK(T, S); |
| } |
| /** |
| * Move constructor. |
| */ |
| V8_INLINE Global(Global&& other) : PersistentBase<T>(other.val_) { // NOLINT |
| other.val_ = nullptr; |
| } |
| V8_INLINE ~Global() { this->Reset(); } |
| /** |
| * Move via assignment. |
| */ |
| template <class S> |
| V8_INLINE Global& operator=(Global<S>&& rhs) { // NOLINT |
| TYPE_CHECK(T, S); |
| if (this != &rhs) { |
| this->Reset(); |
| this->val_ = rhs.val_; |
| rhs.val_ = nullptr; |
| } |
| return *this; |
| } |
| /** |
| * Pass allows returning uniques from functions, etc. |
| */ |
| Global Pass() { return static_cast<Global&&>(*this); } // NOLINT |
| |
| /* |
| * For compatibility with Chromium's base::Bind (base::Passed). |
| */ |
| typedef void MoveOnlyTypeForCPP03; |
| |
| private: |
| template <class F> |
| friend class ReturnValue; |
| Global(const Global&) = delete; |
| void operator=(const Global&) = delete; |
| V8_INLINE T* operator*() const { return this->val_; } |
| }; |
| |
| |
| // UniquePersistent is an alias for Global for historical reason. |
| template <class T> |
| using UniquePersistent = Global<T>; |
| |
| |
| /** |
| * A stack-allocated class that governs a number of local handles. |
| * After a handle scope has been created, all local handles will be |
| * allocated within that handle scope until either the handle scope is |
| * deleted or another handle scope is created. If there is already a |
| * handle scope and a new one is created, all allocations will take |
| * place in the new handle scope until it is deleted. After that, |
| * new handles will again be allocated in the original handle scope. |
| * |
| * After the handle scope of a local handle has been deleted the |
| * garbage collector will no longer track the object stored in the |
| * handle and may deallocate it. The behavior of accessing a handle |
| * for which the handle scope has been deleted is undefined. |
| */ |
| class V8_EXPORT HandleScope { |
| public: |
| HandleScope(Isolate* isolate); |
| |
| ~HandleScope(); |
| |
| /** |
| * Counts the number of allocated handles. |
| */ |
| static int NumberOfHandles(Isolate* isolate); |
| |
| V8_INLINE Isolate* GetIsolate() const { |
| return reinterpret_cast<Isolate*>(isolate_); |
| } |
| |
| protected: |
| V8_INLINE HandleScope() {} |
| |
| void Initialize(Isolate* isolate); |
| |
| static internal::Object** CreateHandle(internal::Isolate* isolate, |
| internal::Object* value); |
| |
| private: |
| // Uses heap_object to obtain the current Isolate. |
| static internal::Object** CreateHandle(internal::HeapObject* heap_object, |
| internal::Object* value); |
| |
| // Make it hard to create heap-allocated or illegal handle scopes by |
| // disallowing certain operations. |
| HandleScope(const HandleScope&); |
| void operator=(const HandleScope&); |
| void* operator new(size_t size); |
| void operator delete(void*, size_t); |
| |
| internal::Isolate* isolate_; |
| internal::Object** prev_next_; |
| internal::Object** prev_limit_; |
| |
| // Local::New uses CreateHandle with an Isolate* parameter. |
| template<class F> friend class Local; |
| |
| // Object::GetInternalField and Context::GetEmbedderData use CreateHandle with |
| // a HeapObject* in their shortcuts. |
| friend class Object; |
| friend class Context; |
| }; |
| |
| |
| /** |
| * A HandleScope which first allocates a handle in the current scope |
| * which will be later filled with the escape value. |
| */ |
| class V8_EXPORT EscapableHandleScope : public HandleScope { |
| public: |
| EscapableHandleScope(Isolate* isolate); |
| V8_INLINE ~EscapableHandleScope() {} |
| |
| /** |
| * Pushes the value into the previous scope and returns a handle to it. |
| * Cannot be called twice. |
| */ |
| template <class T> |
| V8_INLINE Local<T> Escape(Local<T> value) { |
| internal::Object** slot = |
| Escape(reinterpret_cast<internal::Object**>(*value)); |
| return Local<T>(reinterpret_cast<T*>(slot)); |
| } |
| |
| private: |
| internal::Object** Escape(internal::Object** escape_value); |
| |
| // Make it hard to create heap-allocated or illegal handle scopes by |
| // disallowing certain operations. |
| EscapableHandleScope(const EscapableHandleScope&); |
| void operator=(const EscapableHandleScope&); |
| void* operator new(size_t size); |
| void operator delete(void*, size_t); |
| |
| internal::Object** escape_slot_; |
| }; |
| |
| class V8_EXPORT SealHandleScope { |
| public: |
| SealHandleScope(Isolate* isolate); |
| ~SealHandleScope(); |
| |
| private: |
| // Make it hard to create heap-allocated or illegal handle scopes by |
| // disallowing certain operations. |
| SealHandleScope(const SealHandleScope&); |
| void operator=(const SealHandleScope&); |
| void* operator new(size_t size); |
| void operator delete(void*, size_t); |
| |
| internal::Isolate* isolate_; |
| internal::Object** prev_limit_; |
| int prev_sealed_level_; |
| }; |
| |
| |
| // --- Special objects --- |
| |
| |
| /** |
| * The superclass of values and API object templates. |
| */ |
| class V8_EXPORT Data { |
| private: |
| Data(); |
| }; |
| |
| |
| /** |
| * The optional attributes of ScriptOrigin. |
| */ |
| class ScriptOriginOptions { |
| public: |
| V8_INLINE ScriptOriginOptions(bool is_embedder_debug_script = false, |
| bool is_shared_cross_origin = false, |
| bool is_opaque = false) |
| : flags_((is_embedder_debug_script ? kIsEmbedderDebugScript : 0) | |
| (is_shared_cross_origin ? kIsSharedCrossOrigin : 0) | |
| (is_opaque ? kIsOpaque : 0)) {} |
| V8_INLINE ScriptOriginOptions(int flags) |
| : flags_(flags & |
| (kIsEmbedderDebugScript | kIsSharedCrossOrigin | kIsOpaque)) {} |
| bool IsEmbedderDebugScript() const { |
| return (flags_ & kIsEmbedderDebugScript) != 0; |
| } |
| bool IsSharedCrossOrigin() const { |
| return (flags_ & kIsSharedCrossOrigin) != 0; |
| } |
| bool IsOpaque() const { return (flags_ & kIsOpaque) != 0; } |
| int Flags() const { return flags_; } |
| |
| private: |
| enum { |
| kIsEmbedderDebugScript = 1, |
| kIsSharedCrossOrigin = 1 << 1, |
| kIsOpaque = 1 << 2 |
| }; |
| const int flags_; |
| }; |
| |
| /** |
| * The origin, within a file, of a script. |
| */ |
| class ScriptOrigin { |
| public: |
| V8_INLINE ScriptOrigin( |
| Local<Value> resource_name, |
| Local<Integer> resource_line_offset = Local<Integer>(), |
| Local<Integer> resource_column_offset = Local<Integer>(), |
| Local<Boolean> resource_is_shared_cross_origin = Local<Boolean>(), |
| Local<Integer> script_id = Local<Integer>(), |
| Local<Boolean> resource_is_embedder_debug_script = Local<Boolean>(), |
| Local<Value> source_map_url = Local<Value>(), |
| Local<Boolean> resource_is_opaque = Local<Boolean>()); |
| V8_INLINE Local<Value> ResourceName() const; |
| V8_INLINE Local<Integer> ResourceLineOffset() const; |
| V8_INLINE Local<Integer> ResourceColumnOffset() const; |
| /** |
| * Returns true for embedder's debugger scripts |
| */ |
| V8_INLINE Local<Integer> ScriptID() const; |
| V8_INLINE Local<Value> SourceMapUrl() const; |
| V8_INLINE ScriptOriginOptions Options() const { return options_; } |
| |
| private: |
| Local<Value> resource_name_; |
| Local<Integer> resource_line_offset_; |
| Local<Integer> resource_column_offset_; |
| ScriptOriginOptions options_; |
| Local<Integer> script_id_; |
| Local<Value> source_map_url_; |
| }; |
| |
| |
| /** |
| * A compiled JavaScript script, not yet tied to a Context. |
| */ |
| class V8_EXPORT UnboundScript { |
| public: |
| /** |
| * Binds the script to the currently entered context. |
| */ |
| Local<Script> BindToCurrentContext(); |
| |
| int GetId(); |
| Local<Value> GetScriptName(); |
| |
| /** |
| * Data read from magic sourceURL comments. |
| */ |
| Local<Value> GetSourceURL(); |
| /** |
| * Data read from magic sourceMappingURL comments. |
| */ |
| Local<Value> GetSourceMappingURL(); |
| |
| /** |
| * Returns zero based line number of the code_pos location in the script. |
| * -1 will be returned if no information available. |
| */ |
| int GetLineNumber(int code_pos); |
| |
| static const int kNoScriptId = 0; |
| }; |
| |
| |
| /** |
| * A compiled JavaScript script, tied to a Context which was active when the |
| * script was compiled. |
| */ |
| class V8_EXPORT Script { |
| public: |
| /** |
| * A shorthand for ScriptCompiler::Compile(). |
| */ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<Script> Compile(Local<String> source, |
| ScriptOrigin* origin = nullptr)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( |
| Local<Context> context, Local<String> source, |
| ScriptOrigin* origin = nullptr); |
| |
| static Local<Script> V8_DEPRECATE_SOON("Use maybe version", |
| Compile(Local<String> source, |
| Local<String> file_name)); |
| |
| /** |
| * Runs the script returning the resulting value. It will be run in the |
| * context in which it was created (ScriptCompiler::CompileBound or |
| * UnboundScript::BindToCurrentContext()). |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Value> Run()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Run(Local<Context> context); |
| |
| /** |
| * Returns the corresponding context-unbound script. |
| */ |
| Local<UnboundScript> GetUnboundScript(); |
| }; |
| |
| |
| /** |
| * For compiling scripts. |
| */ |
| class V8_EXPORT ScriptCompiler { |
| public: |
| /** |
| * Compilation data that the embedder can cache and pass back to speed up |
| * future compilations. The data is produced if the CompilerOptions passed to |
| * the compilation functions in ScriptCompiler contains produce_data_to_cache |
| * = true. The data to cache can then can be retrieved from |
| * UnboundScript. |
| */ |
| struct V8_EXPORT CachedData { |
| enum BufferPolicy { |
| BufferNotOwned, |
| BufferOwned |
| }; |
| |
| CachedData() |
| : data(NULL), |
| length(0), |
| rejected(false), |
| buffer_policy(BufferNotOwned) {} |
| |
| // If buffer_policy is BufferNotOwned, the caller keeps the ownership of |
| // data and guarantees that it stays alive until the CachedData object is |
| // destroyed. If the policy is BufferOwned, the given data will be deleted |
| // (with delete[]) when the CachedData object is destroyed. |
| CachedData(const uint8_t* data, int length, |
| BufferPolicy buffer_policy = BufferNotOwned); |
| ~CachedData(); |
| // TODO(marja): Async compilation; add constructors which take a callback |
| // which will be called when V8 no longer needs the data. |
| const uint8_t* data; |
| int length; |
| bool rejected; |
| BufferPolicy buffer_policy; |
| |
| private: |
| // Prevent copying. Not implemented. |
| CachedData(const CachedData&); |
| CachedData& operator=(const CachedData&); |
| }; |
| |
| /** |
| * Source code which can be then compiled to a UnboundScript or Script. |
| */ |
| class Source { |
| public: |
| // Source takes ownership of CachedData. |
| V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin, |
| CachedData* cached_data = NULL); |
| V8_INLINE Source(Local<String> source_string, |
| CachedData* cached_data = NULL); |
| V8_INLINE ~Source(); |
| |
| // Ownership of the CachedData or its buffers is *not* transferred to the |
| // caller. The CachedData object is alive as long as the Source object is |
| // alive. |
| V8_INLINE const CachedData* GetCachedData() const; |
| |
| private: |
| friend class ScriptCompiler; |
| // Prevent copying. Not implemented. |
| Source(const Source&); |
| Source& operator=(const Source&); |
| |
| Local<String> source_string; |
| |
| // Origin information |
| Local<Value> resource_name; |
| Local<Integer> resource_line_offset; |
| Local<Integer> resource_column_offset; |
| ScriptOriginOptions resource_options; |
| Local<Value> source_map_url; |
| |
| // Cached data from previous compilation (if a kConsume*Cache flag is |
| // set), or hold newly generated cache data (kProduce*Cache flags) are |
| // set when calling a compile method. |
| CachedData* cached_data; |
| }; |
| |
| /** |
| * For streaming incomplete script data to V8. The embedder should implement a |
| * subclass of this class. |
| */ |
| class V8_EXPORT ExternalSourceStream { |
| public: |
| virtual ~ExternalSourceStream() {} |
| |
| /** |
| * V8 calls this to request the next chunk of data from the embedder. This |
| * function will be called on a background thread, so it's OK to block and |
| * wait for the data, if the embedder doesn't have data yet. Returns the |
| * length of the data returned. When the data ends, GetMoreData should |
| * return 0. Caller takes ownership of the data. |
| * |
| * When streaming UTF-8 data, V8 handles multi-byte characters split between |
| * two data chunks, but doesn't handle multi-byte characters split between |
| * more than two data chunks. The embedder can avoid this problem by always |
| * returning at least 2 bytes of data. |
| * |
| * If the embedder wants to cancel the streaming, they should make the next |
| * GetMoreData call return 0. V8 will interpret it as end of data (and most |
| * probably, parsing will fail). The streaming task will return as soon as |
| * V8 has parsed the data it received so far. |
| */ |
| virtual size_t GetMoreData(const uint8_t** src) = 0; |
| |
| /** |
| * V8 calls this method to set a 'bookmark' at the current position in |
| * the source stream, for the purpose of (maybe) later calling |
| * ResetToBookmark. If ResetToBookmark is called later, then subsequent |
| * calls to GetMoreData should return the same data as they did when |
| * SetBookmark was called earlier. |
| * |
| * The embedder may return 'false' to indicate it cannot provide this |
| * functionality. |
| */ |
| virtual bool SetBookmark(); |
| |
| /** |
| * V8 calls this to return to a previously set bookmark. |
| */ |
| virtual void ResetToBookmark(); |
| }; |
| |
| |
| /** |
| * Source code which can be streamed into V8 in pieces. It will be parsed |
| * while streaming. It can be compiled after the streaming is complete. |
| * StreamedSource must be kept alive while the streaming task is ran (see |
| * ScriptStreamingTask below). |
| */ |
| class V8_EXPORT StreamedSource { |
| public: |
| enum Encoding { ONE_BYTE, TWO_BYTE, UTF8 }; |
| |
| StreamedSource(ExternalSourceStream* source_stream, Encoding encoding); |
| ~StreamedSource(); |
| |
| // Ownership of the CachedData or its buffers is *not* transferred to the |
| // caller. The CachedData object is alive as long as the StreamedSource |
| // object is alive. |
| const CachedData* GetCachedData() const; |
| |
| internal::StreamedSource* impl() const { return impl_; } |
| |
| private: |
| // Prevent copying. Not implemented. |
| StreamedSource(const StreamedSource&); |
| StreamedSource& operator=(const StreamedSource&); |
| |
| internal::StreamedSource* impl_; |
| }; |
| |
| /** |
| * A streaming task which the embedder must run on a background thread to |
| * stream scripts into V8. Returned by ScriptCompiler::StartStreamingScript. |
| */ |
| class ScriptStreamingTask { |
| public: |
| virtual ~ScriptStreamingTask() {} |
| virtual void Run() = 0; |
| }; |
| |
| enum CompileOptions { |
| kNoCompileOptions = 0, |
| kProduceParserCache, |
| kConsumeParserCache, |
| kProduceCodeCache, |
| kConsumeCodeCache |
| }; |
| |
| /** |
| * Compiles the specified script (context-independent). |
| * Cached data as part of the source object can be optionally produced to be |
| * consumed later to speed up compilation of identical source scripts. |
| * |
| * Note that when producing cached data, the source must point to NULL for |
| * cached data. When consuming cached data, the cached data must have been |
| * produced by the same version of V8. |
| * |
| * \param source Script source code. |
| * \return Compiled script object (context independent; for running it must be |
| * bound to a context). |
| */ |
| static V8_DEPRECATE_SOON("Use maybe version", |
| Local<UnboundScript> CompileUnbound( |
| Isolate* isolate, Source* source, |
| CompileOptions options = kNoCompileOptions)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundScript( |
| Isolate* isolate, Source* source, |
| CompileOptions options = kNoCompileOptions); |
| |
| /** |
| * Compiles the specified script (bound to current context). |
| * |
| * \param source Script source code. |
| * \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile() |
| * using pre_data speeds compilation if it's done multiple times. |
| * Owned by caller, no references are kept when this function returns. |
| * \return Compiled script object, bound to the context that was active |
| * when this function was called. When run it will always use this |
| * context. |
| */ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<Script> Compile(Isolate* isolate, Source* source, |
| CompileOptions options = kNoCompileOptions)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( |
| Local<Context> context, Source* source, |
| CompileOptions options = kNoCompileOptions); |
| |
| /** |
| * Returns a task which streams script data into V8, or NULL if the script |
| * cannot be streamed. The user is responsible for running the task on a |
| * background thread and deleting it. When ran, the task starts parsing the |
| * script, and it will request data from the StreamedSource as needed. When |
| * ScriptStreamingTask::Run exits, all data has been streamed and the script |
| * can be compiled (see Compile below). |
| * |
| * This API allows to start the streaming with as little data as possible, and |
| * the remaining data (for example, the ScriptOrigin) is passed to Compile. |
| */ |
| static ScriptStreamingTask* StartStreamingScript( |
| Isolate* isolate, StreamedSource* source, |
| CompileOptions options = kNoCompileOptions); |
| |
| /** |
| * Compiles a streamed script (bound to current context). |
| * |
| * This can only be called after the streaming has finished |
| * (ScriptStreamingTask has been run). V8 doesn't construct the source string |
| * during streaming, so the embedder needs to pass the full source here. |
| */ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<Script> Compile(Isolate* isolate, StreamedSource* source, |
| Local<String> full_source_string, |
| const ScriptOrigin& origin)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile( |
| Local<Context> context, StreamedSource* source, |
| Local<String> full_source_string, const ScriptOrigin& origin); |
| |
| /** |
| * Return a version tag for CachedData for the current V8 version & flags. |
| * |
| * This value is meant only for determining whether a previously generated |
| * CachedData instance is still valid; the tag has no other meaing. |
| * |
| * Background: The data carried by CachedData may depend on the exact |
| * V8 version number or currently compiler flags. This means when |
| * persisting CachedData, the embedder must take care to not pass in |
| * data from another V8 version, or the same version with different |
| * features enabled. |
| * |
| * The easiest way to do so is to clear the embedder's cache on any |
| * such change. |
| * |
| * Alternatively, this tag can be stored alongside the cached data and |
| * compared when it is being used. |
| */ |
| static uint32_t CachedDataVersionTag(); |
| |
| /** |
| * Compile an ES6 module. |
| * |
| * This is an unfinished experimental feature, and is only exposed |
| * here for internal testing purposes. |
| * Only parsing works at the moment. Do not use. |
| * |
| * TODO(adamk): Script is likely the wrong return value for this; |
| * should return some new Module type. |
| */ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Script> CompileModule( |
| Local<Context> context, Source* source, |
| CompileOptions options = kNoCompileOptions); |
| |
| /** |
| * Compile a function for a given context. This is equivalent to running |
| * |
| * with (obj) { |
| * return function(args) { ... } |
| * } |
| * |
| * It is possible to specify multiple context extensions (obj in the above |
| * example). |
| */ |
| static V8_DEPRECATE_SOON("Use maybe version", |
| Local<Function> CompileFunctionInContext( |
| Isolate* isolate, Source* source, |
| Local<Context> context, size_t arguments_count, |
| Local<String> arguments[], |
| size_t context_extension_count, |
| Local<Object> context_extensions[])); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Function> CompileFunctionInContext( |
| Local<Context> context, Source* source, size_t arguments_count, |
| Local<String> arguments[], size_t context_extension_count, |
| Local<Object> context_extensions[]); |
| |
| private: |
| static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal( |
| Isolate* isolate, Source* source, CompileOptions options, bool is_module); |
| }; |
| |
| |
| /** |
| * An error message. |
| */ |
| class V8_EXPORT Message { |
| public: |
| Local<String> Get() const; |
| |
| V8_DEPRECATE_SOON("Use maybe version", Local<String> GetSourceLine() const); |
| V8_WARN_UNUSED_RESULT MaybeLocal<String> GetSourceLine( |
| Local<Context> context) const; |
| |
| /** |
| * Returns the origin for the script from where the function causing the |
| * error originates. |
| */ |
| ScriptOrigin GetScriptOrigin() const; |
| |
| /** |
| * Returns the resource name for the script from where the function causing |
| * the error originates. |
| */ |
| Local<Value> GetScriptResourceName() const; |
| |
| /** |
| * Exception stack trace. By default stack traces are not captured for |
| * uncaught exceptions. SetCaptureStackTraceForUncaughtExceptions allows |
| * to change this option. |
| */ |
| Local<StackTrace> GetStackTrace() const; |
| |
| /** |
| * Returns the number, 1-based, of the line where the error occurred. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", int GetLineNumber() const); |
| V8_WARN_UNUSED_RESULT Maybe<int> GetLineNumber(Local<Context> context) const; |
| |
| /** |
| * Returns the index within the script of the first character where |
| * the error occurred. |
| */ |
| int GetStartPosition() const; |
| |
| /** |
| * Returns the index within the script of the last character where |
| * the error occurred. |
| */ |
| int GetEndPosition() const; |
| |
| /** |
| * Returns the index within the line of the first character where |
| * the error occurred. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", int GetStartColumn() const); |
| V8_WARN_UNUSED_RESULT Maybe<int> GetStartColumn(Local<Context> context) const; |
| |
| /** |
| * Returns the index within the line of the last character where |
| * the error occurred. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", int GetEndColumn() const); |
| V8_WARN_UNUSED_RESULT Maybe<int> GetEndColumn(Local<Context> context) const; |
| |
| /** |
| * Passes on the value set by the embedder when it fed the script from which |
| * this Message was generated to V8. |
| */ |
| bool IsSharedCrossOrigin() const; |
| bool IsOpaque() const; |
| |
| // TODO(1245381): Print to a string instead of on a FILE. |
| static void PrintCurrentStackTrace(Isolate* isolate, FILE* out); |
| |
| static const int kNoLineNumberInfo = 0; |
| static const int kNoColumnInfo = 0; |
| static const int kNoScriptIdInfo = 0; |
| }; |
| |
| |
| /** |
| * Representation of a JavaScript stack trace. The information collected is a |
| * snapshot of the execution stack and the information remains valid after |
| * execution continues. |
| */ |
| class V8_EXPORT StackTrace { |
| public: |
| /** |
| * Flags that determine what information is placed captured for each |
| * StackFrame when grabbing the current stack trace. |
| */ |
| enum StackTraceOptions { |
| kLineNumber = 1, |
| kColumnOffset = 1 << 1 | kLineNumber, |
| kScriptName = 1 << 2, |
| kFunctionName = 1 << 3, |
| kIsEval = 1 << 4, |
| kIsConstructor = 1 << 5, |
| kScriptNameOrSourceURL = 1 << 6, |
| kScriptId = 1 << 7, |
| kExposeFramesAcrossSecurityOrigins = 1 << 8, |
| kOverview = kLineNumber | kColumnOffset | kScriptName | kFunctionName, |
| kDetailed = kOverview | kIsEval | kIsConstructor | kScriptNameOrSourceURL |
| }; |
| |
| /** |
| * Returns a StackFrame at a particular index. |
| */ |
| Local<StackFrame> GetFrame(uint32_t index) const; |
| |
| /** |
| * Returns the number of StackFrames. |
| */ |
| int GetFrameCount() const; |
| |
| /** |
| * Returns StackTrace as a v8::Array that contains StackFrame objects. |
| */ |
| Local<Array> AsArray(); |
| |
| /** |
| * Grab a snapshot of the current JavaScript execution stack. |
| * |
| * \param frame_limit The maximum number of stack frames we want to capture. |
| * \param options Enumerates the set of things we will capture for each |
| * StackFrame. |
| */ |
| static Local<StackTrace> CurrentStackTrace( |
| Isolate* isolate, |
| int frame_limit, |
| StackTraceOptions options = kOverview); |
| }; |
| |
| |
| /** |
| * A single JavaScript stack frame. |
| */ |
| class V8_EXPORT StackFrame { |
| public: |
| /** |
| * Returns the number, 1-based, of the line for the associate function call. |
| * This method will return Message::kNoLineNumberInfo if it is unable to |
| * retrieve the line number, or if kLineNumber was not passed as an option |
| * when capturing the StackTrace. |
| */ |
| int GetLineNumber() const; |
| |
| /** |
| * Returns the 1-based column offset on the line for the associated function |
| * call. |
| * This method will return Message::kNoColumnInfo if it is unable to retrieve |
| * the column number, or if kColumnOffset was not passed as an option when |
| * capturing the StackTrace. |
| */ |
| int GetColumn() const; |
| |
| /** |
| * Returns the id of the script for the function for this StackFrame. |
| * This method will return Message::kNoScriptIdInfo if it is unable to |
| * retrieve the script id, or if kScriptId was not passed as an option when |
| * capturing the StackTrace. |
| */ |
| int GetScriptId() const; |
| |
| /** |
| * Returns the name of the resource that contains the script for the |
| * function for this StackFrame. |
| */ |
| Local<String> GetScriptName() const; |
| |
| /** |
| * Returns the name of the resource that contains the script for the |
| * function for this StackFrame or sourceURL value if the script name |
| * is undefined and its source ends with //# sourceURL=... string or |
| * deprecated //@ sourceURL=... string. |
| */ |
| Local<String> GetScriptNameOrSourceURL() const; |
| |
| /** |
| * Returns the name of the function associated with this stack frame. |
| */ |
| Local<String> GetFunctionName() const; |
| |
| /** |
| * Returns whether or not the associated function is compiled via a call to |
| * eval(). |
| */ |
| bool IsEval() const; |
| |
| /** |
| * Returns whether or not the associated function is called as a |
| * constructor via "new". |
| */ |
| bool IsConstructor() const; |
| }; |
| |
| |
| // A StateTag represents a possible state of the VM. |
| enum StateTag { JS, GC, COMPILER, OTHER, EXTERNAL, IDLE }; |
| |
| |
| // A RegisterState represents the current state of registers used |
| // by the sampling profiler API. |
| struct RegisterState { |
| RegisterState() : pc(NULL), sp(NULL), fp(NULL) {} |
| void* pc; // Instruction pointer. |
| void* sp; // Stack pointer. |
| void* fp; // Frame pointer. |
| }; |
| |
| |
| // The output structure filled up by GetStackSample API function. |
| struct SampleInfo { |
| size_t frames_count; |
| StateTag vm_state; |
| }; |
| |
| |
| /** |
| * A JSON Parser. |
| */ |
| class V8_EXPORT JSON { |
| public: |
| /** |
| * Tries to parse the string |json_string| and returns it as value if |
| * successful. |
| * |
| * \param json_string The string to parse. |
| * \return The corresponding value if successfully parsed. |
| */ |
| static V8_DEPRECATE_SOON("Use maybe version", |
| Local<Value> Parse(Local<String> json_string)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Value> Parse( |
| Isolate* isolate, Local<String> json_string); |
| }; |
| |
| |
| /** |
| * A map whose keys are referenced weakly. It is similar to JavaScript WeakMap |
| * but can be created without entering a v8::Context and hence shouldn't |
| * escape to JavaScript. |
| */ |
| class V8_EXPORT NativeWeakMap : public Data { |
| public: |
| static Local<NativeWeakMap> New(Isolate* isolate); |
| void Set(Local<Value> key, Local<Value> value); |
| Local<Value> Get(Local<Value> key); |
| bool Has(Local<Value> key); |
| bool Delete(Local<Value> key); |
| }; |
| |
| |
| // --- Value --- |
| |
| |
| /** |
| * The superclass of all JavaScript values and objects. |
| */ |
| class V8_EXPORT Value : public Data { |
| public: |
| /** |
| * Returns true if this value is the undefined value. See ECMA-262 |
| * 4.3.10. |
| */ |
| V8_INLINE bool IsUndefined() const; |
| |
| /** |
| * Returns true if this value is the null value. See ECMA-262 |
| * 4.3.11. |
| */ |
| V8_INLINE bool IsNull() const; |
| |
| /** |
| * Returns true if this value is true. |
| */ |
| bool IsTrue() const; |
| |
| /** |
| * Returns true if this value is false. |
| */ |
| bool IsFalse() const; |
| |
| /** |
| * Returns true if this value is a symbol or a string. |
| * This is an experimental feature. |
| */ |
| bool IsName() const; |
| |
| /** |
| * Returns true if this value is an instance of the String type. |
| * See ECMA-262 8.4. |
| */ |
| V8_INLINE bool IsString() const; |
| |
| /** |
| * Returns true if this value is a symbol. |
| * This is an experimental feature. |
| */ |
| bool IsSymbol() const; |
| |
| /** |
| * Returns true if this value is a function. |
| */ |
| bool IsFunction() const; |
| |
| /** |
| * Returns true if this value is an array. |
| */ |
| bool IsArray() const; |
| |
| /** |
| * Returns true if this value is an object. |
| */ |
| bool IsObject() const; |
| |
| /** |
| * Returns true if this value is boolean. |
| */ |
| bool IsBoolean() const; |
| |
| /** |
| * Returns true if this value is a number. |
| */ |
| bool IsNumber() const; |
| |
| /** |
| * Returns true if this value is external. |
| */ |
| bool IsExternal() const; |
| |
| /** |
| * Returns true if this value is a 32-bit signed integer. |
| */ |
| bool IsInt32() const; |
| |
| /** |
| * Returns true if this value is a 32-bit unsigned integer. |
| */ |
| bool IsUint32() const; |
| |
| /** |
| * Returns true if this value is a Date. |
| */ |
| bool IsDate() const; |
| |
| /** |
| * Returns true if this value is an Arguments object. |
| */ |
| bool IsArgumentsObject() const; |
| |
| /** |
| * Returns true if this value is a Boolean object. |
| */ |
| bool IsBooleanObject() const; |
| |
| /** |
| * Returns true if this value is a Number object. |
| */ |
| bool IsNumberObject() const; |
| |
| /** |
| * Returns true if this value is a String object. |
| */ |
| bool IsStringObject() const; |
| |
| /** |
| * Returns true if this value is a Symbol object. |
| * This is an experimental feature. |
| */ |
| bool IsSymbolObject() const; |
| |
| /** |
| * Returns true if this value is a NativeError. |
| */ |
| bool IsNativeError() const; |
| |
| /** |
| * Returns true if this value is a RegExp. |
| */ |
| bool IsRegExp() const; |
| |
| /** |
| * Returns true if this value is a Generator function. |
| * This is an experimental feature. |
| */ |
| bool IsGeneratorFunction() const; |
| |
| /** |
| * Returns true if this value is a Generator object (iterator). |
| * This is an experimental feature. |
| */ |
| bool IsGeneratorObject() const; |
| |
| /** |
| * Returns true if this value is a Promise. |
| * This is an experimental feature. |
| */ |
| bool IsPromise() const; |
| |
| /** |
| * Returns true if this value is a Map. |
| */ |
| bool IsMap() const; |
| |
| /** |
| * Returns true if this value is a Set. |
| */ |
| bool IsSet() const; |
| |
| /** |
| * Returns true if this value is a Map Iterator. |
| */ |
| bool IsMapIterator() const; |
| |
| /** |
| * Returns true if this value is a Set Iterator. |
| */ |
| bool IsSetIterator() const; |
| |
| /** |
| * Returns true if this value is a WeakMap. |
| */ |
| bool IsWeakMap() const; |
| |
| /** |
| * Returns true if this value is a WeakSet. |
| */ |
| bool IsWeakSet() const; |
| |
| /** |
| * Returns true if this value is an ArrayBuffer. |
| * This is an experimental feature. |
| */ |
| bool IsArrayBuffer() const; |
| |
| /** |
| * Returns true if this value is an ArrayBufferView. |
| * This is an experimental feature. |
| */ |
| bool IsArrayBufferView() const; |
| |
| /** |
| * Returns true if this value is one of TypedArrays. |
| * This is an experimental feature. |
| */ |
| bool IsTypedArray() const; |
| |
| /** |
| * Returns true if this value is an Uint8Array. |
| * This is an experimental feature. |
| */ |
| bool IsUint8Array() const; |
| |
| /** |
| * Returns true if this value is an Uint8ClampedArray. |
| * This is an experimental feature. |
| */ |
| bool IsUint8ClampedArray() const; |
| |
| /** |
| * Returns true if this value is an Int8Array. |
| * This is an experimental feature. |
| */ |
| bool IsInt8Array() const; |
| |
| /** |
| * Returns true if this value is an Uint16Array. |
| * This is an experimental feature. |
| */ |
| bool IsUint16Array() const; |
| |
| /** |
| * Returns true if this value is an Int16Array. |
| * This is an experimental feature. |
| */ |
| bool IsInt16Array() const; |
| |
| /** |
| * Returns true if this value is an Uint32Array. |
| * This is an experimental feature. |
| */ |
| bool IsUint32Array() const; |
| |
| /** |
| * Returns true if this value is an Int32Array. |
| * This is an experimental feature. |
| */ |
| bool IsInt32Array() const; |
| |
| /** |
| * Returns true if this value is a Float32Array. |
| * This is an experimental feature. |
| */ |
| bool IsFloat32Array() const; |
| |
| /** |
| * Returns true if this value is a Float64Array. |
| * This is an experimental feature. |
| */ |
| bool IsFloat64Array() const; |
| |
| /** |
| * Returns true if this value is a SIMD Float32x4. |
| * This is an experimental feature. |
| */ |
| bool IsFloat32x4() const; |
| |
| /** |
| * Returns true if this value is a DataView. |
| * This is an experimental feature. |
| */ |
| bool IsDataView() const; |
| |
| /** |
| * Returns true if this value is a SharedArrayBuffer. |
| * This is an experimental feature. |
| */ |
| bool IsSharedArrayBuffer() const; |
| |
| |
| V8_WARN_UNUSED_RESULT MaybeLocal<Boolean> ToBoolean( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Number> ToNumber( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<String> ToString( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<String> ToDetailString( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> ToObject( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Integer> ToInteger( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToUint32( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT MaybeLocal<Int32> ToInt32(Local<Context> context) const; |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Boolean> ToBoolean(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Number> ToNumber(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<String> ToString(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<String> ToDetailString(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Object> ToObject(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Integer> ToInteger(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Uint32> ToUint32(Isolate* isolate) const); |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Int32> ToInt32(Isolate* isolate) const); |
| |
| inline V8_DEPRECATE_SOON("Use maybe version", |
| Local<Boolean> ToBoolean() const); |
| inline V8_DEPRECATE_SOON("Use maybe version", Local<Number> ToNumber() const); |
| inline V8_DEPRECATE_SOON("Use maybe version", Local<String> ToString() const); |
| inline V8_DEPRECATE_SOON("Use maybe version", |
| Local<String> ToDetailString() const); |
| inline V8_DEPRECATE_SOON("Use maybe version", Local<Object> ToObject() const); |
| inline V8_DEPRECATE_SOON("Use maybe version", |
| Local<Integer> ToInteger() const); |
| inline V8_DEPRECATE_SOON("Use maybe version", Local<Uint32> ToUint32() const); |
| inline V8_DEPRECATE_SOON("Use maybe version", Local<Int32> ToInt32() const); |
| |
| /** |
| * Attempts to convert a string to an array index. |
| * Returns an empty handle if the conversion fails. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Uint32> ToArrayIndex() const); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToArrayIndex( |
| Local<Context> context) const; |
| |
| V8_WARN_UNUSED_RESULT Maybe<bool> BooleanValue(Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT Maybe<double> NumberValue(Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT Maybe<int64_t> IntegerValue( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT Maybe<uint32_t> Uint32Value( |
| Local<Context> context) const; |
| V8_WARN_UNUSED_RESULT Maybe<int32_t> Int32Value(Local<Context> context) const; |
| |
| V8_DEPRECATE_SOON("Use maybe version", bool BooleanValue() const); |
| V8_DEPRECATE_SOON("Use maybe version", double NumberValue() const); |
| V8_DEPRECATE_SOON("Use maybe version", int64_t IntegerValue() const); |
| V8_DEPRECATE_SOON("Use maybe version", uint32_t Uint32Value() const); |
| V8_DEPRECATE_SOON("Use maybe version", int32_t Int32Value() const); |
| |
| /** JS == */ |
| V8_DEPRECATE_SOON("Use maybe version", bool Equals(Local<Value> that) const); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Equals(Local<Context> context, |
| Local<Value> that) const; |
| bool StrictEquals(Local<Value> that) const; |
| bool SameValue(Local<Value> that) const; |
| |
| template <class T> V8_INLINE static Value* Cast(T* value); |
| |
| private: |
| V8_INLINE bool QuickIsUndefined() const; |
| V8_INLINE bool QuickIsNull() const; |
| V8_INLINE bool QuickIsString() const; |
| bool FullIsUndefined() const; |
| bool FullIsNull() const; |
| bool FullIsString() const; |
| }; |
| |
| |
| /** |
| * The superclass of primitive values. See ECMA-262 4.3.2. |
| */ |
| class V8_EXPORT Primitive : public Value { }; |
| |
| |
| /** |
| * A primitive boolean value (ECMA-262, 4.3.14). Either the true |
| * or false value. |
| */ |
| class V8_EXPORT Boolean : public Primitive { |
| public: |
| bool Value() const; |
| V8_INLINE static Boolean* Cast(v8::Value* obj); |
| V8_INLINE static Local<Boolean> New(Isolate* isolate, bool value); |
| |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A superclass for symbols and strings. |
| */ |
| class V8_EXPORT Name : public Primitive { |
| public: |
| /** |
| * Returns the identity hash for this object. The current implementation |
| * uses an inline property on the object to store the identity hash. |
| * |
| * The return value will never be 0. Also, it is not guaranteed to be |
| * unique. |
| */ |
| int GetIdentityHash(); |
| |
| V8_INLINE static Name* Cast(v8::Value* obj); |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| enum class NewStringType { kNormal, kInternalized }; |
| |
| |
| /** |
| * A JavaScript string value (ECMA-262, 4.3.17). |
| */ |
| class V8_EXPORT String : public Name { |
| public: |
| static const int kMaxLength = (1 << 28) - 16; |
| |
| enum Encoding { |
| UNKNOWN_ENCODING = 0x1, |
| TWO_BYTE_ENCODING = 0x0, |
| ONE_BYTE_ENCODING = 0x4 |
| }; |
| /** |
| * Returns the number of characters in this string. |
| */ |
| int Length() const; |
| |
| /** |
| * Returns the number of bytes in the UTF-8 encoded |
| * representation of this string. |
| */ |
| int Utf8Length() const; |
| |
| /** |
| * Returns whether this string is known to contain only one byte data. |
| * Does not read the string. |
| * False negatives are possible. |
| */ |
| bool IsOneByte() const; |
| |
| /** |
| * Returns whether this string contain only one byte data. |
| * Will read the entire string in some cases. |
| */ |
| bool ContainsOnlyOneByte() const; |
| |
| /** |
| * Write the contents of the string to an external buffer. |
| * If no arguments are given, expects the buffer to be large |
| * enough to hold the entire string and NULL terminator. Copies |
| * the contents of the string and the NULL terminator into the |
| * buffer. |
| * |
| * WriteUtf8 will not write partial UTF-8 sequences, preferring to stop |
| * before the end of the buffer. |
| * |
| * Copies up to length characters into the output buffer. |
| * Only null-terminates if there is enough space in the buffer. |
| * |
| * \param buffer The buffer into which the string will be copied. |
| * \param start The starting position within the string at which |
| * copying begins. |
| * \param length The number of characters to copy from the string. For |
| * WriteUtf8 the number of bytes in the buffer. |
| * \param nchars_ref The number of characters written, can be NULL. |
| * \param options Various options that might affect performance of this or |
| * subsequent operations. |
| * \return The number of characters copied to the buffer excluding the null |
| * terminator. For WriteUtf8: The number of bytes copied to the buffer |
| * including the null terminator (if written). |
| */ |
| enum WriteOptions { |
| NO_OPTIONS = 0, |
| HINT_MANY_WRITES_EXPECTED = 1, |
| NO_NULL_TERMINATION = 2, |
| PRESERVE_ONE_BYTE_NULL = 4, |
| // Used by WriteUtf8 to replace orphan surrogate code units with the |
| // unicode replacement character. Needs to be set to guarantee valid UTF-8 |
| // output. |
| REPLACE_INVALID_UTF8 = 8 |
| }; |
| |
| // 16-bit character codes. |
| int Write(uint16_t* buffer, |
| int start = 0, |
| int length = -1, |
| int options = NO_OPTIONS) const; |
| // One byte characters. |
| int WriteOneByte(uint8_t* buffer, |
| int start = 0, |
| int length = -1, |
| int options = NO_OPTIONS) const; |
| // UTF-8 encoded characters. |
| int WriteUtf8(char* buffer, |
| int length = -1, |
| int* nchars_ref = NULL, |
| int options = NO_OPTIONS) const; |
| |
| /** |
| * A zero length string. |
| */ |
| V8_INLINE static v8::Local<v8::String> Empty(Isolate* isolate); |
| |
| /** |
| * Returns true if the string is external |
| */ |
| bool IsExternal() const; |
| |
| /** |
| * Returns true if the string is both external and one-byte. |
| */ |
| bool IsExternalOneByte() const; |
| |
| class V8_EXPORT ExternalStringResourceBase { // NOLINT |
| public: |
| virtual ~ExternalStringResourceBase() {} |
| |
| protected: |
| ExternalStringResourceBase() {} |
| |
| /** |
| * Internally V8 will call this Dispose method when the external string |
| * resource is no longer needed. The default implementation will use the |
| * delete operator. This method can be overridden in subclasses to |
| * control how allocated external string resources are disposed. |
| */ |
| virtual void Dispose() { delete this; } |
| |
| private: |
| // Disallow copying and assigning. |
| ExternalStringResourceBase(const ExternalStringResourceBase&); |
| void operator=(const ExternalStringResourceBase&); |
| |
| friend class v8::internal::Heap; |
| }; |
| |
| /** |
| * An ExternalStringResource is a wrapper around a two-byte string |
| * buffer that resides outside V8's heap. Implement an |
| * ExternalStringResource to manage the life cycle of the underlying |
| * buffer. Note that the string data must be immutable. |
| */ |
| class V8_EXPORT ExternalStringResource |
| : public ExternalStringResourceBase { |
| public: |
| /** |
| * Override the destructor to manage the life cycle of the underlying |
| * buffer. |
| */ |
| virtual ~ExternalStringResource() {} |
| |
| /** |
| * The string data from the underlying buffer. |
| */ |
| virtual const uint16_t* data() const = 0; |
| |
| /** |
| * The length of the string. That is, the number of two-byte characters. |
| */ |
| virtual size_t length() const = 0; |
| |
| protected: |
| ExternalStringResource() {} |
| }; |
| |
| /** |
| * An ExternalOneByteStringResource is a wrapper around an one-byte |
| * string buffer that resides outside V8's heap. Implement an |
| * ExternalOneByteStringResource to manage the life cycle of the |
| * underlying buffer. Note that the string data must be immutable |
| * and that the data must be Latin-1 and not UTF-8, which would require |
| * special treatment internally in the engine and do not allow efficient |
| * indexing. Use String::New or convert to 16 bit data for non-Latin1. |
| */ |
| |
| class V8_EXPORT ExternalOneByteStringResource |
| : public ExternalStringResourceBase { |
| public: |
| /** |
| * Override the destructor to manage the life cycle of the underlying |
| * buffer. |
| */ |
| virtual ~ExternalOneByteStringResource() {} |
| /** The string data from the underlying buffer.*/ |
| virtual const char* data() const = 0; |
| /** The number of Latin-1 characters in the string.*/ |
| virtual size_t length() const = 0; |
| protected: |
| ExternalOneByteStringResource() {} |
| }; |
| |
| /** |
| * If the string is an external string, return the ExternalStringResourceBase |
| * regardless of the encoding, otherwise return NULL. The encoding of the |
| * string is returned in encoding_out. |
| */ |
| V8_INLINE ExternalStringResourceBase* GetExternalStringResourceBase( |
| Encoding* encoding_out) const; |
| |
| /** |
| * Get the ExternalStringResource for an external string. Returns |
| * NULL if IsExternal() doesn't return true. |
| */ |
| V8_INLINE ExternalStringResource* GetExternalStringResource() const; |
| |
| /** |
| * Get the ExternalOneByteStringResource for an external one-byte string. |
| * Returns NULL if IsExternalOneByte() doesn't return true. |
| */ |
| const ExternalOneByteStringResource* GetExternalOneByteStringResource() const; |
| |
| V8_INLINE static String* Cast(v8::Value* obj); |
| |
| // TODO(dcarney): remove with deprecation of New functions. |
| enum NewStringType { |
| kNormalString = static_cast<int>(v8::NewStringType::kNormal), |
| kInternalizedString = static_cast<int>(v8::NewStringType::kInternalized) |
| }; |
| |
| /** Allocates a new string from UTF-8 data.*/ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<String> NewFromUtf8(Isolate* isolate, const char* data, |
| NewStringType type = kNormalString, |
| int length = -1)); |
| |
| /** Allocates a new string from UTF-8 data. Only returns an empty value when |
| * length > kMaxLength. **/ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromUtf8( |
| Isolate* isolate, const char* data, v8::NewStringType type, |
| int length = -1); |
| |
| /** Allocates a new string from Latin-1 data.*/ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<String> NewFromOneByte(Isolate* isolate, const uint8_t* data, |
| NewStringType type = kNormalString, |
| int length = -1)); |
| |
| /** Allocates a new string from Latin-1 data. Only returns an empty value |
| * when length > kMaxLength. **/ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromOneByte( |
| Isolate* isolate, const uint8_t* data, v8::NewStringType type, |
| int length = -1); |
| |
| /** Allocates a new string from UTF-16 data.*/ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<String> NewFromTwoByte(Isolate* isolate, const uint16_t* data, |
| NewStringType type = kNormalString, |
| int length = -1)); |
| |
| /** Allocates a new string from UTF-16 data. Only returns an empty value when |
| * length > kMaxLength. **/ |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewFromTwoByte( |
| Isolate* isolate, const uint16_t* data, v8::NewStringType type, |
| int length = -1); |
| |
| /** |
| * Creates a new string by concatenating the left and the right strings |
| * passed in as parameters. |
| */ |
| static Local<String> Concat(Local<String> left, Local<String> right); |
| |
| /** |
| * Creates a new external string using the data defined in the given |
| * resource. When the external string is no longer live on V8's heap the |
| * resource will be disposed by calling its Dispose method. The caller of |
| * this function should not otherwise delete or modify the resource. Neither |
| * should the underlying buffer be deallocated or modified except through the |
| * destructor of the external string resource. |
| */ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<String> NewExternal(Isolate* isolate, |
| ExternalStringResource* resource)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalTwoByte( |
| Isolate* isolate, ExternalStringResource* resource); |
| |
| /** |
| * Associate an external string resource with this string by transforming it |
| * in place so that existing references to this string in the JavaScript heap |
| * will use the external string resource. The external string resource's |
| * character contents need to be equivalent to this string. |
| * Returns true if the string has been changed to be an external string. |
| * The string is not modified if the operation fails. See NewExternal for |
| * information on the lifetime of the resource. |
| */ |
| bool MakeExternal(ExternalStringResource* resource); |
| |
| /** |
| * Creates a new external string using the one-byte data defined in the given |
| * resource. When the external string is no longer live on V8's heap the |
| * resource will be disposed by calling its Dispose method. The caller of |
| * this function should not otherwise delete or modify the resource. Neither |
| * should the underlying buffer be deallocated or modified except through the |
| * destructor of the external string resource. |
| */ |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<String> NewExternal(Isolate* isolate, |
| ExternalOneByteStringResource* resource)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<String> NewExternalOneByte( |
| Isolate* isolate, ExternalOneByteStringResource* resource); |
| |
| /** |
| * Associate an external string resource with this string by transforming it |
| * in place so that existing references to this string in the JavaScript heap |
| * will use the external string resource. The external string resource's |
| * character contents need to be equivalent to this string. |
| * Returns true if the string has been changed to be an external string. |
| * The string is not modified if the operation fails. See NewExternal for |
| * information on the lifetime of the resource. |
| */ |
| bool MakeExternal(ExternalOneByteStringResource* resource); |
| |
| /** |
| * Returns true if this string can be made external. |
| */ |
| bool CanMakeExternal(); |
| |
| /** |
| * Converts an object to a UTF-8-encoded character array. Useful if |
| * you want to print the object. If conversion to a string fails |
| * (e.g. due to an exception in the toString() method of the object) |
| * then the length() method returns 0 and the * operator returns |
| * NULL. |
| */ |
| class V8_EXPORT Utf8Value { |
| public: |
| explicit Utf8Value(Local<v8::Value> obj); |
| ~Utf8Value(); |
| char* operator*() { return str_; } |
| const char* operator*() const { return str_; } |
| int length() const { return length_; } |
| private: |
| char* str_; |
| int length_; |
| |
| // Disallow copying and assigning. |
| Utf8Value(const Utf8Value&); |
| void operator=(const Utf8Value&); |
| }; |
| |
| /** |
| * Converts an object to a two-byte string. |
| * If conversion to a string fails (eg. due to an exception in the toString() |
| * method of the object) then the length() method returns 0 and the * operator |
| * returns NULL. |
| */ |
| class V8_EXPORT Value { |
| public: |
| explicit Value(Local<v8::Value> obj); |
| ~Value(); |
| uint16_t* operator*() { return str_; } |
| const uint16_t* operator*() const { return str_; } |
| int length() const { return length_; } |
| private: |
| uint16_t* str_; |
| int length_; |
| |
| // Disallow copying and assigning. |
| Value(const Value&); |
| void operator=(const Value&); |
| }; |
| |
| private: |
| void VerifyExternalStringResourceBase(ExternalStringResourceBase* v, |
| Encoding encoding) const; |
| void VerifyExternalStringResource(ExternalStringResource* val) const; |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript symbol (ECMA-262 edition 6) |
| * |
| * This is an experimental feature. Use at your own risk. |
| */ |
| class V8_EXPORT Symbol : public Name { |
| public: |
| // Returns the print name string of the symbol, or undefined if none. |
| Local<Value> Name() const; |
| |
| // Create a symbol. If name is not empty, it will be used as the description. |
| static Local<Symbol> New( |
| Isolate *isolate, Local<String> name = Local<String>()); |
| |
| // Access global symbol registry. |
| // Note that symbols created this way are never collected, so |
| // they should only be used for statically fixed properties. |
| // Also, there is only one global name space for the names used as keys. |
| // To minimize the potential for clashes, use qualified names as keys. |
| static Local<Symbol> For(Isolate *isolate, Local<String> name); |
| |
| // Retrieve a global symbol. Similar to |For|, but using a separate |
| // registry that is not accessible by (and cannot clash with) JavaScript code. |
| static Local<Symbol> ForApi(Isolate *isolate, Local<String> name); |
| |
| // Well-known symbols |
| static Local<Symbol> GetIterator(Isolate* isolate); |
| static Local<Symbol> GetUnscopables(Isolate* isolate); |
| static Local<Symbol> GetToStringTag(Isolate* isolate); |
| static Local<Symbol> GetIsConcatSpreadable(Isolate* isolate); |
| |
| V8_INLINE static Symbol* Cast(v8::Value* obj); |
| |
| private: |
| Symbol(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A private symbol |
| * |
| * This is an experimental feature. Use at your own risk. |
| */ |
| class V8_EXPORT Private : public Data { |
| public: |
| // Returns the print name string of the private symbol, or undefined if none. |
| Local<Value> Name() const; |
| |
| // Create a private symbol. If name is not empty, it will be the description. |
| static Local<Private> New(Isolate* isolate, |
| Local<String> name = Local<String>()); |
| |
| // Retrieve a global private symbol. If a symbol with this name has not |
| // been retrieved in the same isolate before, it is created. |
| // Note that private symbols created this way are never collected, so |
| // they should only be used for statically fixed properties. |
| // Also, there is only one global name space for the names used as keys. |
| // To minimize the potential for clashes, use qualified names as keys, |
| // e.g., "Class#property". |
| static Local<Private> ForApi(Isolate* isolate, Local<String> name); |
| |
| private: |
| Private(); |
| }; |
| |
| |
| /** |
| * A JavaScript number value (ECMA-262, 4.3.20) |
| */ |
| class V8_EXPORT Number : public Primitive { |
| public: |
| double Value() const; |
| static Local<Number> New(Isolate* isolate, double value); |
| V8_INLINE static Number* Cast(v8::Value* obj); |
| private: |
| Number(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript value representing a signed integer. |
| */ |
| class V8_EXPORT Integer : public Number { |
| public: |
| static Local<Integer> New(Isolate* isolate, int32_t value); |
| static Local<Integer> NewFromUnsigned(Isolate* isolate, uint32_t value); |
| int64_t Value() const; |
| V8_INLINE static Integer* Cast(v8::Value* obj); |
| private: |
| Integer(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript value representing a 32-bit signed integer. |
| */ |
| class V8_EXPORT Int32 : public Integer { |
| public: |
| int32_t Value() const; |
| V8_INLINE static Int32* Cast(v8::Value* obj); |
| |
| private: |
| Int32(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript value representing a 32-bit unsigned integer. |
| */ |
| class V8_EXPORT Uint32 : public Integer { |
| public: |
| uint32_t Value() const; |
| V8_INLINE static Uint32* Cast(v8::Value* obj); |
| |
| private: |
| Uint32(); |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| enum PropertyAttribute { |
| None = 0, |
| ReadOnly = 1 << 0, |
| DontEnum = 1 << 1, |
| DontDelete = 1 << 2 |
| }; |
| |
| /** |
| * Accessor[Getter|Setter] are used as callback functions when |
| * setting|getting a particular property. See Object and ObjectTemplate's |
| * method SetAccessor. |
| */ |
| typedef void (*AccessorGetterCallback)( |
| Local<String> property, |
| const PropertyCallbackInfo<Value>& info); |
| typedef void (*AccessorNameGetterCallback)( |
| Local<Name> property, |
| const PropertyCallbackInfo<Value>& info); |
| |
| |
| typedef void (*AccessorSetterCallback)( |
| Local<String> property, |
| Local<Value> value, |
| const PropertyCallbackInfo<void>& info); |
| typedef void (*AccessorNameSetterCallback)( |
| Local<Name> property, |
| Local<Value> value, |
| const PropertyCallbackInfo<void>& info); |
| |
| |
| /** |
| * Access control specifications. |
| * |
| * Some accessors should be accessible across contexts. These |
| * accessors have an explicit access control parameter which specifies |
| * the kind of cross-context access that should be allowed. |
| * |
| * TODO(dcarney): Remove PROHIBITS_OVERWRITING as it is now unused. |
| */ |
| enum AccessControl { |
| DEFAULT = 0, |
| ALL_CAN_READ = 1, |
| ALL_CAN_WRITE = 1 << 1, |
| PROHIBITS_OVERWRITING = 1 << 2 |
| }; |
| |
| |
| /** |
| * A JavaScript object (ECMA-262, 4.3.3) |
| */ |
| class V8_EXPORT Object : public Value { |
| public: |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool Set(Local<Value> key, Local<Value> value)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, |
| Local<Value> key, Local<Value> value); |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool Set(uint32_t index, Local<Value> value)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, uint32_t index, |
| Local<Value> value); |
| |
| // Implements CreateDataProperty (ECMA-262, 7.3.4). |
| // |
| // Defines a configurable, writable, enumerable property with the given value |
| // on the object unless the property already exists and is not configurable |
| // or the object is not extensible. |
| // |
| // Returns true on success. |
| V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context, |
| Local<Name> key, |
| Local<Value> value); |
| V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context, |
| uint32_t index, |
| Local<Value> value); |
| |
| // Implements DefineOwnProperty. |
| // |
| // In general, CreateDataProperty will be faster, however, does not allow |
| // for specifying attributes. |
| // |
| // Returns true on success. |
| V8_WARN_UNUSED_RESULT Maybe<bool> DefineOwnProperty( |
| Local<Context> context, Local<Name> key, Local<Value> value, |
| PropertyAttribute attributes = None); |
| |
| // Sets an own property on this object bypassing interceptors and |
| // overriding accessors or read-only properties. |
| // |
| // Note that if the object has an interceptor the property will be set |
| // locally, but since the interceptor takes precedence the local property |
| // will only be returned if the interceptor doesn't return a value. |
| // |
| // Note also that this only works for named properties. |
| V8_DEPRECATE_SOON("Use CreateDataProperty / DefineOwnProperty", |
| bool ForceSet(Local<Value> key, Local<Value> value, |
| PropertyAttribute attribs = None)); |
| V8_DEPRECATE_SOON("Use CreateDataProperty / DefineOwnProperty", |
| Maybe<bool> ForceSet(Local<Context> context, |
| Local<Value> key, Local<Value> value, |
| PropertyAttribute attribs = None)); |
| |
| V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(Local<Value> key)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, |
| Local<Value> key); |
| |
| V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(uint32_t index)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, |
| uint32_t index); |
| |
| /** |
| * Gets the property attributes of a property which can be None or |
| * any combination of ReadOnly, DontEnum and DontDelete. Returns |
| * None when the property doesn't exist. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| PropertyAttribute GetPropertyAttributes(Local<Value> key)); |
| V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetPropertyAttributes( |
| Local<Context> context, Local<Value> key); |
| |
| /** |
| * Returns Object.getOwnPropertyDescriptor as per ES5 section 15.2.3.3. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Value> GetOwnPropertyDescriptor(Local<String> key)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetOwnPropertyDescriptor( |
| Local<Context> context, Local<String> key); |
| |
| V8_DEPRECATE_SOON("Use maybe version", bool Has(Local<Value> key)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, |
| Local<Value> key); |
| |
| V8_DEPRECATE_SOON("Use maybe version", bool Delete(Local<Value> key)); |
| // TODO(dcarney): mark V8_WARN_UNUSED_RESULT |
| Maybe<bool> Delete(Local<Context> context, Local<Value> key); |
| |
| V8_DEPRECATE_SOON("Use maybe version", bool Has(uint32_t index)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, uint32_t index); |
| |
| V8_DEPRECATE_SOON("Use maybe version", bool Delete(uint32_t index)); |
| // TODO(dcarney): mark V8_WARN_UNUSED_RESULT |
| Maybe<bool> Delete(Local<Context> context, uint32_t index); |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool SetAccessor(Local<String> name, |
| AccessorGetterCallback getter, |
| AccessorSetterCallback setter = 0, |
| Local<Value> data = Local<Value>(), |
| AccessControl settings = DEFAULT, |
| PropertyAttribute attribute = None)); |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool SetAccessor(Local<Name> name, |
| AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter = 0, |
| Local<Value> data = Local<Value>(), |
| AccessControl settings = DEFAULT, |
| PropertyAttribute attribute = None)); |
| // TODO(dcarney): mark V8_WARN_UNUSED_RESULT |
| Maybe<bool> SetAccessor(Local<Context> context, Local<Name> name, |
| AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter = 0, |
| MaybeLocal<Value> data = MaybeLocal<Value>(), |
| AccessControl settings = DEFAULT, |
| PropertyAttribute attribute = None); |
| |
| void SetAccessorProperty(Local<Name> name, Local<Function> getter, |
| Local<Function> setter = Local<Function>(), |
| PropertyAttribute attribute = None, |
| AccessControl settings = DEFAULT); |
| |
| /** |
| * Functionality for private properties. |
| * This is an experimental feature, use at your own risk. |
| * Note: Private properties are not inherited. Do not rely on this, since it |
| * may change. |
| */ |
| Maybe<bool> HasPrivate(Local<Context> context, Local<Private> key); |
| Maybe<bool> SetPrivate(Local<Context> context, Local<Private> key, |
| Local<Value> value); |
| Maybe<bool> DeletePrivate(Local<Context> context, Local<Private> key); |
| MaybeLocal<Value> GetPrivate(Local<Context> context, Local<Private> key); |
| |
| /** |
| * Returns an array containing the names of the enumerable properties |
| * of this object, including properties from prototype objects. The |
| * array returned by this method contains the same values as would |
| * be enumerated by a for-in statement over this object. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetPropertyNames()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetPropertyNames( |
| Local<Context> context); |
| |
| /** |
| * This function has the same functionality as GetPropertyNames but |
| * the returned array doesn't contain the names of properties from |
| * prototype objects. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Array> GetOwnPropertyNames()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Array> GetOwnPropertyNames( |
| Local<Context> context); |
| |
| /** |
| * Get the prototype object. This does not skip objects marked to |
| * be skipped by __proto__ and it does not consult the security |
| * handler. |
| */ |
| Local<Value> GetPrototype(); |
| |
| /** |
| * Set the prototype object. This does not skip objects marked to |
| * be skipped by __proto__ and it does not consult the security |
| * handler. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool SetPrototype(Local<Value> prototype)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> SetPrototype(Local<Context> context, |
| Local<Value> prototype); |
| |
| /** |
| * Finds an instance of the given function template in the prototype |
| * chain. |
| */ |
| Local<Object> FindInstanceInPrototypeChain(Local<FunctionTemplate> tmpl); |
| |
| /** |
| * Call builtin Object.prototype.toString on this object. |
| * This is different from Value::ToString() that may call |
| * user-defined toString function. This one does not. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", Local<String> ObjectProtoToString()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<String> ObjectProtoToString( |
| Local<Context> context); |
| |
| /** |
| * Returns the name of the function invoked as a constructor for this object. |
| */ |
| Local<String> GetConstructorName(); |
| |
| /** Gets the number of internal fields for this Object. */ |
| int InternalFieldCount(); |
| |
| /** Same as above, but works for Persistents */ |
| V8_INLINE static int InternalFieldCount( |
| const PersistentBase<Object>& object) { |
| return object.val_->InternalFieldCount(); |
| } |
| |
| /** Gets the value from an internal field. */ |
| V8_INLINE Local<Value> GetInternalField(int index); |
| |
| /** Sets the value in an internal field. */ |
| void SetInternalField(int index, Local<Value> value); |
| |
| /** |
| * Gets a 2-byte-aligned native pointer from an internal field. This field |
| * must have been set by SetAlignedPointerInInternalField, everything else |
| * leads to undefined behavior. |
| */ |
| V8_INLINE void* GetAlignedPointerFromInternalField(int index); |
| |
| /** Same as above, but works for Persistents */ |
| V8_INLINE static void* GetAlignedPointerFromInternalField( |
| const PersistentBase<Object>& object, int index) { |
| return object.val_->GetAlignedPointerFromInternalField(index); |
| } |
| |
| /** |
| * Sets a 2-byte-aligned native pointer in an internal field. To retrieve such |
| * a field, GetAlignedPointerFromInternalField must be used, everything else |
| * leads to undefined behavior. |
| */ |
| void SetAlignedPointerInInternalField(int index, void* value); |
| |
| // Testers for local properties. |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool HasOwnProperty(Local<String> key)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context, |
| Local<Name> key); |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool HasRealNamedProperty(Local<String> key)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedProperty(Local<Context> context, |
| Local<Name> key); |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool HasRealIndexedProperty(uint32_t index)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasRealIndexedProperty( |
| Local<Context> context, uint32_t index); |
| V8_DEPRECATE_SOON("Use maybe version", |
| bool HasRealNamedCallbackProperty(Local<String> key)); |
| V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedCallbackProperty( |
| Local<Context> context, Local<Name> key); |
| |
| /** |
| * If result.IsEmpty() no real property was located in the prototype chain. |
| * This means interceptors in the prototype chain are not called. |
| */ |
| V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<Value> GetRealNamedPropertyInPrototypeChain(Local<String> key)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedPropertyInPrototypeChain( |
| Local<Context> context, Local<Name> key); |
| |
| /** |
| * Gets the property attributes of a real property in the prototype chain, |
| * which can be None or any combination of ReadOnly, DontEnum and DontDelete. |
| * Interceptors in the prototype chain are not called. |
| */ |
| V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Maybe<PropertyAttribute> GetRealNamedPropertyAttributesInPrototypeChain( |
| Local<String> key)); |
| V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> |
| GetRealNamedPropertyAttributesInPrototypeChain(Local<Context> context, |
| Local<Name> key); |
| |
| /** |
| * If result.IsEmpty() no real property was located on the object or |
| * in the prototype chain. |
| * This means interceptors in the prototype chain are not called. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Value> GetRealNamedProperty(Local<String> key)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedProperty( |
| Local<Context> context, Local<Name> key); |
| |
| /** |
| * Gets the property attributes of a real property which can be |
| * None or any combination of ReadOnly, DontEnum and DontDelete. |
| * Interceptors in the prototype chain are not called. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| Maybe<PropertyAttribute> GetRealNamedPropertyAttributes( |
| Local<String> key)); |
| V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetRealNamedPropertyAttributes( |
| Local<Context> context, Local<Name> key); |
| |
| /** Tests for a named lookup interceptor.*/ |
| bool HasNamedLookupInterceptor(); |
| |
| /** Tests for an index lookup interceptor.*/ |
| bool HasIndexedLookupInterceptor(); |
| |
| /** |
| * Returns the identity hash for this object. The current implementation |
| * uses a hidden property on the object to store the identity hash. |
| * |
| * The return value will never be 0. Also, it is not guaranteed to be |
| * unique. |
| */ |
| int GetIdentityHash(); |
| |
| V8_DEPRECATED("Use v8::Object::SetPrivate instead.", |
| bool SetHiddenValue(Local<String> key, Local<Value> value)); |
| V8_DEPRECATED("Use v8::Object::GetPrivate instead.", |
| Local<Value> GetHiddenValue(Local<String> key)); |
| V8_DEPRECATED("Use v8::Object::DeletePrivate instead.", |
| bool DeleteHiddenValue(Local<String> key)); |
| |
| /** |
| * Clone this object with a fast but shallow copy. Values will point |
| * to the same values as the original object. |
| */ |
| // TODO(dcarney): take an isolate and optionally bail out? |
| Local<Object> Clone(); |
| |
| /** |
| * Returns the context in which the object was created. |
| */ |
| Local<Context> CreationContext(); |
| |
| /** |
| * Checks whether a callback is set by the |
| * ObjectTemplate::SetCallAsFunctionHandler method. |
| * When an Object is callable this method returns true. |
| */ |
| bool IsCallable(); |
| |
| /** |
| * Call an Object as a function if a callback is set by the |
| * ObjectTemplate::SetCallAsFunctionHandler method. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Value> CallAsFunction(Local<Value> recv, int argc, |
| Local<Value> argv[])); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsFunction(Local<Context> context, |
| Local<Value> recv, |
| int argc, |
| Local<Value> argv[]); |
| |
| /** |
| * Call an Object as a constructor if a callback is set by the |
| * ObjectTemplate::SetCallAsFunctionHandler method. |
| * Note: This method behaves like the Function::NewInstance method. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Value> CallAsConstructor(int argc, |
| Local<Value> argv[])); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsConstructor( |
| Local<Context> context, int argc, Local<Value> argv[]); |
| |
| /** |
| * Return the isolate to which the Object belongs to. |
| */ |
| V8_DEPRECATE_SOON("Keep track of isolate correctly", Isolate* GetIsolate()); |
| |
| static Local<Object> New(Isolate* isolate); |
| |
| V8_INLINE static Object* Cast(Value* obj); |
| |
| private: |
| Object(); |
| static void CheckCast(Value* obj); |
| Local<Value> SlowGetInternalField(int index); |
| void* SlowGetAlignedPointerFromInternalField(int index); |
| }; |
| |
| |
| /** |
| * An instance of the built-in array constructor (ECMA-262, 15.4.2). |
| */ |
| class V8_EXPORT Array : public Object { |
| public: |
| uint32_t Length() const; |
| |
| /** |
| * Clones an element at index |index|. Returns an empty |
| * handle if cloning fails (for any reason). |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Object> CloneElementAt(uint32_t index)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> CloneElementAt( |
| Local<Context> context, uint32_t index); |
| |
| /** |
| * Creates a JavaScript array with the given length. If the length |
| * is negative the returned array will have length 0. |
| */ |
| static Local<Array> New(Isolate* isolate, int length = 0); |
| |
| V8_INLINE static Array* Cast(Value* obj); |
| private: |
| Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in Map constructor (ECMA-262, 6th Edition, 23.1.1). |
| */ |
| class V8_EXPORT Map : public Object { |
| public: |
| size_t Size() const; |
| void Clear(); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context, |
| Local<Value> key); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Map> Set(Local<Context> context, |
| Local<Value> key, |
| Local<Value> value); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, |
| Local<Value> key); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context, |
| Local<Value> key); |
| |
| /** |
| * Returns an array of length Size() * 2, where index N is the Nth key and |
| * index N + 1 is the Nth value. |
| */ |
| Local<Array> AsArray() const; |
| |
| /** |
| * Creates a new empty Map. |
| */ |
| static Local<Map> New(Isolate* isolate); |
| |
| V8_INLINE static Map* Cast(Value* obj); |
| |
| private: |
| Map(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in Set constructor (ECMA-262, 6th Edition, 23.2.1). |
| */ |
| class V8_EXPORT Set : public Object { |
| public: |
| size_t Size() const; |
| void Clear(); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Set> Add(Local<Context> context, |
| Local<Value> key); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, |
| Local<Value> key); |
| V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context, |
| Local<Value> key); |
| |
| /** |
| * Returns an array of the keys in this Set. |
| */ |
| Local<Array> AsArray() const; |
| |
| /** |
| * Creates a new empty Set. |
| */ |
| static Local<Set> New(Isolate* isolate); |
| |
| V8_INLINE static Set* Cast(Value* obj); |
| |
| private: |
| Set(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| template<typename T> |
| class ReturnValue { |
| public: |
| template <class S> V8_INLINE ReturnValue(const ReturnValue<S>& that) |
| : value_(that.value_) { |
| TYPE_CHECK(T, S); |
| } |
| // Local setters |
| template <typename S> |
| V8_INLINE V8_DEPRECATE_SOON("Use Global<> instead", |
| void Set(const Persistent<S>& handle)); |
| template <typename S> |
| V8_INLINE void Set(const Global<S>& handle); |
| template <typename S> |
| V8_INLINE void Set(const Local<S> handle); |
| // Fast primitive setters |
| V8_INLINE void Set(bool value); |
| V8_INLINE void Set(double i); |
| V8_INLINE void Set(int32_t i); |
| V8_INLINE void Set(uint32_t i); |
| // Fast JS primitive setters |
| V8_INLINE void SetNull(); |
| V8_INLINE void SetUndefined(); |
| V8_INLINE void SetEmptyString(); |
| // Convenience getter for Isolate |
| V8_INLINE Isolate* GetIsolate(); |
| |
| // Pointer setter: Uncompilable to prevent inadvertent misuse. |
| template <typename S> |
| V8_INLINE void Set(S* whatever); |
| |
| private: |
| template<class F> friend class ReturnValue; |
| template<class F> friend class FunctionCallbackInfo; |
| template<class F> friend class PropertyCallbackInfo; |
| template <class F, class G, class H> |
| friend class PersistentValueMapBase; |
| V8_INLINE void SetInternal(internal::Object* value) { *value_ = value; } |
| V8_INLINE internal::Object* GetDefaultValue(); |
| V8_INLINE explicit ReturnValue(internal::Object** slot); |
| internal::Object** value_; |
| }; |
| |
| |
| /** |
| * The argument information given to function call callbacks. This |
| * class provides access to information about the context of the call, |
| * including the receiver, the number and values of arguments, and |
| * the holder of the function. |
| */ |
| template<typename T> |
| class FunctionCallbackInfo { |
| public: |
| V8_INLINE int Length() const; |
| V8_INLINE Local<Value> operator[](int i) const; |
| V8_INLINE Local<Function> Callee() const; |
| V8_INLINE Local<Object> This() const; |
| V8_INLINE Local<Object> Holder() const; |
| V8_INLINE bool IsConstructCall() const; |
| V8_INLINE Local<Value> Data() const; |
| V8_INLINE Isolate* GetIsolate() const; |
| V8_INLINE ReturnValue<T> GetReturnValue() const; |
| // This shouldn't be public, but the arm compiler needs it. |
| static const int kArgsLength = 7; |
| |
| protected: |
| friend class internal::FunctionCallbackArguments; |
| friend class internal::CustomArguments<FunctionCallbackInfo>; |
| static const int kHolderIndex = 0; |
| static const int kIsolateIndex = 1; |
| static const int kReturnValueDefaultValueIndex = 2; |
| static const int kReturnValueIndex = 3; |
| static const int kDataIndex = 4; |
| static const int kCalleeIndex = 5; |
| static const int kContextSaveIndex = 6; |
| |
| V8_INLINE FunctionCallbackInfo(internal::Object** implicit_args, |
| internal::Object** values, |
| int length, |
| bool is_construct_call); |
| internal::Object** implicit_args_; |
| internal::Object** values_; |
| int length_; |
| int is_construct_call_; |
| }; |
| |
| |
| /** |
| * The information passed to a property callback about the context |
| * of the property access. |
| */ |
| template<typename T> |
| class PropertyCallbackInfo { |
| public: |
| V8_INLINE Isolate* GetIsolate() const; |
| V8_INLINE Local<Value> Data() const; |
| V8_INLINE Local<Object> This() const; |
| V8_INLINE Local<Object> Holder() const; |
| V8_INLINE ReturnValue<T> GetReturnValue() const; |
| // This shouldn't be public, but the arm compiler needs it. |
| static const int kArgsLength = 6; |
| |
| protected: |
| friend class MacroAssembler; |
| friend class internal::PropertyCallbackArguments; |
| friend class internal::CustomArguments<PropertyCallbackInfo>; |
| static const int kHolderIndex = 0; |
| static const int kIsolateIndex = 1; |
| static const int kReturnValueDefaultValueIndex = 2; |
| static const int kReturnValueIndex = 3; |
| static const int kDataIndex = 4; |
| static const int kThisIndex = 5; |
| |
| V8_INLINE PropertyCallbackInfo(internal::Object** args) : args_(args) {} |
| internal::Object** args_; |
| }; |
| |
| |
| typedef void (*FunctionCallback)(const FunctionCallbackInfo<Value>& info); |
| |
| |
| /** |
| * A JavaScript function object (ECMA-262, 15.3). |
| */ |
| class V8_EXPORT Function : public Object { |
| public: |
| /** |
| * Create a function in the current execution context |
| * for a given FunctionCallback. |
| */ |
| static MaybeLocal<Function> New(Local<Context> context, |
| FunctionCallback callback, |
| Local<Value> data = Local<Value>(), |
| int length = 0); |
| static V8_DEPRECATE_SOON( |
| "Use maybe version", |
| Local<Function> New(Isolate* isolate, FunctionCallback callback, |
| Local<Value> data = Local<Value>(), int length = 0)); |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Object> NewInstance(int argc, Local<Value> argv[]) |
| const); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance( |
| Local<Context> context, int argc, Local<Value> argv[]) const; |
| |
| V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance() const); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance( |
| Local<Context> context) const { |
| return NewInstance(context, 0, nullptr); |
| } |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Value> Call(Local<Value> recv, int argc, |
| Local<Value> argv[])); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> Call(Local<Context> context, |
| Local<Value> recv, int argc, |
| Local<Value> argv[]); |
| |
| void SetName(Local<String> name); |
| Local<Value> GetName() const; |
| |
| /** |
| * Name inferred from variable or property assignment of this function. |
| * Used to facilitate debugging and profiling of JavaScript code written |
| * in an OO style, where many functions are anonymous but are assigned |
| * to object properties. |
| */ |
| Local<Value> GetInferredName() const; |
| |
| /** |
| * displayName if it is set, otherwise name if it is configured, otherwise |
| * function name, otherwise inferred name. |
| */ |
| Local<Value> GetDebugName() const; |
| |
| /** |
| * User-defined name assigned to the "displayName" property of this function. |
| * Used to facilitate debugging and profiling of JavaScript code. |
| */ |
| Local<Value> GetDisplayName() const; |
| |
| /** |
| * Returns zero based line number of function body and |
| * kLineOffsetNotFound if no information available. |
| */ |
| int GetScriptLineNumber() const; |
| /** |
| * Returns zero based column number of function body and |
| * kLineOffsetNotFound if no information available. |
| */ |
| int GetScriptColumnNumber() const; |
| |
| /** |
| * Tells whether this function is builtin. |
| */ |
| bool IsBuiltin() const; |
| |
| /** |
| * Returns scriptId. |
| */ |
| int ScriptId() const; |
| |
| /** |
| * Returns the original function if this function is bound, else returns |
| * v8::Undefined. |
| */ |
| Local<Value> GetBoundFunction() const; |
| |
| ScriptOrigin GetScriptOrigin() const; |
| V8_INLINE static Function* Cast(Value* obj); |
| static const int kLineOffsetNotFound; |
| |
| private: |
| Function(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in Promise constructor (ES6 draft). |
| * This API is experimental. Only works with --harmony flag. |
| */ |
| class V8_EXPORT Promise : public Object { |
| public: |
| class V8_EXPORT Resolver : public Object { |
| public: |
| /** |
| * Create a new resolver, along with an associated promise in pending state. |
| */ |
| static V8_DEPRECATE_SOON("Use maybe version", |
| Local<Resolver> New(Isolate* isolate)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Resolver> New( |
| Local<Context> context); |
| |
| /** |
| * Extract the associated promise. |
| */ |
| Local<Promise> GetPromise(); |
| |
| /** |
| * Resolve/reject the associated promise with a given value. |
| * Ignored if the promise is no longer pending. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", void Resolve(Local<Value> value)); |
| // TODO(dcarney): mark V8_WARN_UNUSED_RESULT |
| Maybe<bool> Resolve(Local<Context> context, Local<Value> value); |
| |
| V8_DEPRECATE_SOON("Use maybe version", void Reject(Local<Value> value)); |
| // TODO(dcarney): mark V8_WARN_UNUSED_RESULT |
| Maybe<bool> Reject(Local<Context> context, Local<Value> value); |
| |
| V8_INLINE static Resolver* Cast(Value* obj); |
| |
| private: |
| Resolver(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * Register a resolution/rejection handler with a promise. |
| * The handler is given the respective resolution/rejection value as |
| * an argument. If the promise is already resolved/rejected, the handler is |
| * invoked at the end of turn. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Promise> Chain(Local<Function> handler)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Chain(Local<Context> context, |
| Local<Function> handler); |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Promise> Catch(Local<Function> handler)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Catch(Local<Context> context, |
| Local<Function> handler); |
| |
| V8_DEPRECATE_SOON("Use maybe version", |
| Local<Promise> Then(Local<Function> handler)); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Then(Local<Context> context, |
| Local<Function> handler); |
| |
| /** |
| * Returns true if the promise has at least one derived promise, and |
| * therefore resolve/reject handlers (including default handler). |
| */ |
| bool HasHandler(); |
| |
| V8_INLINE static Promise* Cast(Value* obj); |
| |
| private: |
| Promise(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| #ifndef V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT |
| // The number of required internal fields can be defined by embedder. |
| #define V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT 2 |
| #endif |
| |
| |
| enum class ArrayBufferCreationMode { kInternalized, kExternalized }; |
| |
| |
| /** |
| * An instance of the built-in ArrayBuffer constructor (ES6 draft 15.13.5). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT ArrayBuffer : public Object { |
| public: |
| /** |
| * Allocator that V8 uses to allocate |ArrayBuffer|'s memory. |
| * The allocator is a global V8 setting. It has to be set via |
| * Isolate::CreateParams. |
| * |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Allocator { // NOLINT |
| public: |
| virtual ~Allocator() {} |
| |
| /** |
| * Allocate |length| bytes. Return NULL if allocation is not successful. |
| * Memory should be initialized to zeroes. |
| */ |
| virtual void* Allocate(size_t length) = 0; |
| |
| /** |
| * Allocate |length| bytes. Return NULL if allocation is not successful. |
| * Memory does not have to be initialized. |
| */ |
| virtual void* AllocateUninitialized(size_t length) = 0; |
| /** |
| * Free the memory block of size |length|, pointed to by |data|. |
| * That memory is guaranteed to be previously allocated by |Allocate|. |
| */ |
| virtual void Free(void* data, size_t length) = 0; |
| }; |
| |
| /** |
| * The contents of an |ArrayBuffer|. Externalization of |ArrayBuffer| |
| * returns an instance of this class, populated, with a pointer to data |
| * and byte length. |
| * |
| * The Data pointer of ArrayBuffer::Contents is always allocated with |
| * Allocator::Allocate that is set via Isolate::CreateParams. |
| * |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Contents { // NOLINT |
| public: |
| Contents() : data_(NULL), byte_length_(0) {} |
| |
| void* Data() const { return data_; } |
| size_t ByteLength() const { return byte_length_; } |
| |
| private: |
| void* data_; |
| size_t byte_length_; |
| |
| friend class ArrayBuffer; |
| }; |
| |
| |
| /** |
| * Data length in bytes. |
| */ |
| size_t ByteLength() const; |
| |
| /** |
| * Create a new ArrayBuffer. Allocate |byte_length| bytes. |
| * Allocated memory will be owned by a created ArrayBuffer and |
| * will be deallocated when it is garbage-collected, |
| * unless the object is externalized. |
| */ |
| static Local<ArrayBuffer> New(Isolate* isolate, size_t byte_length); |
| |
| /** |
| * Create a new ArrayBuffer over an existing memory block. |
| * The created array buffer is by default immediately in externalized state. |
| * The memory block will not be reclaimed when a created ArrayBuffer |
| * is garbage-collected. |
| */ |
| static Local<ArrayBuffer> New( |
| Isolate* isolate, void* data, size_t byte_length, |
| ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized); |
| |
| /** |
| * Returns true if ArrayBuffer is externalized, that is, does not |
| * own its memory block. |
| */ |
| bool IsExternal() const; |
| |
| /** |
| * Returns true if this ArrayBuffer may be neutered. |
| */ |
| bool IsNeuterable() const; |
| |
| /** |
| * Neuters this ArrayBuffer and all its views (typed arrays). |
| * Neutering sets the byte length of the buffer and all typed arrays to zero, |
| * preventing JavaScript from ever accessing underlying backing store. |
| * ArrayBuffer should have been externalized and must be neuterable. |
| */ |
| void Neuter(); |
| |
| /** |
| * Make this ArrayBuffer external. The pointer to underlying memory block |
| * and byte length are returned as |Contents| structure. After ArrayBuffer |
| * had been etxrenalized, it does no longer owns the memory block. The caller |
| * should take steps to free memory when it is no longer needed. |
| * |
| * The memory block is guaranteed to be allocated with |Allocator::Allocate| |
| * that has been set via Isolate::CreateParams. |
| */ |
| Contents Externalize(); |
| |
| /** |
| * Get a pointer to the ArrayBuffer's underlying memory block without |
| * externalizing it. If the ArrayBuffer is not externalized, this pointer |
| * will become invalid as soon as the ArrayBuffer became garbage collected. |
| * |
| * The embedder should make sure to hold a strong reference to the |
| * ArrayBuffer while accessing this pointer. |
| * |
| * The memory block is guaranteed to be allocated with |Allocator::Allocate|. |
| */ |
| Contents GetContents(); |
| |
| V8_INLINE static ArrayBuffer* Cast(Value* obj); |
| |
| static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT; |
| |
| private: |
| ArrayBuffer(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| #ifndef V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT |
| // The number of required internal fields can be defined by embedder. |
| #define V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT 2 |
| #endif |
| |
| |
| /** |
| * A base class for an instance of one of "views" over ArrayBuffer, |
| * including TypedArrays and DataView (ES6 draft 15.13). |
| * |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT ArrayBufferView : public Object { |
| public: |
| /** |
| * Returns underlying ArrayBuffer. |
| */ |
| Local<ArrayBuffer> Buffer(); |
| /** |
| * Byte offset in |Buffer|. |
| */ |
| size_t ByteOffset(); |
| /** |
| * Size of a view in bytes. |
| */ |
| size_t ByteLength(); |
| |
| /** |
| * Copy the contents of the ArrayBufferView's buffer to an embedder defined |
| * memory without additional overhead that calling ArrayBufferView::Buffer |
| * might incur. |
| * |
| * Will write at most min(|byte_length|, ByteLength) bytes starting at |
| * ByteOffset of the underling buffer to the memory starting at |dest|. |
| * Returns the number of bytes actually written. |
| */ |
| size_t CopyContents(void* dest, size_t byte_length); |
| |
| /** |
| * Returns true if ArrayBufferView's backing ArrayBuffer has already been |
| * allocated. |
| */ |
| bool HasBuffer() const; |
| |
| V8_INLINE static ArrayBufferView* Cast(Value* obj); |
| |
| static const int kInternalFieldCount = |
| V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT; |
| |
| private: |
| ArrayBufferView(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * A base class for an instance of TypedArray series of constructors |
| * (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT TypedArray : public ArrayBufferView { |
| public: |
| /** |
| * Number of elements in this typed array |
| * (e.g. for Int16Array, |ByteLength|/2). |
| */ |
| size_t Length(); |
| |
| V8_INLINE static TypedArray* Cast(Value* obj); |
| |
| private: |
| TypedArray(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Uint8Array constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Uint8Array : public TypedArray { |
| public: |
| static Local<Uint8Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Uint8Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Uint8Array* Cast(Value* obj); |
| |
| private: |
| Uint8Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Uint8ClampedArray constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Uint8ClampedArray : public TypedArray { |
| public: |
| static Local<Uint8ClampedArray> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Uint8ClampedArray> New( |
| Local<SharedArrayBuffer> shared_array_buffer, size_t byte_offset, |
| size_t length); |
| V8_INLINE static Uint8ClampedArray* Cast(Value* obj); |
| |
| private: |
| Uint8ClampedArray(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| /** |
| * An instance of Int8Array constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Int8Array : public TypedArray { |
| public: |
| static Local<Int8Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Int8Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Int8Array* Cast(Value* obj); |
| |
| private: |
| Int8Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Uint16Array constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Uint16Array : public TypedArray { |
| public: |
| static Local<Uint16Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Uint16Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Uint16Array* Cast(Value* obj); |
| |
| private: |
| Uint16Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Int16Array constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Int16Array : public TypedArray { |
| public: |
| static Local<Int16Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Int16Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Int16Array* Cast(Value* obj); |
| |
| private: |
| Int16Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Uint32Array constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Uint32Array : public TypedArray { |
| public: |
| static Local<Uint32Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Uint32Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Uint32Array* Cast(Value* obj); |
| |
| private: |
| Uint32Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Int32Array constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Int32Array : public TypedArray { |
| public: |
| static Local<Int32Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Int32Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Int32Array* Cast(Value* obj); |
| |
| private: |
| Int32Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Float32Array constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Float32Array : public TypedArray { |
| public: |
| static Local<Float32Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Float32Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Float32Array* Cast(Value* obj); |
| |
| private: |
| Float32Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of Float64Array constructor (ES6 draft 15.13.6). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Float64Array : public TypedArray { |
| public: |
| static Local<Float64Array> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<Float64Array> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static Float64Array* Cast(Value* obj); |
| |
| private: |
| Float64Array(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of DataView constructor (ES6 draft 15.13.7). |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT DataView : public ArrayBufferView { |
| public: |
| static Local<DataView> New(Local<ArrayBuffer> array_buffer, |
| size_t byte_offset, size_t length); |
| static Local<DataView> New(Local<SharedArrayBuffer> shared_array_buffer, |
| size_t byte_offset, size_t length); |
| V8_INLINE static DataView* Cast(Value* obj); |
| |
| private: |
| DataView(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in SharedArrayBuffer constructor. |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT SharedArrayBuffer : public Object { |
| public: |
| /** |
| * The contents of an |SharedArrayBuffer|. Externalization of |
| * |SharedArrayBuffer| returns an instance of this class, populated, with a |
| * pointer to data and byte length. |
| * |
| * The Data pointer of SharedArrayBuffer::Contents is always allocated with |
| * |ArrayBuffer::Allocator::Allocate| by the allocator specified in |
| * v8::Isolate::CreateParams::array_buffer_allocator. |
| * |
| * This API is experimental and may change significantly. |
| */ |
| class V8_EXPORT Contents { // NOLINT |
| public: |
| Contents() : data_(NULL), byte_length_(0) {} |
| |
| void* Data() const { return data_; } |
| size_t ByteLength() const { return byte_length_; } |
| |
| private: |
| void* data_; |
| size_t byte_length_; |
| |
| friend class SharedArrayBuffer; |
| }; |
| |
| |
| /** |
| * Data length in bytes. |
| */ |
| size_t ByteLength() const; |
| |
| /** |
| * Create a new SharedArrayBuffer. Allocate |byte_length| bytes. |
| * Allocated memory will be owned by a created SharedArrayBuffer and |
| * will be deallocated when it is garbage-collected, |
| * unless the object is externalized. |
| */ |
| static Local<SharedArrayBuffer> New(Isolate* isolate, size_t byte_length); |
| |
| /** |
| * Create a new SharedArrayBuffer over an existing memory block. The created |
| * array buffer is immediately in externalized state unless otherwise |
| * specified. The memory block will not be reclaimed when a created |
| * SharedArrayBuffer is garbage-collected. |
| */ |
| static Local<SharedArrayBuffer> New( |
| Isolate* isolate, void* data, size_t byte_length, |
| ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized); |
| |
| /** |
| * Returns true if SharedArrayBuffer is externalized, that is, does not |
| * own its memory block. |
| */ |
| bool IsExternal() const; |
| |
| /** |
| * Make this SharedArrayBuffer external. The pointer to underlying memory |
| * block and byte length are returned as |Contents| structure. After |
| * SharedArrayBuffer had been etxrenalized, it does no longer owns the memory |
| * block. The caller should take steps to free memory when it is no longer |
| * needed. |
| * |
| * The memory block is guaranteed to be allocated with |Allocator::Allocate| |
| * by the allocator specified in |
| * v8::Isolate::CreateParams::array_buffer_allocator. |
| * |
| */ |
| Contents Externalize(); |
| |
| /** |
| * Get a pointer to the ArrayBuffer's underlying memory block without |
| * externalizing it. If the ArrayBuffer is not externalized, this pointer |
| * will become invalid as soon as the ArrayBuffer became garbage collected. |
| * |
| * The embedder should make sure to hold a strong reference to the |
| * ArrayBuffer while accessing this pointer. |
| * |
| * The memory block is guaranteed to be allocated with |Allocator::Allocate| |
| * by the allocator specified in |
| * v8::Isolate::CreateParams::array_buffer_allocator. |
| */ |
| Contents GetContents(); |
| |
| V8_INLINE static SharedArrayBuffer* Cast(Value* obj); |
| |
| static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT; |
| |
| private: |
| SharedArrayBuffer(); |
| static void CheckCast(Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in Date constructor (ECMA-262, 15.9). |
| */ |
| class V8_EXPORT Date : public Object { |
| public: |
| static V8_DEPRECATE_SOON("Use maybe version.", |
| Local<Value> New(Isolate* isolate, double time)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<Value> New(Local<Context> context, |
| double time); |
| |
| /** |
| * A specialization of Value::NumberValue that is more efficient |
| * because we know the structure of this object. |
| */ |
| double ValueOf() const; |
| |
| V8_INLINE static Date* Cast(v8::Value* obj); |
| |
| /** |
| * Notification that the embedder has changed the time zone, |
| * daylight savings time, or other date / time configuration |
| * parameters. V8 keeps a cache of various values used for |
| * date / time computation. This notification will reset |
| * those cached values for the current context so that date / |
| * time configuration changes would be reflected in the Date |
| * object. |
| * |
| * This API should not be called more than needed as it will |
| * negatively impact the performance of date operations. |
| */ |
| static void DateTimeConfigurationChangeNotification(Isolate* isolate); |
| |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A Number object (ECMA-262, 4.3.21). |
| */ |
| class V8_EXPORT NumberObject : public Object { |
| public: |
| static Local<Value> New(Isolate* isolate, double value); |
| |
| double ValueOf() const; |
| |
| V8_INLINE static NumberObject* Cast(v8::Value* obj); |
| |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A Boolean object (ECMA-262, 4.3.15). |
| */ |
| class V8_EXPORT BooleanObject : public Object { |
| public: |
| static Local<Value> New(Isolate* isolate, bool value); |
| V8_DEPRECATE_SOON("Pass an isolate", static Local<Value> New(bool value)); |
| |
| bool ValueOf() const; |
| |
| V8_INLINE static BooleanObject* Cast(v8::Value* obj); |
| |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A String object (ECMA-262, 4.3.18). |
| */ |
| class V8_EXPORT StringObject : public Object { |
| public: |
| static Local<Value> New(Local<String> value); |
| |
| Local<String> ValueOf() const; |
| |
| V8_INLINE static StringObject* Cast(v8::Value* obj); |
| |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A Symbol object (ECMA-262 edition 6). |
| * |
| * This is an experimental feature. Use at your own risk. |
| */ |
| class V8_EXPORT SymbolObject : public Object { |
| public: |
| static Local<Value> New(Isolate* isolate, Local<Symbol> value); |
| |
| Local<Symbol> ValueOf() const; |
| |
| V8_INLINE static SymbolObject* Cast(v8::Value* obj); |
| |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * An instance of the built-in RegExp constructor (ECMA-262, 15.10). |
| */ |
| class V8_EXPORT RegExp : public Object { |
| public: |
| /** |
| * Regular expression flag bits. They can be or'ed to enable a set |
| * of flags. |
| */ |
| enum Flags { |
| kNone = 0, |
| kGlobal = 1, |
| kIgnoreCase = 2, |
| kMultiline = 4, |
| kSticky = 8, |
| kUnicode = 16 |
| }; |
| |
| /** |
| * Creates a regular expression from the given pattern string and |
| * the flags bit field. May throw a JavaScript exception as |
| * described in ECMA-262, 15.10.4.1. |
| * |
| * For example, |
| * RegExp::New(v8::String::New("foo"), |
| * static_cast<RegExp::Flags>(kGlobal | kMultiline)) |
| * is equivalent to evaluating "/foo/gm". |
| */ |
| static V8_DEPRECATE_SOON("Use maybe version", |
| Local<RegExp> New(Local<String> pattern, |
| Flags flags)); |
| static V8_WARN_UNUSED_RESULT MaybeLocal<RegExp> New(Local<Context> context, |
| Local<String> pattern, |
| Flags flags); |
| |
| /** |
| * Returns the value of the source property: a string representing |
| * the regular expression. |
| */ |
| Local<String> GetSource() const; |
| |
| /** |
| * Returns the flags bit field. |
| */ |
| Flags GetFlags() const; |
| |
| V8_INLINE static RegExp* Cast(v8::Value* obj); |
| |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| /** |
| * A JavaScript value that wraps a C++ void*. This type of value is mainly used |
| * to associate C++ data structures with JavaScript objects. |
| */ |
| class V8_EXPORT External : public Value { |
| public: |
| static Local<External> New(Isolate* isolate, void* value); |
| V8_INLINE static External* Cast(Value* obj); |
| void* Value() const; |
| private: |
| static void CheckCast(v8::Value* obj); |
| }; |
| |
| |
| #define V8_INTRINSICS_LIST(F) F(ArrayProto_values, array_values_iterator) |
| |
| enum Intrinsic { |
| #define V8_DECL_INTRINSIC(name, iname) k##name, |
| V8_INTRINSICS_LIST(V8_DECL_INTRINSIC) |
| #undef V8_DECL_INTRINSIC |
| }; |
| |
| |
| // --- Templates --- |
| |
| |
| /** |
| * The superclass of object and function templates. |
| */ |
| class V8_EXPORT Template : public Data { |
| public: |
| /** Adds a property to each instance created by this template.*/ |
| void Set(Local<Name> name, Local<Data> value, |
| PropertyAttribute attributes = None); |
| V8_INLINE void Set(Isolate* isolate, const char* name, Local<Data> value); |
| |
| void SetAccessorProperty( |
| Local<Name> name, |
| Local<FunctionTemplate> getter = Local<FunctionTemplate>(), |
| Local<FunctionTemplate> setter = Local<FunctionTemplate>(), |
| PropertyAttribute attribute = None, |
| AccessControl settings = DEFAULT); |
| |
| /** |
| * Whenever the property with the given name is accessed on objects |
| * created from this Template the getter and setter callbacks |
| * are called instead of getting and setting the property directly |
| * on the JavaScript object. |
| * |
| * \param name The name of the property for which an accessor is added. |
| * \param getter The callback to invoke when getting the property. |
| * \param setter The callback to invoke when setting the property. |
| * \param data A piece of data that will be passed to the getter and setter |
| * callbacks whenever they are invoked. |
| * \param settings Access control settings for the accessor. This is a bit |
| * field consisting of one of more of |
| * DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2. |
| * The default is to not allow cross-context access. |
| * ALL_CAN_READ means that all cross-context reads are allowed. |
| * ALL_CAN_WRITE means that all cross-context writes are allowed. |
| * The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all |
| * cross-context access. |
| * \param attribute The attributes of the property for which an accessor |
| * is added. |
| * \param signature The signature describes valid receivers for the accessor |
| * and is used to perform implicit instance checks against them. If the |
| * receiver is incompatible (i.e. is not an instance of the constructor as |
| * defined by FunctionTemplate::HasInstance()), an implicit TypeError is |
| * thrown and no callback is invoked. |
| */ |
| void SetNativeDataProperty( |
| Local<String> name, AccessorGetterCallback getter, |
| AccessorSetterCallback setter = 0, |
| // TODO(dcarney): gcc can't handle Local below |
| Local<Value> data = Local<Value>(), PropertyAttribute attribute = None, |
| Local<AccessorSignature> signature = Local<AccessorSignature>(), |
| AccessControl settings = DEFAULT); |
| void SetNativeDataProperty( |
| Local<Name> name, AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter = 0, |
| // TODO(dcarney): gcc can't handle Local below |
| Local<Value> data = Local<Value>(), PropertyAttribute attribute = None, |
| Local<AccessorSignature> signature = Local<AccessorSignature>(), |
| AccessControl settings = DEFAULT); |
| |
| /** |
| * During template instantiation, sets the value with the intrinsic property |
| * from the correct context. |
| */ |
| void SetIntrinsicDataProperty(Local<Name> name, Intrinsic intrinsic, |
| PropertyAttribute attribute = None); |
| |
| private: |
| Template(); |
| |
| friend class ObjectTemplate; |
| friend class FunctionTemplate; |
| }; |
| |
| |
| /** |
| * NamedProperty[Getter|Setter] are used as interceptors on object. |
| * See ObjectTemplate::SetNamedPropertyHandler. |
| */ |
| typedef void (*NamedPropertyGetterCallback)( |
| Local<String> property, |
| const PropertyCallbackInfo<Value>& info); |
| |
| |
| /** |
| * Returns the value if the setter intercepts the request. |
| * Otherwise, returns an empty handle. |
| */ |
| typedef void (*NamedPropertySetterCallback)( |
| Local<String> property, |
| Local<Value> value, |
| const PropertyCallbackInfo<Value>& info); |
| |
| |
| /** |
| * Returns a non-empty handle if the interceptor intercepts the request. |
| * The result is an integer encoding property attributes (like v8::None, |
| * v8::DontEnum, etc.) |
| */ |
| typedef void (*NamedPropertyQueryCallback)( |
| Local<String> property, |
| const PropertyCallbackInfo<Integer>& info); |
| |
| |
| /** |
| * Returns a non-empty handle if the deleter intercepts the request. |
| * The return value is true if the property could be deleted and false |
| * otherwise. |
| */ |
| typedef void (*NamedPropertyDeleterCallback)( |
| Local<String> property, |
| const PropertyCallbackInfo<Boolean>& info); |
| |
| |
| /** |
| * Returns an array containing the names of the properties the named |
| * property getter intercepts. |
| */ |
| typedef void (*NamedPropertyEnumeratorCallback)( |
| const PropertyCallbackInfo<Array>& info); |
| |
| |
| // TODO(dcarney): Deprecate and remove previous typedefs, and replace |
| // GenericNamedPropertyFooCallback with just NamedPropertyFooCallback. |
| /** |
| * GenericNamedProperty[Getter|Setter] are used as interceptors on object. |
| * See ObjectTemplate::SetNamedPropertyHandler. |
| */ |
| typedef void (*GenericNamedPropertyGetterCallback)( |
| Local<Name> property, const PropertyCallbackInfo<Value>& info); |
| |
| |
| /** |
| * Returns the value if the setter intercepts the request. |
| * Otherwise, returns an empty handle. |
| */ |
| typedef void (*GenericNamedPropertySetterCallback)( |
| Local<Name> property, Local<Value> value, |
| const PropertyCallbackInfo<Value>& info); |
| |
| |
| /** |
| * Returns a non-empty handle if the interceptor intercepts the request. |
| * The result is an integer encoding property attributes (like v8::None, |
| * v8::DontEnum, etc.) |
| */ |
| typedef void (*GenericNamedPropertyQueryCallback)( |
| Local<Name> property, const PropertyCallbackInfo<Integer>& info); |
| |
| |
| /** |
| * Returns a non-empty handle if the deleter intercepts the request. |
| * The return value is true if the property could be deleted and false |
| * otherwise. |
| */ |
| typedef void (*GenericNamedPropertyDeleterCallback)( |
| Local<Name> property, const PropertyCallbackInfo<Boolean>& info); |
| |
| |
| /** |
| * Returns an array containing the names of the properties the named |
| * property getter intercepts. |
| */ |
| typedef void (*GenericNamedPropertyEnumeratorCallback)( |
| const PropertyCallbackInfo<Array>& info); |
| |
| |
| /** |
| * Returns the value of the property if the getter intercepts the |
| * request. Otherwise, returns an empty handle. |
| */ |
| typedef void (*IndexedPropertyGetterCallback)( |
| uint32_t index, |
| const PropertyCallbackInfo<Value>& info); |
| |
| |
| /** |
| * Returns the value if the setter intercepts the request. |
| * Otherwise, returns an empty handle. |
| */ |
| typedef void (*IndexedPropertySetterCallback)( |
| uint32_t index, |
| Local<Value> value, |
| const PropertyCallbackInfo<Value>& info); |
| |
| |
| /** |
| * Returns a non-empty handle if the interceptor intercepts the request. |
| * The result is an integer encoding property attributes. |
| */ |
| typedef void (*IndexedPropertyQueryCallback)( |
| uint32_t index, |
| const PropertyCallbackInfo<Integer>& info); |
| |
| |
| /** |
| * Returns a non-empty handle if the deleter intercepts the request. |
| * The return value is true if the property could be deleted and false |
| * otherwise. |
| */ |
| typedef void (*IndexedPropertyDeleterCallback)( |
| uint32_t index, |
| const PropertyCallbackInfo<Boolean>& info); |
| |
| |
| /** |
| * Returns an array containing the indices of the properties the |
| * indexed property getter intercepts. |
| */ |
| typedef void (*IndexedPropertyEnumeratorCallback)( |
| const PropertyCallbackInfo<Array>& info); |
| |
| |
| /** |
| * Access type specification. |
| */ |
| enum AccessType { |
| ACCESS_GET, |
| ACCESS_SET, |
| ACCESS_HAS, |
| ACCESS_DELETE, |
| ACCESS_KEYS |
| }; |
| |
| |
| /** |
| * Returns true if the given context should be allowed to access the given |
| * object. |
| */ |
| typedef bool (*AccessCheckCallback)(Local<Context> accessing_context, |
| Local<Object> accessed_object); |
| |
| |
| /** |
| * Returns true if cross-context access should be allowed to the named |
| * property with the given key on the host object. |
| */ |
| typedef bool (*NamedSecurityCallback)(Local<Object> host, |
| Local<Value> key, |
| AccessType type, |
| Local<Value> data); |
| |
| |
| /** |
| * Returns true if cross-context access should be allowed to the indexed |
| * property with the given index on the host object. |
| */ |
| typedef bool (*IndexedSecurityCallback)(Local<Object> host, |
| uint32_t index, |
| AccessType type, |
| Local<Value> data); |
| |
| |
| /** |
| * A FunctionTemplate is used to create functions at runtime. There |
| * can only be one function created from a FunctionTemplate in a |
| * context. The lifetime of the created function is equal to the |
| * lifetime of the context. So in case the embedder needs to create |
| * temporary functions that can be collected using Scripts is |
| * preferred. |
| * |
| * Any modification of a FunctionTemplate after first instantiation will trigger |
| *a crash. |
| * |
| * A FunctionTemplate can have properties, these properties are added to the |
| * function object when it is created. |
| * |
| * A FunctionTemplate has a corresponding instance template which is |
| * used to create object instances when the function is used as a |
| * constructor. Properties added to the instance template are added to |
| * each object instance. |
| * |
| * A FunctionTemplate can have a prototype template. The prototype template |
| * is used to create the prototype object of the function. |
| * |
| * The following example shows how to use a FunctionTemplate: |
| * |
| * \code |
| * v8::Local<v8::FunctionTemplate> t = v8::FunctionTemplate::New(); |
| * t->Set("func_property", v8::Number::New(1)); |
| * |
| * v8::Local<v8::Template> proto_t = t->PrototypeTemplate(); |
| * proto_t->Set("proto_method", v8::FunctionTemplate::New(InvokeCallback)); |
| * proto_t->Set("proto_const", v8::Number::New(2)); |
| * |
| * v8::Local<v8::ObjectTemplate> instance_t = t->InstanceTemplate(); |
| * instance_t->SetAccessor("instance_accessor", InstanceAccessorCallback); |
| * instance_t->SetNamedPropertyHandler(PropertyHandlerCallback, ...); |
| * instance_t->Set("instance_property", Number::New(3)); |
| * |
| * v8::Local<v8::Function> function = t->GetFunction(); |
| * v8::Local<v8::Object> instance = function->NewInstance(); |
| * \endcode |
| * |
| * Let's use "function" as the JS variable name of the function object |
| * and "instance" for the instance object created above. The function |
| * and the instance will have the following properties: |
| * |
| * \code |
| * func_property in function == true; |
| * function.func_property == 1; |
| * |
| * function.prototype.proto_method() invokes 'InvokeCallback' |
| * function.prototype.proto_const == 2; |
| * |
| * instance instanceof function == true; |
| * instance.instance_accessor calls 'InstanceAccessorCallback' |
| * instance.instance_property == 3; |
| * \endcode |
| * |
| * A FunctionTemplate can inherit from another one by calling the |
| * FunctionTemplate::Inherit method. The following graph illustrates |
| * the semantics of inheritance: |
| * |
| * \code |
| * FunctionTemplate Parent -> Parent() . prototype -> { } |
| * ^ ^ |
| * | Inherit(Parent) | .__proto__ |
| * | | |
| * FunctionTemplate Child -> Child() . prototype -> { } |
| * \endcode |
| * |
| * A FunctionTemplate 'Child' inherits from 'Parent', the prototype |
| * object of the Child() function has __proto__ pointing to the |
| * Parent() function's prototype object. An instance of the Child |
| * function has all properties on Parent's instance templates. |
| * |
| * Let Parent be the FunctionTemplate initialized in the previous |
| * section and create a Child FunctionTemplate by: |
| * |
| * \code |
| * Local<FunctionTemplate> parent = t; |
| * Local<FunctionTemplate> child = FunctionTemplate::New(); |
| * child->Inherit(parent); |
| * |
| * Local<Function> child_function = child->GetFunction(); |
| * Local<Object> child_instance = child_function->NewInstance(); |
| * \endcode |
| * |
| * The Child function and Child instance will have the following |
| * properties: |
| * |
| * \code |
| * child_func.prototype.__proto__ == function.prototype; |
| * child_instance.instance_accessor calls 'InstanceAccessorCallback' |
| * child_instance.instance_property == 3; |
| * \endcode |
| */ |
| class V8_EXPORT FunctionTemplate : public Template { |
| public: |
| /** Creates a function template.*/ |
| static Local<FunctionTemplate> New( |
| Isolate* isolate, FunctionCallback callback = 0, |
| Local<Value> data = Local<Value>(), |
| Local<Signature> signature = Local<Signature>(), int length = 0); |
| |
| /** |
| * Creates a function template with a fast handler. If a fast handler is set, |
| * the callback cannot be null. |
| */ |
| static Local<FunctionTemplate> NewWithFastHandler( |
| Isolate* isolate, FunctionCallback callback, Local<Value> fast_handler, |
| Local<Value> data = Local<Value>(), |
| Local<Signature> signature = Local<Signature>(), int length = 0); |
| |
| /** Returns the unique function instance in the current execution context.*/ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Function> GetFunction()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Function> GetFunction( |
| Local<Context> context); |
| |
| /** |
| * Set the call-handler callback for a FunctionTemplate. This |
| * callback is called whenever the function created from this |
| * FunctionTemplate is called. |
| */ |
| void SetCallHandler(FunctionCallback callback, |
| Local<Value> data = Local<Value>(), |
| Local<Value> fast_handler = Local<Value>()); |
| |
| /** Set the predefined length property for the FunctionTemplate. */ |
| void SetLength(int length); |
| |
| /** Get the InstanceTemplate. */ |
| Local<ObjectTemplate> InstanceTemplate(); |
| |
| /** Causes the function template to inherit from a parent function template.*/ |
| void Inherit(Local<FunctionTemplate> parent); |
| |
| /** |
| * A PrototypeTemplate is the template used to create the prototype object |
| * of the function created by this template. |
| */ |
| Local<ObjectTemplate> PrototypeTemplate(); |
| |
| /** |
| * Set the class name of the FunctionTemplate. This is used for |
| * printing objects created with the function created from the |
| * FunctionTemplate as its constructor. |
| */ |
| void SetClassName(Local<String> name); |
| |
| |
| /** |
| * When set to true, no access check will be performed on the receiver of a |
| * function call. Currently defaults to true, but this is subject to change. |
| */ |
| void SetAcceptAnyReceiver(bool value); |
| |
| /** |
| * Determines whether the __proto__ accessor ignores instances of |
| * the function template. If instances of the function template are |
| * ignored, __proto__ skips all instances and instead returns the |
| * next object in the prototype chain. |
| * |
| * Call with a value of true to make the __proto__ accessor ignore |
| * instances of the function template. Call with a value of false |
| * to make the __proto__ accessor not ignore instances of the |
| * function template. By default, instances of a function template |
| * are not ignored. |
| */ |
| void SetHiddenPrototype(bool value); |
| |
| /** |
| * Sets the ReadOnly flag in the attributes of the 'prototype' property |
| * of functions created from this FunctionTemplate to true. |
| */ |
| void ReadOnlyPrototype(); |
| |
| /** |
| * Removes the prototype property from functions created from this |
| * FunctionTemplate. |
| */ |
| void RemovePrototype(); |
| |
| /** |
| * Returns true if the given object is an instance of this function |
| * template. |
| */ |
| bool HasInstance(Local<Value> object); |
| |
| private: |
| FunctionTemplate(); |
| friend class Context; |
| friend class ObjectTemplate; |
| }; |
| |
| |
| enum class PropertyHandlerFlags { |
| kNone = 0, |
| // See ALL_CAN_READ above. |
| kAllCanRead = 1, |
| // Will not call into interceptor for properties on the receiver or prototype |
| // chain. Currently only valid for named interceptors. |
| kNonMasking = 1 << 1, |
| // Will not call into interceptor for symbol lookup. Only meaningful for |
| // named interceptors. |
| kOnlyInterceptStrings = 1 << 2, |
| }; |
| |
| |
| struct NamedPropertyHandlerConfiguration { |
| NamedPropertyHandlerConfiguration( |
| /** Note: getter is required **/ |
| GenericNamedPropertyGetterCallback getter = 0, |
| GenericNamedPropertySetterCallback setter = 0, |
| GenericNamedPropertyQueryCallback query = 0, |
| GenericNamedPropertyDeleterCallback deleter = 0, |
| GenericNamedPropertyEnumeratorCallback enumerator = 0, |
| Local<Value> data = Local<Value>(), |
| PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) |
| : getter(getter), |
| setter(setter), |
| query(query), |
| deleter(deleter), |
| enumerator(enumerator), |
| data(data), |
| flags(flags) {} |
| |
| GenericNamedPropertyGetterCallback getter; |
| GenericNamedPropertySetterCallback setter; |
| GenericNamedPropertyQueryCallback query; |
| GenericNamedPropertyDeleterCallback deleter; |
| GenericNamedPropertyEnumeratorCallback enumerator; |
| Local<Value> data; |
| PropertyHandlerFlags flags; |
| }; |
| |
| |
| struct IndexedPropertyHandlerConfiguration { |
| IndexedPropertyHandlerConfiguration( |
| /** Note: getter is required **/ |
| IndexedPropertyGetterCallback getter = 0, |
| IndexedPropertySetterCallback setter = 0, |
| IndexedPropertyQueryCallback query = 0, |
| IndexedPropertyDeleterCallback deleter = 0, |
| IndexedPropertyEnumeratorCallback enumerator = 0, |
| Local<Value> data = Local<Value>(), |
| PropertyHandlerFlags flags = PropertyHandlerFlags::kNone) |
| : getter(getter), |
| setter(setter), |
| query(query), |
| deleter(deleter), |
| enumerator(enumerator), |
| data(data), |
| flags(flags) {} |
| |
| IndexedPropertyGetterCallback getter; |
| IndexedPropertySetterCallback setter; |
| IndexedPropertyQueryCallback query; |
| IndexedPropertyDeleterCallback deleter; |
| IndexedPropertyEnumeratorCallback enumerator; |
| Local<Value> data; |
| PropertyHandlerFlags flags; |
| }; |
| |
| |
| /** |
| * An ObjectTemplate is used to create objects at runtime. |
| * |
| * Properties added to an ObjectTemplate are added to each object |
| * created from the ObjectTemplate. |
| */ |
| class V8_EXPORT ObjectTemplate : public Template { |
| public: |
| /** Creates an ObjectTemplate. */ |
| static Local<ObjectTemplate> New( |
| Isolate* isolate, |
| Local<FunctionTemplate> constructor = Local<FunctionTemplate>()); |
| static V8_DEPRECATED("Use isolate version", Local<ObjectTemplate> New()); |
| |
| /** Creates a new instance of this template.*/ |
| V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance()); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(Local<Context> context); |
| |
| /** |
| * Sets an accessor on the object template. |
| * |
| * Whenever the property with the given name is accessed on objects |
| * created from this ObjectTemplate the getter and setter callbacks |
| * are called instead of getting and setting the property directly |
| * on the JavaScript object. |
| * |
| * \param name The name of the property for which an accessor is added. |
| * \param getter The callback to invoke when getting the property. |
| * \param setter The callback to invoke when setting the property. |
| * \param data A piece of data that will be passed to the getter and setter |
| * callbacks whenever they are invoked. |
| * \param settings Access control settings for the accessor. This is a bit |
| * field consisting of one of more of |
| * DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2. |
| * The default is to not allow cross-context access. |
| * ALL_CAN_READ means that all cross-context reads are allowed. |
| * ALL_CAN_WRITE means that all cross-context writes are allowed. |
| * The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all |
| * cross-context access. |
| * \param attribute The attributes of the property for which an accessor |
| * is added. |
| * \param signature The signature describes valid receivers for the accessor |
| * and is used to perform implicit instance checks against them. If the |
| * receiver is incompatible (i.e. is not an instance of the constructor as |
| * defined by FunctionTemplate::HasInstance()), an implicit TypeError is |
| * thrown and no callback is invoked. |
| */ |
| void SetAccessor( |
| Local<String> name, AccessorGetterCallback getter, |
| AccessorSetterCallback setter = 0, Local<Value> data = Local<Value>(), |
| AccessControl settings = DEFAULT, PropertyAttribute attribute = None, |
| Local<AccessorSignature> signature = Local<AccessorSignature>()); |
| void SetAccessor( |
| Local<Name> name, AccessorNameGetterCallback getter, |
| AccessorNameSetterCallback setter = 0, Local<Value> data = Local<Value>(), |
| AccessControl settings = DEFAULT, PropertyAttribute attribute = None, |
| Local<AccessorSignature> signature = Local<AccessorSignature>()); |
| |
| /** |
| * Sets a named property handler on the object template. |
| * |
| * Whenever a property whose name is a string is accessed on objects created |
| * from this object template, the provided callback is invoked instead of |
| * accessing the property directly on the JavaScript object. |
| * |
| * Note that new code should use the second version that can intercept |
| * symbol-named properties as well as string-named properties. |
| * |
| * \param getter The callback to invoke when getting a property. |
| * \param setter The callback to invoke when setting a property. |
| * \param query The callback to invoke to check if a property is present, |
| * and if present, get its attributes. |
| * \param deleter The callback to invoke when deleting a property. |
| * \param enumerator The callback to invoke to enumerate all the named |
| * properties of an object. |
| * \param data A piece of data that will be passed to the callbacks |
| * whenever they are invoked. |
| */ |
| // TODO(dcarney): deprecate |
| void SetNamedPropertyHandler(NamedPropertyGetterCallback getter, |
| NamedPropertySetterCallback setter = 0, |
| NamedPropertyQueryCallback query = 0, |
| NamedPropertyDeleterCallback deleter = 0, |
| NamedPropertyEnumeratorCallback enumerator = 0, |
| Local<Value> data = Local<Value>()); |
| void SetHandler(const NamedPropertyHandlerConfiguration& configuration); |
| |
| /** |
| * Sets an indexed property handler on the object template. |
| * |
| * Whenever an indexed property is accessed on objects created from |
| * this object template, the provided callback is invoked instead of |
| * accessing the property directly on the JavaScript object. |
| * |
| * \param getter The callback to invoke when getting a property. |
| * \param setter The callback to invoke when setting a property. |
| * \param query The callback to invoke to check if an object has a property. |
| * \param deleter The callback to invoke when deleting a property. |
| * \param enumerator The callback to invoke to enumerate all the indexed |
| * properties of an object. |
| * \param data A piece of data that will be passed to the callbacks |
| * whenever they are invoked. |
| */ |
| void SetHandler(const IndexedPropertyHandlerConfiguration& configuration); |
| // TODO(dcarney): deprecate |
| void SetIndexedPropertyHandler( |
| IndexedPropertyGetterCallback getter, |
| IndexedPropertySetterCallback setter = 0, |
| IndexedPropertyQueryCallback query = 0, |
| IndexedPropertyDeleterCallback deleter = 0, |
| IndexedPropertyEnumeratorCallback enumerator = 0, |
| Local<Value> data = Local<Value>()) { |
| SetHandler(IndexedPropertyHandlerConfiguration(getter, setter, query, |
| deleter, enumerator, data)); |
| } |
| /** |
| * Sets the callback to be used when calling instances created from |
| * this template as a function. If no callback is set, instances |
| * behave like normal JavaScript objects that cannot be called as a |
| * function. |
| */ |
| void SetCallAsFunctionHandler(FunctionCallback callback, |
| Local<Value> data = Local<Value>()); |
| |
| /** |
| * Mark object instances of the template as undetectable. |
| * |
| * In many ways, undetectable objects behave as though they are not |
| * there. They behave like 'undefined' in conditionals and when |
| * printed. However, properties can be accessed and called as on |
| * normal objects. |
| */ |
| void MarkAsUndetectable(); |
| |
| /** |
| * Sets access check callback on the object template and enables access |
| * checks. |
| * |
| * When accessing properties on instances of this object template, |
| * the access check callback will be called to determine whether or |
| * not to allow cross-context access to the properties. |
| */ |
| void SetAccessCheckCallback(AccessCheckCallback callback, |
| Local<Value> data = Local<Value>()); |
| |
| V8_DEPRECATE_SOON( |
| "Use SetAccessCheckCallback instead", |
| void SetAccessCheckCallbacks(NamedSecurityCallback named_handler, |
| IndexedSecurityCallback indexed_handler, |
| Local<Value> data = Local<Value>())); |
| |
| /** |
| * Gets the number of internal fields for objects generated from |
| * this template. |
| */ |
| int InternalFieldCount(); |
| |
| /** |
| * Sets the number of internal fields for objects generated from |
| * this template. |
| */ |
| void SetInternalFieldCount(int value); |
| |
| private: |
| ObjectTemplate(); |
| static Local<ObjectTemplate> New(internal::Isolate* isolate, |
| Local<FunctionTemplate> constructor); |
| friend class FunctionTemplate; |
| }; |
| |
| |
| /** |
| * A Signature specifies which receiver is valid for a function. |
| */ |
| class V8_EXPORT Signature : public Data { |
| public: |
| static Local<Signature> New( |
| Isolate* isolate, |
| Local<FunctionTemplate> receiver = Local<FunctionTemplate>()); |
| |
| private: |
| Signature(); |
| }; |
| |
| |
| /** |
| * An AccessorSignature specifies which receivers are valid parameters |
| * to an accessor callback. |
| */ |
| class V8_EXPORT AccessorSignature : public Data { |
| public: |
| static Local<AccessorSignature> New( |
| Isolate* isolate, |
| Local<FunctionTemplate> receiver = Local<FunctionTemplate>()); |
| |
| private: |
| AccessorSignature(); |
| }; |
| |
| |
| // --- Extensions --- |
| |
| class V8_EXPORT ExternalOneByteStringResourceImpl |
| : public String::ExternalOneByteStringResource { |
| public: |
| ExternalOneByteStringResourceImpl() : data_(0), length_(0) {} |
| ExternalOneByteStringResourceImpl(const char* data, size_t length) |
| : data_(data), length_(length) {} |
| const char* data() const { return data_; } |
| size_t length() const { return length_; } |
| |
| private: |
| const char* data_; |
| size_t length_; |
| }; |
| |
| /** |
| * Ignore |
| */ |
| class V8_EXPORT Extension { // NOLINT |
| public: |
| // Note that the strings passed into this constructor must live as long |
| // as the Extension itself. |
| Extension(const char* name, |
| const char* source = 0, |
| int dep_count = 0, |
| const char** deps = 0, |
| int source_length = -1); |
| virtual ~Extension() { } |
| virtual v8::Local<v8::FunctionTemplate> GetNativeFunctionTemplate( |
| v8::Isolate* isolate, v8::Local<v8::String> name) { |
| return v8::Local<v8::FunctionTemplate>(); |
| } |
| |
| const char* name() const { return name_; } |
| size_t source_length() const { return source_length_; } |
| const String::ExternalOneByteStringResource* source() const { |
| return &source_; } |
| int dependency_count() { return dep_count_; } |
| const char** dependencies() { return deps_; } |
| void set_auto_enable(bool value) { auto_enable_ = value; } |
| bool auto_enable() { return auto_enable_; } |
| |
| private: |
| const char* name_; |
| size_t source_length_; // expected to initialize before source_ |
| ExternalOneByteStringResourceImpl source_; |
| int dep_count_; |
| const char** deps_; |
| bool auto_enable_; |
| |
| // Disallow copying and assigning. |
| Extension(const Extension&); |
| void operator=(const Extension&); |
| }; |
| |
| |
| void V8_EXPORT RegisterExtension(Extension* extension); |
| |
| |
| // --- Statics --- |
| |
| V8_INLINE Local<Primitive> Undefined(Isolate* isolate); |
| V8_INLINE Local<Primitive> Null(Isolate* isolate); |
| V8_INLINE Local<Boolean> True(Isolate* isolate); |
| V8_INLINE Local<Boolean> False(Isolate* isolate); |
| |
| |
| /** |
| * A set of constraints that specifies the limits of the runtime's memory use. |
| * You must set the heap size before initializing the VM - the size cannot be |
| * adjusted after the VM is initialized. |
| * |
| * If you are using threads then you should hold the V8::Locker lock while |
| * setting the stack limit and you must set a non-default stack limit separately |
| * for each thread. |
| */ |
| class V8_EXPORT ResourceConstraints { |
| public: |
| ResourceConstraints(); |
| |
| /** |
| * Configures the constraints with reasonable default values based on the |
| * capabilities of the current device the VM is running on. |
| * |
| * \param physical_memory The total amount of physical memory on the current |
| * device, in bytes. |
| * \param virtual_memory_limit The amount of virtual memory on the current |
| * device, in bytes, or zero, if there is no limit. |
| */ |
| void ConfigureDefaults(uint64_t physical_memory, |
| uint64_t virtual_memory_limit); |
| |
| int max_semi_space_size() const { return max_semi_space_size_; } |
| void set_max_semi_space_size(int value) { max_semi_space_size_ = value; } |
| int max_old_space_size() const { return max_old_space_size_; } |
| void set_max_old_space_size(int value) { max_old_space_size_ = value; } |
| int max_executable_size() const { return max_executable_size_; } |
| void set_max_executable_size(int value) { max_executable_size_ = value; } |
| uint32_t* stack_limit() const { return stack_limit_; } |
| // Sets an address beyond which the VM's stack may not grow. |
| void set_stack_limit(uint32_t* value) { stack_limit_ = value; } |
| size_t code_range_size() const { return code_range_size_; } |
| void set_code_range_size(size_t value) { |
| code_range_size_ = value; |
| } |
| |
| private: |
| int max_semi_space_size_; |
| int max_old_space_size_; |
| int max_executable_size_; |
| uint32_t* stack_limit_; |
| size_t code_range_size_; |
| }; |
| |
| |
| // --- Exceptions --- |
| |
| |
| typedef void (*FatalErrorCallback)(const char* location, const char* message); |
| |
| |
| typedef void (*MessageCallback)(Local<Message> message, Local<Value> error); |
| |
| // --- Tracing --- |
| |
| typedef void (*LogEventCallback)(const char* name, int event); |
| |
| /** |
| * Create new error objects by calling the corresponding error object |
| * constructor with the message. |
| */ |
| class V8_EXPORT Exception { |
| public: |
| static Local<Value> RangeError(Local<String> message); |
| static Local<Value> ReferenceError(Local<String> message); |
| static Local<Value> SyntaxError(Local<String> message); |
| static Local<Value> TypeError(Local<String> message); |
| static Local<Value> Error(Local<String> message); |
| |
| /** |
| * Creates an error message for the given exception. |
| * Will try to reconstruct the original stack trace from the exception value, |
| * or capture the current stack trace if not available. |
| */ |
| static Local<Message> CreateMessage(Isolate* isolate, Local<Value> exception); |
| V8_DEPRECATE_SOON( |
| "Use version with an Isolate*", |
| static Local<Message> CreateMessage(Local<Value> exception)); |
| |
| /** |
| * Returns the original stack trace that was captured at the creation time |
| * of a given exception, or an empty handle if not available. |
| */ |
| static Local<StackTrace> GetStackTrace(Local<Value> exception); |
| }; |
| |
| |
| // --- Counters Callbacks --- |
| |
| typedef int* (*CounterLookupCallback)(const char* name); |
| |
| typedef void* (*CreateHistogramCallback)(const char* name, |
| int min, |
| int max, |
| size_t buckets); |
| |
| typedef void (*AddHistogramSampleCallback)(void* histogram, int sample); |
| |
| // --- Memory Allocation Callback --- |
| enum ObjectSpace { |
| kObjectSpaceNewSpace = 1 << 0, |
| kObjectSpaceOldSpace = 1 << 1, |
| kObjectSpaceCodeSpace = 1 << 2, |
| kObjectSpaceMapSpace = 1 << 3, |
| kObjectSpaceLoSpace = 1 << 4, |
| kObjectSpaceAll = kObjectSpaceNewSpace | kObjectSpaceOldSpace | |
| kObjectSpaceCodeSpace | kObjectSpaceMapSpace | |
| kObjectSpaceLoSpace |
| }; |
| |
| enum AllocationAction { |
| kAllocationActionAllocate = 1 << 0, |
| kAllocationActionFree = 1 << 1, |
| kAllocationActionAll = kAllocationActionAllocate | kAllocationActionFree |
| }; |
| |
| typedef void (*MemoryAllocationCallback)(ObjectSpace space, |
| AllocationAction action, |
| int size); |
| |
| // --- Leave Script Callback --- |
| typedef void (*CallCompletedCallback)(); |
| |
| // --- Promise Reject Callback --- |
| enum PromiseRejectEvent { |
| kPromiseRejectWithNoHandler = 0, |
| kPromiseHandlerAddedAfterReject = 1 |
| }; |
| |
| class PromiseRejectMessage { |
| public: |
| PromiseRejectMessage(Local<Promise> promise, PromiseRejectEvent event, |
| Local<Value> value, Local<StackTrace> stack_trace) |
| : promise_(promise), |
| event_(event), |
| value_(value), |
| stack_trace_(stack_trace) {} |
| |
| V8_INLINE Local<Promise> GetPromise() const { return promise_; } |
| V8_INLINE PromiseRejectEvent GetEvent() const { return event_; } |
| V8_INLINE Local<Value> GetValue() const { return value_; } |
| |
| V8_DEPRECATED("Use v8::Exception::CreateMessage(GetValue())->GetStackTrace()", |
| V8_INLINE Local<StackTrace> GetStackTrace() const) { |
| return stack_trace_; |
| } |
| |
| private: |
| Local<Promise> promise_; |
| PromiseRejectEvent event_; |
| Local<Value> value_; |
| Local<StackTrace> stack_trace_; |
| }; |
| |
| typedef void (*PromiseRejectCallback)(PromiseRejectMessage message); |
| |
| // --- Microtask Callback --- |
| typedef void (*MicrotaskCallback)(void* data); |
| |
| // --- Failed Access Check Callback --- |
| typedef void (*FailedAccessCheckCallback)(Local<Object> target, |
| AccessType type, |
| Local<Value> data); |
| |
| // --- AllowCodeGenerationFromStrings callbacks --- |
| |
| /** |
| * Callback to check if code generation from strings is allowed. See |
| * Context::AllowCodeGenerationFromStrings. |
| */ |
| typedef bool (*AllowCodeGenerationFromStringsCallback)(Local<Context> context); |
| |
| // --- Garbage Collection Callbacks --- |
| |
| /** |
| * Applications can register callback functions which will be called before and |
| * after certain garbage collection operations. Allocations are not allowed in |
| * the callback functions, you therefore cannot manipulate objects (set or |
| * delete properties for example) since it is possible such operations will |
| * result in the allocation of objects. |
| */ |
| enum GCType { |
| kGCTypeScavenge = 1 << 0, |
| kGCTypeMarkSweepCompact = 1 << 1, |
| kGCTypeIncrementalMarking = 1 << 2, |
| kGCTypeProcessWeakCallbacks = 1 << 3, |
| kGCTypeAll = kGCTypeScavenge | kGCTypeMarkSweepCompact | |
| kGCTypeIncrementalMarking | kGCTypeProcessWeakCallbacks |
| }; |
| |
| enum GCCallbackFlags { |
| kNoGCCallbackFlags = 0, |
| kGCCallbackFlagConstructRetainedObjectInfos = 1 << 1, |
| kGCCallbackFlagForced = 1 << 2, |
| kGCCallbackFlagSynchronousPhantomCallbackProcessing = 1 << 3 |
| }; |
| |
| V8_DEPRECATE_SOON("Use GCCallBack instead", |
| typedef void (*GCPrologueCallback)(GCType type, |
| GCCallbackFlags flags)); |
| V8_DEPRECATE_SOON("Use GCCallBack instead", |
| typedef void (*GCEpilogueCallback)(GCType type, |
| GCCallbackFlags flags)); |
| typedef void (*GCCallback)(GCType type, GCCallbackFlags flags); |
| |
| typedef void (*InterruptCallback)(Isolate* isolate, void* data); |
| |
| |
| /** |
| * Collection of V8 heap information. |
| * |
| * Instances of this class can be passed to v8::V8::HeapStatistics to |
| * get heap statistics from V8. |
| */ |
| class V8_EXPORT HeapStatistics { |
| public: |
| HeapStatistics(); |
| size_t total_heap_size() { return total_heap_size_; } |
| size_t total_heap_size_executable() { return total_heap_size_executable_; } |
| size_t total_physical_size() { return total_physical_size_; } |
| size_t total_available_size() { return total_available_size_; } |
| size_t used_heap_size() { return used_heap_size_; } |
| size_t heap_size_limit() { return heap_size_limit_; } |
| size_t does_zap_garbage() { return does_zap_garbage_; } |
| |
| private: |
| size_t total_heap_size_; |
| size_t total_heap_size_executable_; |
| size_t total_physical_size_; |
| size_t total_available_size_; |
| size_t used_heap_size_; |
| size_t heap_size_limit_; |
| bool does_zap_garbage_; |
| |
| friend class V8; |
| friend class Isolate; |
| }; |
| |
| |
| class V8_EXPORT HeapSpaceStatistics { |
| public: |
| HeapSpaceStatistics(); |
| const char* space_name() { return space_name_; } |
| size_t space_size() { return space_size_; } |
| size_t space_used_size() { return space_used_size_; } |
| size_t space_available_size() { return space_available_size_; } |
| size_t physical_space_size() { return physical_space_size_; } |
| |
| private: |
| const char* space_name_; |
| size_t space_size_; |
| size_t space_used_size_; |
| size_t space_available_size_; |
| size_t physical_space_size_; |
| |
| friend class Isolate; |
| }; |
| |
| |
| class V8_EXPORT HeapObjectStatistics { |
| public: |
| HeapObjectStatistics(); |
| const char* object_type() { return object_type_; } |
| const char* object_sub_type() { return object_sub_type_; } |
| size_t object_count() { return object_count_; } |
| size_t object_size() { return object_size_; } |
| |
| private: |
| const char* object_type_; |
| const char* object_sub_type_; |
| size_t object_count_; |
| size_t object_size_; |
| |
| friend class Isolate; |
| }; |
| |
| |
| class RetainedObjectInfo; |
| |
| |
| /** |
| * FunctionEntryHook is the type of the profile entry hook called at entry to |
| * any generated function when function-level profiling is enabled. |
| * |
| * \param function the address of the function that's being entered. |
| * \param return_addr_location points to a location on stack where the machine |
| * return address resides. This can be used to identify the caller of |
| * \p function, and/or modified to divert execution when \p function exits. |
| * |
| * \note the entry hook must not cause garbage collection. |
| */ |
| typedef void (*FunctionEntryHook)(uintptr_t function, |
| uintptr_t return_addr_location); |
| |
| /** |
| * A JIT code event is issued each time code is added, moved or removed. |
| * |
| * \note removal events are not currently issued. |
| */ |
| struct JitCodeEvent { |
| enum EventType { |
| CODE_ADDED, |
| CODE_MOVED, |
| CODE_REMOVED, |
| CODE_ADD_LINE_POS_INFO, |
| CODE_START_LINE_INFO_RECORDING, |
| CODE_END_LINE_INFO_RECORDING |
| }; |
| // Definition of the code position type. The "POSITION" type means the place |
| // in the source code which are of interest when making stack traces to |
| // pin-point the source location of a stack frame as close as possible. |
| // The "STATEMENT_POSITION" means the place at the beginning of each |
| // statement, and is used to indicate possible break locations. |
| enum PositionType { POSITION, STATEMENT_POSITION }; |
| |
| // Type of event. |
| EventType type; |
| // Start of the instructions. |
| void* code_start; |
| // Size of the instructions. |
| size_t code_len; |
| // Script info for CODE_ADDED event. |
| Local<UnboundScript> script; |
| // User-defined data for *_LINE_INFO_* event. It's used to hold the source |
| // code line information which is returned from the |
| // CODE_START_LINE_INFO_RECORDING event. And it's passed to subsequent |
| // CODE_ADD_LINE_POS_INFO and CODE_END_LINE_INFO_RECORDING events. |
| void* user_data; |
| |
| struct name_t { |
| // Name of the object associated with the code, note that the string is not |
| // zero-terminated. |
| const char* str; |
| // Number of chars in str. |
| size_t len; |
| }; |
| |
| struct line_info_t { |
| // PC offset |
| size_t offset; |
| // Code postion |
| size_t pos; |
| // The position type. |
| PositionType position_type; |
| }; |
| |
| union { |
| // Only valid for CODE_ADDED. |
| struct name_t name; |
| |
| // Only valid for CODE_ADD_LINE_POS_INFO |
| struct line_info_t line_info; |
| |
| // New location of instructions. Only valid for CODE_MOVED. |
| void* new_code_start; |
| }; |
| }; |
| |
| /** |
| * Option flags passed to the SetJitCodeEventHandler function. |
| */ |
| enum JitCodeEventOptions { |
| kJitCodeEventDefault = 0, |
| // Generate callbacks for already existent code. |
| kJitCodeEventEnumExisting = 1 |
| }; |
| |
| |
| /** |
| * Callback function passed to SetJitCodeEventHandler. |
| * |
| * \param event code add, move or removal event. |
| */ |
| typedef void (*JitCodeEventHandler)(const JitCodeEvent* event); |
| |
| |
| /** |
| * Interface for iterating through all external resources in the heap. |
| */ |
| class V8_EXPORT ExternalResourceVisitor { // NOLINT |
| public: |
| virtual ~ExternalResourceVisitor() {} |
| virtual void VisitExternalString(Local<String> string) {} |
| }; |
| |
| |
| /** |
| * Interface for iterating through all the persistent handles in the heap. |
| */ |
| class V8_EXPORT PersistentHandleVisitor { // NOLINT |
| public: |
| virtual ~PersistentHandleVisitor() {} |
| virtual void VisitPersistentHandle(Persistent<Value>* value, |
| uint16_t class_id) {} |
| }; |
| |
| |
| /** |
| * Isolate represents an isolated instance of the V8 engine. V8 isolates have |
| * completely separate states. Objects from one isolate must not be used in |
| * other isolates. The embedder can create multiple isolates and use them in |
| * parallel in multiple threads. An isolate can be entered by at most one |
| * thread at any given time. The Locker/Unlocker API must be used to |
| * synchronize. |
| */ |
| class V8_EXPORT Isolate { |
| public: |
| /** |
| * Initial configuration parameters for a new Isolate. |
| */ |
| struct CreateParams { |
| CreateParams() |
| : entry_hook(NULL), |
| code_event_handler(NULL), |
| snapshot_blob(NULL), |
| counter_lookup_callback(NULL), |
| create_histogram_callback(NULL), |
| add_histogram_sample_callback(NULL), |
| array_buffer_allocator(NULL) {} |
| |
| /** |
| * The optional entry_hook allows the host application to provide the |
| * address of a function that's invoked on entry to every V8-generated |
| * function. Note that entry_hook is invoked at the very start of each |
| * generated function. Furthermore, if an entry_hook is given, V8 will |
| * always run without a context snapshot. |
| */ |
| FunctionEntryHook entry_hook; |
| |
| /** |
| * Allows the host application to provide the address of a function that is |
| * notified each time code is added, moved or removed. |
| */ |
| JitCodeEventHandler code_event_handler; |
| |
| /** |
| * ResourceConstraints to use for the new Isolate. |
| */ |
| ResourceConstraints constraints; |
| |
| /** |
| * Explicitly specify a startup snapshot blob. The embedder owns the blob. |
| */ |
| StartupData* snapshot_blob; |
| |
| |
| /** |
| * Enables the host application to provide a mechanism for recording |
| * statistics counters. |
| */ |
| CounterLookupCallback counter_lookup_callback; |
| |
| /** |
| * Enables the host application to provide a mechanism for recording |
| * histograms. The CreateHistogram function returns a |
| * histogram which will later be passed to the AddHistogramSample |
| * function. |
| */ |
| CreateHistogramCallback create_histogram_callback; |
| AddHistogramSampleCallback add_histogram_sample_callback; |
| |
| /** |
| * The ArrayBuffer::Allocator to use for allocating and freeing the backing |
| * store of ArrayBuffers. |
| */ |
| ArrayBuffer::Allocator* array_buffer_allocator; |
| }; |
| |
| |
| /** |
| * Stack-allocated class which sets the isolate for all operations |
| * executed within a local scope. |
| */ |
| class V8_EXPORT Scope { |
| public: |
| explicit Scope(Isolate* isolate) : isolate_(isolate) { |
| isolate->Enter(); |
| } |
| |
| ~Scope() { isolate_->Exit(); } |
| |
| private: |
| Isolate* const isolate_; |
| |
| // Prevent copying of Scope objects. |
| Scope(const Scope&); |
| Scope& operator=(const Scope&); |
| }; |
| |
| |
| /** |
| * Assert that no Javascript code is invoked. |
| */ |
| class V8_EXPORT DisallowJavascriptExecutionScope { |
| public: |
| enum OnFailure { CRASH_ON_FAILURE, THROW_ON_FAILURE }; |
| |
| DisallowJavascriptExecutionScope(Isolate* isolate, OnFailure on_failure); |
| ~DisallowJavascriptExecutionScope(); |
| |
| private: |
| bool on_failure_; |
| void* internal_; |
| |
| // Prevent copying of Scope objects. |
| DisallowJavascriptExecutionScope(const DisallowJavascriptExecutionScope&); |
| DisallowJavascriptExecutionScope& operator=( |
| const DisallowJavascriptExecutionScope&); |
| }; |
| |
| |
| /** |
| * Introduce exception to DisallowJavascriptExecutionScope. |
| */ |
| class V8_EXPORT AllowJavascriptExecutionScope { |
| public: |
| explicit AllowJavascriptExecutionScope(Isolate* isolate); |
| ~AllowJavascriptExecutionScope(); |
| |
| private: |
| void* internal_throws_; |
| void* internal_assert_; |
| |
| // Prevent copying of Scope objects. |
| AllowJavascriptExecutionScope(const AllowJavascriptExecutionScope&); |
| AllowJavascriptExecutionScope& operator=( |
| const AllowJavascriptExecutionScope&); |
| }; |
| |
| /** |
| * Do not run microtasks while this scope is active, even if microtasks are |
| * automatically executed otherwise. |
| */ |
| class V8_EXPORT SuppressMicrotaskExecutionScope { |
| public: |
| explicit SuppressMicrotaskExecutionScope(Isolate* isolate); |
| ~SuppressMicrotaskExecutionScope(); |
| |
| private: |
| internal::Isolate* isolate_; |
| |
| // Prevent copying of Scope objects. |
| SuppressMicrotaskExecutionScope(const SuppressMicrotaskExecutionScope&); |
| SuppressMicrotaskExecutionScope& operator=( |
| const SuppressMicrotaskExecutionScope&); |
| }; |
| |
| /** |
| * Types of garbage collections that can be requested via |
| * RequestGarbageCollectionForTesting. |
| */ |
| enum GarbageCollectionType { |
| kFullGarbageCollection, |
| kMinorGarbageCollection |
| }; |
| |
| /** |
| * Features reported via the SetUseCounterCallback callback. Do not change |
| * assigned numbers of existing items; add new features to the end of this |
| * list. |
| */ |
| enum UseCounterFeature { |
| kUseAsm = 0, |
| kBreakIterator = 1, |
| kLegacyConst = 2, |
| kMarkDequeOverflow = 3, |
| kStoreBufferOverflow = 4, |
| kSlotsBufferOverflow = 5, |
| kObjectObserve = 6, |
| kForcedGC = 7, |
| kSloppyMode = 8, |
| kStrictMode = 9, |
| kStrongMode = 10, |
| kUseCounterFeatureCount // This enum value must be last. |
| }; |
| |
| typedef void (*UseCounterCallback)(Isolate* isolate, |
| UseCounterFeature feature); |
| |
| |
| /** |
| * Creates a new isolate. Does not change the currently entered |
| * isolate. |
| * |
| * When an isolate is no longer used its resources should be freed |
| * by calling Dispose(). Using the delete operator is not allowed. |
| * |
| * V8::Initialize() must have run prior to this. |
| */ |
| static Isolate* New(const CreateParams& params); |
| |
| /** |
| * Returns the entered isolate for the current thread or NULL in |
| * case there is no current isolate. |
| * |
| * This method must not be invoked before V8::Initialize() was invoked. |
| */ |
| static Isolate* GetCurrent(); |
| |
| /** |
| * Custom callback used by embedders to help V8 determine if it should abort |
| * when it throws and no internal handler is predicted to catch the |
| * exception. If --abort-on-uncaught-exception is used on the command line, |
| * then V8 will abort if either: |
| * - no custom callback is set. |
| * - the custom callback set returns true. |
| * Otherwise, the custom callback will not be called and V8 will not abort. |
| */ |
| typedef bool (*AbortOnUncaughtExceptionCallback)(Isolate*); |
| void SetAbortOnUncaughtExceptionCallback( |
| AbortOnUncaughtExceptionCallback callback); |
| |
| /** |
| * Methods below this point require holding a lock (using Locker) in |
| * a multi-threaded environment. |
| */ |
| |
| /** |
| * Sets this isolate as the entered one for the current thread. |
| * Saves the previously entered one (if any), so that it can be |
| * restored when exiting. Re-entering an isolate is allowed. |
| */ |
| void Enter(); |
| |
| /** |
| * Exits this isolate by restoring the previously entered one in the |
| * current thread. The isolate may still stay the same, if it was |
| * entered more than once. |
| * |
| * Requires: this == Isolate::GetCurrent(). |
| */ |
| void Exit(); |
| |
| /** |
| * Disposes the isolate. The isolate must not be entered by any |
| * thread to be disposable. |
| */ |
| void Dispose(); |
| |
| /** |
| * Associate embedder-specific data with the isolate. |slot| has to be |
| * between 0 and GetNumberOfDataSlots() - 1. |
| */ |
| V8_INLINE void SetData(uint32_t slot, void* data); |
| |
| /** |
| * Retrieve embedder-specific data from the isolate. |
| * Returns NULL if SetData has never been called for the given |slot|. |
| */ |
| V8_INLINE void* GetData(uint32_t slot); |
| |
| /** |
| * Returns the maximum number of available embedder data slots. Valid slots |
| * are in the range of 0 - GetNumberOfDataSlots() - 1. |
| */ |
| V8_INLINE static uint32_t GetNumberOfDataSlots(); |
| |
| /** |
| * Get statistics about the heap memory usage. |
| */ |
| void GetHeapStatistics(HeapStatistics* heap_statistics); |
| |
| /** |
| * Returns the number of spaces in the heap. |
| */ |
| size_t NumberOfHeapSpaces(); |
| |
| /** |
| * Get the memory usage of a space in the heap. |
| * |
| * \param space_statistics The HeapSpaceStatistics object to fill in |
| * statistics. |
| * \param index The index of the space to get statistics from, which ranges |
| * from 0 to NumberOfHeapSpaces() - 1. |
| * \returns true on success. |
| */ |
| bool GetHeapSpaceStatistics(HeapSpaceStatistics* space_statistics, |
| size_t index); |
| |
| /** |
| * Returns the number of types of objects tracked in the heap at GC. |
| */ |
| size_t NumberOfTrackedHeapObjectTypes(); |
| |
| /** |
| * Get statistics about objects in the heap. |
| * |
| * \param object_statistics The HeapObjectStatistics object to fill in |
| * statistics of objects of given type, which were live in the previous GC. |
| * \param type_index The index of the type of object to fill details about, |
| * which ranges from 0 to NumberOfTrackedHeapObjectTypes() - 1. |
| * \returns true on success. |
| */ |
| bool GetHeapObjectStatisticsAtLastGC(HeapObjectStatistics* object_statistics, |
| size_t type_index); |
| |
| /** |
| * Get a call stack sample from the isolate. |
| * \param state Execution state. |
| * \param frames Caller allocated buffer to store stack frames. |
| * \param frames_limit Maximum number of frames to capture. The buffer must |
| * be large enough to hold the number of frames. |
| * \param sample_info The sample info is filled up by the function |
| * provides number of actual captured stack frames and |
| * the current VM state. |
| * \note GetStackSample should only be called when the JS thread is paused or |
| * interrupted. Otherwise the behavior is undefined. |
| */ |
| void GetStackSample(const RegisterState& state, void** frames, |
| size_t frames_limit, SampleInfo* sample_info); |
| |
| /** |
| * Adjusts the amount of registered external memory. Used to give V8 an |
| * indication of the amount of externally allocated memory that is kept alive |
| * by JavaScript objects. V8 uses this to decide when to perform global |
| * garbage collections. Registering externally allocated memory will trigger |
| * global garbage collections more often than it would otherwise in an attempt |
| * to garbage collect the JavaScript objects that keep the externally |
| * allocated memory alive. |
| * |
| * \param change_in_bytes the change in externally allocated memory that is |
| * kept alive by JavaScript objects. |
| * \returns the adjusted value. |
| */ |
| V8_INLINE int64_t |
| AdjustAmountOfExternalAllocatedMemory(int64_t change_in_bytes); |
| |
| /** |
| * Returns heap profiler for this isolate. Will return NULL until the isolate |
| * is initialized. |
| */ |
| HeapProfiler* GetHeapProfiler(); |
| |
| /** |
| * Returns CPU profiler for this isolate. Will return NULL unless the isolate |
| * is initialized. It is the embedder's responsibility to stop all CPU |
| * profiling activities if it has started any. |
| */ |
| CpuProfiler* GetCpuProfiler(); |
| |
| /** Returns true if this isolate has a current context. */ |
| bool InContext(); |
| |
| /** |
| * Returns the context of the currently running JavaScript, or the context |
| * on the top of the stack if no JavaScript is running. |
| */ |
| Local<Context> GetCurrentContext(); |
| |
| /** |
| * Returns the context of the calling JavaScript code. That is the |
| * context of the top-most JavaScript frame. If there are no |
| * JavaScript frames an empty handle is returned. |
| */ |
| V8_DEPRECATE_SOON( |
| "Calling context concept is not compatible with tail calls, and will be " |
| "removed.", |
| Local<Context> GetCallingContext()); |
| |
| /** Returns the last context entered through V8's C++ API. */ |
| Local<Context> GetEnteredContext(); |
| |
| /** |
| * Schedules an exception to be thrown when returning to JavaScript. When an |
| * exception has been scheduled it is illegal to invoke any JavaScript |
| * operation; the caller must return immediately and only after the exception |
| * has been handled does it become legal to invoke JavaScript operations. |
| */ |
| Local<Value> ThrowException(Local<Value> exception); |
| |
| /** |
| * Allows the host application to group objects together. If one |
| * object in the group is alive, all objects in the group are alive. |
| * After each garbage collection, object groups are removed. It is |
| * intended to be used in the before-garbage-collection callback |
| * function, for instance to simulate DOM tree connections among JS |
| * wrapper objects. Object groups for all dependent handles need to |
| * be provided for kGCTypeMarkSweepCompact collections, for all other |
| * garbage collection types it is sufficient to provide object groups |
| * for partially dependent handles only. |
| */ |
| template<typename T> void SetObjectGroupId(const Persistent<T>& object, |
| UniqueId id); |
| |
| /** |
| * Allows the host application to declare implicit references from an object |
| * group to an object. If the objects of the object group are alive, the child |
| * object is alive too. After each garbage collection, all implicit references |
| * are removed. It is intended to be used in the before-garbage-collection |
| * callback function. |
| */ |
| template<typename T> void SetReferenceFromGroup(UniqueId id, |
| const Persistent<T>& child); |
| |
| /** |
| * Allows the host application to declare implicit references from an object |
| * to another object. If the parent object is alive, the child object is alive |
| * too. After each garbage collection, all implicit references are removed. It |
| * is intended to be used in the before-garbage-collection callback function. |
| */ |
| template<typename T, typename S> |
| void SetReference(const Persistent<T>& parent, const Persistent<S>& child); |
| |
| V8_DEPRECATE_SOON("Use GCCallBack instead", |
| typedef void (*GCPrologueCallback)(Isolate* isolate, |
| GCType type, |
| GCCallbackFlags flags)); |
| V8_DEPRECATE_SOON("Use GCCallBack instead", |
| typedef void (*GCEpilogueCallback)(Isolate* isolate, |
| GCType type, |
| GCCallbackFlags flags)); |
| typedef void (*GCCallback)(Isolate* isolate, GCType type, |
| GCCallbackFlags flags); |
| |
| /** |
| * Enables the host application to receive a notification before a |
| * garbage collection. Allocations are allowed in the callback function, |
| * but the callback is not re-entrant: if the allocation inside it will |
| * trigger the garbage collection, the callback won't be called again. |
| * It is possible to specify the GCType filter for your callback. But it is |
| * not possible to register the same callback function two times with |
| * different GCType filters. |
| */ |
| void AddGCPrologueCallback(GCCallback callback, |
| GCType gc_type_filter = kGCTypeAll); |
| |
| /** |
| * This function removes callback which was installed by |
| * AddGCPrologueCallback function. |
| */ |
| void RemoveGCPrologueCallback(GCCallback callback); |
| |
| /** |
| * Enables the host application to receive a notification after a |
| * garbage collection. Allocations are allowed in the callback function, |
| * but the callback is not re-entrant: if the allocation inside it will |
| * trigger the garbage collection, the callback won't be called again. |
| * It is possible to specify the GCType filter for your callback. But it is |
| * not possible to register the same callback function two times with |
| * different GCType filters. |
| */ |
| void AddGCEpilogueCallback(GCCallback callback, |
| GCType gc_type_filter = kGCTypeAll); |
| |
| /** |
| * This function removes callback which was installed by |
| * AddGCEpilogueCallback function. |
| */ |
| void RemoveGCEpilogueCallback(GCCallback callback); |
| |
| /** |
| * Forcefully terminate the current thread of JavaScript execution |
| * in the given isolate. |
| * |
| * This method can be used by any thread even if that thread has not |
| * acquired the V8 lock with a Locker object. |
| */ |
| void TerminateExecution(); |
| |
| /** |
| * Is V8 terminating JavaScript execution. |
| * |
| * Returns true if JavaScript execution is currently terminating |
| * because of a call to TerminateExecution. In that case there are |
| * still JavaScript frames on the stack and the termination |
| * exception is still active. |
| */ |
| bool IsExecutionTerminating(); |
| |
| /** |
| * Resume execution capability in the given isolate, whose execution |
| * was previously forcefully terminated using TerminateExecution(). |
| * |
| * When execution is forcefully terminated using TerminateExecution(), |
| * the isolate can not resume execution until all JavaScript frames |
| * have propagated the uncatchable exception which is generated. This |
| * method allows the program embedding the engine to handle the |
| * termination event and resume execution capability, even if |
| * JavaScript frames remain on the stack. |
| * |
| * This method can be used by any thread even if that thread has not |
| * acquired the V8 lock with a Locker object. |
| */ |
| void CancelTerminateExecution(); |
| |
| /** |
| * Request V8 to interrupt long running JavaScript code and invoke |
| * the given |callback| passing the given |data| to it. After |callback| |
| * returns control will be returned to the JavaScript code. |
| * There may be a number of interrupt requests in flight. |
| * Can be called from another thread without acquiring a |Locker|. |
| * Registered |callback| must not reenter interrupted Isolate. |
| */ |
| void RequestInterrupt(InterruptCallback callback, void* data); |
| |
| /** |
| * Request garbage collection in this Isolate. It is only valid to call this |
| * function if --expose_gc was specified. |
| * |
| * This should only be used for testing purposes and not to enforce a garbage |
| * collection schedule. It has strong negative impact on the garbage |
| * collection performance. Use IdleNotificationDeadline() or |
| * LowMemoryNotification() instead to influence the garbage collection |
| * schedule. |
| */ |
| void RequestGarbageCollectionForTesting(GarbageCollectionType type); |
| |
| /** |
| * Set the callback to invoke for logging event. |
| */ |
| void SetEventLogger(LogEventCallback that); |
| |
| /** |
| * Adds a callback to notify the host application when a script finished |
| * running. If a script re-enters the runtime during executing, the |
| * CallCompletedCallback is only invoked when the outer-most script |
| * execution ends. Executing scripts inside the callback do not trigger |
| * further callbacks. |
| */ |
| void AddCallCompletedCallback(CallCompletedCallback callback); |
| |
| /** |
| * Removes callback that was installed by AddCallCompletedCallback. |
| */ |
| void RemoveCallCompletedCallback(CallCompletedCallback callback); |
| |
| |
| /** |
| * Set callback to notify about promise reject with no handler, or |
| * revocation of such a previous notification once the handler is added. |
| */ |
| void SetPromiseRejectCallback(PromiseRejectCallback callback); |
| |
| /** |
| * Experimental: Runs the Microtask Work Queue until empty |
| * Any exceptions thrown by microtask callbacks are swallowed. |
| */ |
| void RunMicrotasks(); |
| |
| /** |
| * Experimental: Enqueues the callback to the Microtask Work Queue |
| */ |
| void EnqueueMicrotask(Local<Function> microtask); |
| |
| /** |
| * Experimental: Enqueues the callback to the Microtask Work Queue |
| */ |
| void EnqueueMicrotask(MicrotaskCallback microtask, void* data = NULL); |
| |
| /** |
| * Experimental: Controls whether the Microtask Work Queue is automatically |
| * run when the script call depth decrements to zero. |
| */ |
| void SetAutorunMicrotasks(bool autorun); |
| |
| /** |
| * Experimental: Returns whether the Microtask Work Queue is automatically |
| * run when the script call depth decrements to zero. |
| */ |
| bool WillAutorunMicrotasks() const; |
| |
| /** |
| * Sets a callback for counting the number of times a feature of V8 is used. |
| */ |
| void SetUseCounterCallback(UseCounterCallback callback); |
| |
| /** |
| * Enables the host application to provide a mechanism for recording |
| * statistics counters. |
| */ |
| void SetCounterFunction(CounterLookupCallback); |
| |
| /** |
| * Enables the host application to provide a mechanism for recording |
| * histograms. The CreateHistogram function returns a |
| * histogram which will later be passed to the AddHistogramSample |
| * function. |
| */ |
| void SetCreateHistogramFunction(CreateHistogramCallback); |
| void SetAddHistogramSampleFunction(AddHistogramSampleCallback); |
| |
| /** |
| * Optional notification that the embedder is idle. |
| * V8 uses the notification to perform garbage collection. |
| * This call can be used repeatedly if the embedder remains idle. |
| * Returns true if the embedder should stop calling IdleNotificationDeadline |
| * until real work has been done. This indicates that V8 has done |
| * as much cleanup as it will be able to do. |
| * |
| * The deadline_in_seconds argument specifies the deadline V8 has to finish |
| * garbage collection work. deadline_in_seconds is compared with |
| * MonotonicallyIncreasingTime() and should be based on the same timebase as |
| * that function. There is no guarantee that the actual work will be done |
| * within the time limit. |
| */ |
| bool IdleNotificationDeadline(double deadline_in_seconds); |
| |
| V8_DEPRECATE_SOON("use IdleNotificationDeadline()", |
| bool IdleNotification(int idle_time_in_ms)); |
| |
| /** |
| * Optional notification that the system is running low on memory. |
| * V8 uses these notifications to attempt to free memory. |
| */ |
| void LowMemoryNotification(); |
| |
| /** |
| * Optional notification that a context has been disposed. V8 uses |
| * these notifications to guide the GC heuristic. Returns the number |
| * of context disposals - including this one - since the last time |
| * V8 had a chance to clean up. |
| * |
| * The optional parameter |dependant_context| specifies whether the disposed |
| * context was depending on state from other contexts or not. |
| */ |
| int ContextDisposedNotification(bool dependant_context = true); |
| |
| /** |
| * Optional notification that the isolate switched to the foreground. |
| * V8 uses these notifications to guide heuristics. |
| */ |
| void IsolateInForegroundNotification(); |
| |
| /** |
| * Optional notification that the isolate switched to the background. |
| * V8 uses these notifications to guide heuristics. |
| */ |
| void IsolateInBackgroundNotification(); |
| |
| /** |
| * Allows the host application to provide the address of a function that is |
| * notified each time code is added, moved or removed. |
| * |
| * \param options options for the JIT code event handler. |
| * \param event_handler the JIT code event handler, which will be invoked |
| * each time code is added, moved or removed. |
| * \note \p event_handler won't get notified of existent code. |
| * \note since code removal notifications are not currently issued, the |
| * \p event_handler may get notifications of code that overlaps earlier |
| * code notifications. This happens when code areas are reused, and the |
| * earlier overlapping code areas should therefore be discarded. |
| * \note the events passed to \p event_handler and the strings they point to |
| * are not guaranteed to live past each call. The \p event_handler must |
| * copy strings and other parameters it needs to keep around. |
| * \note the set of events declared in JitCodeEvent::EventType is expected to |
| * grow over time, and the JitCodeEvent structure is expected to accrue |
| * new members. The \p event_handler function must ignore event codes |
| * it does not recognize to maintain future compatibility. |
| * \note Use Isolate::CreateParams to get events for code executed during |
| * Isolate setup. |
| */ |
| void SetJitCodeEventHandler(JitCodeEventOptions options, |
| JitCodeEventHandler event_handler); |
| |
| /** |
| * Modifies the stack limit for this Isolate. |
| * |
| * \param stack_limit An address beyond which the Vm's stack may not grow. |
| * |
| * \note If you are using threads then you should hold the V8::Locker lock |
| * while setting the stack limit and you must set a non-default stack |
| * limit separately for each thread. |
| */ |
| void SetStackLimit(uintptr_t stack_limit); |
| |
| /** |
| * Returns a memory range that can potentially contain jitted code. |
| * |
| * On Win64, embedders are advised to install function table callbacks for |
| * these ranges, as default SEH won't be able to unwind through jitted code. |
| * |
| * The first page of the code range is reserved for the embedder and is |
| * committed, writable, and executable. |
| * |
| * Might be empty on other platforms. |
| * |
| * https://code.google.com/p/v8/issues/detail?id=3598 |
| */ |
| void GetCodeRange(void** start, size_t* length_in_bytes); |
| |
| /** Set the callback to invoke in case of fatal errors. */ |
| void SetFatalErrorHandler(FatalErrorCallback that); |
| |
| /** |
| * Set the callback to invoke to check if code generation from |
| * strings should be allowed. |
| */ |
| void SetAllowCodeGenerationFromStringsCallback( |
| AllowCodeGenerationFromStringsCallback callback); |
| |
| /** |
| * Check if V8 is dead and therefore unusable. This is the case after |
| * fatal errors such as out-of-memory situations. |
| */ |
| bool IsDead(); |
| |
| /** |
| * Adds a message listener. |
| * |
| * The same message listener can be added more than once and in that |
| * case it will be called more than once for each message. |
| * |
| * If data is specified, it will be passed to the callback when it is called. |
| * Otherwise, the exception object will be passed to the callback instead. |
| */ |
| bool AddMessageListener(MessageCallback that, |
| Local<Value> data = Local<Value>()); |
| |
| /** |
| * Remove all message listeners from the specified callback function. |
| */ |
| void RemoveMessageListeners(MessageCallback that); |
| |
| /** Callback function for reporting failed access checks.*/ |
| void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback); |
| |
| /** |
| * Tells V8 to capture current stack trace when uncaught exception occurs |
| * and report it to the message listeners. The option is off by default. |
| */ |
| void SetCaptureStackTraceForUncaughtExceptions( |
| bool capture, int frame_limit = 10, |
| StackTrace::StackTraceOptions options = StackTrace::kOverview); |
| |
| /** |
| * Enables the host application to provide a mechanism to be notified |
| * and perform custom logging when V8 Allocates Executable Memory. |
| */ |
| void AddMemoryAllocationCallback(MemoryAllocationCallback callback, |
| ObjectSpace space, AllocationAction action); |
| |
| /** |
| * Removes callback that was installed by AddMemoryAllocationCallback. |
| */ |
| void RemoveMemoryAllocationCallback(MemoryAllocationCallback callback); |
| |
| /** |
| * Iterates through all external resources referenced from current isolate |
| * heap. GC is not invoked prior to iterating, therefore there is no |
| * guarantee that visited objects are still alive. |
| */ |
| void VisitExternalResources(ExternalResourceVisitor* visitor); |
| |
| /** |
| * Iterates through all the persistent handles in the current isolate's heap |
| * that have class_ids. |
| */ |
| void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor); |
| |
| /** |
| * Iterates through all the persistent handles in the current isolate's heap |
| * that have class_ids and are candidates to be marked as partially dependent |
| * handles. This will visit handles to young objects created since the last |
| * garbage collection but is free to visit an arbitrary superset of these |
| * objects. |
| */ |
| void VisitHandlesForPartialDependence(PersistentHandleVisitor* visitor); |
| |
| /** |
| * Iterates through all the persistent handles in the current isolate's heap |
| * that have class_ids and are weak to be marked as inactive if there is no |
| * pending activity for the handle. |
| */ |
| void VisitWeakHandles(PersistentHandleVisitor* visitor); |
| |
| private: |
| template <class K, class V, class Traits> |
| friend class PersistentValueMapBase; |
| |
| Isolate(); |
| Isolate(const Isolate&); |
| ~Isolate(); |
| Isolate& operator=(const Isolate&); |
| void* operator new(size_t size); |
| void operator delete(void*, size_t); |
| |
| void SetObjectGroupId(internal::Object** object, UniqueId id); |
| void SetReferenceFromGroup(UniqueId id, internal::Object** object); |
| void SetReference(internal::Object** parent, internal::Object** child); |
| void ReportExternalAllocationLimitReached(); |
| }; |
| |
| class V8_EXPORT StartupData { |
| public: |
| const char* data; |
| int raw_size; |
| }; |
| |
| |
| /** |
| * EntropySource is used as a callback function when v8 needs a source |
| * of entropy. |
| */ |
| typedef bool (*EntropySource)(unsigned char* buffer, size_t length); |
| |
| |
| /** |
| * ReturnAddressLocationResolver is used as a callback function when v8 is |
| * resolving the location of a return address on the stack. Profilers that |
| * change the return address on the stack can use this to resolve the stack |
| * location to whereever the profiler stashed the original return address. |
| * |
| * \param return_addr_location points to a location on stack where a machine |
| * return address resides. |
| * \returns either return_addr_location, or else a pointer to the profiler's |
| * copy of the original return address. |
| * |
| * \note the resolver function must not cause garbage collection. |
| */ |
| typedef uintptr_t (*ReturnAddressLocationResolver)( |
| uintptr_t return_addr_location); |
| |
| |
| /** |
| * Container class for static utility functions. |
| */ |
| class V8_EXPORT V8 { |
| public: |
| /** Set the callback to invoke in case of fatal errors. */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void SetFatalErrorHandler(FatalErrorCallback that)); |
| |
| /** |
| * Set the callback to invoke to check if code generation from |
| * strings should be allowed. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", void SetAllowCodeGenerationFromStringsCallback( |
| AllowCodeGenerationFromStringsCallback that)); |
| |
| /** |
| * Check if V8 is dead and therefore unusable. This is the case after |
| * fatal errors such as out-of-memory situations. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON("no alternative", bool IsDead()); |
| |
| /** |
| * Hand startup data to V8, in case the embedder has chosen to build |
| * V8 with external startup data. |
| * |
| * Note: |
| * - By default the startup data is linked into the V8 library, in which |
| * case this function is not meaningful. |
| * - If this needs to be called, it needs to be called before V8 |
| * tries to make use of its built-ins. |
| * - To avoid unnecessary copies of data, V8 will point directly into the |
| * given data blob, so pretty please keep it around until V8 exit. |
| * - Compression of the startup blob might be useful, but needs to |
| * handled entirely on the embedders' side. |
| * - The call will abort if the data is invalid. |
| */ |
| static void SetNativesDataBlob(StartupData* startup_blob); |
| static void SetSnapshotDataBlob(StartupData* startup_blob); |
| |
| /** |
| * Create a new isolate and context for the purpose of capturing a snapshot |
| * Returns { NULL, 0 } on failure. |
| * The caller owns the data array in the return value. |
| */ |
| static StartupData CreateSnapshotDataBlob(const char* custom_source = NULL); |
| |
| /** |
| * Adds a message listener. |
| * |
| * The same message listener can be added more than once and in that |
| * case it will be called more than once for each message. |
| * |
| * If data is specified, it will be passed to the callback when it is called. |
| * Otherwise, the exception object will be passed to the callback instead. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| bool AddMessageListener(MessageCallback that, |
| Local<Value> data = Local<Value>())); |
| |
| /** |
| * Remove all message listeners from the specified callback function. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", void RemoveMessageListeners(MessageCallback that)); |
| |
| /** |
| * Tells V8 to capture current stack trace when uncaught exception occurs |
| * and report it to the message listeners. The option is off by default. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void SetCaptureStackTraceForUncaughtExceptions( |
| bool capture, int frame_limit = 10, |
| StackTrace::StackTraceOptions options = StackTrace::kOverview)); |
| |
| /** |
| * Sets V8 flags from a string. |
| */ |
| static void SetFlagsFromString(const char* str, int length); |
| |
| /** |
| * Sets V8 flags from the command line. |
| */ |
| static void SetFlagsFromCommandLine(int* argc, |
| char** argv, |
| bool remove_flags); |
| |
| /** Get the version string. */ |
| static const char* GetVersion(); |
| |
| /** Callback function for reporting failed access checks.*/ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void SetFailedAccessCheckCallbackFunction(FailedAccessCheckCallback)); |
| |
| /** |
| * Enables the host application to receive a notification before a |
| * garbage collection. Allocations are not allowed in the |
| * callback function, you therefore cannot manipulate objects (set |
| * or delete properties for example) since it is possible such |
| * operations will result in the allocation of objects. It is possible |
| * to specify the GCType filter for your callback. But it is not possible to |
| * register the same callback function two times with different |
| * GCType filters. |
| */ |
| static V8_DEPRECATED( |
| "Use isolate version", |
| void AddGCPrologueCallback(GCCallback callback, |
| GCType gc_type_filter = kGCTypeAll)); |
| |
| /** |
| * This function removes callback which was installed by |
| * AddGCPrologueCallback function. |
| */ |
| V8_INLINE static V8_DEPRECATED( |
| "Use isolate version", |
| void RemoveGCPrologueCallback(GCCallback callback)); |
| |
| /** |
| * Enables the host application to receive a notification after a |
| * garbage collection. Allocations are not allowed in the |
| * callback function, you therefore cannot manipulate objects (set |
| * or delete properties for example) since it is possible such |
| * operations will result in the allocation of objects. It is possible |
| * to specify the GCType filter for your callback. But it is not possible to |
| * register the same callback function two times with different |
| * GCType filters. |
| */ |
| static V8_DEPRECATED( |
| "Use isolate version", |
| void AddGCEpilogueCallback(GCCallback callback, |
| GCType gc_type_filter = kGCTypeAll)); |
| |
| /** |
| * This function removes callback which was installed by |
| * AddGCEpilogueCallback function. |
| */ |
| V8_INLINE static V8_DEPRECATED( |
| "Use isolate version", |
| void RemoveGCEpilogueCallback(GCCallback callback)); |
| |
| /** |
| * Enables the host application to provide a mechanism to be notified |
| * and perform custom logging when V8 Allocates Executable Memory. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void AddMemoryAllocationCallback(MemoryAllocationCallback callback, |
| ObjectSpace space, |
| AllocationAction action)); |
| |
| /** |
| * Removes callback that was installed by AddMemoryAllocationCallback. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void RemoveMemoryAllocationCallback(MemoryAllocationCallback callback)); |
| |
| /** |
| * Initializes V8. This function needs to be called before the first Isolate |
| * is created. It always returns true. |
| */ |
| static bool Initialize(); |
| |
| /** |
| * Allows the host application to provide a callback which can be used |
| * as a source of entropy for random number generators. |
| */ |
| static void SetEntropySource(EntropySource source); |
| |
| /** |
| * Allows the host application to provide a callback that allows v8 to |
| * cooperate with a profiler that rewrites return addresses on stack. |
| */ |
| static void SetReturnAddressLocationResolver( |
| ReturnAddressLocationResolver return_address_resolver); |
| |
| /** |
| * Forcefully terminate the current thread of JavaScript execution |
| * in the given isolate. |
| * |
| * This method can be used by any thread even if that thread has not |
| * acquired the V8 lock with a Locker object. |
| * |
| * \param isolate The isolate in which to terminate the current JS execution. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON("Use isolate version", |
| void TerminateExecution(Isolate* isolate)); |
| |
| /** |
| * Is V8 terminating JavaScript execution. |
| * |
| * Returns true if JavaScript execution is currently terminating |
| * because of a call to TerminateExecution. In that case there are |
| * still JavaScript frames on the stack and the termination |
| * exception is still active. |
| * |
| * \param isolate The isolate in which to check. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| bool IsExecutionTerminating(Isolate* isolate = NULL)); |
| |
| /** |
| * Resume execution capability in the given isolate, whose execution |
| * was previously forcefully terminated using TerminateExecution(). |
| * |
| * When execution is forcefully terminated using TerminateExecution(), |
| * the isolate can not resume execution until all JavaScript frames |
| * have propagated the uncatchable exception which is generated. This |
| * method allows the program embedding the engine to handle the |
| * termination event and resume execution capability, even if |
| * JavaScript frames remain on the stack. |
| * |
| * This method can be used by any thread even if that thread has not |
| * acquired the V8 lock with a Locker object. |
| * |
| * \param isolate The isolate in which to resume execution capability. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", void CancelTerminateExecution(Isolate* isolate)); |
| |
| /** |
| * Releases any resources used by v8 and stops any utility threads |
| * that may be running. Note that disposing v8 is permanent, it |
| * cannot be reinitialized. |
| * |
| * It should generally not be necessary to dispose v8 before exiting |
| * a process, this should happen automatically. It is only necessary |
| * to use if the process needs the resources taken up by v8. |
| */ |
| static bool Dispose(); |
| |
| /** |
| * Iterates through all external resources referenced from current isolate |
| * heap. GC is not invoked prior to iterating, therefore there is no |
| * guarantee that visited objects are still alive. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void VisitExternalResources(ExternalResourceVisitor* visitor)); |
| |
| /** |
| * Iterates through all the persistent handles in the current isolate's heap |
| * that have class_ids. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void VisitHandlesWithClassIds(PersistentHandleVisitor* visitor)); |
| |
| /** |
| * Iterates through all the persistent handles in isolate's heap that have |
| * class_ids. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void VisitHandlesWithClassIds(Isolate* isolate, |
| PersistentHandleVisitor* visitor)); |
| |
| /** |
| * Iterates through all the persistent handles in the current isolate's heap |
| * that have class_ids and are candidates to be marked as partially dependent |
| * handles. This will visit handles to young objects created since the last |
| * garbage collection but is free to visit an arbitrary superset of these |
| * objects. |
| */ |
| V8_INLINE static V8_DEPRECATE_SOON( |
| "Use isolate version", |
| void VisitHandlesForPartialDependence(Isolate* isolate, |
| PersistentHandleVisitor* visitor)); |
| |
| /** |
| * Initialize the ICU library bundled with V8. The embedder should only |
| * invoke this method when using the bundled ICU. Returns true on success. |
| * |
| * If V8 was compiled with the ICU data in an external file, the location |
| * of the data file has to be provided. |
| */ |
| static bool InitializeICU(const char* icu_data_file = NULL); |
| |
| /** |
| * Initialize the external startup data. The embedder only needs to |
| * invoke this method when external startup data was enabled in a build. |
| * |
| * If V8 was compiled with the startup data in an external file, then |
| * V8 needs to be given those external files during startup. There are |
| * three ways to do this: |
| * - InitializeExternalStartupData(const char*) |
| * This will look in the given directory for files "natives_blob.bin" |
| * and "snapshot_blob.bin" - which is what the default build calls them. |
| * - InitializeExternalStartupData(const char*, const char*) |
| * As above, but will directly use the two given file names. |
| * - Call SetNativesDataBlob, SetNativesDataBlob. |
| * This will read the blobs from the given data structures and will |
| * not perform any file IO. |
| */ |
| static void InitializeExternalStartupData(const char* directory_path); |
| static void InitializeExternalStartupData(const char* natives_blob, |
| const char* snapshot_blob); |
| /** |
| * Sets the v8::Platform to use. This should be invoked before V8 is |
| * initialized. |
| */ |
| static void InitializePlatform(Platform* platform); |
| |
| /** |
| * Clears all references to the v8::Platform. This should be invoked after |
| * V8 was disposed. |
| */ |
| static void ShutdownPlatform(); |
| |
| private: |
| V8(); |
| |
| static internal::Object** GlobalizeReference(internal::Isolate* isolate, |
| internal::Object** handle); |
| static internal::Object** CopyPersistent(internal::Object** handle); |
| static void DisposeGlobal(internal::Object** global_handle); |
| typedef WeakCallbackData<Value, void>::Callback WeakCallback; |
| static void MakeWeak(internal::Object** global_handle, void* data, |
| WeakCallback weak_callback); |
| static void MakeWeak(internal::Object** global_handle, void* data, |
| WeakCallbackInfo<void>::Callback weak_callback, |
| WeakCallbackType type); |
| static void MakeWeak(internal::Object** global_handle, void* data, |
| // Must be 0 or -1. |
| int internal_field_index1, |
| // Must be 1 or -1. |
| int internal_field_index2, |
| WeakCallbackInfo<void>::Callback weak_callback); |
| static void* ClearWeak(internal::Object** global_handle); |
| static void Eternalize(Isolate* isolate, |
| Value* handle, |
| int* index); |
| static Local<Value> GetEternal(Isolate* isolate, int index); |
| |
| static void FromJustIsNothing(); |
| static void ToLocalEmpty(); |
| static void InternalFieldOutOfBounds(int index); |
| template <class T> friend class Local; |
| template <class T> |
| friend class MaybeLocal; |
| template <class T> |
| friend class Maybe; |
| template <class T> |
| friend class WeakCallbackInfo; |
| template <class T> friend class Eternal; |
| template <class T> friend class PersistentBase; |
| template <class T, class M> friend class Persistent; |
| friend class Context; |
| }; |
| |
| |
| /** |
| * A simple Maybe type, representing an object which may or may not have a |
| * value, see https://hackage.haskell.org/package/base/docs/Data-Maybe.html. |
| * |
| * If an API method returns a Maybe<>, the API method can potentially fail |
| * either because an exception is thrown, or because an exception is pending, |
| * e.g. because a previous API call threw an exception that hasn't been caught |
| * yet, or because a TerminateExecution exception was thrown. In that case, a |
| * "Nothing" value is returned. |
| */ |
| template <class T> |
| class Maybe { |
| public: |
| V8_INLINE bool IsNothing() const { return !has_value; } |
| V8_INLINE bool IsJust() const { return has_value; } |
| |
| // Will crash if the Maybe<> is nothing. |
| V8_INLINE T FromJust() const { |
| if (V8_UNLIKELY(!IsJust())) V8::FromJustIsNothing(); |
| return value; |
| } |
| |
| V8_INLINE T FromMaybe(const T& default_value) const { |
| return has_value ? value : default_value; |
| } |
| |
| V8_INLINE bool operator==(const Maybe& other) const { |
| return (IsJust() == other.IsJust()) && |
| (!IsJust() || FromJust() == other.FromJust()); |
| } |
| |
| V8_INLINE bool operator!=(const Maybe& other) const { |
| return !operator==(other); |
| } |
| |
| private: |
| Maybe() : has_value(false) {} |
| explicit Maybe(const T& t) : has_value(true), value(t) {} |
| |
| bool has_value; |
| T value; |
| |
| template <class U> |
| friend Maybe<U> Nothing(); |
| template <class U> |
| friend Maybe<U> Just(const U& u); |
| }; |
| |
| |
| template <class T> |
| inline Maybe<T> Nothing() { |
| return Maybe<T>(); |
| } |
| |
| |
| template <class T> |
| inline Maybe<T> Just(const T& t) { |
| return Maybe<T>(t); |
| } |
| |
| |
| /** |
| * An external exception handler. |
| */ |
| class V8_EXPORT TryCatch { |
| public: |
| /** |
| * Creates a new try/catch block and registers it with v8. Note that |
| * all TryCatch blocks should be stack allocated because the memory |
| * location itself is compared against JavaScript try/catch blocks. |
| */ |
| V8_DEPRECATE_SOON("Use isolate version", TryCatch()); |
| |
| /** |
| * Creates a new try/catch block and registers it with v8. Note that |
| * all TryCatch blocks should be stack allocated because the memory |
| * location itself is compared against JavaScript try/catch blocks. |
| */ |
| TryCatch(Isolate* isolate); |
| |
| /** |
| * Unregisters and deletes this try/catch block. |
| */ |
| ~TryCatch(); |
| |
| /** |
| * Returns true if an exception has been caught by this try/catch block. |
| */ |
| bool HasCaught() const; |
| |
| /** |
| * For certain types of exceptions, it makes no sense to continue execution. |
| * |
| * If CanContinue returns false, the correct action is to perform any C++ |
| * cleanup needed and then return. If CanContinue returns false and |
| * HasTerminated returns true, it is possible to call |
| * CancelTerminateExecution in order to continue calling into the engine. |
| */ |
| bool CanContinue() const; |
| |
| /** |
| * Returns true if an exception has been caught due to script execution |
| * being terminated. |
| * |
| * There is no JavaScript representation of an execution termination |
| * exception. Such exceptions are thrown when the TerminateExecution |
| * methods are called to terminate a long-running script. |
| * |
| * If such an exception has been thrown, HasTerminated will return true, |
| * indicating that it is possible to call CancelTerminateExecution in order |
| * to continue calling into the engine. |
| */ |
| bool HasTerminated() const; |
| |
| /** |
| * Throws the exception caught by this TryCatch in a way that avoids |
| * it being caught again by this same TryCatch. As with ThrowException |
| * it is illegal to execute any JavaScript operations after calling |
| * ReThrow; the caller must return immediately to where the exception |
| * is caught. |
| */ |
| Local<Value> ReThrow(); |
| |
| /** |
| * Returns the exception caught by this try/catch block. If no exception has |
| * been caught an empty handle is returned. |
| * |
| * The returned handle is valid until this TryCatch block has been destroyed. |
| */ |
| Local<Value> Exception() const; |
| |
| /** |
| * Returns the .stack property of the thrown object. If no .stack |
| * property is present an empty handle is returned. |
| */ |
| V8_DEPRECATE_SOON("Use maybe version.", Local<Value> StackTrace() const); |
| V8_WARN_UNUSED_RESULT MaybeLocal<Value> StackTrace( |
| Local<Context> context) const; |
| |
| /** |
| * Returns the message associated with this exception. If there is |
| * no message associated an empty handle is returned. |
| * |
| * The returned handle is valid until this TryCatch block has been |
| * destroyed. |
| */ |
| Local<v8::Message> Message() const; |
| |
| /** |
| * Clears any exceptions that may have been caught by this try/catch block. |
| * After this method has been called, HasCaught() will return false. Cancels |
| * the scheduled exception if it is caught and ReThrow() is not called before. |
| * |
| * It is not necessary to clear a try/catch block before using it again; if |
| * another exception is thrown the previously caught exception will just be |
| * overwritten. However, it is often a good idea since it makes it easier |
| * to determine which operation threw a given exception. |
| */ |
| void Reset(); |
| |
| /** |
| * Set verbosity of the external exception handler. |
| * |
| * By default, exceptions that are caught by an external exception |
| * handler are not reported. Call SetVerbose with true on an |
| * external exception handler to have exceptions caught by the |
| * handler reported as if they were not caught. |
| */ |
| void SetVerbose(bool value); |
| |
| /** |
| * Set whether or not this TryCatch should capture a Message object |
| * which holds source information about where the exception |
| * occurred. True by default. |
| */ |
| void SetCaptureMessage(bool value); |
| |
| /** |
| * There are cases when the raw address of C++ TryCatch object cannot be |
| * used for comparisons with addresses into the JS stack. The cases are: |
| * 1) ARM, ARM64 and MIPS simulators which have separate JS stack. |
| * 2) Address sanitizer allocates local C++ object in the heap when |
| * UseAfterReturn mode is enabled. |
| * This method returns address that can be used for comparisons with |
| * addresses into the JS stack. When neither simulator nor ASAN's |
| * UseAfterReturn is enabled, then the address returned will be the address |
| * of the C++ try catch handler itself. |
| */ |
| static void* JSStackComparableAddress(v8::TryCatch* handler) { |
| if (handler == NULL) return NULL; |
| return handler->js_stack_comparable_address_; |
| } |
| |
| private: |
| void ResetInternal(); |
| |
| // Make it hard to create heap-allocated TryCatch blocks. |
| TryCatch(const TryCatch&); |
| void operator=(const TryCatch&); |
| void* operator new(size_t size); |
| void operator delete(void*, size_t); |
| |
| v8::internal::Isolate* isolate_; |
| v8::TryCatch* next_; |
| void* exception_; |
| void* message_obj_; |
| void* js_stack_comparable_address_; |
| bool is_verbose_ : 1; |
| bool can_continue_ : 1; |
| bool capture_message_ : 1; |
| bool rethrow_ : 1; |
| bool has_terminated_ : 1; |
| |
| friend class v8::internal::Isolate; |
| }; |
| |
| |
| // --- Context --- |
| |
| |
| /** |
| * A container for extension names. |
| */ |
| class V8_EXPORT ExtensionConfiguration { |
| public: |
| ExtensionConfiguration() : name_count_(0), names_(NULL) { } |
| ExtensionConfiguration(int name_count, const char* names[]) |
| : name_count_(name_count), names_(names) { } |
| |
| const char** begin() const { return &names_[0]; } |
| const char** end() const { return &names_[name_count_]; } |
| |
| private: |
| const int name_count_; |
| const char** names_; |
| }; |
| |
| |
| /** |
| * A sandboxed execution context with its own set of built-in objects |
| * and functions. |
| */ |
| class V8_EXPORT Context { |
| public: |
| /** |
| * Returns the global proxy object. |
| * |
| * Global proxy object is a thin wrapper whose prototype points to actual |
| * context's global object with the properties like Object, etc. This is done |
| * that way for security reasons (for more details see |
| * https://wiki.mozilla.org/Gecko:SplitWindow). |
| * |
| * Please note that changes to global proxy object prototype most probably |
| * would break VM---v8 expects only global object as a prototype of global |
| * proxy object. |
| */ |
| Local<Object> Global(); |
| |
| /** |
| * Detaches the global object from its context before |
| * the global object can be reused to create a new context. |
| */ |
| void DetachGlobal(); |
| |
| /** |
| * Creates a new context and returns a handle to the newly allocated |
| * context. |
| * |
| * \param isolate The isolate in which to create the context. |
| * |
| * \param extensions An optional extension configuration containing |
| * the extensions to be installed in the newly created context. |
| * |
| * \param global_template An optional object template from which the |
| * global object for the newly created context will be created. |
| * |
| * \param global_object An optional global object to be reused for |
| * the newly created context. This global object must have been |
| * created by a previous call to Context::New with the same global |
| * template. The state of the global object will be completely reset |
| * and only object identify will remain. |
| */ |
| static Local<Context> New( |
| Isolate* isolate, ExtensionConfiguration* extensions = NULL, |
| Local<ObjectTemplate> global_template = Local<ObjectTemplate>(), |
| Local<Value> global_object = Local<Value>()); |
| |
| /** |
| * Sets the security token for the context. To access an object in |
| * another context, the security tokens must match. |
| */ |
| void SetSecurityToken(Local<Value> token); |
| |
| /** Restores the security token to the default value. */ |
| void UseDefaultSecurityToken(); |
| |
| /** Returns the security token of this context.*/ |
| Local<Value> GetSecurityToken(); |
| |
| /** |
| * Enter this context. After entering a context, all code compiled |
| * and run is compiled and run in this context. If another context |
| * is already entered, this old context is saved so it can be |
| * restored when the new context is exited. |
| */ |
| void Enter(); |
| |
| /** |
| * Exit this context. Exiting the current context restores the |
| * context that was in place when entering the current context. |
| */ |
| void Exit(); |
| |
| /** Returns an isolate associated with a current context. */ |
| v8::Isolate* GetIsolate(); |
| |
| /** |
| * The field at kDebugIdIndex is reserved for V8 debugger implementation. |
| * The value is propagated to the scripts compiled in given Context and |
| * can be used for filtering scripts. |
| */ |
| enum EmbedderDataFields { kDebugIdIndex = 0 }; |
| |
| /** |
| * Gets the embedder data with the given index, which must have been set by a |
| * previous call to SetEmbedderData with the same index. Note that index 0 |
| * currently has a special meaning for Chrome's debugger. |
| */ |
| V8_INLINE Local<Value> GetEmbedderData(int index); |
| |
| /** |
| * Gets the binding object used by V8 extras. Extra natives get a reference |
| * to this object and can use it to "export" functionality by adding |
| * properties. Extra natives can also "import" functionality by accessing |
| * properties added by the embedder using the V8 API. |
| */ |
| Local<Object> GetExtrasBindingObject(); |
| |
| /** |
| * Sets the embedder data with the given index, growing the data as |
| * needed. Note that index 0 currently has a special meaning for Chrome's |
| * debugger. |
| */ |
| void SetEmbedderData(int index, Local<Value> value); |
| |
| /** |
| * Gets a 2-byte-aligned native pointer from the embedder data with the given |
| * index, which must have bees set by a previous call to |
| * SetAlignedPointerInEmbedderData with the same index. Note that index 0 |
| * currently has a special meaning for Chrome's debugger. |
| */ |
| V8_INLINE void* GetAlignedPointerFromEmbedderData(int index); |
| |
| /** |
| * Sets a 2-byte-aligned native pointer in the embedder data with the given |
| * index, growing the data as needed. Note that index 0 currently has a |
| * special meaning for Chrome's debugger. |
| */ |
| void SetAlignedPointerInEmbedderData(int index, void* value); |
| |
| /** |
| * Control whether code generation from strings is allowed. Calling |
| * this method with false will disable 'eval' and the 'Function' |
| * constructor for code running in this context. If 'eval' or the |
| * 'Function' constructor are used an exception will be thrown. |
| * |
| * If code generation from strings is not allowed the |
| * V8::AllowCodeGenerationFromStrings callback will be invoked if |
| * set before blocking the call to 'eval' or the 'Function' |
| * constructor. If that callback returns true, the call will be |
| * allowed, otherwise an exception will be thrown. If no callback is |
| * set an exception will be thrown. |
| */ |
| void AllowCodeGenerationFromStrings(bool allow); |
| |
| /** |
| * Returns true if code generation from strings is allowed for the context. |
| * For more details see AllowCodeGenerationFromStrings(bool) documentation. |
| */ |
| bool IsCodeGenerationFromStringsAllowed(); |
| |
| /** |
| * Sets the error description for the exception that is thrown when |
| * code generation from strings is not allowed and 'eval' or the 'Function' |
| * constructor are called. |
| */ |
| void SetErrorMessageForCodeGenerationFromStrings(Local<String> message); |
| |
| /** |
| * Estimate the memory in bytes retained by this context. |
| */ |
| size_t EstimatedSize(); |
| |
| /** |
| * Stack-allocated class which sets the execution context for all |
| * operations executed within a local scope. |
| */ |
| class Scope { |
| public: |
| explicit V8_INLINE Scope(Local<Context> context) : context_(context) { |
| context_->Enter(); |
| } |
| V8_INLINE ~Scope() { context_->Exit(); } |
| |
| private: |
| Local<Context> context_; |
| }; |
| |
| private: |
| friend class Value; |
| friend class Script; |
| friend class Object; |
| friend class Function; |
| |
| Local<Value> SlowGetEmbedderData(int index); |
| void* SlowGetAlignedPointerFromEmbedderData(int index); |
| }; |
| |
| |
| /** |
| * Multiple threads in V8 are allowed, but only one thread at a time is allowed |
| * to use any given V8 isolate, see the comments in the Isolate class. The |
| * definition of 'using a V8 isolate' includes accessing handles or holding onto |
| * object pointers obtained from V8 handles while in the particular V8 isolate. |
| * It is up to the user of V8 to ensure, perhaps with locking, that this |
| * constraint is not violated. In addition to any other synchronization |
| * mechanism that may be used, the v8::Locker and v8::Unlocker classes must be |
| * used to signal thead switches to V8. |
| * |
| * v8::Locker is a scoped lock object. While it's active, i.e. between its |
| * construction and destruction, the current thread is allowed to use the locked |
| * isolate. V8 guarantees that an isolate can be locked by at most one thread at |
| * any time. In other words, the scope of a v8::Locker is a critical section. |
| * |
| * Sample usage: |
| * \code |
| * ... |
| * { |
| * v8::Locker locker(isolate); |
| * v8::Isolate::Scope isolate_scope(isolate); |
| * ... |
| * // Code using V8 and isolate goes here. |
| * ... |
| * } // Destructor called here |
| * \endcode |
| * |
| * If you wish to stop using V8 in a thread A you can do this either by |
| * destroying the v8::Locker object as above or by constructing a v8::Unlocker |
| * object: |
| * |
| * \code |
| * { |
| * isolate->Exit(); |
| * v8::Unlocker unlocker(isolate); |
| * ... |
| * // Code not using V8 goes here while V8 can run in another thread. |
| * ... |
| * } // Destructor called here. |
| * isolate->Enter(); |
| * \endcode |
| * |
| * The Unlocker object is intended for use in a long-running callback from V8, |
| * where you want to release the V8 lock for other threads to use. |
| * |
| * The v8::Locker is a recursive lock, i.e. you can lock more than once in a |
| * given thread. This can be useful if you have code that can be called either |
| * from code that holds the lock or from code that does not. The Unlocker is |
| * not recursive so you can not have several Unlockers on the stack at once, and |
| * you can not use an Unlocker in a thread that is not inside a Locker's scope. |
| * |
| * An unlocker will unlock several lockers if it has to and reinstate the |
| * correct depth of locking on its destruction, e.g.: |
| * |
| * \code |
| * // V8 not locked. |
| * { |
| * v8::Locker locker(isolate); |
| * Isolate::Scope isolate_scope(isolate); |
| * // V8 locked. |
| * { |
| * v8::Locker another_locker(isolate); |
| * // V8 still locked (2 levels). |
| * { |
| * isolate->Exit(); |
| * v8::Unlocker unlocker(isolate); |
| * // V8 not locked. |
| * } |
| * isolate->Enter(); |
| * // V8 locked again (2 levels). |
| * } |
| * // V8 still locked (1 level). |
| * } |
| * // V8 Now no longer locked. |
| * \endcode |
| */ |
| class V8_EXPORT Unlocker { |
| public: |
| /** |
| * Initialize Unlocker for a given Isolate. |
| */ |
| V8_INLINE explicit Unlocker(Isolate* isolate) { Initialize(isolate); } |
| |
| ~Unlocker(); |
| private: |
| void Initialize(Isolate* isolate); |
| |
| internal::Isolate* isolate_; |
| }; |
| |
| |
| class V8_EXPORT Locker { |
| public: |
| /** |
| * Initialize Locker for a given Isolate. |
| */ |
| V8_INLINE explicit Locker(Isolate* isolate) { Initialize(isolate); } |
| |
| ~Locker(); |
| |
| /** |
| * Returns whether or not the locker for a given isolate, is locked by the |
| * current thread. |
| */ |
| static bool IsLocked(Isolate* isolate); |
| |
| /** |
| * Returns whether v8::Locker is being used by this V8 instance. |
| */ |
| static bool IsActive(); |
| |
| private: |
| void Initialize(Isolate* isolate); |
| |
| bool has_lock_; |
| bool top_level_; |
| internal::Isolate* isolate_; |
| |
| // Disallow copying and assigning. |
| Locker(const Locker&); |
| void operator=(const Locker&); |
| }; |
| |
| |
| // --- Implementation --- |
| |
| |
| namespace internal { |
| |
| const int kApiPointerSize = sizeof(void*); // NOLINT |
| const int kApiIntSize = sizeof(int); // NOLINT |
| const int kApiInt64Size = sizeof(int64_t); // NOLINT |
| |
| // Tag information for HeapObject. |
| const int kHeapObjectTag = 1; |
| const int kHeapObjectTagSize = 2; |
| const intptr_t kHeapObjectTagMask = (1 << kHeapObjectTagSize) - 1; |
| |
| // Tag information for Smi. |
| const int kSmiTag = 0; |
| const int kSmiTagSize = 1; |
| const intptr_t kSmiTagMask = (1 << kSmiTagSize) - 1; |
| |
| template <size_t ptr_size> struct SmiTagging; |
| |
| template<int kSmiShiftSize> |
| V8_INLINE internal::Object* IntToSmi(int value) { |
| int smi_shift_bits = kSmiTagSize + kSmiShiftSize; |
| uintptr_t tagged_value = |
| (static_cast<uintptr_t>(value) << smi_shift_bits) | kSmiTag; |
| return reinterpret_cast<internal::Object*>(tagged_value); |
| } |
| |
| // Smi constants for 32-bit systems. |
| template <> struct SmiTagging<4> { |
| enum { kSmiShiftSize = 0, kSmiValueSize = 31 }; |
| static int SmiShiftSize() { return kSmiShiftSize; } |
| static int SmiValueSize() { return kSmiValueSize; } |
| V8_INLINE static int SmiToInt(const internal::Object* value) { |
| int shift_bits = kSmiTagSize + kSmiShiftSize; |
| // Throw away top 32 bits and shift down (requires >> to be sign extending). |
| return static_cast<int>(reinterpret_cast<intptr_t>(value)) >> shift_bits; |
| } |
| V8_INLINE static internal::Object* IntToSmi(int value) { |
| return internal::IntToSmi<kSmiShiftSize>(value); |
| } |
| V8_INLINE static bool IsValidSmi(intptr_t value) { |
| // To be representable as an tagged small integer, the two |
| // most-significant bits of 'value' must be either 00 or 11 due to |
| // sign-extension. To check this we add 01 to the two |
| // most-significant bits, and check if the most-significant bit is 0 |
| // |
| // CAUTION: The original code below: |
| // bool result = ((value + 0x40000000) & 0x80000000) == 0; |
| // may lead to incorrect results according to the C language spec, and |
| // in fact doesn't work correctly with gcc4.1.1 in some cases: The |
| // compiler may produce undefined results in case of signed integer |
| // overflow. The computation must be done w/ unsigned ints. |
| return static_cast<uintptr_t>(value + 0x40000000U) < 0x80000000U; |
| } |
| }; |
| |
| // Smi constants for 64-bit systems. |
| template <> struct SmiTagging<8> { |
| enum { kSmiShiftSize = 31, kSmiValueSize = 32 }; |
| static int SmiShiftSize() { return kSmiShiftSize; } |
| static int SmiValueSize() { return kSmiValueSize; } |
| V8_INLINE static int SmiToInt(const internal::Object* value) { |
| int shift_bits = kSmiTagSize + kSmiShiftSize; |
| // Shift down and throw away top 32 bits. |
| return static_cast<int>(reinterpret_cast<intptr_t>(value) >> shift_bits); |
| } |
| V8_INLINE static internal::Object* IntToSmi(int value) { |
| return internal::IntToSmi<kSmiShiftSize>(value); |
| } |
| V8_INLINE static bool IsValidSmi(intptr_t value) { |
| // To be representable as a long smi, the value must be a 32-bit integer. |
| return (value == static_cast<int32_t>(value)); |
| } |
| }; |
| |
| typedef SmiTagging<kApiPointerSize> PlatformSmiTagging; |
| const int kSmiShiftSize = PlatformSmiTagging::kSmiShiftSize; |
| const int kSmiValueSize = PlatformSmiTagging::kSmiValueSize; |
| V8_INLINE static bool SmiValuesAre31Bits() { return kSmiValueSize == 31; } |
| V8_INLINE static bool SmiValuesAre32Bits() { return kSmiValueSize == 32; } |
| |
| /** |
| * This class exports constants and functionality from within v8 that |
| * is necessary to implement inline functions in the v8 api. Don't |
| * depend on functions and constants defined here. |
| */ |
| class Internals { |
| public: |
| // These values match non-compiler-dependent values defined within |
| // the implementation of v8. |
| static const int kHeapObjectMapOffset = 0; |
| static const int kMapInstanceTypeAndBitFieldOffset = |
| 1 * kApiPointerSize + kApiIntSize; |
| static const int kStringResourceOffset = 3 * kApiPointerSize; |
| |
| static const int kOddballKindOffset = 4 * kApiPointerSize; |
| static const int kForeignAddressOffset = kApiPointerSize; |
| static const int kJSObjectHeaderSize = 3 * kApiPointerSize; |
| static const int kFixedArrayHeaderSize = 2 * kApiPointerSize; |
| static const int kContextHeaderSize = 2 * kApiPointerSize; |
| static const int kContextEmbedderDataIndex = 5; |
| static const int kFullStringRepresentationMask = 0x07; |
| static const int kStringEncodingMask = 0x4; |
| static const int kExternalTwoByteRepresentationTag = 0x02; |
| static const int kExternalOneByteRepresentationTag = 0x06; |
| |
| static const int kIsolateEmbedderDataOffset = 0 * kApiPointerSize; |
| static const int kAmountOfExternalAllocatedMemoryOffset = |
| 4 * kApiPointerSize; |
| static const int kAmountOfExternalAllocatedMemoryAtLastGlobalGCOffset = |
| kAmountOfExternalAllocatedMemoryOffset + kApiInt64Size; |
| static const int kIsolateRootsOffset = |
| kAmountOfExternalAllocatedMemoryAtLastGlobalGCOffset + kApiInt64Size + |
| kApiPointerSize; |
| static const int kUndefinedValueRootIndex = 5; |
| static const int kNullValueRootIndex = 7; |
| static const int kTrueValueRootIndex = 8; |
| static const int kFalseValueRootIndex = 9; |
| static const int kEmptyStringRootIndex = 10; |
| |
| // The external allocation limit should be below 256 MB on all architectures |
| // to avoid that resource-constrained embedders run low on memory. |
| static const int kExternalAllocationLimit = 192 * 1024 * 1024; |
| |
| static const int kNodeClassIdOffset = 1 * kApiPointerSize; |
| static const int kNodeFlagsOffset = 1 * kApiPointerSize + 3; |
| static const int kNodeStateMask = 0x7; |
| static const int kNodeStateIsWeakValue = 2; |
| static const int kNodeStateIsPendingValue = 3; |
| static const int kNodeStateIsNearDeathValue = 4; |
| static const int kNodeIsIndependentShift = 3; |
| static const int kNodeIsPartiallyDependentShift = 4; |
| static const int kNodeIsActiveShift = 4; |
| |
| static const int kJSObjectType = 0xb8; |
| static const int kFirstNonstringType = 0x80; |
| static const int kOddballType = 0x83; |
| static const int kForeignType = 0x87; |
| |
| static const int kUndefinedOddballKind = 5; |
| static const int kNullOddballKind = 3; |
| |
| static const uint32_t kNumIsolateDataSlots = 4; |
| |
| V8_EXPORT static void CheckInitializedImpl(v8::Isolate* isolate); |
| V8_INLINE static void CheckInitialized(v8::Isolate* isolate) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckInitializedImpl(isolate); |
| #endif |
| } |
| |
| V8_INLINE static bool HasHeapObjectTag(const internal::Object* value) { |
| return ((reinterpret_cast<intptr_t>(value) & kHeapObjectTagMask) == |
| kHeapObjectTag); |
| } |
| |
| V8_INLINE static int SmiValue(const internal::Object* value) { |
| return PlatformSmiTagging::SmiToInt(value); |
| } |
| |
| V8_INLINE static internal::Object* IntToSmi(int value) { |
| return PlatformSmiTagging::IntToSmi(value); |
| } |
| |
| V8_INLINE static bool IsValidSmi(intptr_t value) { |
| return PlatformSmiTagging::IsValidSmi(value); |
| } |
| |
| V8_INLINE static int GetInstanceType(const internal::Object* obj) { |
| typedef internal::Object O; |
| O* map = ReadField<O*>(obj, kHeapObjectMapOffset); |
| // Map::InstanceType is defined so that it will always be loaded into |
| // the LS 8 bits of one 16-bit word, regardless of endianess. |
| return ReadField<uint16_t>(map, kMapInstanceTypeAndBitFieldOffset) & 0xff; |
| } |
| |
| V8_INLINE static int GetOddballKind(const internal::Object* obj) { |
| typedef internal::Object O; |
| return SmiValue(ReadField<O*>(obj, kOddballKindOffset)); |
| } |
| |
| V8_INLINE static bool IsExternalTwoByteString(int instance_type) { |
| int representation = (instance_type & kFullStringRepresentationMask); |
| return representation == kExternalTwoByteRepresentationTag; |
| } |
| |
| V8_INLINE static uint8_t GetNodeFlag(internal::Object** obj, int shift) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; |
| return *addr & static_cast<uint8_t>(1U << shift); |
| } |
| |
| V8_INLINE static void UpdateNodeFlag(internal::Object** obj, |
| bool value, int shift) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; |
| uint8_t mask = static_cast<uint8_t>(1U << shift); |
| *addr = static_cast<uint8_t>((*addr & ~mask) | (value << shift)); |
| } |
| |
| V8_INLINE static uint8_t GetNodeState(internal::Object** obj) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; |
| return *addr & kNodeStateMask; |
| } |
| |
| V8_INLINE static void UpdateNodeState(internal::Object** obj, |
| uint8_t value) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + kNodeFlagsOffset; |
| *addr = static_cast<uint8_t>((*addr & ~kNodeStateMask) | value); |
| } |
| |
| V8_INLINE static void SetEmbedderData(v8::Isolate* isolate, |
| uint32_t slot, |
| void* data) { |
| uint8_t *addr = reinterpret_cast<uint8_t *>(isolate) + |
| kIsolateEmbedderDataOffset + slot * kApiPointerSize; |
| *reinterpret_cast<void**>(addr) = data; |
| } |
| |
| V8_INLINE static void* GetEmbedderData(const v8::Isolate* isolate, |
| uint32_t slot) { |
| const uint8_t* addr = reinterpret_cast<const uint8_t*>(isolate) + |
| kIsolateEmbedderDataOffset + slot * kApiPointerSize; |
| return *reinterpret_cast<void* const*>(addr); |
| } |
| |
| V8_INLINE static internal::Object** GetRoot(v8::Isolate* isolate, |
| int index) { |
| uint8_t* addr = reinterpret_cast<uint8_t*>(isolate) + kIsolateRootsOffset; |
| return reinterpret_cast<internal::Object**>(addr + index * kApiPointerSize); |
| } |
| |
| template <typename T> |
| V8_INLINE static T ReadField(const internal::Object* ptr, int offset) { |
| const uint8_t* addr = |
| reinterpret_cast<const uint8_t*>(ptr) + offset - kHeapObjectTag; |
| return *reinterpret_cast<const T*>(addr); |
| } |
| |
| template <typename T> |
| V8_INLINE static T ReadEmbedderData(const v8::Context* context, int index) { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* ctx = *reinterpret_cast<O* const*>(context); |
| int embedder_data_offset = I::kContextHeaderSize + |
| (internal::kApiPointerSize * I::kContextEmbedderDataIndex); |
| O* embedder_data = I::ReadField<O*>(ctx, embedder_data_offset); |
| int value_offset = |
| I::kFixedArrayHeaderSize + (internal::kApiPointerSize * index); |
| return I::ReadField<T>(embedder_data, value_offset); |
| } |
| }; |
| |
| } // namespace internal |
| |
| |
| template <class T> |
| Local<T> Local<T>::New(Isolate* isolate, Local<T> that) { |
| return New(isolate, that.val_); |
| } |
| |
| template <class T> |
| Local<T> Local<T>::New(Isolate* isolate, const PersistentBase<T>& that) { |
| return New(isolate, that.val_); |
| } |
| |
| |
| template <class T> |
| Local<T> Local<T>::New(Isolate* isolate, T* that) { |
| if (that == NULL) return Local<T>(); |
| T* that_ptr = that; |
| internal::Object** p = reinterpret_cast<internal::Object**>(that_ptr); |
| return Local<T>(reinterpret_cast<T*>(HandleScope::CreateHandle( |
| reinterpret_cast<internal::Isolate*>(isolate), *p))); |
| } |
| |
| |
| template<class T> |
| template<class S> |
| void Eternal<T>::Set(Isolate* isolate, Local<S> handle) { |
| TYPE_CHECK(T, S); |
| V8::Eternalize(isolate, reinterpret_cast<Value*>(*handle), &this->index_); |
| } |
| |
| |
| template<class T> |
| Local<T> Eternal<T>::Get(Isolate* isolate) { |
| return Local<T>(reinterpret_cast<T*>(*V8::GetEternal(isolate, index_))); |
| } |
| |
| |
| template <class T> |
| Local<T> MaybeLocal<T>::ToLocalChecked() { |
| if (V8_UNLIKELY(val_ == nullptr)) V8::ToLocalEmpty(); |
| return Local<T>(val_); |
| } |
| |
| |
| template <class T> |
| void* WeakCallbackInfo<T>::GetInternalField(int index) const { |
| #ifdef V8_ENABLE_CHECKS |
| if (index < 0 || index >= kInternalFieldsInWeakCallback) { |
| V8::InternalFieldOutOfBounds(index); |
| } |
| #endif |
| return internal_fields_[index]; |
| } |
| |
| |
| template <class T> |
| T* PersistentBase<T>::New(Isolate* isolate, T* that) { |
| if (that == NULL) return NULL; |
| internal::Object** p = reinterpret_cast<internal::Object**>(that); |
| return reinterpret_cast<T*>( |
| V8::GlobalizeReference(reinterpret_cast<internal::Isolate*>(isolate), |
| p)); |
| } |
| |
| |
| template <class T, class M> |
| template <class S, class M2> |
| void Persistent<T, M>::Copy(const Persistent<S, M2>& that) { |
| TYPE_CHECK(T, S); |
| this->Reset(); |
| if (that.IsEmpty()) return; |
| internal::Object** p = reinterpret_cast<internal::Object**>(that.val_); |
| this->val_ = reinterpret_cast<T*>(V8::CopyPersistent(p)); |
| M::Copy(that, this); |
| } |
| |
| |
| template <class T> |
| bool PersistentBase<T>::IsIndependent() const { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return false; |
| return I::GetNodeFlag(reinterpret_cast<internal::Object**>(this->val_), |
| I::kNodeIsIndependentShift); |
| } |
| |
| |
| template <class T> |
| bool PersistentBase<T>::IsNearDeath() const { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return false; |
| uint8_t node_state = |
| I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_)); |
| return node_state == I::kNodeStateIsNearDeathValue || |
| node_state == I::kNodeStateIsPendingValue; |
| } |
| |
| |
| template <class T> |
| bool PersistentBase<T>::IsWeak() const { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return false; |
| return I::GetNodeState(reinterpret_cast<internal::Object**>(this->val_)) == |
| I::kNodeStateIsWeakValue; |
| } |
| |
| |
| template <class T> |
| void PersistentBase<T>::Reset() { |
| if (this->IsEmpty()) return; |
| V8::DisposeGlobal(reinterpret_cast<internal::Object**>(this->val_)); |
| val_ = 0; |
| } |
| |
| |
| template <class T> |
| template <class S> |
| void PersistentBase<T>::Reset(Isolate* isolate, const Local<S>& other) { |
| TYPE_CHECK(T, S); |
| Reset(); |
| if (other.IsEmpty()) return; |
| this->val_ = New(isolate, other.val_); |
| } |
| |
| |
| template <class T> |
| template <class S> |
| void PersistentBase<T>::Reset(Isolate* isolate, |
| const PersistentBase<S>& other) { |
| TYPE_CHECK(T, S); |
| Reset(); |
| if (other.IsEmpty()) return; |
| this->val_ = New(isolate, other.val_); |
| } |
| |
| |
| template <class T> |
| template <typename S, typename P> |
| void PersistentBase<T>::SetWeak( |
| P* parameter, |
| typename WeakCallbackData<S, P>::Callback callback) { |
| TYPE_CHECK(S, T); |
| typedef typename WeakCallbackData<Value, void>::Callback Callback; |
| V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter, |
| reinterpret_cast<Callback>(callback)); |
| } |
| |
| |
| template <class T> |
| template <typename P> |
| void PersistentBase<T>::SetWeak( |
| P* parameter, |
| typename WeakCallbackData<T, P>::Callback callback) { |
| SetWeak<T, P>(parameter, callback); |
| } |
| |
| |
| template <class T> |
| template <typename P> |
| void PersistentBase<T>::SetPhantom( |
| P* parameter, typename WeakCallbackInfo<P>::Callback callback, |
| int internal_field_index1, int internal_field_index2) { |
| typedef typename WeakCallbackInfo<void>::Callback Callback; |
| V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter, |
| internal_field_index1, internal_field_index2, |
| reinterpret_cast<Callback>(callback)); |
| } |
| |
| |
| template <class T> |
| template <typename P> |
| V8_INLINE void PersistentBase<T>::SetWeak( |
| P* parameter, typename WeakCallbackInfo<P>::Callback callback, |
| WeakCallbackType type) { |
| typedef typename WeakCallbackInfo<void>::Callback Callback; |
| V8::MakeWeak(reinterpret_cast<internal::Object**>(this->val_), parameter, |
| reinterpret_cast<Callback>(callback), type); |
| } |
| |
| |
| template <class T> |
| template <typename P> |
| P* PersistentBase<T>::ClearWeak() { |
| return reinterpret_cast<P*>( |
| V8::ClearWeak(reinterpret_cast<internal::Object**>(this->val_))); |
| } |
| |
| |
| template <class T> |
| void PersistentBase<T>::MarkIndependent() { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return; |
| I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), |
| true, |
| I::kNodeIsIndependentShift); |
| } |
| |
| |
| template <class T> |
| void PersistentBase<T>::MarkPartiallyDependent() { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return; |
| I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), |
| true, |
| I::kNodeIsPartiallyDependentShift); |
| } |
| |
| |
| template <class T> |
| void PersistentBase<T>::MarkActive() { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return; |
| I::UpdateNodeFlag(reinterpret_cast<internal::Object**>(this->val_), true, |
| I::kNodeIsActiveShift); |
| } |
| |
| |
| template <class T> |
| void PersistentBase<T>::SetWrapperClassId(uint16_t class_id) { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return; |
| internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_); |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset; |
| *reinterpret_cast<uint16_t*>(addr) = class_id; |
| } |
| |
| |
| template <class T> |
| uint16_t PersistentBase<T>::WrapperClassId() const { |
| typedef internal::Internals I; |
| if (this->IsEmpty()) return 0; |
| internal::Object** obj = reinterpret_cast<internal::Object**>(this->val_); |
| uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset; |
| return *reinterpret_cast<uint16_t*>(addr); |
| } |
| |
| |
| template<typename T> |
| ReturnValue<T>::ReturnValue(internal::Object** slot) : value_(slot) {} |
| |
| template<typename T> |
| template<typename S> |
| void ReturnValue<T>::Set(const Persistent<S>& handle) { |
| TYPE_CHECK(T, S); |
| if (V8_UNLIKELY(handle.IsEmpty())) { |
| *value_ = GetDefaultValue(); |
| } else { |
| *value_ = *reinterpret_cast<internal::Object**>(*handle); |
| } |
| } |
| |
| template <typename T> |
| template <typename S> |
| void ReturnValue<T>::Set(const Global<S>& handle) { |
| TYPE_CHECK(T, S); |
| if (V8_UNLIKELY(handle.IsEmpty())) { |
| *value_ = GetDefaultValue(); |
| } else { |
| *value_ = *reinterpret_cast<internal::Object**>(*handle); |
| } |
| } |
| |
| template <typename T> |
| template <typename S> |
| void ReturnValue<T>::Set(const Local<S> handle) { |
| TYPE_CHECK(T, S); |
| if (V8_UNLIKELY(handle.IsEmpty())) { |
| *value_ = GetDefaultValue(); |
| } else { |
| *value_ = *reinterpret_cast<internal::Object**>(*handle); |
| } |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::Set(double i) { |
| TYPE_CHECK(T, Number); |
| Set(Number::New(GetIsolate(), i)); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::Set(int32_t i) { |
| TYPE_CHECK(T, Integer); |
| typedef internal::Internals I; |
| if (V8_LIKELY(I::IsValidSmi(i))) { |
| *value_ = I::IntToSmi(i); |
| return; |
| } |
| Set(Integer::New(GetIsolate(), i)); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::Set(uint32_t i) { |
| TYPE_CHECK(T, Integer); |
| // Can't simply use INT32_MAX here for whatever reason. |
| bool fits_into_int32_t = (i & (1U << 31)) == 0; |
| if (V8_LIKELY(fits_into_int32_t)) { |
| Set(static_cast<int32_t>(i)); |
| return; |
| } |
| Set(Integer::NewFromUnsigned(GetIsolate(), i)); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::Set(bool value) { |
| TYPE_CHECK(T, Boolean); |
| typedef internal::Internals I; |
| int root_index; |
| if (value) { |
| root_index = I::kTrueValueRootIndex; |
| } else { |
| root_index = I::kFalseValueRootIndex; |
| } |
| *value_ = *I::GetRoot(GetIsolate(), root_index); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::SetNull() { |
| TYPE_CHECK(T, Primitive); |
| typedef internal::Internals I; |
| *value_ = *I::GetRoot(GetIsolate(), I::kNullValueRootIndex); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::SetUndefined() { |
| TYPE_CHECK(T, Primitive); |
| typedef internal::Internals I; |
| *value_ = *I::GetRoot(GetIsolate(), I::kUndefinedValueRootIndex); |
| } |
| |
| template<typename T> |
| void ReturnValue<T>::SetEmptyString() { |
| TYPE_CHECK(T, String); |
| typedef internal::Internals I; |
| *value_ = *I::GetRoot(GetIsolate(), I::kEmptyStringRootIndex); |
| } |
| |
| template<typename T> |
| Isolate* ReturnValue<T>::GetIsolate() { |
| // Isolate is always the pointer below the default value on the stack. |
| return *reinterpret_cast<Isolate**>(&value_[-2]); |
| } |
| |
| template<typename T> |
| template<typename S> |
| void ReturnValue<T>::Set(S* whatever) { |
| // Uncompilable to prevent inadvertent misuse. |
| TYPE_CHECK(S*, Primitive); |
| } |
| |
| template<typename T> |
| internal::Object* ReturnValue<T>::GetDefaultValue() { |
| // Default value is always the pointer below value_ on the stack. |
| return value_[-1]; |
| } |
| |
| |
| template<typename T> |
| FunctionCallbackInfo<T>::FunctionCallbackInfo(internal::Object** implicit_args, |
| internal::Object** values, |
| int length, |
| bool is_construct_call) |
| : implicit_args_(implicit_args), |
| values_(values), |
| length_(length), |
| is_construct_call_(is_construct_call) { } |
| |
| |
| template<typename T> |
| Local<Value> FunctionCallbackInfo<T>::operator[](int i) const { |
| if (i < 0 || length_ <= i) return Local<Value>(*Undefined(GetIsolate())); |
| return Local<Value>(reinterpret_cast<Value*>(values_ - i)); |
| } |
| |
| |
| template<typename T> |
| Local<Function> FunctionCallbackInfo<T>::Callee() const { |
| return Local<Function>(reinterpret_cast<Function*>( |
| &implicit_args_[kCalleeIndex])); |
| } |
| |
| |
| template<typename T> |
| Local<Object> FunctionCallbackInfo<T>::This() const { |
| return Local<Object>(reinterpret_cast<Object*>(values_ + 1)); |
| } |
| |
| |
| template<typename T> |
| Local<Object> FunctionCallbackInfo<T>::Holder() const { |
| return Local<Object>(reinterpret_cast<Object*>( |
| &implicit_args_[kHolderIndex])); |
| } |
| |
| |
| template<typename T> |
| Local<Value> FunctionCallbackInfo<T>::Data() const { |
| return Local<Value>(reinterpret_cast<Value*>(&implicit_args_[kDataIndex])); |
| } |
| |
| |
| template<typename T> |
| Isolate* FunctionCallbackInfo<T>::GetIsolate() const { |
| return *reinterpret_cast<Isolate**>(&implicit_args_[kIsolateIndex]); |
| } |
| |
| |
| template<typename T> |
| ReturnValue<T> FunctionCallbackInfo<T>::GetReturnValue() const { |
| return ReturnValue<T>(&implicit_args_[kReturnValueIndex]); |
| } |
| |
| |
| template<typename T> |
| bool FunctionCallbackInfo<T>::IsConstructCall() const { |
| return is_construct_call_ & 0x1; |
| } |
| |
| |
| template<typename T> |
| int FunctionCallbackInfo<T>::Length() const { |
| return length_; |
| } |
| |
| ScriptOrigin::ScriptOrigin(Local<Value> resource_name, |
| Local<Integer> resource_line_offset, |
| Local<Integer> resource_column_offset, |
| Local<Boolean> resource_is_shared_cross_origin, |
| Local<Integer> script_id, |
| Local<Boolean> resource_is_embedder_debug_script, |
| Local<Value> source_map_url, |
| Local<Boolean> resource_is_opaque) |
| : resource_name_(resource_name), |
| resource_line_offset_(resource_line_offset), |
| resource_column_offset_(resource_column_offset), |
| options_(!resource_is_embedder_debug_script.IsEmpty() && |
| resource_is_embedder_debug_script->IsTrue(), |
| !resource_is_shared_cross_origin.IsEmpty() && |
| resource_is_shared_cross_origin->IsTrue(), |
| !resource_is_opaque.IsEmpty() && resource_is_opaque->IsTrue()), |
| script_id_(script_id), |
| source_map_url_(source_map_url) {} |
| |
| Local<Value> ScriptOrigin::ResourceName() const { return resource_name_; } |
| |
| |
| Local<Integer> ScriptOrigin::ResourceLineOffset() const { |
| return resource_line_offset_; |
| } |
| |
| |
| Local<Integer> ScriptOrigin::ResourceColumnOffset() const { |
| return resource_column_offset_; |
| } |
| |
| |
| Local<Integer> ScriptOrigin::ScriptID() const { return script_id_; } |
| |
| |
| Local<Value> ScriptOrigin::SourceMapUrl() const { return source_map_url_; } |
| |
| |
| ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin, |
| CachedData* data) |
| : source_string(string), |
| resource_name(origin.ResourceName()), |
| resource_line_offset(origin.ResourceLineOffset()), |
| resource_column_offset(origin.ResourceColumnOffset()), |
| resource_options(origin.Options()), |
| source_map_url(origin.SourceMapUrl()), |
| cached_data(data) {} |
| |
| |
| ScriptCompiler::Source::Source(Local<String> string, |
| CachedData* data) |
| : source_string(string), cached_data(data) {} |
| |
| |
| ScriptCompiler::Source::~Source() { |
| delete cached_data; |
| } |
| |
| |
| const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData() |
| const { |
| return cached_data; |
| } |
| |
| |
| Local<Boolean> Boolean::New(Isolate* isolate, bool value) { |
| return value ? True(isolate) : False(isolate); |
| } |
| |
| |
| void Template::Set(Isolate* isolate, const char* name, v8::Local<Data> value) { |
| Set(v8::String::NewFromUtf8(isolate, name, NewStringType::kNormal) |
| .ToLocalChecked(), |
| value); |
| } |
| |
| |
| Local<Value> Object::GetInternalField(int index) { |
| #ifndef V8_ENABLE_CHECKS |
| typedef internal::Object O; |
| typedef internal::HeapObject HO; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O**>(this); |
| // Fast path: If the object is a plain JSObject, which is the common case, we |
| // know where to find the internal fields and can return the value directly. |
| if (I::GetInstanceType(obj) == I::kJSObjectType) { |
| int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index); |
| O* value = I::ReadField<O*>(obj, offset); |
| O** result = HandleScope::CreateHandle(reinterpret_cast<HO*>(obj), value); |
| return Local<Value>(reinterpret_cast<Value*>(result)); |
| } |
| #endif |
| return SlowGetInternalField(index); |
| } |
| |
| |
| void* Object::GetAlignedPointerFromInternalField(int index) { |
| #ifndef V8_ENABLE_CHECKS |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O**>(this); |
| // Fast path: If the object is a plain JSObject, which is the common case, we |
| // know where to find the internal fields and can return the value directly. |
| if (V8_LIKELY(I::GetInstanceType(obj) == I::kJSObjectType)) { |
| int offset = I::kJSObjectHeaderSize + (internal::kApiPointerSize * index); |
| return I::ReadField<void*>(obj, offset); |
| } |
| #endif |
| return SlowGetAlignedPointerFromInternalField(index); |
| } |
| |
| |
| String* String::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<String*>(value); |
| } |
| |
| |
| Local<String> String::Empty(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kEmptyStringRootIndex); |
| return Local<String>(reinterpret_cast<String*>(slot)); |
| } |
| |
| |
| String::ExternalStringResource* String::GetExternalStringResource() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| String::ExternalStringResource* result; |
| if (I::IsExternalTwoByteString(I::GetInstanceType(obj))) { |
| void* value = I::ReadField<void*>(obj, I::kStringResourceOffset); |
| result = reinterpret_cast<String::ExternalStringResource*>(value); |
| } else { |
| result = NULL; |
| } |
| #ifdef V8_ENABLE_CHECKS |
| VerifyExternalStringResource(result); |
| #endif |
| return result; |
| } |
| |
| |
| String::ExternalStringResourceBase* String::GetExternalStringResourceBase( |
| String::Encoding* encoding_out) const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| int type = I::GetInstanceType(obj) & I::kFullStringRepresentationMask; |
| *encoding_out = static_cast<Encoding>(type & I::kStringEncodingMask); |
| ExternalStringResourceBase* resource = NULL; |
| if (type == I::kExternalOneByteRepresentationTag || |
| type == I::kExternalTwoByteRepresentationTag) { |
| void* value = I::ReadField<void*>(obj, I::kStringResourceOffset); |
| resource = static_cast<ExternalStringResourceBase*>(value); |
| } |
| #ifdef V8_ENABLE_CHECKS |
| VerifyExternalStringResourceBase(resource, *encoding_out); |
| #endif |
| return resource; |
| } |
| |
| |
| bool Value::IsUndefined() const { |
| #ifdef V8_ENABLE_CHECKS |
| return FullIsUndefined(); |
| #else |
| return QuickIsUndefined(); |
| #endif |
| } |
| |
| bool Value::QuickIsUndefined() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| if (!I::HasHeapObjectTag(obj)) return false; |
| if (I::GetInstanceType(obj) != I::kOddballType) return false; |
| return (I::GetOddballKind(obj) == I::kUndefinedOddballKind); |
| } |
| |
| |
| bool Value::IsNull() const { |
| #ifdef V8_ENABLE_CHECKS |
| return FullIsNull(); |
| #else |
| return QuickIsNull(); |
| #endif |
| } |
| |
| bool Value::QuickIsNull() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| if (!I::HasHeapObjectTag(obj)) return false; |
| if (I::GetInstanceType(obj) != I::kOddballType) return false; |
| return (I::GetOddballKind(obj) == I::kNullOddballKind); |
| } |
| |
| |
| bool Value::IsString() const { |
| #ifdef V8_ENABLE_CHECKS |
| return FullIsString(); |
| #else |
| return QuickIsString(); |
| #endif |
| } |
| |
| bool Value::QuickIsString() const { |
| typedef internal::Object O; |
| typedef internal::Internals I; |
| O* obj = *reinterpret_cast<O* const*>(this); |
| if (!I::HasHeapObjectTag(obj)) return false; |
| return (I::GetInstanceType(obj) < I::kFirstNonstringType); |
| } |
| |
| |
| template <class T> Value* Value::Cast(T* value) { |
| return static_cast<Value*>(value); |
| } |
| |
| |
| Local<Boolean> Value::ToBoolean() const { |
| return ToBoolean(Isolate::GetCurrent()->GetCurrentContext()) |
| .FromMaybe(Local<Boolean>()); |
| } |
| |
| |
| Local<Number> Value::ToNumber() const { |
| return ToNumber(Isolate::GetCurrent()->GetCurrentContext()) |
| .FromMaybe(Local<Number>()); |
| } |
| |
| |
| Local<String> Value::ToString() const { |
| return ToString(Isolate::GetCurrent()->GetCurrentContext()) |
| .FromMaybe(Local<String>()); |
| } |
| |
| |
| Local<String> Value::ToDetailString() const { |
| return ToDetailString(Isolate::GetCurrent()->GetCurrentContext()) |
| .FromMaybe(Local<String>()); |
| } |
| |
| |
| Local<Object> Value::ToObject() const { |
| return ToObject(Isolate::GetCurrent()->GetCurrentContext()) |
| .FromMaybe(Local<Object>()); |
| } |
| |
| |
| Local<Integer> Value::ToInteger() const { |
| return ToInteger(Isolate::GetCurrent()->GetCurrentContext()) |
| .FromMaybe(Local<Integer>()); |
| } |
| |
| |
| Local<Uint32> Value::ToUint32() const { |
| return ToUint32(Isolate::GetCurrent()->GetCurrentContext()) |
| .FromMaybe(Local<Uint32>()); |
| } |
| |
| |
| Local<Int32> Value::ToInt32() const { |
| return ToInt32(Isolate::GetCurrent()->GetCurrentContext()) |
| .FromMaybe(Local<Int32>()); |
| } |
| |
| |
| Boolean* Boolean::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Boolean*>(value); |
| } |
| |
| |
| Name* Name::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Name*>(value); |
| } |
| |
| |
| Symbol* Symbol::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Symbol*>(value); |
| } |
| |
| |
| Number* Number::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Number*>(value); |
| } |
| |
| |
| Integer* Integer::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Integer*>(value); |
| } |
| |
| |
| Int32* Int32::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Int32*>(value); |
| } |
| |
| |
| Uint32* Uint32::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint32*>(value); |
| } |
| |
| |
| Date* Date::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Date*>(value); |
| } |
| |
| |
| StringObject* StringObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<StringObject*>(value); |
| } |
| |
| |
| SymbolObject* SymbolObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<SymbolObject*>(value); |
| } |
| |
| |
| NumberObject* NumberObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<NumberObject*>(value); |
| } |
| |
| |
| BooleanObject* BooleanObject::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<BooleanObject*>(value); |
| } |
| |
| |
| RegExp* RegExp::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<RegExp*>(value); |
| } |
| |
| |
| Object* Object::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Object*>(value); |
| } |
| |
| |
| Array* Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Array*>(value); |
| } |
| |
| |
| Map* Map::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Map*>(value); |
| } |
| |
| |
| Set* Set::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Set*>(value); |
| } |
| |
| |
| Promise* Promise::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Promise*>(value); |
| } |
| |
| |
| Promise::Resolver* Promise::Resolver::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Promise::Resolver*>(value); |
| } |
| |
| |
| ArrayBuffer* ArrayBuffer::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<ArrayBuffer*>(value); |
| } |
| |
| |
| ArrayBufferView* ArrayBufferView::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<ArrayBufferView*>(value); |
| } |
| |
| |
| TypedArray* TypedArray::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<TypedArray*>(value); |
| } |
| |
| |
| Uint8Array* Uint8Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint8Array*>(value); |
| } |
| |
| |
| Int8Array* Int8Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Int8Array*>(value); |
| } |
| |
| |
| Uint16Array* Uint16Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint16Array*>(value); |
| } |
| |
| |
| Int16Array* Int16Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Int16Array*>(value); |
| } |
| |
| |
| Uint32Array* Uint32Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint32Array*>(value); |
| } |
| |
| |
| Int32Array* Int32Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Int32Array*>(value); |
| } |
| |
| |
| Float32Array* Float32Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Float32Array*>(value); |
| } |
| |
| |
| Float64Array* Float64Array::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Float64Array*>(value); |
| } |
| |
| |
| Uint8ClampedArray* Uint8ClampedArray::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Uint8ClampedArray*>(value); |
| } |
| |
| |
| DataView* DataView::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<DataView*>(value); |
| } |
| |
| |
| SharedArrayBuffer* SharedArrayBuffer::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<SharedArrayBuffer*>(value); |
| } |
| |
| |
| Function* Function::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<Function*>(value); |
| } |
| |
| |
| External* External::Cast(v8::Value* value) { |
| #ifdef V8_ENABLE_CHECKS |
| CheckCast(value); |
| #endif |
| return static_cast<External*>(value); |
| } |
| |
| |
| template<typename T> |
| Isolate* PropertyCallbackInfo<T>::GetIsolate() const { |
| return *reinterpret_cast<Isolate**>(&args_[kIsolateIndex]); |
| } |
| |
| |
| template<typename T> |
| Local<Value> PropertyCallbackInfo<T>::Data() const { |
| return Local<Value>(reinterpret_cast<Value*>(&args_[kDataIndex])); |
| } |
| |
| |
| template<typename T> |
| Local<Object> PropertyCallbackInfo<T>::This() const { |
| return Local<Object>(reinterpret_cast<Object*>(&args_[kThisIndex])); |
| } |
| |
| |
| template<typename T> |
| Local<Object> PropertyCallbackInfo<T>::Holder() const { |
| return Local<Object>(reinterpret_cast<Object*>(&args_[kHolderIndex])); |
| } |
| |
| |
| template<typename T> |
| ReturnValue<T> PropertyCallbackInfo<T>::GetReturnValue() const { |
| return ReturnValue<T>(&args_[kReturnValueIndex]); |
| } |
| |
| |
| Local<Primitive> Undefined(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kUndefinedValueRootIndex); |
| return Local<Primitive>(reinterpret_cast<Primitive*>(slot)); |
| } |
| |
| |
| Local<Primitive> Null(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kNullValueRootIndex); |
| return Local<Primitive>(reinterpret_cast<Primitive*>(slot)); |
| } |
| |
| |
| Local<Boolean> True(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kTrueValueRootIndex); |
| return Local<Boolean>(reinterpret_cast<Boolean*>(slot)); |
| } |
| |
| |
| Local<Boolean> False(Isolate* isolate) { |
| typedef internal::Object* S; |
| typedef internal::Internals I; |
| I::CheckInitialized(isolate); |
| S* slot = I::GetRoot(isolate, I::kFalseValueRootIndex); |
| return Local<Boolean>(reinterpret_cast<Boolean*>(slot)); |
| } |
| |
| |
| void Isolate::SetData(uint32_t slot, void* data) { |
| typedef internal::Internals I; |
| I::SetEmbedderData(this, slot, data); |
| } |
| |
| |
| void* Isolate::GetData(uint32_t slot) { |
| typedef internal::Internals I; |
| return I::GetEmbedderData(this, slot); |
| } |
| |
| |
| uint32_t Isolate::GetNumberOfDataSlots() { |
| typedef internal::Internals I; |
| return I::kNumIsolateDataSlots; |
| } |
| |
| |
| int64_t Isolate::AdjustAmountOfExternalAllocatedMemory( |
| int64_t change_in_bytes) { |
| typedef internal::Internals I; |
| int64_t* amount_of_external_allocated_memory = |
| reinterpret_cast<int64_t*>(reinterpret_cast<uint8_t*>(this) + |
| I::kAmountOfExternalAllocatedMemoryOffset); |
| int64_t* amount_of_external_allocated_memory_at_last_global_gc = |
| reinterpret_cast<int64_t*>( |
| reinterpret_cast<uint8_t*>(this) + |
| I::kAmountOfExternalAllocatedMemoryAtLastGlobalGCOffset); |
| int64_t amount = *amount_of_external_allocated_memory + change_in_bytes; |
| if (change_in_bytes > 0 && |
| amount - *amount_of_external_allocated_memory_at_last_global_gc > |
| I::kExternalAllocationLimit) { |
| ReportExternalAllocationLimitReached(); |
| } |
| *amount_of_external_allocated_memory = amount; |
| return *amount_of_external_allocated_memory; |
| } |
| |
| |
| template<typename T> |
| void Isolate::SetObjectGroupId(const Persistent<T>& object, |
| UniqueId id) { |
| TYPE_CHECK(Value, T); |
| SetObjectGroupId(reinterpret_cast<v8::internal::Object**>(object.val_), id); |
| } |
| |
| |
| template<typename T> |
| void Isolate::SetReferenceFromGroup(UniqueId id, |
| const Persistent<T>& object) { |
| TYPE_CHECK(Value, T); |
| SetReferenceFromGroup(id, |
| reinterpret_cast<v8::internal::Object**>(object.val_)); |
| } |
| |
| |
| template<typename T, typename S> |
| void Isolate::SetReference(const Persistent<T>& parent, |
| const Persistent<S>& child) { |
| TYPE_CHECK(Object, T); |
| TYPE_CHECK(Value, S); |
| SetReference(reinterpret_cast<v8::internal::Object**>(parent.val_), |
| reinterpret_cast<v8::internal::Object**>(child.val_)); |
| } |
| |
| |
| Local<Value> Context::GetEmbedderData(int index) { |
| #ifndef V8_ENABLE_CHECKS |
| typedef internal::Object O; |
| typedef internal::HeapObject HO; |
| typedef internal::Internals I; |
| HO* context = *reinterpret_cast<HO**>(this); |
| O** result = |
| HandleScope::CreateHandle(context, I::ReadEmbedderData<O*>(this, index)); |
| return Local<Value>(reinterpret_cast<Value*>(result)); |
| #else |
| return SlowGetEmbedderData(index); |
| #endif |
| } |
| |
| |
| void* Context::GetAlignedPointerFromEmbedderData(int index) { |
| #ifndef V8_ENABLE_CHECKS |
| typedef internal::Internals I; |
| return I::ReadEmbedderData<void*>(this, index); |
| #else |
| return SlowGetAlignedPointerFromEmbedderData(index); |
| #endif |
| } |
| |
| |
| void V8::SetAllowCodeGenerationFromStringsCallback( |
| AllowCodeGenerationFromStringsCallback callback) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->SetAllowCodeGenerationFromStringsCallback(callback); |
| } |
| |
| |
| bool V8::IsDead() { |
| Isolate* isolate = Isolate::GetCurrent(); |
| return isolate->IsDead(); |
| } |
| |
| |
| bool V8::AddMessageListener(MessageCallback that, Local<Value> data) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| return isolate->AddMessageListener(that, data); |
| } |
| |
| |
| void V8::RemoveMessageListeners(MessageCallback that) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->RemoveMessageListeners(that); |
| } |
| |
| |
| void V8::SetFailedAccessCheckCallbackFunction( |
| FailedAccessCheckCallback callback) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->SetFailedAccessCheckCallbackFunction(callback); |
| } |
| |
| |
| void V8::SetCaptureStackTraceForUncaughtExceptions( |
| bool capture, int frame_limit, StackTrace::StackTraceOptions options) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->SetCaptureStackTraceForUncaughtExceptions(capture, frame_limit, |
| options); |
| } |
| |
| |
| void V8::SetFatalErrorHandler(FatalErrorCallback callback) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->SetFatalErrorHandler(callback); |
| } |
| |
| |
| void V8::RemoveGCPrologueCallback(GCCallback callback) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->RemoveGCPrologueCallback( |
| reinterpret_cast<v8::Isolate::GCCallback>(callback)); |
| } |
| |
| |
| void V8::RemoveGCEpilogueCallback(GCCallback callback) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->RemoveGCEpilogueCallback( |
| reinterpret_cast<v8::Isolate::GCCallback>(callback)); |
| } |
| |
| |
| void V8::AddMemoryAllocationCallback(MemoryAllocationCallback callback, |
| ObjectSpace space, |
| AllocationAction action) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->AddMemoryAllocationCallback(callback, space, action); |
| } |
| |
| |
| void V8::RemoveMemoryAllocationCallback(MemoryAllocationCallback callback) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->RemoveMemoryAllocationCallback(callback); |
| } |
| |
| |
| void V8::TerminateExecution(Isolate* isolate) { isolate->TerminateExecution(); } |
| |
| |
| bool V8::IsExecutionTerminating(Isolate* isolate) { |
| if (isolate == NULL) { |
| isolate = Isolate::GetCurrent(); |
| } |
| return isolate->IsExecutionTerminating(); |
| } |
| |
| |
| void V8::CancelTerminateExecution(Isolate* isolate) { |
| isolate->CancelTerminateExecution(); |
| } |
| |
| |
| void V8::VisitExternalResources(ExternalResourceVisitor* visitor) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->VisitExternalResources(visitor); |
| } |
| |
| |
| void V8::VisitHandlesWithClassIds(PersistentHandleVisitor* visitor) { |
| Isolate* isolate = Isolate::GetCurrent(); |
| isolate->VisitHandlesWithClassIds(visitor); |
| } |
| |
| |
| void V8::VisitHandlesWithClassIds(Isolate* isolate, |
| PersistentHandleVisitor* visitor) { |
| isolate->VisitHandlesWithClassIds(visitor); |
| } |
| |
| |
| void V8::VisitHandlesForPartialDependence(Isolate* isolate, |
| PersistentHandleVisitor* visitor) { |
| isolate->VisitHandlesForPartialDependence(visitor); |
| } |
| |
| /** |
| * \example shell.cc |
| * A simple shell that takes a list of expressions on the |
| * command-line and executes them. |
| */ |
| |
| |
| /** |
| * \example process.cc |
| */ |
| |
| |
| } // namespace v8 |
| |
| |
| #undef TYPE_CHECK |
| |
| |
| #endif // V8_H_ |