| // Copyright 2011 The Chromium Authors. All rights reserved. |
| // Use of this source code is governed by a BSD-style license that can be |
| // found in the LICENSE file. |
| |
| #include "cc/layer_tree_host_impl.h" |
| |
| #include <cmath> |
| |
| #include "base/bind.h" |
| #include "base/command_line.h" |
| #include "base/hash_tables.h" |
| #include "cc/compositor_frame_metadata.h" |
| #include "cc/delegated_renderer_layer_impl.h" |
| #include "cc/gl_renderer.h" |
| #include "cc/heads_up_display_layer_impl.h" |
| #include "cc/io_surface_layer_impl.h" |
| #include "cc/layer_impl.h" |
| #include "cc/layer_tiling_data.h" |
| #include "cc/layer_tree_impl.h" |
| #include "cc/math_util.h" |
| #include "cc/quad_sink.h" |
| #include "cc/render_pass_draw_quad.h" |
| #include "cc/scrollbar_geometry_fixed_thumb.h" |
| #include "cc/scrollbar_layer_impl.h" |
| #include "cc/single_thread_proxy.h" |
| #include "cc/solid_color_draw_quad.h" |
| #include "cc/test/animation_test_common.h" |
| #include "cc/test/fake_output_surface.h" |
| #include "cc/test/fake_proxy.h" |
| #include "cc/test/fake_web_graphics_context_3d.h" |
| #include "cc/test/fake_web_scrollbar_theme_geometry.h" |
| #include "cc/test/geometry_test_utils.h" |
| #include "cc/test/layer_test_common.h" |
| #include "cc/test/render_pass_test_common.h" |
| #include "cc/texture_draw_quad.h" |
| #include "cc/texture_layer_impl.h" |
| #include "cc/tile_draw_quad.h" |
| #include "cc/tiled_layer_impl.h" |
| #include "cc/video_layer_impl.h" |
| #include "media/base/media.h" |
| #include "media/base/video_frame.h" |
| #include "testing/gmock/include/gmock/gmock.h" |
| #include "testing/gtest/include/gtest/gtest.h" |
| #include "ui/gfx/size_conversions.h" |
| #include "ui/gfx/vector2d_conversions.h" |
| #include <public/WebVideoFrame.h> |
| #include <public/WebVideoFrameProvider.h> |
| |
| using media::VideoFrame; |
| using ::testing::Mock; |
| using ::testing::Return; |
| using ::testing::AnyNumber; |
| using ::testing::AtLeast; |
| using ::testing::_; |
| |
| namespace cc { |
| namespace { |
| |
| // This test is parametrized to run all tests with the |
| // m_settings.pageScalePinchZoomEnabled field enabled and disabled. |
| class LayerTreeHostImplTest : public testing::TestWithParam<bool>, |
| public LayerTreeHostImplClient { |
| public: |
| LayerTreeHostImplTest() |
| : m_proxy(scoped_ptr<Thread>(NULL)) |
| , m_alwaysImplThread(&m_proxy) |
| , m_alwaysMainThreadBlocked(&m_proxy) |
| , m_onCanDrawStateChangedCalled(false) |
| , m_didRequestCommit(false) |
| , m_didRequestRedraw(false) |
| , m_reduceMemoryResult(true) |
| { |
| media::InitializeMediaLibraryForTesting(); |
| } |
| |
| virtual void SetUp() |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| settings.pageScalePinchZoomEnabled = GetParam(); |
| |
| m_hostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| m_hostImpl->initializeRenderer(createOutputSurface()); |
| m_hostImpl->setViewportSize(gfx::Size(10, 10), gfx::Size(10, 10)); |
| } |
| |
| virtual void TearDown() |
| { |
| } |
| |
| virtual void didLoseOutputSurfaceOnImplThread() OVERRIDE { } |
| virtual void onSwapBuffersCompleteOnImplThread() OVERRIDE { } |
| virtual void onVSyncParametersChanged(base::TimeTicks, base::TimeDelta) OVERRIDE { } |
| virtual void onCanDrawStateChanged(bool canDraw) OVERRIDE { m_onCanDrawStateChangedCalled = true; } |
| virtual void setNeedsRedrawOnImplThread() OVERRIDE { m_didRequestRedraw = true; } |
| virtual void setNeedsCommitOnImplThread() OVERRIDE { m_didRequestCommit = true; } |
| virtual void setNeedsManageTilesOnImplThread() OVERRIDE { } |
| virtual void postAnimationEventsToMainThreadOnImplThread(scoped_ptr<AnimationEventsVector>, base::Time wallClockTime) OVERRIDE { } |
| virtual bool reduceContentsTextureMemoryOnImplThread(size_t limitBytes, int priorityCutoff) OVERRIDE { return m_reduceMemoryResult; } |
| virtual void sendManagedMemoryStats() OVERRIDE { } |
| |
| void setReduceMemoryResult(bool reduceMemoryResult) { m_reduceMemoryResult = reduceMemoryResult; } |
| |
| void createLayerTreeHost(bool partialSwap, scoped_ptr<OutputSurface> outputSurface) |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| settings.partialSwapEnabled = partialSwap; |
| |
| m_hostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| m_hostImpl->initializeRenderer(outputSurface.Pass()); |
| m_hostImpl->setViewportSize(gfx::Size(10, 10), gfx::Size(10, 10)); |
| } |
| |
| void setupRootLayerImpl(scoped_ptr<LayerImpl> root) |
| { |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(0, 0)); |
| root->setBounds(gfx::Size(10, 10)); |
| root->setContentBounds(gfx::Size(10, 10)); |
| root->setDrawsContent(true); |
| root->drawProperties().visible_content_rect = gfx::Rect(0, 0, 10, 10); |
| m_hostImpl->setRootLayer(root.Pass()); |
| } |
| |
| static void expectClearedScrollDeltasRecursive(LayerImpl* layer) |
| { |
| ASSERT_EQ(layer->scrollDelta(), gfx::Vector2d()); |
| for (size_t i = 0; i < layer->children().size(); ++i) |
| expectClearedScrollDeltasRecursive(layer->children()[i]); |
| } |
| |
| static void expectContains(const ScrollAndScaleSet& scrollInfo, int id, const gfx::Vector2d& scrollDelta) |
| { |
| int timesEncountered = 0; |
| |
| for (size_t i = 0; i < scrollInfo.scrolls.size(); ++i) { |
| if (scrollInfo.scrolls[i].layerId != id) |
| continue; |
| EXPECT_VECTOR_EQ(scrollDelta, scrollInfo.scrolls[i].scrollDelta); |
| timesEncountered++; |
| } |
| |
| ASSERT_EQ(timesEncountered, 1); |
| } |
| |
| static void expectNone(const ScrollAndScaleSet& scrollInfo, int id) |
| { |
| int timesEncountered = 0; |
| |
| for (size_t i = 0; i < scrollInfo.scrolls.size(); ++i) { |
| if (scrollInfo.scrolls[i].layerId != id) |
| continue; |
| timesEncountered++; |
| } |
| |
| ASSERT_EQ(0, timesEncountered); |
| } |
| |
| void setupScrollAndContentsLayers(const gfx::Size& contentSize) |
| { |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->setScrollable(true); |
| root->setScrollOffset(gfx::Vector2d(0, 0)); |
| root->setMaxScrollOffset(gfx::Vector2d(contentSize.width(), contentSize.height())); |
| root->setBounds(contentSize); |
| root->setContentBounds(contentSize); |
| root->setPosition(gfx::PointF(0, 0)); |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| |
| scoped_ptr<LayerImpl> contents = LayerImpl::create(m_hostImpl->activeTree(), 2); |
| contents->setDrawsContent(true); |
| contents->setBounds(contentSize); |
| contents->setContentBounds(contentSize); |
| contents->setPosition(gfx::PointF(0, 0)); |
| contents->setAnchorPoint(gfx::PointF(0, 0)); |
| root->addChild(contents.Pass()); |
| m_hostImpl->setRootLayer(root.Pass()); |
| } |
| |
| scoped_ptr<LayerImpl> createScrollableLayer(int id, const gfx::Size& size) |
| { |
| scoped_ptr<LayerImpl> layer = LayerImpl::create(m_hostImpl->activeTree(), id); |
| layer->setScrollable(true); |
| layer->setDrawsContent(true); |
| layer->setBounds(size); |
| layer->setContentBounds(size); |
| layer->setMaxScrollOffset(gfx::Vector2d(size.width() * 2, size.height() * 2)); |
| return layer.Pass(); |
| } |
| |
| void initializeRendererAndDrawFrame() |
| { |
| m_hostImpl->initializeRenderer(createOutputSurface()); |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| void pinchZoomPanViewportForcesCommitRedraw(const float deviceScaleFactor); |
| void pinchZoomPanViewportTest(const float deviceScaleFactor); |
| void pinchZoomPanViewportAndScrollTest(const float deviceScaleFactor); |
| void pinchZoomPanViewportAndScrollBoundaryTest(const float deviceScaleFactor); |
| |
| protected: |
| virtual scoped_ptr<OutputSurface> createOutputSurface() { return createFakeOutputSurface(); } |
| |
| FakeProxy m_proxy; |
| DebugScopedSetImplThread m_alwaysImplThread; |
| DebugScopedSetMainThreadBlocked m_alwaysMainThreadBlocked; |
| |
| scoped_ptr<LayerTreeHostImpl> m_hostImpl; |
| bool m_onCanDrawStateChangedCalled; |
| bool m_didRequestCommit; |
| bool m_didRequestRedraw; |
| bool m_reduceMemoryResult; |
| }; |
| |
| class FakeWebGraphicsContext3DMakeCurrentFails : public FakeWebGraphicsContext3D { |
| public: |
| virtual bool makeContextCurrent() { return false; } |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, notifyIfCanDrawChanged) |
| { |
| // Note: It is not possible to disable the renderer once it has been set, |
| // so we do not need to test that disabling the renderer notifies us |
| // that canDraw changed. |
| EXPECT_FALSE(m_hostImpl->canDraw()); |
| m_onCanDrawStateChangedCalled = false; |
| |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| EXPECT_TRUE(m_hostImpl->canDraw()); |
| EXPECT_TRUE(m_onCanDrawStateChangedCalled); |
| m_onCanDrawStateChangedCalled = false; |
| |
| // Toggle the root layer to make sure it toggles canDraw |
| m_hostImpl->setRootLayer(scoped_ptr<LayerImpl>()); |
| EXPECT_FALSE(m_hostImpl->canDraw()); |
| EXPECT_TRUE(m_onCanDrawStateChangedCalled); |
| m_onCanDrawStateChangedCalled = false; |
| |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| EXPECT_TRUE(m_hostImpl->canDraw()); |
| EXPECT_TRUE(m_onCanDrawStateChangedCalled); |
| m_onCanDrawStateChangedCalled = false; |
| |
| // Toggle the device viewport size to make sure it toggles canDraw. |
| m_hostImpl->setViewportSize(gfx::Size(100, 100), gfx::Size(0, 0)); |
| EXPECT_FALSE(m_hostImpl->canDraw()); |
| EXPECT_TRUE(m_onCanDrawStateChangedCalled); |
| m_onCanDrawStateChangedCalled = false; |
| |
| m_hostImpl->setViewportSize(gfx::Size(100, 100), gfx::Size(100, 100)); |
| EXPECT_TRUE(m_hostImpl->canDraw()); |
| EXPECT_TRUE(m_onCanDrawStateChangedCalled); |
| m_onCanDrawStateChangedCalled = false; |
| |
| // Toggle contents textures purged without causing any evictions, |
| // and make sure that it does not change canDraw. |
| setReduceMemoryResult(false); |
| m_hostImpl->setManagedMemoryPolicy(ManagedMemoryPolicy( |
| m_hostImpl->memoryAllocationLimitBytes() - 1)); |
| EXPECT_TRUE(m_hostImpl->canDraw()); |
| EXPECT_FALSE(m_onCanDrawStateChangedCalled); |
| m_onCanDrawStateChangedCalled = false; |
| |
| // Toggle contents textures purged to make sure it toggles canDraw. |
| setReduceMemoryResult(true); |
| m_hostImpl->setManagedMemoryPolicy(ManagedMemoryPolicy( |
| m_hostImpl->memoryAllocationLimitBytes() - 1)); |
| EXPECT_FALSE(m_hostImpl->canDraw()); |
| EXPECT_TRUE(m_onCanDrawStateChangedCalled); |
| m_onCanDrawStateChangedCalled = false; |
| |
| m_hostImpl->resetContentsTexturesPurged(); |
| EXPECT_TRUE(m_hostImpl->canDraw()); |
| EXPECT_TRUE(m_onCanDrawStateChangedCalled); |
| m_onCanDrawStateChangedCalled = false; |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollDeltaNoLayers) |
| { |
| ASSERT_FALSE(m_hostImpl->rootLayer()); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| ASSERT_EQ(scrollInfo->scrolls.size(), 0u); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollDeltaTreeButNoChanges) |
| { |
| { |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->addChild(LayerImpl::create(m_hostImpl->activeTree(), 2)); |
| root->addChild(LayerImpl::create(m_hostImpl->activeTree(), 3)); |
| root->children()[1]->addChild(LayerImpl::create(m_hostImpl->activeTree(), 4)); |
| root->children()[1]->addChild(LayerImpl::create(m_hostImpl->activeTree(), 5)); |
| root->children()[1]->children()[0]->addChild(LayerImpl::create(m_hostImpl->activeTree(), 6)); |
| m_hostImpl->setRootLayer(root.Pass()); |
| } |
| LayerImpl* root = m_hostImpl->rootLayer(); |
| |
| expectClearedScrollDeltasRecursive(root); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo; |
| |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| ASSERT_EQ(scrollInfo->scrolls.size(), 0u); |
| expectClearedScrollDeltasRecursive(root); |
| |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| ASSERT_EQ(scrollInfo->scrolls.size(), 0u); |
| expectClearedScrollDeltasRecursive(root); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollDeltaRepeatedScrolls) |
| { |
| gfx::Vector2d scrollOffset(20, 30); |
| gfx::Vector2d scrollDelta(11, -15); |
| { |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->setScrollOffset(scrollOffset); |
| root->setScrollable(true); |
| root->setMaxScrollOffset(gfx::Vector2d(100, 100)); |
| root->scrollBy(scrollDelta); |
| m_hostImpl->setRootLayer(root.Pass()); |
| } |
| LayerImpl* root = m_hostImpl->rootLayer(); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo; |
| |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| ASSERT_EQ(scrollInfo->scrolls.size(), 1u); |
| EXPECT_VECTOR_EQ(root->sentScrollDelta(), scrollDelta); |
| expectContains(*scrollInfo, root->id(), scrollDelta); |
| |
| gfx::Vector2d scrollDelta2(-5, 27); |
| root->scrollBy(scrollDelta2); |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| ASSERT_EQ(scrollInfo->scrolls.size(), 1u); |
| EXPECT_VECTOR_EQ(root->sentScrollDelta(), scrollDelta + scrollDelta2); |
| expectContains(*scrollInfo, root->id(), scrollDelta + scrollDelta2); |
| |
| root->scrollBy(gfx::Vector2d()); |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(root->sentScrollDelta(), scrollDelta + scrollDelta2); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollRootCallsCommitAndRedraw) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, 10)); |
| m_hostImpl->scrollEnd(); |
| EXPECT_TRUE(m_didRequestRedraw); |
| EXPECT_TRUE(m_didRequestCommit); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollWithoutRootLayer) |
| { |
| // We should not crash when trying to scroll an empty layer tree. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollIgnored); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollWithoutRenderer) |
| { |
| LayerTreeSettings settings; |
| m_hostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| // Initialization will fail here. |
| m_hostImpl->initializeRenderer(FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new FakeWebGraphicsContext3DMakeCurrentFails)).PassAs<OutputSurface>()); |
| m_hostImpl->setViewportSize(gfx::Size(10, 10), gfx::Size(10, 10)); |
| |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| |
| // We should not crash when trying to scroll after the renderer initialization fails. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollIgnored); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, replaceTreeWhileScrolling) |
| { |
| const int scrollLayerId = 1; |
| |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| // We should not crash if the tree is replaced while we are scrolling. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->detachLayerTree(); |
| |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| |
| // We should still be scrolling, because the scrolled layer also exists in the new tree. |
| gfx::Vector2d scrollDelta(0, 10); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo, scrollLayerId, scrollDelta); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, clearRootRenderSurfaceAndScroll) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| // We should be able to scroll even if the root layer loses its render surface after the most |
| // recent render. |
| m_hostImpl->rootLayer()->clearRenderSurface(); |
| m_hostImpl->setNeedsUpdateDrawProperties(); |
| |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, wheelEventHandlers) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| LayerImpl* root = m_hostImpl->rootLayer(); |
| |
| root->setHaveWheelEventHandlers(true); |
| |
| // With registered event handlers, wheel scrolls have to go to the main thread. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollOnMainThread); |
| |
| // But gesture scrolls can still be handled. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture), InputHandlerClient::ScrollStarted); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, shouldScrollOnMainThread) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| LayerImpl* root = m_hostImpl->rootLayer(); |
| |
| root->setShouldScrollOnMainThread(true); |
| |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollOnMainThread); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture), InputHandlerClient::ScrollOnMainThread); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, nonFastScrollableRegionBasic) |
| { |
| setupScrollAndContentsLayers(gfx::Size(200, 200)); |
| m_hostImpl->setViewportSize(gfx::Size(100, 100), gfx::Size(100, 100)); |
| |
| LayerImpl* root = m_hostImpl->rootLayer(); |
| root->setContentsScale(2, 2); |
| root->setNonFastScrollableRegion(gfx::Rect(0, 0, 50, 50)); |
| |
| initializeRendererAndDrawFrame(); |
| |
| // All scroll types inside the non-fast scrollable region should fail. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(25, 25), InputHandlerClient::Wheel), InputHandlerClient::ScrollOnMainThread); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(25, 25), InputHandlerClient::Gesture), InputHandlerClient::ScrollOnMainThread); |
| |
| // All scroll types outside this region should succeed. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(75, 75), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, 10)); |
| m_hostImpl->scrollEnd(); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(75, 75), InputHandlerClient::Gesture), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, 10)); |
| m_hostImpl->scrollEnd(); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, nonFastScrollableRegionWithOffset) |
| { |
| setupScrollAndContentsLayers(gfx::Size(200, 200)); |
| m_hostImpl->setViewportSize(gfx::Size(100, 100), gfx::Size(100, 100)); |
| |
| LayerImpl* root = m_hostImpl->rootLayer(); |
| root->setContentsScale(2, 2); |
| root->setNonFastScrollableRegion(gfx::Rect(0, 0, 50, 50)); |
| root->setPosition(gfx::PointF(-25, 0)); |
| |
| initializeRendererAndDrawFrame(); |
| |
| // This point would fall into the non-fast scrollable region except that we've moved the layer down by 25 pixels. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(40, 10), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, 1)); |
| m_hostImpl->scrollEnd(); |
| |
| // This point is still inside the non-fast region. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(10, 10), InputHandlerClient::Wheel), InputHandlerClient::ScrollOnMainThread); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollByReturnsCorrectValue) |
| { |
| setupScrollAndContentsLayers(gfx::Size(200, 200)); |
| m_hostImpl->setViewportSize(gfx::Size(100, 100), gfx::Size(100, 100)); |
| |
| initializeRendererAndDrawFrame(); |
| |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, |
| m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| |
| // Trying to scroll to the left/top will not succeed. |
| EXPECT_FALSE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(-10, 0))); |
| EXPECT_FALSE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, -10))); |
| EXPECT_FALSE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(-10, -10))); |
| |
| // Scrolling to the right/bottom will succeed. |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(10, 0))); |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, 10))); |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(10, 10))); |
| |
| // Scrolling to left/top will now succeed. |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(-10, 0))); |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, -10))); |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(-10, -10))); |
| |
| // Scrolling diagonally against an edge will succeed. |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(10, -10))); |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(-10, 0))); |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(-10, 10))); |
| |
| // Trying to scroll more than the available space will also succeed. |
| EXPECT_TRUE(m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(5000, 5000))); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, maxScrollOffsetChangedByDeviceScaleFactor) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| |
| float deviceScaleFactor = 2; |
| gfx::Size layoutViewport(25, 25); |
| gfx::Size deviceViewport(gfx::ToFlooredSize(gfx::ScaleSize(layoutViewport, deviceScaleFactor))); |
| m_hostImpl->setViewportSize(layoutViewport, deviceViewport); |
| m_hostImpl->setDeviceScaleFactor(deviceScaleFactor); |
| EXPECT_EQ(m_hostImpl->rootLayer()->maxScrollOffset(), gfx::Vector2d(25, 25)); |
| |
| deviceScaleFactor = 1; |
| m_hostImpl->setViewportSize(layoutViewport, layoutViewport); |
| m_hostImpl->setDeviceScaleFactor(deviceScaleFactor); |
| EXPECT_EQ(m_hostImpl->rootLayer()->maxScrollOffset(), gfx::Vector2d(75, 75)); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, clearRootRenderSurfaceAndHitTestTouchHandlerRegion) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| // We should be able to hit test for touch event handlers even if the root layer loses |
| // its render surface after the most recent render. |
| m_hostImpl->rootLayer()->clearRenderSurface(); |
| m_hostImpl->setNeedsUpdateDrawProperties(); |
| |
| EXPECT_EQ(m_hostImpl->haveTouchEventHandlersAt(gfx::Point(0, 0)), false); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, implPinchZoom) |
| { |
| // This test is specific to the page-scale based pinch zoom. |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) |
| return; |
| |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| LayerImpl* scrollLayer = m_hostImpl->rootScrollLayer(); |
| DCHECK(scrollLayer); |
| |
| const float minPageScale = 1, maxPageScale = 4; |
| const gfx::Transform identityScaleTransform; |
| |
| // The impl-based pinch zoom should not adjust the max scroll position. |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollDelta(gfx::Vector2d()); |
| |
| float pageScaleDelta = 2; |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(50, 50)); |
| m_hostImpl->pinchGestureEnd(); |
| EXPECT_TRUE(m_didRequestRedraw); |
| EXPECT_TRUE(m_didRequestCommit); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, pageScaleDelta); |
| |
| EXPECT_EQ(m_hostImpl->rootLayer()->maxScrollOffset(), gfx::Vector2d(50, 50)); |
| } |
| |
| // Scrolling after a pinch gesture should always be in local space. The scroll deltas do not |
| // have the page scale factor applied. |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollDelta(gfx::Vector2d()); |
| |
| float pageScaleDelta = 2; |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(0, 0)); |
| m_hostImpl->pinchGestureEnd(); |
| |
| gfx::Vector2d scrollDelta(0, 10); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), scrollDelta); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchGesture) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| LayerImpl* scrollLayer = m_hostImpl->rootScrollLayer(); |
| DCHECK(scrollLayer); |
| |
| const float minPageScale = m_hostImpl->settings().pageScalePinchZoomEnabled ? 1 : 0.5; |
| const float maxPageScale = 4; |
| const gfx::Transform identityScaleTransform; |
| |
| // Basic pinch zoom in gesture |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollDelta(gfx::Vector2d()); |
| |
| float pageScaleDelta = 2; |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(50, 50)); |
| m_hostImpl->pinchGestureEnd(); |
| EXPECT_TRUE(m_didRequestRedraw); |
| EXPECT_TRUE(m_didRequestCommit); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, pageScaleDelta); |
| } |
| |
| // Zoom-in clamping |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollDelta(gfx::Vector2d()); |
| float pageScaleDelta = 10; |
| |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(50, 50)); |
| m_hostImpl->pinchGestureEnd(); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, maxPageScale); |
| } |
| |
| // Zoom-out clamping |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollDelta(gfx::Vector2d()); |
| scrollLayer->setScrollOffset(gfx::Vector2d(50, 50)); |
| |
| float pageScaleDelta = 0.1f; |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(0, 0)); |
| m_hostImpl->pinchGestureEnd(); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, minPageScale); |
| |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) { |
| // Pushed to (0,0) via clamping against contents layer size. |
| expectContains(*scrollInfo, scrollLayer->id(), gfx::Vector2d(-50, -50)); |
| } else { |
| EXPECT_TRUE(scrollInfo->scrolls.empty()); |
| } |
| } |
| |
| // Two-finger panning should not happen based on pinch events only |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollDelta(gfx::Vector2d()); |
| scrollLayer->setScrollOffset(gfx::Vector2d(20, 20)); |
| |
| float pageScaleDelta = 1; |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(10, 10)); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(20, 20)); |
| m_hostImpl->pinchGestureEnd(); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, pageScaleDelta); |
| EXPECT_TRUE(scrollInfo->scrolls.empty()); |
| } |
| |
| // Two-finger panning should work with interleaved scroll events |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollDelta(gfx::Vector2d()); |
| scrollLayer->setScrollOffset(gfx::Vector2d(20, 20)); |
| |
| float pageScaleDelta = 1; |
| m_hostImpl->scrollBegin(gfx::Point(10, 10), InputHandlerClient::Wheel); |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(10, 10)); |
| m_hostImpl->scrollBy(gfx::Point(10, 10), gfx::Vector2d(-10, -10)); |
| m_hostImpl->pinchGestureUpdate(pageScaleDelta, gfx::Point(20, 20)); |
| m_hostImpl->pinchGestureEnd(); |
| m_hostImpl->scrollEnd(); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, pageScaleDelta); |
| expectContains(*scrollInfo, scrollLayer->id(), gfx::Vector2d(-10, -10)); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pageScaleAnimation) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| LayerImpl* scrollLayer = m_hostImpl->rootScrollLayer(); |
| DCHECK(scrollLayer); |
| |
| const float minPageScale = 0.5; |
| const float maxPageScale = 4; |
| const base::TimeTicks startTime = base::TimeTicks() + base::TimeDelta::FromSeconds(1); |
| const base::TimeDelta duration = base::TimeDelta::FromMilliseconds(100); |
| const base::TimeTicks halfwayThroughAnimation = startTime + duration / 2; |
| const base::TimeTicks endTime = startTime + duration; |
| const gfx::Transform identityScaleTransform; |
| |
| // Non-anchor zoom-in |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollOffset(gfx::Vector2d(50, 50)); |
| |
| m_hostImpl->startPageScaleAnimation(gfx::Vector2d(0, 0), false, 2, startTime, duration); |
| m_hostImpl->animate(halfwayThroughAnimation, base::Time()); |
| EXPECT_TRUE(m_didRequestRedraw); |
| m_hostImpl->animate(endTime, base::Time()); |
| EXPECT_TRUE(m_didRequestCommit); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, 2); |
| expectContains(*scrollInfo, scrollLayer->id(), gfx::Vector2d(-50, -50)); |
| } |
| |
| // Anchor zoom-out |
| { |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| scrollLayer->setImplTransform(identityScaleTransform); |
| scrollLayer->setScrollOffset(gfx::Vector2d(50, 50)); |
| |
| m_hostImpl->startPageScaleAnimation(gfx::Vector2d(25, 25), true, minPageScale, startTime, duration); |
| m_hostImpl->animate(endTime, base::Time()); |
| EXPECT_TRUE(m_didRequestRedraw); |
| EXPECT_TRUE(m_didRequestCommit); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, minPageScale); |
| // Pushed to (0,0) via clamping against contents layer size. |
| expectContains(*scrollInfo, scrollLayer->id(), gfx::Vector2d(-50, -50)); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, inhibitScrollAndPageScaleUpdatesWhilePinchZooming) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| LayerImpl* scrollLayer = m_hostImpl->rootScrollLayer(); |
| DCHECK(scrollLayer); |
| |
| const float minPageScale = m_hostImpl->settings().pageScalePinchZoomEnabled ? 1 : 0.5; |
| const float maxPageScale = 4; |
| |
| // Pinch zoom in. |
| { |
| // Start a pinch in gesture at the bottom right corner of the viewport. |
| const float zoomInDelta = 2; |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(zoomInDelta, gfx::Point(50, 50)); |
| |
| // Because we are pinch zooming in, we shouldn't get any scroll or page |
| // scale deltas. |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, 1); |
| EXPECT_EQ(scrollInfo->scrolls.size(), 0u); |
| |
| // Once the gesture ends, we get the final scroll and page scale values. |
| m_hostImpl->pinchGestureEnd(); |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, zoomInDelta); |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) { |
| expectContains(*scrollInfo, scrollLayer->id(), gfx::Vector2d(25, 25)); |
| } else { |
| EXPECT_TRUE(scrollInfo->scrolls.empty()); |
| } |
| } |
| |
| // Pinch zoom out. |
| { |
| // Start a pinch out gesture at the bottom right corner of the viewport. |
| const float zoomOutDelta = 0.75; |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(zoomOutDelta, gfx::Point(50, 50)); |
| |
| // Since we are pinch zooming out, we should get an update to zoom all |
| // the way out to the minimum page scale. |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) { |
| EXPECT_EQ(scrollInfo->pageScaleDelta, minPageScale); |
| expectContains(*scrollInfo, scrollLayer->id(), gfx::Vector2d(0, 0)); |
| } else { |
| EXPECT_EQ(scrollInfo->pageScaleDelta, 1); |
| EXPECT_TRUE(scrollInfo->scrolls.empty()); |
| } |
| |
| // Once the gesture ends, we get the final scroll and page scale values. |
| m_hostImpl->pinchGestureEnd(); |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| if (m_hostImpl->settings().pageScalePinchZoomEnabled) { |
| EXPECT_EQ(scrollInfo->pageScaleDelta, minPageScale); |
| expectContains(*scrollInfo, scrollLayer->id(), gfx::Vector2d(25, 25)); |
| } else { |
| EXPECT_EQ(scrollInfo->pageScaleDelta, zoomOutDelta); |
| expectContains(*scrollInfo, scrollLayer->id(), gfx::Vector2d(8, 8)); |
| } |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, inhibitScrollAndPageScaleUpdatesWhileAnimatingPageScale) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| m_hostImpl->setViewportSize(gfx::Size(50, 50), gfx::Size(50, 50)); |
| initializeRendererAndDrawFrame(); |
| |
| LayerImpl* scrollLayer = m_hostImpl->rootScrollLayer(); |
| DCHECK(scrollLayer); |
| |
| const float minPageScale = 0.5; |
| const float maxPageScale = 4; |
| const base::TimeTicks startTime = base::TimeTicks() + base::TimeDelta::FromSeconds(1); |
| const base::TimeDelta duration = base::TimeDelta::FromMilliseconds(100); |
| const base::TimeTicks halfwayThroughAnimation = startTime + duration / 2; |
| const base::TimeTicks endTime = startTime + duration; |
| |
| const float pageScaleDelta = 2; |
| gfx::Vector2d target(25, 25); |
| gfx::Vector2d scaledTarget = target; |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) |
| scaledTarget = gfx::Vector2d(12, 12); |
| |
| m_hostImpl->setPageScaleFactorAndLimits(1, minPageScale, maxPageScale); |
| m_hostImpl->startPageScaleAnimation(target, false, pageScaleDelta, startTime, duration); |
| |
| // We should immediately get the final zoom and scroll values for the |
| // animation. |
| m_hostImpl->animate(halfwayThroughAnimation, base::Time()); |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, pageScaleDelta); |
| expectContains(*scrollInfo, scrollLayer->id(), scaledTarget); |
| |
| // Scrolling during the animation is ignored. |
| const gfx::Vector2d scrollDelta(0, 10); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(target.x(), target.y()), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // The final page scale and scroll deltas should match what we got |
| // earlier. |
| m_hostImpl->animate(endTime, base::Time()); |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| EXPECT_EQ(scrollInfo->pageScaleDelta, pageScaleDelta); |
| expectContains(*scrollInfo, scrollLayer->id(), scaledTarget); |
| } |
| |
| class DidDrawCheckLayer : public TiledLayerImpl { |
| public: |
| static scoped_ptr<LayerImpl> create(LayerTreeImpl* treeImpl, int id) { return scoped_ptr<LayerImpl>(new DidDrawCheckLayer(treeImpl, id)); } |
| |
| virtual void didDraw(ResourceProvider*) OVERRIDE |
| { |
| m_didDrawCalled = true; |
| } |
| |
| virtual void willDraw(ResourceProvider*) OVERRIDE |
| { |
| m_willDrawCalled = true; |
| } |
| |
| bool didDrawCalled() const { return m_didDrawCalled; } |
| bool willDrawCalled() const { return m_willDrawCalled; } |
| |
| void clearDidDrawCheck() |
| { |
| m_didDrawCalled = false; |
| m_willDrawCalled = false; |
| } |
| |
| protected: |
| DidDrawCheckLayer(LayerTreeImpl* treeImpl, int id) |
| : TiledLayerImpl(treeImpl, id) |
| , m_didDrawCalled(false) |
| , m_willDrawCalled(false) |
| { |
| setAnchorPoint(gfx::PointF(0, 0)); |
| setBounds(gfx::Size(10, 10)); |
| setContentBounds(gfx::Size(10, 10)); |
| setDrawsContent(true); |
| setSkipsDraw(false); |
| drawProperties().visible_content_rect = gfx::Rect(0, 0, 10, 10); |
| |
| scoped_ptr<LayerTilingData> tiler = LayerTilingData::create(gfx::Size(100, 100), LayerTilingData::HasBorderTexels); |
| tiler->setBounds(contentBounds()); |
| setTilingData(*tiler.get()); |
| } |
| |
| private: |
| bool m_didDrawCalled; |
| bool m_willDrawCalled; |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, didDrawNotCalledOnHiddenLayer) |
| { |
| // The root layer is always drawn, so run this test on a child layer that |
| // will be masked out by the root layer's bounds. |
| m_hostImpl->setRootLayer(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 1)); |
| DidDrawCheckLayer* root = static_cast<DidDrawCheckLayer*>(m_hostImpl->rootLayer()); |
| root->setMasksToBounds(true); |
| |
| root->addChild(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 2)); |
| DidDrawCheckLayer* layer = static_cast<DidDrawCheckLayer*>(root->children()[0]); |
| // Ensure visibleContentRect for layer is empty |
| layer->setPosition(gfx::PointF(100, 100)); |
| layer->setBounds(gfx::Size(10, 10)); |
| layer->setContentBounds(gfx::Size(10, 10)); |
| |
| LayerTreeHostImpl::FrameData frame; |
| |
| EXPECT_FALSE(layer->willDrawCalled()); |
| EXPECT_FALSE(layer->didDrawCalled()); |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| EXPECT_FALSE(layer->willDrawCalled()); |
| EXPECT_FALSE(layer->didDrawCalled()); |
| |
| EXPECT_TRUE(layer->visibleContentRect().IsEmpty()); |
| |
| // Ensure visibleContentRect for layer layer is not empty |
| layer->setPosition(gfx::PointF(0, 0)); |
| |
| EXPECT_FALSE(layer->willDrawCalled()); |
| EXPECT_FALSE(layer->didDrawCalled()); |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| EXPECT_TRUE(layer->willDrawCalled()); |
| EXPECT_TRUE(layer->didDrawCalled()); |
| |
| EXPECT_FALSE(layer->visibleContentRect().IsEmpty()); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, willDrawNotCalledOnOccludedLayer) |
| { |
| gfx::Size bigSize(1000, 1000); |
| m_hostImpl->setViewportSize(bigSize, bigSize); |
| |
| m_hostImpl->setRootLayer(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 1)); |
| DidDrawCheckLayer* root = static_cast<DidDrawCheckLayer*>(m_hostImpl->rootLayer()); |
| |
| root->addChild(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 2)); |
| DidDrawCheckLayer* occludedLayer = static_cast<DidDrawCheckLayer*>(root->children()[0]); |
| |
| root->addChild(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 3)); |
| DidDrawCheckLayer* topLayer = static_cast<DidDrawCheckLayer*>(root->children()[1]); |
| // This layer covers the occludedLayer above. Make this layer large so it can occlude. |
| topLayer->setBounds(bigSize); |
| topLayer->setContentBounds(bigSize); |
| topLayer->setContentsOpaque(true); |
| |
| LayerTreeHostImpl::FrameData frame; |
| |
| EXPECT_FALSE(occludedLayer->willDrawCalled()); |
| EXPECT_FALSE(occludedLayer->didDrawCalled()); |
| EXPECT_FALSE(topLayer->willDrawCalled()); |
| EXPECT_FALSE(topLayer->didDrawCalled()); |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| EXPECT_FALSE(occludedLayer->willDrawCalled()); |
| EXPECT_FALSE(occludedLayer->didDrawCalled()); |
| EXPECT_TRUE(topLayer->willDrawCalled()); |
| EXPECT_TRUE(topLayer->didDrawCalled()); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, didDrawCalledOnAllLayers) |
| { |
| m_hostImpl->setRootLayer(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 1)); |
| DidDrawCheckLayer* root = static_cast<DidDrawCheckLayer*>(m_hostImpl->rootLayer()); |
| |
| root->addChild(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 2)); |
| DidDrawCheckLayer* layer1 = static_cast<DidDrawCheckLayer*>(root->children()[0]); |
| |
| layer1->addChild(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 3)); |
| DidDrawCheckLayer* layer2 = static_cast<DidDrawCheckLayer*>(layer1->children()[0]); |
| |
| layer1->setOpacity(0.3f); |
| layer1->setPreserves3D(false); |
| |
| EXPECT_FALSE(root->didDrawCalled()); |
| EXPECT_FALSE(layer1->didDrawCalled()); |
| EXPECT_FALSE(layer2->didDrawCalled()); |
| |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| EXPECT_TRUE(root->didDrawCalled()); |
| EXPECT_TRUE(layer1->didDrawCalled()); |
| EXPECT_TRUE(layer2->didDrawCalled()); |
| |
| EXPECT_NE(root->renderSurface(), layer1->renderSurface()); |
| EXPECT_TRUE(!!layer1->renderSurface()); |
| } |
| |
| class MissingTextureAnimatingLayer : public DidDrawCheckLayer { |
| public: |
| static scoped_ptr<LayerImpl> create(LayerTreeImpl* treeImpl, int id, bool tileMissing, bool skipsDraw, bool animating, ResourceProvider* resourceProvider) |
| { |
| return scoped_ptr<LayerImpl>(new MissingTextureAnimatingLayer(treeImpl, id, tileMissing, skipsDraw, animating, resourceProvider)); |
| } |
| |
| private: |
| MissingTextureAnimatingLayer(LayerTreeImpl* treeImpl, int id, bool tileMissing, bool skipsDraw, bool animating, ResourceProvider* resourceProvider) |
| : DidDrawCheckLayer(treeImpl, id) |
| { |
| scoped_ptr<LayerTilingData> tilingData = LayerTilingData::create(gfx::Size(10, 10), LayerTilingData::NoBorderTexels); |
| tilingData->setBounds(bounds()); |
| setTilingData(*tilingData.get()); |
| setSkipsDraw(skipsDraw); |
| if (!tileMissing) { |
| ResourceProvider::ResourceId resource = resourceProvider->createResource(gfx::Size(), GL_RGBA, ResourceProvider::TextureUsageAny); |
| pushTileProperties(0, 0, resource, gfx::Rect(), false); |
| } |
| if (animating) |
| addAnimatedTransformToLayer(*this, 10, 3, 0); |
| } |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, prepareToDrawFailsWhenAnimationUsesCheckerboard) |
| { |
| // When the texture is not missing, we draw as usual. |
| m_hostImpl->setRootLayer(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 1)); |
| DidDrawCheckLayer* root = static_cast<DidDrawCheckLayer*>(m_hostImpl->rootLayer()); |
| root->addChild(MissingTextureAnimatingLayer::create(m_hostImpl->activeTree(), 2, false, false, true, m_hostImpl->resourceProvider())); |
| |
| LayerTreeHostImpl::FrameData frame; |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // When a texture is missing and we're not animating, we draw as usual with checkerboarding. |
| m_hostImpl->setRootLayer(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 3)); |
| root = static_cast<DidDrawCheckLayer*>(m_hostImpl->rootLayer()); |
| root->addChild(MissingTextureAnimatingLayer::create(m_hostImpl->activeTree(), 4, true, false, false, m_hostImpl->resourceProvider())); |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // When a texture is missing and we're animating, we don't want to draw anything. |
| m_hostImpl->setRootLayer(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 5)); |
| root = static_cast<DidDrawCheckLayer*>(m_hostImpl->rootLayer()); |
| root->addChild(MissingTextureAnimatingLayer::create(m_hostImpl->activeTree(), 6, true, false, true, m_hostImpl->resourceProvider())); |
| |
| EXPECT_FALSE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // When the layer skips draw and we're animating, we still draw the frame. |
| m_hostImpl->setRootLayer(DidDrawCheckLayer::create(m_hostImpl->activeTree(), 7)); |
| root = static_cast<DidDrawCheckLayer*>(m_hostImpl->rootLayer()); |
| root->addChild(MissingTextureAnimatingLayer::create(m_hostImpl->activeTree(), 8, false, true, true, m_hostImpl->resourceProvider())); |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollRootIgnored) |
| { |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->setScrollable(false); |
| m_hostImpl->setRootLayer(root.Pass()); |
| initializeRendererAndDrawFrame(); |
| |
| // Scroll event is ignored because layer is not scrollable. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollIgnored); |
| EXPECT_FALSE(m_didRequestRedraw); |
| EXPECT_FALSE(m_didRequestCommit); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollNonCompositedRoot) |
| { |
| // Test the configuration where a non-composited root layer is embedded in a |
| // scrollable outer layer. |
| gfx::Size surfaceSize(10, 10); |
| |
| scoped_ptr<LayerImpl> contentLayer = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| contentLayer->setDrawsContent(true); |
| contentLayer->setPosition(gfx::PointF(0, 0)); |
| contentLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| contentLayer->setBounds(surfaceSize); |
| contentLayer->setContentBounds(gfx::Size(surfaceSize.width() * 2, surfaceSize.height() * 2)); |
| contentLayer->setContentsScale(2, 2); |
| |
| scoped_ptr<LayerImpl> scrollLayer = LayerImpl::create(m_hostImpl->activeTree(), 2); |
| scrollLayer->setScrollable(true); |
| scrollLayer->setMaxScrollOffset(gfx::Vector2d(surfaceSize.width(), surfaceSize.height())); |
| scrollLayer->setBounds(surfaceSize); |
| scrollLayer->setContentBounds(surfaceSize); |
| scrollLayer->setPosition(gfx::PointF(0, 0)); |
| scrollLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| scrollLayer->addChild(contentLayer.Pass()); |
| |
| m_hostImpl->setRootLayer(scrollLayer.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, 10)); |
| m_hostImpl->scrollEnd(); |
| EXPECT_TRUE(m_didRequestRedraw); |
| EXPECT_TRUE(m_didRequestCommit); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollChildCallsCommitAndRedraw) |
| { |
| gfx::Size surfaceSize(10, 10); |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->setBounds(surfaceSize); |
| root->setContentBounds(surfaceSize); |
| root->addChild(createScrollableLayer(2, surfaceSize)); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gfx::Vector2d(0, 10)); |
| m_hostImpl->scrollEnd(); |
| EXPECT_TRUE(m_didRequestRedraw); |
| EXPECT_TRUE(m_didRequestCommit); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollMissesChild) |
| { |
| gfx::Size surfaceSize(10, 10); |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->addChild(createScrollableLayer(2, surfaceSize)); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| // Scroll event is ignored because the input coordinate is outside the layer boundaries. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(15, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollIgnored); |
| EXPECT_FALSE(m_didRequestRedraw); |
| EXPECT_FALSE(m_didRequestCommit); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollMissesBackfacingChild) |
| { |
| gfx::Size surfaceSize(10, 10); |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| scoped_ptr<LayerImpl> child = createScrollableLayer(2, surfaceSize); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| |
| gfx::Transform matrix; |
| MathUtil::rotateEulerAngles(&matrix, 180, 0, 0); |
| child->setTransform(matrix); |
| child->setDoubleSided(false); |
| |
| root->addChild(child.Pass()); |
| m_hostImpl->setRootLayer(root.Pass()); |
| initializeRendererAndDrawFrame(); |
| |
| // Scroll event is ignored because the scrollable layer is not facing the viewer and there is |
| // nothing scrollable behind it. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollIgnored); |
| EXPECT_FALSE(m_didRequestRedraw); |
| EXPECT_FALSE(m_didRequestCommit); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollBlockedByContentLayer) |
| { |
| gfx::Size surfaceSize(10, 10); |
| scoped_ptr<LayerImpl> contentLayer = createScrollableLayer(1, surfaceSize); |
| contentLayer->setShouldScrollOnMainThread(true); |
| contentLayer->setScrollable(false); |
| |
| scoped_ptr<LayerImpl> scrollLayer = createScrollableLayer(2, surfaceSize); |
| scrollLayer->addChild(contentLayer.Pass()); |
| |
| m_hostImpl->setRootLayer(scrollLayer.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| // Scrolling fails because the content layer is asking to be scrolled on the main thread. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollOnMainThread); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollRootAndChangePageScaleOnMainThread) |
| { |
| gfx::Size surfaceSize(10, 10); |
| float pageScale = 2; |
| scoped_ptr<LayerImpl> root = createScrollableLayer(1, surfaceSize); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| gfx::Vector2d scrollDelta(0, 10); |
| gfx::Vector2d expectedScrollDelta(scrollDelta); |
| gfx::Vector2d expectedMaxScroll(m_hostImpl->rootLayer()->maxScrollOffset()); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // Set new page scale from main thread. |
| m_hostImpl->setPageScaleFactorAndLimits(pageScale, pageScale, pageScale); |
| |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) { |
| // The scale should apply to the scroll delta. |
| expectedScrollDelta = gfx::ToFlooredVector2d(gfx::ScaleVector2d(expectedScrollDelta, pageScale)); |
| } |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedScrollDelta); |
| |
| // The scroll range should also have been updated. |
| EXPECT_EQ(m_hostImpl->rootLayer()->maxScrollOffset(), expectedMaxScroll); |
| |
| // The page scale delta remains constant because the impl thread did not scale. |
| // TODO: If possible, use gfx::Transform() or Skia equality functions. At |
| // the moment we avoid that because skia does exact bit-wise equality |
| // checking that does not consider -0 == +0. |
| // http://code.google.com/p/chromium/issues/detail?id=162747 |
| EXPECT_EQ(1.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(0, 0)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(0, 1)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(0, 2)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(0, 3)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(1, 0)); |
| EXPECT_EQ(1.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(1, 1)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(1, 2)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(1, 3)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(2, 0)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(2, 1)); |
| EXPECT_EQ(1.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(2, 2)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(2, 3)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(3, 0)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(3, 1)); |
| EXPECT_EQ(0.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(3, 2)); |
| EXPECT_EQ(1.0, m_hostImpl->rootLayer()->implTransform().matrix().getDouble(3, 3)); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollRootAndChangePageScaleOnImplThread) |
| { |
| gfx::Size surfaceSize(10, 10); |
| float pageScale = 2; |
| scoped_ptr<LayerImpl> root = createScrollableLayer(1, surfaceSize); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| m_hostImpl->setPageScaleFactorAndLimits(1, 1, pageScale); |
| initializeRendererAndDrawFrame(); |
| |
| gfx::Vector2d scrollDelta(0, 10); |
| gfx::Vector2d expectedScrollDelta(scrollDelta); |
| gfx::Vector2d expectedMaxScroll(m_hostImpl->rootLayer()->maxScrollOffset()); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // Set new page scale on impl thread by pinching. |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScale, gfx::Point()); |
| m_hostImpl->pinchGestureEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| // The scroll delta is not scaled because the main thread did not scale. |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedScrollDelta); |
| |
| // The scroll range should also have been updated. |
| EXPECT_EQ(m_hostImpl->rootLayer()->maxScrollOffset(), expectedMaxScroll); |
| |
| // The page scale delta should match the new scale on the impl side. |
| gfx::Transform expectedScale; |
| expectedScale.Scale(pageScale, pageScale); |
| EXPECT_EQ(m_hostImpl->rootLayer()->implTransform(), expectedScale); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pageScaleDeltaAppliedToRootScrollLayerOnly) |
| { |
| gfx::Size surfaceSize(10, 10); |
| float defaultPageScale = 1; |
| gfx::Transform defaultPageScaleMatrix; |
| |
| float newPageScale = 2; |
| gfx::Transform newPageScaleMatrix; |
| newPageScaleMatrix.Scale(newPageScale, newPageScale); |
| |
| // Create a normal scrollable root layer and another scrollable child layer. |
| setupScrollAndContentsLayers(surfaceSize); |
| LayerImpl* root = m_hostImpl->rootLayer(); |
| LayerImpl* child = root->children()[0]; |
| |
| scoped_ptr<LayerImpl> scrollableChild = createScrollableLayer(3, surfaceSize); |
| child->addChild(scrollableChild.Pass()); |
| LayerImpl* grandChild = child->children()[0]; |
| |
| // Set new page scale on impl thread by pinching. |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(newPageScale, gfx::Point()); |
| m_hostImpl->pinchGestureEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| // The page scale delta should only be applied to the scrollable root layer. |
| EXPECT_EQ(root->implTransform(), newPageScaleMatrix); |
| EXPECT_EQ(child->implTransform(), defaultPageScaleMatrix); |
| EXPECT_EQ(grandChild->implTransform(), defaultPageScaleMatrix); |
| |
| // Make sure all the layers are drawn with the page scale delta applied, i.e., the page scale |
| // delta on the root layer is applied hierarchically. |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| EXPECT_EQ(root->drawTransform().matrix().getDouble(0, 0), newPageScale); |
| EXPECT_EQ(root->drawTransform().matrix().getDouble(1, 1), newPageScale); |
| EXPECT_EQ(child->drawTransform().matrix().getDouble(0, 0), newPageScale); |
| EXPECT_EQ(child->drawTransform().matrix().getDouble(1, 1), newPageScale); |
| EXPECT_EQ(grandChild->drawTransform().matrix().getDouble(0, 0), newPageScale); |
| EXPECT_EQ(grandChild->drawTransform().matrix().getDouble(1, 1), newPageScale); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollChildAndChangePageScaleOnMainThread) |
| { |
| gfx::Size surfaceSize(10, 10); |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->setBounds(surfaceSize); |
| root->setContentBounds(surfaceSize); |
| // Also mark the root scrollable so it becomes the root scroll layer. |
| root->setScrollable(true); |
| int scrollLayerId = 2; |
| root->addChild(createScrollableLayer(scrollLayerId, surfaceSize)); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| LayerImpl* child = m_hostImpl->rootLayer()->children()[0]; |
| |
| gfx::Vector2d scrollDelta(0, 10); |
| gfx::Vector2d expectedScrollDelta(scrollDelta); |
| gfx::Vector2d expectedMaxScroll(child->maxScrollOffset()); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| float pageScale = 2; |
| m_hostImpl->setPageScaleFactorAndLimits(pageScale, 1, pageScale); |
| |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) { |
| // The scale should apply to the scroll delta. |
| expectedScrollDelta = gfx::ToFlooredVector2d(gfx::ScaleVector2d(expectedScrollDelta, pageScale)); |
| } |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), scrollLayerId, expectedScrollDelta); |
| |
| // The scroll range should not have changed. |
| EXPECT_EQ(child->maxScrollOffset(), expectedMaxScroll); |
| |
| // The page scale delta remains constant because the impl thread did not scale. |
| gfx::Transform identityTransform; |
| EXPECT_EQ(child->implTransform(), gfx::Transform()); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollChildBeyondLimit) |
| { |
| // Scroll a child layer beyond its maximum scroll range and make sure the |
| // parent layer is scrolled on the axis on which the child was unable to |
| // scroll. |
| gfx::Size surfaceSize(10, 10); |
| scoped_ptr<LayerImpl> root = createScrollableLayer(1, surfaceSize); |
| |
| scoped_ptr<LayerImpl> grandChild = createScrollableLayer(3, surfaceSize); |
| grandChild->setScrollOffset(gfx::Vector2d(0, 5)); |
| |
| scoped_ptr<LayerImpl> child = createScrollableLayer(2, surfaceSize); |
| child->setScrollOffset(gfx::Vector2d(3, 0)); |
| child->addChild(grandChild.Pass()); |
| |
| root->addChild(child.Pass()); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| { |
| gfx::Vector2d scrollDelta(-8, -7); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| |
| // The grand child should have scrolled up to its limit. |
| LayerImpl* child = m_hostImpl->rootLayer()->children()[0]; |
| LayerImpl* grandChild = child->children()[0]; |
| expectContains(*scrollInfo.get(), grandChild->id(), gfx::Vector2d(0, -5)); |
| |
| // The child should have only scrolled on the other axis. |
| expectContains(*scrollInfo.get(), child->id(), gfx::Vector2d(-3, 0)); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollEventBubbling) |
| { |
| // When we try to scroll a non-scrollable child layer, the scroll delta |
| // should be applied to one of its ancestors if possible. |
| gfx::Size surfaceSize(10, 10); |
| scoped_ptr<LayerImpl> root = createScrollableLayer(1, surfaceSize); |
| scoped_ptr<LayerImpl> child = createScrollableLayer(2, surfaceSize); |
| |
| child->setScrollable(false); |
| root->addChild(child.Pass()); |
| |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| { |
| gfx::Vector2d scrollDelta(0, 4); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| |
| // Only the root should have scrolled. |
| ASSERT_EQ(scrollInfo->scrolls.size(), 1u); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), scrollDelta); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollBeforeRedraw) |
| { |
| gfx::Size surfaceSize(10, 10); |
| m_hostImpl->setRootLayer(createScrollableLayer(1, surfaceSize)); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| |
| // Draw one frame and then immediately rebuild the layer tree to mimic a tree synchronization. |
| initializeRendererAndDrawFrame(); |
| m_hostImpl->detachLayerTree(); |
| m_hostImpl->setRootLayer(createScrollableLayer(2, surfaceSize)); |
| |
| // Scrolling should still work even though we did not draw yet. |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(5, 5), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollAxisAlignedRotatedLayer) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| |
| // Rotate the root layer 90 degrees counter-clockwise about its center. |
| gfx::Transform rotateTransform; |
| rotateTransform.Rotate(-90); |
| m_hostImpl->rootLayer()->setTransform(rotateTransform); |
| |
| gfx::Size surfaceSize(50, 50); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| // Scroll to the right in screen coordinates with a gesture. |
| gfx::Vector2d gestureScrollDelta(10, 0); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gestureScrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // The layer should have scrolled down in its local coordinates. |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), gfx::Vector2d(0, gestureScrollDelta.x())); |
| |
| // Reset and scroll down with the wheel. |
| m_hostImpl->rootLayer()->setScrollDelta(gfx::Vector2dF()); |
| gfx::Vector2d wheelScrollDelta(0, 10); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), wheelScrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // The layer should have scrolled down in its local coordinates. |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), wheelScrollDelta); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollNonAxisAlignedRotatedLayer) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| int childLayerId = 3; |
| float childLayerAngle = -20; |
| |
| // Create a child layer that is rotated to a non-axis-aligned angle. |
| scoped_ptr<LayerImpl> child = createScrollableLayer(childLayerId, m_hostImpl->rootLayer()->contentBounds()); |
| gfx::Transform rotateTransform; |
| rotateTransform.Translate(-50, -50); |
| rotateTransform.Rotate(childLayerAngle); |
| rotateTransform.Translate(50, 50); |
| child->setTransform(rotateTransform); |
| |
| // Only allow vertical scrolling. |
| child->setMaxScrollOffset(gfx::Vector2d(0, child->contentBounds().height())); |
| m_hostImpl->rootLayer()->addChild(child.Pass()); |
| |
| gfx::Size surfaceSize(50, 50); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| { |
| // Scroll down in screen coordinates with a gesture. |
| gfx::Vector2d gestureScrollDelta(0, 10); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gestureScrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // The child layer should have scrolled down in its local coordinates an amount proportional to |
| // the angle between it and the input scroll delta. |
| gfx::Vector2d expectedScrollDelta(0, gestureScrollDelta.y() * std::cos(MathUtil::Deg2Rad(childLayerAngle))); |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), childLayerId, expectedScrollDelta); |
| |
| // The root layer should not have scrolled, because the input delta was close to the layer's |
| // axis of movement. |
| EXPECT_EQ(scrollInfo->scrolls.size(), 1u); |
| } |
| |
| { |
| // Now reset and scroll the same amount horizontally. |
| m_hostImpl->rootLayer()->children()[1]->setScrollDelta(gfx::Vector2dF()); |
| gfx::Vector2d gestureScrollDelta(10, 0); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), gestureScrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // The child layer should have scrolled down in its local coordinates an amount proportional to |
| // the angle between it and the input scroll delta. |
| gfx::Vector2d expectedScrollDelta(0, -gestureScrollDelta.x() * std::sin(MathUtil::Deg2Rad(childLayerAngle))); |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), childLayerId, expectedScrollDelta); |
| |
| // The root layer should have scrolled more, since the input scroll delta was mostly |
| // orthogonal to the child layer's vertical scroll axis. |
| gfx::Vector2d expectedRootScrollDelta(gestureScrollDelta.x() * std::pow(std::cos(MathUtil::Deg2Rad(childLayerAngle)), 2), 0); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedRootScrollDelta); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, scrollScaledLayer) |
| { |
| setupScrollAndContentsLayers(gfx::Size(100, 100)); |
| |
| // Scale the layer to twice its normal size. |
| int scale = 2; |
| gfx::Transform scaleTransform; |
| scaleTransform.Scale(scale, scale); |
| m_hostImpl->rootLayer()->setTransform(scaleTransform); |
| |
| gfx::Size surfaceSize(50, 50); |
| m_hostImpl->setViewportSize(surfaceSize, surfaceSize); |
| initializeRendererAndDrawFrame(); |
| |
| // Scroll down in screen coordinates with a gesture. |
| gfx::Vector2d scrollDelta(0, 10); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // The layer should have scrolled down in its local coordinates, but half he amount. |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), gfx::Vector2d(0, scrollDelta.y() / scale)); |
| |
| // Reset and scroll down with the wheel. |
| m_hostImpl->rootLayer()->setScrollDelta(gfx::Vector2dF()); |
| gfx::Vector2d wheelScrollDelta(0, 10); |
| EXPECT_EQ(m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Wheel), InputHandlerClient::ScrollStarted); |
| m_hostImpl->scrollBy(gfx::Point(), wheelScrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| // The scale should not have been applied to the scroll delta. |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), wheelScrollDelta); |
| } |
| |
| class BlendStateTrackerContext: public FakeWebGraphicsContext3D { |
| public: |
| BlendStateTrackerContext() : m_blend(false) { } |
| |
| virtual void enable(WebKit::WGC3Denum cap) |
| { |
| if (cap == GL_BLEND) |
| m_blend = true; |
| } |
| |
| virtual void disable(WebKit::WGC3Denum cap) |
| { |
| if (cap == GL_BLEND) |
| m_blend = false; |
| } |
| |
| bool blend() const { return m_blend; } |
| |
| private: |
| bool m_blend; |
| }; |
| |
| class BlendStateCheckLayer : public LayerImpl { |
| public: |
| static scoped_ptr<LayerImpl> create(LayerTreeImpl* treeImpl, int id, ResourceProvider* resourceProvider) { return scoped_ptr<LayerImpl>(new BlendStateCheckLayer(treeImpl, id, resourceProvider)); } |
| |
| virtual void appendQuads(QuadSink& quadSink, AppendQuadsData& appendQuadsData) OVERRIDE |
| { |
| m_quadsAppended = true; |
| |
| gfx::Rect opaqueRect; |
| if (contentsOpaque()) |
| opaqueRect = m_quadRect; |
| else |
| opaqueRect = m_opaqueContentRect; |
| |
| SharedQuadState* sharedQuadState = quadSink.useSharedQuadState(createSharedQuadState()); |
| scoped_ptr<TileDrawQuad> testBlendingDrawQuad = TileDrawQuad::Create(); |
| testBlendingDrawQuad->SetNew(sharedQuadState, m_quadRect, opaqueRect, m_resourceId, gfx::RectF(0, 0, 1, 1), gfx::Size(1, 1), false, false, false, false, false); |
| testBlendingDrawQuad->visible_rect = m_quadVisibleRect; |
| EXPECT_EQ(m_blend, testBlendingDrawQuad->ShouldDrawWithBlending()); |
| EXPECT_EQ(m_hasRenderSurface, !!renderSurface()); |
| quadSink.append(testBlendingDrawQuad.PassAs<DrawQuad>(), appendQuadsData); |
| } |
| |
| void setExpectation(bool blend, bool hasRenderSurface) |
| { |
| m_blend = blend; |
| m_hasRenderSurface = hasRenderSurface; |
| m_quadsAppended = false; |
| } |
| |
| bool quadsAppended() const { return m_quadsAppended; } |
| |
| void setQuadRect(const gfx::Rect& rect) { m_quadRect = rect; } |
| void setQuadVisibleRect(const gfx::Rect& rect) { m_quadVisibleRect = rect; } |
| void setOpaqueContentRect(const gfx::Rect& rect) { m_opaqueContentRect = rect; } |
| |
| private: |
| BlendStateCheckLayer(LayerTreeImpl* treeImpl, int id, ResourceProvider* resourceProvider) |
| : LayerImpl(treeImpl, id) |
| , m_blend(false) |
| , m_hasRenderSurface(false) |
| , m_quadsAppended(false) |
| , m_quadRect(5, 5, 5, 5) |
| , m_quadVisibleRect(5, 5, 5, 5) |
| , m_resourceId(resourceProvider->createResource(gfx::Size(1, 1), GL_RGBA, ResourceProvider::TextureUsageAny)) |
| { |
| setAnchorPoint(gfx::PointF(0, 0)); |
| setBounds(gfx::Size(10, 10)); |
| setContentBounds(gfx::Size(10, 10)); |
| setDrawsContent(true); |
| } |
| |
| bool m_blend; |
| bool m_hasRenderSurface; |
| bool m_quadsAppended; |
| gfx::Rect m_quadRect; |
| gfx::Rect m_opaqueContentRect; |
| gfx::Rect m_quadVisibleRect; |
| ResourceProvider::ResourceId m_resourceId; |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, blendingOffWhenDrawingOpaqueLayers) |
| { |
| { |
| scoped_ptr<LayerImpl> root = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setBounds(gfx::Size(10, 10)); |
| root->setContentBounds(root->bounds()); |
| root->setDrawsContent(false); |
| m_hostImpl->setRootLayer(root.Pass()); |
| } |
| LayerImpl* root = m_hostImpl->rootLayer(); |
| |
| root->addChild(BlendStateCheckLayer::create(m_hostImpl->activeTree(), 2, m_hostImpl->resourceProvider())); |
| BlendStateCheckLayer* layer1 = static_cast<BlendStateCheckLayer*>(root->children()[0]); |
| layer1->setPosition(gfx::PointF(2, 2)); |
| |
| LayerTreeHostImpl::FrameData frame; |
| |
| // Opaque layer, drawn without blending. |
| layer1->setContentsOpaque(true); |
| layer1->setExpectation(false, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Layer with translucent content and painting, so drawn with blending. |
| layer1->setContentsOpaque(false); |
| layer1->setExpectation(true, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Layer with translucent opacity, drawn with blending. |
| layer1->setContentsOpaque(true); |
| layer1->setOpacity(0.5); |
| layer1->setExpectation(true, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Layer with translucent opacity and painting, drawn with blending. |
| layer1->setContentsOpaque(true); |
| layer1->setOpacity(0.5); |
| layer1->setExpectation(true, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| layer1->addChild(BlendStateCheckLayer::create(m_hostImpl->activeTree(), 3, m_hostImpl->resourceProvider())); |
| BlendStateCheckLayer* layer2 = static_cast<BlendStateCheckLayer*>(layer1->children()[0]); |
| layer2->setPosition(gfx::PointF(4, 4)); |
| |
| // 2 opaque layers, drawn without blending. |
| layer1->setContentsOpaque(true); |
| layer1->setOpacity(1); |
| layer1->setExpectation(false, false); |
| layer2->setContentsOpaque(true); |
| layer2->setOpacity(1); |
| layer2->setExpectation(false, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| EXPECT_TRUE(layer2->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Parent layer with translucent content, drawn with blending. |
| // Child layer with opaque content, drawn without blending. |
| layer1->setContentsOpaque(false); |
| layer1->setExpectation(true, false); |
| layer2->setExpectation(false, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| EXPECT_TRUE(layer2->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Parent layer with translucent content but opaque painting, drawn without blending. |
| // Child layer with opaque content, drawn without blending. |
| layer1->setContentsOpaque(true); |
| layer1->setExpectation(false, false); |
| layer2->setExpectation(false, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| EXPECT_TRUE(layer2->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Parent layer with translucent opacity and opaque content. Since it has a |
| // drawing child, it's drawn to a render surface which carries the opacity, |
| // so it's itself drawn without blending. |
| // Child layer with opaque content, drawn without blending (parent surface |
| // carries the inherited opacity). |
| layer1->setContentsOpaque(true); |
| layer1->setOpacity(0.5); |
| layer1->setExpectation(false, true); |
| layer2->setExpectation(false, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| EXPECT_TRUE(layer2->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Draw again, but with child non-opaque, to make sure |
| // layer1 not culled. |
| layer1->setContentsOpaque(true); |
| layer1->setOpacity(1); |
| layer1->setExpectation(false, false); |
| layer2->setContentsOpaque(true); |
| layer2->setOpacity(0.5); |
| layer2->setExpectation(true, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| EXPECT_TRUE(layer2->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // A second way of making the child non-opaque. |
| layer1->setContentsOpaque(true); |
| layer1->setOpacity(1); |
| layer1->setExpectation(false, false); |
| layer2->setContentsOpaque(false); |
| layer2->setOpacity(1); |
| layer2->setExpectation(true, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| EXPECT_TRUE(layer2->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // And when the layer says its not opaque but is painted opaque, it is not blended. |
| layer1->setContentsOpaque(true); |
| layer1->setOpacity(1); |
| layer1->setExpectation(false, false); |
| layer2->setContentsOpaque(true); |
| layer2->setOpacity(1); |
| layer2->setExpectation(false, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| EXPECT_TRUE(layer2->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Layer with partially opaque contents, drawn with blending. |
| layer1->setContentsOpaque(false); |
| layer1->setQuadRect(gfx::Rect(5, 5, 5, 5)); |
| layer1->setQuadVisibleRect(gfx::Rect(5, 5, 5, 5)); |
| layer1->setOpaqueContentRect(gfx::Rect(5, 5, 2, 5)); |
| layer1->setExpectation(true, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Layer with partially opaque contents partially culled, drawn with blending. |
| layer1->setContentsOpaque(false); |
| layer1->setQuadRect(gfx::Rect(5, 5, 5, 5)); |
| layer1->setQuadVisibleRect(gfx::Rect(5, 5, 5, 2)); |
| layer1->setOpaqueContentRect(gfx::Rect(5, 5, 2, 5)); |
| layer1->setExpectation(true, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Layer with partially opaque contents culled, drawn with blending. |
| layer1->setContentsOpaque(false); |
| layer1->setQuadRect(gfx::Rect(5, 5, 5, 5)); |
| layer1->setQuadVisibleRect(gfx::Rect(7, 5, 3, 5)); |
| layer1->setOpaqueContentRect(gfx::Rect(5, 5, 2, 5)); |
| layer1->setExpectation(true, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| // Layer with partially opaque contents and translucent contents culled, drawn without blending. |
| layer1->setContentsOpaque(false); |
| layer1->setQuadRect(gfx::Rect(5, 5, 5, 5)); |
| layer1->setQuadVisibleRect(gfx::Rect(5, 5, 2, 5)); |
| layer1->setOpaqueContentRect(gfx::Rect(5, 5, 2, 5)); |
| layer1->setExpectation(false, false); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(layer1->quadsAppended()); |
| m_hostImpl->didDrawAllLayers(frame); |
| |
| } |
| |
| TEST_P(LayerTreeHostImplTest, viewportCovered) |
| { |
| m_hostImpl->initializeRenderer(createOutputSurface()); |
| m_hostImpl->setBackgroundColor(SK_ColorGRAY); |
| |
| gfx::Size viewportSize(1000, 1000); |
| m_hostImpl->setViewportSize(viewportSize, viewportSize); |
| |
| m_hostImpl->setRootLayer(LayerImpl::create(m_hostImpl->activeTree(), 1)); |
| m_hostImpl->rootLayer()->addChild(BlendStateCheckLayer::create(m_hostImpl->activeTree(), 2, m_hostImpl->resourceProvider())); |
| BlendStateCheckLayer* child = static_cast<BlendStateCheckLayer*>(m_hostImpl->rootLayer()->children()[0]); |
| child->setExpectation(false, false); |
| child->setContentsOpaque(true); |
| |
| // No gutter rects |
| { |
| gfx::Rect layerRect(0, 0, 1000, 1000); |
| child->setPosition(layerRect.origin()); |
| child->setBounds(layerRect.size()); |
| child->setContentBounds(layerRect.size()); |
| child->setQuadRect(gfx::Rect(gfx::Point(), layerRect.size())); |
| child->setQuadVisibleRect(gfx::Rect(gfx::Point(), layerRect.size())); |
| |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| ASSERT_EQ(1u, frame.renderPasses.size()); |
| |
| size_t numGutterQuads = 0; |
| for (size_t i = 0; i < frame.renderPasses[0]->quad_list.size(); ++i) |
| numGutterQuads += (frame.renderPasses[0]->quad_list[i]->material == DrawQuad::SOLID_COLOR) ? 1 : 0; |
| EXPECT_EQ(0u, numGutterQuads); |
| EXPECT_EQ(1u, frame.renderPasses[0]->quad_list.size()); |
| |
| LayerTestCommon::verifyQuadsExactlyCoverRect(frame.renderPasses[0]->quad_list, gfx::Rect(gfx::Point(), viewportSize)); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Empty visible content area (fullscreen gutter rect) |
| { |
| gfx::Rect layerRect(0, 0, 0, 0); |
| child->setPosition(layerRect.origin()); |
| child->setBounds(layerRect.size()); |
| child->setContentBounds(layerRect.size()); |
| child->setQuadRect(gfx::Rect(gfx::Point(), layerRect.size())); |
| child->setQuadVisibleRect(gfx::Rect(gfx::Point(), layerRect.size())); |
| |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| ASSERT_EQ(1u, frame.renderPasses.size()); |
| |
| size_t numGutterQuads = 0; |
| for (size_t i = 0; i < frame.renderPasses[0]->quad_list.size(); ++i) |
| numGutterQuads += (frame.renderPasses[0]->quad_list[i]->material == DrawQuad::SOLID_COLOR) ? 1 : 0; |
| EXPECT_EQ(1u, numGutterQuads); |
| EXPECT_EQ(1u, frame.renderPasses[0]->quad_list.size()); |
| |
| LayerTestCommon::verifyQuadsExactlyCoverRect(frame.renderPasses[0]->quad_list, gfx::Rect(gfx::Point(), viewportSize)); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Content area in middle of clip rect (four surrounding gutter rects) |
| { |
| gfx::Rect layerRect(500, 500, 200, 200); |
| child->setPosition(layerRect.origin()); |
| child->setBounds(layerRect.size()); |
| child->setContentBounds(layerRect.size()); |
| child->setQuadRect(gfx::Rect(gfx::Point(), layerRect.size())); |
| child->setQuadVisibleRect(gfx::Rect(gfx::Point(), layerRect.size())); |
| |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| ASSERT_EQ(1u, frame.renderPasses.size()); |
| |
| size_t numGutterQuads = 0; |
| for (size_t i = 0; i < frame.renderPasses[0]->quad_list.size(); ++i) |
| numGutterQuads += (frame.renderPasses[0]->quad_list[i]->material == DrawQuad::SOLID_COLOR) ? 1 : 0; |
| EXPECT_EQ(4u, numGutterQuads); |
| EXPECT_EQ(5u, frame.renderPasses[0]->quad_list.size()); |
| |
| LayerTestCommon::verifyQuadsExactlyCoverRect(frame.renderPasses[0]->quad_list, gfx::Rect(gfx::Point(), viewportSize)); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| } |
| |
| |
| class ReshapeTrackerContext: public FakeWebGraphicsContext3D { |
| public: |
| ReshapeTrackerContext() : m_reshapeCalled(false) { } |
| |
| virtual void reshape(int width, int height) |
| { |
| m_reshapeCalled = true; |
| } |
| |
| bool reshapeCalled() const { return m_reshapeCalled; } |
| |
| private: |
| bool m_reshapeCalled; |
| }; |
| |
| class FakeDrawableLayerImpl: public LayerImpl { |
| public: |
| static scoped_ptr<LayerImpl> create(LayerTreeImpl* treeImpl, int id) { return scoped_ptr<LayerImpl>(new FakeDrawableLayerImpl(treeImpl, id)); } |
| protected: |
| FakeDrawableLayerImpl(LayerTreeImpl* treeImpl, int id) : LayerImpl(treeImpl, id) { } |
| }; |
| |
| // Only reshape when we know we are going to draw. Otherwise, the reshape |
| // can leave the window at the wrong size if we never draw and the proper |
| // viewport size is never set. |
| TEST_P(LayerTreeHostImplTest, reshapeNotCalledUntilDraw) |
| { |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new ReshapeTrackerContext)).PassAs<OutputSurface>(); |
| ReshapeTrackerContext* reshapeTracker = static_cast<ReshapeTrackerContext*>(outputSurface->Context3D()); |
| m_hostImpl->initializeRenderer(outputSurface.Pass()); |
| |
| scoped_ptr<LayerImpl> root = FakeDrawableLayerImpl::create(m_hostImpl->activeTree(), 1); |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setBounds(gfx::Size(10, 10)); |
| root->setDrawsContent(true); |
| m_hostImpl->setRootLayer(root.Pass()); |
| EXPECT_FALSE(reshapeTracker->reshapeCalled()); |
| |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| EXPECT_TRUE(reshapeTracker->reshapeCalled()); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| class PartialSwapTrackerContext : public FakeWebGraphicsContext3D { |
| public: |
| virtual void postSubBufferCHROMIUM(int x, int y, int width, int height) |
| { |
| m_partialSwapRect = gfx::Rect(x, y, width, height); |
| } |
| |
| virtual WebKit::WebString getString(WebKit::WGC3Denum name) |
| { |
| if (name == GL_EXTENSIONS) |
| return WebKit::WebString("GL_CHROMIUM_post_sub_buffer GL_CHROMIUM_set_visibility"); |
| |
| return WebKit::WebString(); |
| } |
| |
| gfx::Rect partialSwapRect() const { return m_partialSwapRect; } |
| |
| private: |
| gfx::Rect m_partialSwapRect; |
| }; |
| |
| // Make sure damage tracking propagates all the way to the graphics context, |
| // where it should request to swap only the subBuffer that is damaged. |
| TEST_P(LayerTreeHostImplTest, partialSwapReceivesDamageRect) |
| { |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapTrackerContext)).PassAs<OutputSurface>(); |
| PartialSwapTrackerContext* partialSwapTracker = static_cast<PartialSwapTrackerContext*>(outputSurface->Context3D()); |
| |
| // This test creates its own LayerTreeHostImpl, so |
| // that we can force partial swap enabled. |
| LayerTreeSettings settings; |
| settings.partialSwapEnabled = true; |
| scoped_ptr<LayerTreeHostImpl> layerTreeHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| layerTreeHostImpl->initializeRenderer(outputSurface.Pass()); |
| layerTreeHostImpl->setViewportSize(gfx::Size(500, 500), gfx::Size(500, 500)); |
| |
| scoped_ptr<LayerImpl> root = FakeDrawableLayerImpl::create(layerTreeHostImpl->activeTree(), 1); |
| scoped_ptr<LayerImpl> child = FakeDrawableLayerImpl::create(layerTreeHostImpl->activeTree(), 2); |
| child->setPosition(gfx::PointF(12, 13)); |
| child->setAnchorPoint(gfx::PointF(0, 0)); |
| child->setBounds(gfx::Size(14, 15)); |
| child->setContentBounds(gfx::Size(14, 15)); |
| child->setDrawsContent(true); |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setBounds(gfx::Size(500, 500)); |
| root->setContentBounds(gfx::Size(500, 500)); |
| root->setDrawsContent(true); |
| root->addChild(child.Pass()); |
| layerTreeHostImpl->setRootLayer(root.Pass()); |
| |
| LayerTreeHostImpl::FrameData frame; |
| |
| // First frame, the entire screen should get swapped. |
| EXPECT_TRUE(layerTreeHostImpl->prepareToDraw(frame)); |
| layerTreeHostImpl->drawLayers(frame); |
| layerTreeHostImpl->didDrawAllLayers(frame); |
| layerTreeHostImpl->swapBuffers(); |
| gfx::Rect actualSwapRect = partialSwapTracker->partialSwapRect(); |
| gfx::Rect expectedSwapRect = gfx::Rect(gfx::Point(), gfx::Size(500, 500)); |
| EXPECT_EQ(expectedSwapRect.x(), actualSwapRect.x()); |
| EXPECT_EQ(expectedSwapRect.y(), actualSwapRect.y()); |
| EXPECT_EQ(expectedSwapRect.width(), actualSwapRect.width()); |
| EXPECT_EQ(expectedSwapRect.height(), actualSwapRect.height()); |
| |
| // Second frame, only the damaged area should get swapped. Damage should be the union |
| // of old and new child rects. |
| // expected damage rect: gfx::Rect(gfx::Point(), gfx::Size(26, 28)); |
| // expected swap rect: vertically flipped, with origin at bottom left corner. |
| layerTreeHostImpl->rootLayer()->children()[0]->setPosition(gfx::PointF(0, 0)); |
| EXPECT_TRUE(layerTreeHostImpl->prepareToDraw(frame)); |
| layerTreeHostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| layerTreeHostImpl->swapBuffers(); |
| actualSwapRect = partialSwapTracker->partialSwapRect(); |
| expectedSwapRect = gfx::Rect(gfx::Point(0, 500-28), gfx::Size(26, 28)); |
| EXPECT_EQ(expectedSwapRect.x(), actualSwapRect.x()); |
| EXPECT_EQ(expectedSwapRect.y(), actualSwapRect.y()); |
| EXPECT_EQ(expectedSwapRect.width(), actualSwapRect.width()); |
| EXPECT_EQ(expectedSwapRect.height(), actualSwapRect.height()); |
| |
| // Make sure that partial swap is constrained to the viewport dimensions |
| // expected damage rect: gfx::Rect(gfx::Point(), gfx::Size(500, 500)); |
| // expected swap rect: flipped damage rect, but also clamped to viewport |
| layerTreeHostImpl->setViewportSize(gfx::Size(10, 10), gfx::Size(10, 10)); |
| layerTreeHostImpl->rootLayer()->setOpacity(0.7f); // this will damage everything |
| EXPECT_TRUE(layerTreeHostImpl->prepareToDraw(frame)); |
| layerTreeHostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| layerTreeHostImpl->swapBuffers(); |
| actualSwapRect = partialSwapTracker->partialSwapRect(); |
| expectedSwapRect = gfx::Rect(gfx::Point(), gfx::Size(10, 10)); |
| EXPECT_EQ(expectedSwapRect.x(), actualSwapRect.x()); |
| EXPECT_EQ(expectedSwapRect.y(), actualSwapRect.y()); |
| EXPECT_EQ(expectedSwapRect.width(), actualSwapRect.width()); |
| EXPECT_EQ(expectedSwapRect.height(), actualSwapRect.height()); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, rootLayerDoesntCreateExtraSurface) |
| { |
| scoped_ptr<LayerImpl> root = FakeDrawableLayerImpl::create(m_hostImpl->activeTree(), 1); |
| scoped_ptr<LayerImpl> child = FakeDrawableLayerImpl::create(m_hostImpl->activeTree(), 2); |
| child->setAnchorPoint(gfx::PointF(0, 0)); |
| child->setBounds(gfx::Size(10, 10)); |
| child->setContentBounds(gfx::Size(10, 10)); |
| child->setDrawsContent(true); |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setBounds(gfx::Size(10, 10)); |
| root->setContentBounds(gfx::Size(10, 10)); |
| root->setDrawsContent(true); |
| root->setOpacity(0.7f); |
| root->addChild(child.Pass()); |
| |
| m_hostImpl->setRootLayer(root.Pass()); |
| |
| LayerTreeHostImpl::FrameData frame; |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| EXPECT_EQ(1u, frame.renderSurfaceLayerList->size()); |
| EXPECT_EQ(1u, frame.renderPasses.size()); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| class FakeLayerWithQuads : public LayerImpl { |
| public: |
| static scoped_ptr<LayerImpl> create(LayerTreeImpl* treeImpl, int id) { return scoped_ptr<LayerImpl>(new FakeLayerWithQuads(treeImpl, id)); } |
| |
| virtual void appendQuads(QuadSink& quadSink, AppendQuadsData& appendQuadsData) OVERRIDE |
| { |
| SharedQuadState* sharedQuadState = quadSink.useSharedQuadState(createSharedQuadState()); |
| |
| SkColor gray = SkColorSetRGB(100, 100, 100); |
| gfx::Rect quadRect(gfx::Point(0, 0), contentBounds()); |
| scoped_ptr<SolidColorDrawQuad> myQuad = SolidColorDrawQuad::Create(); |
| myQuad->SetNew(sharedQuadState, quadRect, gray); |
| quadSink.append(myQuad.PassAs<DrawQuad>(), appendQuadsData); |
| } |
| |
| private: |
| FakeLayerWithQuads(LayerTreeImpl* treeImpl, int id) |
| : LayerImpl(treeImpl, id) |
| { |
| } |
| }; |
| |
| class MockContext : public FakeWebGraphicsContext3D { |
| public: |
| MOCK_METHOD1(useProgram, void(WebKit::WebGLId program)); |
| MOCK_METHOD5(uniform4f, void(WebKit::WGC3Dint location, WebKit::WGC3Dfloat x, WebKit::WGC3Dfloat y, WebKit::WGC3Dfloat z, WebKit::WGC3Dfloat w)); |
| MOCK_METHOD4(uniformMatrix4fv, void(WebKit::WGC3Dint location, WebKit::WGC3Dsizei count, WebKit::WGC3Dboolean transpose, const WebKit::WGC3Dfloat* value)); |
| MOCK_METHOD4(drawElements, void(WebKit::WGC3Denum mode, WebKit::WGC3Dsizei count, WebKit::WGC3Denum type, WebKit::WGC3Dintptr offset)); |
| MOCK_METHOD1(getString, WebKit::WebString(WebKit::WGC3Denum name)); |
| MOCK_METHOD0(getRequestableExtensionsCHROMIUM, WebKit::WebString()); |
| MOCK_METHOD1(enable, void(WebKit::WGC3Denum cap)); |
| MOCK_METHOD1(disable, void(WebKit::WGC3Denum cap)); |
| MOCK_METHOD4(scissor, void(WebKit::WGC3Dint x, WebKit::WGC3Dint y, WebKit::WGC3Dsizei width, WebKit::WGC3Dsizei height)); |
| }; |
| |
| class MockContextHarness { |
| private: |
| MockContext* m_context; |
| public: |
| MockContextHarness(MockContext* context) |
| : m_context(context) |
| { |
| // Catch "uninteresting" calls |
| EXPECT_CALL(*m_context, useProgram(_)) |
| .Times(0); |
| |
| EXPECT_CALL(*m_context, drawElements(_, _, _, _)) |
| .Times(0); |
| |
| // These are not asserted |
| EXPECT_CALL(*m_context, uniformMatrix4fv(_, _, _, _)) |
| .WillRepeatedly(Return()); |
| |
| EXPECT_CALL(*m_context, uniform4f(_, _, _, _, _)) |
| .WillRepeatedly(Return()); |
| |
| // Any other strings are empty |
| EXPECT_CALL(*m_context, getString(_)) |
| .WillRepeatedly(Return(WebKit::WebString())); |
| |
| // Support for partial swap, if needed |
| EXPECT_CALL(*m_context, getString(GL_EXTENSIONS)) |
| .WillRepeatedly(Return(WebKit::WebString("GL_CHROMIUM_post_sub_buffer"))); |
| |
| EXPECT_CALL(*m_context, getRequestableExtensionsCHROMIUM()) |
| .WillRepeatedly(Return(WebKit::WebString("GL_CHROMIUM_post_sub_buffer"))); |
| |
| // Any un-sanctioned calls to enable() are OK |
| EXPECT_CALL(*m_context, enable(_)) |
| .WillRepeatedly(Return()); |
| |
| // Any un-sanctioned calls to disable() are OK |
| EXPECT_CALL(*m_context, disable(_)) |
| .WillRepeatedly(Return()); |
| } |
| |
| void mustDrawSolidQuad() |
| { |
| EXPECT_CALL(*m_context, drawElements(GL_TRIANGLES, 6, GL_UNSIGNED_SHORT, 0)) |
| .WillOnce(Return()) |
| .RetiresOnSaturation(); |
| |
| // 1 is hardcoded return value of fake createProgram() |
| EXPECT_CALL(*m_context, useProgram(1)) |
| .WillOnce(Return()) |
| .RetiresOnSaturation(); |
| |
| } |
| |
| void mustSetScissor(int x, int y, int width, int height) |
| { |
| EXPECT_CALL(*m_context, enable(GL_SCISSOR_TEST)) |
| .WillRepeatedly(Return()); |
| |
| EXPECT_CALL(*m_context, scissor(x, y, width, height)) |
| .Times(AtLeast(1)) |
| .WillRepeatedly(Return()); |
| } |
| |
| void mustSetNoScissor() |
| { |
| EXPECT_CALL(*m_context, disable(GL_SCISSOR_TEST)) |
| .WillRepeatedly(Return()); |
| |
| EXPECT_CALL(*m_context, enable(GL_SCISSOR_TEST)) |
| .Times(0); |
| |
| EXPECT_CALL(*m_context, scissor(_, _, _, _)) |
| .Times(0); |
| } |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, noPartialSwap) |
| { |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new MockContext)).PassAs<OutputSurface>(); |
| MockContext* mockContext = static_cast<MockContext*>(outputSurface->Context3D()); |
| MockContextHarness harness(mockContext); |
| |
| // Run test case |
| createLayerTreeHost(false, outputSurface.Pass()); |
| setupRootLayerImpl(FakeLayerWithQuads::create(m_hostImpl->activeTree(), 1)); |
| |
| // without partial swap, and no clipping, no scissor is set. |
| harness.mustDrawSolidQuad(); |
| harness.mustSetNoScissor(); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| Mock::VerifyAndClearExpectations(&mockContext); |
| |
| // without partial swap, but a layer does clip its subtree, one scissor is set. |
| m_hostImpl->rootLayer()->setMasksToBounds(true); |
| harness.mustDrawSolidQuad(); |
| harness.mustSetScissor(0, 0, 10, 10); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| Mock::VerifyAndClearExpectations(&mockContext); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, partialSwap) |
| { |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new MockContext)).PassAs<OutputSurface>(); |
| MockContext* mockContext = static_cast<MockContext*>(outputSurface->Context3D()); |
| MockContextHarness harness(mockContext); |
| |
| createLayerTreeHost(true, outputSurface.Pass()); |
| setupRootLayerImpl(FakeLayerWithQuads::create(m_hostImpl->activeTree(), 1)); |
| |
| // The first frame is not a partially-swapped one. |
| harness.mustSetScissor(0, 0, 10, 10); |
| harness.mustDrawSolidQuad(); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| Mock::VerifyAndClearExpectations(&mockContext); |
| |
| // Damage a portion of the frame. |
| m_hostImpl->rootLayer()->setUpdateRect(gfx::Rect(0, 0, 2, 3)); |
| |
| // The second frame will be partially-swapped (the y coordinates are flipped). |
| harness.mustSetScissor(0, 7, 2, 3); |
| harness.mustDrawSolidQuad(); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| Mock::VerifyAndClearExpectations(&mockContext); |
| } |
| |
| class PartialSwapContext : public FakeWebGraphicsContext3D { |
| public: |
| WebKit::WebString getString(WebKit::WGC3Denum name) |
| { |
| if (name == GL_EXTENSIONS) |
| return WebKit::WebString("GL_CHROMIUM_post_sub_buffer"); |
| return WebKit::WebString(); |
| } |
| |
| WebKit::WebString getRequestableExtensionsCHROMIUM() |
| { |
| return WebKit::WebString("GL_CHROMIUM_post_sub_buffer"); |
| } |
| |
| // Unlimited texture size. |
| virtual void getIntegerv(WebKit::WGC3Denum pname, WebKit::WGC3Dint* value) |
| { |
| if (pname == GL_MAX_TEXTURE_SIZE) |
| *value = 8192; |
| } |
| }; |
| |
| static scoped_ptr<LayerTreeHostImpl> setupLayersForOpacity(bool partialSwap, LayerTreeHostImplClient* client, Proxy* proxy) |
| { |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapContext)).PassAs<OutputSurface>(); |
| |
| LayerTreeSettings settings; |
| settings.partialSwapEnabled = partialSwap; |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, client, proxy); |
| myHostImpl->initializeRenderer(outputSurface.Pass()); |
| myHostImpl->setViewportSize(gfx::Size(100, 100), gfx::Size(100, 100)); |
| |
| /* |
| Layers are created as follows: |
| |
| +--------------------+ |
| | 1 | |
| | +-----------+ | |
| | | 2 | | |
| | | +-------------------+ |
| | | | 3 | |
| | | +-------------------+ |
| | | | | |
| | +-----------+ | |
| | | |
| | | |
| +--------------------+ |
| |
| Layers 1, 2 have render surfaces |
| */ |
| scoped_ptr<LayerImpl> root = LayerImpl::create(myHostImpl->activeTree(), 1); |
| scoped_ptr<LayerImpl> child = LayerImpl::create(myHostImpl->activeTree(), 2); |
| scoped_ptr<LayerImpl> grandChild = FakeLayerWithQuads::create(myHostImpl->activeTree(), 3); |
| |
| gfx::Rect rootRect(0, 0, 100, 100); |
| gfx::Rect childRect(10, 10, 50, 50); |
| gfx::Rect grandChildRect(5, 5, 150, 150); |
| |
| root->createRenderSurface(); |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(rootRect.x(), rootRect.y())); |
| root->setBounds(gfx::Size(rootRect.width(), rootRect.height())); |
| root->setContentBounds(root->bounds()); |
| root->drawProperties().visible_content_rect = rootRect; |
| root->setDrawsContent(false); |
| root->renderSurface()->setContentRect(gfx::Rect(gfx::Point(), gfx::Size(rootRect.width(), rootRect.height()))); |
| |
| child->setAnchorPoint(gfx::PointF(0, 0)); |
| child->setPosition(gfx::PointF(childRect.x(), childRect.y())); |
| child->setOpacity(0.5f); |
| child->setBounds(gfx::Size(childRect.width(), childRect.height())); |
| child->setContentBounds(child->bounds()); |
| child->drawProperties().visible_content_rect = childRect; |
| child->setDrawsContent(false); |
| child->setForceRenderSurface(true); |
| |
| grandChild->setAnchorPoint(gfx::PointF(0, 0)); |
| grandChild->setPosition(gfx::Point(grandChildRect.x(), grandChildRect.y())); |
| grandChild->setBounds(gfx::Size(grandChildRect.width(), grandChildRect.height())); |
| grandChild->setContentBounds(grandChild->bounds()); |
| grandChild->drawProperties().visible_content_rect = grandChildRect; |
| grandChild->setDrawsContent(true); |
| |
| child->addChild(grandChild.Pass()); |
| root->addChild(child.Pass()); |
| |
| myHostImpl->setRootLayer(root.Pass()); |
| return myHostImpl.Pass(); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, contributingLayerEmptyScissorPartialSwap) |
| { |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = setupLayersForOpacity(true, this, &m_proxy); |
| |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Verify all quads have been computed |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| ASSERT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| ASSERT_EQ(1U, frame.renderPasses[1]->quad_list.size()); |
| EXPECT_EQ(DrawQuad::SOLID_COLOR, frame.renderPasses[0]->quad_list[0]->material); |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[1]->quad_list[0]->material); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, contributingLayerEmptyScissorNoPartialSwap) |
| { |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = setupLayersForOpacity(false, this, &m_proxy); |
| |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Verify all quads have been computed |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| ASSERT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| ASSERT_EQ(1U, frame.renderPasses[1]->quad_list.size()); |
| EXPECT_EQ(DrawQuad::SOLID_COLOR, frame.renderPasses[0]->quad_list[0]->material); |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[1]->quad_list[0]->material); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| // Make sure that output surface lost notifications are propagated through the tree. |
| class OutputSurfaceLostNotificationCheckLayer : public LayerImpl { |
| public: |
| static scoped_ptr<LayerImpl> create(LayerTreeImpl* treeImpl, int id) { return scoped_ptr<LayerImpl>(new OutputSurfaceLostNotificationCheckLayer(treeImpl, id)); } |
| |
| virtual void didLoseOutputSurface() OVERRIDE |
| { |
| m_didLoseOutputSurfaceCalled = true; |
| } |
| |
| bool didLoseOutputSurfaceCalled() const { return m_didLoseOutputSurfaceCalled; } |
| |
| private: |
| OutputSurfaceLostNotificationCheckLayer(LayerTreeImpl* treeImpl, int id) |
| : LayerImpl(treeImpl, id) |
| , m_didLoseOutputSurfaceCalled(false) |
| { |
| } |
| |
| bool m_didLoseOutputSurfaceCalled; |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, outputSurfaceLostAndRestoredNotificationSentToAllLayers) |
| { |
| m_hostImpl->setRootLayer(OutputSurfaceLostNotificationCheckLayer::create(m_hostImpl->activeTree(), 1)); |
| OutputSurfaceLostNotificationCheckLayer* root = static_cast<OutputSurfaceLostNotificationCheckLayer*>(m_hostImpl->rootLayer()); |
| |
| root->addChild(OutputSurfaceLostNotificationCheckLayer::create(m_hostImpl->activeTree(), 2)); |
| OutputSurfaceLostNotificationCheckLayer* layer1 = static_cast<OutputSurfaceLostNotificationCheckLayer*>(root->children()[0]); |
| |
| layer1->addChild(OutputSurfaceLostNotificationCheckLayer::create(m_hostImpl->activeTree(), 3)); |
| OutputSurfaceLostNotificationCheckLayer* layer2 = static_cast<OutputSurfaceLostNotificationCheckLayer*>(layer1->children()[0]); |
| |
| EXPECT_FALSE(root->didLoseOutputSurfaceCalled()); |
| EXPECT_FALSE(layer1->didLoseOutputSurfaceCalled()); |
| EXPECT_FALSE(layer2->didLoseOutputSurfaceCalled()); |
| |
| m_hostImpl->initializeRenderer(createOutputSurface()); |
| |
| EXPECT_TRUE(root->didLoseOutputSurfaceCalled()); |
| EXPECT_TRUE(layer1->didLoseOutputSurfaceCalled()); |
| EXPECT_TRUE(layer2->didLoseOutputSurfaceCalled()); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, finishAllRenderingAfterContextLost) |
| { |
| LayerTreeSettings settings; |
| m_hostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| // The context initialization will fail, but we should still be able to call finishAllRendering() without any ill effects. |
| m_hostImpl->initializeRenderer(FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new FakeWebGraphicsContext3DMakeCurrentFails)).PassAs<OutputSurface>()); |
| m_hostImpl->finishAllRendering(); |
| } |
| |
| class FakeWebGraphicsContext3DMakeCurrentFailsEventually : public FakeWebGraphicsContext3D { |
| public: |
| explicit FakeWebGraphicsContext3DMakeCurrentFailsEventually(unsigned succeedCount) : m_succeedCount(succeedCount) { } |
| virtual bool makeContextCurrent() { |
| if (!m_succeedCount) |
| return false; |
| --m_succeedCount; |
| return true; |
| } |
| |
| private: |
| unsigned m_succeedCount; |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, context3DLostDuringInitialize) |
| { |
| LayerTreeSettings settings; |
| m_hostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| // Initialize into a known successful state. |
| EXPECT_TRUE(m_hostImpl->initializeRenderer(createOutputSurface())); |
| EXPECT_TRUE(m_hostImpl->outputSurface()); |
| EXPECT_TRUE(m_hostImpl->renderer()); |
| EXPECT_TRUE(m_hostImpl->resourceProvider()); |
| |
| // We will make the context get lost after a numer of makeContextCurrent |
| // calls. The exact number of calls to make it succeed is dependent on the |
| // implementation and doesn't really matter (i.e. can be changed to make the |
| // tests pass after some refactoring). |
| const unsigned kMakeCurrentSuccessesNeededForSuccessfulInitialization = 3; |
| |
| for (unsigned i = 0; i < kMakeCurrentSuccessesNeededForSuccessfulInitialization; ++i) { |
| // The context will get lost during initialization, we shouldn't crash. We |
| // should also be in a consistent state. |
| EXPECT_FALSE(m_hostImpl->initializeRenderer(FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new FakeWebGraphicsContext3DMakeCurrentFailsEventually(i))).PassAs<OutputSurface>())); |
| EXPECT_EQ(0, m_hostImpl->outputSurface()); |
| EXPECT_EQ(0, m_hostImpl->renderer()); |
| EXPECT_EQ(0, m_hostImpl->resourceProvider()); |
| EXPECT_TRUE(m_hostImpl->initializeRenderer(createOutputSurface())); |
| } |
| |
| EXPECT_TRUE(m_hostImpl->initializeRenderer(FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new FakeWebGraphicsContext3DMakeCurrentFailsEventually(kMakeCurrentSuccessesNeededForSuccessfulInitialization))).PassAs<OutputSurface>())); |
| EXPECT_TRUE(m_hostImpl->outputSurface()); |
| EXPECT_TRUE(m_hostImpl->renderer()); |
| EXPECT_TRUE(m_hostImpl->resourceProvider()); |
| } |
| |
| // Fake WebKit::WebGraphicsContext3D that will cause a failure if trying to use a |
| // resource that wasn't created by it (resources created by |
| // FakeWebGraphicsContext3D have an id of 1). |
| class StrictWebGraphicsContext3D : public FakeWebGraphicsContext3D { |
| public: |
| StrictWebGraphicsContext3D() |
| : FakeWebGraphicsContext3D() |
| { |
| m_nextTextureId = 8; // Start allocating texture ids larger than any other resource IDs so we can tell if someone's mixing up their resource types. |
| } |
| |
| virtual WebKit::WebGLId createBuffer() { return 2; } |
| virtual WebKit::WebGLId createFramebuffer() { return 3; } |
| virtual WebKit::WebGLId createProgram() { return 4; } |
| virtual WebKit::WebGLId createRenderbuffer() { return 5; } |
| virtual WebKit::WebGLId createShader(WebKit::WGC3Denum) { return 6; } |
| |
| static const WebKit::WebGLId kExternalTextureId = 7; |
| |
| virtual void deleteBuffer(WebKit::WebGLId id) |
| { |
| if (id != 2) |
| ADD_FAILURE() << "Trying to delete buffer id " << id; |
| } |
| |
| virtual void deleteFramebuffer(WebKit::WebGLId id) |
| { |
| if (id != 3) |
| ADD_FAILURE() << "Trying to delete framebuffer id " << id; |
| } |
| |
| virtual void deleteProgram(WebKit::WebGLId id) |
| { |
| if (id != 4) |
| ADD_FAILURE() << "Trying to delete program id " << id; |
| } |
| |
| virtual void deleteRenderbuffer(WebKit::WebGLId id) |
| { |
| if (id != 5) |
| ADD_FAILURE() << "Trying to delete renderbuffer id " << id; |
| } |
| |
| virtual void deleteShader(WebKit::WebGLId id) |
| { |
| if (id != 6) |
| ADD_FAILURE() << "Trying to delete shader id " << id; |
| } |
| |
| virtual WebKit::WebGLId createTexture() |
| { |
| unsigned textureId = FakeWebGraphicsContext3D::createTexture(); |
| m_allocatedTextureIds.insert(textureId); |
| return textureId; |
| } |
| virtual void deleteTexture(WebKit::WebGLId id) |
| { |
| if (id == kExternalTextureId) |
| ADD_FAILURE() << "Trying to delete external texture"; |
| if (!ContainsKey(m_allocatedTextureIds, id)) |
| ADD_FAILURE() << "Trying to delete texture id " << id; |
| m_allocatedTextureIds.erase(id); |
| } |
| |
| virtual void bindBuffer(WebKit::WGC3Denum, WebKit::WebGLId id) |
| { |
| if (id != 2 && id) |
| ADD_FAILURE() << "Trying to bind buffer id " << id; |
| } |
| |
| virtual void bindFramebuffer(WebKit::WGC3Denum, WebKit::WebGLId id) |
| { |
| if (id != 3 && id) |
| ADD_FAILURE() << "Trying to bind framebuffer id " << id; |
| } |
| |
| virtual void useProgram(WebKit::WebGLId id) |
| { |
| if (id != 4) |
| ADD_FAILURE() << "Trying to use program id " << id; |
| } |
| |
| virtual void bindRenderbuffer(WebKit::WGC3Denum, WebKit::WebGLId id) |
| { |
| if (id != 5 && id) |
| ADD_FAILURE() << "Trying to bind renderbuffer id " << id; |
| } |
| |
| virtual void attachShader(WebKit::WebGLId program, WebKit::WebGLId shader) |
| { |
| if ((program != 4) || (shader != 6)) |
| ADD_FAILURE() << "Trying to attach shader id " << shader << " to program id " << program; |
| } |
| |
| virtual void bindTexture(WebKit::WGC3Denum, WebKit::WebGLId id) |
| { |
| if (id && id != kExternalTextureId && !ContainsKey(m_allocatedTextureIds, id)) |
| ADD_FAILURE() << "Trying to bind texture id " << id; |
| } |
| |
| private: |
| base::hash_set<unsigned> m_allocatedTextureIds; |
| }; |
| |
| // Fake WebKit::WebVideoFrame wrapper of media::VideoFrame. |
| class FakeVideoFrame: public WebKit::WebVideoFrame { |
| public: |
| explicit FakeVideoFrame(const scoped_refptr<VideoFrame>& frame) : m_frame(frame) { } |
| virtual ~FakeVideoFrame() { } |
| |
| virtual Format format() const { NOTREACHED(); return FormatInvalid; } |
| virtual unsigned width() const { NOTREACHED(); return 0; } |
| virtual unsigned height() const { NOTREACHED(); return 0; } |
| virtual unsigned planes() const { NOTREACHED(); return 0; } |
| virtual int stride(unsigned plane) const { NOTREACHED(); return 0; } |
| virtual const void* data(unsigned plane) const { NOTREACHED(); return NULL; } |
| virtual unsigned textureId() const { NOTREACHED(); return 0; } |
| virtual unsigned textureTarget() const { NOTREACHED(); return 0; } |
| virtual WebKit::WebRect visibleRect() const { NOTREACHED(); return WebKit::WebRect(0, 0, 0, 0); } |
| virtual WebKit::WebSize textureSize() const { NOTREACHED(); return WebKit::WebSize(4, 4); } |
| |
| static VideoFrame* toVideoFrame(WebKit::WebVideoFrame* web_video_frame) { |
| FakeVideoFrame* wrapped_frame = |
| static_cast<FakeVideoFrame*>(web_video_frame); |
| if (wrapped_frame) |
| return wrapped_frame->m_frame.get(); |
| return NULL; |
| } |
| |
| private: |
| scoped_refptr<VideoFrame> m_frame; |
| }; |
| |
| // Fake video frame provider that always provides the same FakeVideoFrame. |
| class FakeVideoFrameProvider: public WebKit::WebVideoFrameProvider { |
| public: |
| FakeVideoFrameProvider() : m_frame(0), m_client(0) { } |
| virtual ~FakeVideoFrameProvider() |
| { |
| if (m_client) |
| m_client->stopUsingProvider(); |
| } |
| |
| virtual void setVideoFrameProviderClient(Client* client) { m_client = client; } |
| virtual WebKit::WebVideoFrame* getCurrentFrame() { return m_frame; } |
| virtual void putCurrentFrame(WebKit::WebVideoFrame*) { } |
| |
| void setFrame(WebKit::WebVideoFrame* frame) { m_frame = frame; } |
| |
| private: |
| WebKit::WebVideoFrame* m_frame; |
| Client* m_client; |
| }; |
| |
| class StrictWebGraphicsContext3DWithIOSurface : public StrictWebGraphicsContext3D { |
| public: |
| virtual WebKit::WebString getString(WebKit::WGC3Denum name) OVERRIDE |
| { |
| if (name == GL_EXTENSIONS) |
| return WebKit::WebString("GL_CHROMIUM_iosurface GL_ARB_texture_rectangle"); |
| |
| return WebKit::WebString(); |
| } |
| }; |
| |
| class FakeWebGraphicsContext3DWithIOSurface : public FakeWebGraphicsContext3D { |
| public: |
| virtual WebKit::WebString getString(WebKit::WGC3Denum name) OVERRIDE |
| { |
| if (name == GL_EXTENSIONS) |
| return WebKit::WebString("GL_CHROMIUM_iosurface GL_ARB_texture_rectangle"); |
| |
| return WebKit::WebString(); |
| } |
| }; |
| |
| class FakeWebScrollbarThemeGeometryNonEmpty : public FakeWebScrollbarThemeGeometry { |
| virtual WebKit::WebRect trackRect(WebKit::WebScrollbar*) OVERRIDE { return WebKit::WebRect(0, 0, 10, 10); } |
| virtual WebKit::WebRect thumbRect(WebKit::WebScrollbar*) OVERRIDE { return WebKit::WebRect(0, 5, 5, 2); } |
| virtual void splitTrack(WebKit::WebScrollbar*, const WebKit::WebRect& track, WebKit::WebRect& startTrack, WebKit::WebRect& thumb, WebKit::WebRect& endTrack) OVERRIDE |
| { |
| thumb = WebKit::WebRect(0, 5, 5, 2); |
| startTrack = WebKit::WebRect(0, 5, 0, 5); |
| endTrack = WebKit::WebRect(0, 0, 0, 5); |
| } |
| }; |
| |
| class FakeScrollbarLayerImpl : public ScrollbarLayerImpl { |
| public: |
| static scoped_ptr<FakeScrollbarLayerImpl> create(LayerTreeImpl* treeImpl, int id) |
| { |
| return make_scoped_ptr(new FakeScrollbarLayerImpl(treeImpl, id)); |
| } |
| |
| void createResources(ResourceProvider* provider) |
| { |
| DCHECK(provider); |
| gfx::Size size(10, 10); |
| GLenum format = GL_RGBA; |
| ResourceProvider::TextureUsageHint hint = ResourceProvider::TextureUsageAny; |
| setScrollbarGeometry(ScrollbarGeometryFixedThumb::create(FakeWebScrollbarThemeGeometryNonEmpty::create())); |
| |
| setBackTrackResourceId(provider->createResource(size, format, hint)); |
| setForeTrackResourceId(provider->createResource(size, format, hint)); |
| setThumbResourceId(provider->createResource(size, format, hint)); |
| } |
| |
| protected: |
| FakeScrollbarLayerImpl(LayerTreeImpl* treeImpl, int id) |
| : ScrollbarLayerImpl(treeImpl, id) |
| { |
| } |
| }; |
| |
| static inline scoped_ptr<RenderPass> createRenderPassWithResource(ResourceProvider* provider) |
| { |
| ResourceProvider::ResourceId resourceId = provider->createResource(gfx::Size(1, 1), GL_RGBA, ResourceProvider::TextureUsageAny); |
| |
| scoped_ptr<TestRenderPass> pass = TestRenderPass::Create(); |
| pass->SetNew(RenderPass::Id(1, 1), gfx::Rect(0, 0, 1, 1), gfx::Rect(0, 0, 1, 1), gfx::Transform()); |
| scoped_ptr<SharedQuadState> sharedState = SharedQuadState::Create(); |
| sharedState->SetAll(gfx::Transform(), gfx::Rect(0, 0, 1, 1), gfx::Rect(0, 0, 1, 1), gfx::Rect(0, 0, 1, 1), false, 1); |
| const float vertex_opacity[] = {1.0f, 1.0f, 1.0f, 1.0f}; |
| scoped_ptr<TextureDrawQuad> quad = TextureDrawQuad::Create(); |
| quad->SetNew(sharedState.get(), gfx::Rect(0, 0, 1, 1), gfx::Rect(0, 0, 1, 1), resourceId, false, gfx::RectF(0, 0, 1, 1), vertex_opacity, false); |
| |
| pass->AppendSharedQuadState(sharedState.Pass()); |
| pass->AppendQuad(quad.PassAs<DrawQuad>()); |
| |
| return pass.PassAs<RenderPass>(); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, dontUseOldResourcesAfterLostOutputSurface) |
| { |
| int layerId = 1; |
| |
| scoped_ptr<LayerImpl> rootLayer(LayerImpl::create(m_hostImpl->activeTree(), layerId++)); |
| rootLayer->setBounds(gfx::Size(10, 10)); |
| rootLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| |
| scoped_ptr<TiledLayerImpl> tileLayer = TiledLayerImpl::create(m_hostImpl->activeTree(), layerId++); |
| tileLayer->setBounds(gfx::Size(10, 10)); |
| tileLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| tileLayer->setContentBounds(gfx::Size(10, 10)); |
| tileLayer->setDrawsContent(true); |
| tileLayer->setSkipsDraw(false); |
| scoped_ptr<LayerTilingData> tilingData(LayerTilingData::create(gfx::Size(10, 10), LayerTilingData::NoBorderTexels)); |
| tilingData->setBounds(gfx::Size(10, 10)); |
| tileLayer->setTilingData(*tilingData); |
| tileLayer->pushTileProperties(0, 0, 1, gfx::Rect(0, 0, 10, 10), false); |
| rootLayer->addChild(tileLayer.PassAs<LayerImpl>()); |
| |
| scoped_ptr<TextureLayerImpl> textureLayer = TextureLayerImpl::create(m_hostImpl->activeTree(), layerId++); |
| textureLayer->setBounds(gfx::Size(10, 10)); |
| textureLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| textureLayer->setContentBounds(gfx::Size(10, 10)); |
| textureLayer->setDrawsContent(true); |
| textureLayer->setTextureId(StrictWebGraphicsContext3D::kExternalTextureId); |
| rootLayer->addChild(textureLayer.PassAs<LayerImpl>()); |
| |
| scoped_ptr<TiledLayerImpl> maskLayer = TiledLayerImpl::create(m_hostImpl->activeTree(), layerId++); |
| maskLayer->setBounds(gfx::Size(10, 10)); |
| maskLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| maskLayer->setContentBounds(gfx::Size(10, 10)); |
| maskLayer->setDrawsContent(true); |
| maskLayer->setSkipsDraw(false); |
| maskLayer->setTilingData(*tilingData); |
| maskLayer->pushTileProperties(0, 0, 1, gfx::Rect(0, 0, 10, 10), false); |
| |
| scoped_ptr<TextureLayerImpl> textureLayerWithMask = TextureLayerImpl::create(m_hostImpl->activeTree(), layerId++); |
| textureLayerWithMask->setBounds(gfx::Size(10, 10)); |
| textureLayerWithMask->setAnchorPoint(gfx::PointF(0, 0)); |
| textureLayerWithMask->setContentBounds(gfx::Size(10, 10)); |
| textureLayerWithMask->setDrawsContent(true); |
| textureLayerWithMask->setTextureId(StrictWebGraphicsContext3D::kExternalTextureId); |
| textureLayerWithMask->setMaskLayer(maskLayer.PassAs<LayerImpl>()); |
| rootLayer->addChild(textureLayerWithMask.PassAs<LayerImpl>()); |
| |
| FakeVideoFrame videoFrame(VideoFrame::CreateColorFrame(gfx::Size(4, 4), |
| 0x80, 0x80, 0x80, |
| base::TimeDelta())); |
| VideoLayerImpl::FrameUnwrapper unwrapper = |
| base::Bind(FakeVideoFrame::toVideoFrame); |
| FakeVideoFrameProvider provider; |
| provider.setFrame(&videoFrame); |
| scoped_ptr<VideoLayerImpl> videoLayer = VideoLayerImpl::create(m_hostImpl->activeTree(), layerId++, &provider, unwrapper); |
| videoLayer->setBounds(gfx::Size(10, 10)); |
| videoLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| videoLayer->setContentBounds(gfx::Size(10, 10)); |
| videoLayer->setDrawsContent(true); |
| rootLayer->addChild(videoLayer.PassAs<LayerImpl>()); |
| |
| FakeVideoFrameProvider providerScaled; |
| scoped_ptr<VideoLayerImpl> videoLayerScaled = VideoLayerImpl::create(m_hostImpl->activeTree(), layerId++, &providerScaled, unwrapper); |
| videoLayerScaled->setBounds(gfx::Size(10, 10)); |
| videoLayerScaled->setAnchorPoint(gfx::PointF(0, 0)); |
| videoLayerScaled->setContentBounds(gfx::Size(10, 10)); |
| videoLayerScaled->setDrawsContent(true); |
| rootLayer->addChild(videoLayerScaled.PassAs<LayerImpl>()); |
| |
| FakeVideoFrameProvider hwProvider; |
| scoped_ptr<VideoLayerImpl> hwVideoLayer = VideoLayerImpl::create(m_hostImpl->activeTree(), layerId++, &hwProvider, unwrapper); |
| hwVideoLayer->setBounds(gfx::Size(10, 10)); |
| hwVideoLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| hwVideoLayer->setContentBounds(gfx::Size(10, 10)); |
| hwVideoLayer->setDrawsContent(true); |
| rootLayer->addChild(hwVideoLayer.PassAs<LayerImpl>()); |
| |
| scoped_ptr<IOSurfaceLayerImpl> ioSurfaceLayer = IOSurfaceLayerImpl::create(m_hostImpl->activeTree(), layerId++); |
| ioSurfaceLayer->setBounds(gfx::Size(10, 10)); |
| ioSurfaceLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| ioSurfaceLayer->setContentBounds(gfx::Size(10, 10)); |
| ioSurfaceLayer->setDrawsContent(true); |
| ioSurfaceLayer->setIOSurfaceProperties(1, gfx::Size(10, 10)); |
| rootLayer->addChild(ioSurfaceLayer.PassAs<LayerImpl>()); |
| |
| scoped_ptr<HeadsUpDisplayLayerImpl> hudLayer = HeadsUpDisplayLayerImpl::create(m_hostImpl->activeTree(), layerId++); |
| hudLayer->setBounds(gfx::Size(10, 10)); |
| hudLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| hudLayer->setContentBounds(gfx::Size(10, 10)); |
| hudLayer->setDrawsContent(true); |
| rootLayer->addChild(hudLayer.PassAs<LayerImpl>()); |
| |
| scoped_ptr<FakeScrollbarLayerImpl> scrollbarLayer(FakeScrollbarLayerImpl::create(m_hostImpl->activeTree(), layerId++)); |
| scrollbarLayer->setBounds(gfx::Size(10, 10)); |
| scrollbarLayer->setContentBounds(gfx::Size(10, 10)); |
| scrollbarLayer->setDrawsContent(true); |
| scrollbarLayer->createResources(m_hostImpl->resourceProvider()); |
| rootLayer->addChild(scrollbarLayer.PassAs<LayerImpl>()); |
| |
| scoped_ptr<DelegatedRendererLayerImpl> delegatedRendererLayer(DelegatedRendererLayerImpl::create(m_hostImpl->activeTree(), layerId++)); |
| delegatedRendererLayer->setBounds(gfx::Size(10, 10)); |
| delegatedRendererLayer->setContentBounds(gfx::Size(10, 10)); |
| delegatedRendererLayer->setDrawsContent(true); |
| ScopedPtrVector<RenderPass> passList; |
| passList.append(createRenderPassWithResource(m_hostImpl->resourceProvider())); |
| delegatedRendererLayer->setRenderPasses(passList); |
| EXPECT_TRUE(passList.isEmpty()); |
| rootLayer->addChild(delegatedRendererLayer.PassAs<LayerImpl>()); |
| |
| // Use a context that supports IOSurfaces |
| m_hostImpl->initializeRenderer(FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new FakeWebGraphicsContext3DWithIOSurface)).PassAs<OutputSurface>()); |
| |
| FakeVideoFrame hwVideoFrame( |
| VideoFrame::WrapNativeTexture( |
| m_hostImpl->resourceProvider()->graphicsContext3D()->createTexture(), |
| GL_TEXTURE_2D, |
| gfx::Size(4, 4), gfx::Rect(0, 0, 4, 4), gfx::Size(4, 4), base::TimeDelta(), |
| VideoFrame::ReadPixelsCB(), base::Closure())); |
| hwProvider.setFrame(&hwVideoFrame); |
| |
| FakeVideoFrame videoFrameScaled( |
| VideoFrame::WrapNativeTexture( |
| m_hostImpl->resourceProvider()->graphicsContext3D()->createTexture(), |
| GL_TEXTURE_2D, |
| gfx::Size(4, 4), gfx::Rect(0, 0, 3, 2), gfx::Size(4, 4), base::TimeDelta(), |
| VideoFrame::ReadPixelsCB(), base::Closure())); |
| providerScaled.setFrame(&videoFrameScaled); |
| |
| m_hostImpl->setRootLayer(rootLayer.Pass()); |
| |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| m_hostImpl->swapBuffers(); |
| |
| unsigned numResources = m_hostImpl->resourceProvider()->numResources(); |
| |
| // Lose the WebKit::WebGraphicsContext3D, replacing it with a StrictWebGraphicsContext3DWithIOSurface, |
| // that will warn if any resource from the previous context gets used. |
| m_hostImpl->initializeRenderer(FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new StrictWebGraphicsContext3DWithIOSurface)).PassAs<OutputSurface>()); |
| |
| // Create dummy resources so that looking up an old resource will get an |
| // invalid texture id mapping. |
| for (unsigned i = 0; i < numResources; ++i) |
| m_hostImpl->resourceProvider()->createResourceFromExternalTexture(StrictWebGraphicsContext3D::kExternalTextureId); |
| |
| // The WebKit::WebVideoFrameProvider is expected to recreate its textures after a |
| // lost output surface (or not serve a frame). |
| hwProvider.setFrame(0); |
| providerScaled.setFrame(0); |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| m_hostImpl->swapBuffers(); |
| |
| FakeVideoFrame hwVideoFrame2( |
| VideoFrame::WrapNativeTexture( |
| m_hostImpl->resourceProvider()->graphicsContext3D()->createTexture(), |
| GL_TEXTURE_2D, |
| gfx::Size(4, 4), gfx::Rect(0, 0, 4, 4), gfx::Size(4, 4), base::TimeDelta(), |
| VideoFrame::ReadPixelsCB(), base::Closure())); |
| hwProvider.setFrame(&hwVideoFrame2); |
| |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| m_hostImpl->swapBuffers(); |
| } |
| |
| // Fake WebKit::WebGraphicsContext3D that tracks the number of textures in use. |
| class TrackingWebGraphicsContext3D : public FakeWebGraphicsContext3D { |
| public: |
| TrackingWebGraphicsContext3D() |
| : FakeWebGraphicsContext3D() |
| , m_numTextures(0) |
| { } |
| |
| virtual WebKit::WebGLId createTexture() OVERRIDE |
| { |
| WebKit::WebGLId id = FakeWebGraphicsContext3D::createTexture(); |
| |
| m_textures[id] = true; |
| ++m_numTextures; |
| return id; |
| } |
| |
| virtual void deleteTexture(WebKit::WebGLId id) OVERRIDE |
| { |
| if (m_textures.find(id) == m_textures.end()) |
| return; |
| |
| m_textures[id] = false; |
| --m_numTextures; |
| } |
| |
| virtual WebKit::WebString getString(WebKit::WGC3Denum name) OVERRIDE |
| { |
| if (name == GL_EXTENSIONS) |
| return WebKit::WebString("GL_CHROMIUM_iosurface GL_ARB_texture_rectangle"); |
| |
| return WebKit::WebString(); |
| } |
| |
| unsigned numTextures() const { return m_numTextures; } |
| |
| private: |
| base::hash_map<WebKit::WebGLId, bool> m_textures; |
| unsigned m_numTextures; |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, layersFreeTextures) |
| { |
| scoped_ptr<LayerImpl> rootLayer(LayerImpl::create(m_hostImpl->activeTree(), 1)); |
| rootLayer->setBounds(gfx::Size(10, 10)); |
| rootLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| |
| scoped_ptr<TiledLayerImpl> tileLayer = TiledLayerImpl::create(m_hostImpl->activeTree(), 2); |
| tileLayer->setBounds(gfx::Size(10, 10)); |
| tileLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| tileLayer->setContentBounds(gfx::Size(10, 10)); |
| tileLayer->setDrawsContent(true); |
| tileLayer->setSkipsDraw(false); |
| scoped_ptr<LayerTilingData> tilingData(LayerTilingData::create(gfx::Size(10, 10), LayerTilingData::NoBorderTexels)); |
| tilingData->setBounds(gfx::Size(10, 10)); |
| tileLayer->setTilingData(*tilingData); |
| tileLayer->pushTileProperties(0, 0, 1, gfx::Rect(0, 0, 10, 10), false); |
| rootLayer->addChild(tileLayer.PassAs<LayerImpl>()); |
| |
| scoped_ptr<TextureLayerImpl> textureLayer = TextureLayerImpl::create(m_hostImpl->activeTree(), 3); |
| textureLayer->setBounds(gfx::Size(10, 10)); |
| textureLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| textureLayer->setContentBounds(gfx::Size(10, 10)); |
| textureLayer->setDrawsContent(true); |
| textureLayer->setTextureId(1); |
| rootLayer->addChild(textureLayer.PassAs<LayerImpl>()); |
| |
| VideoLayerImpl::FrameUnwrapper unwrapper = |
| base::Bind(FakeVideoFrame::toVideoFrame); |
| FakeVideoFrameProvider provider; |
| scoped_ptr<VideoLayerImpl> videoLayer = VideoLayerImpl::create(m_hostImpl->activeTree(), 4, &provider, unwrapper); |
| videoLayer->setBounds(gfx::Size(10, 10)); |
| videoLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| videoLayer->setContentBounds(gfx::Size(10, 10)); |
| videoLayer->setDrawsContent(true); |
| rootLayer->addChild(videoLayer.PassAs<LayerImpl>()); |
| |
| scoped_ptr<IOSurfaceLayerImpl> ioSurfaceLayer = IOSurfaceLayerImpl::create(m_hostImpl->activeTree(), 5); |
| ioSurfaceLayer->setBounds(gfx::Size(10, 10)); |
| ioSurfaceLayer->setAnchorPoint(gfx::PointF(0, 0)); |
| ioSurfaceLayer->setContentBounds(gfx::Size(10, 10)); |
| ioSurfaceLayer->setDrawsContent(true); |
| ioSurfaceLayer->setIOSurfaceProperties(1, gfx::Size(10, 10)); |
| rootLayer->addChild(ioSurfaceLayer.PassAs<LayerImpl>()); |
| |
| // Lose the WebGraphicsContext3D, replacing it with a TrackingWebGraphicsContext3D (which the LayerTreeHostImpl takes ownership of). |
| scoped_ptr<OutputSurface> outputSurface(FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new TrackingWebGraphicsContext3D))); |
| TrackingWebGraphicsContext3D* trackingWebGraphicsContext3D = static_cast<TrackingWebGraphicsContext3D*>(outputSurface->Context3D()); |
| m_hostImpl->initializeRenderer(outputSurface.Pass()); |
| |
| m_hostImpl->setRootLayer(rootLayer.Pass()); |
| |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| m_hostImpl->swapBuffers(); |
| |
| EXPECT_GT(trackingWebGraphicsContext3D->numTextures(), 0u); |
| |
| // Kill the layer tree. |
| m_hostImpl->setRootLayer(LayerImpl::create(m_hostImpl->activeTree(), 100)); |
| // There should be no textures left in use after. |
| EXPECT_EQ(0u, trackingWebGraphicsContext3D->numTextures()); |
| } |
| |
| class MockDrawQuadsToFillScreenContext : public FakeWebGraphicsContext3D { |
| public: |
| MOCK_METHOD1(useProgram, void(WebKit::WebGLId program)); |
| MOCK_METHOD4(drawElements, void(WebKit::WGC3Denum mode, WebKit::WGC3Dsizei count, WebKit::WGC3Denum type, WebKit::WGC3Dintptr offset)); |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, hasTransparentBackground) |
| { |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new MockDrawQuadsToFillScreenContext)).PassAs<OutputSurface>(); |
| MockDrawQuadsToFillScreenContext* mockContext = static_cast<MockDrawQuadsToFillScreenContext*>(outputSurface->Context3D()); |
| |
| // Run test case |
| createLayerTreeHost(false, outputSurface.Pass()); |
| setupRootLayerImpl(LayerImpl::create(m_hostImpl->activeTree(), 1)); |
| m_hostImpl->setBackgroundColor(SK_ColorWHITE); |
| |
| // Verify one quad is drawn when transparent background set is not set. |
| m_hostImpl->setHasTransparentBackground(false); |
| EXPECT_CALL(*mockContext, useProgram(_)) |
| .Times(1); |
| EXPECT_CALL(*mockContext, drawElements(_, _, _, _)) |
| .Times(1); |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| Mock::VerifyAndClearExpectations(&mockContext); |
| |
| // Verify no quads are drawn when transparent background is set. |
| m_hostImpl->setHasTransparentBackground(true); |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| Mock::VerifyAndClearExpectations(&mockContext); |
| } |
| |
| static void addDrawingLayerTo(LayerImpl* parent, int id, const gfx::Rect& layerRect, LayerImpl** result) |
| { |
| scoped_ptr<LayerImpl> layer = FakeLayerWithQuads::create(parent->layerTreeImpl(), id); |
| LayerImpl* layerPtr = layer.get(); |
| layerPtr->setAnchorPoint(gfx::PointF(0, 0)); |
| layerPtr->setPosition(gfx::PointF(layerRect.origin())); |
| layerPtr->setBounds(layerRect.size()); |
| layerPtr->setContentBounds(layerRect.size()); |
| layerPtr->setDrawsContent(true); // only children draw content |
| layerPtr->setContentsOpaque(true); |
| parent->addChild(layer.Pass()); |
| if (result) |
| *result = layerPtr; |
| } |
| |
| static void setupLayersForTextureCaching(LayerTreeHostImpl* layerTreeHostImpl, LayerImpl*& rootPtr, LayerImpl*& intermediateLayerPtr, LayerImpl*& surfaceLayerPtr, LayerImpl*& childPtr, const gfx::Size& rootSize) |
| { |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapContext)).PassAs<OutputSurface>(); |
| |
| layerTreeHostImpl->initializeRenderer(outputSurface.Pass()); |
| layerTreeHostImpl->setViewportSize(rootSize, rootSize); |
| |
| scoped_ptr<LayerImpl> root = LayerImpl::create(layerTreeHostImpl->activeTree(), 1); |
| rootPtr = root.get(); |
| |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(0, 0)); |
| root->setBounds(rootSize); |
| root->setContentBounds(rootSize); |
| root->setDrawsContent(true); |
| layerTreeHostImpl->activeTree()->SetRootLayer(root.Pass()); |
| |
| addDrawingLayerTo(rootPtr, 2, gfx::Rect(10, 10, rootSize.width(), rootSize.height()), &intermediateLayerPtr); |
| intermediateLayerPtr->setDrawsContent(false); // only children draw content |
| |
| // Surface layer is the layer that changes its opacity |
| // It will contain other layers that draw content. |
| addDrawingLayerTo(intermediateLayerPtr, 3, gfx::Rect(10, 10, rootSize.width(), rootSize.height()), &surfaceLayerPtr); |
| surfaceLayerPtr->setDrawsContent(false); // only children draw content |
| surfaceLayerPtr->setOpacity(0.5f); |
| surfaceLayerPtr->setForceRenderSurface(true); // This will cause it to have a surface |
| |
| // Child of the surface layer will produce some quads |
| addDrawingLayerTo(surfaceLayerPtr, 4, gfx::Rect(5, 5, rootSize.width() - 25, rootSize.height() - 25), &childPtr); |
| } |
| |
| class GLRendererWithReleaseTextures : public GLRenderer { |
| public: |
| using GLRenderer::releaseRenderPassTextures; |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, textureCachingWithOcclusion) |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| // Layers are structure as follows: |
| // |
| // R +-- S1 +- L10 (owning) |
| // | +- L11 |
| // | +- L12 |
| // | |
| // +-- S2 +- L20 (owning) |
| // +- L21 |
| // |
| // Occlusion: |
| // L12 occludes L11 (internal) |
| // L20 occludes L10 (external) |
| // L21 occludes L20 (internal) |
| |
| LayerImpl* rootPtr; |
| LayerImpl* layerS1Ptr; |
| LayerImpl* layerS2Ptr; |
| |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapContext)).PassAs<OutputSurface>(); |
| |
| gfx::Size rootSize(1000, 1000); |
| |
| myHostImpl->initializeRenderer(outputSurface.Pass()); |
| myHostImpl->setViewportSize(gfx::Size(rootSize.width(), rootSize.height()), gfx::Size(rootSize.width(), rootSize.height())); |
| |
| scoped_ptr<LayerImpl> root = LayerImpl::create(myHostImpl->activeTree(), 1); |
| rootPtr = root.get(); |
| |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(0, 0)); |
| root->setBounds(rootSize); |
| root->setContentBounds(rootSize); |
| root->setDrawsContent(true); |
| root->setMasksToBounds(true); |
| myHostImpl->setRootLayer(root.Pass()); |
| |
| addDrawingLayerTo(rootPtr, 2, gfx::Rect(300, 300, 300, 300), &layerS1Ptr); |
| layerS1Ptr->setForceRenderSurface(true); |
| |
| addDrawingLayerTo(layerS1Ptr, 3, gfx::Rect(10, 10, 10, 10), 0); // L11 |
| addDrawingLayerTo(layerS1Ptr, 4, gfx::Rect(0, 0, 30, 30), 0); // L12 |
| |
| addDrawingLayerTo(rootPtr, 5, gfx::Rect(550, 250, 300, 400), &layerS2Ptr); |
| layerS2Ptr->setForceRenderSurface(true); |
| |
| addDrawingLayerTo(layerS2Ptr, 6, gfx::Rect(20, 20, 5, 5), 0); // L21 |
| |
| // Initial draw - must receive all quads |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 3 render passes. |
| // For Root, there are 2 quads; for S1, there are 2 quads (1 is occluded); for S2, there is 2 quads. |
| ASSERT_EQ(3U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(2U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(2U, frame.renderPasses[1]->quad_list.size()); |
| EXPECT_EQ(2U, frame.renderPasses[2]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // "Unocclude" surface S1 and repeat draw. |
| // Must remove S2's render pass since it's cached; |
| // Must keep S1 quads because texture contained external occlusion. |
| gfx::Transform transform = layerS2Ptr->transform(); |
| transform.Translate(150, 150); |
| layerS2Ptr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 2 render passes. |
| // For Root, there are 2 quads |
| // For S1, the number of quads depends on what got unoccluded, so not asserted beyond being positive. |
| // For S2, there is no render pass |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| EXPECT_GT(frame.renderPasses[0]->quad_list.size(), 0U); |
| EXPECT_EQ(2U, frame.renderPasses[1]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // "Re-occlude" surface S1 and repeat draw. |
| // Must remove S1's render pass since it is now available in full. |
| // S2 has no change so must also be removed. |
| transform = layerS2Ptr->transform(); |
| transform.Translate(-15, -15); |
| layerS2Ptr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 1 render pass - for the root. |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(2U, frame.renderPasses[0]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| } |
| |
| TEST_P(LayerTreeHostImplTest, textureCachingWithOcclusionEarlyOut) |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| // Layers are structure as follows: |
| // |
| // R +-- S1 +- L10 (owning, non drawing) |
| // | +- L11 (corner, unoccluded) |
| // | +- L12 (corner, unoccluded) |
| // | +- L13 (corner, unoccluded) |
| // | +- L14 (corner, entirely occluded) |
| // | |
| // +-- S2 +- L20 (owning, drawing) |
| // |
| |
| LayerImpl* rootPtr; |
| LayerImpl* layerS1Ptr; |
| LayerImpl* layerS2Ptr; |
| |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapContext)).PassAs<OutputSurface>(); |
| |
| gfx::Size rootSize(1000, 1000); |
| |
| myHostImpl->initializeRenderer(outputSurface.Pass()); |
| myHostImpl->setViewportSize(gfx::Size(rootSize.width(), rootSize.height()), gfx::Size(rootSize.width(), rootSize.height())); |
| |
| scoped_ptr<LayerImpl> root = LayerImpl::create(myHostImpl->activeTree(), 1); |
| rootPtr = root.get(); |
| |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(0, 0)); |
| root->setBounds(rootSize); |
| root->setContentBounds(rootSize); |
| root->setDrawsContent(true); |
| root->setMasksToBounds(true); |
| myHostImpl->setRootLayer(root.Pass()); |
| |
| addDrawingLayerTo(rootPtr, 2, gfx::Rect(0, 0, 800, 800), &layerS1Ptr); |
| layerS1Ptr->setForceRenderSurface(true); |
| layerS1Ptr->setDrawsContent(false); |
| |
| addDrawingLayerTo(layerS1Ptr, 3, gfx::Rect(0, 0, 300, 300), 0); // L11 |
| addDrawingLayerTo(layerS1Ptr, 4, gfx::Rect(0, 500, 300, 300), 0); // L12 |
| addDrawingLayerTo(layerS1Ptr, 5, gfx::Rect(500, 0, 300, 300), 0); // L13 |
| addDrawingLayerTo(layerS1Ptr, 6, gfx::Rect(500, 500, 300, 300), 0); // L14 |
| addDrawingLayerTo(layerS1Ptr, 9, gfx::Rect(500, 500, 300, 300), 0); // L14 |
| |
| addDrawingLayerTo(rootPtr, 7, gfx::Rect(450, 450, 450, 450), &layerS2Ptr); |
| layerS2Ptr->setForceRenderSurface(true); |
| |
| // Initial draw - must receive all quads |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 3 render passes. |
| // For Root, there are 2 quads; for S1, there are 3 quads; for S2, there is 1 quad. |
| ASSERT_EQ(3U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| |
| // L14 is culled, so only 3 quads. |
| EXPECT_EQ(3U, frame.renderPasses[1]->quad_list.size()); |
| EXPECT_EQ(2U, frame.renderPasses[2]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // "Unocclude" surface S1 and repeat draw. |
| // Must remove S2's render pass since it's cached; |
| // Must keep S1 quads because texture contained external occlusion. |
| gfx::Transform transform = layerS2Ptr->transform(); |
| transform.Translate(100, 100); |
| layerS2Ptr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 2 render passes. |
| // For Root, there are 2 quads |
| // For S1, the number of quads depends on what got unoccluded, so not asserted beyond being positive. |
| // For S2, there is no render pass |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| EXPECT_GT(frame.renderPasses[0]->quad_list.size(), 0U); |
| EXPECT_EQ(2U, frame.renderPasses[1]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // "Re-occlude" surface S1 and repeat draw. |
| // Must remove S1's render pass since it is now available in full. |
| // S2 has no change so must also be removed. |
| transform = layerS2Ptr->transform(); |
| transform.Translate(-15, -15); |
| layerS2Ptr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 1 render pass - for the root. |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(2U, frame.renderPasses[0]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, textureCachingWithOcclusionExternalOverInternal) |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| // Layers are structured as follows: |
| // |
| // R +-- S1 +- L10 (owning, drawing) |
| // | +- L11 (corner, occluded by L12) |
| // | +- L12 (opposite corner) |
| // | |
| // +-- S2 +- L20 (owning, drawing) |
| // |
| |
| LayerImpl* rootPtr; |
| LayerImpl* layerS1Ptr; |
| LayerImpl* layerS2Ptr; |
| |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapContext)).PassAs<OutputSurface>(); |
| |
| gfx::Size rootSize(1000, 1000); |
| |
| myHostImpl->initializeRenderer(outputSurface.Pass()); |
| myHostImpl->setViewportSize(gfx::Size(rootSize.width(), rootSize.height()), gfx::Size(rootSize.width(), rootSize.height())); |
| |
| scoped_ptr<LayerImpl> root = LayerImpl::create(myHostImpl->activeTree(), 1); |
| rootPtr = root.get(); |
| |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(0, 0)); |
| root->setBounds(rootSize); |
| root->setContentBounds(rootSize); |
| root->setDrawsContent(true); |
| root->setMasksToBounds(true); |
| myHostImpl->setRootLayer(root.Pass()); |
| |
| addDrawingLayerTo(rootPtr, 2, gfx::Rect(0, 0, 400, 400), &layerS1Ptr); |
| layerS1Ptr->setForceRenderSurface(true); |
| |
| addDrawingLayerTo(layerS1Ptr, 3, gfx::Rect(0, 0, 300, 300), 0); // L11 |
| addDrawingLayerTo(layerS1Ptr, 4, gfx::Rect(100, 0, 300, 300), 0); // L12 |
| |
| addDrawingLayerTo(rootPtr, 7, gfx::Rect(200, 0, 300, 300), &layerS2Ptr); |
| layerS2Ptr->setForceRenderSurface(true); |
| |
| // Initial draw - must receive all quads |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 3 render passes. |
| // For Root, there are 2 quads; for S1, there are 3 quads; for S2, there is 1 quad. |
| ASSERT_EQ(3U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(3U, frame.renderPasses[1]->quad_list.size()); |
| EXPECT_EQ(2U, frame.renderPasses[2]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // "Unocclude" surface S1 and repeat draw. |
| // Must remove S2's render pass since it's cached; |
| // Must keep S1 quads because texture contained external occlusion. |
| gfx::Transform transform = layerS2Ptr->transform(); |
| transform.Translate(300, 0); |
| layerS2Ptr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 2 render passes. |
| // For Root, there are 2 quads |
| // For S1, the number of quads depends on what got unoccluded, so not asserted beyond being positive. |
| // For S2, there is no render pass |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| EXPECT_GT(frame.renderPasses[0]->quad_list.size(), 0U); |
| EXPECT_EQ(2U, frame.renderPasses[1]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, textureCachingWithOcclusionExternalNotAligned) |
| { |
| LayerTreeSettings settings; |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| // Layers are structured as follows: |
| // |
| // R +-- S1 +- L10 (rotated, drawing) |
| // +- L11 (occupies half surface) |
| |
| LayerImpl* rootPtr; |
| LayerImpl* layerS1Ptr; |
| |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapContext)).PassAs<OutputSurface>(); |
| |
| gfx::Size rootSize(1000, 1000); |
| |
| myHostImpl->initializeRenderer(outputSurface.Pass()); |
| myHostImpl->setViewportSize(gfx::Size(rootSize.width(), rootSize.height()), gfx::Size(rootSize.width(), rootSize.height())); |
| |
| scoped_ptr<LayerImpl> root = LayerImpl::create(myHostImpl->activeTree(), 1); |
| rootPtr = root.get(); |
| |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(0, 0)); |
| root->setBounds(rootSize); |
| root->setContentBounds(rootSize); |
| root->setDrawsContent(true); |
| root->setMasksToBounds(true); |
| myHostImpl->setRootLayer(root.Pass()); |
| |
| addDrawingLayerTo(rootPtr, 2, gfx::Rect(0, 0, 400, 400), &layerS1Ptr); |
| layerS1Ptr->setForceRenderSurface(true); |
| gfx::Transform transform = layerS1Ptr->transform(); |
| transform.Translate(200, 200); |
| transform.Rotate(45); |
| transform.Translate(-200, -200); |
| layerS1Ptr->setTransform(transform); |
| |
| addDrawingLayerTo(layerS1Ptr, 3, gfx::Rect(200, 0, 200, 400), 0); // L11 |
| |
| // Initial draw - must receive all quads |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 2 render passes. |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(2U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(1U, frame.renderPasses[1]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change opacity and draw. Verify we used cached texture. |
| layerS1Ptr->setOpacity(0.2f); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // One render pass must be gone due to cached texture. |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, textureCachingWithOcclusionPartialSwap) |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| settings.partialSwapEnabled = true; |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| // Layers are structure as follows: |
| // |
| // R +-- S1 +- L10 (owning) |
| // | +- L11 |
| // | +- L12 |
| // | |
| // +-- S2 +- L20 (owning) |
| // +- L21 |
| // |
| // Occlusion: |
| // L12 occludes L11 (internal) |
| // L20 occludes L10 (external) |
| // L21 occludes L20 (internal) |
| |
| LayerImpl* rootPtr; |
| LayerImpl* layerS1Ptr; |
| LayerImpl* layerS2Ptr; |
| |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapContext)).PassAs<OutputSurface>(); |
| |
| gfx::Size rootSize(1000, 1000); |
| |
| myHostImpl->initializeRenderer(outputSurface.Pass()); |
| myHostImpl->setViewportSize(gfx::Size(rootSize.width(), rootSize.height()), gfx::Size(rootSize.width(), rootSize.height())); |
| |
| scoped_ptr<LayerImpl> root = LayerImpl::create(myHostImpl->activeTree(), 1); |
| rootPtr = root.get(); |
| |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(0, 0)); |
| root->setBounds(rootSize); |
| root->setContentBounds(rootSize); |
| root->setDrawsContent(true); |
| root->setMasksToBounds(true); |
| myHostImpl->setRootLayer(root.Pass()); |
| |
| addDrawingLayerTo(rootPtr, 2, gfx::Rect(300, 300, 300, 300), &layerS1Ptr); |
| layerS1Ptr->setForceRenderSurface(true); |
| |
| addDrawingLayerTo(layerS1Ptr, 3, gfx::Rect(10, 10, 10, 10), 0); // L11 |
| addDrawingLayerTo(layerS1Ptr, 4, gfx::Rect(0, 0, 30, 30), 0); // L12 |
| |
| addDrawingLayerTo(rootPtr, 5, gfx::Rect(550, 250, 300, 400), &layerS2Ptr); |
| layerS2Ptr->setForceRenderSurface(true); |
| |
| addDrawingLayerTo(layerS2Ptr, 6, gfx::Rect(20, 20, 5, 5), 0); // L21 |
| |
| // Initial draw - must receive all quads |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 3 render passes. |
| // For Root, there are 2 quads; for S1, there are 2 quads (one is occluded); for S2, there is 2 quads. |
| ASSERT_EQ(3U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(2U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(2U, frame.renderPasses[1]->quad_list.size()); |
| EXPECT_EQ(2U, frame.renderPasses[2]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // "Unocclude" surface S1 and repeat draw. |
| // Must remove S2's render pass since it's cached; |
| // Must keep S1 quads because texture contained external occlusion. |
| gfx::Transform transform = layerS2Ptr->transform(); |
| transform.Translate(150, 150); |
| layerS2Ptr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive 2 render passes. |
| // For Root, there are 2 quads. |
| // For S1, there are 2 quads. |
| // For S2, there is no render pass |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(2U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(2U, frame.renderPasses[1]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // "Re-occlude" surface S1 and repeat draw. |
| // Must remove S1's render pass since it is now available in full. |
| // S2 has no change so must also be removed. |
| transform = layerS2Ptr->transform(); |
| transform.Translate(-15, -15); |
| layerS2Ptr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Root render pass only. |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, textureCachingWithScissor) |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| /* |
| Layers are created as follows: |
| |
| +--------------------+ |
| | 1 | |
| | +-----------+ | |
| | | 2 | | |
| | | +-------------------+ |
| | | | 3 | |
| | | +-------------------+ |
| | | | | |
| | +-----------+ | |
| | | |
| | | |
| +--------------------+ |
| |
| Layers 1, 2 have render surfaces |
| */ |
| scoped_ptr<LayerImpl> root = LayerImpl::create(myHostImpl->activeTree(), 1); |
| scoped_ptr<TiledLayerImpl> child = TiledLayerImpl::create(myHostImpl->activeTree(), 2); |
| scoped_ptr<LayerImpl> grandChild = LayerImpl::create(myHostImpl->activeTree(), 3); |
| |
| gfx::Rect rootRect(0, 0, 100, 100); |
| gfx::Rect childRect(10, 10, 50, 50); |
| gfx::Rect grandChildRect(5, 5, 150, 150); |
| |
| scoped_ptr<OutputSurface> outputSurface = FakeOutputSurface::Create3d(scoped_ptr<WebKit::WebGraphicsContext3D>(new PartialSwapContext)).PassAs<OutputSurface>(); |
| myHostImpl->initializeRenderer(outputSurface.Pass()); |
| |
| root->setAnchorPoint(gfx::PointF(0, 0)); |
| root->setPosition(gfx::PointF(rootRect.x(), rootRect.y())); |
| root->setBounds(gfx::Size(rootRect.width(), rootRect.height())); |
| root->setContentBounds(root->bounds()); |
| root->setDrawsContent(true); |
| root->setMasksToBounds(true); |
| |
| child->setAnchorPoint(gfx::PointF(0, 0)); |
| child->setPosition(gfx::PointF(childRect.x(), childRect.y())); |
| child->setOpacity(0.5); |
| child->setBounds(gfx::Size(childRect.width(), childRect.height())); |
| child->setContentBounds(child->bounds()); |
| child->setDrawsContent(true); |
| child->setSkipsDraw(false); |
| |
| // child layer has 10x10 tiles. |
| scoped_ptr<LayerTilingData> tiler = LayerTilingData::create(gfx::Size(10, 10), LayerTilingData::HasBorderTexels); |
| tiler->setBounds(child->contentBounds()); |
| child->setTilingData(*tiler.get()); |
| |
| grandChild->setAnchorPoint(gfx::PointF(0, 0)); |
| grandChild->setPosition(gfx::Point(grandChildRect.x(), grandChildRect.y())); |
| grandChild->setBounds(gfx::Size(grandChildRect.width(), grandChildRect.height())); |
| grandChild->setContentBounds(grandChild->bounds()); |
| grandChild->setDrawsContent(true); |
| |
| TiledLayerImpl* childPtr = child.get(); |
| RenderPass::Id childPassId(childPtr->id(), 0); |
| |
| child->addChild(grandChild.Pass()); |
| root->addChild(child.PassAs<LayerImpl>()); |
| myHostImpl->setRootLayer(root.Pass()); |
| myHostImpl->setViewportSize(rootRect.size(), rootRect.size()); |
| |
| EXPECT_FALSE(myHostImpl->renderer()->haveCachedResourcesForRenderPassId(childPassId)); |
| |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // We should have cached textures for surface 2. |
| EXPECT_TRUE(myHostImpl->renderer()->haveCachedResourcesForRenderPassId(childPassId)); |
| |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // We should still have cached textures for surface 2 after drawing with no damage. |
| EXPECT_TRUE(myHostImpl->renderer()->haveCachedResourcesForRenderPassId(childPassId)); |
| |
| // Damage a single tile of surface 2. |
| childPtr->setUpdateRect(gfx::Rect(10, 10, 10, 10)); |
| |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // We should have a cached texture for surface 2 again even though it was damaged. |
| EXPECT_TRUE(myHostImpl->renderer()->haveCachedResourcesForRenderPassId(childPassId)); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, surfaceTextureCaching) |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| settings.partialSwapEnabled = true; |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| LayerImpl* rootPtr; |
| LayerImpl* intermediateLayerPtr; |
| LayerImpl* surfaceLayerPtr; |
| LayerImpl* childPtr; |
| |
| setupLayersForTextureCaching(myHostImpl.get(), rootPtr, intermediateLayerPtr, surfaceLayerPtr, childPtr, gfx::Size(100, 100)); |
| |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive two render passes, each with one quad |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(1U, frame.renderPasses[1]->quad_list.size()); |
| |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[1]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[1]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_FALSE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Draw without any change |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive one render pass, as the other one should be culled |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_TRUE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change opacity and draw |
| surfaceLayerPtr->setOpacity(0.6f); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive one render pass, as the other one should be culled |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_TRUE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change less benign property and draw - should have contents changed flag |
| surfaceLayerPtr->setStackingOrderChanged(true); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive two render passes, each with one quad |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(DrawQuad::SOLID_COLOR, frame.renderPasses[0]->quad_list[0]->material); |
| |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[1]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[1]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_FALSE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change opacity again, and evict the cached surface texture. |
| surfaceLayerPtr->setOpacity(0.5f); |
| static_cast<GLRendererWithReleaseTextures*>(myHostImpl->renderer())->releaseRenderPassTextures(); |
| |
| // Change opacity and draw |
| surfaceLayerPtr->setOpacity(0.6f); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive two render passes |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| // Even though not enough properties changed, the entire thing must be |
| // redrawn as we don't have cached textures |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(1U, frame.renderPasses[1]->quad_list.size()); |
| |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[1]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[1]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_TRUE(targetPass->damage_rect.IsEmpty()); |
| |
| // Was our surface evicted? |
| EXPECT_FALSE(myHostImpl->renderer()->haveCachedResourcesForRenderPassId(targetPass->id)); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Draw without any change, to make sure the state is clear |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive one render pass, as the other one should be culled |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_TRUE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change location of the intermediate layer |
| gfx::Transform transform = intermediateLayerPtr->transform(); |
| transform.matrix().setDouble(0, 3, 1.0001); |
| intermediateLayerPtr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive one render pass, as the other one should be culled. |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_TRUE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, surfaceTextureCachingNoPartialSwap) |
| { |
| LayerTreeSettings settings; |
| settings.minimumOcclusionTrackingSize = gfx::Size(); |
| scoped_ptr<LayerTreeHostImpl> myHostImpl = LayerTreeHostImpl::create(settings, this, &m_proxy); |
| |
| LayerImpl* rootPtr; |
| LayerImpl* intermediateLayerPtr; |
| LayerImpl* surfaceLayerPtr; |
| LayerImpl* childPtr; |
| |
| setupLayersForTextureCaching(myHostImpl.get(), rootPtr, intermediateLayerPtr, surfaceLayerPtr, childPtr, gfx::Size(100, 100)); |
| |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive two render passes, each with one quad |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(1U, frame.renderPasses[1]->quad_list.size()); |
| |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[1]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[1]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_FALSE(targetPass->damage_rect.IsEmpty()); |
| |
| EXPECT_FALSE(frame.renderPasses[0]->damage_rect.IsEmpty()); |
| EXPECT_FALSE(frame.renderPasses[1]->damage_rect.IsEmpty()); |
| |
| EXPECT_FALSE(frame.renderPasses[0]->has_occlusion_from_outside_target_surface); |
| EXPECT_FALSE(frame.renderPasses[1]->has_occlusion_from_outside_target_surface); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Draw without any change |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Even though there was no change, we set the damage to entire viewport. |
| // One of the passes should be culled as a result, since contents didn't change |
| // and we have cached texture. |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| |
| EXPECT_TRUE(frame.renderPasses[0]->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change opacity and draw |
| surfaceLayerPtr->setOpacity(0.6f); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive one render pass, as the other one should be culled |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_TRUE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change less benign property and draw - should have contents changed flag |
| surfaceLayerPtr->setStackingOrderChanged(true); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive two render passes, each with one quad |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(DrawQuad::SOLID_COLOR, frame.renderPasses[0]->quad_list[0]->material); |
| |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[1]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[1]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_FALSE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change opacity again, and evict the cached surface texture. |
| surfaceLayerPtr->setOpacity(0.5f); |
| static_cast<GLRendererWithReleaseTextures*>(myHostImpl->renderer())->releaseRenderPassTextures(); |
| |
| // Change opacity and draw |
| surfaceLayerPtr->setOpacity(0.6f); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive two render passes |
| ASSERT_EQ(2U, frame.renderPasses.size()); |
| |
| // Even though not enough properties changed, the entire thing must be |
| // redrawn as we don't have cached textures |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| EXPECT_EQ(1U, frame.renderPasses[1]->quad_list.size()); |
| |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[1]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[1]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_TRUE(targetPass->damage_rect.IsEmpty()); |
| |
| // Was our surface evicted? |
| EXPECT_FALSE(myHostImpl->renderer()->haveCachedResourcesForRenderPassId(targetPass->id)); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Draw without any change, to make sure the state is clear |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Even though there was no change, we set the damage to entire viewport. |
| // One of the passes should be culled as a result, since contents didn't change |
| // and we have cached texture. |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| |
| // Change location of the intermediate layer |
| gfx::Transform transform = intermediateLayerPtr->transform(); |
| transform.matrix().setDouble(0, 3, 1.0001); |
| intermediateLayerPtr->setTransform(transform); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(myHostImpl->prepareToDraw(frame)); |
| |
| // Must receive one render pass, as the other one should be culled. |
| ASSERT_EQ(1U, frame.renderPasses.size()); |
| EXPECT_EQ(1U, frame.renderPasses[0]->quad_list.size()); |
| |
| EXPECT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* quad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| RenderPass* targetPass = frame.renderPassesById.get(quad->render_pass_id); |
| EXPECT_TRUE(targetPass->damage_rect.IsEmpty()); |
| |
| myHostImpl->drawLayers(frame); |
| myHostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| TEST_P(LayerTreeHostImplTest, releaseContentsTextureShouldTriggerCommit) |
| { |
| setReduceMemoryResult(false); |
| |
| // Even if changing the memory limit didn't result in anything being |
| // evicted, we need to re-commit because the new value may result in us |
| // drawing something different than before. |
| setReduceMemoryResult(false); |
| m_hostImpl->setManagedMemoryPolicy(ManagedMemoryPolicy( |
| m_hostImpl->memoryAllocationLimitBytes() - 1)); |
| EXPECT_TRUE(m_didRequestCommit); |
| m_didRequestCommit = false; |
| |
| // Especially if changing the memory limit caused evictions, we need |
| // to re-commit. |
| setReduceMemoryResult(true); |
| m_hostImpl->setManagedMemoryPolicy(ManagedMemoryPolicy( |
| m_hostImpl->memoryAllocationLimitBytes() - 1)); |
| EXPECT_TRUE(m_didRequestCommit); |
| m_didRequestCommit = false; |
| |
| // But if we set it to the same value that it was before, we shouldn't |
| // re-commit. |
| m_hostImpl->setManagedMemoryPolicy(ManagedMemoryPolicy( |
| m_hostImpl->memoryAllocationLimitBytes())); |
| EXPECT_FALSE(m_didRequestCommit); |
| } |
| |
| struct RenderPassRemovalTestData : public LayerTreeHostImpl::FrameData { |
| ScopedPtrHashMap<RenderPass::Id, TestRenderPass> renderPassCache; |
| scoped_ptr<SharedQuadState> sharedQuadState; |
| }; |
| |
| class TestRenderer : public GLRenderer, public RendererClient { |
| public: |
| static scoped_ptr<TestRenderer> create(ResourceProvider* resourceProvider, OutputSurface* outputSurface, Proxy* proxy) |
| { |
| scoped_ptr<TestRenderer> renderer(new TestRenderer(resourceProvider, outputSurface, proxy)); |
| if (!renderer->initialize()) |
| return scoped_ptr<TestRenderer>(); |
| |
| return renderer.Pass(); |
| } |
| |
| void clearCachedTextures() { m_textures.clear(); } |
| void setHaveCachedResourcesForRenderPassId(RenderPass::Id id) { m_textures.insert(id); } |
| |
| virtual bool haveCachedResourcesForRenderPassId(RenderPass::Id id) const OVERRIDE { return m_textures.count(id); } |
| |
| // RendererClient implementation. |
| virtual const gfx::Size& deviceViewportSize() const OVERRIDE { return m_viewportSize; } |
| virtual const LayerTreeSettings& settings() const OVERRIDE { return m_settings; } |
| virtual void didLoseOutputSurface() OVERRIDE { } |
| virtual void onSwapBuffersComplete() OVERRIDE { } |
| virtual void setFullRootLayerDamage() OVERRIDE { } |
| virtual void setManagedMemoryPolicy(const ManagedMemoryPolicy& policy) OVERRIDE { } |
| virtual void enforceManagedMemoryPolicy(const ManagedMemoryPolicy& policy) OVERRIDE { } |
| virtual bool hasImplThread() const OVERRIDE { return false; } |
| virtual bool shouldClearRootRenderPass() const OVERRIDE { return true; } |
| virtual CompositorFrameMetadata makeCompositorFrameMetadata() const |
| OVERRIDE { return CompositorFrameMetadata(); } |
| |
| protected: |
| TestRenderer(ResourceProvider* resourceProvider, OutputSurface* outputSurface, Proxy* proxy) : GLRenderer(this, outputSurface, resourceProvider) { } |
| |
| private: |
| LayerTreeSettings m_settings; |
| gfx::Size m_viewportSize; |
| base::hash_set<RenderPass::Id> m_textures; |
| }; |
| |
| static void configureRenderPassTestData(const char* testScript, RenderPassRemovalTestData& testData, TestRenderer* renderer) |
| { |
| renderer->clearCachedTextures(); |
| |
| // One shared state for all quads - we don't need the correct details |
| testData.sharedQuadState = SharedQuadState::Create(); |
| testData.sharedQuadState->SetAll(gfx::Transform(), gfx::Rect(), gfx::Rect(), gfx::Rect(), false, 1.0); |
| |
| const char* currentChar = testScript; |
| |
| // Pre-create root pass |
| RenderPass::Id rootRenderPassId = RenderPass::Id(testScript[0], testScript[1]); |
| scoped_ptr<TestRenderPass> pass = TestRenderPass::Create(); |
| pass->SetNew(rootRenderPassId, gfx::Rect(), gfx::Rect(), gfx::Transform()); |
| testData.renderPassCache.add(rootRenderPassId, pass.Pass()); |
| while (*currentChar) { |
| int layerId = *currentChar; |
| currentChar++; |
| ASSERT_TRUE(currentChar); |
| int index = *currentChar; |
| currentChar++; |
| |
| RenderPass::Id renderPassId = RenderPass::Id(layerId, index); |
| |
| bool isReplica = false; |
| if (!testData.renderPassCache.contains(renderPassId)) |
| isReplica = true; |
| |
| scoped_ptr<TestRenderPass> renderPass = testData.renderPassCache.take(renderPassId); |
| |
| // Cycle through quad data and create all quads |
| while (*currentChar && *currentChar != '\n') { |
| if (*currentChar == 's') { |
| // Solid color draw quad |
| scoped_ptr<SolidColorDrawQuad> quad = SolidColorDrawQuad::Create(); |
| quad->SetNew(testData.sharedQuadState.get(), gfx::Rect(0, 0, 10, 10), SK_ColorWHITE); |
| |
| renderPass->AppendQuad(quad.PassAs<DrawQuad>()); |
| currentChar++; |
| } else if ((*currentChar >= 'A') && (*currentChar <= 'Z')) { |
| // RenderPass draw quad |
| int layerId = *currentChar; |
| currentChar++; |
| ASSERT_TRUE(currentChar); |
| int index = *currentChar; |
| currentChar++; |
| RenderPass::Id newRenderPassId = RenderPass::Id(layerId, index); |
| ASSERT_NE(rootRenderPassId, newRenderPassId); |
| bool hasTexture = false; |
| bool contentsChanged = true; |
| |
| if (*currentChar == '[') { |
| currentChar++; |
| while (*currentChar && *currentChar != ']') { |
| switch (*currentChar) { |
| case 'c': |
| contentsChanged = false; |
| break; |
| case 't': |
| hasTexture = true; |
| break; |
| } |
| currentChar++; |
| } |
| if (*currentChar == ']') |
| currentChar++; |
| } |
| |
| if (testData.renderPassCache.find(newRenderPassId) == testData.renderPassCache.end()) { |
| if (hasTexture) |
| renderer->setHaveCachedResourcesForRenderPassId(newRenderPassId); |
| |
| scoped_ptr<TestRenderPass> pass = TestRenderPass::Create(); |
| pass->SetNew(newRenderPassId, gfx::Rect(), gfx::Rect(), gfx::Transform()); |
| testData.renderPassCache.add(newRenderPassId, pass.Pass()); |
| } |
| |
| gfx::Rect quadRect = gfx::Rect(0, 0, 1, 1); |
| gfx::Rect contentsChangedRect = contentsChanged ? quadRect : gfx::Rect(); |
| scoped_ptr<RenderPassDrawQuad> quad = RenderPassDrawQuad::Create(); |
| quad->SetNew(testData.sharedQuadState.get(), quadRect, newRenderPassId, isReplica, 1, contentsChangedRect, gfx::RectF(0, 0, 1, 1)); |
| renderPass->AppendQuad(quad.PassAs<DrawQuad>()); |
| } |
| } |
| testData.renderPasses.insert(testData.renderPasses.begin(), renderPass.get()); |
| testData.renderPassesById.add(renderPassId, renderPass.PassAs<RenderPass>()); |
| if (*currentChar) |
| currentChar++; |
| } |
| } |
| |
| void dumpRenderPassTestData(const RenderPassRemovalTestData& testData, char* buffer) |
| { |
| char* pos = buffer; |
| for (RenderPassList::const_reverse_iterator it = testData.renderPasses.rbegin(); it != testData.renderPasses.rend(); ++it) { |
| const RenderPass* currentPass = *it; |
| *pos = currentPass->id.layer_id; |
| pos++; |
| *pos = currentPass->id.index; |
| pos++; |
| |
| QuadList::const_iterator quadListIterator = currentPass->quad_list.begin(); |
| while (quadListIterator != currentPass->quad_list.end()) { |
| DrawQuad* currentQuad = *quadListIterator; |
| switch (currentQuad->material) { |
| case DrawQuad::SOLID_COLOR: |
| *pos = 's'; |
| pos++; |
| break; |
| case DrawQuad::RENDER_PASS: |
| *pos = RenderPassDrawQuad::MaterialCast(currentQuad)->render_pass_id.layer_id; |
| pos++; |
| *pos = RenderPassDrawQuad::MaterialCast(currentQuad)->render_pass_id.index; |
| pos++; |
| break; |
| default: |
| *pos = 'x'; |
| pos++; |
| break; |
| } |
| |
| quadListIterator++; |
| } |
| *pos = '\n'; |
| pos++; |
| } |
| *pos = '\0'; |
| } |
| |
| // Each RenderPassList is represented by a string which describes the configuration. |
| // The syntax of the string is as follows: |
| // |
| // RsssssX[c]ssYsssZ[t]ssW[ct] |
| // Identifies the render pass---------------------------^ ^^^ ^ ^ ^ ^ ^ |
| // These are solid color quads-----------------------------+ | | | | | |
| // Identifies RenderPassDrawQuad's RenderPass-----------------+ | | | | |
| // This quad's contents didn't change---------------------------+ | | | |
| // This quad's contents changed and it has no texture---------------+ | | |
| // This quad has texture but its contents changed-------------------------+ | |
| // This quad's contents didn't change and it has texture - will be removed------+ |
| // |
| // Expected results have exactly the same syntax, except they do not use square brackets, |
| // since we only check the structure, not attributes. |
| // |
| // Test case configuration consists of initialization script and expected results, |
| // all in the same format. |
| struct TestCase { |
| const char* name; |
| const char* initScript; |
| const char* expectedResult; |
| }; |
| |
| TestCase removeRenderPassesCases[] = |
| { |
| { |
| "Single root pass", |
| "R0ssss\n", |
| "R0ssss\n" |
| }, { |
| "Single pass - no quads", |
| "R0\n", |
| "R0\n" |
| }, { |
| "Two passes, no removal", |
| "R0ssssA0sss\n" |
| "A0ssss\n", |
| "R0ssssA0sss\n" |
| "A0ssss\n" |
| }, { |
| "Two passes, remove last", |
| "R0ssssA0[ct]sss\n" |
| "A0ssss\n", |
| "R0ssssA0sss\n" |
| }, { |
| "Have texture but contents changed - leave pass", |
| "R0ssssA0[t]sss\n" |
| "A0ssss\n", |
| "R0ssssA0sss\n" |
| "A0ssss\n" |
| }, { |
| "Contents didn't change but no texture - leave pass", |
| "R0ssssA0[c]sss\n" |
| "A0ssss\n", |
| "R0ssssA0sss\n" |
| "A0ssss\n" |
| }, { |
| "Replica: two quads reference the same pass; remove", |
| "R0ssssA0[ct]A0[ct]sss\n" |
| "A0ssss\n", |
| "R0ssssA0A0sss\n" |
| }, { |
| "Replica: two quads reference the same pass; leave", |
| "R0ssssA0[c]A0[c]sss\n" |
| "A0ssss\n", |
| "R0ssssA0A0sss\n" |
| "A0ssss\n", |
| }, { |
| "Many passes, remove all", |
| "R0ssssA0[ct]sss\n" |
| "A0sssB0[ct]C0[ct]s\n" |
| "B0sssD0[ct]ssE0[ct]F0[ct]\n" |
| "E0ssssss\n" |
| "C0G0[ct]\n" |
| "D0sssssss\n" |
| "F0sssssss\n" |
| "G0sss\n", |
| |
| "R0ssssA0sss\n" |
| }, { |
| "Deep recursion, remove all", |
| |
| "R0sssssA0[ct]ssss\n" |
| "A0ssssB0sss\n" |
| "B0C0\n" |
| "C0D0\n" |
| "D0E0\n" |
| "E0F0\n" |
| "F0G0\n" |
| "G0H0\n" |
| "H0sssI0sss\n" |
| "I0J0\n" |
| "J0ssss\n", |
| |
| "R0sssssA0ssss\n" |
| }, { |
| "Wide recursion, remove all", |
| "R0A0[ct]B0[ct]C0[ct]D0[ct]E0[ct]F0[ct]G0[ct]H0[ct]I0[ct]J0[ct]\n" |
| "A0s\n" |
| "B0s\n" |
| "C0ssss\n" |
| "D0ssss\n" |
| "E0s\n" |
| "F0\n" |
| "G0s\n" |
| "H0s\n" |
| "I0s\n" |
| "J0ssss\n", |
| |
| "R0A0B0C0D0E0F0G0H0I0J0\n" |
| }, { |
| "Remove passes regardless of cache state", |
| "R0ssssA0[ct]sss\n" |
| "A0sssB0C0s\n" |
| "B0sssD0[c]ssE0[t]F0\n" |
| "E0ssssss\n" |
| "C0G0\n" |
| "D0sssssss\n" |
| "F0sssssss\n" |
| "G0sss\n", |
| |
| "R0ssssA0sss\n" |
| }, { |
| "Leave some passes, remove others", |
| |
| "R0ssssA0[c]sss\n" |
| "A0sssB0[t]C0[ct]s\n" |
| "B0sssD0[c]ss\n" |
| "C0G0\n" |
| "D0sssssss\n" |
| "G0sss\n", |
| |
| "R0ssssA0sss\n" |
| "A0sssB0C0s\n" |
| "B0sssD0ss\n" |
| "D0sssssss\n" |
| }, { |
| 0, 0, 0 |
| } |
| }; |
| |
| static void verifyRenderPassTestData(TestCase& testCase, RenderPassRemovalTestData& testData) |
| { |
| char actualResult[1024]; |
| dumpRenderPassTestData(testData, actualResult); |
| EXPECT_STREQ(testCase.expectedResult, actualResult) << "In test case: " << testCase.name; |
| } |
| |
| TEST_P(LayerTreeHostImplTest, testRemoveRenderPasses) |
| { |
| scoped_ptr<OutputSurface> outputSurface(createOutputSurface()); |
| ASSERT_TRUE(outputSurface->Context3D()); |
| scoped_ptr<ResourceProvider> resourceProvider(ResourceProvider::create(outputSurface.get())); |
| |
| scoped_ptr<TestRenderer> renderer(TestRenderer::create(resourceProvider.get(), outputSurface.get(), &m_proxy)); |
| |
| int testCaseIndex = 0; |
| while (removeRenderPassesCases[testCaseIndex].name) { |
| RenderPassRemovalTestData testData; |
| configureRenderPassTestData(removeRenderPassesCases[testCaseIndex].initScript, testData, renderer.get()); |
| LayerTreeHostImpl::removeRenderPasses(LayerTreeHostImpl::CullRenderPassesWithCachedTextures(*renderer), testData); |
| verifyRenderPassTestData(removeRenderPassesCases[testCaseIndex], testData); |
| testCaseIndex++; |
| } |
| } |
| |
| // Make sure that scrolls that only pan the pinch viewport, and not the document, |
| // still force redraw/commit. |
| void LayerTreeHostImplTest::pinchZoomPanViewportForcesCommitRedraw(const float deviceScaleFactor) |
| { |
| m_hostImpl->setDeviceScaleFactor(deviceScaleFactor); |
| |
| gfx::Size layoutSurfaceSize(10, 20); |
| gfx::Size deviceSurfaceSize(layoutSurfaceSize.width() * static_cast<int>(deviceScaleFactor), |
| layoutSurfaceSize.height() * static_cast<int>(deviceScaleFactor)); |
| float pageScale = 2; |
| scoped_ptr<LayerImpl> root = createScrollableLayer(1, layoutSurfaceSize); |
| // For this test we want to force scrolls to only pan the pinchZoomViewport |
| // and not the document, we can verify commit/redraw are requested. |
| root->setMaxScrollOffset(gfx::Vector2d()); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(layoutSurfaceSize, deviceSurfaceSize); |
| m_hostImpl->setPageScaleFactorAndLimits(1, 1, pageScale); |
| initializeRendererAndDrawFrame(); |
| |
| // Set new page scale on impl thread by pinching. |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScale, gfx::Point()); |
| m_hostImpl->pinchGestureEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| gfx::Transform expectedImplTransform; |
| expectedImplTransform.Scale(pageScale, pageScale); |
| |
| // Verify the pinch zoom took place. |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| |
| // The implTransform ignores the scroll if !pageScalePinchZoomEnabled, |
| // so no point in continuing without it. |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) |
| return; |
| |
| m_didRequestCommit = false; |
| m_didRequestRedraw = false; |
| |
| // This scroll will force the viewport to pan horizontally. |
| gfx::Vector2d scrollDelta(5, 0); |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| EXPECT_EQ(true, m_didRequestCommit); |
| EXPECT_EQ(true, m_didRequestRedraw); |
| |
| m_didRequestCommit = false; |
| m_didRequestRedraw = false; |
| |
| // This scroll will force the viewport to pan vertically. |
| scrollDelta = gfx::Vector2d(0, 5); |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| |
| EXPECT_EQ(true, m_didRequestCommit); |
| EXPECT_EQ(true, m_didRequestRedraw); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchZoomPanViewportForcesCommitDeviceScaleFactor1) |
| { |
| pinchZoomPanViewportForcesCommitRedraw(1); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchZoomPanViewportForcesCommitDeviceScaleFactor2) |
| { |
| pinchZoomPanViewportForcesCommitRedraw(2); |
| } |
| |
| // The following test confirms correct operation of scroll of the pinchZoomViewport. |
| // The device scale factor directly affects computation of the implTransform, so |
| // we test the two most common use cases. |
| void LayerTreeHostImplTest::pinchZoomPanViewportTest(const float deviceScaleFactor) |
| { |
| m_hostImpl->setDeviceScaleFactor(deviceScaleFactor); |
| |
| gfx::Size layoutSurfaceSize(10, 20); |
| gfx::Size deviceSurfaceSize(layoutSurfaceSize.width() * static_cast<int>(deviceScaleFactor), |
| layoutSurfaceSize.height() * static_cast<int>(deviceScaleFactor)); |
| float pageScale = 2; |
| scoped_ptr<LayerImpl> root = createScrollableLayer(1, layoutSurfaceSize); |
| // For this test we want to force scrolls to move the pinchZoomViewport so |
| // we can see the scroll component on the implTransform. |
| root->setMaxScrollOffset(gfx::Vector2d()); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(layoutSurfaceSize, deviceSurfaceSize); |
| m_hostImpl->setPageScaleFactorAndLimits(1, 1, pageScale); |
| initializeRendererAndDrawFrame(); |
| |
| // Set new page scale on impl thread by pinching. |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScale, gfx::Point()); |
| m_hostImpl->pinchGestureEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| gfx::Transform expectedImplTransform; |
| expectedImplTransform.Scale(pageScale, pageScale); |
| |
| EXPECT_EQ(m_hostImpl->rootLayer()->implTransform(), expectedImplTransform); |
| |
| // The implTransform ignores the scroll if !pageScalePinchZoomEnabled, |
| // so no point in continuing without it. |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) |
| return; |
| |
| gfx::Vector2d scrollDelta(5, 0); |
| gfx::Vector2d expectedMaxScroll(m_hostImpl->rootLayer()->maxScrollOffset()); |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| gfx::Vector2dF expectedTranslation = gfx::ScaleVector2d(scrollDelta, m_hostImpl->deviceScaleFactor()); |
| expectedImplTransform.Translate(-expectedTranslation.x(), -expectedTranslation.y()); |
| |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| // No change expected. |
| EXPECT_EQ(expectedMaxScroll, m_hostImpl->rootLayer()->maxScrollOffset()); |
| // None of the scroll delta should have been used for document scroll. |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectNone(*scrollInfo.get(), m_hostImpl->rootLayer()->id()); |
| |
| // Test scroll in y-direction also. |
| scrollDelta = gfx::Vector2d(0, 5); |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| expectedTranslation = gfx::ScaleVector2d(scrollDelta, m_hostImpl->deviceScaleFactor()); |
| expectedImplTransform.Translate(-expectedTranslation.x(), -expectedTranslation.y()); |
| |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| // No change expected. |
| EXPECT_EQ(expectedMaxScroll, m_hostImpl->rootLayer()->maxScrollOffset()); |
| // None of the scroll delta should have been used for document scroll. |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectNone(*scrollInfo.get(), m_hostImpl->rootLayer()->id()); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchZoomPanViewportWithDeviceScaleFactor1) |
| { |
| pinchZoomPanViewportTest(1); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchZoomPanViewportWithDeviceScaleFactor2) |
| { |
| pinchZoomPanViewportTest(2); |
| } |
| |
| // This test verifies the correct behaviour of the document-then-pinchZoomViewport |
| // scrolling model, in both x- and y-directions. |
| void LayerTreeHostImplTest::pinchZoomPanViewportAndScrollTest(const float deviceScaleFactor) |
| { |
| m_hostImpl->setDeviceScaleFactor(deviceScaleFactor); |
| |
| gfx::Size layoutSurfaceSize(10, 20); |
| gfx::Size deviceSurfaceSize(layoutSurfaceSize.width() * static_cast<int>(deviceScaleFactor), |
| layoutSurfaceSize.height() * static_cast<int>(deviceScaleFactor)); |
| float pageScale = 2; |
| scoped_ptr<LayerImpl> root = createScrollableLayer(1, layoutSurfaceSize); |
| // For this test we want to scrolls to move both the document and the |
| // pinchZoomViewport so we can see some scroll component on the implTransform. |
| root->setMaxScrollOffset(gfx::Vector2d(3, 4)); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(layoutSurfaceSize, deviceSurfaceSize); |
| m_hostImpl->setPageScaleFactorAndLimits(1, 1, pageScale); |
| initializeRendererAndDrawFrame(); |
| |
| // Set new page scale on impl thread by pinching. |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScale, gfx::Point()); |
| m_hostImpl->pinchGestureEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| gfx::Transform expectedImplTransform; |
| expectedImplTransform.Scale(pageScale, pageScale); |
| |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| |
| // The implTransform ignores the scroll if !pageScalePinchZoomEnabled, |
| // so no point in continuing without it. |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) |
| return; |
| |
| // Scroll document only: scrollDelta chosen to move document horizontally |
| // to its max scroll offset. |
| gfx::Vector2d scrollDelta(3, 0); |
| gfx::Vector2d expectedScrollDelta(scrollDelta); |
| gfx::Vector2d expectedMaxScroll(m_hostImpl->rootLayer()->maxScrollOffset()); |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| // The scroll delta is not scaled because the main thread did not scale. |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedScrollDelta); |
| EXPECT_EQ(expectedMaxScroll, m_hostImpl->rootLayer()->maxScrollOffset()); |
| |
| // Verify we did not change the implTransform this time. |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| |
| // Further scrolling should move the pinchZoomViewport only. |
| scrollDelta = gfx::Vector2d(2, 0); |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| gfx::Vector2d expectedPanDelta(scrollDelta); |
| gfx::Vector2dF expectedTranslation = gfx::ScaleVector2d(expectedPanDelta, m_hostImpl->deviceScaleFactor()); |
| expectedImplTransform.Translate(-expectedTranslation.x(), -expectedTranslation.y()); |
| |
| EXPECT_EQ(m_hostImpl->rootLayer()->implTransform(), expectedImplTransform); |
| |
| // The scroll delta on the main thread should not have been affected by this. |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedScrollDelta); |
| EXPECT_EQ(expectedMaxScroll, m_hostImpl->rootLayer()->maxScrollOffset()); |
| |
| // Perform same test sequence in y-direction also. |
| // Document only scroll. |
| scrollDelta = gfx::Vector2d(0, 4); |
| expectedScrollDelta += scrollDelta; |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| // The scroll delta is not scaled because the main thread did not scale. |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedScrollDelta); |
| EXPECT_EQ(expectedMaxScroll, m_hostImpl->rootLayer()->maxScrollOffset()); |
| |
| // Verify we did not change the implTransform this time. |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| |
| // pinchZoomViewport scroll only. |
| scrollDelta = gfx::Vector2d(0, 1); |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| expectedPanDelta = scrollDelta; |
| expectedTranslation = gfx::ScaleVector2d(expectedPanDelta, m_hostImpl->deviceScaleFactor()); |
| expectedImplTransform.Translate(-expectedTranslation.x(), -expectedTranslation.y()); |
| |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| |
| // The scroll delta on the main thread should not have been affected by this. |
| scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedScrollDelta); |
| EXPECT_EQ(expectedMaxScroll, m_hostImpl->rootLayer()->maxScrollOffset()); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchZoomPanViewportAndScrollWithDeviceScaleFactor) |
| { |
| pinchZoomPanViewportAndScrollTest(1); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchZoomPanViewportAndScrollWithDeviceScaleFactor2) |
| { |
| pinchZoomPanViewportAndScrollTest(2); |
| } |
| |
| // This test verifies the correct behaviour of the document-then-pinchZoomViewport |
| // scrolling model, in both x- and y-directions, but this time using a single scroll |
| // that crosses the 'boundary' of what will cause document-only scroll and what will |
| // cause both document-scroll and zoomViewport panning. |
| void LayerTreeHostImplTest::pinchZoomPanViewportAndScrollBoundaryTest(const float deviceScaleFactor) |
| { |
| m_hostImpl->setDeviceScaleFactor(deviceScaleFactor); |
| |
| gfx::Size layoutSurfaceSize(10, 20); |
| gfx::Size deviceSurfaceSize(layoutSurfaceSize.width() * static_cast<int>(deviceScaleFactor), |
| layoutSurfaceSize.height() * static_cast<int>(deviceScaleFactor)); |
| float pageScale = 2; |
| scoped_ptr<LayerImpl> root = createScrollableLayer(1, layoutSurfaceSize); |
| // For this test we want to scrolls to move both the document and the |
| // pinchZoomViewport so we can see some scroll component on the implTransform. |
| root->setMaxScrollOffset(gfx::Vector2d(3, 4)); |
| m_hostImpl->setRootLayer(root.Pass()); |
| m_hostImpl->setViewportSize(layoutSurfaceSize, deviceSurfaceSize); |
| m_hostImpl->setPageScaleFactorAndLimits(1, 1, pageScale); |
| initializeRendererAndDrawFrame(); |
| |
| // Set new page scale on impl thread by pinching. |
| m_hostImpl->pinchGestureBegin(); |
| m_hostImpl->pinchGestureUpdate(pageScale, gfx::Point()); |
| m_hostImpl->pinchGestureEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| gfx::Transform expectedImplTransform; |
| expectedImplTransform.Scale(pageScale, pageScale); |
| |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| |
| // The implTransform ignores the scroll if !pageScalePinchZoomEnabled, |
| // so no point in continuing without it. |
| if (!m_hostImpl->settings().pageScalePinchZoomEnabled) |
| return; |
| |
| // Scroll document and pann zoomViewport in one scroll-delta. |
| gfx::Vector2d scrollDelta(5, 0); |
| gfx::Vector2d expectedScrollDelta(gfx::Vector2d(3, 0)); // This component gets handled by document scroll. |
| gfx::Vector2d expectedMaxScroll(m_hostImpl->rootLayer()->maxScrollOffset()); |
| |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| // The scroll delta is not scaled because the main thread did not scale. |
| scoped_ptr<ScrollAndScaleSet> scrollInfo = m_hostImpl->processScrollDeltas(); |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedScrollDelta); |
| EXPECT_EQ(expectedMaxScroll, m_hostImpl->rootLayer()->maxScrollOffset()); |
| |
| gfx::Vector2d expectedPanDelta(2, 0); // This component gets handled by zoomViewport pan. |
| gfx::Vector2dF expectedTranslation = gfx::ScaleVector2d(expectedPanDelta, m_hostImpl->deviceScaleFactor()); |
| expectedImplTransform.Translate(-expectedTranslation.x(), -expectedTranslation.y()); |
| |
| EXPECT_EQ(m_hostImpl->rootLayer()->implTransform(), expectedImplTransform); |
| |
| // Perform same test sequence in y-direction also. |
| scrollDelta = gfx::Vector2d(0, 5); |
| expectedScrollDelta += gfx::Vector2d(0, 4); // This component gets handled by document scroll. |
| EXPECT_EQ(InputHandlerClient::ScrollStarted, m_hostImpl->scrollBegin(gfx::Point(0, 0), InputHandlerClient::Gesture)); |
| m_hostImpl->scrollBy(gfx::Point(), scrollDelta); |
| m_hostImpl->scrollEnd(); |
| m_hostImpl->updateRootScrollLayerImplTransform(); |
| |
| // The scroll delta is not scaled because the main thread did not scale. |
| scrollInfo = m_hostImpl->processScrollDeltas(); // This component gets handled by zoomViewport pan. |
| expectContains(*scrollInfo.get(), m_hostImpl->rootLayer()->id(), expectedScrollDelta); |
| EXPECT_EQ(expectedMaxScroll, m_hostImpl->rootLayer()->maxScrollOffset()); |
| |
| expectedPanDelta = gfx::Vector2d(0, 1); |
| expectedTranslation = gfx::ScaleVector2d(expectedPanDelta, m_hostImpl->deviceScaleFactor()); |
| expectedImplTransform.Translate(-expectedTranslation.x(), -expectedTranslation.y()); |
| |
| EXPECT_EQ(expectedImplTransform, m_hostImpl->rootLayer()->implTransform()); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchZoomPanViewportAndScrollBoundaryWithDeviceScaleFactor) |
| { |
| pinchZoomPanViewportAndScrollBoundaryTest(1); |
| } |
| |
| TEST_P(LayerTreeHostImplTest, pinchZoomPanViewportAndScrollBoundaryWithDeviceScaleFactor2) |
| { |
| pinchZoomPanViewportAndScrollBoundaryTest(2); |
| } |
| |
| class LayerTreeHostImplTestWithDelegatingRenderer : public LayerTreeHostImplTest { |
| protected: |
| virtual scoped_ptr<OutputSurface> createOutputSurface() |
| { |
| // Creates an output surface with a parent to use a delegating renderer. |
| WebKit::WebGraphicsContext3D::Attributes attrs; |
| return FakeOutputSurface::CreateDelegating3d(CompositorFakeWebGraphicsContext3D::create(attrs).PassAs<WebKit::WebGraphicsContext3D>()).PassAs<OutputSurface>(); |
| } |
| |
| void drawFrameAndTestDamage(const gfx::RectF& expectedDamage) { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| ASSERT_EQ(1u, frame.renderPasses.size()); |
| |
| // Verify the damage rect for the root render pass. |
| const RenderPass* rootRenderPass = frame.renderPasses.back(); |
| EXPECT_RECT_EQ(expectedDamage, rootRenderPass->damage_rect); |
| |
| // Verify the root layer's quad is generated and not being culled. |
| ASSERT_EQ(1u, rootRenderPass->quad_list.size()); |
| gfx::Rect expectedVisibleRect(m_hostImpl->rootLayer()->contentBounds()); |
| EXPECT_RECT_EQ(expectedVisibleRect, rootRenderPass->quad_list[0]->visible_rect); |
| |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| }; |
| |
| TEST_P(LayerTreeHostImplTestWithDelegatingRenderer, FrameIncludesDamageRect) |
| { |
| // Draw a frame. In the first frame, the entire viewport should be damaged. |
| gfx::Rect fullFrameDamage = gfx::Rect(m_hostImpl->deviceViewportSize()); |
| drawFrameAndTestDamage(fullFrameDamage); |
| |
| // The second frame should have no damage, but the quads should still be generated. |
| gfx::Rect noDamage = gfx::Rect(m_hostImpl->deviceViewportSize()); |
| drawFrameAndTestDamage(noDamage); |
| } |
| |
| class FakeMaskLayerImpl : public LayerImpl { |
| public: |
| static scoped_ptr<FakeMaskLayerImpl> create(LayerTreeImpl* treeImpl, int id) |
| { |
| return make_scoped_ptr(new FakeMaskLayerImpl(treeImpl, id)); |
| } |
| |
| virtual ResourceProvider::ResourceId contentsResourceId() const { return 0; } |
| |
| private: |
| FakeMaskLayerImpl(LayerTreeImpl* treeImpl, int id) : LayerImpl(treeImpl, id) { } |
| }; |
| |
| TEST_P(LayerTreeHostImplTest, maskLayerWithScaling) |
| { |
| // Root |
| // | |
| // +-- Scaling Layer (adds a 2x scale) |
| // | |
| // +-- Content Layer |
| // +--Mask |
| scoped_ptr<LayerImpl> scopedRoot = LayerImpl::create(m_hostImpl->activeTree(), 1); |
| LayerImpl* root = scopedRoot.get(); |
| m_hostImpl->activeTree()->SetRootLayer(scopedRoot.Pass()); |
| |
| scoped_ptr<LayerImpl> scopedScalingLayer = LayerImpl::create(m_hostImpl->activeTree(), 2); |
| LayerImpl* scalingLayer = scopedScalingLayer.get(); |
| root->addChild(scopedScalingLayer.Pass()); |
| |
| scoped_ptr<LayerImpl> scopedContentLayer = LayerImpl::create(m_hostImpl->activeTree(), 3); |
| LayerImpl* contentLayer = scopedContentLayer.get(); |
| scalingLayer->addChild(scopedContentLayer.Pass()); |
| |
| scoped_ptr<FakeMaskLayerImpl> scopedMaskLayer = FakeMaskLayerImpl::create(m_hostImpl->activeTree(), 4); |
| FakeMaskLayerImpl* maskLayer = scopedMaskLayer.get(); |
| contentLayer->setMaskLayer(scopedMaskLayer.PassAs<LayerImpl>()); |
| |
| gfx::Size rootSize(100, 100); |
| root->setBounds(rootSize); |
| root->setContentBounds(rootSize); |
| root->setPosition(gfx::PointF()); |
| root->setAnchorPoint(gfx::PointF()); |
| |
| gfx::Size scalingLayerSize(50, 50); |
| scalingLayer->setBounds(scalingLayerSize); |
| scalingLayer->setContentBounds(scalingLayerSize); |
| scalingLayer->setPosition(gfx::PointF()); |
| scalingLayer->setAnchorPoint(gfx::PointF()); |
| gfx::Transform scale; |
| scale.Scale(2.0, 2.0); |
| scalingLayer->setTransform(scale); |
| |
| contentLayer->setBounds(scalingLayerSize); |
| contentLayer->setContentBounds(scalingLayerSize); |
| contentLayer->setPosition(gfx::PointF()); |
| contentLayer->setAnchorPoint(gfx::PointF()); |
| contentLayer->setDrawsContent(true); |
| |
| maskLayer->setBounds(scalingLayerSize); |
| maskLayer->setContentBounds(scalingLayerSize); |
| maskLayer->setPosition(gfx::PointF()); |
| maskLayer->setAnchorPoint(gfx::PointF()); |
| maskLayer->setDrawsContent(true); |
| |
| |
| // Check that the tree scaling is correctly taken into account for the mask, |
| // that should fully map onto the quad. |
| float deviceScaleFactor = 1.f; |
| m_hostImpl->setViewportSize(rootSize, rootSize); |
| m_hostImpl->setDeviceScaleFactor(deviceScaleFactor); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| |
| ASSERT_EQ(1u, frame.renderPasses.size()); |
| ASSERT_EQ(1u, frame.renderPasses[0]->quad_list.size()); |
| ASSERT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* renderPassQuad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| EXPECT_EQ(renderPassQuad->rect.ToString(), gfx::Rect(0, 0, 100, 100).ToString()); |
| EXPECT_EQ(renderPassQuad->mask_uv_rect.ToString(), gfx::RectF(0.f, 0.f, 1.f, 1.f).ToString()); |
| |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| |
| // Applying a DSF should change the render surface size, but won't affect |
| // which part of the mask is used. |
| deviceScaleFactor = 2.f; |
| gfx::Size deviceViewport(gfx::ToFlooredSize(gfx::ScaleSize(rootSize, deviceScaleFactor))); |
| m_hostImpl->setViewportSize(rootSize, deviceViewport); |
| m_hostImpl->setDeviceScaleFactor(deviceScaleFactor); |
| m_hostImpl->setNeedsUpdateDrawProperties(); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| |
| ASSERT_EQ(1u, frame.renderPasses.size()); |
| ASSERT_EQ(1u, frame.renderPasses[0]->quad_list.size()); |
| ASSERT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* renderPassQuad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| EXPECT_EQ(renderPassQuad->rect.ToString(), gfx::Rect(0, 0, 200, 200).ToString()); |
| EXPECT_EQ(renderPassQuad->mask_uv_rect.ToString(), gfx::RectF(0.f, 0.f, 1.f, 1.f).ToString()); |
| |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| |
| |
| // Applying an equivalent content scale on the content layer and the mask |
| // should still result in the same part of the mask being used. |
| gfx::Size contentsBounds(gfx::ToRoundedSize(gfx::ScaleSize(scalingLayerSize, deviceScaleFactor))); |
| contentLayer->setContentBounds(contentsBounds); |
| contentLayer->setContentsScale(deviceScaleFactor, deviceScaleFactor); |
| maskLayer->setContentBounds(contentsBounds); |
| maskLayer->setContentsScale(deviceScaleFactor, deviceScaleFactor); |
| m_hostImpl->setNeedsUpdateDrawProperties(); |
| { |
| LayerTreeHostImpl::FrameData frame; |
| EXPECT_TRUE(m_hostImpl->prepareToDraw(frame)); |
| |
| ASSERT_EQ(1u, frame.renderPasses.size()); |
| ASSERT_EQ(1u, frame.renderPasses[0]->quad_list.size()); |
| ASSERT_EQ(DrawQuad::RENDER_PASS, frame.renderPasses[0]->quad_list[0]->material); |
| const RenderPassDrawQuad* renderPassQuad = RenderPassDrawQuad::MaterialCast(frame.renderPasses[0]->quad_list[0]); |
| EXPECT_EQ(renderPassQuad->rect.ToString(), gfx::Rect(0, 0, 200, 200).ToString()); |
| EXPECT_EQ(renderPassQuad->mask_uv_rect.ToString(), gfx::RectF(0.f, 0.f, 1.f, 1.f).ToString()); |
| |
| m_hostImpl->drawLayers(frame); |
| m_hostImpl->didDrawAllLayers(frame); |
| } |
| } |
| |
| INSTANTIATE_TEST_CASE_P(LayerTreeHostImplTests, |
| LayerTreeHostImplTest, |
| ::testing::Values(false, true)); |
| |
| } // namespace |
| } // namespace cc |